2.0 2015-06-08 15:27:29 -0600 2015-09-14 16:46:24 -0600 ECMDB23869 M2MDB005511 alpha-D-Aldose 1-phosphate In E. coli, alpha-D-Aldose 1-phosphate is involved in several reactions. ADP-sugar pyrophosphatase catalyzes the reaction an ADP-sugar + H2O → AMP + an alpha-D-aldose 1-phosphate; UDP-sugar pyrophosphorylase catalyzes the reaction an alpha-D-aldose 1-phosphate + a nucleoside diphosphate + H+ = a nucleotide diphosphate-aldose + phosphate; The reaction a UDP-sugar[periplasmic space] + H2O[periplasmic space] → UMP[periplasmic space] + an alpha-D-aldose 1-phosphate[periplasmic space] + 2 H+[periplasmic space] is catalyzed by UDP-sugar hydrolase (BioCyc compound class: Alpha-D-aldose-1-phosphates). a-D-Aldose 1-phosphate a-D-Aldose 1-phosphoric acid alpha-D-Aldose 1-phosphoric acid Renillluciferin α-D-Aldose 1-phosphate α-D-Aldose 1-phosphoric acid C26H21N3O2 407.473 407.163376928 2,8-dibenzyl-6-(4-hydroxyphenyl)-3H,7H-imidazo[1,2-a]pyrazin-3-one renilla luciferin OC1=CC=C(C=C1)C1=CN2C(=O)C(CC3=CC=CC=C3)=NC2=C(CC2=CC=CC=C2)N1 InChI=1S/C26H21N3O2/c30-21-13-11-20(12-14-21)24-17-29-25(22(27-24)15-18-7-3-1-4-8-18)28-23(26(29)31)16-19-9-5-2-6-10-19/h1-14,17,27,30H,15-16H2 KAEGGIFPLJZUOZ-UHFFFAOYSA-N logp 4.29 ALOGPS logs -4.65 ALOGPS solubility 9.13e-03 g/l ALOGPS logp 4.7 ChemAxon pka_strongest_acidic 9.45 ChemAxon pka_strongest_basic -0.13 ChemAxon iupac 2,8-dibenzyl-6-(4-hydroxyphenyl)-3H,7H-imidazo[1,2-a]pyrazin-3-one ChemAxon average_mass 407.473 ChemAxon mono_mass 407.163376928 ChemAxon smiles OC1=CC=C(C=C1)C1=CN2C(=O)C(CC3=CC=CC=C3)=NC2=C(CC2=CC=CC=C2)N1 ChemAxon formula C26H21N3O2 ChemAxon inchi InChI=1S/C26H21N3O2/c30-21-13-11-20(12-14-21)24-17-29-25(22(27-24)15-18-7-3-1-4-8-18)28-23(26(29)31)16-19-9-5-2-6-10-19/h1-14,17,27,30H,15-16H2 ChemAxon inchikey KAEGGIFPLJZUOZ-UHFFFAOYSA-N ChemAxon polar_surface_area 64.93 ChemAxon refractivity 131.91 ChemAxon polarizability 44.42 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Purine metabolism ec00230 Pyrimidine metabolism The metabolism of pyrimidines begins with L-glutamine interacting with water molecule and a hydrogen carbonate through an ATP driven carbamoyl phosphate synthetase resulting in a hydrogen ion, an ADP, a phosphate, an L-glutamic acid and a carbamoyl phosphate. The latter compound interacts with an L-aspartic acid through a aspartate transcarbamylase resulting in a phosphate, a hydrogen ion and a N-carbamoyl-L-aspartate. The latter compound interacts with a hydrogen ion through a dihydroorotase resulting in the release of a water molecule and a 4,5-dihydroorotic acid. This compound interacts with an ubiquinone-1 through a dihydroorotate dehydrogenase, type 2 resulting in a release of an ubiquinol-1 and an orotic acid. The orotic acid then interacts with a phosphoribosyl pyrophosphate through a orotate phosphoribosyltransferase resulting in a pyrophosphate and an orotidylic acid. The latter compound then interacts with a hydrogen ion through an orotidine-5 '-phosphate decarboxylase, resulting in an release of carbon dioxide and an Uridine 5' monophosphate. The Uridine 5' monophosphate process to get phosphorylated by an ATP driven UMP kinase resulting in the release of an ADP and an Uridine 5--diphosphate. Uridine 5-diphosphate can be metabolized in multiple ways in order to produce a Deoxyuridine triphosphate. 1.-Uridine 5-diphosphate interacts with a reduced thioredoxin through a ribonucleoside diphosphate reductase 1 resulting in the release of a water molecule and an oxidized thioredoxin and an dUDP. The dUDP is then phosphorylated by an ATP through a nucleoside diphosphate kinase resulting in the release of an ADP and a DeoxyUridine triphosphate. 2.-Uridine 5-diphosphate interacts with a reduced NrdH glutaredoxin-like protein through a Ribonucleoside-diphosphate reductase 1 resulting in a release of a water molecule, an oxidized NrdH glutaredoxin-like protein and a dUDP. The dUDP is then phosphorylated by an ATP through a nucleoside diphosphate kinase resulting in the release of an ADP and a DeoxyUridine triphosphate. 