<?xml version="1.0" encoding="UTF-8"?>
<compound>
  <version>2.0</version>
  <creation_date>2012-07-30 14:54:55 -0600</creation_date>
  <update_date>2015-06-03 17:20:52 -0600</update_date>
  <accession>ECMDB21204</accession>
  <m2m_id>M2MDB001612</m2m_id>
  <name>Decanoate (N-C10:0)</name>
  <description>Decanoate (n-c10:0) belongs to the class of Carboxylic Acid Salts. These are ionic derivatives of carboxylic acid. (inferred from compound structure)Decanoate (n-c10:0) is invovled in Fatty acid biosynthesis. (KEGG)Decanoic acid, or capric acid, is a saturated fatty acid. Its formula is CH3(CH2)8COOH. Salts and esters of decanoic acid are called decanoates. The term capric acid arises from the Latin capric which pertains to goats due to their olfactory similarities. Capric acid occurs naturally in coconut oil and palm kernel oil, as well as in the milk of various mammals and to a lesser extent in other animal fats. It is used in organic synthesis and industrially in the manufacture of perfumes, lubricants, greases, rubber, dyes, plastics, food additives and pharmaceuticals. Two other acids are named after goats: caproic (C6) and caprylic (C8). Along with decanoic acid, these total 15% in goat milk fat. (WikiPedia)</description>
  <synonyms>
    <synonym>Caprinate</synonym>
    <synonym>Caprinic acid</synonym>
    <synonym>Decanoate</synonym>
    <synonym>Decanoic acid</synonym>
    <synonym>Decanoic acid (N-C10:0)</synonym>
    <synonym>N-Caprate</synonym>
    <synonym>N-Capric acid</synonym>
    <synonym>N-Decanoate</synonym>
    <synonym>N-Decanoic acid</synonym>
  </synonyms>
  <chemical_formula>C10H19O2</chemical_formula>
  <average_molecular_weight>171.2567</average_molecular_weight>
  <monisotopic_moleculate_weight>171.138504852</monisotopic_moleculate_weight>
  <iupac_name>decanoate</iupac_name>
  <traditional_iupac>decanoate</traditional_iupac>
  <cas_registry_number/>
  <smiles>CCCCCCCCCC([O-])=O</smiles>
  <inchi>InChI=1S/C10H20O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-9H2,1H3,(H,11,12)/p-1</inchi>
  <inchikey>GHVNFZFCNZKVNT-UHFFFAOYSA-M</inchikey>
  <state/>
  <cellular_locations>
    <cellular_location>Membrane</cellular_location>
  </cellular_locations>
  <predicted_properties>
    <property>
      <kind>logp</kind>
      <value>4.13</value>
      <source>ALOGPS</source>
    </property>
    <property>
      <kind>logs</kind>
      <value>-3.53</value>
      <source>ALOGPS</source>
    </property>
    <property>
      <kind>solubility</kind>
      <value>5.60e-02 g/l</value>
      <source>ALOGPS</source>
    </property>
  </predicted_properties>
  <experimental_properties>
  </experimental_properties>
  <property>
    <kind>logp</kind>
    <value>3.59</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>pka_strongest_acidic</kind>
    <value>4.95</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>iupac</kind>
    <value>decanoate</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>average_mass</kind>
    <value>171.2567</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>mono_mass</kind>
    <value>171.138504852</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>smiles</kind>
    <value>CCCCCCCCCC([O-])=O</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>formula</kind>
    <value>C10H19O2</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>inchi</kind>
    <value>InChI=1S/C10H20O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-9H2,1H3,(H,11,12)/p-1</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>inchikey</kind>
    <value>GHVNFZFCNZKVNT-UHFFFAOYSA-M</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>polar_surface_area</kind>
    <value>40.13</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>refractivity</kind>
    <value>60.31</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>polarizability</kind>
    <value>21.14</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>rotatable_bond_count</kind>
    <value>8</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>acceptor_count</kind>
    <value>2</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>donor_count</kind>
    <value>0</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>physiological_charge</kind>
    <value>-1</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>formal_charge</kind>
    <value>-1</value>
    <source>ChemAxon</source>
  </property>
  <pathways>
  </pathways>
