2.0 2012-07-30 14:55:10 -0600 2015-06-03 17:21:04 -0600 ECMDB21275 M2MDB001682 Peroxyaminoacrylate Peroxyaminoacrylate is a member of the chemical class known as Enones. These are compounds containing the enone functional group, with the structure RC(=O)CR'. (2Z)-3-aminoprop-2-eneperoxoate (2Z)-3-aminoprop-2-eneperoxoic acid (Z)-3-Peroxyaminoacrylate (Z)-3-Peroxyaminoacrylic acid Aminoacrylate peracid Aminoacrylic acid peracid Peroxy aminoacrylate Peroxy aminoacrylic acid Peroxyaminoacrylate Peroxyaminoacrylic acid C3H5NO3 103.0767 103.026943031 (2Z)-3-aminoprop-2-eneperoxoic acid peroxyaminoacrylate N\C=C/C(=O)OO InChI=1S/C3H5NO3/c4-2-1-3(5)7-6/h1-2,6H,4H2/b2-1- WQKGFGLGYOHJOG-UPHRSURJSA-N Cytosol logp -0.64 ALOGPS logs 0.19 ALOGPS solubility 1.59e+02 g/l ALOGPS logp -0.54 ChemAxon pka_strongest_acidic 7.39 ChemAxon pka_strongest_basic 3.83 ChemAxon iupac (2Z)-3-aminoprop-2-eneperoxoic acid ChemAxon average_mass 103.0767 ChemAxon mono_mass 103.026943031 ChemAxon smiles N\C=C/C(=O)OO ChemAxon formula C3H5NO3 ChemAxon inchi InChI=1S/C3H5NO3/c4-2-1-3(5)7-6/h1-2,6H,4H2/b2-1- ChemAxon inchikey WQKGFGLGYOHJOG-UPHRSURJSA-N ChemAxon polar_surface_area 72.55 ChemAxon refractivity 22.56 ChemAxon polarizability 8.39 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Pyrimidine metabolism The metabolism of pyrimidines begins with L-glutamine interacting with water molecule and a hydrogen carbonate through an ATP driven carbamoyl phosphate synthetase resulting in a hydrogen ion, an ADP, a phosphate, an L-glutamic acid and a carbamoyl phosphate. The latter compound interacts with an L-aspartic acid through a aspartate transcarbamylase resulting in a phosphate, a hydrogen ion and a N-carbamoyl-L-aspartate. The latter compound interacts with a hydrogen ion through a dihydroorotase resulting in the release of a water molecule and a 4,5-dihydroorotic acid. This compound interacts with an ubiquinone-1 through a dihydroorotate dehydrogenase, type 2 resulting in a release of an ubiquinol-1 and an orotic acid. The orotic acid then interacts with a phosphoribosyl pyrophosphate through a orotate phosphoribosyltransferase resulting in a pyrophosphate and an orotidylic acid. The latter compound then interacts with a hydrogen ion through an orotidine-5 '-phosphate decarboxylase, resulting in an release of carbon dioxide and an Uridine 5' monophosphate. The Uridine 5' monophosphate process to get phosphorylated by an ATP driven UMP kinase resulting in the release of an ADP and an Uridine 5--diphosphate. Uridine 5-diphosphate can be metabolized in multiple ways in order to produce a Deoxyuridine triphosphate. 1.-Uridine 5-diphosphate interacts with a reduced thioredoxin through a ribonucleoside diphosphate reductase 1 resulting in the release of a water molecule and an oxidized thioredoxin and an dUDP. The dUDP is then phosphorylated by an ATP through a nucleoside diphosphate kinase resulting in the release of an ADP and a DeoxyUridine triphosphate. 2.-Uridine 5-diphosphate interacts with a reduced NrdH glutaredoxin-like protein through a Ribonucleoside-diphosphate reductase 1 resulting in a release of a water molecule, an oxidized NrdH glutaredoxin-like protein and a dUDP. The dUDP is then phosphorylated by an ATP through a nucleoside diphosphate kinase resulting in the release of an ADP and a DeoxyUridine triphosphate. 3.-Uridine 5-diphosphate is phosphorylated by an ATP-driven nucleoside diphosphate kinase resulting in an ADP and an Uridinetriphosphate. The latter compound interacts with a reduced flavodoxin through ribonucleoside-triphosphate reductase resulting in the release of an oxidized flavodoxin, a water molecule and a Deoxyuridine triphosphate 4.-Uridine 5-diphosphate is phosphorylated by an ATP-driven nucleoside diphosphate kinase resulting in an ADP and an Uridinetriphosphate The uridine triphosphate interacts with a L-glutamine and a water molecule through an ATP driven CTP synthase resulting in an ADP, a phosphate, a hydrogen ion, an L-glutamic acid and a cytidine triphosphate. The cytidine triphosphate interacts with a reduced flavodoxin through a ribonucleoside-triphosphate reductase resulting in the release of a water molecule, an oxidized flavodoxin and a dCTP. The dCTP interacts with a water molecule and a hydrogen ion through a dCTP deaminase resulting in a release of an ammonium molecule and a Deoxyuridine triphosphate. 5.