<?xml version="1.0" encoding="UTF-8"?>
<compound>
  <version>2.0</version>
  <creation_date>2012-05-31 13:53:20 -0600</creation_date>
  <update_date>2015-09-13 12:56:11 -0600</update_date>
  <accession>ECMDB01487</accession>
  <m2m_id>M2MDB000398</m2m_id>
  <name>NADH</name>
  <description>NADH is the reduced form of NAD+, and NAD+ is the oxidized form of NADH, A coenzyme composed of ribosylnicotinamide 5'-diphosphate coupled to adenosine 5'-phosphate by pyrophosphate linkage. It is found widely in nature and is involved in numerous enzymatic reactions in which it serves as an electron carrier by being alternately oxidized (NAD+) and reduced (NADH). It forms NADP with the addition of a phosphate group to the 2' position of the adenosyl nucleotide through an ester linkage.(Dorland, 27th ed)</description>
  <synonyms>
    <synonym>1,4-Dihydronicotinamide adenine dinucleotide</synonym>
    <synonym>B-DPNH</synonym>
    <synonym>B-NADH</synonym>
    <synonym>Beta-DPNH</synonym>
    <synonym>Beta-NADH</synonym>
    <synonym>Dihydrocodehydrogenase I</synonym>
    <synonym>Dihydrocozymase</synonym>
    <synonym>Dihydrodiphosphopyridine nucleotide</synonym>
    <synonym>Dihydronicotinamide adenine dinucleotide</synonym>
    <synonym>Dihydronicotinamide mononucleotide</synonym>
    <synonym>Diphosphopyridine nucleotide reduced</synonym>
    <synonym>DPNH</synonym>
    <synonym>ENADA</synonym>
    <synonym>NAD-reduced</synonym>
    <synonym>NADH</synonym>
    <synonym>NADH+H+</synonym>
    <synonym>NADH2</synonym>
    <synonym>NADH&lt;sub&gt;2&lt;/sub&gt;</synonym>
    <synonym>Nicotinamide adenine dinucleotide reduced</synonym>
    <synonym>Reduced codehydrogenase I</synonym>
    <synonym>Reduced diphosphopyridine nucleotide</synonym>
    <synonym>Reduced nicotinamide adenine diphosphate</synonym>
    <synonym>Reduced nicotinamide adenine diphosphoric acid</synonym>
    <synonym>Reduced nicotinamide-adenine dinucleotide</synonym>
    <synonym>β-DPNH</synonym>
    <synonym>β-NADH</synonym>
  </synonyms>
  <chemical_formula>C21H29N7O14P2</chemical_formula>
  <average_molecular_weight>665.441</average_molecular_weight>
  <monisotopic_moleculate_weight>665.124771695</monisotopic_moleculate_weight>
  <iupac_name>[({[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy]({[(2R,3S,4R,5R)-5-(3-carbamoyl-1,4-dihydropyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy})phosphinic acid</iupac_name>
  <traditional_iupac>NADH</traditional_iupac>
  <cas_registry_number>58-68-4</cas_registry_number>
  <smiles>NC(=O)C1=CN(C=CC1)[C@@H]1O[C@H](CO[P@](O)(=O)O[P@](O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O</smiles>
  <inchi>InChI=1S/C21H29N7O14P2/c22-17-12-19(25-7-24-17)28(8-26-12)21-16(32)14(30)11(41-21)6-39-44(36,37)42-43(34,35)38-5-10-13(29)15(31)20(40-10)27-3-1-2-9(4-27)18(23)33/h1,3-4,7-8,10-11,13-16,20-21,29-32H,2,5-6H2,(H2,23,33)(H,34,35)(H,36,37)(H2,22,24,25)/t10-,11-,13-,14-,15-,16-,20-,21-/m1/s1</inchi>
  <inchikey>BOPGDPNILDQYTO-NNYOXOHSSA-N</inchikey>
  <state>Solid</state>
  <cellular_locations>
    <cellular_location>Cytosol</cellular_location>
  </cellular_locations>
  <predicted_properties>
    <property>
      <kind>logp</kind>
      <value>-1.45</value>
      <source>ALOGPS</source>
    </property>
    <property>
      <kind>logs</kind>
      <value>-2.35</value>
      <source>ALOGPS</source>
    </property>
    <property>
      <kind>solubility</kind>
      <value>2.95e+00 g/l</value>
      <source>ALOGPS</source>
    </property>
  </predicted_properties>
  <experimental_properties>
    <property>
      <kind>melting_point</kind>
      <value>140.0-142.0oC</value>
    </property>
  </experimental_properties>
  <property>
    <kind>logp</kind>
    <value>-5.9</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>pka_strongest_acidic</kind>
    <value>1.85</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>pka_strongest_basic</kind>
    <value>4.01</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>iupac</kind>
    <value>[({[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy]({[(2R,3S,4R,5R)-5-(3-carbamoyl-1,4-dihydropyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy})phosphinic acid</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>average_mass</kind>
    <value>665.441</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>mono_mass</kind>
    <value>665.124771695</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>smiles</kind>
    <value>NC(=O)C1=CN(C=CC1)[C@@H]1O[C@H](CO[P@](O)(=O)O[P@](O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>formula</kind>
    <value>C21H29N7O14P2</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>inchi</kind>
    <value>InChI=1S/C21H29N7O14P2/c22-17-12-19(25-7-24-17)28(8-26-12)21-16(32)14(30)11(41-21)6-39-44(36,37)42-43(34,35)38-5-10-13(29)15(31)20(40-10)27-3-1-2-9(4-27)18(23)33/h1,3-4,7-8,10-11,13-16,20-21,29-32H,2,5-6H2,(H2,23,33)(H,34,35)(H,36,37)(H2,22,24,25)/t10-,11-,13-,14-,15-,16-,20-,21-/m1/s1</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>inchikey</kind>
    <value>BOPGDPNILDQYTO-NNYOXOHSSA-N</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>polar_surface_area</kind>
    <value>317.62</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>refractivity</kind>
    <value>143</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>polarizability</kind>
    <value>57.65</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>rotatable_bond_count</kind>
    <value>11</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>acceptor_count</kind>
    <value>16</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>donor_count</kind>
    <value>8</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>physiological_charge</kind>
    <value>-2</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>formal_charge</kind>
    <value>0</value>
    <source>ChemAxon</source>
  </property>
  <pathways>
    <pathway>
      <name>Citrate cycle (TCA cycle)</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00020</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Oxidative phosphorylation</name>
      <description>The process of oxidative phosphorylation involves multiple interactions of ubiquinone with succinic acid, resulting in a fumaric acid and ubiquinol.

Ubiquinone interacts with succinic acid through a succinate:quinone oxidoreductase resulting in a fumaric acid an ubiquinol. This enzyme has various cofactors, ferroheme b, 2FE-2S, FAD, and 3Fe-4S iron-sulfur cluster. 
Then 2 ubiquinol interact with oxygen and 4 hydrogen ion through a cytochrome bd-I terminal oxidase resulting in a 4 hydrogen ion transferred into the periplasmic space, 2  water returned into the cytoplasm and 2 ubiquinone, which stay in the inner membrane.
The ubiquinone interacts with succinic acid through a succinate:quinone oxidoreductase resulting in a fumaric acid an ubiquinol. 
Then 2 ubiquinol interacts with oxygen and 4 hydrogen ion through a cytochrome bd-II terminal oxidase resulting in a 4 hydrogen ion transferred into the periplasmic space, 2 water returned into the cytoplasm and 2 ubiquinone, which stay in the inner membrane.
The ubiquinone interacts with succinic acid through a succinate:quinone oxidoreductase resulting in a fumaric acid an ubiquinol. 
The 2 ubiquinol interact with oxygen and 8 hydrogen ion through a cytochrome bo terminal oxidase resulting in a 8 hydrogen ion transferred into the periplasmic space, 2 water returned into the cytoplasm and 2 ubiquinone, which stays in the inner membrane.
The ubiquinone then interacts with 5 hydrogen ion through a NADH dependent ubiquinone oxidoreductase I resulting in NAD, hydrogen ion released into the periplasmic space and an ubiquinol.
 The ubiquinol is then processed reacting with oxygen, and 4 hydrogen through a ion cytochrome bd-I terminal oxidase resulting in 4 hydrogen ions released into the periplasmic space, 2 water molecules into the cytoplasm and 2 ubiquinones.
The ubiquinone then interacts with 5 hydrogen ion through a NADH dependent ubiquinone oxidoreductase I resulting in NAD, hydrogen ion released into the periplasmic space and an ubiquinol.
The 2 ubiquinol interact with oxygen and 8 hydrogen ion through a cytochrome bo terminal oxidase resulting in a 8 hydrogen ion transferred into the periplasmic space, 2 water returned into the cytoplasm and 2 ubiquinone, which stays in the inner membrane.
</description>
      <pathwhiz_id>PW000919</pathwhiz_id>
      <kegg_map_id>ec00190</kegg_map_id>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Butanoate metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00650</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Reductive carboxylate cycle (CO2 fixation)</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00720</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Alanine, aspartate and glutamate metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00250</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Arginine and proline metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00330</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Nitrogen metabolism</name>
      <description>
The biological process of the nitrogen cycle is a complex interplay among many microorganisms catalyzing different reactions, where nitrogen is found in various oxidation states ranging from +5 in nitrate to -3 in ammonia. 
 The ability of fixing atmospheric nitrogen by the nitrogenase enzyme complex is present in restricted prokaryotes (diazotrophs). The other reduction pathways are assimilatory nitrate reduction  and dissimilatory nitrate reduction  both for conversion to ammonia, and denitrification. Denitrification is a respiration in which nitrate or nitrite is reduced as a terminal electron acceptor under low oxygen or anoxic conditions, producing gaseous nitrogen compounds (N2, NO and N2O) to the atmosphere.
Nitrate can be introduced into the cytoplasm through a nitrate:nitrite antiporter NarK or a nitrate / nitrite transporter NarU. Nitrate is then reduced by a Nitrate Reductase resulting in the release of water, an acceptor and a Nitrite. Nitrite can also be introduced into the cytoplasm through a nitrate:nitrite antiporter NarK
Nitrite can be reduced a NADPH dependent nitrite reductase resulting in water and NAD and Ammonia.
Nitrite can interact with hydrogen ion, ferrocytochrome c through a cytochrome c-552 ferricytochrome resulting in the release of ferricytochrome c, water and ammonia
Another process by which ammonia is produced is by a reversible reaction of hydroxylamine with a reduced acceptor through a hydroxylamine reductase resulting in an acceptor, water and ammonia.
Water and carbon dioxide react through a carbonate dehydratase resulting in carbamic acid. This compound reacts spontaneously with hydrogen ion resulting in the release of carbon dioxide and ammonia. Carbon dioxide can interact with water through a carbonic anhydrase resulting in hydrogen carbonate. This compound interacts with cyanate and hydrogen ion through a cyanate hydratase resulting in a carbamic acid. 
Ammonia can be metabolized by reacting with L-glutamine and ATP driven glutamine synthetase resulting in ADP, phosphate and L-glutamine. The latter compound reacts with oxoglutaric acid and hydrogen ion through a NADPH dependent glutamate synthase resulting in the release of NADP and L-glutamic acid. L-glutamic acid reacts with water through a NADP-specific glutamate dehydrogenase resulting in the release of oxoglutaric acid, NADPH, hydrogen ion and ammonia.

</description>
      <pathwhiz_id>PW000755</pathwhiz_id>
      <kegg_map_id>ec00910</kegg_map_id>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Purine metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00230</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Pyrimidine metabolism</name>
      <description>The metabolism of pyrimidines begins with L-glutamine interacting with water molecule and a hydrogen carbonate through an ATP driven carbamoyl phosphate synthetase resulting in a hydrogen ion, an ADP, a phosphate, an L-glutamic acid and a carbamoyl phosphate. The latter compound interacts with an L-aspartic acid through a aspartate transcarbamylase resulting in a phosphate, a hydrogen ion and a N-carbamoyl-L-aspartate. The latter compound interacts with a hydrogen ion through a dihydroorotase resulting in the release of a water molecule and a 4,5-dihydroorotic acid. This compound interacts with an ubiquinone-1 through a dihydroorotate dehydrogenase, type 2 resulting in a release of an ubiquinol-1 and an orotic acid. The orotic acid then interacts with a phosphoribosyl pyrophosphate through a orotate phosphoribosyltransferase resulting in a pyrophosphate and an orotidylic acid. The latter compound then interacts with a hydrogen ion through an orotidine-5 '-phosphate decarboxylase, resulting in an release of carbon dioxide and an Uridine 5' monophosphate. The Uridine 5' monophosphate process to get phosphorylated by an ATP driven UMP kinase resulting in the release of an ADP and an Uridine 5--diphosphate.
Uridine 5-diphosphate can be metabolized in multiple ways in order to produce a Deoxyuridine triphosphate.
        1.-Uridine 5-diphosphate interacts with a reduced thioredoxin through a ribonucleoside diphosphate reductase 1 resulting in the release of a water molecule and an oxidized thioredoxin and an dUDP. The dUDP is then phosphorylated by an ATP through a nucleoside diphosphate kinase resulting in the release of an ADP and a DeoxyUridine triphosphate.
        2.-Uridine 5-diphosphate interacts with a reduced NrdH glutaredoxin-like protein through a Ribonucleoside-diphosphate reductase 1 resulting in a release of a water molecule, an oxidized NrdH glutaredoxin-like protein and a dUDP. The dUDP is then phosphorylated by an ATP through a nucleoside diphosphate kinase resulting in the release of an ADP and a DeoxyUridine triphosphate.
        3.-Uridine 5-diphosphate is phosphorylated by an ATP-driven nucleoside diphosphate kinase resulting in an ADP and an Uridinetriphosphate. The latter compound interacts with a reduced flavodoxin through ribonucleoside-triphosphate reductase resulting in the release of an oxidized flavodoxin, a water molecule and a Deoxyuridine triphosphate
        4.-Uridine 5-diphosphate is phosphorylated by an ATP-driven nucleoside diphosphate kinase resulting in an ADP and an Uridinetriphosphate    The uridine triphosphate interacts with a L-glutamine and a water molecule through an ATP driven CTP synthase resulting in an ADP, a phosphate, a hydrogen ion, an L-glutamic acid and a cytidine triphosphate. The cytidine triphosphate interacts with a reduced flavodoxin through a ribonucleoside-triphosphate reductase resulting in the release of a water molecule, an oxidized flavodoxin and a dCTP. The dCTP interacts with a water molecule and a hydrogen ion through a dCTP deaminase resulting in a release of an ammonium molecule and a Deoxyuridine triphosphate.
        5.-Uridine 5-diphosphate is phosphorylated by an ATP-driven nucleoside diphosphate kinase resulting in an ADP and an Uridinetriphosphate The uridine triphosphate interacts with a L-glutamine and a water molecule through an ATP driven CTP synthase resulting in an ADP, a phosphate, a hydrogen ion, an L-glutamic acid and a cytidine triphosphate. The cytidine triphosphate then interacts spontaneously with a water molecule resulting in the release of a phosphate, a hydrogen ion and a CDP. The CDP then interacts with a reduced NrdH glutaredoxin-like protein through a ribonucleoside-diphosphate reductase 2 resulting in the release of a water molecule, an oxidized NrdH glutaredoxin-like protein and a dCDP. The dCDP is then phosphorylated through an ATP driven nucleoside diphosphate kinase resulting in an ADP and a dCTP. The dCTP interacts with a water molecule and a hydrogen ion through a dCTP deaminase resulting in a release of an ammonium molecule and a Deoxyuridine triphosphate.
        6.-Uridine 5-diphosphate is phosphorylated by an ATP-driven nucleoside diphosphate kinase resulting in an ADP and an Uridinetriphosphate The uridine triphosphate interacts with a L-glutamine and a water molecule through an ATP driven CTP synthase resulting in an ADP, a phosphate, a hydrogen ion, an L-glutamic acid and a cytidine triphosphate. The cytidine triphosphate then interacts spontaneously with a water molecule resulting in the release of a phosphate, a hydrogen ion and a CDP. The CDP interacts with a reduced thioredoxin through a ribonucleoside diphosphate reductase 1 resulting in a release of a water molecule, an oxidized thioredoxin and a dCDP. The dCDP is then phosphorylated through an ATP driven nucleoside diphosphate kinase resulting in an ADP and a dCTP. The dCTP interacts with a water molecule and a hydrogen ion through a dCTP deaminase resulting in a release of an ammonium molecule and a Deoxyuridine triphosphate.

The deoxyuridine triphosphate then interacts with a water molecule through a nucleoside triphosphate pyrophosphohydrolase resulting in a release of a hydrogen ion, a phosphate and a dUMP. The dUMP then interacts with a methenyltetrahydrofolate through a thymidylate synthase resulting in a dihydrofolic acid and a 5-thymidylic acid. Then 5-thymidylic acid is then phosphorylated through a nucleoside diphosphate kinase resulting in the release of an ADP and thymidine 5'-triphosphate.</description>
      <pathwhiz_id>PW000942</pathwhiz_id>
      <kegg_map_id>ec00240</kegg_map_id>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Starch and sucrose metabolism</name>
      <description>The metabolism of starch and sucrose begins with D-fructose interacting with a D-glucose in a reversible reaction through a maltodextrin glucosidase resulting in a water molecule and a sucrose. D-fructose is phosphorylated through an ATP driven fructokinase resulting in the release of an ADP, a hydrogen ion and a Beta-D-fructofuranose 6-phosphate. This compound can also be introduced into the cytoplasm through either a mannose PTS permease or a hexose-6-phosphate:phosphate antiporter. 
The Beta-D-fructofuranose 6-phosphate is isomerized through a phosphoglucose isomerase resulting in a Beta-D-glucose 6-phosphate. This compound can also be incorporated by glucose PTS permease or a hexose-6-phosphate:phosphate antiporter. 
The beta-D-glucose 6 phosphate can also be produced by a D-glucose being phosphorylated by an ATP-driven glucokinase resulting in a ADP, a hydrogen ion and a Beta-D-glucose 6 phosphate. 

The beta-D-glucose can produce alpha-D-glucose-1-phosphate  by two methods:
1.-Beta-D-glucose is isomerized into an alpha-D-Glucose 6-phosphate and then interacts in a reversible reaction through a phosphoglucomutase-1 resulting in a alpha-D-glucose-1-phosphate.
2.-Beta-D-glucose interacts with a putative beta-phosphoglucomutase resulting in a Beta-D-glucose 1-phosphate.  Beta-D-glucose 1-phosphate can be incorporated into the cytoplasm through a 
glucose PTS permease. This compound is then isomerized into a Alpha-D-glucose-1-phosphate
The beta-D-glucose can cycle back into a D-fructose by first interacting with D-fructose in a reversible reaction through a Polypeptide: predicted glucosyltransferase resulting in the release of a phosphate and a sucrose. The sucrose then interacts in a reversible reaction with a water molecule through a maltodextrin glucosidase resulting in a D-glucose and a D-fructose. 

Alpha-D-glucose-1-phosphate can produce glycogen in by two different sets of reactions:
1.-Alpha-D-glucose-1-phosphate interacts with a hydrogen ion and an ATP through a glucose-1-phosphate adenylyltransferase resulting in a pyrophosphate and an ADP-glucose. The ADP-glucose then interacts with an amylose through a glycogen synthase resulting in the release of an ADP and an Amylose. The amylose then interacts with 1,4-α-glucan branching enzyme resulting in glycogen
2.- Alpha-D-glucose-1-phosphate interacts with amylose through a maltodextrin phosphorylase resulting in a phosphate and a glycogen.

Alpha-D-glucose-1-phosphate can also interacts with UDP-galactose through a galactose-1-phosphate uridylyltransferase resulting in a galactose 1-phosphate and a Uridine diphosphate glucose. The UDP-glucose then interacts with an alpha-D-glucose 6-phosphate through a trehalose-6-phosphate synthase resulting in a uridine 5'-diphosphate, a hydrogen ion and a Trehalose 6- phosphate. The latter compound can also be incorporated into the cytoplasm through a trehalose PTS permease. Trehalose interacts with a water molecule through a trehalose-6-phosphate phosphatase resulting in the release of a phosphate and an alpha,alpha-trehalose.The alpha,alpha-trehalose can also be obtained from glycogen being metabolized through a glycogen debranching enzyme resulting in a the alpha, alpha-trehalose. This compound ca then be hydrated through a cytoplasmic trehalase resulting in the release of an alpha-D-glucose and a beta-d-glucose.

Glycogen is then metabolized by reacting with a phosphate through a glycogen phosphorylase resulting in a alpha-D-glucose-1-phosphate and a dextrin. The dextrin is then hydrated through a glycogen phosphorylase-limit dextrin α-1,6-glucohydrolase resulting in the release of a debranched limit dextrin and a maltotetraose. This compound can also be incorporated into the cytoplasm through a 
maltose ABC transporter. The maltotetraose interacts with a phosphate through a maltodextrin phosphorylase releasing a alpha-D-glucose-1-phosphate and a maltotriose. The maltotriose can also be incorporated through a maltose ABC transporter. The maltotriose can then interact with water through a maltodextrin glucosidase resulting in a D-glucose and a D-maltose. D-maltose can also be incorporated through a 
maltose ABC transporter 

The D-maltose can then interact with a maltotriose through a amylomaltase resulting in a maltotetraose and a D-glucose. The D-glucose is then phosphorylated through an ATP driven glucokinase resulting in a hydrogen ion, an ADP and a Beta-D-glucose 6-phosphate</description>
      <pathwhiz_id>PW000941</pathwhiz_id>
      <kegg_map_id>ec00500</kegg_map_id>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Cysteine and methionine metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00270</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Tyrosine metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00350</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Phenylalanine metabolism</name>
      <description>The pathways of the metabolism of phenylalaline begins with the conversion of chorismate to prephenate through a P-protein (chorismate mutase:pheA). Prephenate then interacts with a hydrogen ion through the same previous enzyme resulting in a release of carbon dioxide, water and a phenolpyruvic acid. Three enzymes those enconde by tyrB, aspC and ilvE are involved in catalyzing the third step of these pathways, all three can contribute to the synthesis of phenylalanine: only tyrB and aspC contribute to biosynthesis of tyrosine.
Phenolpyruvic acid can also be obtained from a reversivle reaction with ammonia, a reduced acceptor and a D-amino acid dehydrogenase, resulting in a water, an acceptor and a D-phenylalanine, which can be then transported into the periplasmic space by aromatic amino acid exporter.
L-phenylalanine also interacts in two reversible reactions, one involved with oxygen through a catalase peroxidase resulting in a carbon dioxide and 2-phenylacetamide. The other reaction involved an interaction with oxygen through a phenylalanine aminotransferase resulting in a oxoglutaric acid and phenylpyruvic acid.
L-phenylalanine can be imported into the cytoplasm through an aromatic amino acid:H+ symporter AroP.
The compound can also be imported into the periplasmic space through a transporter: L-amino acid efflux transporter.</description>
      <pathwhiz_id>PW000921</pathwhiz_id>
      <kegg_map_id>ec00360</kegg_map_id>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Phenylalanine, tyrosine and tryptophan biosynthesis</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00400</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Carbon fixation in photosynthetic organisms</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00710</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Glycine, serine and threonine metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00260</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Glycolysis / Gluconeogenesis</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00010</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Fructose and mannose metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00051</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Galactose metabolism</name>
      <description>Galactose can be synthesized through two pathways: melibiose degradation involving an alpha galactosidase and lactose degradation involving a beta galactosidase. Melibiose is first transported inside the cell through the melibiose:Li+/Na+/H+ symporter. Once inside the cell, melibiose is degraded through alpha galactosidase  into an alpha-D-galactose and a beta-D-glucose. The beta-D-glucose is phosphorylated by a glucokinase to produce a beta-D-glucose-6-phosphate which can spontaneously be turned into a alpha D glucose 6 phosphate. This alpha D-glucose-6-phosphate is metabolized into a glucose -1-phosphate through a phosphoglucomutase-1. The glucose -1-phosphate is transformed into a uridine diphosphate glucose through UTP--glucose-1-phosphate uridylyltransferase. The product, uridine diphosphate glucose, can undergo a reversible reaction in which it can be turned into uridine diphosphategalactose through an UDP-glucose 4-epimerase.
Galactose can also be produced by lactose degradation involving a lactose permease to uptake lactose from the environment and a beta-galactosidase to turn lactose into Beta-D-galactose. 
Beta-D-galactose can also be uptaken from the environment through a galactose proton symporter.
Galactose is degraded through the following process:
Beta-D-galactose is introduced into the cytoplasm through a galactose proton symporter, or it can be synthesized from an alpha lactose that is introduced into the cytoplasm through a lactose permease. Alpha lactose interacts with water through a beta-galactosidase resulting in a beta-D-glucose and beta-D-galactose. Beta-D-galactose is isomerized into D-galactose. D-Galactose undergoes phosphorylation through a galactokinase, hence producing galactose 1 phosphate. On the other side of the pathway, a gluose-1-phosphate (product of the interaction of alpha-D-glucose 6-phosphate with a phosphoglucomutase resulting in a alpha-D-glucose-1-phosphate, an isomer of Glucose 1-phosphate, or an isomer of Beta-D-glucose 1-phosphate) interacts with UTP and a hydrogen ion in order to produce a uridine diphosphate glucose. This is followed by the interaction of galactose-1-phosphate with an established amount of uridine diphosphate glucose through a galactose-1-phosphate uridylyltransferase, which in turn output a glucose-1-phosphate and a uridine diphosphate galactose. The glucose -1-phosphate is transformed into a uridine diphosphate glucose through UTP--glucose-1-phosphate uridylyltransferase. The product, uridine diphosphate glucose, can undergo a reversible reaction in which it can be turned into uridine diphosphategalactose through an  UDP-glucose 4-epimerase, and so the cycle can keep going as long as more lactose or galactose is imported into the cell
</description>
      <pathwhiz_id>PW000821</pathwhiz_id>
      <kegg_map_id>ec00052</kegg_map_id>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Ascorbate and aldarate metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00053</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Amino sugar and nucleotide sugar metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00520</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Lysine biosynthesis</name>
      <description>Lysine is biosynthesized from L-aspartic acid. L-aspartic acid can be incorporated into the cell through various methods: C4 dicarboxylate / orotate:H+ symporter , 
glutamate / aspartate : H+ symporter GltP, dicarboxylate transporter , C4 dicarboxylate / C4 monocarboxylate transporter DauA, glutamate / aspartate ABC transporter 
L-aspartic acid is phosphorylated by an ATP-driven Aspartate kinase resulting in ADP and L-aspartyl-4-phosphate. L-aspartyl-4-phosphate is then dehydrogenated through an NADPH driven aspartate semialdehyde dehydrogenase resulting in a release of phosphate, NADP and L-aspartic 4-semialdehyde (involved in methionine biosynthesis).
L-aspartic 4-semialdehyde interacts with a pyruvic acid through a 4-hydroxy-tetrahydrodipicolinate synthase resulting in a release of hydrogen ion, water and 
(2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate. The latter compound is then reduced by an NADPH  driven 4-hydroxy-tetrahydrodipicolinate reductase resulting in a release of water, NADP and (S)-2,3,4,5-tetrahydrodipicolinate, This compound interacts with succinyl-CoA and water through a tetrahydrodipicolinate succinylase resulting in a release of coenzyme A and N-Succinyl-2-amino-6-ketopimelate. This compound interacts with L-glutamic acid through a N-succinyldiaminopimelate aminotransferase resulting in oxoglutaric acid, N-succinyl-L,L-2,6-diaminopimelate. The latter compound is then desuccinylated by reacting with water through a  N-succinyl-L-diaminopimelate desuccinylase resulting in a succinic acid and L,L-diaminopimelate. This compound is then isomerized through a diaminopimelate epimerase resulting in a meso-diaminopimelate (involved in peptidoglyccan biosynthesis I). This compound is then decarboxylated by a diaminopimelate decarboxylase resulting in a release of carbon dioxide and L-lysine.
L-lysine is then incorporated into lysine degradation pathway. Lysine also regulate its own biosynthesis by repressing dihydrodipicolinate synthase and also repressing lysine-sensitive aspartokinase 3.

A metabolic connection joins synthesis of an amino acid, lysine, to synthesis of cell wall material. Diaminopimelate is a precursor both for lysine and for cell wall components. The synthesis of lysine, methionine and threonine share two reactions at the start of the three pathways, the reactions converting L-aspartate to L-aspartate semialdehyde. The reaction involving aspartate kinase is carried out by three isozymes, one specific for synthesis of each end product amino acid. Each of the three aspartate kinase isozymes is regulated by its corresponding end product amino acid.</description>
      <pathwhiz_id>PW000771</pathwhiz_id>
      <kegg_map_id>ec00300</kegg_map_id>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Folate biosynthesis</name>
      <description>The biosynthesis of folic acid begins with a product of purine nucleotides de novo biosynthesis pathway, GTP. This compound  is involved in a reaction with water through a GTP cyclohydrolase 1 protein complex, resulting in a hydrogen ion, formic acid and 7,8-dihydroneopterin 3-triphosphate. The latter compound is dephosphatased through a dihydroneopterin triphosphate pyrophosphohydrolase resulting in the release of a pyrophosphate, hydrogen ion and 7,8-dihydroneopterin 3-phosphate. The latter compound reacts with water spontaneously resulting in the release of a phosphate and a 7,8 -dihydroneopterin. This compound reacts with a dihydroneopterin aldolase, releasing a glycoaldehyde and 6-hydroxymethyl-7,9-dihydropterin. The latter compound is phosphorylated with a ATP-driven 6-hydroxymethyl-7,8-dihydropterin pyrophosphokinase resulting in a (2-amino-4-hydroxy-7,8-dihydropteridin-6-yl)methyl diphosphate.
Chorismate is metabolized by reacting with L-glutamine through a 4-amino-4-deoxychorismate synthase resulting in L-glutamic acid and 4-amino-4-deoxychorismate. The latter compound then reacts through an aminodeoxychorismate lyase resulting in pyruvic acid,hydrogen ion and p-aminobenzoic acid. 
 (2-amino-4-hydroxy-7,8-dihydropteridin-6-yl)methyl diphosphate and p-aminobenzoic acid react through a dihydropteroate synthase resulting in pyrophosphate and 7,8-dihydropteroic acid. This compound reacts with L-glutamic acid through an ATP driven bifunctional folylpolyglutamate synthetase / dihydrofolate synthetase resulting in a 7,8-dihydrofolate monoglutamate. This compound is reduced through an NADPH mediated dihydrofolate reductase resulting in a tetrahydrofate.
This product goes on to a one carbon pool by folate pathway.
</description>
      <pathwhiz_id>PW000908</pathwhiz_id>
      <kegg_map_id>ec00790</kegg_map_id>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Pyruvate metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00620</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Methane metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00680</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Valine, leucine and isoleucine biosynthesis</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00290</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>C5-Branched dibasic acid metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00660</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Pantothenate and CoA biosynthesis</name>
      <description>The CoA biosynthesis requires compounds from two other pathways: aspartate metabolism and valine biosynthesis. It requires a Beta-Alanine and R-pantoate.
The compound (R)-pantoate is generated in two reactions, as shown by the interaction of alpha-ketoisovaleric acid, 5,10 methylene-THF and water through a 3-methyl-2-oxobutanoate hydroxymethyltransferase resulting in a tetrahydrofolic acid and a 2-dehydropantoate. This compound interacts with hydrogen through a NADPH driven acetohydroxy acid isomeroreductase resulting in the release of NADP and R-pantoate.
On the other hand L-aspartic acid interacts with a hydrogen ion and gets decarboxylated through an Aspartate 1- decarboxylase resulting in a carbon dioxide and a Beta-alanine.
Beta-alanine and R-pantoate interact with an ATP driven pantothenate synthetase resulting in pyrophosphate, AMP, hydrogen ion and pantothenic acid.
Pantothenic acid is phosphorylated through a ATP-driven pantothenate kinase resulting in a ADP, a hydrogen ion and D-4'-Phosphopantothenate. This compound interacts with a CTP and a L-cysteine resulting in a fused 4'-phosphopantothenoylcysteine decarboxylase and phosphopantothenoylcysteine synthetase resulting in a hydrogen ion, a pyrophosphate, a CMP and 4-phosphopantothenoylcysteine. 
The latter compound interacts with a hydrogen ion through a fused 4'-phosphopantothenoylcysteine decarboxylase and phosphopantothenoylcysteine synthetase resulting in a carbon dioxide release and a  4-phosphopantetheine. This compound interacts with an ATP, hydrogen ion and an phosphopantetheine adenylyltransferase resulting in a release of pyrophosphate, and dephospho-CoA.
Dephospho-CoA reacts with an ATP driven dephospho-CoA kinase resulting in a ADP , a hydrogen ion and a Coenzyme A.

 . The latter is converted into (R)-4'-phosphopantothenate is two steps, involving a β-alanine ligase and a kinase. In most organsims the ligase acts before the kinase (EC 6.3.2.1, pantoate—β-alanine ligase (AMP-forming) followed by EC 2.7.1.33, pantothenate kinase, as described in phosphopantothenate biosynthesis I and phosphopantothenate biosynthesis II. However, in archaea the order is reversed, and EC 2.7.1.169, pantoate kinase acts before EC 6.3.2.36, 4-phosphopantoate—β-alanine ligase, as described in phosphopantothenate biosynthesis III.

The kinases are feedback inhibited by CoA itself, accounting for the primary regulatory mechanism of CoA biosynthesis. The addition of L-cysteine to (R)-4'-phosphopantothenate, resulting in the formation of R-4'-phosphopantothenoyl-L-cysteine (PPC), is followed by decarboxylation of PPC to 4'-phosphopantetheine. The ultimate reaction is catalyzed by EC 2.7.1.24, dephospho-CoA kinase, which converts 4'-phosphopantetheine to CoA. All enzymes of this pathway are essential for growth.

The reactions in the biosynthetic route towards CoA are identical in most organisms, although there are differences in the functionality of the involved enzymes. In plants every step is catalyzed by single monofunctional enzymes, whereas in bacteria and mammals bifunctional enzymes are often employed [Rubio06].</description>
      <pathwhiz_id>PW000828</pathwhiz_id>
      <kegg_map_id>ec00770</kegg_map_id>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Vitamin B6 metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00750</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Pentose and glucuronate interconversions</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00040</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Tryptophan metabolism</name>
      <description>The biosynthesis of L-tryptophan begins with L-glutamine interacting with a chorismate through a anthranilate synthase which results in a L-glutamic acid, a pyruvic acid, a hydrogen ion and a 2-aminobenzoic acid. The aminobenzoic acid interacts with a phosphoribosyl pyrophosphate through an anthranilate synthase component II resulting in a pyrophosphate and a N-(5-phosphoribosyl)-anthranilate. The latter compound is then metabolized by an indole-3-glycerol phosphate synthase / phosphoribosylanthranilate isomerase resulting in a 1-(o-carboxyphenylamino)-1-deoxyribulose 5'-phosphate. This compound then interacts with a hydrogen ion through a indole-3-glycerol phosphate synthase / phosphoribosylanthranilate isomerase resulting in the release of carbon dioxide, a water molecule and a  (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate. The latter compound then interacts with a D-glyceraldehyde 3-phosphate and an Indole. The indole interacts with an L-serine through a tryptophan synthase, β subunit dimer resulting in a water molecule and an L-tryptophan.

The metabolism of L-tryptophan starts with L-tryptophan being dehydrogenated by a tryptophanase / L-cysteine desulfhydrase resulting in the release of a hydrogen ion, an Indole and a 2-aminoacrylic acid. The latter compound is isomerized into a 2-iminopropanoate. This compound then interacts with a water molecule and a hydrogen ion  spontaneously resulting in the release of an Ammonium and a pyruvic acid. The pyruvic acid then interacts with a coenzyme A through a NAD driven pyruvate dehydrogenase complex resulting in the release of a NADH, a carbon dioxide and an Acetyl-CoA

</description>
      <pathwhiz_id>PW000815</pathwhiz_id>
      <kegg_map_id>ec00380</kegg_map_id>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Drug metabolism - other enzymes</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00983</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Porphyrin and chlorophyll metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00860</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Glyoxylate and dicarboxylate metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00630</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Glycerophospholipid metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00564</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Glycerolipid metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00561</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Histidine metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00340</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Nicotinate and nicotinamide metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00760</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>One carbon pool by folate</name>
      <description>Dihydrofolic acid, a product of the folate biosynthesis pathway, can be metabolized by multiple enzymes. 
Dihydrofolic acid can be reduced by a NADP-driven dihydrofolate reductase resulting in a NADPH, hydrogen ion and folic acid. 
Dihydrofolic acid can also be reduced by an NADPH-driven dihydrofolate reductase resulting in a NADP and a tetrahydrofolic acid. Folic acid can also produce a tetrahydrofolic acid through a NADPH-driven dihydrofolate reductase. 
Dihydrofolic acid also interacts with 5-thymidylic acid through a thymidylate synthase resulting in the release of dUMP and 5,10-methylene-THF
Tetrahydrofolic acid can be converted into 5,10-methylene-THF through two different reversible reactions.
Tetrahydrofolic acid interacts with a S-Aminomethyldihydrolipoylprotein through a aminomethyltransferase resulting in the release of ammonia, a dihydrolipoylprotein and 5,10-Methylene-THF
Tetrahydrofolic acid interacts with L-serine through a glycine hydroxymethyltransferase resulting in a glycine, water and 5,10-Methylene-THF.
The compound 5,10-methylene-THF reacts with an NADPH dependent methylenetetrahydrofolate reductase [NAD(P)H] resulting in NADP and 5-Methyltetrahydrofolic acid. This compound interacts with homocysteine through a methionine synthase resulting in L-methionine and tetrahydrofolic acid.
Tetrahydrofolic acid can be metabolized into 10-formyltetrahydrofolate through 4 different enzymes:

1.- Tetrahydrofolic acid interacts with FAICAR through a phosphoribosylaminoimidazolecarboxamide formyltransferase resulting in a 1-(5'-Phosphoribosyl)-5-amino-4-imidazolecarboxamide and a 10-formyltetrahydrofolate
2.-Tetrahydrofolic acid interacts with 5'-Phosphoribosyl-N-formylglycinamide through a phosphoribosylglycinamide formyltransferase 2 resulting in a Glycineamideribotide and a 10-formyltetrahydrofolate
3.-Tetrahydrofolic acid interacts with Formic acid through a formyltetrahydrofolate hydrolase resulting in water and a 10-formyltetrahydrofolate
4.-Tetrahydrofolic acid interacts with  N-formylmethionyl-tRNA(fMet) through a 10-formyltetrahydrofolate:L-methionyl-tRNA(fMet) N-formyltransferase resulting in a L-methionyl-tRNA(Met) and a 10-formyltetrahydrofolate

10-formyltetrahydrofolate can interact with a hydrogen ion through a bifunctional 5,10-methylene-tetrahydrofolate dehydrogenase resulting in water and 
5,10-methenyltetrahydrofolic acid.
 
Tetrahydrofolic acid can be metabolized into 5,10-methenyltetrahydrofolic acid  by reacting with a 
5'-phosphoribosyl-a-N-formylglycineamidine through a phosphoribosylglycinamide formyltransferase 2 resulting in water, glycineamideribotide and  5,10-methenyltetrahydrofolic acid. The latter compound can either interact with water through an aminomethyltransferase resulting in a N5-Formyl-THF, or it can interact with a NADPH driven bifunctional 5,10-methylene-tetrahydrofolate dehydrogenase resulting in a NADP and 5,10-Methylene THF.