  <spectra>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>29576</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>29577</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>29578</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>36134</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>36135</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>36136</spectrum_id>
    </spectrum>
  </spectra>
  <hmdb_id/>
  <pubchem_compound_id>4678093</pubchem_compound_id>
  <chemspider_id>3866366</chemspider_id>
  <kegg_id>C01571</kegg_id>
  <chebi_id>27689</chebi_id>
  <biocyc_id>CPD-3617</biocyc_id>
  <het_id/>
  <wikipidia>Decanoate</wikipidia>
  <foodb_id/>
  <general_references>
    <reference>
      <reference_text>Yurtsever D. (2007). Fatty acid methyl ester profiling of Enterococcus and Esherichia coli for microbial source tracking. M.sc. Thesis. Villanova University: U.S.A</reference_text>
      <pubmed_id/>
    </reference>
  </general_references>
  <synthesis_reference/>
  <msds_url/>
  <enzymes>
    <enzyme>
      <name>Acyl carrier protein phosphodiesterase</name>
      <uniprot_id>P21515</uniprot_id>
      <uniprot_name>ACPH_ECOLI</uniprot_name>
      <gene_name>acpH</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P21515.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Bifunctional protein aas</name>
      <uniprot_id>P31119</uniprot_id>
      <uniprot_name>AAS_ECOLI</uniprot_name>
      <gene_name>aas</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P31119.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Long-chain-fatty-acid--CoA ligase</name>
      <uniprot_id>P69451</uniprot_id>
      <uniprot_name>LCFA_ECOLI</uniprot_name>
      <gene_name>fadD</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P69451.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Short-chain-fatty-acid--CoA ligase</name>
      <uniprot_id>P38135</uniprot_id>
      <uniprot_name>FADK_ECOLI</uniprot_name>
      <gene_name>fadK</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P38135.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Acyl-CoA thioesterase 2</name>
      <uniprot_id>P0AGG2</uniprot_id>
      <uniprot_name>TESB_ECOLI</uniprot_name>
      <gene_name>tesB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AGG2.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Acyl carrier protein</name>
      <uniprot_id>P0A6A8</uniprot_id>
      <uniprot_name>ACP_ECOLI</uniprot_name>
      <gene_name>acpP</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A6A8.xml</protein_url>
    </enzyme>
  </enzymes>
  <transporters>
    <enzyme>
      <name>Outer membrane protein N</name>
      <uniprot_id>P77747</uniprot_id>
      <uniprot_name>OMPN_ECOLI</uniprot_name>
      <gene_name>ompN</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P77747.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Outer membrane pore protein E</name>
      <uniprot_id>P02932</uniprot_id>
      <uniprot_name>PHOE_ECOLI</uniprot_name>
      <gene_name>phoE</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P02932.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Outer membrane protein F</name>
      <uniprot_id>P02931</uniprot_id>
      <uniprot_name>OMPF_ECOLI</uniprot_name>
      <gene_name>ompF</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P02931.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Outer membrane protein C</name>
      <uniprot_id>P06996</uniprot_id>
      <uniprot_name>OMPC_ECOLI</uniprot_name>
      <gene_name>ompC</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P06996.xml</protein_url>
    </enzyme>
  </transporters>
  <reactions>
    <reaction_text>Adenosine triphosphate + Coenzyme A + Decanoate (N-C10:0) + Hydrogen ion &gt; Adenosine monophosphate + Decanoyl-CoA (N-C10:0CoA) + Hydrogen ion + Pyrophosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>acyl carrier protein + Adenosine triphosphate + Decanoate (N-C10:0) &gt; Adenosine monophosphate + Decanoyl-ACP (n-C10:0ACP) + Pyrophosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Decanoyl-ACP (n-C10:0ACP) + Water &gt; acyl carrier protein + Decanoate (N-C10:0) + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Decanoyl-CoA (N-C10:0CoA) + Water &gt; Coenzyme A + Decanoate (N-C10:0) + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
  </reactions>
  <concentrations>
  </concentrations>
</compound>