-Uridine 5-diphosphate is phosphorylated by an ATP-driven nucleoside diphosphate kinase resulting in an ADP and an Uridinetriphosphate The uridine triphosphate interacts with a L-glutamine and a water molecule through an ATP driven CTP synthase resulting in an ADP, a phosphate, a hydrogen ion, an L-glutamic acid and a cytidine triphosphate. The cytidine triphosphate then interacts spontaneously with a water molecule resulting in the release of a phosphate, a hydrogen ion and a CDP. The CDP then interacts with a reduced NrdH glutaredoxin-like protein through a ribonucleoside-diphosphate reductase 2 resulting in the release of a water molecule, an oxidized NrdH glutaredoxin-like protein and a dCDP. The dCDP is then phosphorylated through an ATP driven nucleoside diphosphate kinase resulting in an ADP and a dCTP. The dCTP interacts with a water molecule and a hydrogen ion through a dCTP deaminase resulting in a release of an ammonium molecule and a Deoxyuridine triphosphate. 6.-Uridine 5-diphosphate is phosphorylated by an ATP-driven nucleoside diphosphate kinase resulting in an ADP and an Uridinetriphosphate The uridine triphosphate interacts with a L-glutamine and a water molecule through an ATP driven CTP synthase resulting in an ADP, a phosphate, a hydrogen ion, an L-glutamic acid and a cytidine triphosphate. The cytidine triphosphate then interacts spontaneously with a water molecule resulting in the release of a phosphate, a hydrogen ion and a CDP. The CDP interacts with a reduced thioredoxin through a ribonucleoside diphosphate reductase 1 resulting in a release of a water molecule, an oxidized thioredoxin and a dCDP. The dCDP is then phosphorylated through an ATP driven nucleoside diphosphate kinase resulting in an ADP and a dCTP. The dCTP interacts with a water molecule and a hydrogen ion through a dCTP deaminase resulting in a release of an ammonium molecule and a Deoxyuridine triphosphate. The deoxyuridine triphosphate then interacts with a water molecule through a nucleoside triphosphate pyrophosphohydrolase resulting in a release of a hydrogen ion, a phosphate and a dUMP. The dUMP then interacts with a methenyltetrahydrofolate through a thymidylate synthase resulting in a dihydrofolic acid and a 5-thymidylic acid. Then 5-thymidylic acid is then phosphorylated through a nucleoside diphosphate kinase resulting in the release of an ADP and thymidine 5'-triphosphate. PW000942 ec00240 Metabolic Metabolic pathways eco01100 Uracil degradation III PW002026 Metabolic uracil degradation III PWY0-1471 Specdb::CMs 1086462 Specdb::NmrOneD 315441 Specdb::NmrOneD 315442 Specdb::NmrOneD 315443 Specdb::NmrOneD 315444 Specdb::NmrOneD 315445 Specdb::NmrOneD 315446 Specdb::NmrOneD 315447 Specdb::NmrOneD 315448 Specdb::NmrOneD 315449 Specdb::NmrOneD 315450 Specdb::NmrOneD 315451 Specdb::NmrOneD 315452 Specdb::NmrOneD 315453 Specdb::NmrOneD 315454 Specdb::NmrOneD 315455 Specdb::NmrOneD 315456 Specdb::NmrOneD 315457 Specdb::NmrOneD 315458 Specdb::NmrOneD 315459 Specdb::NmrOneD 315460 Specdb::MsMs 28580 Specdb::MsMs 28581 Specdb::MsMs 28582 Specdb::MsMs 35138 Specdb::MsMs 35139 Specdb::MsMs 35140 46173085 26331745 C20249 59892 CPD0-2340 Keseler, I. M., Collado-Vides, J., Santos-Zavaleta, A., Peralta-Gil, M., Gama-Castro, S., Muniz-Rascado, L., Bonavides-Martinez, C., Paley, S., Krummenacker, M., Altman, T., Kaipa, P., Spaulding, A., Pacheco, J., Latendresse, M., Fulcher, C., Sarker, M., Shearer, A. G., Mackie, A., Paulsen, I., Gunsalus, R. P., Karp, P. D. (2011). "EcoCyc: a comprehensive database of Escherichia coli biology." Nucleic Acids Res 39:D583-D590. 21097882 UPF0076 protein rutC P0AFQ5 RUTC_ECOLI rutC http://ecmdb.ca/proteins/P0AFQ5.xml Putative monooxygenase rutA P75898 RUTA_ECOLI rutA http://ecmdb.ca/proteins/P75898.xml Putative isochorismatase family protein rutB P75897 RUTB_ECOLI rutB http://ecmdb.ca/proteins/P75897.xml NADH + Peroxyaminoacrylate > 3-Aminoacrylate + Water + NAD Water + Ureidoacrylate peracid > Carbamic acid + Hydrogen ion + Peroxyaminoacrylate R09947 RXN0-6460 Ureidoacrylate peracid + Water <> Peroxyaminoacrylate + Carbamic acid R09947 Peroxyaminoacrylate <> 3-Aminoacrylate R09982 Peroxyaminoacrylate + a reduced electron acceptor > 3-Aminoacrylate + Water + Hydrogen ion + an oxidized electron acceptor RXN0-6461 Ureidoacrylate peracid + Water > Peroxyaminoacrylate + Ammonia Ureidoacrylate peracid + Water + Carbamic acid + (Z)-2-Methyl-ureidoacrylate peracid <> Peroxyaminoacrylate + Carbon dioxide + Ammonia + (Z)-2-Methyl-peroxyaminoacrylate R09948 Ureidoacrylate peracid + Water > Peroxyaminoacrylate + Carbamic acid + Hydrogen ion + 3-Aminoacrylate PW_R005906 Peroxyaminoacrylate + an unknown reduced electron acceptor + 3-Aminoacrylate > 2-Aminoacrylic acid + an unknown oxidized electron acceptor PW_R005908 Uracil + FMNH2 + Oxygen > Ureidoacrylate peracid + Flavin Mononucleotide + Hydrogen ion + Peroxyaminoacrylate PW_R005905