</description>
      <pathwhiz_id>PW000773</pathwhiz_id>
      <kegg_map_id>ec00670</kegg_map_id>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>beta-Alanine metabolism</name>
      <description>The Beta-Alanine Metabolism starts with a product of Aspartate metabolism. Aspartate is decarboxylated by aspartate 1-decarboxylase, releasing carbon dioxide and Beta-alanine. Beta alanine is then metabolized through  a pantothenate synthetase resulting in Pantothenic acid undergoes phosphorylation through a ATP driven pantothenate kinase, resulting in D-4-phosphopantothenate.
Pantothenate (vitamin B5) is the universal precursor for the synthesis of the 4'-phosphopantetheine moiety of coenzyme A and acyl carrier protein. Only plants and microorganismscan synthesize pantothenate de novo - animals require a dietary supplement. The enzymes of this pathway are therefore considered to be antimicrobial drug targets.</description>
      <pathwhiz_id>PW000896</pathwhiz_id>
      <kegg_map_id>ec00410</kegg_map_id>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Propanoate metabolism</name>
      <description>
Starting from L-threonine, this compound is deaminated through a threonine deaminase resulting in a hydrogen ion, a water molecule and a (2z)-2-aminobut-2-enoate. The latter compound then isomerizes to a 2-iminobutanoate, This compound then reacts spontaneously with hydrogen ion and a water molecule resulting in a ammonium and a 2-Ketobutyric acid. The latter compound interacts with CoA through a pyruvate formate-lyase / 2-ketobutyrate formate-lyase resulting in a formic acid and a propionyl-CoA. 
Propionyl-CoA can then be processed either into a 2-methylcitric acid or into a propanoyl phosphate.
Propionyl-CoA interacts with oxalacetic acid and a water molecule through a 2-methylcitrate synthase resulting in a hydrogen ion, a CoA and a 2-Methylcitric acid.The latter compound is dehydrated through a 2-methylcitrate dehydratase resulting in a water molecule and cis-2-methylaconitate. The latter compound is then dehydrated by a 
bifunctional aconitate hydratase 2 and 2-methylisocitrate dehydratase  resulting in a water molecule and methylisocitric acid. The latter compound is then processed by 2-methylisocitrate lyase resulting in a release of succinic acid and pyruvic acid.
Succinic acid can then interact with a propionyl-CoA through a propionyl-CoA:succinate CoA transferase resulting in a propionic acid and a succinyl CoA. Succinyl-CoA is then isomerized through a methylmalonyl-CoA mutase resulting in a methylmalonyl-CoA. This compound is then decarboxylated through a methylmalonyl-CoA decarboxylase resulting in a release of Carbon dioxide and Propionyl-CoA.
ropionyl-CoA interacts with a phosphate through a phosphate acetyltransferase / phosphate propionyltransferase resulting in a CoA and a propanoyl phosphate.
Propionyl-CoA can react with a phosphate through a phosphate acetyltransferase / phosphate propionyltransferase resulting in a CoA and a propanoyl phosphate. The latter compound is then dephosphorylated through a ADP driven acetate kinase/propionate kinase protein complex resulting in an ATP and Propionic acid.
Propionic acid can be processed by a reaction with CoA through a ATP-driven propionyl-CoA synthetase resulting in a pyrophosphate, an AMP and a propionyl-CoA.</description>
      <pathwhiz_id>PW000940</pathwhiz_id>
      <kegg_map_id>ec00640</kegg_map_id>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Fatty acid biosynthesis</name>
      <description>The fatty acid biosynthesis starts from acetyl-CoA reacting either with a holo-[acp] through a 3-oxoacyl-[acp]  synthase 3 resulting in an acetyl-[acp] or react with hydrogen carbonate through an ATP driven acetyl-CoA carboxylase resulting in a malonyl-CoA.
Malonyl-CoA reacts with a holo-acp] through a malonyl-CoA-ACP transacylase resulting in a malonyl-[acp]. This compound can react with a KASI protein resulting in an acetyl-[acp]. A malonyl-[acp] can also react with an acetyl-[acp] through KASI and KASII or with acetyl-CoA through a beta-ketoacyl-ACP synthase to produce an acetoacetyl-[acp]. An acetoacetyl-[acp] is also known as a 3-oxoacyl-[acp].
A 3-oxoacyl-[acp] is reduced through a NDPH mediated 3-oxoacyl-[acp] reductase resulting in a (3R)-3-hydroxyacyl-[acp] (R3 hydroxydecanoyl-[acp]) which can either join the fatty acid metabolism, be dehydrated by an 3R-hydroxymyristoyl-[acp] dehydratase to produce a trans-2-enoyl-[acp] or  be dehydrated by a hydroxydecanoyl-[acp] to produce a trans-delta2 decenoyl-[acp].
Trans-2-enoyl-[acp] is reduced by a NADH driven enoyl-[acp] reductase resulting in a 2,3,4-saturated fatty acyl-[acp]. This product then reacts with malonyl-[acp] through KASI and KASII resulting in a holo-acyl carrier protein and a 3- oxoacyl-[acp].
Trans-delta2 decenoyl-[acp] reacts with a 3-hydroxydecanoyl-[acp] dehydrase producing a cis-delta 3-decenoyl-ACP. This product then reacts with KASI to produce a 3-oxo-cis-delta5-dodecenoyl-[acp], which in turn is reduced by a NADPH driven 3-oxoacyl-[acp] resulting in a 3R-hydroxy cis delta5-dodecenoyl-acp. This product is dehydrated by a (3R)-hydroxymyristoyl-[acp] dehydratase resulting in a trans-delta 3- cis-delta 5-dodecenoyl-[acp] which in turn is reduced by a NADH driven enoyl-[acp] reductase resulting in a cis-delta5-dodecenoyl-acp which goes into fatty acid metabolism

</description>
      <pathwhiz_id>PW000900</pathwhiz_id>
      <kegg_map_id>ec00061</kegg_map_id>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Riboflavin metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00740</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>alpha-Linolenic acid metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00592</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Metabolism of xenobiotics by cytochrome P450</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00980</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Drug metabolism - cytochrome P450</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00982</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Valine, leucine and isoleucine degradation</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00280</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Ubiquinone and other terpenoid-quinone biosynthesis</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00130</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Trinitrotoluene degradation</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00633</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Biosynthesis of siderophore group nonribosomal peptides</name>
      <description>2,3-dihydroxybenzoate is synthesized from chorismate via isochorismate and 2,3-dihydroxy-2,3-dihydrobenzoate. 
The biosynthesis of 2,3-dihydroxybenzoate starts  from chorismate being synthesized into isochorismate through isochorismate synthase entC.  EntC catalyzes the conversion of chorismate to isochorismate. The N-terminal isochorismate lyase domain of EntB hydrolyzes the pyruvate group of isochorismate to produce 2,3-dihydro-2,3-dihydroxybenzoate. The conversion of this latter compound to 2,3-dihydroxybenzoate is catalyzed by the EntA dehydrogenase.This compound then interacts with L-serine and ATP through enterobactin synthase protein complex resulting in the production of enterobactin. Enterobactin is exported into the periplasmic space through the enterobactin exporter entS. The compound is the export to the environment through the outer membrane protein TolC. In the environment enterobactin reacts with iron to produce Ferric enterobactin. This compound is imported into the periplasmic space through a ferric enterobactin outermembrane transport complex. The compound then enters the cytoplasm through a ferric enterobactin ABC transporter.Once inside the cytoplasm, ferric enterobactin spontaneously releases the iron  ion from the enterobactin.
</description>
      <pathwhiz_id>PW000760</pathwhiz_id>
      <kegg_map_id>ec01053</kegg_map_id>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Benzoate degradation via hydroxylation</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00362</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Fatty acid metabolism</name>
      <description>This pathway depicts the degradation of palmitic acid (C16:0). Fatty acid degradation and synthesis are relatively simple processes that are essentially the reverse of each other. The process of fatty acid degradation, also known as Beta-Oxidation, converts an aliphatic compound into a set of activated acetyl units (acetyl CoA) that can be processed by the citric acid cycle. An activated fatty acid is first oxidized to introduce a double bond; the double bond is then hydrated to introduce an oxygen; the alcohol is then oxidized to a ketone; and, finally, the four carbon fragment is cleaved by coenzyme A to yield acetyl CoA and a fatty acid chain two carbons shorter. If the fatty acid has an even number of carbon atoms and is saturated, the process is simply repeated until the fatty acid is completely converted into acetyl CoA units. Fatty acid synthesis is essentially the reverse of this process. Because the result is a polymer, the process starts with monomers—in this case with activated acyl group and malonyl units. The malonyl unit is condensed with the acetyl unit to form a four-carbon fragment. To produce the required hydrocarbon chain, the carbonyl must be reduced. The fragment is reduced, dehydrated, and reduced again, exactly the opposite of degradation, to bring the carbonyl group to the level of a methylene group with the formation of butyryl CoA. Another activated malonyl group condenses with the butyryl unit and the process is repeated until a C16 fatty acid is synthesized.
 The first step converts the hydroxydecanoyl into a trans 2decenoyl acp through a protein complex conformed of a hydroxomyristoyl dehydratase and a hydroxydecanoyl dehydratase. The second step leads to the production of a cis 3 decenoyl acp through a 3-hydroxydecanoyl acp dehydratase. For the third step the cis 3 decenoyl acp enters a cycle involving a synthase, reductase, dehydratase and an enoyl reductase which in turn produce a cis x enoyl-acp, hydroxy cis x enoyl, trans x-2 cis x enoyl acp and  cis x enoyl respectively.This is done until a palmitoleoyl is produce. In said case the pathway procedes in two different directions. It can either produce a palmitoleic acid through a acyl-coa thioesterase, or produce a Vaccenic acid through a different set of reactions. This process is achieved through a 3-oxoacyl acp synthase, a 3-oxoacyl acp reductase, a 3r hydroxymyristoyl dehydratase and an enoyl acp reductase that produces a transition through 3-oxo cis vaccenoyl acp, 3 hydroxy cis vaccenoyl acp, cis vaccen 2 enoyl acp and a cis vaccenoyl acp respectively. At this point it goes through one final reaction to produce a Vaccenic acid, through an acyl-CoA thioesterase</description>
      <pathwhiz_id>PW000796</pathwhiz_id>
      <kegg_map_id>ec00071</kegg_map_id>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Terpenoid backbone biosynthesis</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00900</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>1- and 2-Methylnaphthalene degradation</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00624</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>3-Chloroacrylic acid degradation</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00641</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Retinol metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00830</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Biphenyl degradation</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00621</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Toluene and xylene degradation</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00622</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Styrene degradation</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00643</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Microbial metabolism in diverse environments</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec01120</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Two-component system</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec02020</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Chloroalkane and chloroalkene degradation</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00625</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Naphthalene degradation</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00626</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Monobactam biosynthesis</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>eco00261</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Metabolic pathways</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>eco01100</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>2,3-dihydroxybenzoate biosynthesis</name>
      <description>2,3-dihydroxybenzoate is synthesized from chorismate via isochorismate and 2,3-dihydroxy-2,3-dihydrobenzoate. Chorismate is a key intermediate and branch point in the biosynthesis of many aromatic compounds.

The biosynthesis of 2,3-dihydroxybenzoate from chorismate is catalyzed by three enzymes EntC, EntB, and EntA. EntC catalyzes the conversion of chorismate to isochorismate. The N-terminal isochorismate lyase domain of EntB hydrolyzes the pyruvate group of isochorismate to produce 2,3-dihydro-2,3-dihydroxybenzoate. The conversion of this latter compound to 2,3-dihydroxybenzoate is catalyzed by the EntA dehydrogenase.

</description>
      <pathwhiz_id>PW000751</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>2-Oxopent-4-enoate metabolism</name>
      <description>The pathway starts with trans-cinnamate interacting with a hydrogen ion, an oxygen molecule, and a NADH through a cinnamate dioxygenase resulting in a NAD and a cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol which then interact together through a  2,3-dihydroxy-2,3-dihydrophenylpropionate dehydrogenase resulting in the release of a hydrogen ion, an NADH molecule and a 2,3 dihydroxy-trans-cinnamate.

The second way by which the 2,3 dihydroxy-trans-cinnamate is acquired is through a 3-hydroxy-trans-cinnamate interacting with a hydrogen ion, a NADH and an oxygen molecule through a 3-(3-hydroxyphenyl)propionate 2-hydroxylase resulting in the release of a NAD molecule, a water molecule and a 2,3-dihydroxy-trans-cinnamate.

The compound 2,3 dihydroxy-trans-cinnamate then interacts with an oxygen molecule through a 2,3-dihydroxyphenylpropionate 1,2-dioxygenase resulting in a hydrogen ion and a 2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate. The latter compound then interacts with a water molecule through a 2-hydroxy-6-oxononatrienedioate hydrolase resulting in a release of a hydrogen ion, a fumarate molecule and (2Z)-2-hydroxypenta-2,4-dienoate. The latter compound reacts spontaneously to isomerize into a 2-oxopent-4-enoate. This compound is then hydrated through a 2-oxopent-4-enoate hydratase resulting in a 4-hydroxy-2-oxopentanoate. This compound then interacts with a 4-hydroxy-2-ketovalerate aldolase resulting in the release of a pyruvate, and an acetaldehyde. The acetaldehyde then interacts with a coenzyme A and a NAD molecule through a acetaldehyde dehydrogenase resulting in a hydrogen ion, a NADH and an acetyl-coa which can be incorporated into the TCA cycle</description>
      <pathwhiz_id>PW001890</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Amino sugar and nucleotide sugar metabolism I</name>
      <description>The synthesis of amino sugars and nucleotide sugars  starts with the phosphorylation of N-Acetylmuramic acid (MurNac) through its transport from the periplasmic space to the cytoplasm. Once in the cytoplasm, MurNac and water undergo a reversible reaction through a N-acetylmuramic acid 6-phosphate etherase, producing a D-lactic acid and N-Acetyl-D-Glucosamine 6-phosphate. This latter compound can also be introduced into the cytoplasm through a phosphorylating PTS permase in the inner membrane that allows for the transport of N-Acetyl-D-glucosamine from the periplasmic space.  N-Acetyl-D-Glucosamine 6-phosphate can also be obtained from chitin dependent reactions. Chitin is hydrated through a bifunctional chitinase to produce chitobiose. This in turn gets hydrated by a beta-hexosaminidase to produce N-acetyl-D-glucosamine. The latter undergoes an atp dependent phosphorylation leading to the production of N-Acetyl-D-Glucosamine 6-phosphate.
 N-Acetyl-D-Glucosamine 6-phosphate is then be deacetylated in order to produce Glucosamine 6-phosphate through a N-acetylglucosamine-6-phosphate deacetylase. This compound can either be isomerized  or deaminated into Beta-D-fructofuranose 6-phosphate through a glucosamine-fructose-6-phosphate aminotransferase and a glucosamine-6-phosphate deaminase respectively. 
Glucosamine 6-phosphate undergoes a reversible reaction to glucosamine 1 phosphate through a phosphoglucosamine mutase. This compound is then acetylated through a bifunctional protein glmU to produce a N-Acetyl glucosamine 1-phosphate. 
N-Acetyl glucosamine 1-phosphate enters the nucleotide sugar synthesis by reacting with UTP and hydrogen ion through a bifunctional protein glmU releasing pyrophosphate and a Uridine diphosphate-N-acetylglucosamine.This compound can either be isomerized into a  UDP-N-acetyl-D-mannosamine or undergo a reaction with phosphoenolpyruvic acid through UDP-N-acetylglucosamine 1-carboxyvinyltransferase releasing a phosphate and a UDP-N-Acetyl-alpha-D-glucosamine-enolpyruvate.
UDP-N-acetyl-D-mannosamine undergoes a NAD dependent dehydrogenation  through a UDP-N-acetyl-D-mannosamine dehydrogenase, releasing NADH, a hydrogen ion and a UDP-N-Acetyl-alpha-D-mannosaminuronate, This compound is then used in the production of enterobacterial common antigens. 
UDP-N-Acetyl-alpha-D-glucosamine-enolpyruvate is reduced through a NADPH dependent UDP-N-acetylenolpyruvoylglucosamine reductase, releasing a NADP and a UDP-N-acetyl-alpha-D-muramate. This compound is involved in the D-glutamine and D-glutamate metabolism.
</description>
      <pathwhiz_id>PW000886</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Amino sugar and nucleotide sugar metabolism III</name>
      <description>The synthesis of amino sugars and nucleotide sugars  starts with the phosphorylation of N-Acetylmuramic acid (MurNac) through its transport from the periplasmic space to the cytoplasm. Once in the cytoplasm, MurNac and water undergo a reversible reaction through a N-acetylmuramic acid 6-phosphate etherase, producing a D-lactic acid and N-Acetyl-D-Glucosamine 6-phosphate. This latter compound can also be introduced into the cytoplasm through a phosphorylating PTS permase in the inner membrane that allows for the transport of N-Acetyl-D-glucosamine from the periplasmic space.  N-Acetyl-D-Glucosamine 6-phosphate can also be obtained from chitin dependent reactions. Chitin is hydrated through a bifunctional chitinase to produce chitobiose. This in turn gets hydrated by a beta-hexosaminidase to produce N-acetyl-D-glucosamine. The latter undergoes an atp dependent phosphorylation leading to the production of N-Acetyl-D-Glucosamine 6-phosphate.
 N-Acetyl-D-Glucosamine 6-phosphate is then be deacetylated in order to produce Glucosamine 6-phosphate through a N-acetylglucosamine-6-phosphate deacetylase. This compound is then deaminased into Beta-D-fructofuranose 6-phosphate through a glucosamine-6-phosphate deaminase.
 Beta-D-fructofuranose 6-phosphate is isomerized into a beta-D-glucose 6-phosphate through a glucose-6-phosphate isomerase. The compound is then isomerized by a putative beta-phosphoglucomutase to produce a beta-D-glucose 1-phosphate. This compound enters the nucleotide sugar metabolism through uridylation resulting in a UDP-glucose. UDP-glucose is then dehydrated through a UDP-glucose 6-dehydrogenase to produce a UDP-glucuronic acid. This compound undergoes a NAD dependent reaction through a bifunctional polymyxin resistance protein to produce UDP-Beta-L-threo-pentapyranos-4-ulose. This compound then reacts with L-glutamic acid through a UDP-4-amino-4-deoxy-L-arabinose--oxoglutarate aminotransferase to produce an oxoglutaric acid and UDP-4-amino-4-deoxy-beta-L-arabinopyranose
The latter compound interacts with a N10-formyl-tetrahydrofolate through a bifunctional polymyxin resistance protein ArnA, resulting in  a tetrahydrofolate, a hydrogen ion and a UDP-4-deoxy-4-formamido-beta-L-arabinopyranose, which in turn reacts with a product of the methylerythritol phosphate and polysoprenoid biosynthesis pathway, di-trans,octa-cis-undecaprenyl phosphate to produce a 4-deoxy-4-formamido-alpha-L-arabinopyranosyl ditrans, octacis-undecaprenyl phosphate.

Alpha-D-glucose is introduced into the cytoplasm through a glucose PTS permease, which phosphorylates the compound in order to produce an alpha-D-glucose 6-phosphate. This compound is then modified through a phosphoglucomutase 1 to yield alpha-D-glucose 1-phosphate. This compound can either be adenylated to produce ADP-glucose or uridylylated to produce galactose 1-phosphate through glucose-1-phosphate adenyllyltransferase and galactose-1-phosphate uridylyltransferase respectively.</description>
      <pathwhiz_id>PW000895</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Ascorbate metabolism</name>
      <description>E. coli is able to utilize L-ascorbate (vitamin C) as the sole source of carbon under anaerobic and aerobic conditions.
Ascorbic acid in the cytoplasm is processed through a spontaneous reaction with a hydrogen ion and hydrogen peroxide, producing water, dehydroascorbic acid and ascorbic acid. Dehydroascorbic acid reacts with water spontaneously producing an isomer, dehydroascorbate (bicyclic form). The compound then loses a hydrogen ion resulting in a 2,3-Diketo-L-gulonate. This compound is then reduced through a NADH dependent 2,3 diketo-L-gulonate reductase, releasing a NAD and 3-Dehydro-L-gulonate.This compound is phosphorylated through an ATP mediated L-xylulose/3-keto-L-gulonate kinase resulting in an ADP, hydrogen ion and a 3-Keto-L-gulonate 6 phosphate.
L-ascorbate can also be imported and converted to L-ascorbate-6-phosphate by the L-ascorbate PTS transporter. L-ascorbate-6-phosphate reacts with a probable L-ascorbate-6-phosphate lactonase ulaG, resulting in a 3-keto-L-gulonate 6-phosphate. 
 The compound 3-keto-L-gulonate 6-phosphate can be processed aerobically or anaerobically.
Aerobic:
3-keto-L-gulonate 6-phosphate is decarboxylated by a 3-keto-L-gulonate-6-phosphate decarboxylase ulaD, releasing carbon dioxide and L-xylulose-5-phosphate. This compound in turn is changed into an isomer by L-ribulose-5-phosphate 3-epimerase ulaE, resulting in L-ribulose 5-phosphate. This compound again changes into a different isomer through a L-ribulose-5-phosphate 4-epimerase ulaF resulting in Xylulose 5-phosphate. This compound can then be part of the pentose phosphate pathway.

Anaerobic:
3-keto-L-gulonate 6-phosphate is decarboxylated by 3-keto-L-gulonate 6-phosphate decarboxylase sgbH, releasing carbon dioxide and L-xylulose-5-phosphate. This compound in turn is changed into an isomer by predicted L-xylulose 5-phosphate 3-epimerase, resulting in L-ribulose 5-phosphate. This compound again changes into a different isomer through a  L-ribulose-5-phosphate 4-epimerase resulting in Xylulose 5-phosphate. This compound can then be part of the pentose phosphate pathway.


Expression of the ula regulon is regulated by the L-ascorbate 6-phosphate-binding repressor UlaR and by cAMP-CRP.
Under aerobic conditions, metabolism of L-ascorbate is hindered by the special reactivity and toxicity of this compound in the presence of oxygen.</description>
      <pathwhiz_id>PW000793</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Collection of Reactions without pathways</name>
      <description/>
      <pathwhiz_id>PW001891</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Galactitol and galactonate degradation</name>
      <description>D-galactonate can serve as the sole source of carbon and energy for E. coli . The initial step, after the transport of galactonic acid into the cell is the degradation of D-galactonate is dehydration to 2-dehydro-3-deoxy-D-galactonate by D-galactonate dehydratase. Subsequent phosphorylation by 2-dehydro-3-deoxygalactonate kinase and aldol cleavage by 2-oxo-3-deoxygalactonate 6-phosphate aldolase produce pyruvate and D-glyceraldehyde-3-phosphate, which enter central metabolism.
Galactitol can also be utilized by E. coli K-12 as a total source of carbon and energy. Each enters the cell via a specific phosphotransferase system, so the first intracellular species is  D-galactitol-1-phosphate or D-galactitol-6-phosphate, which are identical. This sugar alcohol phosphate becomes the substrate for a dehydrogenase that oxidizes its 2-alcohol group to a keto group. Galactitol-1-phosphate, the product of the dehydrogenation is tagatose-6-phosphate, which becomes the substrate of a kinase and subsequently an aldolase (in a pair of reactions that parallel those of glycolysis) before it is converted into intermediates (D-glyceraldehde-3-phosphate and dihydroxy-acetone-phosphate) of glycolysis.</description>
      <pathwhiz_id>PW000820</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Gluconeogenesis from L-malic acid</name>
      <description>Gluconeogenesis from L-malic acid starts from the introduction of L-malic acid into cytoplasm either through a C4 dicarboxylate / orotate:H+ symporter or a dicarboxylate transporter (succinic acid antiporter). L-malic acid is then metabolized through 3 possible ways: NAD driven malate dehydrogenase resulting in oxalacetic acid, NADP driven malate dehydrogenase B resulting pyruvic acid or malate dehydrogenase, NAD-requiring resulting in pyruvic acid. 
Oxalacetic acid is processed by phosphoenolpyruvate carboxykinase (ATP driven) while pyruvic acid is processed by phosphoenolpyruvate synthetase resulting in phosphoenolpyruvic acid. This compound is dehydrated by enolase resulting in an 2-phosphoglyceric acid. This compound is then isomerized by 2,3-bisphosphoglycerate-independent phosphoglycerate mutase resulting in a 3-phosphoglyceric acid which is phosphorylated by an ATP driven phosphoglycerate kinase resulting in an glyceric acid 1,3-biphosphate. This compound undergoes an NADH driven glyceraldehyde 3-phosphate dehydrogenase reaction resulting in a D-Glyceraldehyde 3-phosphate which is first isomerized into dihydroxyacetone phosphate through an triosephosphate isomerase. D-glyceraldehyde 3-phosphate and Dihydroxyacetone phosphate react through a fructose biphosphate aldolase protein complex resulting in a fructose 1,6-biphosphate. This compound is metabolized by a fructose-1,6-bisphosphatase resulting in a Beta-D-fructofuranose 6-phosphate which is then isomerized into a Beta-D-glucose 6-phosphate through a glucose-6-phosphate isomerase. 
</description>
      <pathwhiz_id>PW000819</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Leucine Biosynthesis</name>
      <description>Leucine biosynthesis involves a five-step conversion process starting with the valine precursor 2-keto-isovalerate interacting with acetyl-CoA and water through a 2-isopropylmalate synthase resulting in Coenzyme A, hydrogen Ion and 2-isopropylmalic acid. The latter compound reacts with isopropylmalate isomerase which dehydrates the compound resulting in a Isopropylmaleate. This compound reacts with  water through a isopropylmalate isomerase resulting in 3-isopropylmalate. This compound interacts with a NAD-driven D-malate / 3-isopropylmalate dehydrogenase results in 2-isopropyl-3-oxosuccinate. This compound interacts spontaneously with hydrogen resulting in the release of carbon dioxide and ketoleucine. Ketoleucine interacts in a reversible reaction with L-glutamic acid through a branched-chain amino-acid aminotransferase resulting in Oxoglutaric acid and L-leucine
L-leucine can then be exported outside the cytoplasm through a transporter: L-amino acid efflux transporter.
The final step in this pathway is catalyzed by two transaminases of broad specificity, IlvE and TyrB.

Both the first enzyme in the pathway, 2-isopropylmalate synthase, and the terminal transaminase TyrB are suppressed by leucine. TyrB is subject to inhibition by the pathway's starting compound, 2-keto-isovalerate, and by one of its off-pathway products, tyrosine. One consequence of this inhibition by 2-keto-isovalerate is that in the absence of IlvE activity, mutations in earlier steps in the pathway cannot be compensated for by any alternate method of introducing 2-ketoisocaproate for conversion to leucine. </description>
      <pathwhiz_id>PW000811</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>N-oxide electron transfer</name>
      <description>The pathway can start in various spots. First step in this case starts with NADH interacting with a menaquinone oxidoreductase resulting in the release of a NADH and a hydrogen Ion, at the same time in the inner membrane a menaquinone interacts with 2 electrons and 2 hydrogen ions thus releasing a menaquinol. This allows for 4 hydrogen ions to be transferred from the cytosol to the periplasmic space. The menaquinol then interacts with a trimethylamine N-oxide reductase resulting in the release of 2 hydrogen ion and 2 electrons. At the same time trimethylamine N-oxide and 3 hydrogen ions interact with the enzyme trimethylamine N-oxide reductase resulting in the release of a trimethylamine and a water molecule, this reaction happening in the periplasmic space.
The second set of reactions starts with a hydrogen interacting with a menaquinone oxidoreductase resulting in the release of two electrons being released into the inner membrane which then react with with 2 hydrogen ion and a menaquinone to produce a menaquinol. This menaquinol then reacts with a trimethylamine N-oxide reductase following the same steps as mentioned before.
The third set of reactions starts with with formate interacting with a formate dehydrogenase-O resulting in a release of carbon dioxide and a hydrogen ion, this releases 2 electrons that interact with a menaquinone and two hydrogen ions. This releases a menaquinol which then reacts with a trimethylamine N-oxide reductase following the same steps as mentioned before</description>
      <pathwhiz_id>PW001889</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Porphyrin metabolism</name>
      <description>The metabolism of porphyrin begins with with glutamic acid being processed by an ATP-driven glutamyl-tRNA synthetase by interacting with hydrogen ion and tRNA(Glu), resulting in amo, pyrophosphate and L-glutamyl-tRNA(Glu) Glutamic acid. Glutamic acid can be obtained as a result of L-glutamate metabolism pathway, glutamate / aspartate : H+ symporter GltP, glutamate:sodium symporter or a glutamate / aspartate ABC transporter .
L-glutamyl-tRNA(Glu) Glutamic acid interacts with a NADPH glutamyl-tRNA reductase resulting in a NADP, a tRNA(Glu) and a (S)-4-amino-5-oxopentanoate. 
This compound interacts with a glutamate-1-semialdehyde aminotransferase resulting a 5-aminolevulinic acid. This compound interacts with a porphobilinogen synthase resulting in a hydrogen ion, water and porphobilinogen. The latter compound interacts with water resulting in hydroxymethylbilane synthase resulting in ammonium, and hydroxymethylbilane. 
 Hydroxymethylbilane can either be dehydrated to produce uroporphyrinogen I or interact with a uroporphyrinogen III synthase resulting in a water molecule and a uroporphyrinogen III.
Uroporphyrinogen I interacts with hydrogen ion through a uroporphyrinogen decarboxylase resulting in a carbon dioxide and a coproporphyrinogen I
Uroporphyrinogen III can be metabolized into precorrin by interacting with a S-adenosylmethionine through a siroheme synthase resulting in hydrogen ion, an s-adenosylhomocysteine and a precorrin-1. On the other hand, Uroporphyrinogen III interacts with hydrogen ion through a uroporphyrinogen decarboxylase resulting in a carbon dioxide and a Coproporphyrinogen III.
Precorrin-1 reacts with a S-adenosylmethionine through a siroheme synthase resulting in a S-adenosylhomocysteine and a Precorrin-2. The latter compound is processed by a NAD dependent uroporphyrin III C-methyltransferase [multifunctional] resulting in a NADH and a sirohydrochlorin. This compound then interacts with Fe 2+ 
uroporphyrin III C-methyltransferase [multifunctional] resulting in a hydrogen ion and a siroheme. The siroheme is then processed in sulfur metabolism pathway.
Uroporphyrinogen III can be processed in anaerobic or aerobic condition. 
Anaerobic:
Uroporphyrinogen III interacts with an oxygen molecule, a hydrogen ion through a coproporphyrinogen III oxidase resulting in water, carbon dioxide and protoporphyrinogen IX. The latter compound then interacts with an 3 oxygen molecule through a protoporphyrinogen oxidase resulting in 3 hydrogen peroxide and a Protoporphyrin IX
Aerobic:
Uroporphyrinogen III reacts with S-adenosylmethionine through a coproporphyrinogen III dehydrogenase resulting in carbon dioxide, 5-deoxyadenosine, L-methionine and protoporphyrinogen IX. The latter compound interacts with a meanquinone through a protoporphyrinogen oxidase resulting in protoporphyrin IX.

The protoporphyrin IX interacts with Fe 2+ through a ferrochelatase resulting in a hydrogen ion and a ferroheme b. The ferroheme b can either be incorporated into the oxidative phosphorylation as a cofactor of the enzymes involved in that pathway or it can interact with hydrogen peroxide through a catalase HPII resulting in a heme D. Heme D can then be incorporated into the oxidative phosphyrlation pathway as a cofactor of the enzymes involved in that pathway. Ferroheme b can also interact with water and a farnesyl pyrophosphate through a heme O synthase resulting in a release of pyrophosphate and heme O. Heme O is then incorporated into the Oxidative phosphorylation pathway.
</description>
      <pathwhiz_id>PW000936</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Secondary Metabolite: Leucine biosynthesis</name>
      <description>Leucine biosynthesis involves a five-step conversion process starting with a 3-methyl-2-oxovaleric acid interacting with acetyl-CoA and a water molecule through a 2-isopropylmalate synthase resulting in Coenzyme A, hydrogen Ion and 2-isopropylmalic acid. The latter compound reacts with isopropylmalate isomerase which dehydrates the compound resulting in a Isopropylmaleate. This compound reacts with  water through a isopropylmalate isomerase resulting in 3-isopropylmalate. This compound interacts with a NAD-driven D-malate / 3-isopropylmalate dehydrogenase results in 2-isopropyl-3-oxosuccinate. This compound interacts spontaneously with hydrogen resulting in the release of carbon dioxide and ketoleucine. Ketoleucine interacts in a reversible reaction with L-glutamic acid through a branched-chain amino-acid aminotransferase resulting in Oxoglutaric acid and L-leucine



