2.0 2015-06-04 16:16:58 -0600 2015-08-05 16:22:04 -0600 ECMDB23826 M2MDB004556 Purine deoxyribonucleoside A deoxyribonucleoside containing a purine base 2'-Deoxy-N-b-D-ribosylpurine 2'-Deoxy-N-beta-D-ribosylpurine 2'-Deoxy-N-β-D-ribosylpurine 2'-Deoxynebularine 2-Deoxy-N-D-ribosylpurine 6-deamino-2'-Deoxyadenosine 9-(2-Deoxy-b-D-ribofuranosyl)-9H-purine 9-(2-Deoxy-beta-D-ribofuranosyl)-9H-purine 9-(2-Deoxy-β-D-ribofuranosyl)-9H-purine 9-(b-D-2'-Deoxyribofuranosyl)purine 9-(beta-D-2'-Deoxyribofuranosyl)purine 9-(β-D-2'-deoxyribofuranosyl)purine N-(b-D-2'-Deoxyribosyl)purine N-(beta-D-2'-Deoxyribosyl)purine N-(β-D-2'-deoxyribosyl)purine C10H12N4O3 236.231 236.090940262 (2R,3S,5R)-2-(hydroxymethyl)-5-(9H-purin-9-yl)oxolan-3-ol (2R,3S,5R)-2-(hydroxymethyl)-5-(purin-9-yl)oxolan-3-ol OC[C@H]1O[C@H](C[C@@H]1O)N1C=NC2=C1N=CN=C2 InChI=1S/C10H12N4O3/c15-3-8-7(16)1-9(17-8)14-5-13-6-2-11-4-12-10(6)14/h2,4-5,7-9,15-16H,1,3H2/t7-,8+,9+/m0/s1 WJBNIBFTNGZFBW-DJLDLDEBSA-N logp -0.90 ALOGPS logs -1.29 ALOGPS solubility 1.20e+01 g/l ALOGPS logp -0.96 ChemAxon pka_strongest_acidic 13.89 ChemAxon pka_strongest_basic 3.79 ChemAxon iupac (2R,3S,5R)-2-(hydroxymethyl)-5-(9H-purin-9-yl)oxolan-3-ol ChemAxon average_mass 236.231 ChemAxon mono_mass 236.090940262 ChemAxon smiles OC[C@H]1O[C@H](C[C@@H]1O)N1C=NC2=C1N=CN=C2 ChemAxon formula C10H12N4O3 ChemAxon inchi InChI=1S/C10H12N4O3/c15-3-8-7(16)1-9(17-8)14-5-13-6-2-11-4-12-10(6)14/h2,4-5,7-9,15-16H,1,3H2/t7-,8+,9+/m0/s1 ChemAxon inchikey WJBNIBFTNGZFBW-DJLDLDEBSA-N ChemAxon polar_surface_area 93.29 ChemAxon refractivity 56.67 ChemAxon polarizability 22.78 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 6 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Purine metabolism ec00230 Pyrimidine metabolism The metabolism of pyrimidines begins with L-glutamine interacting with water molecule and a hydrogen carbonate through an ATP driven carbamoyl phosphate synthetase resulting in a hydrogen ion, an ADP, a phosphate, an L-glutamic acid and a carbamoyl phosphate. The latter compound interacts with an L-aspartic acid through a aspartate transcarbamylase resulting in a phosphate, a hydrogen ion and a N-carbamoyl-L-aspartate. The latter compound interacts with a hydrogen ion through a dihydroorotase resulting in the release of a water molecule and a 4,5-dihydroorotic acid. This compound interacts with an ubiquinone-1 through a dihydroorotate dehydrogenase, type 2 resulting in a release of an ubiquinol-1 and an orotic acid. The orotic acid then interacts with a phosphoribosyl pyrophosphate through a orotate phosphoribosyltransferase resulting in a pyrophosphate and an orotidylic acid. The latter compound then interacts with a hydrogen ion through an orotidine-5 '-phosphate decarboxylase, resulting in an release of carbon dioxide and an Uridine 5' monophosphate. The Uridine 5' monophosphate process to get phosphorylated by an ATP driven UMP kinase resulting in the release of an ADP and an Uridine 5--diphosphate. Uridine 5-diphosphate can be metabolized in multiple ways in order to produce a Deoxyuridine triphosphate. 1.-Uridine 5-diphosphate interacts with a reduced thioredoxin through a ribonucleoside diphosphate reductase 1 resulting in the release of a water molecule and an oxidized thioredoxin and an dUDP. The dUDP is then phosphorylated by an ATP through a nucleoside diphosphate kinase resulting in the release of an ADP and a DeoxyUridine triphosphate. 2.-Uridine 5-diphosphate interacts with a reduced NrdH glutaredoxin-like protein through a Ribonucleoside-diphosphate reductase 1 resulting in a release of a water molecule, an oxidized NrdH glutaredoxin-like protein and a dUDP. The dUDP is then phosphorylated by an ATP through a nucleoside diphosphate kinase resulting in the release of an ADP and a DeoxyUridine triphosphate. 3.-Uridine 5-diphosphate is phosphorylated by an ATP-driven nucleoside diphosphate kinase resulting in an ADP and an Uridinetriphosphate. The latter compound interacts with a reduced flavodoxin through ribonucleoside-triphosphate reductase resulting in the release of an oxidized flavodoxin, a water molecule and a Deoxyuridine triphosphate 4.