3.-Uridine 5-diphosphate is phosphorylated by an ATP-driven nucleoside diphosphate kinase resulting in an ADP and an Uridinetriphosphate. The latter compound interacts with a reduced flavodoxin through ribonucleoside-triphosphate reductase resulting in the release of an oxidized flavodoxin, a water molecule and a Deoxyuridine triphosphate 4.-Uridine 5-diphosphate is phosphorylated by an ATP-driven nucleoside diphosphate kinase resulting in an ADP and an Uridinetriphosphate The uridine triphosphate interacts with a L-glutamine and a water molecule through an ATP driven CTP synthase resulting in an ADP, a phosphate, a hydrogen ion, an L-glutamic acid and a cytidine triphosphate. The cytidine triphosphate interacts with a reduced flavodoxin through a ribonucleoside-triphosphate reductase resulting in the release of a water molecule, an oxidized flavodoxin and a dCTP. The dCTP interacts with a water molecule and a hydrogen ion through a dCTP deaminase resulting in a release of an ammonium molecule and a Deoxyuridine triphosphate. 5.-Uridine 5-diphosphate is phosphorylated by an ATP-driven nucleoside diphosphate kinase resulting in an ADP and an Uridinetriphosphate The uridine triphosphate interacts with a L-glutamine and a water molecule through an ATP driven CTP synthase resulting in an ADP, a phosphate, a hydrogen ion, an L-glutamic acid and a cytidine triphosphate. The cytidine triphosphate then interacts spontaneously with a water molecule resulting in the release of a phosphate, a hydrogen ion and a CDP. The CDP then interacts with a reduced NrdH glutaredoxin-like protein through a ribonucleoside-diphosphate reductase 2 resulting in the release of a water molecule, an oxidized NrdH glutaredoxin-like protein and a dCDP. The dCDP is then phosphorylated through an ATP driven nucleoside diphosphate kinase resulting in an ADP and a dCTP. The dCTP interacts with a water molecule and a hydrogen ion through a dCTP deaminase resulting in a release of an ammonium molecule and a Deoxyuridine triphosphate. 6.-Uridine 5-diphosphate is phosphorylated by an ATP-driven nucleoside diphosphate kinase resulting in an ADP and an Uridinetriphosphate The uridine triphosphate interacts with a L-glutamine and a water molecule through an ATP driven CTP synthase resulting in an ADP, a phosphate, a hydrogen ion, an L-glutamic acid and a cytidine triphosphate. The cytidine triphosphate then interacts spontaneously with a water molecule resulting in the release of a phosphate, a hydrogen ion and a CDP. The CDP interacts with a reduced thioredoxin through a ribonucleoside diphosphate reductase 1 resulting in a release of a water molecule, an oxidized thioredoxin and a dCDP. The dCDP is then phosphorylated through an ATP driven nucleoside diphosphate kinase resulting in an ADP and a dCTP. The dCTP interacts with a water molecule and a hydrogen ion through a dCTP deaminase resulting in a release of an ammonium molecule and a Deoxyuridine triphosphate. The deoxyuridine triphosphate then interacts with a water molecule through a nucleoside triphosphate pyrophosphohydrolase resulting in a release of a hydrogen ion, a phosphate and a dUMP. The dUMP then interacts with a methenyltetrahydrofolate through a thymidylate synthase resulting in a dihydrofolic acid and a 5-thymidylic acid. Then 5-thymidylic acid is then phosphorylated through a nucleoside diphosphate kinase resulting in the release of an ADP and thymidine 5'-triphosphate. PW000942 ec00240 Metabolic Nicotinate and nicotinamide metabolism ec00760 Specdb::CMs 1086485 Specdb::EiMs 4390 Specdb::MsMs 23714 Specdb::MsMs 23715 Specdb::MsMs 23716 Specdb::MsMs 30512 Specdb::MsMs 30513 Specdb::MsMs 30514 C00991 UDP-sugar + Water <> Uridine 5'-monophosphate + alpha-D-Aldose 1-phosphate R03986