Both the first enzyme in the pathway, 2-isopropylmalate synthase, and the terminal transaminase TyrB are suppressed by leucine. TyrB is subject to inhibition by the pathway's starting compound, 2-keto-isovalerate, and by one of its off-pathway products, tyrosine. One consequence of this inhibition by 2-keto-isovalerate is that in the absence of IlvE activity, mutations in earlier steps in the pathway cannot be compensated for by any alternate method of introducing 2-ketoisocaproate for conversion to leucine. </description>
      <pathwhiz_id>PW000980</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Secondary Metabolites: Glyoxylate cycle</name>
      <description>The glyoxylate cycle starts with the interaction of Acetyl-Coa with a water molecule and Oxalacetic acid interact through a Citrate synthase resulting in a release of a coenzyme a and citric acid. The citric acid gets dehydrated through a citrate hydro-lyase resulting in the release of a water molecule and cis-Aconitic acid. The cis-Aconitic acid is then hydrated in an reversible reaction through an aconitate hydratase resulting in an Isocitric acid. The isocitric acid then interacts in a reversible reaction through isocitrate lyase resulting in the release of a succinic acid and a glyoxylic acid. The glyoxylic acid then reacts in a reversible reaction with an acetyl-coa, and a water molecule in a reversible reaction, resulting in a release of a coenzyme A, a hydrogen ion and an L-malic acid. The L-malic acid interacts in a reversible reaction through a NAD driven malate dehydrogenase resulting in the release of NADH, a hydrogen ion and an Oxalacetic acid.</description>
      <pathwhiz_id>PW000967</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Secondary Metabolites: Histidine biosynthesis</name>
      <description>Histidine biosynthesis starts with a product of PRPP biosynthesis pathway, phosphoribosyl pyrophosphate which interacts with a hydrogen ion through an ATP phosphoribosyltransferase resulting in an pyrophosphate and a phosphoribosyl-ATP. This compound interacts with water through a phosphoribosyl-AMP cyclohydrolase / phosphoribosyl-ATP pyrophosphatase resulting in the release of pyrophosphate, hydrogen ion and a phosphoribosyl-AMP. This enzyme proceeds to interact with phosphoribosyl-AMP and water resulting in a 1-(5'-Phosphoribosyl)-5-amino-4-imidazolecarboxamide. This compound is then isomerized by a N-(5'-phospho-L-ribosyl-formimino)-5-amino-1-(5'-phosphoribosyl)-4-imidazolecarboxamide isomerase resulting in a PhosphoribosylformiminoAICAR-phosphate. This compound reacts with L-glutamine through an imidazole glycerol phosphate synthase resulting in a L-glutamic acid, hydrogen ion, 5-aminoimidazole-4-carboxamide and a D-erythro-imidazole-glycerol-phosphate. This compound reacts with a imidazoleglycerol-phosphate dehydratase / histidinol-phosphatase, dehydrating the compound and resulting in a imidazole acetol-phosphate.
This compound interacts with L-glutamic acid through a histidinol-phosphate aminotransferase, releasing oxoglutaric acid and L-histidinol-phosphate. The latter compound interacts with water and a imidazoleglycerol-phosphate dehydratase / histidinol-phosphatase resulting in L-histidinol and phosphate. L-histidinol interacts with a NAD-driven histidinol dehydrogenase resulting in a Histidinal. This in turn reacts with water in a NAD driven histidinal dehydrogenase resulting in L-Histidine.
L-Histidine then represses ATP phosphoribosyltransferase, regulation its own biosynthesis.</description>
      <pathwhiz_id>PW000984</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Secondary Metabolites: Valine and I-leucine biosynthesis from pyruvate</name>
      <description>The biosynthesis of Valine and L-leucine from pyruvic acid starts with pyruvic acid interacting with a hydrogen ion through a acetolactate synthase / acetohydroxybutanoate synthase resulting in a release of a carbon dioxide, a (S)-2-acetolactate. The latter compound then interacts with a hydrogen ion through a NADPH-driven acetohydroxy acid isomeroreductase resulting in the release of a NADP, a (R) 2,3-dihydroxy-3-methylvalerate. The latter compound is then dehydrated by a dihydroxy acid dehydratase resulting in the release of a water molecule an 3-methyl-2-oxovaleric acid. 
The 3-methyl-2-oxovaleric acid can produce an L-valine by interacting with a L-glutamic acid through a Valine Transaminase resulting in the release of a Oxoglutaric acid and a L-valine.
The 3-methyl-2-oxovaleric acid then interacts with an acetyl-CoA and a water molecule through a 2-isopropylmalate synthase resulting in the release of a hydrogen ion, a Coenzyme A and a 2-Isopropylmalic acid. The isopropylimalic acid is then hydrated by interacting with a isopropylmalate isomerase resulting in a 3-isopropylmalate. This compound then interacts with an NAD driven 3-isopropylmalate dehydrogenase resulting in a NADH, a hydrogen ion and a 2-isopropyl-3-oxosuccinate. The latter compound then interacts with hydrogen ion spontaneously resulting in a carbon dioxide and a ketoleucine. The ketoleucine then interacts with a L-glutamic acid through a branched-chain amino-acid aminotransferase resulting in the oxoglutaric acid and L-leucine.</description>
      <pathwhiz_id>PW000978</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Secondary Metabolites: cysteine biosynthesis from serine</name>
      <description>The pathway starts with a 3-phosphoglyceric acid interacting with an NAD driven D-3-phosphoglycerate dehydrogenase / α-ketoglutarate reductase resulting in an NADH, a hydrogen ion and a phosphohydroxypyruvic acid. This compound then interacts with an L-glutamic acid through a 3-phosphoserine aminotransferase / phosphohydroxythreonine aminotransferase resulting in a oxoglutaric acid and a DL-D-phosphoserine. The latter compound then interacts with a water molecule through a phosphoserine phosphatase resulting in a phosphate and an L-serine. The L-serine interacts with an acetyl-coa through a serine acetyltransferase resulting in a release of a Coenzyme A and a O-Acetylserine. The O-acetylserine then interacts with a hydrogen sulfide through a O-acetylserine sulfhydrylase A resulting in an acetic acid, a hydrogen ion and an L-cysteine</description>
      <pathwhiz_id>PW000977</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Secondary metabolites: isoprenoid biosynthesis (nonmevalonate pathway)</name>
      <description>The biosynthesis of isoprenoids starts with a D-glyceraldehyde 3-phosphate interacting with a hydrogen ion through a 1-deoxyxylulose-5-phosphate synthase resulting in a carbon dioxide and 1-Deoxy-D-xylulose. The latter compound then interacts with a hydrogen ion through a NADPH driven 1-deoxy-D-xylulose 5-phosphate reductoisomerase resulting in a NADP and a 2-C-methyl-D-erythritol 4-phosphate. The latter compound then interacts with a cytidine triphosphate and a hydrogen ion through a 4-diphosphocytidyl-2C-methyl-D-erythritol synthase resulting in a pyrophosphate and a 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol. The latter compound is then phosphorylated through an ATP driven 
4-diphosphocytidyl-2-C-methylerythritol kinase resulting in a release of an ADP, a hydrogen ion and a 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol. The latter compound then interacts with a 
2C-methyl-D-erythritol 2,4-cyclodiphosphate synthase  resulting in the release of a 2-C-methyl-D-erythritol-2,4-cyclodiphosphate resulting in the release of a cytidine monophosphate and 2-C-methyl-D-erythritol-2,4-cyclodiphosphate. The latter compound then interacts with a reduced flavodoxin through a 
1-hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate synthase  resulting in the release of a water molecule, a hydrogen ion, an oxidized flavodoxin and a 1-hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate. 
The compound 1-hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate can interact with an NADPH,a hydrogen ion through a 1-hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate reductase  resulting in a NADP, a water molecule and either a Dimethylallylpyrophosphate or a Isopentenyl pyrophosphate. These two last compounds can be are isomers that can be produced through a isopentenyl diphosphate isomerase.and then get incorporated into the methylerythritol phosphate and polyisoprenoid biosynthesis pathway</description>
      <pathwhiz_id>PW000975</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Secondary metabolites: methylerythritol phosphate and polyisoprenoid biosynthesis</name>
      <description>The biosynthesis of isoprenoids starts with a D-glyceraldehyde 3-phosphate interacting with a hydrogen ion through a 1-deoxyxylulose-5-phosphate synthase resulting in a carbon dioxide and 1-Deoxy-D-xylulose. The latter compound then interacts with a hydrogen ion through a NADPH driven 1-deoxy-D-xylulose 5-phosphate reductoisomerase resulting in a NADP and a 2-C-methyl-D-erythritol 4-phosphate. The latter compound then interacts with a cytidine triphosphate and a hydrogen ion through a 4-diphosphocytidyl-2C-methyl-D-erythritol synthase resulting in a pyrophosphate and a 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol. The latter compound is then phosphorylated through an ATP driven 
4-diphosphocytidyl-2-C-methylerythritol kinase resulting in a release of an ADP, a hydrogen ion and a 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol. The latter compound then interacts with a 
2C-methyl-D-erythritol 2,4-cyclodiphosphate synthase  resulting in the release of a 2-C-methyl-D-erythritol-2,4-cyclodiphosphate resulting in the release of a cytidine monophosphate and 2-C-methyl-D-erythritol-2,4-cyclodiphosphate. The latter compound then interacts with a reduced flavodoxin through a 
1-hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate synthase  resulting in the release of a water molecule, a hydrogen ion, an oxidized flavodoxin and a 1-hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate. 
The compound 1-hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate can interact with an NADPH,a hydrogen ion through a 1-hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate reductase  resulting in a NADP, a water molecule and either a Dimethylallylpyrophosphate or a Isopentenyl pyrophosphate. These two last compounds can be are isomers that can be produced through a isopentenyl diphosphate isomerase.
Dimethylallylpyrophosphate interacts with the isopentenyl pyrophosphate through a geranyl diphosphate synthase / farnesyl diphosphate synthase resulting in a pyrophosphate and a geranyl--PP. The latter compound interacts with a Isopentenyl pyrophosphate through a geranyl diphosphate synthase / farnesyl diphosphate synthase resulting in the release of a pyrophosphate and a farnesyl pyrophosphate. The latter compound interacts with isopentenyl pyrophosphate either through a undecaprenyl diphosphate synthase resulting in a release of a pyrophosphate and a di-trans,octa-cis-undecaprenyl diphosphate or through a octaprenyl diphosphate synthase resulting in a pyrophosphate and an octaprenyl diphosphate</description>
      <pathwhiz_id>PW000958</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>TCA cycle</name>
      <description>
The TCA pathway is a catabolic pathway of aerobic respiration. It generates energy and reducing power. It is the first step in generating precursors for biosynthesis. When acetate is the carbon source, citrate synthase is rate-limiting for the TCA cycle. Respiration is an ATP-generating process in which compounds act as electron donors through a chain of electron transfer to electron acceptors. Aerobic respiration uses oxygen as the final acceptor. Anaerobic respiration uses several organic compounds as acceptors such as fumarate, nitrate and hydrogen. During the chain of electron transfer, protons (H+) are transported outside the cytoplasmic membrane, generating a proton motive force. Upon passage of protons back into the cytoplasm, the PMF energy is captured as ATP, catalyzed by a multisubunit ATPase.
The cycle can start from Acetyl-CoA interacting with Oxalacetic acid and water through a citrate synthase monomer resulting in a hydrogen ion, CoA and a Citric Acid. The latter compound is dehydrated by a Citrate hydro-lyase resulting in the release of water and a cis-Aconitic acid. This compound is then hydrated through a Citrate hydro-lyase resulting in a D-threo-Isocitric acid. This compound is decarboxylated by an NADP dependent Citrate dehydrogenase, resulting in a release of carbon dioxide and NADPH and Oxoglutaric acid. The oxoglutaric acid interacts with a Coenzyme A through a NAD driven 2-oxoglutarate dehydrogenase resulting in a release of carbon dioxide, an NADH and succinyl-CoA. The succinyl-CoA interacts with a phosphate and an ADP through a 2-oxoglutarate dehydrogenase resulting in a CoA, an ATP and Succinic Acid. Succinic acid interacts with a ubiquinone, in this case a ubiquinone 1 through a succinate:quinone oxidoreductase resulting in an ubiquinol, in this case a ubiquinol-1 and a fumaric acid.
The fumaric acid interacts with water through a fumarase hydratase resulting in a L-Malic acid.This compound can either interact with quinone through a malate:quinone oxidoreductase resulting in a release of hydroquinone and oxalacetic acid, or it can react with an NAD through a malate dehydrogenase resulting in a hydrogen ion, NADH and Oxalacetic acid.</description>
      <pathwhiz_id>PW000779</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>TCA cycle (ubiquinol-10)</name>
      <description>The TCA pathway is a catabolic pathway of aerobic respiration. It generates energy and reducing power. It is the first step in generating precursors for biosynthesis. When acetate is the carbon source, citrate synthase is rate-limiting for the TCA cycle. Respiration is an ATP-generating process in which compounds act as electron donors through a chain of electron transfer to electron acceptors. Aerobic respiration uses oxygen as the final acceptor. Anaerobic respiration uses several organic compounds as acceptors such as fumarate, nitrate and hydrogen. During the chain of electron transfer, protons (H+) are transported outside the cytoplasmic membrane, generating a proton motive force. Upon passage of protons back into the cytoplasm, the PMF energy is captured as ATP, catalyzed by a multisubunit ATPase.
The cycle can start from Acetyl-CoA interacting with Oxalacetic acid and water through a citrate synthase monomer resulting in a hydrogen ion, CoA and a Citric Acid. The latter compound is dehydrated by a Citrate hydro-lyase resulting in the release of water and a cis-Aconitic acid. This compound is then hydrated through a Citrate hydro-lyase resulting in a D-threo-Isocitric acid. This compound is decarboxylated by an NADP dependent Citrate dehydrogenase, resulting in a release of carbon dioxide and NADPH and Oxoglutaric acid. The oxoglutaric acid interacts with a Coenzyme A through a NAD driven 2-oxoglutarate dehydrogenase resulting in a release of carbon dioxide, an NADH and succinyl-CoA. The succinyl-CoA interacts with a phosphate and an ADP through a 2-oxoglutarate dehydrogenase resulting in a CoA, an ATP and Succinic Acid. Succinic acid interacts with a ubiquinone, in this case a ubiquinone 1 through a succinate:quinone oxidoreductase resulting in an ubiquinol, in this case a ubiquinol-1 and a fumaric acid.
The fumaric acid interacts with water through a fumarase hydratase resulting in a L-Malic acid.This compound can either interact with quinone through a malate:quinone oxidoreductase resulting in a release of hydroquinone and oxalacetic acid, or it can react with an NAD through a malate dehydrogenase resulting in a hydrogen ion, NADH and Oxalacetic acid.</description>
      <pathwhiz_id>PW001010</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>TCA cycle (ubiquinol-2)</name>
      <description>The TCA pathway is a catabolic pathway of aerobic respiration. It generates energy and reducing power. It is the first step in generating precursors for biosynthesis. When acetate is the carbon source, citrate synthase is rate-limiting for the TCA cycle. Respiration is an ATP-generating process in which compounds act as electron donors through a chain of electron transfer to electron acceptors. Aerobic respiration uses oxygen as the final acceptor. Anaerobic respiration uses several organic compounds as acceptors such as fumarate, nitrate and hydrogen. During the chain of electron transfer, protons (H+) are transported outside the cytoplasmic membrane, generating a proton motive force. Upon passage of protons back into the cytoplasm, the PMF energy is captured as ATP, catalyzed by a multisubunit ATPase.
The cycle can start from Acetyl-CoA interacting with Oxalacetic acid and water through a citrate synthase monomer resulting in a hydrogen ion, CoA and a Citric Acid. The latter compound is dehydrated by a Citrate hydro-lyase resulting in the release of water and a cis-Aconitic acid. This compound is then hydrated through a Citrate hydro-lyase resulting in a D-threo-Isocitric acid. This compound is decarboxylated by an NADP dependent Citrate dehydrogenase, resulting in a release of carbon dioxide and NADPH and Oxoglutaric acid. The oxoglutaric acid interacts with a Coenzyme A through a NAD driven 2-oxoglutarate dehydrogenase resulting in a release of carbon dioxide, an NADH and succinyl-CoA. The succinyl-CoA interacts with a phosphate and an ADP through a 2-oxoglutarate dehydrogenase resulting in a CoA, an ATP and Succinic Acid. Succinic acid interacts with a ubiquinone, in this case a ubiquinone 2 through a succinate:quinone oxidoreductase resulting in an ubiquinol, in this case a ubiquinol-2 and a fumaric acid.
The fumaric acid interacts with water through a fumarase hydratase resulting in a L-Malic acid.This compound can either interact with quinone through a malate:quinone oxidoreductase resulting in a release of hydroquinone and oxalacetic acid, or it can react with an NAD through a malate dehydrogenase resulting in a hydrogen ion, NADH and Oxalacetic acid.</description>
      <pathwhiz_id>PW001002</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>TCA cycle (ubiquinol-3)</name>
      <description>The TCA pathway is a catabolic pathway of aerobic respiration. It generates energy and reducing power. It is the first step in generating precursors for biosynthesis. When acetate is the carbon source, citrate synthase is rate-limiting for the TCA cycle. Respiration is an ATP-generating process in which compounds act as electron donors through a chain of electron transfer to electron acceptors. Aerobic respiration uses oxygen as the final acceptor. Anaerobic respiration uses several organic compounds as acceptors such as fumarate, nitrate and hydrogen. During the chain of electron transfer, protons (H+) are transported outside the cytoplasmic membrane, generating a proton motive force. Upon passage of protons back into the cytoplasm, the PMF energy is captured as ATP, catalyzed by a multisubunit ATPase.
The cycle can start from Acetyl-CoA interacting with Oxalacetic acid and water through a citrate synthase monomer resulting in a hydrogen ion, CoA and a Citric Acid. The latter compound is dehydrated by a Citrate hydro-lyase resulting in the release of water and a cis-Aconitic acid. This compound is then hydrated through a Citrate hydro-lyase resulting in a D-threo-Isocitric acid. This compound is decarboxylated by an NADP dependent Citrate dehydrogenase, resulting in a release of carbon dioxide and NADPH and Oxoglutaric acid. The oxoglutaric acid interacts with a Coenzyme A through a NAD driven 2-oxoglutarate dehydrogenase resulting in a release of carbon dioxide, an NADH and succinyl-CoA. The succinyl-CoA interacts with a phosphate and an ADP through a 2-oxoglutarate dehydrogenase resulting in a CoA, an ATP and Succinic Acid. Succinic acid interacts with a ubiquinone, in this case a ubiquinone-3 through a succinate:quinone oxidoreductase resulting in an ubiquinol, in this case a ubiquinol-3 and a fumaric acid.
The fumaric acid interacts with water through a fumarase hydratase resulting in a L-Malic acid.This compound can either interact with quinone through a malate:quinone oxidoreductase resulting in a release of hydroquinone and oxalacetic acid, or it can react with an NAD through a malate dehydrogenase resulting in a hydrogen ion, NADH and Oxalacetic acid.</description>
      <pathwhiz_id>PW001003</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>TCA cycle (ubiquinol-4)</name>
      <description>The TCA pathway is a catabolic pathway of aerobic respiration. It generates energy and reducing power. It is the first step in generating precursors for biosynthesis. When acetate is the carbon source, citrate synthase is rate-limiting for the TCA cycle. Respiration is an ATP-generating process in which compounds act as electron donors through a chain of electron transfer to electron acceptors. Aerobic respiration uses oxygen as the final acceptor. Anaerobic respiration uses several organic compounds as acceptors such as fumarate, nitrate and hydrogen. During the chain of electron transfer, protons (H+) are transported outside the cytoplasmic membrane, generating a proton motive force. Upon passage of protons back into the cytoplasm, the PMF energy is captured as ATP, catalyzed by a multisubunit ATPase.
The cycle can start from Acetyl-CoA interacting with Oxalacetic acid and water through a citrate synthase monomer resulting in a hydrogen ion, CoA and a Citric Acid. The latter compound is dehydrated by a Citrate hydro-lyase resulting in the release of water and a cis-Aconitic acid. This compound is then hydrated through a Citrate hydro-lyase resulting in a D-threo-Isocitric acid. This compound is decarboxylated by an NADP dependent Citrate dehydrogenase, resulting in a release of carbon dioxide and NADPH and Oxoglutaric acid. The oxoglutaric acid interacts with a Coenzyme A through a NAD driven 2-oxoglutarate dehydrogenase resulting in a release of carbon dioxide, an NADH and succinyl-CoA. The succinyl-CoA interacts with a phosphate and an ADP through a 2-oxoglutarate dehydrogenase resulting in a CoA, an ATP and Succinic Acid. Succinic acid interacts with a ubiquinone, in this case a ubiquinone 1 through a succinate:quinone oxidoreductase resulting in an ubiquinol, in this case a ubiquinol-1 and a fumaric acid.
The fumaric acid interacts with water through a fumarase hydratase resulting in a L-Malic acid.This compound can either interact with quinone through a malate:quinone oxidoreductase resulting in a release of hydroquinone and oxalacetic acid, or it can react with an NAD through a malate dehydrogenase resulting in a hydrogen ion, NADH and Oxalacetic acid.</description>
      <pathwhiz_id>PW001004</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>TCA cycle (ubiquinol-5)</name>
      <description>The TCA pathway is a catabolic pathway of aerobic respiration. It generates energy and reducing power. It is the first step in generating precursors for biosynthesis. When acetate is the carbon source, citrate synthase is rate-limiting for the TCA cycle. Respiration is an ATP-generating process in which compounds act as electron donors through a chain of electron transfer to electron acceptors. Aerobic respiration uses oxygen as the final acceptor. Anaerobic respiration uses several organic compounds as acceptors such as fumarate, nitrate and hydrogen. During the chain of electron transfer, protons (H+) are transported outside the cytoplasmic membrane, generating a proton motive force. Upon passage of protons back into the cytoplasm, the PMF energy is captured as ATP, catalyzed by a multisubunit ATPase.
The cycle can start from Acetyl-CoA interacting with Oxalacetic acid and water through a citrate synthase monomer resulting in a hydrogen ion, CoA and a Citric Acid. The latter compound is dehydrated by a Citrate hydro-lyase resulting in the release of water and a cis-Aconitic acid. This compound is then hydrated through a Citrate hydro-lyase resulting in a D-threo-Isocitric acid. This compound is decarboxylated by an NADP dependent Citrate dehydrogenase, resulting in a release of carbon dioxide and NADPH and Oxoglutaric acid. The oxoglutaric acid interacts with a Coenzyme A through a NAD driven 2-oxoglutarate dehydrogenase resulting in a release of carbon dioxide, an NADH and succinyl-CoA. The succinyl-CoA interacts with a phosphate and an ADP through a 2-oxoglutarate dehydrogenase resulting in a CoA, an ATP and Succinic Acid. Succinic acid interacts with a ubiquinone, in this case a ubiquinone 1 through a succinate:quinone oxidoreductase resulting in an ubiquinol, in this case a ubiquinol-1 and a fumaric acid.
The fumaric acid interacts with water through a fumarase hydratase resulting in a L-Malic acid.This compound can either interact with quinone through a malate:quinone oxidoreductase resulting in a release of hydroquinone and oxalacetic acid, or it can react with an NAD through a malate dehydrogenase resulting in a hydrogen ion, NADH and Oxalacetic acid.</description>
      <pathwhiz_id>PW001005</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>TCA cycle (ubiquinol-6)</name>
      <description>The TCA pathway is a catabolic pathway of aerobic respiration. It generates energy and reducing power. It is the first step in generating precursors for biosynthesis. When acetate is the carbon source, citrate synthase is rate-limiting for the TCA cycle. Respiration is an ATP-generating process in which compounds act as electron donors through a chain of electron transfer to electron acceptors. Aerobic respiration uses oxygen as the final acceptor. Anaerobic respiration uses several organic compounds as acceptors such as fumarate, nitrate and hydrogen. During the chain of electron transfer, protons (H+) are transported outside the cytoplasmic membrane, generating a proton motive force. Upon passage of protons back into the cytoplasm, the PMF energy is captured as ATP, catalyzed by a multisubunit ATPase.
The cycle can start from Acetyl-CoA interacting with Oxalacetic acid and water through a citrate synthase monomer resulting in a hydrogen ion, CoA and a Citric Acid. The latter compound is dehydrated by a Citrate hydro-lyase resulting in the release of water and a cis-Aconitic acid. This compound is then hydrated through a Citrate hydro-lyase resulting in a D-threo-Isocitric acid. This compound is decarboxylated by an NADP dependent Citrate dehydrogenase, resulting in a release of carbon dioxide and NADPH and Oxoglutaric acid. The oxoglutaric acid interacts with a Coenzyme A through a NAD driven 2-oxoglutarate dehydrogenase resulting in a release of carbon dioxide, an NADH and succinyl-CoA. The succinyl-CoA interacts with a phosphate and an ADP through a 2-oxoglutarate dehydrogenase resulting in a CoA, an ATP and Succinic Acid. Succinic acid interacts with a ubiquinone, in this case a ubiquinone 1 through a succinate:quinone oxidoreductase resulting in an ubiquinol, in this case a ubiquinol-1 and a fumaric acid.
The fumaric acid interacts with water through a fumarase hydratase resulting in a L-Malic acid.This compound can either interact with quinone through a malate:quinone oxidoreductase resulting in a release of hydroquinone and oxalacetic acid, or it can react with an NAD through a malate dehydrogenase resulting in a hydrogen ion, NADH and Oxalacetic acid.</description>
      <pathwhiz_id>PW001006</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>TCA cycle (ubiquinol-7)</name>
      <description>The TCA pathway is a catabolic pathway of aerobic respiration. It generates energy and reducing power. It is the first step in generating precursors for biosynthesis. When acetate is the carbon source, citrate synthase is rate-limiting for the TCA cycle. Respiration is an ATP-generating process in which compounds act as electron donors through a chain of electron transfer to electron acceptors. Aerobic respiration uses oxygen as the final acceptor. Anaerobic respiration uses several organic compounds as acceptors such as fumarate, nitrate and hydrogen. During the chain of electron transfer, protons (H+) are transported outside the cytoplasmic membrane, generating a proton motive force. Upon passage of protons back into the cytoplasm, the PMF energy is captured as ATP, catalyzed by a multisubunit ATPase.
The cycle can start from Acetyl-CoA interacting with Oxalacetic acid and water through a citrate synthase monomer resulting in a hydrogen ion, CoA and a Citric Acid. The latter compound is dehydrated by a Citrate hydro-lyase resulting in the release of water and a cis-Aconitic acid. This compound is then hydrated through a Citrate hydro-lyase resulting in a D-threo-Isocitric acid. This compound is decarboxylated by an NADP dependent Citrate dehydrogenase, resulting in a release of carbon dioxide and NADPH and Oxoglutaric acid. The oxoglutaric acid interacts with a Coenzyme A through a NAD driven 2-oxoglutarate dehydrogenase resulting in a release of carbon dioxide, an NADH and succinyl-CoA. The succinyl-CoA interacts with a phosphate and an ADP through a 2-oxoglutarate dehydrogenase resulting in a CoA, an ATP and Succinic Acid. Succinic acid interacts with a ubiquinone, in this case a ubiquinone 1 through a succinate:quinone oxidoreductase resulting in an ubiquinol, in this case a ubiquinol-1 and a fumaric acid.
The fumaric acid interacts with water through a fumarase hydratase resulting in a L-Malic acid.This compound can either interact with quinone through a malate:quinone oxidoreductase resulting in a release of hydroquinone and oxalacetic acid, or it can react with an NAD through a malate dehydrogenase resulting in a hydrogen ion, NADH and Oxalacetic acid.</description>
      <pathwhiz_id>PW001007</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>TCA cycle (ubiquinol-8)</name>
      <description>The TCA pathway is a catabolic pathway of aerobic respiration. It generates energy and reducing power. It is the first step in generating precursors for biosynthesis. When acetate is the carbon source, citrate synthase is rate-limiting for the TCA cycle. Respiration is an ATP-generating process in which compounds act as electron donors through a chain of electron transfer to electron acceptors. Aerobic respiration uses oxygen as the final acceptor. Anaerobic respiration uses several organic compounds as acceptors such as fumarate, nitrate and hydrogen. During the chain of electron transfer, protons (H+) are transported outside the cytoplasmic membrane, generating a proton motive force. Upon passage of protons back into the cytoplasm, the PMF energy is captured as ATP, catalyzed by a multisubunit ATPase.
The cycle can start from Acetyl-CoA interacting with Oxalacetic acid and water through a citrate synthase monomer resulting in a hydrogen ion, CoA and a Citric Acid. The latter compound is dehydrated by a Citrate hydro-lyase resulting in the release of water and a cis-Aconitic acid. This compound is then hydrated through a Citrate hydro-lyase resulting in a D-threo-Isocitric acid. This compound is decarboxylated by an NADP dependent Citrate dehydrogenase, resulting in a release of carbon dioxide and NADPH and Oxoglutaric acid. The oxoglutaric acid interacts with a Coenzyme A through a NAD driven 2-oxoglutarate dehydrogenase resulting in a release of carbon dioxide, an NADH and succinyl-CoA. The succinyl-CoA interacts with a phosphate and an ADP through a 2-oxoglutarate dehydrogenase resulting in a CoA, an ATP and Succinic Acid. Succinic acid interacts with a ubiquinone, in this case a ubiquinone 1 through a succinate:quinone oxidoreductase resulting in an ubiquinol, in this case a ubiquinol-1 and a fumaric acid.
The fumaric acid interacts with water through a fumarase hydratase resulting in a L-Malic acid.This compound can either interact with quinone through a malate:quinone oxidoreductase resulting in a release of hydroquinone and oxalacetic acid, or it can react with an NAD through a malate dehydrogenase resulting in a hydrogen ion, NADH and Oxalacetic acid.</description>
      <pathwhiz_id>PW001008</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>TCA cycle (ubiquinol-9)</name>
      <description>The TCA pathway is a catabolic pathway of aerobic respiration. It generates energy and reducing power. It is the first step in generating precursors for biosynthesis. When acetate is the carbon source, citrate synthase is rate-limiting for the TCA cycle. Respiration is an ATP-generating process in which compounds act as electron donors through a chain of electron transfer to electron acceptors. Aerobic respiration uses oxygen as the final acceptor. Anaerobic respiration uses several organic compounds as acceptors such as fumarate, nitrate and hydrogen. During the chain of electron transfer, protons (H+) are transported outside the cytoplasmic membrane, generating a proton motive force. Upon passage of protons back into the cytoplasm, the PMF energy is captured as ATP, catalyzed by a multisubunit ATPase.
The cycle can start from Acetyl-CoA interacting with Oxalacetic acid and water through a citrate synthase monomer resulting in a hydrogen ion, CoA and a Citric Acid. The latter compound is dehydrated by a Citrate hydro-lyase resulting in the release of water and a cis-Aconitic acid. This compound is then hydrated through a Citrate hydro-lyase resulting in a D-threo-Isocitric acid. This compound is decarboxylated by an NADP dependent Citrate dehydrogenase, resulting in a release of carbon dioxide and NADPH and Oxoglutaric acid. The oxoglutaric acid interacts with a Coenzyme A through a NAD driven 2-oxoglutarate dehydrogenase resulting in a release of carbon dioxide, an NADH and succinyl-CoA. The succinyl-CoA interacts with a phosphate and an ADP through a 2-oxoglutarate dehydrogenase resulting in a CoA, an ATP and Succinic Acid. Succinic acid interacts with a ubiquinone, in this case a ubiquinone 1 through a succinate:quinone oxidoreductase resulting in an ubiquinol, in this case a ubiquinol-1 and a fumaric acid.
The fumaric acid interacts with water through a fumarase hydratase resulting in a L-Malic acid.This compound can either interact with quinone through a malate:quinone oxidoreductase resulting in a release of hydroquinone and oxalacetic acid, or it can react with an NAD through a malate dehydrogenase resulting in a hydrogen ion, NADH and Oxalacetic acid.</description>
      <pathwhiz_id>PW001009</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Vitamin B6 1430936196</name>
      <description/>
      <pathwhiz_id>PW000891</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>arginine metabolism</name>
      <description>The metabolism of L-arginine starts with the acetylation of L-glutamic acid resulting in a N-acetylglutamic acid while releasing a coenzyme A and a hydrogen ion. N-acetylglutamic acid is then phosphorylated via an ATP driven acetylglutamate kinase which yields a N-acetyl-L-glutamyl 5-phosphate. This compound undergoes a NDPH dependent reduction resulting in N-acetyl-L-glutamate 5-semialdehyde. This compound reacts with L-glutamic acid through a acetylornithine aminotransferase / N-succinyldiaminopimelate aminotransferase to produce  a N-acetylornithine which is then deacetylated through a acetylornithine deacetylase which yield an ornithine.
L-glutamine is used to synthesize carbamoyl phosphate through the interaction of L-glutamine, water, ATP, and hydrogen carbonate. This reaction yields ADP, L-glutamic acid, phosphate, and hydrogen ion. 
Carbamoyl phosphate and ornithine are used to catalyze the production of citrulline through an ornithine carbamoyltransferase. Citrulline reacts with L-aspartic acid through an ATP dependent enzyme, argininosuccinate synthase to produce pyrophosphate, AMP and argininosuccinic acid. Argininosussinic acid is then lyase to produce L-arginine and fumaric acid.
L-arginine can be metabolized into succinic acid by two different sets of reactions:
1. Arginine reacts with succinyl-CoA through a arginine N-succinyltransferase resulting in N2-succinyl-L-arginine while releasing CoA and Hydrogen Ion. N2-succinyl-L-arginine is then dihydrolase to produce a N2-succinyl-L-ornithine through a N-succinylarginine dihydrolase. This compound in turn reacts with oxoglutaric acid through succinylornithine transaminase resulting in L-glutamic acid and N2-succinyl-L-glutamic acid 5-semialdehyde. This compoud in turn reacts with a NAD dependent dehydrogenase resulting in N2-succinylglutamate while releasing NADH and hydrogen ion. N2-succinylglutamate reacts with water through a succinylglutamate desuccinylase resulting in  L-glutamic acid and 
a succinic acid. The succinic acid is then incorporated in the TCA cycle
2.Argine reacts with carbon dioxide and a hydrogen ion through a biodegradative arginine decarboxylase, resulting in Agmatine. This compound is then transformed into putrescine by reacting with water and an agmatinase, and releasing urea. Putrescine can be metabolized by reaction with either l-glutamic acid or oxoglutaric acid. If putrescine reacts with L-glutamic acid, it reacts through an ATP mediated gamma-glutamylputrescine producing a hydrogen ion, ADP, phosphate and gamma-glutamyl-L-putrescine. This compound is reduced by interacting with oxygen, water and a gamma-glutamylputrescine oxidoreductase resulting in ammonium, hydrogen peroxide and 4-gamma-glutamylamino butanal. This compound is dehydrogenated through a NADP mediated reaction  lead by gamma-glutamyl-gamma-aminobutaryaldehyde dehydrogenase resulting in  hydrogen ion, NADPH and 4-glutamylamino butanoate. In turn, the latter compound reacts with water through a gamma-glutamyl-gamma-aminobutyrate hydrolase resulting in L-glutamic acid and Gamma aminobutyric acid. On the other hand, if putrescine reacts with oxoglutaric acid through a putrescine aminotransferase, it results in L-glutamic acid, and a 4-aminobutyraldehyde. This compound reacts with water through a NAD dependent gamma aminobutyraldehyde dehydrogenase resulting in hydrogen ion, NADH and gamma-aminobutyric acid.
Gamma Aaminobutyric acid reacts with oxoglutaric acid through 4-aminobutyrate aminotransferase resulting in L-glutamic acid and succinic acid semialdehyde. This compound in turn can react with with either NADP  or NAD to result in the production of succinic acid through succinate-semialdehyde dehydrogenase or aldehyde dehydrogenase-like protein yneI respectively. Succinic acid can then be integrated in the TCA cycle. 
L-arginine is eventua lly metabolized into succinic acid which then goes to the TCA cycle</description>
      <pathwhiz_id>PW000790</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>colanic acid building blocks biosynthesis</name>
      <description>The colonic acid building blocks biosynthesis starts with a Beta-D-Glucose undergoing a transport reaction mediated by a glucose PTS permease. The permease phosphorylates the Beta-D-Glucose, producing a Beta-D-Glucose 6-phosphate. This compound can either change to an Alpha-D-Glucose 6-phosphate spontaneously or into a fructose 6-phosphate through a glucose-6-phosphate isomerase. The latter compound can also be present in E.coli through the interaction of D-fructose and a mannose PTS permease which phosphorylate the D-fructose. 
Fructose 6-phosphate interacts in a reversible reaction with mannose-6-phosphate isomerase in order to produce a Alpha-D-mannose 6-phosphate. This compound can also be present in E.coli through the interaction of Alpha-D-mannose and a mannose PTS permease which phosphorylates the alpha-D-mannose. Alpha-D-mannose 6-phosphate interacts in a reversible reaction with a phosphomannomutase to produce a alpha-D-mannose 1-phosphate. This compound in turn with a hydrogen ion and gtp undergoes a reaction with a mannose-1-phosphate guanylyltransferase, releasing a pyrophosphate and producing a guanosine diphosphate mannose. Guanosine diphosphate mannose interacts with gdp-mannose 4,6-dehydratase releasing a water, and gdp-4-dehydro-6-deoxy-D-mannose. This compound in turn with hydrogen ion and NADPH interact with GDP-L-fucose synthase releasing NADP and producing a GDP-L-fucose.
The Alpha-D-Glucose 6-phosphate interacts in a reversible reaction with phosphoglucomutase-1 to produce a alpha-D-glucose 1-phosphate. This in turn with UTP and hydrogen ion interact with UTP--glucose-1-phosphate uridyleltransferase releasing a pyrophosphate and UDP-glucose.
UDP-glucose can either interact with galactose-1-phosphate uridylyltransferase to produce a UDP-galactose or in turn with NAD and water interact with UDP-glucose 6-dehydrogenase releasing a NADH and a hydrogen ion and producing a UDP-glucuronate.
GDP-L-fucose, UDP-glucose, UDP-galactose and UDP-glucuronate are sugars that need to be activated in the form of nucleotide sugar prior to their assembly into colanic acid, also known as M antigen. 
Colanic acid is an extracellular polysaccharide which has been linked to a cluster of 19 genes(wca).
</description>
      <pathwhiz_id>PW000951</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>cysteine biosynthesis</name>
      <description>The pathway of cysteine biosynthesis is a two-step conversion starting from L-serine and yielding L-cysteine. L-serine biosynthesis is shown for context.
L-cysteine can also be synthesized from sulfate derivatives.
The process through L-serine involves a serine acetyltransferase that produces a O-acetylserine which reacts together with hydrogen sulfide through a cysteine synthase complex in order to produce L-cysteine and acetic acid.
Hydrogen sulfide is produced from a sulfate. Sulfate reacts with sulfate adenylyltransferase to produce adenosine phosphosulfate. This compound in turn is phosphorylated through a adenylyl-sulfate kinase into a phosphoadenosine phosphosulfate which in turn reacts with a phosphoadenosine phosphosulfate reductase to produce a sulfite. The sulfite reacts with a sulfite reductase to produce the hydrogen sulfide.
This pathway is regulated at the genetic level in its second step, wtih both cysteine synthase isozymes being under the positive control of the cysteine-responsive transcription factor CysB. It is also subject to very strong feedback inhibition of its first step by the final pathway product, cysteine.

Although two cysteine synthase isozymes exist, only cysteine synthase A (CysK) forms a complex with serine acetyltransferase. CysK is also the only one of the two cysteine synthases that is required for cell viability on cysteine-free medium.

Both steps in this pathway are reversible. Based on genetic and proteomic data, it appears that the cysteine synthases may actually act as a sulfur scavenging system during sulfur starvation, stripping sulfur off of L-cysteine, generating any number of variant amino acids in the process.</description>
      <pathwhiz_id>PW000800</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>dimethyl sulfoxide electron transfer</name>
      <description>The pathway can start in various spots. First step in this case starts with NADH interacting with a menaquinone oxidoreductase resulting in the release of a NADH and a hydrogen Ion, at the same time in the inner membrane a menaquinone interacts with 2 electrons and 2 hydrogen ions thus releasing a menaquinol. This allows for 4 hydrogen ions to be transferred from the cytosol to the periplasmic space. The menaquinol then interacts with a dimethyl sulfoxide reductase resulting in the release of 2 hydrogen ion and 2 electrons. At the same time dimethyl sulfoxide and 2 hydrogen ions interact with the enzyme resulting in the release of a dimethyl sulfide and a water molecule, this reaction happening in the periplasmic space.
The second set of reactions starts with a hydrogen interacting with a menaquinone oxidoreductase resulting in the release of two electrons being released into the inner membrane which then react with with 2 hydrogen ion and a menaquinone to produce a menaquinol. This menaquinol then reacts with a trimethylamine N-oxide reductase following the same steps as mentioned before.
The third set of reactions starts with with formate interacting with a formate dehydrogenase-O resulting in a release of carbon dioxide and a hydrogen ion, this releases 2 electrons that interact with a menaquinone and two hydrogen ions. This releases a menaquinol which then reacts with a trimethylamine N-oxide reductase following the same steps as mentioned before</description>
      <pathwhiz_id>PW001892</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>fatty acid elongation -- saturated</name>
      <description>This pathway shows the reactions that constitute one turn of a cycle that lengthens the chain of an acyl-ACP molecule by two carbons. The pathway is fed acetoacetyl-ACP, produces from malonyl acp, acetyl coa and 3-oxoacyl acp synthase 3. The products of multiple turns of this cycle that are drawn off to become components of fatty acid-containing compounds such as phospholipids, lipid A, and lipoproteins are the saturated fatty acids , lauric (dodecanoic), myristic (tetradecanoic), palmitic (hexadecanoic), and stearic (octadecanoic) acids. E. coli also contains unsaturated fatty acids. These are formed by a pathway that branches at the level of the 10-carbon intermediate. The final step of the cycle, the reductase, once thought to be catalyzed by two enzymes, has been shown to be catalyzed by a single enzyme, FabI, that can use either NADH or NADPH as a cofactor. However, the activity with NADH was over 17-fold higher than with NADPH, The production of acetoacetyl-acp is provided for context. Acetoacetyl-acp reacts spontaneously to produce a 3-oxoacyl acp. This compound will undergo the cycles of the elongation. 
The first step is converting the oxoacyl acp into  a (3R) 3-hydroxyacyl(acp) through a 3-oxoacyl[acp] reductase.This second step converts the hydroxyacyl into a trans 2 enoyl acp through a protein complex conformed of a hydroxomyristoyl dehydratase and a hydroxydecanoyl dehydratase. The third step can be reached through two different reactions with a enoyl-acp reductase, involving NADPH or NADH. This leads to the production of a 2,3,4-saturated fatty acyl acp. For the final step the 2,3,4 fatty acyl acp is turned into a oxoacyl acp through a 3-oxoacyl acp synthase protein complex. This concludes one cycle.</description>
      <pathwhiz_id>PW000798</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>fatty acid oxidation</name>
      <description>Although enzymes of the pathway handle both short and long chain fatty acids, it is the long chain compounds that induce the enzymes of the pathway . Each turn of the cycle removes two carbon atoms until only two or three remain. When even-numbered fatty acids are broken down, a two-carbon compound remains, acetyl-CoA. When odd number fatty acids are broken down, a three-carbon residue results, propionylCoA.  Unsaturated fatty acids, with cis double bonds located at odd-numbered carbon atoms, enter the main pathway of saturated fatty acid degradation by converting related metabolites of cis configuration and D stereoisomers, derived from breakdown of unsaturated fatty acids, to the trans- or L isomers of saturated fatty acid breakdown by an isomerase and an epimerase, respectively. When cis double bonds are located at even-numbered carbon atoms, such as linoleic acid (cis,cis(9,12)-octadecadienoic acid), after the fatty acid is degraded to the ten carbon stage an extra step is required to deal with the resulting compound, trans,δ(2)-cis,δ(4)decadienoyl-CoA. The enzyme 2,4-dienoyl-CoA reductase, converts this to trans,δ(2)decenoyl-CoA which enters the normal cycle at the point of the isomerase.

The order of the reaction is as follows:
a 2,3,4 saturated fatty acid is transformed into a 2,3,4 saturated fatty acyl CoA through a Long and short chain fatty acid CoA ligase. The 2,3,4 saturated fatty acyl CoA is then transformed into a trans 2 enoyl CoA. This enoyl can also be produced from a cis 3 enoyl CoA through a fatty acid oxidation protein complex. The trans 2 enoyl is transformed into a 3s 3 hydroxyacyl CoA through a 2,3 dehydroadipyl CoA hydratase. This same enzyme turns the product into a 3-oxoacyl-CoA. This is followed by the last step in the reaction when the oxoacyl-coa is turn into an acetyl coa+ a 2,3,4 saturated fatty acyl CoA through a 3-ketoacyl-CoA thiolase</description>
      <pathwhiz_id>PW000758</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>fatty acid oxidation (Butanoate)</name>
      <description>Although enzymes of the pathway handle both short and long chain fatty acids, it is the long chain compounds that induce the enzymes of the pathway . Each turn of the cycle removes two carbon atoms until only two or three remain. When even-numbered fatty acids are broken down, a two-carbon compound remains, acetyl-CoA. When odd number fatty acids are broken down, a three-carbon residue results, propionylCoA.  Unsaturated fatty acids, with cis double bonds located at odd-numbered carbon atoms, enter the main pathway of saturated fatty acid degradation by converting related metabolites of cis configuration and D stereoisomers, derived from breakdown of unsaturated fatty acids, to the trans- or L isomers of saturated fatty acid breakdown by an isomerase and an epimerase, respectively. When cis double bonds are located at even-numbered carbon atoms, such as linoleic acid (cis,cis(9,12)-octadecadienoic acid), after the fatty acid is degraded to the ten carbon stage an extra step is required to deal with the resulting compound, trans,δ(2)-cis,δ(4)decadienoyl-CoA. The enzyme 2,4-dienoyl-CoA reductase, converts this to trans,δ(2)decenoyl-CoA which enters the normal cycle at the point of the isomerase.

The order of the reaction is as follows:
a 2,3,4 saturated fatty acid is transformed into a 2,3,4 saturated fatty acyl CoA through a Long and short chain fatty acid CoA ligase. The 2,3,4 saturated fatty acyl CoA is then transformed into a trans 2 enoyl CoA. This enoyl can also be produced from a cis 3 enoyl CoA through a fatty acid oxidation protein complex. The trans 2 enoyl is transformed into a 3s 3 hydroxyacyl CoA through a 2,3 dehydroadipyl CoA hydratase. This same enzyme turns the product into a 3-oxoacyl-CoA. This is followed by the last step in the reaction when the oxoacyl-coa is turn into an acetyl coa+ a 2,3,4 saturated fatty acyl CoA through a 3-ketoacyl-CoA thiolase</description>
      <pathwhiz_id>PW001017</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>fatty acid oxidation (Decanoate)</name>
      <description>Although enzymes of the pathway handle both short and long chain fatty acids, it is the long chain compounds that induce the enzymes of the pathway . Each turn of the cycle removes two carbon atoms until only two or three remain. When even-numbered fatty acids are broken down, a two-carbon compound remains, acetyl-CoA. When odd number fatty acids are broken down, a three-carbon residue results, propionylCoA.  Unsaturated fatty acids, with cis double bonds located at odd-numbered carbon atoms, enter the main pathway of saturated fatty acid degradation by converting related metabolites of cis configuration and D stereoisomers, derived from breakdown of unsaturated fatty acids, to the trans- or L isomers of saturated fatty acid breakdown by an isomerase and an epimerase, respectively. When cis double bonds are located at even-numbered carbon atoms, such as linoleic acid (cis,cis(9,12)-octadecadienoic acid), after the fatty acid is degraded to the ten carbon stage an extra step is required to deal with the resulting compound, trans,δ(2)-cis,δ(4)decadienoyl-CoA. The enzyme 2,4-dienoyl-CoA reductase, converts this to trans,δ(2)decenoyl-CoA which enters the normal cycle at the point of the isomerase.

The order of the reaction is as follows:
a 2,3,4 saturated fatty acid is transformed into a 2,3,4 saturated fatty acyl CoA through a Long and short chain fatty acid CoA ligase. The 2,3,4 saturated fatty acyl CoA is then transformed into a trans 2 enoyl CoA. This enoyl can also be produced from a cis 3 enoyl CoA through a fatty acid oxidation protein complex. The trans 2 enoyl is transformed into a 3s 3 hydroxyacyl CoA through a 2,3 dehydroadipyl CoA hydratase. This same enzyme turns the product into a 3-oxoacyl-CoA. This is followed by the last step in the reaction when the oxoacyl-coa is turn into an acetyl coa+ a 2,3,4 saturated fatty acyl CoA through a 3-ketoacyl-CoA thiolase</description>
      <pathwhiz_id>PW001018</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>fatty acid oxidation (hexanoate)</name>
      <description>Although enzymes of the pathway handle both short and long chain fatty acids, it is the long chain compounds that induce the enzymes of the pathway . Each turn of the cycle removes two carbon atoms until only two or three remain. When even-numbered fatty acids are broken down, a two-carbon compound remains, acetyl-CoA. When odd number fatty acids are broken down, a three-carbon residue results, propionylCoA.  Unsaturated fatty acids, with cis double bonds located at odd-numbered carbon atoms, enter the main pathway of saturated fatty acid degradation by converting related metabolites of cis configuration and D stereoisomers, derived from breakdown of unsaturated fatty acids, to the trans- or L isomers of saturated fatty acid breakdown by an isomerase and an epimerase, respectively. When cis double bonds are located at even-numbered carbon atoms, such as linoleic acid (cis,cis(9,12)-octadecadienoic acid), after the fatty acid is degraded to the ten carbon stage an extra step is required to deal with the resulting compound, trans,δ(2)-cis,δ(4)decadienoyl-CoA. The enzyme 2,4-dienoyl-CoA reductase, converts this to trans,δ(2)decenoyl-CoA which enters the normal cycle at the point of the isomerase.

The order of the reaction is as follows:
a 2,3,4 saturated fatty acid is transformed into a 2,3,4 saturated fatty acyl CoA through a Long and short chain fatty acid CoA ligase. The 2,3,4 saturated fatty acyl CoA is then transformed into a trans 2 enoyl CoA. This enoyl can also be produced from a cis 3 enoyl CoA through a fatty acid oxidation protein complex. The trans 2 enoyl is transformed into a 3s 3 hydroxyacyl CoA through a 2,3 dehydroadipyl CoA hydratase. This same enzyme turns the product into a 3-oxoacyl-CoA. This is followed by the last step in the reaction when the oxoacyl-coa is turn into an acetyl coa+ a 2,3,4 saturated fatty acyl CoA through a 3-ketoacyl-CoA thiolase</description>
      <pathwhiz_id>PW001019</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>fatty acid oxidation (laurate)</name>
      <description>Although enzymes of the pathway handle both short and long chain fatty acids, it is the long chain compounds that induce the enzymes of the pathway . Each turn of the cycle removes two carbon atoms until only two or three remain. When even-numbered fatty acids are broken down, a two-carbon compound remains, acetyl-CoA. When odd number fatty acids are broken down, a three-carbon residue results, propionylCoA.  Unsaturated fatty acids, with cis double bonds located at odd-numbered carbon atoms, enter the main pathway of saturated fatty acid degradation by converting related metabolites of cis configuration and D stereoisomers, derived from breakdown of unsaturated fatty acids, to the trans- or L isomers of saturated fatty acid breakdown by an isomerase and an epimerase, respectively. When cis double bonds are located at even-numbered carbon atoms, such as linoleic acid (cis,cis(9,12)-octadecadienoic acid), after the fatty acid is degraded to the ten carbon stage an extra step is required to deal with the resulting compound, trans,δ(2)-cis,δ(4)decadienoyl-CoA. The enzyme 2,4-dienoyl-CoA reductase, converts this to trans,δ(2)decenoyl-CoA which enters the normal cycle at the point of the isomerase.

The order of the reaction is as follows:
a 2,3,4 saturated fatty acid is transformed into a 2,3,4 saturated fatty acyl CoA through a Long and short chain fatty acid CoA ligase. The 2,3,4 saturated fatty acyl CoA is then transformed into a trans 2 enoyl CoA. This enoyl can also be produced from a cis 3 enoyl CoA through a fatty acid oxidation protein complex. The trans 2 enoyl is transformed into a 3s 3 hydroxyacyl CoA through a 2,3 dehydroadipyl CoA hydratase. This same enzyme turns the product into a 3-oxoacyl-CoA. This is followed by the last step in the reaction when the oxoacyl-coa is turn into an acetyl coa+ a 2,3,4 saturated fatty acyl CoA through a 3-ketoacyl-CoA thiolase</description>
      <pathwhiz_id>PW001020</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>fatty acid oxidation (myristate)</name>
      <description>Although enzymes of the pathway handle both short and long chain fatty acids, it is the long chain compounds that induce the enzymes of the pathway . Each turn of the cycle removes two carbon atoms until only two or three remain. When even-numbered fatty acids are broken down, a two-carbon compound remains, acetyl-CoA. When odd number fatty acids are broken down, a three-carbon residue results, propionylCoA.  Unsaturated fatty acids, with cis double bonds located at odd-numbered carbon atoms, enter the main pathway of saturated fatty acid degradation by converting related metabolites of cis configuration and D stereoisomers, derived from breakdown of unsaturated fatty acids, to the trans- or L isomers of saturated fatty acid breakdown by an isomerase and an epimerase, respectively. When cis double bonds are located at even-numbered carbon atoms, such as linoleic acid (cis,cis(9,12)-octadecadienoic acid), after the fatty acid is degraded to the ten carbon stage an extra step is required to deal with the resulting compound, trans,δ(2)-cis,δ(4)decadienoyl-CoA. The enzyme 2,4-dienoyl-CoA reductase, converts this to trans,δ(2)decenoyl-CoA which enters the normal cycle at the point of the isomerase.

The order of the reaction is as follows:
a 2,3,4 saturated fatty acid is transformed into a 2,3,4 saturated fatty acyl CoA through a Long and short chain fatty acid CoA ligase. The 2,3,4 saturated fatty acyl CoA is then transformed into a trans 2 enoyl CoA. This enoyl can also be produced from a cis 3 enoyl CoA through a fatty acid oxidation protein complex. The trans 2 enoyl is transformed into a 3s 3 hydroxyacyl CoA through a 2,3 dehydroadipyl CoA hydratase. This same enzyme turns the product into a 3-oxoacyl-CoA. This is followed by the last step in the reaction when the oxoacyl-coa is turn into an acetyl coa+ a 2,3,4 saturated fatty acyl CoA through a 3-ketoacyl-CoA thiolase</description>
      <pathwhiz_id>PW001021</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>fatty acid oxidation (octanoate)</name>
      <description>Although enzymes of the pathway handle both short and long chain fatty acids, it is the long chain compounds that induce the enzymes of the pathway . Each turn of the cycle removes two carbon atoms until only two or three remain. When even-numbered fatty acids are broken down, a two-carbon compound remains, acetyl-CoA. When odd number fatty acids are broken down, a three-carbon residue results, propionylCoA.  Unsaturated fatty acids, with cis double bonds located at odd-numbered carbon atoms, enter the main pathway of saturated fatty acid degradation by converting related metabolites of cis configuration and D stereoisomers, derived from breakdown of unsaturated fatty acids, to the trans- or L isomers of saturated fatty acid breakdown by an isomerase and an epimerase, respectively. When cis double bonds are located at even-numbered carbon atoms, such as linoleic acid (cis,cis(9,12)-octadecadienoic acid), after the fatty acid is degraded to the ten carbon stage an extra step is required to deal with the resulting compound, trans,δ(2)-cis,δ(4)decadienoyl-CoA. The enzyme 2,4-dienoyl-CoA reductase, converts this to trans,δ(2)decenoyl-CoA which enters the normal cycle at the point of the isomerase.

The order of the reaction is as follows:
a 2,3,4 saturated fatty acid is transformed into a 2,3,4 saturated fatty acyl CoA through a Long and short chain fatty acid CoA ligase. The 2,3,4 saturated fatty acyl CoA is then transformed into a trans 2 enoyl CoA. This enoyl can also be produced from a cis 3 enoyl CoA through a fatty acid oxidation protein complex. The trans 2 enoyl is transformed into a 3s 3 hydroxyacyl CoA through a 2,3 dehydroadipyl CoA hydratase. This same enzyme turns the product into a 3-oxoacyl-CoA. This is followed by the last step in the reaction when the oxoacyl-coa is turn into an acetyl coa+ a 2,3,4 saturated fatty acyl CoA through a 3-ketoacyl-CoA thiolase</description>
      <pathwhiz_id>PW001022</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>fatty acid oxidation (palmitate)</name>
      <description>Although enzymes of the pathway handle both short and long chain fatty acids, it is the long chain compounds that induce the enzymes of the pathway . Each turn of the cycle removes two carbon atoms until only two or three remain. When even-numbered fatty acids are broken down, a two-carbon compound remains, acetyl-CoA. When odd number fatty acids are broken down, a three-carbon residue results, propionylCoA.  Unsaturated fatty acids, with cis double bonds located at odd-numbered carbon atoms, enter the main pathway of saturated fatty acid degradation by converting related metabolites of cis configuration and D stereoisomers, derived from breakdown of unsaturated fatty acids, to the trans- or L isomers of saturated fatty acid breakdown by an isomerase and an epimerase, respectively. When cis double bonds are located at even-numbered carbon atoms, such as linoleic acid (cis,cis(9,12)-octadecadienoic acid), after the fatty acid is degraded to the ten carbon stage an extra step is required to deal with the resulting compound, trans,δ(2)-cis,δ(4)decadienoyl-CoA. The enzyme 2,4-dienoyl-CoA reductase, converts this to trans,δ(2)decenoyl-CoA which enters the normal cycle at the point of the isomerase.