-Uridine 5-diphosphate is phosphorylated by an ATP-driven nucleoside diphosphate kinase resulting in an ADP and an Uridinetriphosphate The uridine triphosphate interacts with a L-glutamine and a water molecule through an ATP driven CTP synthase resulting in an ADP, a phosphate, a hydrogen ion, an L-glutamic acid and a cytidine triphosphate. The cytidine triphosphate interacts with a reduced flavodoxin through a ribonucleoside-triphosphate reductase resulting in the release of a water molecule, an oxidized flavodoxin and a dCTP. The dCTP interacts with a water molecule and a hydrogen ion through a dCTP deaminase resulting in a release of an ammonium molecule and a Deoxyuridine triphosphate. 5.-Uridine 5-diphosphate is phosphorylated by an ATP-driven nucleoside diphosphate kinase resulting in an ADP and an Uridinetriphosphate The uridine triphosphate interacts with a L-glutamine and a water molecule through an ATP driven CTP synthase resulting in an ADP, a phosphate, a hydrogen ion, an L-glutamic acid and a cytidine triphosphate. The cytidine triphosphate then interacts spontaneously with a water molecule resulting in the release of a phosphate, a hydrogen ion and a CDP. The CDP then interacts with a reduced NrdH glutaredoxin-like protein through a ribonucleoside-diphosphate reductase 2 resulting in the release of a water molecule, an oxidized NrdH glutaredoxin-like protein and a dCDP. The dCDP is then phosphorylated through an ATP driven nucleoside diphosphate kinase resulting in an ADP and a dCTP. The dCTP interacts with a water molecule and a hydrogen ion through a dCTP deaminase resulting in a release of an ammonium molecule and a Deoxyuridine triphosphate. 6.-Uridine 5-diphosphate is phosphorylated by an ATP-driven nucleoside diphosphate kinase resulting in an ADP and an Uridinetriphosphate The uridine triphosphate interacts with a L-glutamine and a water molecule through an ATP driven CTP synthase resulting in an ADP, a phosphate, a hydrogen ion, an L-glutamic acid and a cytidine triphosphate. The cytidine triphosphate then interacts spontaneously with a water molecule resulting in the release of a phosphate, a hydrogen ion and a CDP. The CDP interacts with a reduced thioredoxin through a ribonucleoside diphosphate reductase 1 resulting in a release of a water molecule, an oxidized thioredoxin and a dCDP. The dCDP is then phosphorylated through an ATP driven nucleoside diphosphate kinase resulting in an ADP and a dCTP. The dCTP interacts with a water molecule and a hydrogen ion through a dCTP deaminase resulting in a release of an ammonium molecule and a Deoxyuridine triphosphate. The deoxyuridine triphosphate then interacts with a water molecule through a nucleoside triphosphate pyrophosphohydrolase resulting in a release of a hydrogen ion, a phosphate and a dUMP. The dUMP then interacts with a methenyltetrahydrofolate through a thymidylate synthase resulting in a dihydrofolic acid and a 5-thymidylic acid. Then 5-thymidylic acid is then phosphorylated through a nucleoside diphosphate kinase resulting in the release of an ADP and thymidine 5'-triphosphate. PW000942 ec00240 Metabolic Nicotinate and nicotinamide metabolism ec00760 Metabolic pathways eco01100 Specdb::CMs 1088013 Specdb::EiMs 3735 Specdb::NmrOneD 320311 Specdb::NmrOneD 320312 Specdb::NmrOneD 320313 Specdb::NmrOneD 320314 Specdb::NmrOneD 320315 Specdb::NmrOneD 320316 Specdb::NmrOneD 320317 Specdb::NmrOneD 320318 Specdb::NmrOneD 320319 Specdb::NmrOneD 320320 Specdb::NmrOneD 320321 Specdb::NmrOneD 320322 Specdb::NmrOneD 320323 Specdb::NmrOneD 320324 Specdb::NmrOneD 320325 Specdb::NmrOneD 320326 Specdb::NmrOneD 320327 Specdb::NmrOneD 320328 Specdb::NmrOneD 320329 Specdb::NmrOneD 320330 Specdb::MsMs 29255 Specdb::MsMs 29256 Specdb::MsMs 29257 Specdb::MsMs 35813 Specdb::MsMs 35814 Specdb::MsMs 35815 C20463 Purine nucleoside phosphorylase deoD-type P0ABP8 DEOD_ECOLI deoD http://ecmdb.ca/proteins/P0ABP8.xml Purine nucleoside + Phosphate + Purine deoxyribonucleoside <> Purine + Ribose-1-phosphate + Deoxyribose 1-phosphate R08368