The order of the reaction is as follows:
a 2,3,4 saturated fatty acid is transformed into a 2,3,4 saturated fatty acyl CoA through a Long and short chain fatty acid CoA ligase. The 2,3,4 saturated fatty acyl CoA is then transformed into a trans 2 enoyl CoA. This enoyl can also be produced from a cis 3 enoyl CoA through a fatty acid oxidation protein complex. The trans 2 enoyl is transformed into a 3s 3 hydroxyacyl CoA through a 2,3 dehydroadipyl CoA hydratase. This same enzyme turns the product into a 3-oxoacyl-CoA. This is followed by the last step in the reaction when the oxoacyl-coa is turn into an acetyl coa+ a 2,3,4 saturated fatty acyl CoA through a 3-ketoacyl-CoA thiolase</description>
      <pathwhiz_id>PW001023</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>fatty acid oxidation (steareate)</name>
      <description>Although enzymes of the pathway handle both short and long chain fatty acids, it is the long chain compounds that induce the enzymes of the pathway . Each turn of the cycle removes two carbon atoms until only two or three remain. When even-numbered fatty acids are broken down, a two-carbon compound remains, acetyl-CoA. When odd number fatty acids are broken down, a three-carbon residue results, propionylCoA.  Unsaturated fatty acids, with cis double bonds located at odd-numbered carbon atoms, enter the main pathway of saturated fatty acid degradation by converting related metabolites of cis configuration and D stereoisomers, derived from breakdown of unsaturated fatty acids, to the trans- or L isomers of saturated fatty acid breakdown by an isomerase and an epimerase, respectively. When cis double bonds are located at even-numbered carbon atoms, such as linoleic acid (cis,cis(9,12)-octadecadienoic acid), after the fatty acid is degraded to the ten carbon stage an extra step is required to deal with the resulting compound, trans,δ(2)-cis,δ(4)decadienoyl-CoA. The enzyme 2,4-dienoyl-CoA reductase, converts this to trans,δ(2)decenoyl-CoA which enters the normal cycle at the point of the isomerase.

The order of the reaction is as follows:
a 2,3,4 saturated fatty acid is transformed into a 2,3,4 saturated fatty acyl CoA through a Long and short chain fatty acid CoA ligase. The 2,3,4 saturated fatty acyl CoA is then transformed into a trans 2 enoyl CoA. This enoyl can also be produced from a cis 3 enoyl CoA through a fatty acid oxidation protein complex. The trans 2 enoyl is transformed into a 3s 3 hydroxyacyl CoA through a 2,3 dehydroadipyl CoA hydratase. This same enzyme turns the product into a 3-oxoacyl-CoA. This is followed by the last step in the reaction when the oxoacyl-coa is turn into an acetyl coa+ a 2,3,4 saturated fatty acyl CoA through a 3-ketoacyl-CoA thiolase</description>
      <pathwhiz_id>PW001024</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>fructose metabolism</name>
      <description>Fructose metabolism begins with the transport of Beta-D-fructofuranose through a fructose PTS permease, resulting in a Beta-D-fructofuranose 1-phosphate. This compound is phosphorylated by an ATP driven 1-phosphofructokinase resulting in a fructose 1,6-biphosphate. This compound can either react with a fructose bisphosphate aldolase class 1 resulting in D-glyceraldehyde 3-phosphate and a dihydroxyacetone phosphate or through a fructose biphosphate aldolase class 2 resulting in a D-glyceraldehyde 3-phosphate. This compound can then either react in a reversible triosephosphate isomerase resulting in a dihydroxyacetone phosphate or react with a phosphate through a NAD dependent Glyceraldehyde 3-phosphate dehydrogenase resulting in a glyceric acid 1,3-biphosphate. This compound is desphosphorylated by a phosphoglycerate kinase resulting in a 3-phosphoglyceric acid.This compound in turn can either react with a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase or a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase resulting in a 2-phospho-D-glyceric acid. This compound interacts with an enolase resulting in a phosphoenolpyruvic acid and water. Phosphoenolpyruvic acid can react either through a AMP driven phosphoenoylpyruvate synthase or a ADP driven pyruvate kinase protein complex resulting in a pyruvic acid.
Pyruvic acid reacts with CoA through a NAD driven pyruvate dehydrogenase complex resulting in a carbon dioxide and a Acetyl-CoA which gets incorporated into the TCA cycle pathway.






















































</description>
      <pathwhiz_id>PW000913</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>fucose and rhamnose degradation</name>
      <description>In E. coli, L-fucose and L-rhamnose are metabolized through parallel pathways. The pathways converge after their corresponding aldolase reactions yielding the same products: lactaldehye. Via reactions catalyzed by proteins encoded in linked operons comprising a regulon, the methylpentose, alpha-L-rhamnopyranose and/or beta-L-rhamnopyranose, is taken into the cell through a proton symporter and metabolized, enabling E. coli to grow on it as a total source of carbon and energy. 
For alpha-L-rhamnopyranose, it is isomerized by a l-rhamnose mutarotase resulting in a beta-L-rhamnopyranose which is then isomerized into a keto-L-rhamnulose by a l-rhamnose isomerase. The keto-L-rhamnulose spontaneously changes into a L-rhamnulofuranose which is phosphorylated by a rhamnulokinase resulting in a L-rhamnulose 1-phosphate. This compound reacts  with a rhamnulose-1-phosphate aldolase resulting in a dihydroxyacetone phosphate and a lactaldehyde.
For beta-L-rhamnopyranose, it is isomerized by a L-fucose mutarotase resulting in a alpha-L-fucopyranose. This compound is then isomerized by an L-fucose isomerase resulting in a L-fuculose which in turn gets phosphorylated into an L-fuculose 1-phosphate through an L-fuculokinase.  The compound L-fuculose 1-phosphate reacts with an L-fuculose phosphate aldolase through a dihydroxyacetone phosphate and a lactaldehyde.
Two pathways can be used for degradation of L-lactaldehyde. Aerobically, it is converted via lactate to pyruvate, also an intermediate of glycolysis. Anaerobically, lactaldehyde reductase is induced which converts lactaldehyde into propane-1,2-diol. Under aerobic conditions, L-lactaldehyde is oxidized in two steps to pyruvate, thereby channeling all the carbons from fucose or rhamnose into central metabolic pathways. Under anaerobic conditions, L-lactaldehyde is reduced to L-1,2-propanediol, which is secreted into the environment.







</description>
      <pathwhiz_id>PW000826</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>glycerol metabolism</name>
      <description>Glycerol metabolism  starts with glycerol is introduced into the cytoplasm through a glycerol channel GlpF Glycerol is then phosphorylated through an ATP mediated glycerol kinase resulting in a Glycerol 3-phosphate. This compound can also be obtained through a glycerophosphodiester reacting with water through a glycerophosphoryl diester phosphodiesterase or it can also be introduced into the cytoplasm through a glycerol-3-phosphate:phosphate antiporter. 
Glycerol 3-phosphate is then metabolized into a dihydroxyacetone phosphate in both aerobic or anaerobic conditions. In anaerobic conditions the metabolism is done through the reaction of glycerol 3-phosphate with a menaquinone mediated by a glycerol-3-phosphate dehydrogenase protein complex. In aerobic conditions, the metabolism is done through the reaction of glycerol 3-phosphate with ubiquinone mediated by a  glycerol-3-phosphate dehydrogenase [NAD(P]+].
Dihydroxyacetone phosphate is then introduced into the fructose metabolism by turning a dihydroxyacetone into an isomer through a triosephosphate isomerase resulting in a D-glyceraldehyde 3-phosphate which in turn reacts with a phosphate through a NAD dependent Glyceraldehyde 3-phosphate dehydrogenase resulting in a glyceric acid 1,3-biphosphate. This compound is desphosphorylated by a phosphoglycerate kinase resulting in a 3-phosphoglyceric acid.This compound in turn can either react with a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase or a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase resulting in a 2-phospho-D-glyceric acid. This compound interacts with an enolase resulting in a phosphoenolpyruvic acid and water. Phosphoenolpyruvic acid can react either through a AMP driven phosphoenoylpyruvate synthase or a ADP driven pyruvate kinase protein complex resulting in a pyruvic acid. Pyruvic acid reacts with CoA through a NAD driven pyruvate dehydrogenase complex resulting in a carbon dioxide and a Acetyl-CoA which gets incorporated into the TCA cycle pathway.</description>
      <pathwhiz_id>PW000914</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>glycerol metabolism II</name>
      <description>Glycerol metabolism starts with glycerol is introduced into the cytoplasm through a glycerol channel GlpF Glycerol is then phosphorylated through an ATP mediated glycerol kinase resulting in a Glycerol 3-phosphate. This compound can also be obtained through sn-glycero-3-phosphocholine reacting with water through a glycerophosphoryl diester phosphodiesterase  producing a benzyl alcohol, a hydrogen ion and a glycerol 3-phosphate or  the campound can be introduced into the cytoplasm through a glycerol-3-phosphate:phosphate antiporter. Glycerol 3-phosphate is then metabolized into a dihydroxyacetone phosphate in both aerobic or anaerobic conditions. In anaerobic conditions the metabolism is done through the reaction of glycerol 3-phosphate with a menaquinone mediated by a glycerol-3-phosphate dehydrogenase protein complex. In aerobic conditions, the metabolism is done through the reaction of glycerol 3-phosphate with ubiquinone mediated by a glycerol-3-phosphate dehydrogenase [NAD(P]+]. Dihydroxyacetone phosphate is then introduced into the fructose metabolism by turning a dihydroxyacetone into an isomer through a triosephosphate isomerase resulting in a D-glyceraldehyde 3-phosphate which in turn reacts with a phosphate through a NAD dependent Glyceraldehyde 3-phosphate dehydrogenase resulting in a glyceric acid 1,3-biphosphate. This compound is desphosphorylated by a phosphoglycerate kinase resulting in a 3-phosphoglyceric acid.This compound in turn can either react with a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase or a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase resulting in a 2-phospho-D-glyceric acid. This compound interacts with an enolase resulting in a phosphoenolpyruvic acid and water. Phosphoenolpyruvic acid can react either through a AMP driven phosphoenoylpyruvate synthase or a ADP driven pyruvate kinase protein complex resulting in a pyruvic acid. Pyruvic acid reacts with CoA through a NAD driven pyruvate dehydrogenase complex resulting in a carbon dioxide and a Acetyl-CoA which gets incorporated into the TCA cycle pathway.</description>
      <pathwhiz_id>PW000915</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>glycerol metabolism III (sn-glycero-3-phosphoethanolamine)</name>
      <description>Glycerol metabolism starts with glycerol is introduced into the cytoplasm through a glycerol channel GlpF Glycerol is then phosphorylated through an ATP mediated glycerol kinase resulting in a Glycerol 3-phosphate. This compound can also be obtained through sn-glycero-3-phosphethanolamine reacting with water through a glycerophosphoryl diester phosphodiesterase producing a benzyl alcohol, a hydrogen ion and a glycerol 3-phosphate or the campound can be introduced into the cytoplasm through a glycerol-3-phosphate:phosphate antiporter. Glycerol 3-phosphate is then metabolized into a dihydroxyacetone phosphate in both aerobic or anaerobic conditions. In anaerobic conditions the metabolism is done through the reaction of glycerol 3-phosphate with a menaquinone mediated by a glycerol-3-phosphate dehydrogenase protein complex. In aerobic conditions, the metabolism is done through the reaction of glycerol 3-phosphate with ubiquinone mediated by a glycerol-3-phosphate dehydrogenase [NAD(P]+]. Dihydroxyacetone phosphate is then introduced into the fructose metabolism by turning a dihydroxyacetone into an isomer through a triosephosphate isomerase resulting in a D-glyceraldehyde 3-phosphate which in turn reacts with a phosphate through a NAD dependent Glyceraldehyde 3-phosphate dehydrogenase resulting in a glyceric acid 1,3-biphosphate. This compound is desphosphorylated by a phosphoglycerate kinase resulting in a 3-phosphoglyceric acid.This compound in turn can either react with a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase or a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase resulting in a 2-phospho-D-glyceric acid. This compound interacts with an enolase resulting in a phosphoenolpyruvic acid and water. Phosphoenolpyruvic acid can react either through a AMP driven phosphoenoylpyruvate synthase or a ADP driven pyruvate kinase protein complex resulting in a pyruvic acid. Pyruvic acid reacts with CoA through a NAD driven pyruvate dehydrogenase complex resulting in a carbon dioxide and a Acetyl-CoA which gets incorporated into the TCA cycle pathway.</description>
      <pathwhiz_id>PW000916</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>glycerol metabolism IV (glycerophosphoglycerol)</name>
      <description>Glycerol metabolism starts with glycerol is introduced into the cytoplasm through a glycerol channel GlpF Glycerol is then phosphorylated through an ATP mediated glycerol kinase resulting in a Glycerol 3-phosphate. This compound can also be obtained through glycerophosphoglycerol reacting with water through a glycerophosphoryl diester phosphodiesterase producing a benzyl alcohol, a hydrogen ion and a glycerol 3-phosphate or the campound can be introduced into the cytoplasm through a glycerol-3-phosphate:phosphate antiporter. Glycerol 3-phosphate is then metabolized into a dihydroxyacetone phosphate in both aerobic or anaerobic conditions. In anaerobic conditions the metabolism is done through the reaction of glycerol 3-phosphate with a menaquinone mediated by a glycerol-3-phosphate dehydrogenase protein complex. In aerobic conditions, the metabolism is done through the reaction of glycerol 3-phosphate with ubiquinone mediated by a glycerol-3-phosphate dehydrogenase [NAD(P]+]. Dihydroxyacetone phosphate is then introduced into the fructose metabolism by turning a dihydroxyacetone into an isomer through a triosephosphate isomerase resulting in a D-glyceraldehyde 3-phosphate which in turn reacts with a phosphate through a NAD dependent Glyceraldehyde 3-phosphate dehydrogenase resulting in a glyceric acid 1,3-biphosphate. This compound is desphosphorylated by a phosphoglycerate kinase resulting in a 3-phosphoglyceric acid.This compound in turn can either react with a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase or a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase resulting in a 2-phospho-D-glyceric acid. This compound interacts with an enolase resulting in a phosphoenolpyruvic acid and water. Phosphoenolpyruvic acid can react either through a AMP driven phosphoenoylpyruvate synthase or a ADP driven pyruvate kinase protein complex resulting in a pyruvic acid. Pyruvic acid reacts with CoA through a NAD driven pyruvate dehydrogenase complex resulting in a carbon dioxide and a Acetyl-CoA which gets incorporated into the TCA cycle pathway.</description>
      <pathwhiz_id>PW000917</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>glycerol metabolism V (glycerophosphoserine)</name>
      <description>Glycerol metabolism starts with glycerol is introduced into the cytoplasm through a glycerol channel GlpF Glycerol is then phosphorylated through an ATP mediated glycerol kinase resulting in a Glycerol 3-phosphate. This compound can also be obtained through glycerophosphoserine reacting with water through a glycerophosphoryl diester phosphodiesterase producing a benzyl alcohol, a hydrogen ion and a glycerol 3-phosphate or the campound can be introduced into the cytoplasm through a glycerol-3-phosphate:phosphate antiporter. Glycerol 3-phosphate is then metabolized into a dihydroxyacetone phosphate in both aerobic or anaerobic conditions. In anaerobic conditions the metabolism is done through the reaction of glycerol 3-phosphate with a menaquinone mediated by a glycerol-3-phosphate dehydrogenase protein complex. In aerobic conditions, the metabolism is done through the reaction of glycerol 3-phosphate with ubiquinone mediated by a glycerol-3-phosphate dehydrogenase [NAD(P]+]. Dihydroxyacetone phosphate is then introduced into the fructose metabolism by turning a dihydroxyacetone into an isomer through a triosephosphate isomerase resulting in a D-glyceraldehyde 3-phosphate which in turn reacts with a phosphate through a NAD dependent Glyceraldehyde 3-phosphate dehydrogenase resulting in a glyceric acid 1,3-biphosphate. This compound is desphosphorylated by a phosphoglycerate kinase resulting in a 3-phosphoglyceric acid.This compound in turn can either react with a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase or a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase resulting in a 2-phospho-D-glyceric acid. This compound interacts with an enolase resulting in a phosphoenolpyruvic acid and water. Phosphoenolpyruvic acid can react either through a AMP driven phosphoenoylpyruvate synthase or a ADP driven pyruvate kinase protein complex resulting in a pyruvic acid. Pyruvic acid reacts with CoA through a NAD driven pyruvate dehydrogenase complex resulting in a carbon dioxide and a Acetyl-CoA which gets incorporated into the TCA cycle pathway.</description>
      <pathwhiz_id>PW000918</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>glycolate and glyoxylate degradation</name>
      <description>Glycolic acid is introduced into the cytoplasm through either a glycolate / lactate:H+ symporter or a acetate / glycolate transporter. Once inside, glycolic acid reacts with an oxidized electron-transfer flavoprotein through a glycolate oxidase resulting in a reduced acceptor and glyoxylic acid. Glyoxylic acid can also be obtained from the introduction of glyoxylic acid. It can also be obtained from the metabolism of (S)-allantoin.
S-allantoin is introduced into the cytoplasm through a purine and pyrimidine transporter(allantoin specific). Once inside, the compound reacts with water through a allantoinase resulting in hydrogen ion and allantoic acid. Allantoic acid then reacts with water and hydrogen ion through a allantoate amidohydrolase resulting in a carbon dioxide, ammonium and S-ureidoglycine. The latter compound reacts with water through a S-ureidoglycine aminohydrolase resulting in ammonium and S-ureidoglycolic acid which in turn reacts with a Ureidoglycolate lyase resulting in urea and glyoxylic acid.
 Glyoxylic acid can either be metabolized into L-malic acid by a reaction with acetyl-CoA and Water through a malate synthase G which also releases hydrogen ion and Coenzyme A. L-malic acid is then incorporated into the TCA cycle.
Glyoxylic acid can also be metabolized by glyoxylate carboligase, releasing a carbon dioxide and tartronate semialdehyde. The latter compound is then reduced by an NADH driven tartronate semialdehyde reductase 2 resulting in glyceric acid. Glyceric acid is phosphorylated by a glycerate kinase 2 resulting in a 3-phosphoglyceric acid. This compound is then integrated into various other pathways: cysteine biosynthesis, serine biosynthesis and glycolysis and pyruvate dehydrogenase.


</description>
      <pathwhiz_id>PW000827</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>glycolysis and pyruvate dehydrogenase</name>
      <description>Fructose metabolism begins with the transport of Beta-D-glucose 6-phosphate through a glucose PTS permease, resulting in a Beta-D-glucose 6-phosphate. This compound is isomerized by a glucose-6-phosphate isomerase resulting in a fructose 6-phosphate. This compound can be phosphorylated by two different enzymes, a pyridoxal phosphatase/fructose 1,6-bisphosphatase or a ATP driven-6-phosphofructokinase-1 resulting in a fructose 1,6-biphosphate. This compound can either react with a fructose bisphosphate aldolase class 1 resulting in D-glyceraldehyde 3-phosphate and a dihydroxyacetone phosphate or through a fructose biphosphate aldolase class 2 resulting in a D-glyceraldehyde 3-phosphate. This compound can then either react in a reversible triosephosphate isomerase resulting in a dihydroxyacetone phosphate or react with a phosphate through a NAD dependent Glyceraldehyde 3-phosphate dehydrogenase resulting in a glyceric acid 1,3-biphosphate. This compound is desphosphorylated by a phosphoglycerate kinase resulting in a 3-phosphoglyceric acid.This compound in turn can either react with a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase or a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase resulting in a 2-phospho-D-glyceric acid. This compound interacts with an enolase resulting in a phosphoenolpyruvic acid and water. Phosphoenolpyruvic acid can react either through a AMP driven phosphoenoylpyruvate synthase or a ADP driven pyruvate kinase protein complex resulting in a pyruvic acid.
Pyruvic acid reacts with CoA through a NAD driven pyruvate dehydrogenase complex resulting in a carbon dioxide and a Acetyl-CoA which gets incorporated into the TCA cycle pathway.


</description>
      <pathwhiz_id>PW000785</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>hexuronide and hexuronate degradation</name>
      <description>E. coli can use β-D-glucuronosides, D-glucuronate and D-fructuronate as an only sources of carbon for growth.
β-D-glucuronosides are detoxification products that are excreted into the mammalian gut in the bile. They enter E.coli through an outer membrane protein called gusC. Once in the periplasmic space it is transported through a hydrogen symporter into the cytoplasm.
Once inside the cytoplasm, the initial step in the degradation of β-glucuronides is hydrolysis by β-D-glucuronidase to yield D-glucuronate. This is then isomerized to D-fructuronate by D-glucuronate isomerase. D-fructuronate then undergoes an NADH-dependent reduction to D-mannonate by D-mannonate oxidoreductase. D-mannonate dehydratase subsequently catalyzes dehydration to yield 2-dehydro-3-deoxy-D-gluconate. At this point, a common enzyme, 2-keto-3-deoxygluconokinase, phosphorylates 2-dehydro-3-deoxy-D-gluconate to yield 2-dehydro-3-deoxy-D-gluconate-6-phosphate.This product is then process by KHG/KDPG aldolase which in turn produces D-Glyceraldehyde 3-phosphate and Pyruvic Acid which then go into their respective sub pathways: glycolysis and pyruvate dehydrogenase
The pathway can also start from  3 other points: a hydrogen ion symporter (gluconate/fructuronate transporter GntP) of D-fructuronate, a hydrogen ion symporter (Hexuronate transporter) of aldehydo-D-galacturonate that spontaneously turns into D-tagaturonate and  then undergoes an NADH-dependent reduction to D-altronate through an altronate oxidoreductase. D-altronate undergoes dehydration to yield 2-dehydro-3-deoxy-D-gluconate, the third and last point where the reaction can start from a hydrogen symporter of a 2-dehydro-3-deoy-D-gluconate.</description>
      <pathwhiz_id>PW000834</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>histidine biosynthesis</name>
      <description>Histidine biosynthesis starts with a product of PRPP biosynthesis pathway, phosphoribosyl pyrophosphate which interacts with a hydrogen ion through an ATP phosphoribosyltransferase resulting in an pyrophosphate and a phosphoribosyl-ATP. This compound interacts with water through a phosphoribosyl-AMP cyclohydrolase / phosphoribosyl-ATP pyrophosphatase resulting in the release of pyrophosphate, hydrogen ion and a phosphoribosyl-AMP. This enzyme proceeds to interact with phosphoribosyl-AMP and water resulting in a 1-(5'-Phosphoribosyl)-5-amino-4-imidazolecarboxamide. This compound is then isomerized by a N-(5'-phospho-L-ribosyl-formimino)-5-amino-1-(5'-phosphoribosyl)-4-imidazolecarboxamide isomerase resulting in a PhosphoribosylformiminoAICAR-phosphate. This compound reacts with L-glutamine through an imidazole glycerol phosphate synthase resulting in a L-glutamic acid, hydrogen ion, 5-aminoimidazole-4-carboxamide and a D-erythro-imidazole-glycerol-phosphate. This compound reacts with a imidazoleglycerol-phosphate dehydratase / histidinol-phosphatase, dehydrating the compound and resulting in a imidazole acetol-phosphate.
This compound interacts with L-glutamic acid through a histidinol-phosphate aminotransferase, releasing oxoglutaric acid and L-histidinol-phosphate. The latter compound interacts with water and a imidazoleglycerol-phosphate dehydratase / histidinol-phosphatase resulting in L-histidinol and phosphate. L-histidinol interacts with a NAD-driven histidinol dehydrogenase resulting in a Histidinal. This in turn reacts with water in a NAD driven histidinal dehydrogenase resulting in L-Histidine.
L-Histidine then represses ATP phosphoribosyltransferase, regulation its own biosynthesis.</description>
      <pathwhiz_id>PW000810</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>inner membrane transport</name>
      <description>list of inner membrane transport complexes, transporting compounds from the periplasmic space to the cytosol
This pathway should be updated regularly with the new inner membrae transports added</description>
      <pathwhiz_id>PW000786</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>ornithine metabolism</name>
      <description>
In the ornithine biosynthesis pathway of E. coli, L-glutamate is acetylated to N-acetylglutamate by the enzyme N-acetylglutamate synthase, encoded by the argA gene. The acetyl donor for this reaction is acetyl-CoA. N-acetylglutamic acid is then phosphorylated via an ATP driven acetylglutamate kinase which yields a N-acetyl-L-glutamyl 5-phosphate. This compound undergoes a NADPH dependent reduction resulting in N-acetyl-L-glutamate 5-semialdehyde. This compound reacts with L-glutamic acid through a acetylornithine aminotransferase / N-succinyldiaminopimelate aminotransferase to produce  a N-acetylornithine which is then deacetylated through a acetylornithine deacetylase which yield an ornithine. Ornithine interacts with hydrogen ion  through a Ornithine decarboxylase resulting in a carbon dioxide release and  a putrescine
Putrescine can be metabolized by reaction with either l-glutamic acid or oxoglutaric acid. If putrescine reacts with L-glutamic acid, it reacts through an ATP mediated gamma-glutamylputrescine producing a hydrogen ion, ADP, phosphate and gamma-glutamyl-L-putrescine. This compound is reduced by interacting with oxygen, water and a gamma-glutamylputrescine oxidoreductase resulting in ammonium, hydrogen peroxide and 4-gamma-glutamylamino butanal. This compound is dehydrogenated through a NADP mediated reaction  lead by gamma-glutamyl-gamma-aminobutaryaldehyde dehydrogenase resulting in  hydrogen ion, NADPH and 4-glutamylamino butanoate. In turn, the latter compound reacts with water through a gamma-glutamyl-gamma-aminobutyrate hydrolase resulting in L-glutamic acid and Gamma aminobutyric acid. On the other hand, if putrescine reacts with oxoglutaric acid through a putrescine aminotransferase, it results in L-glutamic acid, and a 4-aminobutyraldehyde. This compound reacts with water through a NAD dependent gamma aminobutyraldehyde dehydrogenase resulting in hydrogen ion, NADH and gamma-aminobutyric acid.
Gamma Aaminobutyric acid reacts with oxoglutaric acid through 4-aminobutyrate aminotransferase resulting in L-glutamic acid and succinic acid semialdehyde. This compound in turn can react with with either NADP  or NAD to result in the production of succinic acid through succinate-semialdehyde dehydrogenase or aldehyde dehydrogenase-like protein yneI respectively. Succinic acid can then be integrated in the TCA cycle. 

</description>
      <pathwhiz_id>PW000791</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>palmitate biosynthesis</name>
      <description>Palmitate is synthesized by stepwise condensation of C2 units to a growing acyl chain. Each elongation cycle results in the addition of two carbons to the acyl chain, and consists of four separate reactions.
The pathway starts with acetyl-CoA interacting with hydrogen carbonate through an ATP driven acetyl-CoA carboxylase resulting in a phosphate, an ADP , a hydrogen ion and a malonyl-CoA. The latter compound interacts with a holo-[acp] through a malonyl-CoA-ACP transacylase resulting in a CoA and a malonyl-[acp]. This compound interacts with hydrogen ion, acetyl-CoA through a  KASIII resulting in a CoA, carbon dioxide and an acetoacetyl-[acp]. 

The latter compound interacts with a hydrogen ion through a NADPH driven 3-oxoacyl-[acyl-carrier-protein] reductase resulting in an NADP and a (R) 3-Hydroxybutanoyl-[acp](1). 
This compound is then dehydrated by a 3-hydroxyacyl-[acyl-carrier-protein] dehydratase resulting in the release of water and a crotonyl-[acp](2).
The crotonyl-[acp] interacts with a hydrogen ion through a NADH enoyl-[acyl-carrier-protein] reductase(NAD) resulting in NAD and a butyryl-[acp](3).
The butyryl-[acp] interacts with a hydrogen ion, a malonyl-[acp] through a KASI resulting in a holo-[acp],carbon dioxide and a 3-oxo-hexanoyl-[acp](4).

The  3-oxo-hexanoyl-[acp] interacts with a hydrogen ion through a NADPH driven 3-oxoacyl-[acyl-carrier-protein] reductase resulting in an NADP and a (R) 3-Hydroxyhexanoyl-[acp](1).
 This compound is then dehydrated by a 3-hydroxyacyl-[acyl-carrier-protein] dehydratase resulting in the release of water and a trans hex-2-enoyl-[acp](2).
The  trans hex-2-enoyl-[acp] interacts with a hydrogen ion through a NADH enoyl-[acyl-carrier-protein] reductase(NAD) resulting in NAD and a hexanoyl-[acp](3).
The hexanoyl-[acp] interacts with a hydrogen ion, a malonyl-[acp] through a KASI resulting in a holo-[acp],carbon dioxide and a 3-oxo-octanoyl-[acp](4).

The 3-oxo-octanoyl-[acp] interacts with a hydrogen ion through a NADPH driven 3-oxoacyl-[acyl-carrier-protein] reductase resulting in an NADP and a (R) 3-Hydroxyoctanoyl-[acp](1).
 This compound is then dehydrated by a 3-hydroxyacyl-[acyl-carrier-protein] dehydratase resulting in the release of water and a trans oct-2-enoyl-[acp](2).
The trans oct-2-enoyl-[acp] interacts with a hydrogen ion through a NADH enoyl-[acyl-carrier-protein] reductase(NAD) resulting in NAD and a octanoyl-[acp](3).
The octanoyl-[acp] interacts with a hydrogen ion, a malonyl-[acp] through a KASI resulting in a holo-[acp],carbon dioxide and a 3-oxo-decanoyl-[acp](4).

The 3-oxo-decanoyl-[acp] interacts with a hydrogen ion through a NADPH driven 3-oxoacyl-[acyl-carrier-protein] reductase resulting in an NADP and a (R) 3-Hydroxydecanoyl-[acp](1).
 This compound is then dehydrated by a 3-hydroxyacyl-[acyl-carrier-protein] dehydratase resulting in the release of water and a trans-delta2-decenoyl-[acp](2).
The a trans-delta2-decenoyl-[acp] interacts with a hydrogen ion through a NADH enoyl-[acyl-carrier-protein] reductase(NAD) resulting in NAD and a decanoyl-[acp](3).
The decanoyl-[acp] interacts with a malonyl-[acp] through a KASI resulting in a holo-[acp],carbon dioxide and a 3-oxo-dodecanoyl-[acp](4).

The 3-oxo-dodecanoyl-[acp ]interacts with a hydrogen ion through a NADPH driven 3-oxoacyl-[acyl-carrier-protein] reductase resulting in an NADP and a (R) 3-Hydroxydodecanoyl-[acp](1).
 This compound is then dehydrated by a 3-hydroxyacyl-[acyl-carrier-protein] dehydratase resulting in the release of water and a trans dodec-2-enoyl-[acp](2).
The  trans dodec-2-enoyl-[acp] interacts with a hydrogen ion through a NADH enoyl-[acyl-carrier-protein] reductase(NAD) resulting in NAD and a dodecanoyl-[acp](3). This compound can either react with water  spontaneously resulting in a hydrogen ion, a holo-[acp] and a dodecanoic acid or  it interacts with a hydrogen ion, a malonyl-[acp] through a KASI resulting in a holo-[acp],carbon dioxide and a 3-oxo-myristoyl-[acp](4).

The 3-oxo-myristoyl-[acp] interacts with a hydrogen ion through a NADPH driven 3-oxoacyl-[acyl-carrier-protein] reductase resulting in an NADP and a (3R) 3-Hydroxymyristoyl-[acp](1).
 This compound is then dehydrated by a 3-hydroxyacyl-[acyl-carrier-protein] dehydratase resulting in the release of water and a trans tetradec-2-enoyl-[acp](2).
This compound interacts with a hydrogen ion, through a NADH-driven KASI resulting in a NAD and a myristoyl-[acp].
Myristoyl-[acp] with a hydrogen ion, a malonyl-[acp] through a KASI resulting in a holo-[acp],carbon dioxide and a 3-oxo-palmitoyl-[acp](4).

The 3-oxo-palmitoyl-[acp] interacts with a hydrogen ion through a NADPH driven 3-oxoacyl-[acyl-carrier-protein] reductase resulting in an NADP and a (3R) 3-Hydroxypalmitoyl-[acp](1).
This compound is then dehydrated by a 3-hydroxyacyl-[acyl-carrier-protein] dehydratase resulting in the release of water and a trans hexadecenoyl-[acp](2).
The  trans hexadecenoyl-[acp] interacts with a hydrogen ion through a NADH enoyl-[acyl-carrier-protein] reductase(NAD) resulting in NAD and a palmitoyl-[acp](3). 
Palmitoyl then reacts with water spontaneously resulting in a hydrogen ion, a holo-[acp] and palmitic acid.

No integral membrane protein required for long chain fatty acid uptake has been identified in E. coli. The transport of long chain fatty acids across the cytoplasmic membrane is dependent on fatty acyl-CoA synthetase. An energised membrane is necessary for fatty acid transport and it has been suggested that uncharged fatty acids flip across the inner membrane by diffusion.

</description>
      <pathwhiz_id>PW000797</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>proline metabolism</name>
      <description>
The biosynthesis of L-proline in E. coli involves L-glutamic acid being phosphorylated through an ATP driven glutamate 5-kinase resulting in a L-glutamic acid 5-phosphate. This compound is then reduced through a NADPH driven gamma glutamyl phosphate reductase resulting in the release of a phosphate, a NADP and a L-glutamic gamma-semialdehyde. 
L-glutamic gamma-semialdehyde is dehydrated spontaneously, resulting in a release of water,hydrogen ion and 1-Pyrroline-5-carboxylic acid. The latter compound is reduced by an NADPH driven pyrroline-5-carboxylate reductase  which is subsequently reduced to L-proline. L-proline works as a repressor of the pyrroline-5-carboxylate reductase enzyme and glutamate 5-kinase.

 In E. coli, the biosynthesis of L-proline from L-glutamate is governed by three genetic loci namely proB, proA and proC. The first reaction in the pathway is catalyzed by γ-glutamyl kinase, encoded by proB . The second reaction, NADPH-dependent reduction of γ-glutamyl phosphate to glutamate-5-semialdehyde, in the pathway is catalyzed by glutamate-5-semialdehyde dehydrogenase, encoded by proA . These two enzymes aggregate into a multimeric bi-functional enzyme complex known as γ-glutamyl kinase-GP-reductase multienzyme complex. It is believed that the complex formation serves to protect the highly labile glutamyl phosphate from the hostile nucleophilic and aqueous environment found in the cell . The final step in the pathway, the reduction of pyrroline 5-carboxylate to L-proline, is catalyzed by an NADPH-dependent pyrroline-5-carboxylate reductase encoded by proC .
 
Proline is  metabolized by being converted back to L-glutamate, which is further degraded to α-ketoglutarate, an intermediate of the TCA cycle. Curiously, L-glutamate, the obligate intermediate of the proline degradation pathway, cannot itself serve as a total source of carbon and energy for E. coli, because glutamate transport supplies exogenous glutamate at an inadequate rate.
The proces by which proline is turned into L-glutamate starts with L-proline interacting with ubiquinone through a bifunctional protein putA resulting in an ubiquinol, a hydrogen ion and a 1-pyrroline-5-carboxylic acid. The latter compound is then hydrated spontaneously resulting in a L-glutamic gamma-semialdehyde. This compound is then processed by interacting with water through an NAD driven bifunctional protein putA resulting in a hydrogen ion, NADH and L-glutamic acid.</description>
      <pathwhiz_id>PW000794</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>purine nucleotides de novo biosynthesis</name>
      <description>The biosynthesis of purine nucleotides is a complex process that begins with a phosphoribosyl pyrophosphate. This compound interacts with water and L-glutamine through a 
amidophosphoribosyl transferase resulting in a pyrophosphate, L-glutamic acid and a 5-phosphoribosylamine. The latter compound proceeds to interact with a glycine through an ATP driven phosphoribosylamine-glycine ligase resulting in the addition of glycine to the compound. This reaction releases an ADP, a phosphate, a hydrogen ion and a N1-(5-phospho-β-D-ribosyl)glycinamide. The latter compound interacts with formic acid, through an ATP driven phosphoribosylglycinamide formyltransferase 2 resulting in a phosphate, an ADP, a hydrogen ion and a 5-phosphoribosyl-N-formylglycinamide. The latter compound interacts with L-glutamine, and water through an ATP-driven 
phosphoribosylformylglycinamide synthetase resulting in a release of a phosphate, an ADP, a hydrogen ion, a L-glutamic acid and a 2-(formamido)-N1-(5-phospho-D-ribosyl)acetamidine. The latter compound interacts with an ATP driven phosphoribosylformylglycinamide cyclo-ligase resulting in a release of ADP, a phosphate, a hydrogen ion and a 5-aminoimidazole ribonucleotide. The latter compound interacts with a hydrogen carbonate through an ATP driven N5-carboxyaminoimidazole ribonucleotide synthetase resulting in a release of a phosphate, an ADP, a hydrogen ion and a N5-carboxyaminoimidazole ribonucleotide.The latter compound then interacts with a N5-carboxyaminoimidazole ribonucleotide mutase resulting in a 5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylate. This compound interacts with an L-aspartic acid through an ATP driven phosphoribosylaminoimidazole-succinocarboxamide synthase resulting in a phosphate, an ADP, a hydrogen ion and a SAICAR. SAICAR interacts with an adenylosuccinate lyase resulting in a fumaric acid and an AICAR. AICAR interacts with a formyltetrahydrofolate through a AICAR transformylase / IMP cyclohydrolase resulting in a release of a tetrahydropterol mono-l-glutamate and a FAICAR. The latter compound, FAICAR, interacts in a reversible reaction through a AICAR transformylase / IMP cyclohydrolase resulting in a release of water and Inosinic acid. 
Inosinic acid can be metabolized to produce dGTP and dATP   three different methods each.

dGTP:
 Inosinic acid, water and NAD are processed by IMP dehydrogenase resulting in a release of NADH, a hydrogen ion and Xanthylic acid. Xanthylic acid interacts with L-glutamine, and water through an ATP driven GMP synthetase resulting in pyrophosphate, AMP, L-glutamic acid, a hydrogen ion and Guanosine monophosphate. The latter compound is the phosphorylated by reacting with an ATP driven guanylate kinase resulting in a release of ADP and a Gaunosine diphosphate. Guanosine diphosphate can be metabolized in three different ways:
       1.-Guanosine diphosphate is phosphorylated by an ATP-driven nucleoside diphosphate kinase resulting in an ADP and a Guanosine triphosphate. This compound interacts with a reduced flavodoxin protein through a ribonucleoside-triphosphate reductase resulting in a oxidized flavodoxin a water moleculer and a dGTP
       2.-Guanosine diphosphate interacts with a reduced NrdH glutaredoxin-like proteins through a ribonucleoside-diphosphate reductase 2 resulting in the release of an oxidized NrdH glutaredoxin-like protein, a water molecule and a dGDP. The dGDP is then phosphorylated by interacting with an ATP-driven nucleoside diphosphate kinase resulting in an ADP and dGTP.
       3.-Guanosine diphosphate interacts with a reduced thioredoxin ribonucleoside diphosphate reductase 1 resulting in a release of a water molecule, an oxidized thioredoxin and a dGDP. The dGDP is then phosphorylated by interacting with an ATP-driven nucleoside diphosphate kinase resulting in an ADP and dGTP.

dATP:
Inosinic acid interacts with L-aspartic acid through an GTP driven adenylosuccinate synthase results in the release of GDP, a hydrogen ion, a phosphate and N(6)-(1,2-dicarboxyethyl)AMP. The latter compound is then cleaved by a adenylosuccinate lyase resulting in a fumaric acid and an Adenosine monophosphate. This compound is then phosphorylated by an adenylate kinase resulting in the release of ATP and an adenosine diphosphate. Adenosine diphosphate can be metabolized in three different ways:
        1.-Adenosine diphosphate is involved in a reversible reaction by interacting with a hydrogen ion and a phosphate through a ATP synthase / thiamin triphosphate synthase resulting in a hydrogen ion, a water molecule and an Adenosine triphosphate. The adenosine triphosphate interacts with a reduced flavodoxin through a ribonucleoside-triphosphate reductase resulting in an oxidized flavodoxin, a water molecule and a dATP
        2.- Adenosine diphosphate interacts with an reduced thioredoxin through a ribonucleoside diphosphate reductase 1 resulting in a release of a water molecule, a oxidized thioredoxin and a dADP. The dADP is then phosphorylated by a nucleoside diphosphate kinase resulting in the release of ADP and a dATP
        3.- Adenosine diphosphate interacts with an reduced NrdH glutaredoxin-like protein through a ribonucleoside diphosphate reductase 2 resulting in a release of a water molecule, a oxidized glutaredoxin-like protein and a dADP. The dADP is then phosphorylated by a nucleoside diphosphate kinase resulting in the release of ADP and a dATP


</description>
      <pathwhiz_id>PW000910</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>purine nucleotides de novo biosynthesis 1435709748</name>
      <description/>
      <pathwhiz_id>PW000960</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>serine biosynthesis and metabolism</name>
      <description>Serine biosynthesis is a major metabolic pathway in E. coli. Its end product, serine, is not only used in protein synthesis, but also as a precursor for the biosynthesis of glycine, cysteine, tryptophan, and phospholipids. In addition, it directly or indirectly serves as a source of one-carbon units for the biosynthesis of various compounds.
 
The biosynthesis of serine starts with 3-phosphoglyceric acid being metabolized by a NAD driven D-3-phosphoglycerate dehydrogenase / α-ketoglutarate reductase resulting in the release of a NADH, a hydrogen ion and a phosphohydroxypyruvic acid. The latter compound then interacts with an L-glutamic acid through a 3-phosphoserine aminotransferase / phosphohydroxythreonine aminotransferase resulting in oxoglutaric acid and DL-D-phosphoserine.
The DL-D-phosphoserine can also be imported into the cytoplasm through a phosphonate ABC transporter. The DL-D-phosphoserine is dephosphorylated by interacting with a water molecule through a phosphoserine phosphatase resulting in the release of a phosphate and an L-serine
L-serine is then metabolized by being dehydrated through either a L-serine dehydratase 2 or a L-serine dehydratase 1 resulting in the release of a water molecule, a hydrogen ion and a 2-aminoacrylic acid. The latter compound is an isomer of a 2-iminopropanoate which reacts spontaneously with a water molecule and a hydrogen ion resulting in the release of Ammonium and pyruvic acid. Pyruvic acid then interacts with a coenzyme A through a NAD driven pyruvate dehydrogenase complex resulting in the release of a NADH, a carbon dioxide and an acetyl-CoA.
</description>
      <pathwhiz_id>PW000809</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>superpathway of D-glucarate and D-galactarate degradation</name>
      <description>
Galactarate is a naturally occurring dicarboxylic acid analog of D-galactose. E. coli can use both diacid sugars galactarate and D-glucarate as the sole source of carbon for growth.
 The initial step in the degradation of galactarate is its dehydration to 5-dehydro-4-deoxy-D-glucarate(2--) by galactarate dehydratase. Glucaric acid can also be dehydrated by a glucarate dehydratase resulting in water and 5-dehydro-4-deoxy-D-glucarate(2--).
 The  5-dehydro-4-deoxy-D-glucarate(2--)  is then metabolized by a alpha-dehydro-beta-deoxy-D-glucarate aldolase resulting in pyruvic acid and a tartonate semialdehyde. 
Pyruvic acid interacts with coenzyme A through a NAD driven Pyruvate dehydrogenase complex resulting in a carbon dioxide, an NADH and an acetyl-CoA.

The tartronate semialdehyde interacts with a hydrogen ion through a NADPH driven tartronate semialdehyde reductase resulting in a NADP and a glyceric acid. The glyceric acid is phosphorylated by an ATP-driven glycerate kinase 2 resulting in an ADP, a hydrogen ion and a 2-phosphoglyceric acid. The latter compound is dehydrated by an enolase resulting in the release of water and a phosphoenolpyruvic acid.

The phosphoenolpyruvic acid interacts with a hydrogen ion through an ADP driven pyruvate kinase resulting in an ATP and a pyruvic acid. The pyruvic acid then interacts with water and an ATP through a phosphoenolpyruvate synthetase resulting in the release of a hydrogen ion, a phosphate, an AMP and a Phosphoenolpyruvic acid.</description>
      <pathwhiz_id>PW000795</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>threonine biosynthesis</name>
      <description>The biosynthesis of threonine starts with oxalacetic acid interacting with an L-glutamic acid through an aspartate aminotransferase resulting in a oxoglutaric acid and an L-aspartic acid. The latter compound is then phosphorylated by an ATP driven Aspartate kinase resulting in an a release of an ADP and an L-aspartyl-4-phosphate. This compound interacts with a hydrogen ion through an NADPH driven aspartate semialdehyde dehydrogenase resulting in the release of a phosphate, an NADP and a L-aspartate-semialdehyde.The latter compound interacts with a hydrogen ion through a NADPH driven aspartate kinase / homoserine dehydrogenase resulting in the release of an NADP and a L-homoserine. L-homoserine is phosphorylated through an ATP driven homoserine kinase resulting in the release of an ADP, a hydrogen ion and a O-phosphohomoserine. The latter compound then interacts with a water molecule threonine synthase resulting in the release of a phosphate and an L-threonine. </description>
      <pathwhiz_id>PW000817</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>tyrosine biosynthesis</name>
      <description>The pathways of biosynthesis of phenylalaline and tyrosine are intimately connected. First step of both pathways is the conversion of chorismate to prephenate, the third step of both is the conversion of a ketoacid to the aminoacid through transamination. The two pathways differ only in the second step of their three-step reaction sequences: In the case of phenylalanine biosynthesi a dehydratase converts prephenate to phenylpyruvate(reaction occurs slowly in the absence of enzymic activity); in the case of tyrosine biosynthesis, a dehydrogenase converts prephenate to p-hydroxyphenylpyruvate. Also in both pathways the first two steps are catalyzed by two distinc active sites on a single protein. Thus the first step of each pathway can be catalyzed by two enzyme: those associated with both the phenylalanine specific dehydratase and the tyrosine specific dehydrogenase. Three enzymes those enconde by tyrB, aspC and ilvE are involved in catalyzing the third step of these pathways, all three can contribute to the synthesis of phenylalanine: only tyrB and aspC contribute to biosynthesis of tyrosine</description>
      <pathwhiz_id>PW000806</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>tryptophan metabolism II</name>
      <description>The biosynthesis of L-tryptophan begins with L-glutamine interacting with a chorismate through a anthranilate synthase which results in a L-glutamic acid, a pyruvic acid, a hydrogen ion and a 2-aminobenzoic acid. The aminobenzoic acid interacts with a phosphoribosyl pyrophosphate through an anthranilate synthase component II resulting in a pyrophosphate and a N-(5-phosphoribosyl)-anthranilate. The latter compound is then metabolized by an indole-3-glycerol phosphate synthase / phosphoribosylanthranilate isomerase resulting in a 1-(o-carboxyphenylamino)-1-deoxyribulose 5'-phosphate. This compound then interacts with a hydrogen ion through a indole-3-glycerol phosphate synthase / phosphoribosylanthranilate isomerase resulting in the release of carbon dioxide, a water molecule and a  (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate. The latter compound then interacts with a D-glyceraldehyde 3-phosphate and an Indole. The indole interacts with an L-serine through a tryptophan synthase, β subunit dimer resulting in a water molecule and an L-tryptophan.

The metabolism of L-tryptophan starts with L-tryptophan being dehydrogenated by a tryptophanase / L-cysteine desulfhydrase resulting in the release of a hydrogen ion, an Indole and a 2-aminoacrylic acid. The latter compound is isomerized into a 2-iminopropanoate. This compound then interacts with a water molecule and a hydrogen ion  spontaneously resulting in the release of an Ammonium and a pyruvic acid. The pyruvic acid then interacts with a coenzyme A through a NAD driven pyruvate dehydrogenase complex resulting in the release of a NADH, a carbon dioxide and an Acetyl-CoA</description>
      <pathwhiz_id>PW001916</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>D-sorbitol degradation II</name>
      <description>Of the six existing hexitols only three (D-mannitol, D-sorbitol [glucitol], and galactitol [owing to symmetry, D- and L-galactitol are identical]) occur naturally and each of these can be utilized by E. coli K-12 as a total source of carbon and energy. Each enters the cell via a specific phosphotransferase system so the first intracellular species is the 6-phospho derivative. D-sorbitol-6-phosphate is converted by a single dehydrogenase reaction to the glycolytic intermediate, D-fructose-6-phosphate and hence flows through the pathways of central metabolism to satisfy the cell's need for precursor metabolites, reducing power, and metabolic energy.</description>
      <pathwhiz_id>PW002022</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>TCA cycle (ubiquinol-0)</name>
      <description>The TCA pathway is a catabolic pathway of aerobic respiration. It generates energy and reducing power. It is the first step in generating precursors for biosynthesis. When acetate is the carbon source, citrate synthase is rate-limiting for the TCA cycle. Respiration is an ATP-generating process in which compounds act as electron donors through a chain of electron transfer to electron acceptors. Aerobic respiration uses oxygen as the final acceptor. Anaerobic respiration uses several organic compounds as acceptors such as fumarate, nitrate and hydrogen. During the chain of electron transfer, protons (H+) are transported outside the cytoplasmic membrane, generating a proton motive force. Upon passage of protons back into the cytoplasm, the PMF energy is captured as ATP, catalyzed by a multisubunit ATPase. The cycle can start from Acetyl-CoA interacting with Oxalacetic acid and water through a citrate synthase monomer resulting in a hydrogen ion, CoA and a Citric Acid. The latter compound is dehydrated by a Citrate hydro-lyase resulting in the release of water and a cis-Aconitic acid. This compound is then hydrated through a Citrate hydro-lyase resulting in a D-threo-Isocitric acid. This compound is decarboxylated by an NADP dependent Citrate dehydrogenase, resulting in a release of carbon dioxide and NADPH and Oxoglutaric acid. The oxoglutaric acid interacts with a Coenzyme A through a NAD driven 2-oxoglutarate dehydrogenase resulting in a release of carbon dioxide, an NADH and succinyl-CoA. The succinyl-CoA interacts with a phosphate and an ADP through a 2-oxoglutarate dehydrogenase resulting in a CoA, an ATP and Succinic Acid. Succinic acid interacts with a ubiquinone, in this case a ubiquinone 1 through a succinate:quinone oxidoreductase resulting in an ubiquinol, in this case a ubiquinol-1 and a fumaric acid. The fumaric acid interacts with water through a fumarase hydratase resulting in a L-Malic acid.This compound can either interact with quinone through a malate:quinone oxidoreductase resulting in a release of hydroquinone and oxalacetic acid, or it can react with an NAD through a malate dehydrogenase resulting in a hydrogen ion, NADH and Oxalacetic acid.</description>
      <pathwhiz_id>PW002023</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>glycolate and glyoxylate degradation II</name>
      <description>Oxaloglycolate (2-Hydroxy-3-oxosuccinate) interacts with a tartrate dehydrogenase resulting in a L-tartrate. L-tartrate then interacts with tartrate dehydrogenase resulting in a Oxaloacetate. Oxaloacetate and acetyl-coa interact  to result in a citrate which is processed by a aconitate hydratase  resulting in a cis-Aconitate and further more into a isocitrate which will eventually be procressed into a glyoxylic acid.  Glyoxylic acid can either be metabolized into L-malic acid by a reaction with acetyl-CoA and Water through a malate synthase G which also releases hydrogen ion and Coenzyme A. L-malic acid is then incorporated into the TCA cycle. Glyoxylic acid can also be metabolized by glyoxylate carboligase, releasing a carbon dioxide and tartronate semialdehyde. The latter compound is then reduced by an NADH driven tartronate semialdehyde reductase 2 resulting in glyceric acid. Glyceric acid is phosphorylated by a glycerate kinase 2 resulting in a 3-phosphoglyceric acid. This compound is then integrated into various other pathways: cysteine biosynthesis, serine biosynthesis and glycolysis and pyruvate dehydrogenase.</description>
      <pathwhiz_id>PW002021</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Phenylethylamine metabolism</name>
      <description>The process of phenylethylamine metabolism starts with 2-phenylethylamine interacting with an oxygen molecule and a water molecule in the periplasmic space through a phenylethylamine oxidase. This reaction results in the release of a hydrogen peroxide, ammonium and phenylacetaldehyde. 
Phenylacetaldehyde is introduced into the cytosol and degraded into phenylacetate by reaction with a phenylacetaldehyde dehydrogenase. This reaction involves phenylacetaldehyde interacting with NAD, and a water molecule and then resulting in the release of NADH, and 2 hydrogen ion.
Phenylacetate is then degraded. The first step involves phenylacetate interacting with an coenzyme A and an ATP driven phenylacetate-CoA ligase resulting in the release of a AMP, a diphosphate and a phenylacetyl-CoA. This resulting compound the interacts with a hydrogen ion, NADPH, and oxygen molecule through a ring 1,2-phenylacetyl-CoA epoxidase protein complex resulting in the release of a water molecule, an NADP and a 2-(1,2-epoxy-1,2-dihydrophenyl)acetyl-CoA. This compound is then metabolized by a ring 1,2 epoxyphenylacetyl-CoA isomerase resulting in a 2-oxepin-2(3H)-ylideneacetyl-CoA. This compound is then hydrolated through a oxepin-CoA hydrolase resulting in a 3-oxo-5,6-didehydrosuberyl-CoA semialdehyde. This commpound then interacts with a water molecule and NADP driven 3-oxo-5,6-dehydrosuberyl-CoA semialadehyde dehydrogenase resulting in 2 hydrogen ions, a NADPH and a 3-oxo-5,6-didehydrosuberyl-CoA. The resulting compound interacts with a coenzyme A and a 3-oxo-5,6 dehydrosuberyl-CoA thiolase resulting in an acetyl-CoA and a 2,3-didehydroadipyl-CoA. This resulting compound is the hydrated by a 2,3-dehydroadipyl-CoA hydratas resulting in a 3-hydroxyadipyl-CoA whuch is dehydrogenated through an NAD driven 3-hydroxyadipyl-CoA dehydrogenase resulting in a NADH, a hydrogen ion and a 3-oxoadipyl-CoA. The latter compound then interacts with conezyme A through a beta-ketoadipyl-CoA thiolase resulting in an acetyl-CoA and a succinyl-CoA. The succinyl-CoA is then integrated into the TCA cycle.</description>
      <pathwhiz_id>PW002027</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Thiamin diphosphate biosynthesis</name>
      <description/>
      <pathwhiz_id>PW002028</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>2-Oxopent-4-enoate metabolism 2</name>
      <description>The pathway starts with trans-cinnamate interacting with a hydrogen ion, an oxygen molecule, and a NADH through a cinnamate dioxygenase resulting in a NAD and a Cis-3-(3-carboxyethyl)-3,5-cyclohexadiene-1,2-diol which then interact together through a 2,3-dihydroxy-2,3-dihydrophenylpropionate dehydrogenase resulting in the release of a hydrogen ion, an NADH molecule and a 2,3 dihydroxy-trans-cinnamate. The second way by which the 2,3 dihydroxy-trans-cinnamate is acquired is through a 3-hydroxy-trans-cinnamate interacting with a hydrogen ion, a NADH and an oxygen molecule through a 3-(3-hydroxyphenyl)propionate 2-hydroxylase resulting in the release of a NAD molecule, a water molecule and a 2,3-dihydroxy-trans-cinnamate. The compound 2,3 dihydroxy-trans-cinnamate then interacts with an oxygen molecule through a 2,3-dihydroxyphenylpropionate 1,2-dioxygenase resulting in a hydrogen ion and a 2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate. The latter compound then interacts with a water molecule through a 2-hydroxy-6-oxononatrienedioate hydrolase resulting in a release of a hydrogen ion, a fumarate molecule and (2Z)-2-hydroxypenta-2,4-dienoate. The latter compound reacts spontaneously to isomerize into a 2-oxopent-4-enoate. This compound is then hydrated through a 2-oxopent-4-enoate hydratase resulting in a 4-hydroxy-2-oxopentanoate. This compound then interacts with a 4-hydroxy-2-ketovalerate aldolase resulting in the release of a pyruvate, and an acetaldehyde. The acetaldehyde then interacts with a coenzyme A and a NAD molecule through a acetaldehyde dehydrogenase resulting in a hydrogen ion, a NADH and an acetyl-coa which can be incorporated into the TCA cycle</description>
      <pathwhiz_id>PW002035</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>4-aminobutanoate degradation I</name>
      <description>E. coli can utilize putrescine as the sole source of carbon and nitrogen. The enzymes of the putrescine degradation II pathway are inducible by extracellular putrescine, leading to the production of GABA. Both enzymes of this pathway are inducible by putrescine in E. coli.
This variant of the pathway includes a 2-oxoglutarate-dependent 4-aminobutyrate transaminase and an NAD+-dependent dehydrogenase. This combination of enzymes has been documented in bacteria and animals and in some plants.
Regarding the hydrogenase, NAD-specific variants have been studied from many bacteria, plant and animals.</description>
      <pathwhiz_id>PW002068</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>D-arabinose degradation I</name>
      <description>E. coli K-12 uses the enzymes of the fucose degradation pathway for utilization of D-arabinose. Expression of the enzymes in this pathway is normally induced by L-fucose and not by D-arabinose; thus, wild-type E. coli K-12 can not use D-arabinose as a sole source of carbon and energy without prior induction by growth on L-fucose. Growth on D-arabinose requires a mutation in the transcriptional regulator FucR. D-arabinose is metabolized yielding dihydroxy-acetone phosphate, an intermediate of glycolysis, which thereby enters central metabolism, and glycolaldehyde. Glycolaldehyde may be further catabolized to glycolate. (EcoCyc)</description>
      <pathwhiz_id>PW002038</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Enterobactin Biosynthesis</name>
      <description>Enterobactin is a catecholate siderophore produced almost exclusively by enterobacteria, although it has been reported in some Streptomyces species. It is a cyclic compound made of three units of 2,3-dihydroxybenzoylserine joined in a cyclic structure by lactone linkages (only the δ-cis isomer of the ferric chelate is biologically active). Not only the cyclic molecule, but also the biosynthetic precursor 2,3-dihydroxy-N-benzoylserine and its linear dimer and trimer condensation products are able to transport iron into enterobacteria.
Enterobactin is synthesized under iron-deficient conditions and excreted into the environment where it binds Fe(III) with high affinity and specificity. The ferrisiderophore complexes are taken up into the cell by specific transport components. Enterobactin synthesis is divided into two parts: 1) the conversion of chorismate to 2,3-dihydroxybenzoate 2) the synthesis of enterobactin from 2,3-dihydroxybenzoate and L-serine. (EcoCyc)</description>
      <pathwhiz_id>PW002048</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>L-lactaldehyde degradation (aerobic)</name>
      <description>L-lactaldehyde is one of two products resulting from degradation of the two methylpentoses L-fucose and rhamnose, which are metabolized by an analogous series of reactions.
Aerobically, lactaldehyde is oxidized in two steps to pyruvate, which enters central metabolism.</description>
      <pathwhiz_id>PW002073</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>allantoin degradation (anaerobic)</name>
      <description>Allantoin can be degraded in anaerobic conditions. The first step involves allantoin being degraded by an allantoinase resulting in an allantoate. This compound in turn is metabolized by reacting with water and 2 hydrogen ions through an allantoate amidohydrolase resulting in the release of a carbon dioxide, ammonium and an S-ureidoglycine. The  latter compund is further degrades through a S-ureidoglycine aminohydrolase resulting in the release of an ammonium and an S-ureidoglycolate. 
S-ureidoglycolate can be metabolized into oxalurate by two different reactions. The first reactions involves a NAD driven ureidoglycolate dehydrogenase resulting in the release of a hydrogen ion , an NADH and a oxalurate. On the other hand S-ureidoglycolate can react with NADP resulting in the release of an NADPH, a hydroge ion and an oxalurate.
It is hypothesized that oxalurate can interact with a phosphate and release a a carbamoyl phosphate and an oxamate.
The carbamoyl phosphate can be further degraded by reacting with an ADP, and a hydrogen ion through a carbamate kinase resulting in the release of an ammonium , ATP and carbon dioxide</description>
      <pathwhiz_id>PW002050</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>palmitate biosynthesis 2</name>
      <description>Palmitate is synthesized by stepwise condensation of C2 units to a growing acyl chain. Each elongation cycle results in the addition of two carbons to the acyl chain, and consists of four separate reactions. The pathway starts with acetyl-CoA interacting with hydrogen carbonate through an ATP driven acetyl-CoA carboxylase resulting in a phosphate, an ADP , a hydrogen ion and a malonyl-CoA. The latter compound interacts with a holo-[acp] through a malonyl-CoA-ACP transacylase resulting in a CoA and a malonyl-[acp]. This compound interacts with hydrogen ion, acetyl-CoA through a KASIII resulting in a CoA, carbon dioxide and an acetoacetyl-[acp]. The latter compound interacts with a hydrogen ion through a NADPH driven 3-oxoacyl-[acyl-carrier-protein] reductase resulting in an NADP and a (R) 3-Hydroxybutanoyl-[acp](1). This compound is then dehydrated by a 3-hydroxyacyl-[acyl-carrier-protein] dehydratase resulting in the release of water and a crotonyl-[acp](2). The crotonyl-[acp] interacts with a hydrogen ion through a NADH enoyl-[acyl-carrier-protein] reductase(NAD) resulting in NAD and a butyryl-[acp](3). The butyryl-[acp] interacts with a hydrogen ion, a malonyl-[acp] through a KASI resulting in a holo-[acp],carbon dioxide and a 3-oxo-hexanoyl-[acp](4). The 3-oxo-hexanoyl-[acp] interacts with a hydrogen ion through a NADPH driven 3-oxoacyl-[acyl-carrier-protein] reductase resulting in an NADP and a (R) 3-Hydroxyhexanoyl-[acp](1). This compound is then dehydrated by a 3-hydroxyacyl-[acyl-carrier-protein] dehydratase resulting in the release of water and a trans hex-2-enoyl-[acp](2). The trans hex-2-enoyl-[acp] interacts with a hydrogen ion through a NADH enoyl-[acyl-carrier-protein] reductase(NAD) resulting in NAD and a hexanoyl-[acp](3). The hexanoyl-[acp] interacts with a hydrogen ion, a malonyl-[acp] through a KASI resulting in a holo-[acp],carbon dioxide and a 3-oxo-octanoyl-[acp](4). The 3-oxo-octanoyl-[acp] interacts with a hydrogen ion through a NADPH driven 3-oxoacyl-[acyl-carrier-protein] reductase resulting in an NADP and a (R) 3-Hydroxyoctanoyl-[acp](1). This compound is then dehydrated by a 3-hydroxyacyl-[acyl-carrier-protein] dehydratase resulting in the release of water and a trans oct-2-enoyl-[acp](2). The trans oct-2-enoyl-[acp] interacts with a hydrogen ion through a NADH enoyl-[acyl-carrier-protein] reductase(NAD) resulting in NAD and a octanoyl-[acp](3). The octanoyl-[acp] interacts with a hydrogen ion, a malonyl-[acp] through a KASI resulting in a holo-[acp],carbon dioxide and a 3-oxo-decanoyl-[acp](4). The 3-oxo-decanoyl-[acp] interacts with a hydrogen ion through a NADPH driven 3-oxoacyl-[acyl-carrier-protein] reductase resulting in an NADP and a (R) 3-Hydroxydecanoyl-[acp](1). This compound is then dehydrated by a 3-hydroxyacyl-[acyl-carrier-protein] dehydratase resulting in the release of water and a trans-delta2-decenoyl-[acp](2). The a trans-delta2-decenoyl-[acp] interacts with a hydrogen ion through a NADH enoyl-[acyl-carrier-protein] reductase(NAD) resulting in NAD and a decanoyl-[acp](3). The decanoyl-[acp] interacts with a malonyl-[acp] through a KASI resulting in a holo-[acp],carbon dioxide and a 3-oxo-dodecanoyl-[acp](4). The 3-oxo-dodecanoyl-[acp ]interacts with a hydrogen ion through a NADPH driven 3-oxoacyl-[acyl-carrier-protein] reductase resulting in an NADP and a (R) 3-Hydroxydodecanoyl-[acp](1). This compound is then dehydrated by a 3-hydroxyacyl-[acyl-carrier-protein] dehydratase resulting in the release of water and a trans dodec-2-enoyl-[acp](2). The trans dodec-2-enoyl-[acp] interacts with a hydrogen ion through a NADH enoyl-[acyl-carrier-protein] reductase(NAD) resulting in NAD and a dodecanoyl-[acp](3). This compound can either react with water spontaneously resulting in a hydrogen ion, a holo-[acp] and a dodecanoic acid or it interacts with a hydrogen ion, a malonyl-[acp] through a KASI resulting in a holo-[acp],carbon dioxide and a 3-oxo-myristoyl-[acp](4). The 3-oxo-myristoyl-[acp] interacts with a hydrogen ion through a NADPH driven 3-oxoacyl-[acyl-carrier-protein] reductase resulting in an NADP and a (3R) 3-Hydroxymyristoyl-[acp](1). This compound is then dehydrated by a 3-hydroxyacyl-[acyl-carrier-protein] dehydratase resulting in the release of water and a trans tetradec-2-enoyl-[acp](2). This compound interacts with a hydrogen ion, through a NADH-driven KASI resulting in a NAD and a myristoyl-[acp]. Myristoyl-[acp] with a hydrogen ion, a malonyl-[acp] through a KASI resulting in a holo-[acp],carbon dioxide and a 3-oxo-palmitoyl-[acp](4). The 3-oxo-palmitoyl-[acp] interacts with a hydrogen ion through a NADPH driven 3-oxoacyl-[acyl-carrier-protein] reductase resulting in an NADP and a (3R) 3-Hydroxypalmitoyl-[acp](1). This compound is then dehydrated by a 3-hydroxyacyl-[acyl-carrier-protein] dehydratase resulting in the release of water and a trans hexadecenoyl-[acp](2). The trans hexadecenoyl-[acp] interacts with a hydrogen ion through a NADH enoyl-[acyl-carrier-protein] reductase(NAD) resulting in NAD and a palmitoyl-[acp](3). Palmitoyl then reacts with water spontaneously resulting in a hydrogen ion, a holo-[acp] and palmitic acid. No integral membrane protein required for long chain fatty acid uptake has been identified in E. coli. The transport of long chain fatty acids across the cytoplasmic membrane is dependent on fatty acyl-CoA synthetase. An energised membrane is necessary for fatty acid transport and it has been suggested that uncharged fatty acids flip across the inner membrane by diffusion.</description>
      <pathwhiz_id>PW002044</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>polymyxin resistance</name>
      <description>UDP-glucuronic acid compound undergoes a NAD dependent reaction through a bifunctional polymyxin resistance protein to produce UDP-Beta-L-threo-pentapyranos-4-ulose. This compound then reacts with L-glutamic acid through a UDP-4-amino-4-deoxy-L-arabinose--oxoglutarate aminotransferase to produce an oxoglutaric acid and UDP-4-amino-4-deoxy-beta-L-arabinopyranose The latter compound interacts with a N10-formyl-tetrahydrofolate through a bifunctional polymyxin resistance protein ArnA, resulting in a tetrahydrofolate, a hydrogen ion and a UDP-4-deoxy-4-formamido-beta-L-arabinopyranose, which in turn reacts with a product of the methylerythritol phosphate and polysoprenoid biosynthesis pathway, di-trans,octa-cis-undecaprenyl phosphate to produce a 4-deoxy-4-formamido-alpha-L-arabinopyranosyl ditrans, octacis-undecaprenyl phosphate. 
The compound  4-deoxy-4-formamido-alpha-L-arabinopyranosyl ditrans, octacis-undecaprenyl phosphate hypothetically reacts with water and results in the release of a formic acid and  4-amino-4-deoxy-α-L-arabinopyranosyl ditrans,octacis-undecaprenyl phosphate which in turn reacts with a KDO2-lipid A through a 4-amino-4-deoxy-L-arabinose transferase resulting in the release of a di-trans,octa-cis-undecaprenyl phosphate and a L-Ara4N-modified KDO2-Lipid A</description>
      <pathwhiz_id>PW002052</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>purine nucleotides de novo biosynthesis 2</name>
      <description>The biosynthesis of purine nucleotides is a complex process that begins with a phosphoribosyl pyrophosphate. This compound interacts with water and L-glutamine through a amidophosphoribosyl transferase resulting in a pyrophosphate, L-glutamic acid and a 5-phosphoribosylamine. The latter compound proceeds to interact with a glycine through an ATP driven phosphoribosylamine-glycine ligase resulting in the addition of glycine to the compound. This reaction releases an ADP, a phosphate, a hydrogen ion and a N1-(5-phospho-β-D-ribosyl)glycinamide. The latter compound interacts with formic acid, through an ATP driven phosphoribosylglycinamide formyltransferase 2 resulting in a phosphate, an ADP, a hydrogen ion and a 5-phosphoribosyl-N-formylglycinamide. The latter compound interacts with L-glutamine, and water through an ATP-driven phosphoribosylformylglycinamide synthetase resulting in a release of a phosphate, an ADP, a hydrogen ion, a L-glutamic acid and a 2-(formamido)-N1-(5-phospho-D-ribosyl)acetamidine. The latter compound interacts with an ATP driven phosphoribosylformylglycinamide cyclo-ligase resulting in a release of ADP, a phosphate, a hydrogen ion and a 5-aminoimidazole ribonucleotide. The latter compound interacts with a hydrogen carbonate through an ATP driven N5-carboxyaminoimidazole ribonucleotide synthetase resulting in a release of a phosphate, an ADP, a hydrogen ion and a N5-carboxyaminoimidazole ribonucleotide(5-Phosphoribosyl-5-carboxyaminoimidazole).The latter compound then interacts with a N5-carboxyaminoimidazole ribonucleotide mutase resulting in a 5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylate. This compound interacts with an L-aspartic acid through an ATP driven phosphoribosylaminoimidazole-succinocarboxamide synthase resulting in a phosphate, an ADP, a hydrogen ion and a SAICAR. SAICAR interacts with an adenylosuccinate lyase resulting in a fumaric acid and an AICAR. AICAR interacts with a formyltetrahydrofolate through a AICAR transformylase / IMP cyclohydrolase resulting in a release of a tetrahydropterol mono-l-glutamate and a FAICAR. The latter compound, FAICAR, interacts in a reversible reaction through a AICAR transformylase / IMP cyclohydrolase resulting in a release of water and Inosinic acid. Inosinic acid can be metabolized to produce dGTP and dATP three different methods each. dGTP: Inosinic acid, water and NAD are processed by IMP dehydrogenase resulting in a release of NADH, a hydrogen ion and Xanthylic acid. Xanthylic acid interacts with L-glutamine, and water through an ATP driven GMP synthetase resulting in pyrophosphate, AMP, L-glutamic acid, a hydrogen ion and Guanosine monophosphate. The latter compound is the phosphorylated by reacting with an ATP driven guanylate kinase resulting in a release of ADP and a Gaunosine diphosphate. Guanosine diphosphate can be metabolized in three different ways: 1.-Guanosine diphosphate is phosphorylated by an ATP-driven nucleoside diphosphate kinase resulting in an ADP and a Guanosine triphosphate. This compound interacts with a reduced flavodoxin protein through a ribonucleoside-triphosphate reductase resulting in a oxidized flavodoxin a water moleculer and a dGTP 2.-Guanosine diphosphate interacts with a reduced NrdH glutaredoxin-like proteins through a ribonucleoside-diphosphate reductase 2 resulting in the release of an oxidized NrdH glutaredoxin-like protein, a water molecule and a dGDP. The dGDP is then phosphorylated by interacting with an ATP-driven nucleoside diphosphate kinase resulting in an ADP and dGTP. 3.-Guanosine diphosphate interacts with a reduced thioredoxin ribonucleoside diphosphate reductase 1 resulting in a release of a water molecule, an oxidized thioredoxin and a dGDP. The dGDP is then phosphorylated by interacting with an ATP-driven nucleoside diphosphate kinase resulting in an ADP and dGTP. dATP: Inosinic acid interacts with L-aspartic acid through an GTP driven adenylosuccinate synthase results in the release of GDP, a hydrogen ion, a phosphate and N(6)-(1,2-dicarboxyethyl)AMP. The latter compound is then cleaved by a adenylosuccinate lyase resulting in a fumaric acid and an Adenosine monophosphate. This compound is then phosphorylated by an adenylate kinase resulting in the release of ATP and an adenosine diphosphate. Adenosine diphosphate can be metabolized in three different ways: 1.-Adenosine diphosphate is involved in a reversible reaction by interacting with a hydrogen ion and a phosphate through a ATP synthase / thiamin triphosphate synthase resulting in a hydrogen ion, a water molecule and an Adenosine triphosphate. The adenosine triphosphate interacts with a reduced flavodoxin through a ribonucleoside-triphosphate reductase resulting in an oxidized flavodoxin, a water molecule and a dATP 2.- Adenosine diphosphate interacts with an reduced thioredoxin through a ribonucleoside diphosphate reductase 1 resulting in a release of a water molecule, a oxidized thioredoxin and a dADP. The dADP is then phosphorylated by a nucleoside diphosphate kinase resulting in the release of ADP and a dATP 3.- Adenosine diphosphate interacts with an reduced NrdH glutaredoxin-like protein through a ribonucleoside diphosphate reductase 2 resulting in a release of a water molecule, a oxidized glutaredoxin-like protein and a dADP. The dADP is then phosphorylated by a nucleoside diphosphate kinase resulting in the release of ADP and a dATP</description>
      <pathwhiz_id>PW002033</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>2-oxoglutarate decarboxylation to succinyl-CoA</name>
      <description>The pathway illustrated here shows the reactions catalyzed by the 2-oxoglutarate dehydrogenase complex, a key, rate-limiting enzyme of the TCA cycle I (prokaryotic). These reactions can be summarized by the general reaction 2-oxoglutarate + coenzyme A + NAD+ → succinyl-CoA + CO2 + NADH which is the form commonly found in the TCA cycle.
During the OGDHC reaction cycle, 2-oxoglutarate is bound and decarboxylated by E1(o), a thiamin-diphosphate cofactor containing enzyme. The succinyl group is transferred to the lipoyl domain of E2(o) where it is carried to the active site and transferred to coenzyme A, forming succinyl-CoA. During this transfer the lipoyl group is reduced to dihydrolipoyl. The succinyl-CoA is released and the lipoyl domain of E2(o) is oxidized by E3 via transfer of protons to NAD, forming NADH and regenerating the lipoyl group back to lipoyllysine for another cycle.
Under aerobic growth conditions the OGDHC not only catalyzes a key reaction in the TCA cycle, it also provides succinyl-CoA for methionine and lysine biosynthesis, the latter pathway also leading to peptidoglycan biosynthesis. The synthesis of the OGDHC is repressed by anaerobiosis and is also subject to glucose repression. It is induced by aerobic growth on acetate. (EcoCyc)</description>
      <pathwhiz_id>PW002108</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Ethylene Glycol Degradation</name>
      <description>Although wild-type E. coli is unable to utilize ethylene glycol as a carbon source, mutant strains can be isolated that can utilize it. Such strains carry two regulatory mutations: one that elevates the levels of propanediol oxidoreductase, the normal function of which is to metabolize propanediol, and the other that elevates the levels of aldehyde reductases, an enzyme of low specificity which participates in the degradation of fucose. (EcoCyc)</description>
      <pathwhiz_id>PW002093</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>L-threonine degradation to methylglyoxal</name>
      <description>L-threonine is degrade into methylglyoxal (pyruvaldehyde) by first reacting with a NDA dependent threonine dehydrogenase resulting in the release of a hydrogen ion, an NADH and a 2-amino-3-oxobutanoate. The latter compound reacts spontaneously with a hydrogen ion resulting in the release of a carbon dioxide and a aminoacetone. The aminoacetone in turn reacts with an oxygen and a water molecule through an aminoacetone oxidase resulting in the release of a hydrogen peroxide, ammonium and a methylglyoxal which can then be incorporated in the methylglyoxal degradation pathways.</description>
      <pathwhiz_id>PW002106</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>NAD phosphorylation and dephosphorylation</name>
      <description>NAD kinases have been characterized in organisms from a variety of taxonomic groups including archaea, eubacteria and eukaryotes. The NAD kinase of Salmonella enterica has been shown to be essential for growth and evidence for its essentiality in E. coli has been presented.
In contrast, NADP phosphatases (NADPases) remain poorly characterized despite their important role. Although an NAD kinase homolog in the archaeon Methanococcus jannaschii was shown to also have NADP phosphatase activity, NADP phosphatases from eubacterial and eukaryotic sources still require identification of the genes encoding them and further study of their enzymatic properties. In E. coli the product of cysQ showed high NADP and NADPH phosphatase activities, but kinetic studies of the purified enzyme suggested that it is not the true NADP phosphatase of this organism. Reviewed in. (EcoCyc)</description>
      <pathwhiz_id>PW002081</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>adenosine nucleotides degradation</name>
      <description>The degradation of of adenosine nucleotides starts with AMP reacting with water through a nucleoside monophosphate phosphatase results in the release of phosphate and a adenosine. Adenosine reacts with water and hydrogen ion through an adenosine deaminase resulting in the release of ammonium and a inosine. Inosine reacts with phosphate through a inosine phosphorylase resulting in the release of an alpha-D-ribose-1-phosphate and an hypoxanthine. Hypoxanthine reacts with a water molecule and a NAD molecule through an hypoxanthine hydroxylase resulting in the release of an hydrogen ion, an NADH and a xanthine. Xanthine in turn is degraded by reacting with a water molecule and a NAD through xanthine NAD oxidoreductase resulting in the release of NADH, a hydrogen ion and urate.</description>
      <pathwhiz_id>PW002091</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>methylglyoxal degradation III</name>
      <description>In E. coli there are several pathways for the removal of methylglyoxal. In this pathway, methylglyoxal is reduced to acetol by the action of various enzymes possessing methylglyoxal reductase activity. Most of the enzymes that have been characterized with this activity belong to the NADPH-dependent aldo-keto reductase subfamily of the aldo-keto reductase (AKR) superfamily. AKRs are found in both prokaryotes and eukaryotes and catalyze the reduction of carbonyl-containing aldehyde and/or ketone containing compounds to their corresponding alcohols. A few dual-specificity AKRs are also able to utilize NADH. An AKR from E. coli has been identified that is NADH-specific (AKR11B2, the product of gene ydjG). AKRs have been of considerable interest in metabolic engineering studies.
E. coli K-12 enzymes homologous to mammalian AKRs have been shown to catalyze the methylglyoxal reductase reaction. Overexpression of the aldo-keto reductase AKR14A1, encoded by the yghZ gene, leads to increased resistance to methylglyoxal. In addition, three other genes yeaE (yeaE), dkgA (yqhE), and dkgB (yafB) were shown to encode proteins with similar activities. All four proteins were purified, and shown to catalyze the reaction in vitro, in the presence of NADPH.
Prolonged incubation of E. coli cell-free extracts with methylglyoxal resulted in conversion of acetol to (S)-propane-1,2-diol. The enzyme proposed to catalyze (S)-propane-1,2-diol production is L-1,2-propanediol dehydrogenase / glycerol dehydrogenase. In bacteria (S)-propane-1,2-diol is a dead-end metabolite and exits the cell rapidly.
Although AKRs can reduce methylglyoxal to acetol, a methylglyoxal reductase (NADPH-dependent) encoded by an unknown gene was purified from E. coli and shown to convert methylglyoxal to lactaldehyde. (EcoCyc)</description>
      <pathwhiz_id>PW002079</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>methylglyoxal degradation IV</name>
      <description>In this pathway, which has been characterized in Escherichia coli K-12, methylglyoxal is reduced to lactaldehyde by the enzyme methylglyoxal reductase. (S)-lactaldehyde is then reduced to (S)-lactate which is finally converted to pyruvate and joins the pool of central metobolites.
Methylglyoxal reductases have been characterized in bacteria and fungi. Some of the enzymes are NADP-linked, while others are NAD-linked. Two variants of this pathway have been entered in MetaCyc to reflect the different biochemistry of the last enzyme, L-lactate dehydrogenase. The Escherichia coli K-12 enzyme encoded by gene lldD uses an unidentified electron acceptor, while the Saccharomyces cerevisiae enzyme uses an an oxidized c-type cytochrome. (EcoCyc)</description>
      <pathwhiz_id>PW002078</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>nitrate reduction VIII</name>
      <description>In the anaerobic respiratory chain formed by NADH dehydrogenase and nitrate reductase the transfer of electrons from NADH to nitrate is coupled to the generation of a proton-motive force (H+/e- = 3) across the cytoplasmic membrane.
E. coli K-12 contains two NADH dehydrogenases - energy conserving NDH-I and NDH-II which does not contribute to the proton gradient; both enzymes appear to be involved in anaerobic nitrate respiration. By analogy to the related enzyme from mitochondria, NDH-I is thought to function as a proton pump translocating 4H+ per NADH oxidised (2e-) [H+/e- = 2] however a lower ratio of 3H+/2e- has also been proposed. Nitrate induces the expression of the nuo operon (encoding NDH-I) in a NarL dependent manner.
E. coli K-12 also contains two energy conserving (H+/e- = 1) nitrate reductases. Expression of nitrate reductase A (NRA) occurs in response to high levels of nitrate in the environment whereas expression of nitrate reductase Z (NRZ) is not dependent on nitrate levels or anaerobiosis.
Quinones are the obligate redox carriers during anaerobic nitrate respiration; the concentration of menaquinone increases in cells grown anaerobically with nitrate while the concentration of ubiquinone decreases (as compared with cells grown aerobically). Nitrate reductase A can use both menaquinol and ubiquinol as electron donors. In anaerobic growth with nitrate the major quinone is demethylmenaquinone (DMK); an E. coli strain containing only demethylmenaquinone is unable to grow with nitrate as terminal reductase.</description>
      <pathwhiz_id>PW002092</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>pyruvate decarboxylation to acetyl CoA</name>
      <description>This multi-enzyme complex, which consists of 24 subunits of pyruvate dehydrogenase, 24 subunits of lipoate acetyltransferase, and 12 subunits of dihydrolipoate dehydrogenase, catalyzes three reactions, which constitute a cycle. The complex contains a lipoyl active site in the form of lipoyllysine, as well as a thiamin diphosphate.

The net consequence of the cycle, in addition to reducing NAD+, is the conversion of pyruvate into acetyl-CoA and CO2, a key reaction of central metabolism because it links glycolysis I, which generates pyruvate, to the TCA cycle, into which the acetyl-CoA flows.
During aerobic growth the cycle is an essential source of acetyl-CoA to feed the TCA cycle and thereby to satisfy the cellular requirements for the precursor metabolites it forms. Mutant strains defective in the complex require an exogenous source of acetate to meet this requirement, but anaerobically such mutants grow without exogenous acetate because under such conditions, pyruvate formate lyase generates acetyl-CoA from pyruvate. Mutant strains lacking pyruvate formate lyase have the reverse phenotype. They require acetate for anaerobic but not for aerobic growth.</description>
      <pathwhiz_id>PW002083</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>pyrimidine deoxyribonucleosides degradation</name>
      <ecocyc_pathway_id>PWY0-1298</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>purine deoxyribonucleosides degradation</name>
      <ecocyc_pathway_id>PWY0-1297</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>mixed acid fermentation</name>
      <ecocyc_pathway_id>FERMENTATION-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>L-ascorbate degradation II (bacterial, aerobic)</name>
      <ecocyc_pathway_id>PWY-6961</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>gluconeogenesis I</name>
      <ecocyc_pathway_id>GLUCONEO-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>glycolysis I</name>
      <ecocyc_pathway_id>GLYCOLYSIS</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>adenosine nucleotides degradation II</name>
      <ecocyc_pathway_id>SALVADEHYPOX-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>fatty acid &amp;beta;-oxidation I</name>
      <ecocyc_pathway_id>FAO-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>phenylacetate degradation I (aerobic)</name>
      <ecocyc_pathway_id>PWY0-321</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>guanosine nucleotides &lt;i&gt;de novo&lt;/i&gt; biosynthesis</name>
      <ecocyc_pathway_id>PWY-6125</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>formylTHF biosynthesis I</name>
      <ecocyc_pathway_id>1CMET2-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>threonine degradation III (to methylglyoxal)</name>
      <ecocyc_pathway_id>THRDLCTCAT-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>phenylethylamine degradation I</name>
      <ecocyc_pathway_id>2PHENDEG-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>glycine cleavage complex</name>
      <ecocyc_pathway_id>GLYCLEAV-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>arginine degradation II (AST pathway)</name>
      <ecocyc_pathway_id>AST-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>guanosine nucleotides degradation III</name>
      <ecocyc_pathway_id>PWY-6608</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>respiration (anaerobic)</name>
      <ecocyc_pathway_id>ANARESP1-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>glyoxylate cycle</name>
      <ecocyc_pathway_id>GLYOXYLATE-BYPASS</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>TCA cycle I (prokaryotic)</name>
      <ecocyc_pathway_id>TCA</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>glycine betaine biosynthesis I (Gram-negative bacteria)</name>
      <ecocyc_pathway_id>BETSYN-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>ethanol degradation I</name>
      <ecocyc_pathway_id>ETOH-ACETYLCOA-ANA-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>glycolate and glyoxylate degradation I</name>
      <ecocyc_pathway_id>GLYCOLATEMET-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>threonine degradation II</name>
      <ecocyc_pathway_id>THREONINE-DEG2-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>threonine degradation IV</name>
      <ecocyc_pathway_id>PWY-5436</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>mannitol degradation I</name>
      <ecocyc_pathway_id>MANNIDEG-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>sorbitol degradation II</name>
      <ecocyc_pathway_id>SORBDEG-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>glycerol degradation V</name>
      <ecocyc_pathway_id>GLYCEROLMETAB-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>polymyxin resistance</name>
      <ecocyc_pathway_id>PWY0-1338</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>colanic acid building blocks biosynthesis</name>
      <ecocyc_pathway_id>COLANSYN-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>proline degradation</name>
      <ecocyc_pathway_id>PROUT-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>histidine biosynthesis</name>
      <ecocyc_pathway_id>HISTSYN-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>isoleucine biosynthesis I (from threonine)</name>
      <ecocyc_pathway_id>LEUSYN-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>4-aminobutyrate degradation I</name>
      <ecocyc_pathway_id>PWY-6535</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>homoserine biosynthesis</name>
      <ecocyc_pathway_id>SERSYN-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>pyridoxal 5'-phosphate biosynthesis I</name>
      <ecocyc_pathway_id>PYRIDOXSYN-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>putrescine degradation I</name>
      <ecocyc_pathway_id>PUTDEG-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>enterobacterial common antigen biosynthesis</name>
      <ecocyc_pathway_id>ECASYN-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>tyrosine biosynthesis I</name>
      <ecocyc_pathway_id>TYRSYN</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>NADH to fumarate electron transfer</name>
      <ecocyc_pathway_id>PWY0-1336</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>cinnamate and 3-hydroxycinnamate degradation to 2-oxopent-4-enoate</name>
      <ecocyc_pathway_id>PWY-6690</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>L-lactaldehyde degradation (aerobic)</name>
      <ecocyc_pathway_id>PWY0-1317</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>fatty acid elongation -- saturated</name>
      <ecocyc_pathway_id>FASYN-ELONG-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>palmitate biosynthesis II (bacteria and plants)</name>
      <ecocyc_pathway_id>PWY-5971</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>methylglyoxal degradation III</name>
      <ecocyc_pathway_id>PWY-5453</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>NAD phosphorylation and dephosphorylation</name>
      <ecocyc_pathway_id>NADPHOS-DEPHOS-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>acetyl-CoA biosynthesis I (pyruvate dehydrogenase complex)</name>
      <ecocyc_pathway_id>PYRUVDEHYD-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>superpathway of glycolysis, pyruvate dehydrogenase, TCA, and glyoxylate bypass</name>
      <ecocyc_pathway_id>GLYCOLYSIS-TCA-GLYOX-BYPASS</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>D-malate degradation</name>
      <ecocyc_pathway_id>PWY0-1465</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>2,3-dihydroxybenzoate biosynthesis</name>
      <ecocyc_pathway_id>PWY-5901</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>2-oxopentenoate degradation</name>
      <ecocyc_pathway_id>PWY-5162</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>3-phenylpropionate and 3-(3-hydroxyphenyl)propionate degradation to 2-oxopent-4-enoate</name>
      <ecocyc_pathway_id>HCAMHPDEG-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>NADH to dimethyl sulfoxide electron transfer</name>
      <ecocyc_pathway_id>PWY0-1348</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>nitrate reduction VIII (dissimilatory)</name>
      <ecocyc_pathway_id>PWY0-1352</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>NADH to trimethylamine N-oxide electron transfer</name>
      <ecocyc_pathway_id>PWY0-1347</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>NADH to cytochrome &lt;i&gt;bd&lt;/i&gt; oxidase electron transfer</name>
      <ecocyc_pathway_id>PWY0-1334</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>NADH to cytochrome &lt;i&gt;bo&lt;/i&gt; oxidase electron transfer</name>
      <ecocyc_pathway_id>PWY0-1335</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>ethylene glycol degradation</name>
      <ecocyc_pathway_id>PWY0-1280</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>D-arabinose degradation I</name>
      <ecocyc_pathway_id>DARABCATK12-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>&amp;beta;-D-glucuronide and D-glucuronate degradation</name>
      <ecocyc_pathway_id>GLUCUROCAT-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>D-galacturonate degradation I</name>
      <ecocyc_pathway_id>GALACTUROCAT-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>galactitol degradation</name>
      <ecocyc_pathway_id>GALACTITOLCAT-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>L-galactonate degradation</name>
      <ecocyc_pathway_id>PWY0-1306</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>L-lactaldehyde degradation (anaerobic)</name>
      <ecocyc_pathway_id>PWY0-1315</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>siroheme biosynthesis</name>
      <ecocyc_pathway_id>PWY-5194</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>2-ketoglutarate dehydrogenase complex</name>
      <ecocyc_pathway_id>PWY-5084</ecocyc_pathway_id>
    </pathway>
  </pathways>
  <spectra>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>20201</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>676620</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>676621</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>676622</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>676623</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>676624</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>676625</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>676626</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>676627</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>676628</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>676629</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>676630</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>676631</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>676632</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>676633</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>676634</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>676635</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>676636</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>676637</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>676638</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>676639</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>676640</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>676641</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>676642</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>676643</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>5177</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>147840</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>147841</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>147842</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>147843</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>147844</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>147845</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>147846</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>147847</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>147848</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>147849</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>147850</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>147851</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>147852</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>147853</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>147854</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>147855</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>147856</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>147857</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>147858</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>147859</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>26882</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>26883</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>26884</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>33440</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>33441</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>33442</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>1218127</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>1218128</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>1218129</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>1471109</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>1471110</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>1471111</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>1471124</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>1471125</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2230977</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2233239</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2252254</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2254225</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2254291</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2256282</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2256350</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2258221</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2258408</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2260183</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2432008</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrTwoD</type>
      <spectrum_id>2011</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrTwoD</type>
      <spectrum_id>2012</spectrum_id>
    </spectrum>
  </spectra>
  <hmdb_id>HMDB01487</hmdb_id>
  <pubchem_compound_id>928</pubchem_compound_id>
  <chemspider_id>903</chemspider_id>
  <kegg_id>C00004</kegg_id>
  <chebi_id>16908</chebi_id>
  <biocyc_id>NADH</biocyc_id>
  <het_id>NAI</het_id>
  <wikipidia>NADH</wikipidia>
  <foodb_id/>
  <general_references>
    <reference>
      <reference_text>Keseler, I. M., Collado-Vides, J., Santos-Zavaleta, A., Peralta-Gil, M., Gama-Castro, S., Muniz-Rascado, L., Bonavides-Martinez, C., Paley, S., Krummenacker, M., Altman, T., Kaipa, P., Spaulding, A., Pacheco, J., Latendresse, M., Fulcher, C., Sarker, M., Shearer, A. G., Mackie, A., Paulsen, I., Gunsalus, R. P., Karp, P. D. (2011). "EcoCyc: a comprehensive database of Escherichia coli biology." Nucleic Acids Res 39:D583-D590.</reference_text>
      <pubmed_id>21097882</pubmed_id>
    </reference>
    <reference>
      <reference_text>Kanehisa, M., Goto, S., Sato, Y., Furumichi, M., Tanabe, M. (2012). "KEGG for integration and interpretation of large-scale molecular data sets." Nucleic Acids Res 40:D109-D114.</reference_text>
      <pubmed_id>22080510</pubmed_id>
    </reference>
    <reference>
      <reference_text>van der Werf, M. J., Overkamp, K. M., Muilwijk, B., Coulier, L., Hankemeier, T. (2007). "Microbial metabolomics: toward a platform with full metabolome coverage." Anal Biochem 370:17-25.</reference_text>
      <pubmed_id>17765195</pubmed_id>
    </reference>
    <reference>
      <reference_text>Bennett, B. D., Kimball, E. H., Gao, M., Osterhout, R., Van Dien, S. J., Rabinowitz, J. D. (2009). "Absolute metabolite concentrations and implied enzyme active site occupancy in Escherichia coli." Nat Chem Biol 5:593-599.</reference_text>
      <pubmed_id>19561621</pubmed_id>
    </reference>
    <reference>
      <reference_text>Krotz F, Sohn HY, Gloe T, Zahler S, Riexinger T, Schiele TM, Becker BF, Theisen K, Klauss V, Pohl U: NAD(P)H oxidase-dependent platelet superoxide anion release increases platelet recruitment. Blood. 2002 Aug 1;100(3):917-24.</reference_text>
      <pubmed_id>12130503</pubmed_id>
    </reference>
    <reference>
      <reference_text>Yamamoto T, Moriwaki Y, Takahashi S, Suda M, Higashino K: Ethanol as a xanthine dehydrogenase inhibitor.  Metabolism. 1995 Jun;44(6):779-85.</reference_text>
      <pubmed_id>7783663</pubmed_id>
    </reference>
    <reference>
      <reference_text>Nadlinger K, Westerthaler W, Storga-Tomic D, Birkmayer JG: Extracellular metabolisation of NADH by blood cells correlates with intracellular ATP levels. Biochim Biophys Acta. 2002 Nov 14;1573(2):177-82.</reference_text>
      <pubmed_id>12399028</pubmed_id>
    </reference>
    <reference>
      <reference_text>Saada A, Bar-Meir M, Belaiche C, Miller C, Elpeleg O: Evaluation of enzymatic assays and compounds affecting ATP production in mitochondrial respiratory chain complex I deficiency. Anal Biochem. 2004 Dec 1;335(1):66-72.</reference_text>
      <pubmed_id>15519572</pubmed_id>
    </reference>
    <reference>
      <reference_text>Heiman-Patterson TD, Argov Z, Chavin JM, Kalman B, Alder H, DiMauro S, Bank W, Tahmoush AJ: Biochemical and genetic studies in a family with mitochondrial myopathy.  Muscle Nerve. 1997 Oct;20(10):1219-24.</reference_text>
      <pubmed_id>9324076</pubmed_id>
    </reference>
    <reference>
      <reference_text>Mintun MA, Vlassenko AG, Rundle MM, Raichle ME: Increased lactate/pyruvate ratio augments blood flow in physiologically activated human brain. Proc Natl Acad Sci U S A. 2004 Jan 13;101(2):659-64. Epub 2004 Jan 2.</reference_text>
      <pubmed_id>14704276</pubmed_id>
    </reference>
    <reference>
      <reference_text>Yeo SF, Zhang Y, Schafer D, Campbell S, Wong B: A rapid, automated enzymatic fluorometric assay for determination of D-arabinitol in serum. J Clin Microbiol. 2000 Apr;38(4):1439-43.</reference_text>
      <pubmed_id>10747122</pubmed_id>
    </reference>
    <reference>
      <reference_text>Uppal A, Ghosh N, Datta A, Gupta PK: Fluorimetric estimation of the concentration of NADH from human blood samples. Biotechnol Appl Biochem. 2005 Feb;41(Pt 1):43-7.</reference_text>
      <pubmed_id>15035655</pubmed_id>
    </reference>
    <reference>
      <reference_text>Yamamoto T, Moriwaki Y, Takahashi S, Suda M, Higashino K: Xylitol-induced increase in the concentration of oxypurines and its mechanism. Int J Clin Pharmacol Ther. 1995 Jun;33(6):360-5.</reference_text>
      <pubmed_id>7582389</pubmed_id>
    </reference>
    <reference>
      <reference_text>Helge JW, Fraser AM, Kriketos AD, Jenkins AB, Calvert GD, Ayre KJ, Storlien LH: Interrelationships between muscle fibre type, substrate oxidation and body fat. Int J Obes Relat Metab Disord. 1999 Sep;23(9):986-91.</reference_text>
      <pubmed_id>10490806</pubmed_id>
    </reference>
    <reference>
      <reference_text>Fulco M, Schiltz RL, Iezzi S, King MT, Zhao P, Kashiwaya Y, Hoffman E, Veech RL, Sartorelli V: Sir2 regulates skeletal muscle differentiation as a potential sensor of the redox state. Mol Cell. 2003 Jul;12(1):51-62.</reference_text>
      <pubmed_id>12887892</pubmed_id>
    </reference>
    <reference>
      <reference_text>Li D, Gan Y, Wientjes MG, Badalament RA, Au JL: Distribution of DT-diaphorase and reduced nicotinamide adenine dinucleotide phosphate: cytochrome p450 oxidoreductase in bladder tissues and tumors. J Urol. 2001 Dec;166(6):2500-5.</reference_text>
      <pubmed_id>11696818</pubmed_id>
    </reference>
    <reference>
      <reference_text>Desir G, Bratusch-Marrain P, DeFronzo RA: Effect of hyperketonemia on renal ammonia excretion in man.  Metabolism. 1986 Aug;35(8):736-43.</reference_text>
      <pubmed_id>3736414</pubmed_id>
    </reference>
    <reference>
      <reference_text>Odland LM, Heigenhauser GJ, Spriet LL: Effects of high fat provision on muscle PDH activation and malonyl-CoA content in moderate exercise. J Appl Physiol. 2000 Dec;89(6):2352-8.</reference_text>
      <pubmed_id>11090589</pubmed_id>
    </reference>
    <reference>
      <reference_text>Rani K, Garg P, Pundir CS: Measurement of bile acid in serum and bile with arylamine-glass-bound 3alpha-hydroxysteroid dehydrogenase and diaphorase. Anal Biochem. 2004 Sep 1;332(1):32-7.</reference_text>
      <pubmed_id>15301946</pubmed_id>
    </reference>
    <reference>
      <reference_text>Nomura H, Koike F, Tsuruta Y, Iwaki A, Iwaki T: Autopsy case of autosomal recessive hereditary spastic paraplegia with reference to the muscular pathology. Neuropathology. 2001 Sep;21(3):212-7.</reference_text>
      <pubmed_id>11666018</pubmed_id>
    </reference>
    <reference>
      <reference_text>Orallo F, Alvarez E, Camina M, Leiro JM, Gomez E, Fernandez P: The possible implication of trans-Resveratrol in the cardioprotective effects of long-term moderate wine consumption. Mol Pharmacol. 2002 Feb;61(2):294-302.</reference_text>
      <pubmed_id>11809853</pubmed_id>
    </reference>
    <reference>
      <reference_text>Jawed S, Stevens CR, Harrison R, Blake DR: Elevated circulating plasma NADH oxidising activity of xanthine oxidoreductase in plasma. Biochem Soc Trans. 1997 Aug;25(3):531S.</reference_text>
      <pubmed_id>9388747</pubmed_id>
    </reference>
    <reference>
      <reference_text>Harbord MG, Hwang PA, Robinson BH, Becker LE, Hunjan A, Murphy EG: Infant-onset progressive myoclonus epilepsy.  J Child Neurol. 1991 Apr;6(2):134-42.</reference_text>
      <pubmed_id>1904460</pubmed_id>
    </reference>
    <reference>
      <reference_text>Mayevsky A, Meilin S, Manor T, Ornstein E, Zarchin N, Sonn J: Multiparametric monitoring of brain oxygen balance under experimental and clinical conditions. Neurol Res. 1998;20 Suppl 1:S76-80.</reference_text>
      <pubmed_id>9584930</pubmed_id>
    </reference>
    <reference>
      <reference_text>Biellmann JF, Lapinte C, Haid E, Weimann G: Structure of lactate dehydrogenase inhibitor generated from coenzyme. Biochemistry. 1979 Apr 3;18(7):1212-7.</reference_text>
      <pubmed_id>218616</pubmed_id>
    </reference>
    <reference>
      <reference_text>Lin SJ, Guarente L: Nicotinamide adenine dinucleotide, a metabolic regulator of transcription, longevity and disease. Curr Opin Cell Biol. 2003 Apr;15(2):241-6.</reference_text>
      <pubmed_id>12648681</pubmed_id>
    </reference>
    <reference>
      <reference_text>Belenky P, Bogan KL, Brenner C: NAD+ metabolism in health and disease. Trends Biochem Sci. 2007 Jan;32(1):12-9. Epub 2006 Dec 11.</reference_text>
      <pubmed_id>17161604</pubmed_id>
    </reference>
    <reference>
      <reference_text>Pollak N, Dolle C, Ziegler M: The power to reduce: pyridine nucleotides--small molecules with a multitude of functions. Biochem J. 2007 Mar 1;402(2):205-18.</reference_text>
      <pubmed_id>17295611</pubmed_id>
    </reference>
    <reference>
      <reference_text>Khan JA, Forouhar F, Tao X, Tong L: Nicotinamide adenine dinucleotide metabolism as an attractive target for drug discovery. Expert Opin Ther Targets. 2007 May;11(5):695-705.</reference_text>
      <pubmed_id>17465726</pubmed_id>
    </reference>
    <reference>
      <reference_text>WholeHealthMD: http://www.wholehealthmd.com/ME2/dirmod.asp?sid=17E09E7CFFF640448FFB0B4FC1B7FEF0&amp;nm=Reference+Library&amp;type=AWHN_Supplements&amp;mod=Supplements&amp;mid=&amp;id=F8DDC620C82D41D1A6FBEDDD38337F63&amp;tier=2</reference_text>
      <pubmed_id/>
    </reference>
  </general_references>
  <synthesis_reference>Marek, Miroslav; Vrbova, Eva; Horakova, Irena; Musil, Petr; Kefurt, Karel.  NADH manufacture with immobilized Candida formate dehydrogenase.    Czech.  (1992),     4 pp.</synthesis_reference>
  <msds_url>http://hmdb.ca/system/metabolites/msds/000/001/349/original/NADH_msds.pdf?1368650512</msds_url>
  <enzymes>
    <enzyme>
      <name>NADP-specific glutamate dehydrogenase</name>
      <uniprot_id>P00370</uniprot_id>
      <uniprot_name>DHE4_ECOLI</uniprot_name>
      <gene_name>gdhA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P00370.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH dehydrogenase</name>
      <uniprot_id>P00393</uniprot_id>
      <uniprot_name>DHNA_ECOLI</uniprot_name>
      <gene_name>ndh</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P00393.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Bifunctional aspartokinase/homoserine dehydrogenase 1</name>
      <uniprot_id>P00561</uniprot_id>
      <uniprot_name>AK1H_ECOLI</uniprot_name>
      <gene_name>thrA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P00561.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Bifunctional aspartokinase/homoserine dehydrogenase 2</name>
      <uniprot_id>P00562</uniprot_id>
      <uniprot_name>AK2H_ECOLI</uniprot_name>
      <gene_name>metL</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P00562.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Dihydrodipicolinate reductase</name>
      <uniprot_id>P04036</uniprot_id>
      <uniprot_name>DAPB_ECOLI</uniprot_name>
      <gene_name>dapB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P04036.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Erythronate-4-phosphate dehydrogenase</name>
      <uniprot_id>P05459</uniprot_id>
      <uniprot_name>PDXB_ECOLI</uniprot_name>
      <gene_name>pdxB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P05459.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Sorbitol-6-phosphate 2-dehydrogenase</name>
      <uniprot_id>P05707</uniprot_id>
      <uniprot_name>SRLD_ECOLI</uniprot_name>
      <gene_name>srlD</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P05707.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>D-lactate dehydrogenase</name>
      <uniprot_id>P06149</uniprot_id>
      <uniprot_name>DLD_ECOLI</uniprot_name>
      <gene_name>dld</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P06149.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Glutathione reductase</name>
      <uniprot_id>P06715</uniprot_id>
      <uniprot_name>GSHR_ECOLI</uniprot_name>
      <gene_name>gor</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P06715.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Dihydrolipoyllysine-residue acetyltransferase component of pyruvate dehydrogenase complex</name>
      <uniprot_id>P06959</uniprot_id>
      <uniprot_name>ODP2_ECOLI</uniprot_name>
      <gene_name>aceF</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P06959.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Histidinol dehydrogenase</name>
      <uniprot_id>P06988</uniprot_id>
      <uniprot_name>HISX_ECOLI</uniprot_name>
      <gene_name>hisD</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P06988.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NAD(P) transhydrogenase subunit alpha</name>
      <uniprot_id>P07001</uniprot_id>
      <uniprot_name>PNTA_ECOLI</uniprot_name>
      <gene_name>pntA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P07001.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>T-protein</name>
      <uniprot_id>P07023</uniprot_id>
      <uniprot_name>TYRA_ECOLI</uniprot_name>
      <gene_name>tyrA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P07023.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Formate dehydrogenase H</name>
      <uniprot_id>P07658</uniprot_id>
      <uniprot_name>FDHF_ECOLI</uniprot_name>
      <gene_name>fdhF</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P07658.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>L-threonine 3-dehydrogenase</name>
      <uniprot_id>P07913</uniprot_id>
      <uniprot_name>TDH_ECOLI</uniprot_name>
      <gene_name>tdh</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P07913.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Nitrite reductase [NAD(P)H] large subunit</name>
      <uniprot_id>P08201</uniprot_id>
      <uniprot_name>NIRB_ECOLI</uniprot_name>
      <gene_name>nirB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P08201.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>UDP-N-acetylenolpyruvoylglucosamine reductase</name>
      <uniprot_id>P08373</uniprot_id>
      <uniprot_name>MURB_ECOLI</uniprot_name>
      <gene_name>murB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P08373.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Mannitol-1-phosphate 5-dehydrogenase</name>
      <uniprot_id>P09424</uniprot_id>
      <uniprot_name>MTLD_ECOLI</uniprot_name>
      <gene_name>mtlD</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P09424.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Bifunctional protein putA</name>
      <uniprot_id>P09546</uniprot_id>
      <uniprot_name>PUTA_ECOLI</uniprot_name>
      <gene_name>putA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P09546.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Glutamate synthase [NADPH] large chain</name>
      <uniprot_id>P09831</uniprot_id>
      <uniprot_name>GLTB_ECOLI</uniprot_name>
      <gene_name>gltB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P09831.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Glutamate synthase [NADPH] small chain</name>
      <uniprot_id>P09832</uniprot_id>
      <uniprot_name>GLTD_ECOLI</uniprot_name>
      <gene_name>gltD</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P09832.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Cysteine desulfurase</name>
      <uniprot_id>P0A6B7</uniprot_id>
      <uniprot_name>ISCS_ECOLI</uniprot_name>
      <gene_name>iscS</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A6B7.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Quinate/shikimate dehydrogenase</name>
      <uniprot_id>P0A6D5</uniprot_id>
      <uniprot_name>YDIB_ECOLI</uniprot_name>
      <gene_name>ydiB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A6D5.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Altronate oxidoreductase</name>
      <uniprot_id>P0A6L7</uniprot_id>
      <uniprot_name>UXAB_ECOLI</uniprot_name>
      <gene_name>uxaB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A6L7.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Glycerol-3-phosphate dehydrogenase [NAD(P)+]</name>
      <uniprot_id>P0A6S7</uniprot_id>
      <uniprot_name>GPDA_ECOLI</uniprot_name>
      <gene_name>gpsA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A6S7.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Pyridoxine 5'-phosphate synthase</name>
      <uniprot_id>P0A794</uniprot_id>
      <uniprot_name>PDXJ_ECOLI</uniprot_name>
      <gene_name>pdxJ</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A794.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>3-oxoacyl-[acyl-carrier-protein] synthase 1</name>
      <uniprot_id>P0A953</uniprot_id>
      <uniprot_name>FABB_ECOLI</uniprot_name>
      <gene_name>fabB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A953.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Glyceraldehyde-3-phosphate dehydrogenase A</name>
      <uniprot_id>P0A9B2</uniprot_id>
      <uniprot_name>G3P1_ECOLI</uniprot_name>
      <gene_name>gapA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A9B2.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>D-erythrose-4-phosphate dehydrogenase</name>
      <uniprot_id>P0A9B6</uniprot_id>
      <uniprot_name>E4PD_ECOLI</uniprot_name>
      <gene_name>epd</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A9B6.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Nitrite reductase [NAD(P)H] small subunit</name>
      <uniprot_id>P0A9I8</uniprot_id>
      <uniprot_name>NIRD_ECOLI</uniprot_name>
      <gene_name>nirD</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A9I8.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Pyrroline-5-carboxylate reductase</name>
      <uniprot_id>P0A9L8</uniprot_id>
      <uniprot_name>P5CR_ECOLI</uniprot_name>
      <gene_name>proC</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A9L8.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Dihydrolipoyl dehydrogenase</name>
      <uniprot_id>P0A9P0</uniprot_id>
      <uniprot_name>DLDH_ECOLI</uniprot_name>
      <gene_name>lpdA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A9P0.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Aldehyde-alcohol dehydrogenase</name>
      <uniprot_id>P0A9Q7</uniprot_id>
      <uniprot_name>ADHE_ECOLI</uniprot_name>
      <gene_name>adhE</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A9Q7.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Lactaldehyde reductase</name>
      <uniprot_id>P0A9S1</uniprot_id>
      <uniprot_name>FUCO_ECOLI</uniprot_name>
      <gene_name>fucO</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A9S1.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Galactitol-1-phosphate 5-dehydrogenase</name>
      <uniprot_id>P0A9S3</uniprot_id>
      <uniprot_name>GATD_ECOLI</uniprot_name>
      <gene_name>gatD</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A9S3.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Glycerol dehydrogenase</name>
      <uniprot_id>P0A9S5</uniprot_id>
      <uniprot_name>GLDA_ECOLI</uniprot_name>
      <gene_name>gldA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A9S5.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>D-3-phosphoglycerate dehydrogenase</name>
      <uniprot_id>P0A9T0</uniprot_id>
      <uniprot_name>SERA_ECOLI</uniprot_name>
      <gene_name>serA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A9T0.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Formate dehydrogenase, nitrate-inducible, iron-sulfur subunit</name>
      <uniprot_id>P0AAJ3</uniprot_id>
      <uniprot_name>FDNH_ECOLI</uniprot_name>
      <gene_name>fdnH</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AAJ3.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Formate dehydrogenase-O iron-sulfur subunit</name>
      <uniprot_id>P0AAJ5</uniprot_id>
      <uniprot_name>FDOH_ECOLI</uniprot_name>
      <gene_name>fdoH</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AAJ5.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NAD(P) transhydrogenase subunit beta</name>
      <uniprot_id>P0AB67</uniprot_id>
      <uniprot_name>PNTB_ECOLI</uniprot_name>
      <gene_name>pntB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AB67.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>2-hydroxy-3-oxopropionate reductase</name>
      <uniprot_id>P0ABQ2</uniprot_id>
      <uniprot_name>GARR_ECOLI</uniprot_name>
      <gene_name>garR</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0ABQ2.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Dihydrofolate reductase</name>
      <uniprot_id>P0ABQ4</uniprot_id>
      <uniprot_name>DYR_ECOLI</uniprot_name>
      <gene_name>folA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0ABQ4.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>3-phenylpropionate/cinnamic acid dioxygenase subunit alpha</name>
      <uniprot_id>P0ABR5</uniprot_id>
      <uniprot_name>HCAE_ECOLI</uniprot_name>
      <gene_name>hcaE</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0ABR5.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>3-phenylpropionate/cinnamic acid dioxygenase ferredoxin subunit</name>
      <uniprot_id>P0ABW0</uniprot_id>
      <uniprot_name>HCAC_ECOLI</uniprot_name>
      <gene_name>hcaC</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0ABW0.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Inosine-5'-monophosphate dehydrogenase</name>
      <uniprot_id>P0ADG7</uniprot_id>
      <uniprot_name>IMDH_ECOLI</uniprot_name>
      <gene_name>guaB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0ADG7.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Siroheme synthase</name>
      <uniprot_id>P0AEA8</uniprot_id>
      <uniprot_name>CYSG_ECOLI</uniprot_name>
      <gene_name>cysG</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AEA8.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Enoyl-[acyl-carrier-protein] reductase [NADH]</name>
      <uniprot_id>P0AEK4</uniprot_id>
      <uniprot_name>FABI_ECOLI</uniprot_name>
      <gene_name>fabI</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AEK4.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Formate dehydrogenase, nitrate-inducible, cytochrome b556(fdn) subunit</name>
      <uniprot_id>P0AEK7</uniprot_id>
      <uniprot_name>FDNI_ECOLI</uniprot_name>
      <gene_name>fdnI</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AEK7.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Formate dehydrogenase, cytochrome b556(fdo) subunit</name>
      <uniprot_id>P0AEL0</uniprot_id>
      <uniprot_name>FDOI_ECOLI</uniprot_name>
      <gene_name>fdoI</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AEL0.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NAD(P)H-flavin reductase</name>
      <uniprot_id>P0AEN1</uniprot_id>
      <uniprot_name>FRE_ECOLI</uniprot_name>
      <gene_name>fre</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AEN1.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>7-alpha-hydroxysteroid dehydrogenase</name>
      <uniprot_id>P0AET8</uniprot_id>
      <uniprot_name>HDHA_ECOLI</uniprot_name>
      <gene_name>hdhA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AET8.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>5,10-methylenetetrahydrofolate reductase</name>
      <uniprot_id>P0AEZ1</uniprot_id>
      <uniprot_name>METF_ECOLI</uniprot_name>
      <gene_name>metF</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AEZ1.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit A</name>
      <uniprot_id>P0AFC3</uniprot_id>
      <uniprot_name>NUOA_ECOLI</uniprot_name>
      <gene_name>nuoA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AFC3.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit B</name>
      <uniprot_id>P0AFC7</uniprot_id>
      <uniprot_name>NUOB_ECOLI</uniprot_name>
      <gene_name>nuoB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AFC7.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit E</name>
      <uniprot_id>P0AFD1</uniprot_id>
      <uniprot_name>NUOE_ECOLI</uniprot_name>
      <gene_name>nuoE</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AFD1.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit H</name>
      <uniprot_id>P0AFD4</uniprot_id>
      <uniprot_name>NUOH_ECOLI</uniprot_name>
      <gene_name>nuoH</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AFD4.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit I</name>
      <uniprot_id>P0AFD6</uniprot_id>
      <uniprot_name>NUOI_ECOLI</uniprot_name>
      <gene_name>nuoI</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AFD6.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit J</name>
      <uniprot_id>P0AFE0</uniprot_id>
      <uniprot_name>NUOJ_ECOLI</uniprot_name>
      <gene_name>nuoJ</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AFE0.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit K</name>
      <uniprot_id>P0AFE4</uniprot_id>
      <uniprot_name>NUOK_ECOLI</uniprot_name>
      <gene_name>nuoK</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AFE4.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit M</name>
      <uniprot_id>P0AFE8</uniprot_id>
      <uniprot_name>NUOM_ECOLI</uniprot_name>
      <gene_name>nuoM</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AFE8.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit N</name>
      <uniprot_id>P0AFF0</uniprot_id>
      <uniprot_name>NUON_ECOLI</uniprot_name>
      <gene_name>nuoN</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AFF0.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>2-oxoglutarate dehydrogenase E1 component</name>
      <uniprot_id>P0AFG3</uniprot_id>
      <uniprot_name>ODO1_ECOLI</uniprot_name>
      <gene_name>sucA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AFG3.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex</name>
      <uniprot_id>P0AFG6</uniprot_id>
      <uniprot_name>ODO2_ECOLI</uniprot_name>
      <gene_name>sucB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AFG6.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Pyruvate dehydrogenase E1 component</name>
      <uniprot_id>P0AFG8</uniprot_id>
      <uniprot_name>ODP1_ECOLI</uniprot_name>
      <gene_name>aceE</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AFG8.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Dihydrofolate reductase folM</name>
      <uniprot_id>P0AFS3</uniprot_id>
      <uniprot_name>FOLM_ECOLI</uniprot_name>
      <gene_name>folM</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AFS3.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>2,3-dihydro-2,3-dihydroxybenzoate dehydrogenase</name>
      <uniprot_id>P15047</uniprot_id>
      <uniprot_name>ENTA_ECOLI</uniprot_name>
      <gene_name>entA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P15047.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Choline dehydrogenase</name>
      <uniprot_id>P17444</uniprot_id>
      <uniprot_name>BETA_ECOLI</uniprot_name>
      <gene_name>betA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P17444.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Betaine aldehyde dehydrogenase</name>
      <uniprot_id>P17445</uniprot_id>
      <uniprot_name>BETB_ECOLI</uniprot_name>
      <gene_name>betB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P17445.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>4-hydroxythreonine-4-phosphate dehydrogenase</name>
      <uniprot_id>P19624</uniprot_id>
      <uniprot_name>PDXA_ECOLI</uniprot_name>
      <gene_name>pdxA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P19624.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Biotin sulfoxide reductase</name>
      <uniprot_id>P20099</uniprot_id>
      <uniprot_name>BISC_ECOLI</uniprot_name>
      <gene_name>bisC</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P20099.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Fatty acid oxidation complex subunit alpha</name>
      <uniprot_id>P21177</uniprot_id>
      <uniprot_name>FADB_ECOLI</uniprot_name>
      <gene_name>fadB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P21177.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Gamma-glutamyl-gamma-aminobutyraldehyde dehydrogenase</name>
      <uniprot_id>P23883</uniprot_id>
      <uniprot_name>PUUC_ECOLI</uniprot_name>
      <gene_name>puuC</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P23883.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Formate dehydrogenase, nitrate-inducible, major subunit</name>
      <uniprot_id>P24183</uniprot_id>
      <uniprot_name>FDNG_ECOLI</uniprot_name>
      <gene_name>fdnG</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P24183.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Flavohemoprotein</name>
      <uniprot_id>P24232</uniprot_id>
      <uniprot_name>HMP_ECOLI</uniprot_name>
      <gene_name>hmp</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P24232.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>S-(hydroxymethyl)glutathione dehydrogenase</name>
      <uniprot_id>P25437</uniprot_id>
      <uniprot_name>FRMA_ECOLI</uniprot_name>
      <gene_name>frmA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P25437.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Succinate-semialdehyde dehydrogenase [NADP+]</name>
      <uniprot_id>P25526</uniprot_id>
      <uniprot_name>GABD_ECOLI</uniprot_name>
      <gene_name>gabD</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P25526.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Lactaldehyde dehydrogenase</name>
      <uniprot_id>P25553</uniprot_id>
      <uniprot_name>ALDA_ECOLI</uniprot_name>
      <gene_name>aldA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P25553.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NAD-dependent malic enzyme</name>
      <uniprot_id>P26616</uniprot_id>
      <uniprot_name>MAO1_ECOLI</uniprot_name>
      <gene_name>sfcA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P26616.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Aminomethyltransferase</name>
      <uniprot_id>P27248</uniprot_id>
      <uniprot_name>GCST_ECOLI</uniprot_name>
      <gene_name>gcvT</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P27248.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Soluble pyridine nucleotide transhydrogenase</name>
      <uniprot_id>P27306</uniprot_id>
      <uniprot_name>STHA_ECOLI</uniprot_name>
      <gene_name>sthA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P27306.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>UDP-N-acetyl-D-mannosamine dehydrogenase</name>
      <uniprot_id>P27829</uniprot_id>
      <uniprot_name>WECC_ECOLI</uniprot_name>
      <gene_name>wecC</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P27829.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>3-isopropylmalate dehydrogenase</name>
      <uniprot_id>P30125</uniprot_id>
      <uniprot_name>LEU3_ECOLI</uniprot_name>
      <gene_name>leuB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P30125.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Molybdopterin synthase sulfur carrier subunit</name>
      <uniprot_id>P30748</uniprot_id>
      <uniprot_name>MOAD_ECOLI</uniprot_name>
      <gene_name>moaD</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P30748.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit F</name>
      <uniprot_id>P31979</uniprot_id>
      <uniprot_name>NUOF_ECOLI</uniprot_name>
      <gene_name>nuoF</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P31979.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Formate dehydrogenase-O major subunit</name>
      <uniprot_id>P32176</uniprot_id>
      <uniprot_name>FDOG_ECOLI</uniprot_name>
      <gene_name>fdoG</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P32176.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH pyrophosphatase</name>
      <uniprot_id>P32664</uniprot_id>
      <uniprot_name>NUDC_ECOLI</uniprot_name>
      <gene_name>nudC</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P32664.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Glycine dehydrogenase [decarboxylating]</name>
      <uniprot_id>P33195</uniprot_id>
      <uniprot_name>GCSP_ECOLI</uniprot_name>
      <gene_name>gcvP</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P33195.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit C/D</name>
      <uniprot_id>P33599</uniprot_id>
      <uniprot_name>NUOCD_ECOLI</uniprot_name>
      <gene_name>nuoC</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P33599.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit G</name>
      <uniprot_id>P33602</uniprot_id>
      <uniprot_name>NUOG_ECOLI</uniprot_name>
      <gene_name>nuoG</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P33602.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit L</name>
      <uniprot_id>P33607</uniprot_id>
      <uniprot_name>NUOL_ECOLI</uniprot_name>
      <gene_name>nuoL</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P33607.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Glyoxylate/hydroxypyruvate reductase B</name>
      <uniprot_id>P37666</uniprot_id>
      <uniprot_name>GHRB_ECOLI</uniprot_name>
      <gene_name>ghrB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P37666.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>2,3-diketo-L-gulonate reductase</name>
      <uniprot_id>P37672</uniprot_id>
      <uniprot_name>DLGD_ECOLI</uniprot_name>
      <gene_name>dlgD</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P37672.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>dTDP-4-dehydrorhamnose reductase</name>
      <uniprot_id>P37760</uniprot_id>
      <uniprot_name>RMLD_ECOLI</uniprot_name>
      <gene_name>rfbD</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P37760.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>2-dehydro-3-deoxy-D-gluconate 5-dehydrogenase</name>
      <uniprot_id>P37769</uniprot_id>
      <uniprot_name>KDUD_ECOLI</uniprot_name>
      <gene_name>kduD</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P37769.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Oxygen-insensitive NAD(P)H nitroreductase</name>
      <uniprot_id>P38489</uniprot_id>
      <uniprot_name>NFNB_ECOLI</uniprot_name>
      <gene_name>nfnB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P38489.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>D-mannonate oxidoreductase</name>
      <uniprot_id>P39160</uniprot_id>
      <uniprot_name>UXUB_ECOLI</uniprot_name>
      <gene_name>uxuB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P39160.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>L-idonate 5-dehydrogenase</name>
      <uniprot_id>P39346</uniprot_id>
      <uniprot_name>IDND_ECOLI</uniprot_name>
      <gene_name>idnD</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P39346.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Alcohol dehydrogenase, propanol-preferring</name>
      <uniprot_id>P39451</uniprot_id>
      <uniprot_name>ADHP_ECOLI</uniprot_name>
      <gene_name>adhP</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P39451.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>D-lactate dehydrogenase_</name>
      <uniprot_id>P52643</uniprot_id>
      <uniprot_name>LDHD_ECOLI</uniprot_name>
      <gene_name>ldhA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P52643.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Lipoyl synthase</name>
      <uniprot_id>P60716</uniprot_id>
      <uniprot_name>LIPA_ECOLI</uniprot_name>
      <gene_name>lipA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P60716.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Malate dehydrogenase</name>
      <uniprot_id>P61889</uniprot_id>
      <uniprot_name>MDH_ECOLI</uniprot_name>
      <gene_name>mdh</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P61889.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>4-hydroxy-3-methylbut-2-enyl diphosphate reductase</name>
      <uniprot_id>P62623</uniprot_id>
      <uniprot_name>ISPH_ECOLI</uniprot_name>
      <gene_name>ispH</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P62623.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Hydroxylamine reductase</name>
      <uniprot_id>P75825</uniprot_id>
      <uniprot_name>HCP_ECOLI</uniprot_name>
      <gene_name>hcp</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P75825.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Glyoxylate/hydroxypyruvate reductase A</name>
      <uniprot_id>P75913</uniprot_id>
      <uniprot_name>GHRA_ECOLI</uniprot_name>
      <gene_name>ghrA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P75913.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Probable enoyl-CoA hydratase paaF</name>
      <uniprot_id>P76082</uniprot_id>
      <uniprot_name>PAAF_ECOLI</uniprot_name>
      <gene_name>paaF</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P76082.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Probable 3-hydroxybutyryl-CoA dehydrogenase</name>
      <uniprot_id>P76083</uniprot_id>
      <uniprot_name>PAAH_ECOLI</uniprot_name>
      <gene_name>paaH</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P76083.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>N-succinylglutamate 5-semialdehyde dehydrogenase</name>
      <uniprot_id>P76217</uniprot_id>
      <uniprot_name>ASTD_ECOLI</uniprot_name>
      <gene_name>astD</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P76217.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>D-malate dehydrogenase [decarboxylating]</name>
      <uniprot_id>P76251</uniprot_id>
      <uniprot_name>DMLA_ECOLI</uniprot_name>
      <gene_name>dmlA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P76251.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>UDP-glucose 6-dehydrogenase</name>
      <uniprot_id>P76373</uniprot_id>
      <uniprot_name>UDG_ECOLI</uniprot_name>
      <gene_name>ugd</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P76373.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>2-hydroxy-3-oxopropionate reductase_</name>
      <uniprot_id>P77161</uniprot_id>
      <uniprot_name>GLXR_ECOLI</uniprot_name>
      <gene_name>glxR</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P77161.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Putative xanthine dehydrogenase yagS FAD-binding subunit</name>
      <uniprot_id>P77324</uniprot_id>
      <uniprot_name>YAGS_ECOLI</uniprot_name>
      <gene_name>yagS</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P77324.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Bifunctional polymyxin resistance protein ArnA</name>
      <uniprot_id>P77398</uniprot_id>
      <uniprot_name>ARNA_ECOLI</uniprot_name>
      <gene_name>arnA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P77398.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Fatty acid oxidation complex subunit alpha_</name>
      <uniprot_id>P77399</uniprot_id>
      <uniprot_name>FADJ_ECOLI</uniprot_name>
      <gene_name>fadJ</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P77399.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Putative xanthine dehydrogenase yagR molybdenum-binding subunit</name>
      <uniprot_id>P77489</uniprot_id>
      <uniprot_name>YAGR_ECOLI</uniprot_name>
      <gene_name>yagR</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P77489.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Ureidoglycolate dehydrogenase</name>
      <uniprot_id>P77555</uniprot_id>
      <uniprot_name>ALLD_ECOLI</uniprot_name>
      <gene_name>allD</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P77555.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Acetaldehyde dehydrogenase</name>
      <uniprot_id>P77580</uniprot_id>
      <uniprot_name>ACDH_ECOLI</uniprot_name>
      <gene_name>mhpF</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P77580.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>3-phenylpropionate/cinnamic acid dioxygenase ferredoxin--NAD(+) reductase component</name>
      <uniprot_id>P77650</uniprot_id>
      <uniprot_name>HCAD_ECOLI</uniprot_name>
      <gene_name>hcaD</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P77650.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Gamma-aminobutyraldehyde dehydrogenase</name>
      <uniprot_id>P77674</uniprot_id>
      <uniprot_name>ABDH_ECOLI</uniprot_name>
      <gene_name>ydcW</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P77674.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>FMN reductase</name>
      <uniprot_id>P80644</uniprot_id>
      <uniprot_name>SSUE_ECOLI</uniprot_name>
      <gene_name>ssuE</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P80644.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Phenylacetaldehyde dehydrogenase</name>
      <uniprot_id>P80668</uniprot_id>
      <uniprot_name>FEAB_ECOLI</uniprot_name>
      <gene_name>feaB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P80668.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Xanthine dehydrogenase molybdenum-binding subunit</name>
      <uniprot_id>Q46799</uniprot_id>
      <uniprot_name>XDHA_ECOLI</uniprot_name>
      <gene_name>xdhA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/Q46799.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Xanthine dehydrogenase FAD-binding subunit</name>
      <uniprot_id>Q46800</uniprot_id>
      <uniprot_name>XDHB_ECOLI</uniprot_name>
      <gene_name>xdhB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/Q46800.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Xanthine dehydrogenase iron-sulfur-binding subunit</name>
      <uniprot_id>Q46801</uniprot_id>
      <uniprot_name>XDHC_ECOLI</uniprot_name>
      <gene_name>xdhC</gene_name>
      <protein_url>http://ecmdb.ca/proteins/Q46801.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>3-phenylpropionate/cinnamic acid dioxygenase subunit beta</name>
      <uniprot_id>Q47140</uniprot_id>
      <uniprot_name>HCAF_ECOLI</uniprot_name>
      <gene_name>hcaF</gene_name>
      <protein_url>http://ecmdb.ca/proteins/Q47140.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Aldehyde dehydrogenase-like protein yneI</name>
      <uniprot_id>P76149</uniprot_id>
      <uniprot_name>YNEI_ECOLI</uniprot_name>
      <gene_name>yneI</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P76149.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>UPF0076 protein rutC</name>
      <uniprot_id>P0AFQ5</uniprot_id>
      <uniprot_name>RUTC_ECOLI</uniprot_name>
      <gene_name>rutC</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AFQ5.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>3-phenylpropionate-dihydrodiol/cinnamic acid-dihydrodiol dehydrogenase</name>
      <uniprot_id>P0CI31</uniprot_id>
      <uniprot_name/>
      <gene_name>hcaB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0CI31.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Uncharacterized oxidoreductase yihU</name>
      <uniprot_id>P0A9V8</uniprot_id>
      <uniprot_name>YIHU_ECOLI</uniprot_name>
      <gene_name>yihU</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A9V8.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Putative flavin reductase rutF</name>
      <uniprot_id>P75893</uniprot_id>
      <uniprot_name>RUTF_ECOLI</uniprot_name>
      <gene_name>rutF</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P75893.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Uncharacterized protein yeiA</name>
      <uniprot_id>P25889</uniprot_id>
      <uniprot_name>YEIA_ECOLI</uniprot_name>
      <gene_name>yeiA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P25889.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Putative monooxygenase rutA</name>
      <uniprot_id>P75898</uniprot_id>
      <uniprot_name>RUTA_ECOLI</uniprot_name>
      <gene_name>rutA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P75898.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Uncharacterized oxidoreductase yeiT</name>
      <uniprot_id>P76440</uniprot_id>
      <uniprot_name>YEIT_ECOLI</uniprot_name>
      <gene_name>yeiT</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P76440.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Putative L-galactonate oxidoreductase</name>
      <uniprot_id>P39400</uniprot_id>
      <uniprot_name>YJJN_ECOLI</uniprot_name>
      <gene_name>yjjN</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P39400.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Trimethylamine-N-oxide reductase 1</name>
      <uniprot_id>P33225</uniprot_id>
      <uniprot_name>TORA_ECOLI</uniprot_name>
      <gene_name>torA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P33225.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Cytochrome c-type protein torC</name>
      <uniprot_id>P33226</uniprot_id>
      <uniprot_name>TORC_ECOLI</uniprot_name>
      <gene_name>torC</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P33226.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Phosphomethylpyrimidine synthase</name>
      <uniprot_id>P30136</uniprot_id>
      <uniprot_name>THIC_ECOLI</uniprot_name>
      <gene_name>thiC</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P30136.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Nitric oxide reductase FlRd-NAD(+) reductase</name>
      <uniprot_id>P37596</uniprot_id>
      <uniprot_name>NORW_ECOLI</uniprot_name>
      <gene_name>norW</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P37596.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>3-(3-hydroxy-phenyl)propionate/3-hydroxycinnamic acid hydroxylase</name>
      <uniprot_id>P77397</uniprot_id>
      <uniprot_name>MHPA_ECOLI</uniprot_name>
      <gene_name>mhpA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P77397.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Glycine cleavage system H protein</name>
      <uniprot_id>P0A6T9</uniprot_id>
      <uniprot_name>GCSH_ECOLI</uniprot_name>
      <gene_name>gcvH</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A6T9.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Anaerobic nitric oxide reductase flavorubredoxin</name>
      <uniprot_id>Q46877</uniprot_id>
      <uniprot_name>NORV_ECOLI</uniprot_name>
      <gene_name>norV</gene_name>
      <protein_url>http://ecmdb.ca/proteins/Q46877.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>aldehyde oxidoreductase, ethanolamine utilization protein</name>
      <uniprot_id>P77445</uniprot_id>
      <uniprot_name/>
      <gene_name>eutE</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P77445.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>predicted Fe-containing alcohol dehydrogenase, Pfam00465 family</name>
      <uniprot_id>P37686</uniprot_id>
      <uniprot_name/>
      <gene_name>yiaY</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P37686.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>ethanol dehydrogenase involved in ethanolamine utilization; aldehyde reductase, converts acetaldehyde to ethanol</name>
      <uniprot_id>P76553</uniprot_id>
      <uniprot_name/>
      <gene_name>eutG</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P76553.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>PaoABC aldehyde oxidoreductase, 2Fe-2S subunit</name>
      <uniprot_id>P77165</uniprot_id>
      <uniprot_name/>
      <gene_name>paoA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P77165.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>predicted 2Fe-2S cluster-containing protein</name>
      <uniprot_id>P0ABR7</uniprot_id>
      <uniprot_name/>
      <gene_name>yeaW</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0ABR7.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>nitroreductase A, NADPH-dependent, FMN-dependent (EC:1.-.-.-)</name>
      <uniprot_id>P17117</uniprot_id>
      <uniprot_name/>
      <gene_name>nfsA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P17117.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>N-ethylmaleimide reductase, FMN-linked (EC:1.-.-.-)</name>
      <uniprot_id>P77258</uniprot_id>
      <uniprot_name/>
      <gene_name>nemA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P77258.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Uncharacterized protein yjeF</name>
      <uniprot_id>P31806</uniprot_id>
      <uniprot_name>YJEF_ECOLI</uniprot_name>
      <gene_name>yjeF</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P31806.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Starvation-sensing protein RspB</name>
      <uniprot_id>P38105</uniprot_id>
      <uniprot_name>RSPB_ECOLI</uniprot_name>
      <gene_name>rspB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P38105.xml</protein_url>
    </enzyme>
  </enzymes>
  <transporters>
    <enzyme>
      <name>Fatty acid oxidation complex subunit alpha</name>
      <uniprot_id>P21177</uniprot_id>
      <uniprot_name>FADB_ECOLI</uniprot_name>
      <gene_name>fadB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P21177.xml</protein_url>
    </enzyme>
  </transporters>
  <reactions>
    <reaction_text>1-Deoxy-D-xylulose 5-phosphate + NAD + O-Phospho-4-hydroxy-L-threonine &gt; Carbon dioxide + Hydrogen ion +2 Water + NADH + Pyridoxine 5'-phosphate + Phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Coenzyme A + NAD + Pyruvic acid &gt; Acetyl-CoA + Carbon dioxide + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>PYRUVDEH-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>alpha-Ketoglutarate + Coenzyme A + NAD &gt; Carbon dioxide + NADH + Succinyl-CoA</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Acetaldehyde + Coenzyme A + NAD &lt;&gt; Acetyl-CoA + Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id>R00228</kegg_reaction_id>
    <ecocyc_id>ACETALD-DEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Tartronate semialdehyde + Hydrogen ion + NADH &lt;&gt; Glyceric acid + NAD</reaction_text>
    <kegg_reaction_id>R01745</kegg_reaction_id>
    <ecocyc_id>RXN0-5289</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Flavin Mononucleotide + Hydrogen ion + NADH &gt; FMNH + NAD</reaction_text>
    <kegg_reaction_id>R05705</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + NADH + Oxygen + Uracil &gt; NAD + Ureidoacrylate peracid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + Hydroxypyruvic acid + NADH &gt; Glyceric acid + NAD</reaction_text>
    <kegg_reaction_id>R01388</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Ethanol + NAD &lt;&gt; Acetaldehyde + Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id>R00754</kegg_reaction_id>
    <ecocyc_id>ALCOHOL-DEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>NADH + NADP + 2 Hydrogen ion &gt;2 Hydrogen ion + NAD + NADPH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>D-Lactic acid + NAD &lt;&gt; Hydrogen ion + NADH + Pyruvic acid</reaction_text>
    <kegg_reaction_id>R00704</kegg_reaction_id>
    <ecocyc_id>DLACTDEHYDROGNAD-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Dihydrouracil + NAD &lt;&gt; Hydrogen ion + NADH + Uracil</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>DIHYDROURACIL-DEHYDROGENASE-NAD+-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>2-Demethylmenaquinone 8 + 4 Hydrogen ion + NADH &gt; 2-Demethylmenaquinol 8 + NAD +3 Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>4 Hydrogen ion + NADH + Ubiquinone-8 &gt; NAD + Ubiquinol-8 +3 Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>4 Hydrogen ion + Menaquinone 8 + NADH &gt; Menaquinol 8 + NAD +3 Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>IscS with bound sulfur + MoaD Protein with bound AMP + NADH &gt; Adenosine monophosphate + IscS sulfur acceptor protein + MoaD Protein with thiocarboxylate + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>trans-Cinnamic acid + Hydrogen ion + NADH + Oxygen &gt; cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD</reaction_text>
    <kegg_reaction_id>R06783</kegg_reaction_id>
    <ecocyc_id>RXN-12072</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + NADH + Oxygen + Hydrocinnamic acid &gt; Cis-3-(3-carboxyethyl)-3,5-cyclohexadiene-1,2-diol + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + NADH + 2 Nitric oxide &gt; Water + Nitrous oxide + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Water + Hypoxanthine + NAD &gt; Hydrogen ion + NADH + Xanthine</reaction_text>
    <kegg_reaction_id>R01768</kegg_reaction_id>
    <ecocyc_id>RXN-7682</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Water + NAD + Xanthine &lt;&gt; Hydrogen ion + NADH + Uric acid</reaction_text>
    <kegg_reaction_id>R02103</kegg_reaction_id>
    <ecocyc_id>RXN0-901</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Glycine + NAD + Tetrahydrofolic acid &gt; Carbon dioxide + 5,10-Methylene-THF + NADH + Ammonium</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>D-Erythrose 4-phosphate + Water + NAD &lt;&gt; 4-Phospho-D-erythronate +2 Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id>R01825</kegg_reaction_id>
    <ecocyc_id>ERYTH4PDEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>5 Hydrogen ion + 3 NADH + Nitrite &gt;2 Water +3 NAD + Ammonium</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Glyoxylic acid + Hydrogen ion + NADH &gt; Glycolic acid + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Acetoacetyl-CoA + Hydrogen ion + NADH &lt;&gt; 3-Hydroxybutyryl-CoA + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3-Oxotetradecanoyl-CoA + Hydrogen ion + NADH &lt;&gt; (S)-3-Hydroxytetradecanoyl-CoA + NAD</reaction_text>
    <kegg_reaction_id>R04739</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3-Oxododecanoyl-CoA + Hydrogen ion + NADH &lt;&gt; (S)-3-Hydroxydodecanoyl-CoA + NAD</reaction_text>
    <kegg_reaction_id>R04741</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3-Oxodecanoyl-CoA + Hydrogen ion + NADH &lt;&gt; (S)-Hydroxydecanoyl-CoA + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3-Oxooctanoyl-CoA + Hydrogen ion + NADH &lt;&gt; (S)-Hydroxyoctanoyl-CoA + NAD</reaction_text>
    <kegg_reaction_id>R04745</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3-Oxohexanoyl-CoA + Hydrogen ion + NADH &lt;&gt; (S)-Hydroxyhexanoyl-CoA + NAD</reaction_text>
    <kegg_reaction_id>R04748</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3-Oxohexadecanoyl-CoA + Hydrogen ion + NADH &lt;&gt; (S)-3-Hydroxyhexadecanoyl-CoA + NAD</reaction_text>
    <kegg_reaction_id>R04737</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3-Oxooctadecanoyl-CoA + Hydrogen ion + NADH &lt;&gt; (S)-3-Hydroxyoctadecanoyl-CoA + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>NAD + NADPH &lt;&gt; NADH + NADP</reaction_text>
    <kegg_reaction_id>R00112</kegg_reaction_id>
    <ecocyc_id>PYRNUTRANSHYDROGEN-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH &gt; Water + Isopentenyl pyrophosphate + NAD</reaction_text>
    <kegg_reaction_id>R08209</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH &gt; Dimethylallylpyrophosphate + Water + NAD</reaction_text>
    <kegg_reaction_id>R08210</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3-Isopropylmalate + NAD &gt; 2-Isopropyl-3-oxosuccinate + Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id>R04426</kegg_reaction_id>
    <ecocyc_id>3-ISOPROPYLMALDEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Choline + NAD &gt; Betaine aldehyde + Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Betaine aldehyde + Water + NAD &lt;&gt; Betaine +2 Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id>R02565</kegg_reaction_id>
    <ecocyc_id>BADH-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>3-(3-Hydroxyphenyl)propanoic acid + Hydrogen ion + NADH + Oxygen &gt; 3-(2,3-Dihydroxyphenyl)propionic acid + Water + NAD</reaction_text>
    <kegg_reaction_id>R06786</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3-Hydroxycinnamic acid + Hydrogen ion + NADH + Oxygen &gt; Trans-2,3-Dihydroxycinnamate + Water + NAD</reaction_text>
    <kegg_reaction_id>R06787</kegg_reaction_id>
    <ecocyc_id>RXN-10040</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>D-Glyceraldehyde + Hydrogen ion + NADH &lt;&gt; Glycerol + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>S-(Hydroxymethyl)glutathione + NAD &lt;&gt; S-Formylglutathione + Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id>R06983</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>NAD + (S)-Ureidoglycolic acid &lt;&gt; Hydrogen ion + NADH + Oxalureate</reaction_text>
    <kegg_reaction_id>R02935</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>6,7-Dihydropteridine + 3 Hydrogen ion + NADH &lt;&gt; NAD + Tetrahydropteridine</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>(2S,3S)-2,3-Dihydro-2,3-dihydroxybenzoate + NAD + 2,3-Dihydro-2,3-dihydroxybenzoic acid &lt;&gt; 2-Pyrocatechuic acid + Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id>R01505</kegg_reaction_id>
    <ecocyc_id>DHBDEHYD-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>[4Fe-4S] iron-sulfur cluster + 2 S-Adenosylmethionine + Hydrogen ion + NAD + octanoate (protein bound) &gt; [2Fe-2S] iron-sulfur cluster +2 5'-Deoxyadenosine +2 Iron + lipoate (protein bound) +2 L-Methionine + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>NADH + Peroxyaminoacrylate &gt; 3-Aminoacrylate + Water + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-D-1-Pyrroline-5-carboxylic acid + 2 Water + NAD &gt; L-Glutamate + Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id>R00707</kegg_reaction_id>
    <ecocyc_id>PYRROLINECARBDEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>2-Demethylmenaquinone 8 + Hydrogen ion + NADH &gt; 2-Demethylmenaquinol 8 + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + NADH + Ubiquinone-8 &gt; NAD + Ubiquinol-8</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + Menaquinone 8 + NADH &gt; Menaquinol 8 + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>But-2-enoyl-[acyl-carrier protein] + Hydrogen ion + NADH &gt; Butyryl-ACP (n-C4:0ACP) + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + NADH + trans-3-cis-11-vacceoyl-[acyl-carrier protein] &gt; NAD + cis-octadec-11-enoyl-[acyl-carrier protein] (n-C18:1)</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + NADH + trans-3-cis-5-dodecenoyl-[acyl-carrier protein] &gt; cis-dodec-5-enoyl-[acyl-carrier protein] (n-C12:1) + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + NADH + trans-3-cis-7-myristoleoyl-[acyl-carrier protein] &gt; NAD + cis-tetradec-7-enoyl-[acyl-carrier protein] (n-C14:1)</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + NADH + trans-3-cis-9-palmitoleoyl-[acyl-carrier protein] &gt; cis-hexadec-9-enoyl-[acyl-carrier protein] (n-C16:1) + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + NADH + trans-Dec-2-enoyl-[acyl-carrier protein] &gt; Decanoyl-ACP (n-C10:0ACP) + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + NADH + trans-Dodec-2-enoyl-[acyl-carrier protein] &gt; Dodecanoyl-ACP (n-C12:0ACP) + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + NADH + trans-Hex-2-enoyl-[acyl-carrier protein] &gt; Hexanoyl-ACP (n-C6:0ACP) + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + NADH + trans-Hexadec-2-enoyl-[acyl-carrier protein] &gt; NAD + Palmitoyl-ACP (n-C16:0ACP)</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + NADH + trans-Oct-2-enoyl-[acyl-carrier protein] &gt; NAD + Octanoyl-ACP (n-C8:0ACP)</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + NADH + trans-octadec-2-enoyl-[acyl-carrier protein] &gt; NAD + Octadecanoyl-ACP (n-C18:0ACP)</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + NADH + trans-Tetradec-2-enoyl-[acyl-carrier protein] &gt; Myristoyl-ACP (n-C14:0ACP) + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Acetaldehyde + Water + NAD &gt; Acetic acid +2 Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Water + NAD + Phenylacetaldehyde &lt;&gt;2 Hydrogen ion + NADH + Benzeneacetic acid</reaction_text>
    <kegg_reaction_id>R02536</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>(3S)-3-Hydroxyadipyl-CoA + NAD &lt;&gt; Hydrogen ion + NADH + 3-Oxoadipyl-CoA</reaction_text>
    <kegg_reaction_id>R06941</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Water + Lactaldehyde + NAD + (S)-Lactaldehyde &lt;&gt;2 Hydrogen ion + L-Lactic acid + NADH</reaction_text>
    <kegg_reaction_id>R01446</kegg_reaction_id>
    <ecocyc_id>LACTALDDEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Glycolaldehyde + Water + NAD &gt; Glycolic acid +2 Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id>R01333</kegg_reaction_id>
    <ecocyc_id>GLYCOLALD-DEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>4-Aminobutyraldehyde + Water + NAD &lt;&gt; gamma-Aminobutyric acid +2 Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id>R02549</kegg_reaction_id>
    <ecocyc_id>AMINOBUTDEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>L-Malic acid + NAD &gt; Carbon dioxide + NADH + Pyruvic acid</reaction_text>
    <kegg_reaction_id>R00214</kegg_reaction_id>
    <ecocyc_id>MALIC-NAD-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>D-Altronate + NAD &lt;&gt; Hydrogen ion + NADH + 5-Keto-D-gluconate + D-Tagaturonate</reaction_text>
    <kegg_reaction_id>R02555</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Water + NAD + Succinic acid semialdehyde &gt;2 Hydrogen ion + NADH + Succinic acid</reaction_text>
    <kegg_reaction_id>R00713</kegg_reaction_id>
    <ecocyc_id>SUCCINATE-SEMIALDEHYDE-DEHYDROGENASE-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>NAD + Quinate &lt;&gt; 3-Dehydroquinate +2 Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id>R01872</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Water + NAD + N2-Succinyl-L-glutamic acid 5-semialdehyde &lt;&gt;2 Hydrogen ion + NADH + N-Succinyl-L-glutamate</reaction_text>
    <kegg_reaction_id>R05049</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>D-Glyceraldehyde 3-phosphate + NAD + Phosphate &lt;&gt; Glyceric acid 1,3-biphosphate + Hydrogen ion + NADH + 3-phospho-D-glyceroyl phosphate</reaction_text>
    <kegg_reaction_id>R01061</kegg_reaction_id>
    <ecocyc_id>GAPOXNPHOSPHN-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>(R)-Malate + NAD &lt;&gt; Carbon dioxide + NADH + Pyruvic acid</reaction_text>
    <kegg_reaction_id>R00215</kegg_reaction_id>
    <ecocyc_id>1.1.1.83-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Water + L-Histidinol + 2 NAD &gt;3 Hydrogen ion + L-Histidine +2 NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Water + 2 NAD + UDP-Glucose &lt;&gt;3 Hydrogen ion +2 NADH + Uridine diphosphate glucuronic acid + UDP-Glucuronic acid</reaction_text>
    <kegg_reaction_id>R00286</kegg_reaction_id>
    <ecocyc_id>UGD-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Galactitol 1-phosphate + NAD &lt;&gt; Hydrogen ion + NADH + D-Tagatose 6-phosphate</reaction_text>
    <kegg_reaction_id>R05571</kegg_reaction_id>
    <ecocyc_id>GALACTITOLPDEHYD-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>NAD + Uridine diphosphate glucuronic acid &gt; Carbon dioxide + NADH + UDP-4-Keto-pyranose</reaction_text>
    <kegg_reaction_id>R07658</kegg_reaction_id>
    <ecocyc_id>RXN0-1861</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>4-Phospho-D-erythronate + NAD &lt;&gt; Hydrogen ion + NADH + 2-Oxo-3-hydroxy-4-phosphobutanoic acid</reaction_text>
    <kegg_reaction_id>R04210</kegg_reaction_id>
    <ecocyc_id>ERYTHRON4PDEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Water + Inosinic acid + NAD &lt;&gt; Hydrogen ion + NADH + Xanthylic acid</reaction_text>
    <kegg_reaction_id>R01130</kegg_reaction_id>
    <ecocyc_id>IMP-DEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD &gt; Trans-2,3-Dihydroxycinnamate + Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id>R06785</kegg_reaction_id>
    <ecocyc_id>RXN-12071</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Cis-3-(3-carboxyethyl)-3,5-cyclohexadiene-1,2-diol + NAD &gt; 3-(2,3-Dihydroxyphenyl)propionic acid + Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>NADH + 2 Nitric oxide + 2 Oxygen &gt; Hydrogen ion + NAD +2 Nitrate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>NAD + Prephenate &gt; 4-Hydroxyphenylpyruvic acid + Carbon dioxide + NADH</reaction_text>
    <kegg_reaction_id>R01728</kegg_reaction_id>
    <ecocyc_id>PREPHENATEDEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>NAD + Sorbitol-6-phosphate &lt;&gt; Fructose 6-phosphate + Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>MANNPDEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + Lactaldehyde + NADH &lt;&gt; (S)-Propane-1,2-diol + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3-Phosphoglycerate + NAD &gt; Phosphohydroxypyruvic acid + Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>PGLYCDEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>L-Malic acid + NAD &lt;&gt; Hydrogen ion + NADH + Oxalacetic acid</reaction_text>
    <kegg_reaction_id>R00342</kegg_reaction_id>
    <ecocyc_id>MALATE-DEH-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Precorrin 2 + NAD &gt; Hydrogen ion + NADH + Sirohydrochlorin</reaction_text>
    <kegg_reaction_id>R03947</kegg_reaction_id>
    <ecocyc_id>DIMETHUROPORDEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>D-Biotin D-sulfoxide + Hydrogen ion + NADH &gt; Biotin + Water + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2 -Dehydro-L-gulonate + Hydrogen ion + NADH &gt; Gluconic acid + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2 -Dehydro-L-gulonate + Hydrogen ion + NADH &gt; D-Galactonate + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2,5-Diketo-D-gluconate + Hydrogen ion + NADH &gt; 5-Keto-D-gluconate + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2,3-Diketo-L-gulonate + Hydrogen ion + NADH &gt; 3-Dehydro-L-gulonate + NAD</reaction_text>
    <kegg_reaction_id>R02637</kegg_reaction_id>
    <ecocyc_id>RXN0-703</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>NAD + L-Threonine &lt;&gt; L-2-Amino-3-oxobutanoic acid + Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id>R01465</kegg_reaction_id>
    <ecocyc_id>THREODEHYD-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Water + 2 NAD + UDP-N-Acetyl-D-mannosamine &lt;&gt;3 Hydrogen ion +2 NADH + UDP-N-Acetyl-D-mannosaminouronate</reaction_text>
    <kegg_reaction_id>R03317</kegg_reaction_id>
    <ecocyc_id>UDPMANNACADEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>FAD + Hydrogen ion + NADH &gt; FADH2 + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + NADH + Riboflavin &gt; NAD + Reduced riboflavin</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + NADH + Succinic acid semialdehyde &lt;&gt; gamma-Hydroxybutyrate + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>4-HYDROXYBUTYRATE-DEHYDROGENASE-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>2 Hydrogen ion + 5,10-Methylene-THF + NADH &gt; 5-Methyltetrahydrofolic acid + NAD</reaction_text>
    <kegg_reaction_id>R07168</kegg_reaction_id>
    <ecocyc_id>1.5.1.20-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Acetol + Hydrogen ion + NADH &gt; (R)-Propane-1,2-diol + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Glycerol + NAD &lt;&gt; Dihydroxyacetone + Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id>R01034</kegg_reaction_id>
    <ecocyc_id>GLYCDEH-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Aminoacetone + Hydrogen ion + NADH &lt;&gt; 1-Amino-2-propanol + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>AMINOPROPDEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + Pyruvaldehyde + NADH &gt; D-Lactaldehyde + NAD</reaction_text>
    <kegg_reaction_id>R02527</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>5-Aminoimidazole ribonucleotide + Water + NAD &gt; 4-Amino-2-methyl-5-phosphomethylpyrimidine +2 Formic acid +3 Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>5-Keto-D-gluconate + Hydrogen ion + NADH &lt;&gt; D-Galactonate + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>D-Mannonate + NAD &lt;&gt; D-Fructuronate + Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id>R02454</kegg_reaction_id>
    <ecocyc_id>MANNONOXIDOREDUCT-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>D-Galactonate + NAD &gt; Hydrogen ion + NADH + 5-Keto-D-gluconate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2 L-Glutamate + NAD &lt;&gt; L-Glutamine + alpha-Ketoglutarate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R00093</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2 Glutathione + NAD &lt;&gt; Glutathione disulfide + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R00094</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>NAD + 2 Cob(II)alamin + 2 Water + Hydrogen ion &lt;&gt; NADH +2 Aquacobalamin</reaction_text>
    <kegg_reaction_id>R00097</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Pyruvaldehyde + NAD + Water &lt;&gt; Pyruvic acid + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R00203</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-Malic acid + NAD &lt;&gt; Pyruvic acid + Carbon dioxide + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R00214</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>(R)-Malate + NAD &lt;&gt; Pyruvic acid + Carbon dioxide + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R00215</kegg_reaction_id>
    <ecocyc_id>1.1.1.83-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>L-Glutamate + NAD + Water &lt;&gt; alpha-Ketoglutarate + Ammonia + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R00243</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-Glutamic-gamma-semialdehyde + NAD + Water &lt;&gt; L-Glutamate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R00245</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>UDP-Glucose + Water + 2 NAD &lt;&gt; Uridine diphosphate glucuronic acid +2 NADH +2 Hydrogen ion</reaction_text>
    <kegg_reaction_id>R00286</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Formic acid + NAD &lt;&gt; Hydrogen ion + Carbon dioxide + NADH</reaction_text>
    <kegg_reaction_id>R00519</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Primary alcohol + NAD &lt;&gt; Aldehyde + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R00623</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-D-1-Pyrroline-5-carboxylic acid + NAD + 2 Water &lt;&gt; L-Glutamate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R00707</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Succinic acid semialdehyde + NAD + Water &lt;&gt; Succinic acid + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R00713</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Ammonium hydroxide + 3 NAD + Water + Ammonia &lt;&gt; Nitrite +3 NADH +3 Hydrogen ion</reaction_text>
    <kegg_reaction_id>R00787</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Glycerol 3-phosphate + NAD &lt;&gt; Dihydroxyacetone phosphate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R00842</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Tetrahydrofolic acid + NAD &lt;&gt; Dihydrofolic acid + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R00936</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Tetrahydrofolic acid + 2 NAD &lt;&gt; Folic acid +2 NADH +2 Hydrogen ion</reaction_text>
    <kegg_reaction_id>R00937</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2-Ketobutyric acid + Carbon dioxide + NADH + Hydrogen ion &lt;&gt; D-Erythro-3-Methylmalate + NAD</reaction_text>
    <kegg_reaction_id>R00994</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>D-Glyceraldehyde 3-phosphate + Phosphate + NAD &lt;&gt; Glyceric acid 1,3-biphosphate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01061</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-Histidinal + Water + NAD &lt;&gt; L-Histidine + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01163</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Butanal + Coenzyme A + NAD &lt;&gt; Butanoyl-CoA + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01172</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Glycine + Tetrahydrofolic acid + NAD &lt;&gt; 5,10-Methylene-THF + Ammonia + Carbon dioxide + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01221</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-Proline + NAD &lt;&gt; L-D-1-Pyrroline-5-carboxylic acid + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01248</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Glycolaldehyde + NAD + Water &lt;&gt; Glycolic acid + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01333</kegg_reaction_id>
    <ecocyc_id>GLYCOLALD-DEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Glyceric acid + NAD &lt;&gt; Hydroxypyruvic acid + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01388</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Lactaldehyde + NAD + Water &lt;&gt; L-Lactic acid + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01446</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>(2S,3S)-2,3-Dihydro-2,3-dihydroxybenzoate + NAD &lt;&gt; 2-Pyrocatechuic acid + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01505</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3-Phospho-D-glycerate + NAD &lt;&gt; Phosphohydroxypyruvic acid + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01513</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2-Keto-3-deoxy-D-gluconic acid + NAD &lt;&gt; (4S)-4,6-Dihydroxy-2,5-dioxohexanoate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01542</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Dihydrolipoamide + NAD &lt;&gt; Lipoamide + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01698</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Prephenate + NAD &lt;&gt; 4-Hydroxyphenylpyruvic acid + Carbon dioxide + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01728</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Glyceric acid + NAD &lt;&gt; Tartronate semialdehyde + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01745</kegg_reaction_id>
    <ecocyc_id>RXN0-5289</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Hypoxanthine + NAD + Water &lt;&gt; Xanthine + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01768</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-Homoserine + NAD &lt;&gt; L-Aspartate-semialdehyde + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01773</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Ethylene glycol + NAD &lt;&gt; Glycolaldehyde + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01781</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>D-Erythrose 4-phosphate + NAD + Water &lt;&gt; 4-Phospho-D-erythronate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01825</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Quinate + NAD &lt;&gt; 3-Dehydroquinate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01872</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Oxoadipic acid + Coenzyme A + NAD &lt;&gt; Glutaryl-CoA + Carbon dioxide + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01933</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>(S)-3-Hydroxybutanoyl-CoA + NAD &lt;&gt; Acetoacetyl-CoA + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01975</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2 Reduced rubredoxin + NAD &lt;&gt;2 Oxidized rubredoxin + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R02000</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Retinol + NAD &lt;&gt; Retinal + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R02124</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Dihydrofolic acid + NAD &lt;&gt; Folic acid + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R02235</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Propylene glycol + NAD &lt;&gt; Lactaldehyde + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R02257</kegg_reaction_id>
    <ecocyc_id>LACTALDREDUCT-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>D-Lactaldehyde + NAD &lt;&gt; Pyruvaldehyde + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R02527</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Phenylacetaldehyde + NAD + Water &lt;&gt; Benzeneacetic acid + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R02536</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Meso-Tartaric acid + NAD &lt;&gt; 2-Hydroxy-3-oxosuccinate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R02545</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>4-Aminobutyraldehyde + NAD + Water &lt;&gt; gamma-Aminobutyric acid + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R02549</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>D-Altronate + NAD &lt;&gt; 5-Keto-D-gluconate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R02555</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3-Dehydro-L-gulonate + NAD &lt;&gt; 2,3-Diketo-L-gulonate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R02637</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Sorbitol-6-phosphate + NAD &lt;&gt; beta-D-Fructose 6-phosphate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R05607</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-Histidinol + NAD &lt;&gt; L-Histidinal + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R03012</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>UDP-N-Acetylmuraminate + NAD &lt;&gt; UDP-N-Acetyl-3-(1-carboxyvinyl)-D-glucosamine + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R03191</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hydroxyproline + NAD &lt;&gt; Pyrroline hydroxycarboxylic acid + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R03291</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>UDP-N-Acetyl-D-mannosamine + 2 NAD + Water &lt;&gt; UDP-N-Acetyl-D-mannosaminouronate +2 NADH +2 Hydrogen ion</reaction_text>
    <kegg_reaction_id>R03317</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Dihydrolipoylprotein + NAD &lt;&gt; Lipoylprotein + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R03815</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Precorrin 2 + NAD &lt;&gt; Sirohydrochlorin + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R03947</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Tetrahydrodipicolinate + NAD &lt;&gt; 2,3-Dihydrodipicolinic acid + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R04198</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2-Methyl-3-hydroxybutyryl-CoA + NAD &lt;&gt; 2-Methylacetoacetyl-CoA + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R04203</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3-Isopropylmalate + NAD &lt;&gt; 2-Isopropyl-3-oxosuccinate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R04426</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Butyryl-[acp] + NAD &lt;&gt; But-2-enoyl-[acyl-carrier protein] + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R04429</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Pyrroline hydroxycarboxylic acid + NAD + 2 Water &lt;&gt; L-erythro-4-Hydroxyglutamate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R04444</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Dodecanoyl-[acyl-carrier protein] + NAD &lt;&gt; trans-Dodec-2-enoyl-[acp] + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R04724</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>(S)-3-Hydroxyhexadecanoyl-CoA + NAD &lt;&gt; 3-Oxohexadecanoyl-CoA + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R04737</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>(S)-3-Hydroxytetradecanoyl-CoA + NAD &lt;&gt; 3-Oxotetradecanoyl-CoA + NADH</reaction_text>
    <kegg_reaction_id>R04739</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>(S)-3-Hydroxydodecanoyl-CoA + NAD &lt;&gt; 3-Oxododecanoyl-CoA + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R04741</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>(S)-Hydroxyoctanoyl-CoA + NAD &lt;&gt; 3-Oxooctanoyl-CoA + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R04745</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>(S)-Hydroxyhexanoyl-CoA + NAD &lt;&gt; 3-Oxohexanoyl-CoA + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R04748</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3,4-Dihydroxyphenylglycol + NAD &lt;&gt; 3,4-Dihydroxymandelaldehyde + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R04880</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hexanoyl-[acp] + NAD &lt;&gt; trans-Hex-2-enoyl-[acp] + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R04955</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Octanoyl-[acp] + NAD &lt;&gt; trans-Oct-2-enoyl-[acp] + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R04958</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Decanoyl-[acp] + NAD &lt;&gt; trans-Dec-2-enoyl-[acp] + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R04961</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Tetradecanoyl-[acp] + NAD &lt;&gt; trans-Tetradec-2-enoyl-[acp] + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R04966</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hexadecanoyl-[acp] + NAD &lt;&gt; trans-Hexadec-2-enoyl-[acp] + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R04969</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>N2-Succinyl-L-glutamic acid 5-semialdehyde + NAD + Water &lt;&gt; N-Succinyl-L-glutamate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R05049</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-erythro-4-Hydroxyglutamate + NADH + Hydrogen ion &lt;&gt; L-4-Hydroxyglutamate semialdehyde + NAD + Water</reaction_text>
    <kegg_reaction_id>R05051</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>(S)-3-Hydroxyisobutyrate + NAD &lt;&gt; (S)-Methylmalonic acid semialdehyde + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R05066</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>trans-3-Chloro-2-propene-1-ol + NAD &lt;&gt; trans-3-Chloroallyl aldehyde + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R05233</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>cis-3-Chloro-2-propene-1-ol + NAD &lt;&gt; cis-3-Chloroallyl aldehyde + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R05234</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>4-Chlorobiphenyl + Oxygen + NADH + Hydrogen ion &lt;&gt; cis-2,3-Dihydro-2,3-dihydroxy-4'-chlorobiphenyl + NAD</reaction_text>
    <kegg_reaction_id>R05261</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Biphenyl + Oxygen + NADH + Hydrogen ion &lt;&gt; cis-2,3-Dihydro-2,3-dihydroxybiphenyl + NAD</reaction_text>
    <kegg_reaction_id>R05263</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Ethylbenzene + Oxygen + NADH + Hydrogen ion &lt;&gt; cis-1,2-Dihydro-3-ethylcatechol + NAD</reaction_text>
    <kegg_reaction_id>R05440</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>O-Phospho-4-hydroxy-L-threonine + NAD &lt;&gt; 2-Amino-3-oxo-4-phosphonooxybutyrate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R05681</kegg_reaction_id>
    <ecocyc_id>1.1.1.262-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>FMNH + NAD &lt;&gt; Flavin Mononucleotide + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R05705</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Tartaric acid + NAD &lt;&gt; 2-Hydroxy-3-oxosuccinate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R06180</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hydrocinnamic acid + Oxygen + NADH + Hydrogen ion &lt;&gt; cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD</reaction_text>
    <kegg_reaction_id>R06782</kegg_reaction_id>
    <ecocyc_id>HCAMULTI-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>trans-Cinnamic acid + Oxygen + NADH + Hydrogen ion &lt;&gt; cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD</reaction_text>
    <kegg_reaction_id>R06783</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD &lt;&gt; 3-(2,3-Dihydroxyphenyl)propionic acid + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R06784</kegg_reaction_id>
    <ecocyc_id>PHENPRODIOLDEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD &lt;&gt; Trans-2,3-Dihydroxycinnamate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R06785</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3-(3-Hydroxyphenyl)propanoic acid + Oxygen + NADH + Hydrogen ion &lt;&gt; 3-(2,3-Dihydroxyphenyl)propionic acid + Water + NAD</reaction_text>
    <kegg_reaction_id>R06786</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3-Hydroxycinnamic acid + Oxygen + NADH + Hydrogen ion &lt;&gt; Trans-2,3-Dihydroxycinnamate + Water + NAD</reaction_text>
    <kegg_reaction_id>R06787</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Shikimic acid + NAD &lt;&gt; 3-Dehydro-shikimate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R06847</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Bisphenol A + NADH + Hydrogen ion + Oxygen &lt;&gt; 1,2-Bis(4-hydroxyphenyl)-2-propanol + NAD + Water</reaction_text>
    <kegg_reaction_id>R06883</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2,2-Bis(4-hydroxyphenyl)-1-propanol + NADH + Hydrogen ion + Oxygen &lt;&gt; 2,3-Bis(4-hydroxyphenyl)-1,2-propanediol + NAD + Water</reaction_text>
    <kegg_reaction_id>R06888</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>1-Hydroxymethylnaphthalene + NAD &lt;&gt; 1-Naphthaldehyde + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R06917</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>(2-Naphthyl)methanol + NAD &lt;&gt; 2-Naphthaldehyde + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R06927</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Chloral hydrate + NADH + Hydrogen ion &lt;&gt; Trichloroethanol + NAD + Water</reaction_text>
    <kegg_reaction_id>R07105</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>5-Methyltetrahydrofolic acid + NAD &lt;&gt; 5,10-Methylene-THF + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R07168</kegg_reaction_id>
    <ecocyc_id>1.5.1.20-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>gamma-Glutamyl-gamma-butyraldehyde + NAD + Water &lt;&gt; 4-(Glutamylamino) butanoate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R07417</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Enzyme N6-(dihydrolipoyl)lysine + NAD &lt;&gt; Enzyme N6-(lipoyl)lysine + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R07618</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Uridine diphosphate glucuronic acid + NAD &lt;&gt; UDP-4-Keto-pyranose + Carbon dioxide + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R07658</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>(2E)-Octadecenoyl-[acp] + NADH + Hydrogen ion &lt;&gt; Octadecanoyl-[acyl-carrier protein] + NAD</reaction_text>
    <kegg_reaction_id>R07765</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Trinitrotoluene + 2 NADH + 2 Hydrogen ion &lt;&gt; 4-Hydroxylamino-2,6-dinitrotoluene +2 NAD + Water</reaction_text>
    <kegg_reaction_id>R08017</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Trinitrotoluene + 2 NADH + 2 Hydrogen ion &lt;&gt; 2-Hydroxylamino-4,6-dinitrotoluene +2 NAD + Water</reaction_text>
    <kegg_reaction_id>R08042</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3-Hydroxy-5-methylhex-4-enoyl-CoA + NAD &lt;&gt; 5-Methyl-3-oxo-4-hexenoyl-CoA + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R08094</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Isopentenyl pyrophosphate + NAD + Water &lt;&gt; 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R08209</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Dimethylallylpyrophosphate + NAD + Water &lt;&gt; 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R08210</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>6-Thioinosine-5'-monophosphate + NAD + Water &lt;&gt; 6-Thioxanthine 5'-monophosphate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R08240</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Aldophosphamide + NADH + Hydrogen ion &lt;&gt; Alcophosphamide + NAD</reaction_text>
    <kegg_reaction_id>R08281</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2-Phenyl-1,3-propanediol monocarbamate + NAD &lt;&gt; 3-Carbamoyl-2-phenylpropionaldehyde + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R08306</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>4-Hydroxy-5-phenyltetrahydro-1,3-oxazin-2-one + NAD &lt;&gt; 5-Phenyl-1,3-oxazinane-2,4-dione + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R08310</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Oxoglutaric acid + Coenzyme A + NAD &gt; Succinyl-CoA + Carbon dioxide + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>2OXOGLUTARATEDEH-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>4,6-Dideoxy-4-oxo-dTDP-D-glucose + NADH + Hydrogen ion &lt;&gt; Deoxythymidine diphosphate-L-rhamnose + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>DTDPRHAMSYNTHMULTI-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>NAD + Glycine + Tetrahydrofolic acid &gt; Hydrogen ion + 5,10-Methylene-THF + Ammonia + Carbon dioxide + NADH</reaction_text>
    <kegg_reaction_id>R01221</kegg_reaction_id>
    <ecocyc_id>GCVMULTI-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>NADH + Water &gt; (&lt;i&gt;S&lt;/i&gt;)-NADHX</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN-12753</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>NADH + Water &gt; (&lt;i&gt;R&lt;/i&gt;)-NADHX</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN-12754</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Propylene glycol + NAD &lt;&gt; acetol + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN-8632</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>L-Galactonate + NAD &gt; Hydrogen ion + D-tagaturonate + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN0-5229</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Ureidoacrylate peracid + NADH &gt; 3-ureidoacrylate + NAD + Water</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN0-6450</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>D-Galactose + NAD  3-keto-&amp;beta;-D-galactose + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN0-6730</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>NADP + NADH + Hydrogen ion &gt; NADPH + NAD + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>TRANS-RXN0-277</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>O-Phospho-4-hydroxy-L-threonine + NAD &gt; Hydrogen ion + NADH + 2-Amino-3-oxo-4-phosphonooxybutyrate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>1.1.1.262-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>NAD + (R)-Malate &gt; NADH + Carbon dioxide + Pyruvic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>1.1.1.83-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>NAD + gamma-Hydroxybutyrate &lt;&gt; Hydrogen ion + NADH + Succinic acid semialdehyde</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>4-HYDROXYBUTYRATE-DEHYDROGENASE-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>NAD + cholate  Hydrogen ion + NADH + 3-alpha,12-alpha-dihydroxy-7-oxo-5-beta-cholanate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>7-ALPHA-HYDROXYSTEROID-DEH-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>a primary alcohol + NAD &lt;&gt; an aldehyde + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>ALCOHOL-DEHYDROG-GENERIC-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Ethanol + NAD &lt;&gt; Acetaldehyde + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>ALCOHOL-DEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>NAD + D-Altronate &lt;&gt; Hydrogen ion + NADH + D-tagaturonate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>ALTRO-OXIDOREDUCT-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>4-Aminobutyraldehyde + NAD + Water &gt; gamma-Aminobutyric acid + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>AMINOBUTDEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>1-Amino-2-propanol + NAD &lt; Hydrogen ion + Aminoacetone + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>AMINOPROPDEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Betaine aldehyde + NAD + Water &gt; Hydrogen ion + Betaine + NADH</reaction_text>
    <kegg_reaction_id>R02565</kegg_reaction_id>
    <ecocyc_id>BADH-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>NAD + (2S,3S)-2,3-Dihydro-2,3-dihydroxybenzoate &gt; Hydrogen ion + NADH + 2-Pyrocatechuic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>DHBDEHYD-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>NAD + D-Lactic acid &lt; Hydrogen ion + NADH + Pyruvic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>DLACTDEHYDROGNAD-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>D-Erythrose 4-phosphate + Water + NAD &gt; 4-Phospho-D-erythronate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>ERYTH4PDEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>4-Phospho-D-erythronate + NAD &gt; Hydrogen ion + 2-Oxo-3-hydroxy-4-phosphobutanoic acid + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>ERYTHRON4PDEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Water + NAD + Glycolaldehyde &gt; Hydrogen ion + NADH + Glycolic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>GLYCOLALD-DEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Hydrocinnamic acid + NADH + Oxygen + Hydrogen ion &gt; cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>HCAMULTI-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>histidinal + NAD + Water &gt; Hydrogen ion + L-Histidine + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>HISTALDEHYD-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>L-Histidinol + NAD &gt; Hydrogen ion + histidinal + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>HISTOLDEHYD-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Water + NAD + Inosinic acid &gt; Hydrogen ion + NADH + Xanthylic acid</reaction_text>
    <kegg_reaction_id>R01130</kegg_reaction_id>
    <ecocyc_id>IMP-DEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>NAD + 2-Deoxygluconate &lt;&gt; Hydrogen ion + NADH + 3-Dehydro-2-deoxy-D-gluconate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>KDUD-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Water + NAD + Lactaldehyde &gt; Hydrogen ion + NADH + L-Lactic acid</reaction_text>
    <kegg_reaction_id>R01446</kegg_reaction_id>
    <ecocyc_id>LACTALDDEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + NADH + Lactaldehyde &lt;&gt; NAD + Propylene glycol</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>LACTALDREDUCT-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + 3-(3-Hydroxyphenyl)propionate + NADH + Oxygen &gt; Water + 3-(2,3-Dihydroxyphenyl)propionic acid + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>MHPHYDROXY-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + a ubiquinone + NADH &lt;&gt; a ubiquinol + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN0-5330</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>menadione + NADH + Hydrogen ion  menadiol + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>NADH-DEHYDROGENASE-QUINONE-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>NAD + a (3&lt;i&gt;S&lt;/i&gt;)-3-hydroxyacyl-CoA &gt; NADH + a 3-oxoacyl-CoA + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>OHACYL-COA-DEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>3-Phosphoglycerate + NAD &lt;&gt; Hydrogen ion + Phosphohydroxypyruvic acid + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>PGLYCDEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Water + NAD + Phenylacetaldehyde &lt;&gt; Hydrogen ion + NADH + phenylacetate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>PHENDEHYD-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD &gt; Hydrogen ion + 3-(2,3-Dihydroxyphenyl)propionic acid + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>PHENPRODIOLDEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>L-D-1-Pyrroline-5-carboxylic acid + NAD + Water &gt; Hydrogen ion + L-Glutamate + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>PYRROLINECARBDEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Pyruvic acid + Coenzyme A + NAD &gt; Acetyl-CoA + Carbon dioxide + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>PYRUVDEH-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>NADH + Copper  Hydrogen ion + NAD + Cu&lt;SUP&gt;+&lt;/SUP&gt;</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>R170-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>an alcohol + Water + NAD &lt; an organic hydroperoxide + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>R4-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>2-hydroxyglutarate + NAD &lt;&gt; Hydrogen ion + Oxoglutaric acid + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN-8645</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>3-Hydroxyadipyl-CoA + NAD &lt;&gt; Hydrogen ion + 3-Oxoadipyl-CoA + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN0-2044</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>NADH + Water &gt; Hydrogen ion + NMNH + Adenosine monophosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN0-4401</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + Pyruvaldehyde + NADH  acetol + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN0-5213</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + a ubiquinone + NADH &gt; a ubiquinol + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN0-5330</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + methyl red + NADH  2-Aminobenzoic acid + N,N'-dimethyl-p-phenylenediamine + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN0-5375</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>NADH + Hydrogen ion + a menaquinone &gt; a menaquinol + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN0-5388</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>3-hydroxypropionaldehyde + NAD + Water &gt; Hydrogen ion + 3-Hydroxypropanoate + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN0-5455</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Dihydrothymine + NAD &lt;&gt; Thymine + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN0-6565</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>a quinone + NADH  NAD + a semiquinone</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN0-6722</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>3-Dehydro-L-gulonate + NAD &lt; Hydrogen ion + 2,3-Diketo-L-gulonate + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN0-703</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Xanthine + NAD + Water &gt; Uric acid + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN0-901</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>N2-Succinyl-L-glutamic acid 5-semialdehyde + NAD + Water &gt; N&lt;SUP&gt;2&lt;/SUP&gt;-succinylglutamate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>SUCCGLUALDDEHYD-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Water + NAD + Succinic acid semialdehyde &gt; Hydrogen ion + NADH + Succinic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>SUCCINATE-SEMIALDEHYDE-DEHYDROGENASE-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>L-Threonine + NAD &gt; Hydrogen ion + L-2-Amino-3-oxobutanoic acid + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>THREODEHYD-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Trimethylamine N-Oxide + NADH + Hydrogen ion &gt; Trimethylamine + NAD + Water</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>TMAOREDUCT-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>UDP-N-Acetyl-D-mannosamine + NAD + Water &lt;&gt; UDP-N-Acetyl-D-mannosaminouronate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>UDPMANNACADEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>UDP-Glucose + Water + NAD &gt; Hydrogen ion + NADH + Uridine diphosphate glucuronic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>UGD-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>3-Hydroxyisobutyric acid + NAD &lt;&gt; 2-Aminomalonate semialdehyde + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>4-Aminobutyraldehyde + NAD + Water &gt; gamma-Aminobutyric acid + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Acetaldehyde + CoA + NAD &gt; Acetyl-CoA + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>An alcohol + NAD &gt; an aldehyde or ketone + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Lactaldehyde + NAD + Water &gt; L-Lactic acid + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Glycolaldehyde + NAD + Water &gt; Glycolic acid + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>UDP-Glucuronic acid + NAD &gt; UDP-beta-L-Threo-pentapyranos-4-ulose + Carbon dioxide + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>N2-Succinyl-L-glutamic acid 5-semialdehyde + NAD + Water &gt; N-Succinyl-L-glutamate + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Betaine aldehyde + NAD + Water &gt; Betaine + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Precorrin-2 + NAD &gt; Sirohydrochlorin + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>NADH + acceptor &gt; NAD + reduced acceptor</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Protein N(6)-(dihydrolipoyl)lysine + NAD &gt; protein N(6)-(lipoyl)lysine + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>D-Lactic acid + NAD &gt; Pyruvic acid + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>D-Erythrose 4-phosphate + NAD + Water &gt; 4-Phospho-D-erythronate + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2,3-dihydroxy-2,3-dihydrobenzoate + NAD &gt; 2-Pyrocatechuic acid + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Acyl-[acyl-carrier-protein] + NAD &gt; trans-2,3-dehydroacyl-[acyl-carrier-protein] + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>(S)-3-hydroxyacyl-CoA + NAD &gt; 3-oxoacyl-CoA + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Formic acid + NAD &gt; Carbon dioxide + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Phenylacetaldehyde + NAD + Water &gt; Benzeneacetic acid + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2 Cob(II)alamin + NAD &gt;2 Aquacobalamin + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>(R)-Propane-1,2-diol + NAD &gt; D-Lactaldehyde + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>(S)-Propane-1,2-diol + NAD &gt; Lactaldehyde + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>D-Glyceraldehyde 3-phosphate + Inorganic phosphate + NAD &gt; 3-phospho-D-glyceroyl phosphate + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Galactitol 1-phosphate + NAD &gt; L-Tagatose-6-phosphate + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Glycerol + NAD &gt; Dihydroxyacetone + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD &gt; 3-(2,3-Dihydroxyphenyl)propanoate + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD &gt; Trans-2,3-Dihydroxycinnamate + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Reduced ferredoxin + NAD &gt; oxidized ferredoxin + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hydrocinnamic acid + NADH + Oxygen &gt; cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD</reaction_text>
    <kegg_reaction_id>R06782</kegg_reaction_id>
    <ecocyc_id>HCAMULTI-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>trans-Cinnamic acid + NADH + Oxygen &gt; Trans-2,3-Dihydroxycinnamate + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3-Alpha,7-alpha,12-alpha-trihydroxy-5-beta-cholanate + NAD &gt; 3-alpha,12-alpha-dihydroxy-7-oxo-5-beta-cholanate + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-Histidinol + Water + 2 NAD &gt; L-Histidine +2 NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Inosinic acid + NAD + Water &gt; Xanthylic acid + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2-Keto-3-deoxy-D-gluconic acid + NAD &gt; (4S)-4,6-Dihydroxy-2,5-dioxohexanoate + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3-Isopropylmalate + NAD &gt; Ketoleucine + Carbon dioxide + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-Malic acid + NAD &gt; Oxalacetic acid + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3-(3-Hydroxyphenyl)propanoic acid + NADH + Oxygen &gt; 3-(2,3-Dihydroxyphenyl)propanoate + Water + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3-Hydroxycinnamic acid + NADH + Oxygen &gt; Trans-2,3-Dihydroxycinnamate + Water + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Mannitol 1-phosphate + NAD &gt; Fructose 6-phosphate + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Tetrahydropteridine + NAD &gt; 6,7-Dihydropteridine + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>ADP + (6S)-6-beta-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide &gt; Adenosine monophosphate + Inorganic phosphate + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Reduced NO reductase rubredoxin + NAD &gt; oxidized NO reductase rubredoxin + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>NADH + Quinone &gt; NAD + Hydroquinone</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>O-Phospho-4-hydroxy-L-threonine + NAD &gt; 2-Amino-3-phosphonopropionic acid + Carbon dioxide + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>4-Phospho-D-erythronate + NAD &gt; 2-Oxo-3-hydroxy-4-phosphobutanoic acid + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>NADPH + NAD &gt; NADP + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Dihydrouracil + NAD &gt; Uracil + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Dihydrothymine + NAD &gt; Thymine + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN0-6565</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Gamma-glutamyl-gamma-aminobutyraldehyde + NAD + Water &gt; 4-(Glutamylamino) butanoate + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>FMNH(2) + NAD &gt; Flavin Mononucleotide + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3-Phospho-D-glycerate + NAD &gt; Phosphohydroxypyruvic acid + NADH</reaction_text>
    <kegg_reaction_id>R01513</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>D-2-Hydroxyglutaric acid + NAD &gt; Oxoglutaric acid + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Sorbitol-6-phosphate + NAD &gt; Fructose 6-phosphate + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-Threonine + NAD &gt; L-2-Amino-3-oxobutanoic acid + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Prephenate + NAD &gt; 4-hydroxyphenylpyruvate + Carbon dioxide + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>UDP-Glucose + 2 NAD + Water &gt; UDP-Glucuronic acid +2 NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>D-Altronate + NAD &gt; D-tagaturonate + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>D-Mannonate + NAD &gt; D-Fructuronate + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>UDP-N-Acetyl-D-mannosamine + 2 NAD + Water &gt; UDP-N-Acetyl-D-mannosaminouronate +2 NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Xanthine + NAD + Water &gt; Uric acid + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hypoxanthine + NAD + Water &gt; Xanthine + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Succinic acid semialdehyde + NAD + NADP + Water &lt;&gt; Succinic acid + NADH + NADPH +2 Hydrogen ion</reaction_text>
    <kegg_reaction_id>R00713 R00714 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Glyceric acid + NAD + NADP &lt;&gt; Tartronate semialdehyde + NADH + NADPH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01745 R01747 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Protein dithiol + NAD + NADP &lt;&gt; Protein disulfide + NADH + NADPH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R03913 R03914 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Isopentenyl pyrophosphate + NAD + NADP + Water + Dimethylallylpyrophosphate &lt;&gt; 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH + NADPH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R05884 R08209 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Tetrahydrodipicolinate + NAD + NADP + Water &lt;&gt; (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate + NADH + NADPH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R04198 R04199 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Protein N6-(dihydrolipoyl)lysine + NAD &lt;&gt; Protein N6-(lipoyl)lysine + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R08550 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3-(3-Hydroxyphenyl)propanoic acid + NADH + Hydrogen ion + Oxygen + 3-Hydroxycinnamic acid &lt;&gt; 3-(2,3-Dihydroxyphenyl)propionic acid + Water + NAD + Trans-2,3-Dihydroxycinnamate</reaction_text>
    <kegg_reaction_id>R06786 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>NADH + Hydrogen ion + Acceptor &lt;&gt; NAD + Reduced acceptor</reaction_text>
    <kegg_reaction_id>R00281 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Quinate + NAD + NADP + Shikimic acid &lt;&gt; 3-Dehydroquinate + NADH + NADPH + Hydrogen ion + 3-Dehydro-shikimate</reaction_text>
    <kegg_reaction_id>R01872 R06846 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-Histidinol + 2 NAD + Water &lt;&gt; L-Histidine +2 NADH +3 Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01158 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Dihydrouracil + NAD + Dihydrothymine &lt;&gt; Uracil + NADH + Hydrogen ion + Thymine</reaction_text>
    <kegg_reaction_id>R00977 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>NADH + Hydrogen ion + Oxygen + Hydrocinnamic acid &lt;&gt; cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD + Trans-2,3-Dihydroxycinnamate</reaction_text>
    <kegg_reaction_id>R06782 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD + cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol &lt;&gt; 3-(2,3-Dihydroxyphenyl)propionic acid + NADH + Hydrogen ion + Trans-2,3-Dihydroxycinnamate</reaction_text>
    <kegg_reaction_id>R06784 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>NAD + Hydrogen ion &lt;&gt; NADH</reaction_text>
    <kegg_reaction_id>R05875 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Nitric oxide + 2 Oxygen + NADH + NADPH &lt;&gt;2 Nitrate + NAD + NADP + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R05724 R05725 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Sorbitol 6-phosphate + NAD &lt;&gt; Fructose 6-phosphate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R07133 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3-Dehydro-L-gulonate + NAD + NADP &lt;&gt; 2,3-Diketo-L-gulonate + NADH + NADPH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R02637 R02639 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Mannitol 1-phosphate + NAD &lt;&gt; Fructose 6-phosphate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R00758 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>5-Methyltetrahydrofolic acid + NAD + NADP &lt;&gt; 5,10-Methylene-THF + NADH + NADPH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01224 R07168 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>ADP + (6S)-6-beta-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide + (6S)-6beta-Hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide phosphate &lt;&gt; Adenosine monophosphate + Phosphate + NADH + NADPH</reaction_text>
    <kegg_reaction_id>R10267 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>NAD + 2-Amino-3-oxo-4-phosphonooxybutyrate + O-Phospho-4-hydroxy-L-threonine &lt;&gt; 3-Amino-2-oxopropyl phosphate + Carbon dioxide + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R05837 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3-Isopropylmalate + NAD + 2-Isopropyl-3-oxosuccinate &lt;&gt; Ketoleucine + Carbon dioxide + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R10052 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>S-(Hydroxymethyl)glutathione + NAD + NADP &lt;&gt; S-Formylglutathione + NADH + NADPH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R06983 R07140 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-Proline + NAD + NADP &lt;&gt; (S)-1-pyrroline-5-carboxylate + NADH + NADPH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01248 R01251 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Tetrahydropteridine + NAD + NADP &lt;&gt; 6,7-Dihydropteridine + NADH + NADPH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R07354 R07355 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>NADH + NADPH + Hydrogen ion + Quinone &lt;&gt; NAD + NADP + Hydroquinone</reaction_text>
    <kegg_reaction_id>R07358 R07359 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Acyl-[acyl-carrier protein] + NAD &lt;&gt; trans-2,3-Dehydroacyl-[acyl-carrier protein] + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01403 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Primary alcohol + NAD + Secondary alcohol &lt;&gt; Aldehyde + NADH + Hydrogen ion + Ketone</reaction_text>
    <kegg_reaction_id>R00623 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-Malic acid + NAD + Oxalacetic acid &lt;&gt; Pyruvic acid + Carbon dioxide + NADH</reaction_text>
    <kegg_reaction_id>R00214 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-Gulonate + NAD &lt;&gt; D-Fructuronate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R10848 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Cholic acid + NAD &lt;&gt; NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R02792 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>NAD + Galactitol 1-phosphate &lt;&gt; L-Tagatose-6-phosphate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R05147 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>NADH + Ubiquinone-1 &lt;&gt; NAD + Ubiquinol-8</reaction_text>
    <kegg_reaction_id>R02163 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>(3S)-3-Hydroxyacyl-CoA + NAD &lt;&gt; 3-Oxoacyl-CoA + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01778 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>(R)-Propane-1,2-diol + (S)-Propane-1,2-diol + NAD &lt;&gt; D-Lactaldehyde + (S)-Lactaldehyde + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R02258 R03080 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3-Phospho-D-glycerate + NAD + D-2-Hydroxyglutaric acid &lt;&gt; Phosphohydroxypyruvic acid + NADH + Hydrogen ion + alpha-Ketoglutarate</reaction_text>
    <kegg_reaction_id>R01513 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Glycerol 3-phosphate + NAD + NADP &lt;&gt; Dihydroxyacetone phosphate + NADH + NADPH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R00842 R00844 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>4-Hydroxybutanoic acid + NAD &lt;&gt; Succinic acid semialdehyde + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01644 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Gluconic acid + NAD + NADP &lt;&gt; 5-Keto-D-gluconate + NADH + NADPH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01738 R01740 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-Idonate + NAD + NADP &lt;&gt; 5-Keto-D-gluconate + NADH + NADPH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R05683 R05684 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Ammonia + NAD + 3 NADP + 2 Water &lt;&gt; Nitrite + NADH +3 NADPH +5 Hydrogen ion</reaction_text>
    <kegg_reaction_id>R00787 R00789 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>(S)-Ureidoglycolic acid + NAD + NADP &lt;&gt; Oxalureate + NADH + NADPH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R02935 R02936 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Nitrite + 3 NADH + 5 Hydrogen ion + Nitrite  Ammonia +2 Water +3 NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002427</pw_reaction_id>
    <reaction_text>(3S)-3-hydroxyacyl-CoA  + NAD &gt; NADH + Hydrogen ion + a 3-oxoacyl-CoA </reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002908</pw_reaction_id>
    <reaction_text>3-Hydroxybutyryl-CoA + NAD + 3-Hydroxybutyryl-CoA &gt; NADH + Hydrogen ion + Acetoacetyl-CoA + Acetoacetyl-CoA</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R003769</pw_reaction_id>
    <reaction_text>(S)-Hydroxydecanoyl-CoA + NAD &gt; NADH + Hydrogen ion + 3-Oxodecanoyl-CoA</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R003774</pw_reaction_id>
    <reaction_text>(S)-Hydroxyhexanoyl-CoA + NAD &gt; NADH + Hydrogen ion + 3-Oxohexanoyl-CoA</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R003779</pw_reaction_id>
    <reaction_text>(S)-3-Hydroxydodecanoyl-CoA + NAD &gt; NADH + Hydrogen ion + 3-Oxododecanoyl-CoA</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R003784</pw_reaction_id>
    <reaction_text>(S)-3-Hydroxytetradecanoyl-CoA + NAD &gt; NADH + Hydrogen ion + 3-Oxotetradecanoyl-CoA</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R003789</pw_reaction_id>
    <reaction_text>(S)-Hydroxyoctanoyl-CoA + NAD + (S)-Hydroxyoctanoyl-CoA  NADH + Hydrogen ion + 3-Oxooctanoyl-CoA</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R003794</pw_reaction_id>
    <reaction_text>(S)-3-Hydroxyhexadecanoyl-CoA + NAD &gt; NADH + Hydrogen ion + 3-Oxohexadecanoyl-CoA</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R003799</pw_reaction_id>
    <reaction_text>(S)-3-Hydroxyoctadecanoyl-CoA + NAD &gt; NADH + Hydrogen ion + 3-Oxooctadecanoyl-CoA + 3-Oxooctadecanoyl-CoA</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R003804</pw_reaction_id>
    <reaction_text>2,3-dihydroxy-2,3-dihydrobenzoate + NAD &gt; 2,3-Dihydroxybenzoic acid + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002454</pw_reaction_id>
    <reaction_text>2,3-dihydroxy-2,3-dihydrobenzoate + NAD &gt; 2-Pyrocatechuic acid + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002423</pw_reaction_id>
    <reaction_text>(S)-3-Hydroxyhexadecanoyl-CoA + NAD &lt;&gt; 3-Oxohexadecanoyl-CoA + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002468</pw_reaction_id>
    <reaction_text>(S)-3-Hydroxytetradecanoyl-CoA + NAD &lt;&gt; 3-Oxotetradecanoyl-CoA + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002471</pw_reaction_id>
    <reaction_text>(S)-3-Hydroxydodecanoyl-CoA + NAD &lt;&gt; 3-Oxododecanoyl-CoA + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002472</pw_reaction_id>
    <reaction_text>(S)-Hydroxydecanoyl-CoA + NAD &lt;&gt; 3-Oxodecanoyl-CoA + Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002474</pw_reaction_id>
    <reaction_text>(S)-Hydroxyoctanoyl-CoA + NAD + (S)-Hydroxyoctanoyl-CoA &lt;&gt; 3-Oxooctanoyl-CoA + Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002476</pw_reaction_id>
    <reaction_text>(S)-Hydroxyhexanoyl-CoA + NAD &lt;&gt; 3-Oxohexanoyl-CoA + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002479</pw_reaction_id>
    <reaction_text>3-Hydroxybutyryl-CoA + NAD + 3-Hydroxybutyryl-CoA &lt;&gt; Acetoacetyl-CoA + NADH + Hydrogen ion + Acetoacetyl-CoA</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002484</pw_reaction_id>
    <reaction_text>NAD + 3-Hydroxy-5-methylhex-4-enoyl-CoA &gt; NADH + Hydrogen ion + 5-Methyl-3-oxo-4-hexenoyl-CoA</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002506</pw_reaction_id>
    <reaction_text>(3S)-3-Hydroxyadipyl-CoA + NAD &gt; 3-Oxoadipyl-CoA + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002511</pw_reaction_id>
    <reaction_text>Isocitric acid + NAD + Isocitric acid &gt; Oxoglutaric acid + Carbon dioxide + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002576</pw_reaction_id>
    <reaction_text>Oxoglutaric acid + NAD + Coenzyme A &gt; Succinyl-CoA + NADH + Hydrogen ion + Carbon dioxide + Succinyl-CoA</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002577</pw_reaction_id>
    <reaction_text>L-Malic acid + NAD + L-Malic acid &lt;&gt; Oxalacetic acid + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002580</pw_reaction_id>
    <reaction_text>Oxoglutaric acid + NAD + Coenzyme A &gt; NADH + Carbon dioxide + Succinyl-CoA + Succinyl-CoA</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002608</pw_reaction_id>
    <reaction_text>L-Malic acid + NAD + L-Malic acid &gt; Oxalacetic acid + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002625</pw_reaction_id>
    <reaction_text>D-Glyceraldehyde 3-phosphate + NAD + Phosphate + D-Glyceraldehyde 3-phosphate &gt; Glyceric acid 1,3-biphosphate + NADH + Hydrogen ion + Glyceric acid 1,3-biphosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002635</pw_reaction_id>
    <reaction_text>Glyceric acid 1,3-biphosphate + NADH + Hydrogen ion + Glyceric acid 1,3-biphosphate &gt; NAD + Phosphate + D-Glyceraldehyde 3-phosphate + D-Glyceraldehyde 3-phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002935</pw_reaction_id>
    <reaction_text>N2-Succinyl-L-glutamic acid 5-semialdehyde + Water + NAD &gt;2 Hydrogen ion + NADH +  N2-succinylglutamate +  N2-succinylglutamate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002681</pw_reaction_id>
    <reaction_text>2,3-Diketo-L-gulonate + NADH + Hydrogen ion + 2,3-Diketo-L-gulonate &gt; 3-Dehydro-L-gulonate + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002698</pw_reaction_id>
    <reaction_text>L-Glutamic-gamma-semialdehyde + NAD + Water &gt;2 Hydrogen ion + NADH + L-Glutamic acid + L-Glutamate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002722</pw_reaction_id>
    <reaction_text> trans-Δ3-cis-Δ7-tetradecenoyl-[acp] + Hydrogen ion + NADH &gt; NAD + cis-Δ7-tetradecenoyl-[acp] </reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002769</pw_reaction_id>
    <reaction_text> trans tetradec-2-enoyl-[acp] + Hydrogen ion + NADH &gt; NAD +  myristoyl-[acp]</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002816</pw_reaction_id>
    <reaction_text>trans-Δ3-cis-Δ5-dodecenoyl-[acp] + Hydrogen ion + NADH &gt; cis-Δ5-dodecenoyl-[acp]  + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002765</pw_reaction_id>
    <reaction_text>trans-Δ3-cis-Δ9-hexadecenoyl-[acp] + Hydrogen ion + NADH &gt; NAD + a palmitoleoyl-[acp] </reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002775</pw_reaction_id>
    <reaction_text>cis-vaccen-2-enoyl-[acp]  + Hydrogen ion + NADH &gt; NAD +  a cis-vaccenoyl-[acp]</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002780</pw_reaction_id>
    <reaction_text> trans-2-enoyl-[acyl-carrier protein] + Hydrogen ion + NADH &gt; NAD + 2,3,4-saturated fatty acyl-[acp] </reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002789</pw_reaction_id>
    <reaction_text>crotonyl-[acp]  + Hydrogen ion + NADH &gt; NAD + butyryl-[acp] </reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002795</pw_reaction_id>
    <reaction_text>trans hex-2-enoyl-[acp] + Hydrogen ion + NADH &gt; NAD + hexanoyl-[acyl-carrier-protein] </reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002799</pw_reaction_id>
    <reaction_text> trans oct-2-enoyl-[acp]  + Hydrogen ion + NADH &gt; NAD + Octanoyl-[acyl-carrier protein] </reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002803</pw_reaction_id>
    <reaction_text>a trans-Δ2-decenoyl-[acp]  + Hydrogen ion + NADH &gt; NAD + decanoyl-[acp] </reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002807</pw_reaction_id>
    <reaction_text>trans dodec-2-enoyl-[acp] + Hydrogen ion + NADH &gt; NAD + dodecanoyl-[acp] </reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002811</pw_reaction_id>
    <reaction_text>Hydrogen ion + NADH +  trans hexadecenoyl-[acp] &gt; NAD + palmitoyl-[acp]</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002821</pw_reaction_id>
    <reaction_text>3-Phosphoglyceric acid + NAD + 3-Phosphoglycerate &gt; NADH + Hydrogen ion + Phosphohydroxypyruvic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002843</pw_reaction_id>
    <reaction_text>L-Histidinol + NAD &gt; NADH + Hydrogen ion + Histidinal</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002873</pw_reaction_id>
    <reaction_text>Water + NAD + Histidinal &gt;2 Hydrogen ion + NADH + L-Histidine + L-Histidine</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002874</pw_reaction_id>
    <reaction_text>L-Malic acid + NAD + L-Malic acid &gt; Carbon dioxide + NADH + Pyruvic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002931</pw_reaction_id>
    <reaction_text>Galactose 1-phosphate + NAD + Galactose 1-phosphate &gt; NADH + Hydrogen ion + D-tagatofuranose 6-phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002943</pw_reaction_id>
    <reaction_text>NAD + Water + (S)-lactaldehyde + Lactaldehyde &gt; NADH +2 Hydrogen ion + L-Lactic acid + L-Lactic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002976</pw_reaction_id>
    <reaction_text>(S)-lactaldehyde + NADH + Hydrogen ion + Lactaldehyde &gt; NAD + Propylene glycol</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002977</pw_reaction_id>
    <reaction_text>Tartronate semialdehyde + NADH + Hydrogen ion &gt; NAD + Glyceric acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002983</pw_reaction_id>
    <reaction_text>D-Fructuronate + NADH + Hydrogen ion &gt; NAD +  D-altronate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R003059</pw_reaction_id>
    <reaction_text>D-tagaturonate + NADH + Hydrogen ion + D-Tagaturonate &gt; NAD +  D-altronate +  D-altronate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R003062</pw_reaction_id>
    <reaction_text>UDP-N-acetyl-D-mannosamine + 2 NAD + Water + UDP-N-Acetyl-D-mannosamine &gt; UDP-N-acetyl-α-D-mannosaminuronate +2 NADH +3 Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R003316</pw_reaction_id>
    <reaction_text>UDP-Glucose + 2 NAD + Water &gt; UDP-Glucuronic acid +2 NADH +3 Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R003355</pw_reaction_id>
    <reaction_text>UDP-Glucuronic acid + NAD &gt; Carbon dioxide + NADH + UDP-β-L-threo-pentapyranos-4-ulose</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R003356</pw_reaction_id>
    <reaction_text>Precorrin-2 + NAD &gt; NADH + Hydrogen ion + Sirohydrochlorin</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R003491</pw_reaction_id>
    <reaction_text>3-Hydroxycinnamic acid + Hydrogen ion + NADH + Oxygen &gt; NAD + Water + 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid + 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R005155</pw_reaction_id>
    <reaction_text>Cinnamic acid + NADH + Oxygen &lt;&gt; cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R003835</pw_reaction_id>
    <reaction_text>NADH + Oxygen + 3-phenylpropanoate &lt;&gt; NAD + cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R003836</pw_reaction_id>
    <reaction_text>NADH + Oxygen + 3-phenylpropanoate &lt;&gt; NAD + Cis-3-(3-carboxyethyl)-3,5-cyclohexadiene-1,2-diol</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R003837</pw_reaction_id>
    <reaction_text>Hydrocinnamic acid + NADH + Oxygen &lt;&gt; NAD + cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R003850</pw_reaction_id>
    <reaction_text>Copper + NADH &gt; NAD + Cu(+)</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R003845</pw_reaction_id>
    <reaction_text>Fructose 6-phosphate + NADH + Hydrogen ion + Fructose 6-phosphate &lt;&gt; NAD + Mannitol 1-phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R005148</pw_reaction_id>
    <reaction_text>NAD + cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol &gt; NADH + Hydrogen ion + 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid + 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R005157</pw_reaction_id>
    <reaction_text>Acetaldehyde + Coenzyme A + NAD &gt; Hydrogen ion + NADH + Acetyl-CoA</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R005163</pw_reaction_id>
    <reaction_text>L-Threonine + NAD + L-Threonine &gt; Hydrogen ion + NADH + L-2-Amino-3-oxobutanoic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R005168</pw_reaction_id>
    <reaction_text>NADH + 5 Hydrogen ion + Ubiquinone-1 &gt; Hydrogen ion + NAD + Ubiquinol-1</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_RCT000143</pw_reaction_id>
    <reaction_text>NADH + 4 Hydrogen ion + 2 Hydrogen ion + menaquinone-8  NAD + Hydrogen ion + Menaquinol 8 + Electron +4 Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_RCT000172</pw_reaction_id>
    <reaction_text>1-Amino-2-propanol + NAD + 4,5-Dihydro-4-hydroxy-5-S-glutathionyl-benzo[a]pyrene &lt; NADH + Hydrogen ion + Aminoacetone</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R005365</pw_reaction_id>
    <reaction_text>Precorrin 2 + NAD &lt;&gt; Sirohydrochlorin + NADH +2 Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R005872</pw_reaction_id>
    <reaction_text>Trimethylamine N-Oxide + NADH + 2 Hydrogen ion &gt; Trimethylamine + NAD + Water</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R005885</pw_reaction_id>
    <reaction_text>2-Deoxygluconate + NAD &gt; 3-Dehydro-2-deoxy-D-gluconate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R005869</pw_reaction_id>
    <reaction_text>(2-Naphthyl)methanol + NAD &gt; 2-Naphthaldehyde + Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R005893</pw_reaction_id>
    <reaction_text>Phenylacetaldehyde + NAD + Water &gt; NADH + Hydrogen ion + Benzeneacetic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R005918</pw_reaction_id>
    <reaction_text>3-Hydroxyadipyl-CoA + NAD &gt; NADH + Hydrogen ion + 3-Oxoadipyl-CoA</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R005925</pw_reaction_id>
    <reaction_text>a [pyruvate dehydrogenase E2 protein] N6-dihydrolipoyl-L-lysine + NAD &gt; a [pyruvate dehydrogenase E2 protein] N6-lipoyl-L-lysine + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R006084</pw_reaction_id>
    <reaction_text>Hydrogen ion + NADH + NADP &gt; NADPH + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_RCT000189</pw_reaction_id>
    <reaction_text>D-Erythrose 4-phosphate + NAD + Water &gt; 4-Phospho-D-erythronate + NADH +2 Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R006051</pw_reaction_id>
    <reaction_text>trans-Cinnamic acid + Hydrogen ion + Oxygen + NADH &gt; Cis-3-(3-carboxyethyl)-3,5-cyclohexadiene-1,2-diol + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R005945</pw_reaction_id>
    <reaction_text>Cis-3-(3-carboxyethyl)-3,5-cyclohexadiene-1,2-diol + NAD &gt; 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R005946</pw_reaction_id>
    <reaction_text>Hydroxyacetone + NADH + Hydrogen ion &lt;&gt; Propylene glycol + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R006075</pw_reaction_id>
    <reaction_text>(S)-Ureidoglycolic acid + NAD &gt; Hydrogen ion + NADH + Oxalureate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R005987</pw_reaction_id>
    <reaction_text>L-Galactonate + NAD &gt; NADH + Hydrogen ion + D-Tagaturonate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R006012</pw_reaction_id>
    <reaction_text>a menaquinone + 4 Hydrogen ion + NADH &gt; a menaquinol + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_RCT000188</pw_reaction_id>
    <reaction_text>a [2-oxoglutarate dehydrogenase E2 protein] N6-dihydrolipoyl-L-lysine + NAD &gt; a [2-oxoglutarate dehydrogenase E2 protein] N6-lipoyl-L-lysine + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R006142</pw_reaction_id>
    <reaction_text>dTDP-4-dehydro-beta-L-rhamnose + NADH + Hydrogen ion &gt; NADP + TDP-Rhamnose</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R006147</pw_reaction_id>
    <reaction_text>NAD + NADPH &lt;&gt; NADH + NADP</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3 3-Phospho-D-glycerate + NAD &lt;&gt; Phosphohydroxypyruvic acid + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2 Hydrogen ion + 5 5,10-Methylene-THF + NADH &gt;5 5-Methyltetrahydrofolic acid + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>D-Erythrose 4-phosphate + Water + NAD &lt;&gt;4 4-Phospho-D-erythronate +2 Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>O-Phospho-4-hydroxy-L-threonine + NAD &lt;&gt;2 2-Amino-3-oxo-4-phosphonooxybutyrate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-D-1-Pyrroline-5-carboxylic acid + 2 Water + NAD &gt; L-Glutamate + Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Water + NAD + N2-Succinyl-L-glutamic acid 5-semialdehyde &lt;&gt;2 Hydrogen ion + NADH + N-Succinyl-L-glutamate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>D-Lactic acid + NAD &lt;&gt; Hydrogen ion + NADH + Pyruvic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>4 4-Phospho-D-erythronate + NAD &lt;&gt; Hydrogen ion + NADH +2 2-Oxo-3-hydroxy-4-phosphobutanoic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Tartronate semialdehyde + Hydrogen ion + NADH &lt;&gt; Glyceric acid + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Water + Hypoxanthine + NAD &gt; Hydrogen ion + NADH + Xanthine</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Oxoadipic acid + Coenzyme A + NAD &lt;&gt; Glutaryl-CoA + Carbon dioxide + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Ammonia + NAD + 3 NADP + 2 Water &lt;&gt; Nitrite + NADH +3 NADPH +5 Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Butyryl-[acp] + NAD &lt;&gt; But-2-enoyl-[acyl-carrier protein] + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + Hydroxypyruvic acid + NADH &gt; Glyceric acid + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Sorbitol-6-phosphate + NAD &lt;&gt; beta-D-Fructose 6-phosphate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>NADH + Ubiquinone-1 &lt;&gt; NAD + Ubiquinol-8</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>UDP-N-Acetylmuraminate + NAD &lt;&gt; UDP-N-Acetyl-3-(1-carboxyvinyl)-D-glucosamine + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3 3-Isopropylmalate + NAD &gt;2 2-Isopropyl-3-oxosuccinate + Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Flavin Mononucleotide + Hydrogen ion + NADH &gt; FMNH + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-Malic acid + NAD &gt; Carbon dioxide + NADH + Pyruvic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>NAD + Uridine diphosphate glucuronic acid &gt; Carbon dioxide + NADH + UDP-4-Keto-pyranose</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Ethanol + NAD &lt;&gt; Acetaldehyde + Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Water + Inosinic acid + NAD &lt;&gt; Hydrogen ion + NADH + Xanthylic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Cholic acid + NAD &lt;&gt; NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-Histidinal + Water + NAD &lt;&gt; L-Histidine + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>NADH + Hydrogen ion + Acceptor &lt;&gt; NAD + Reduced acceptor</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH &gt; Water + Isopentenyl pyrophosphate + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-Glutamate + NAD + Water &lt;&gt; alpha-Ketoglutarate + Ammonia + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Formic acid + NAD &lt;&gt; Hydrogen ion + Carbon dioxide + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Glycine + Tetrahydrofolic acid + NAD &lt;&gt;5 5,10-Methylene-THF + Ammonia + Carbon dioxide + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2 Hydrogen ion + 5 5,10-Methylene-THF + NADH &gt;5 5-Methyltetrahydrofolic acid + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>O-Phospho-4-hydroxy-L-threonine + NAD &lt;&gt;2 2-Amino-3-oxo-4-phosphonooxybutyrate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-D-1-Pyrroline-5-carboxylic acid + 2 Water + NAD &gt; L-Glutamate + Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>D-Lactic acid + NAD &lt;&gt; Hydrogen ion + NADH + Pyruvic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>4 4-Phospho-D-erythronate + NAD &lt;&gt; Hydrogen ion + NADH +2 2-Oxo-3-hydroxy-4-phosphobutanoic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Water + Hypoxanthine + NAD &gt; Hydrogen ion + NADH + Xanthine</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Ammonia + NAD + 3 NADP + 2 Water &lt;&gt; Nitrite + NADH +3 NADPH +5 Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Water + Hypoxanthine + NAD &gt; Hydrogen ion + NADH + Xanthine</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>3 3-Isopropylmalate + NAD &gt;2 2-Isopropyl-3-oxosuccinate + Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>D-Erythrose 4-phosphate + Water + NAD &lt;&gt;4 4-Phospho-D-erythronate +2 Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Flavin Mononucleotide + Hydrogen ion + NADH &gt; FMNH + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>NAD + Uridine diphosphate glucuronic acid &gt; Carbon dioxide + NADH + UDP-4-Keto-pyranose</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Ethanol + NAD &lt;&gt; Acetaldehyde + Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Water + Inosinic acid + NAD &lt;&gt; Hydrogen ion + NADH + Xanthylic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>NADH + Hydrogen ion + Acceptor &lt;&gt; NAD + Reduced acceptor</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Formic acid + NAD &lt;&gt; Hydrogen ion + Carbon dioxide + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Formic acid + NAD &lt;&gt; Hydrogen ion + Carbon dioxide + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2 L-Glutamate + NAD &lt;&gt; L-Glutamine + alpha-Ketoglutarate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Glycine + Tetrahydrofolic acid + NAD &lt;&gt;5 5,10-Methylene-THF + Ammonia + Carbon dioxide + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
  </reactions>
  <concentrations>
    <growth_media>Gutnick minimal complete medium (4.7 g/L KH2PO4; 13.5 g/L K2HPO4; 1 g/L K2SO4; 0.1 g/L MgSO4-7H2O; 10 mM NH4Cl) with 4 g/L glucose</growth_media>
    <growth_system>Shake flask and filter culture</growth_system>
    <concentration>83.2</concentration>
    <concentration_units>uM</concentration_units>
    <internal/>
    <error>0.0</error>
    <temperature>37 oC</temperature>
    <strain>K12 NCM3722</strain>
    <growth_status>Mid-Log Phase</growth_status>
    <molecules>332800</molecules>
    <molecules_error>0</molecules_error>
    <reference>
      <reference_text>Bennett, B. D., Kimball, E. H., Gao, M., Osterhout, R., Van Dien, S. J., Rabinowitz, J. D. (2009). "Absolute metabolite concentrations and implied enzyme active site occupancy in Escherichia coli." Nat Chem Biol 5:593-599.</reference_text>
      <pubmed_id>19561621</pubmed_id>
    </reference>
    <growth_media>Gutnick minimal complete medium (4.7 g/L KH2PO4; 13.5 g/L K2HPO4; 1 g/L K2SO4; 0.1 g/L MgSO4-7H2O; 10 mM NH4Cl) with 4 g/L glycerol</growth_media>
    <growth_system>Shake flask and filter culture</growth_system>
    <concentration>129.0</concentration>
    <concentration_units>uM</concentration_units>
    <internal/>
    <error>0.0</error>
    <temperature>37 oC</temperature>
    <strain>K12 NCM3722</strain>
    <growth_status>Mid-Log Phase</growth_status>
    <molecules>516000</molecules>
    <molecules_error>0</molecules_error>
    <reference>
      <reference_text>Bennett, B. D., Kimball, E. H., Gao, M., Osterhout, R., Van Dien, S. J., Rabinowitz, J. D. (2009). "Absolute metabolite concentrations and implied enzyme active site occupancy in Escherichia coli." Nat Chem Biol 5:593-599.</reference_text>
      <pubmed_id>19561621</pubmed_id>
    </reference>
    <growth_media>Gutnick minimal complete medium (4.7 g/L KH2PO4; 13.5 g/L K2HPO4; 1 g/L K2SO4; 0.1 g/L MgSO4-7H2O; 10 mM NH4Cl) with 4 g/L acetate</growth_media>
    <growth_system>Shake flask and filter culture</growth_system>
    <concentration>135.0</concentration>
    <concentration_units>uM</concentration_units>
    <internal/>
    <error>0.0</error>
    <temperature>37 oC</temperature>
    <strain>K12 NCM3722</strain>
    <growth_status>Mid-Log Phase</growth_status>
    <molecules>540000</molecules>
    <molecules_error>0</molecules_error>
    <reference>
      <reference_text>Bennett, B. D., Kimball, E. H., Gao, M., Osterhout, R., Van Dien, S. J., Rabinowitz, J. D. (2009). "Absolute metabolite concentrations and implied enzyme active site occupancy in Escherichia coli." Nat Chem Biol 5:593-599.</reference_text>
      <pubmed_id>19561621</pubmed_id>
    </reference>
  </concentrations>
</compound>
