<?xml version="1.0" encoding="UTF-8"?>
<compound>
  <version>2.0</version>
  <creation_date>2012-07-30 14:54:42 -0600</creation_date>
  <update_date>2015-06-03 17:20:45 -0600</update_date>
  <accession>ECMDB21154</accession>
  <m2m_id>M2MDB001563</m2m_id>
  <name>2-Demethylmenaquinol 8</name>
  <description>2-demethylmenaquinol 8 belongs to the class of Tetraterpenes. These are terpene molecules containing 10 consecutively linked isoprene units. (inferred from compound structure)</description>
  <synonyms>
    <synonym>2-Demethylmenaquinol-8</synonym>
    <synonym>DMKH2-8</synonym>
  </synonyms>
  <chemical_formula>C50H72O2</chemical_formula>
  <average_molecular_weight>705.1055</average_molecular_weight>
  <monisotopic_moleculate_weight>704.553231548</monisotopic_moleculate_weight>
  <iupac_name>2-[(2E,6E,10E,14E,18E,22E,26E)-3,7,11,15,19,23,27,31-octamethyldotriaconta-2,6,10,14,18,22,26,30-octaen-1-yl]naphthalene-1,4-diol</iupac_name>
  <traditional_iupac>2-demethylmenaquinol-8</traditional_iupac>
  <cas_registry_number/>
  <smiles>[H]\C(CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC1=C(O)C2=CC=CC=C2C(O)=C1)=C(\C)CCC=C(C)C</smiles>
  <inchi>InChI=1S/C50H72O2/c1-38(2)19-12-20-39(3)21-13-22-40(4)23-14-24-41(5)25-15-26-42(6)27-16-28-43(7)29-17-30-44(8)31-18-32-45(9)35-36-46-37-49(51)47-33-10-11-34-48(47)50(46)52/h10-11,19,21,23,25,27,29,31,33-35,37,51-52H,12-18,20,22,24,26,28,30,32,36H2,1-9H3/b39-21+,40-23+,41-25+,42-27+,43-29+,44-31+,45-35+</inchi>
  <inchikey>FGYPGICSXJEKCG-AENDIINCSA-N</inchikey>
  <state/>
  <cellular_locations>
    <cellular_location>Membrane</cellular_location>
  </cellular_locations>
  <predicted_properties>
    <property>
      <kind>logp</kind>
      <value>10.00</value>
      <source>ALOGPS</source>
    </property>
    <property>
      <kind>logs</kind>
      <value>-6.48</value>
      <source>ALOGPS</source>
    </property>
    <property>
      <kind>solubility</kind>
      <value>2.33e-04 g/l</value>
      <source>ALOGPS</source>
    </property>
  </predicted_properties>
  <experimental_properties>
  </experimental_properties>
  <property>
    <kind>logp</kind>
    <value>15.7</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>pka_strongest_acidic</kind>
    <value>9.16</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>pka_strongest_basic</kind>
    <value>-6</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>iupac</kind>
    <value>2-[(2E,6E,10E,14E,18E,22E,26E)-3,7,11,15,19,23,27,31-octamethyldotriaconta-2,6,10,14,18,22,26,30-octaen-1-yl]naphthalene-1,4-diol</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>average_mass</kind>
    <value>705.1055</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>mono_mass</kind>
    <value>704.553231548</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>smiles</kind>
    <value>[H]\C(CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC\C(C)=C(/[H])CC1=C(O)C2=CC=CC=C2C(O)=C1)=C(\C)CCC=C(C)C</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>formula</kind>
    <value>C50H72O2</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>inchi</kind>
    <value>InChI=1S/C50H72O2/c1-38(2)19-12-20-39(3)21-13-22-40(4)23-14-24-41(5)25-15-26-42(6)27-16-28-43(7)29-17-30-44(8)31-18-32-45(9)35-36-46-37-49(51)47-33-10-11-34-48(47)50(46)52/h10-11,19,21,23,25,27,29,31,33-35,37,51-52H,12-18,20,22,24,26,28,30,32,36H2,1-9H3/b39-21+,40-23+,41-25+,42-27+,43-29+,44-31+,45-35+</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>inchikey</kind>
    <value>FGYPGICSXJEKCG-AENDIINCSA-N</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>polar_surface_area</kind>
    <value>40.46</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>refractivity</kind>
    <value>237.33</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>polarizability</kind>
    <value>91.6</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>rotatable_bond_count</kind>
    <value>23</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>acceptor_count</kind>
    <value>2</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>donor_count</kind>
    <value>2</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>physiological_charge</kind>
    <value>0</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>formal_charge</kind>
    <value>0</value>
    <source>ChemAxon</source>
  </property>
  <pathways>
    <pathway>
      <name>Menaquinol biosythesis</name>
      <description>Menaquinol biosynthesis starts with chorismate being metabolized into isochorismate through a isochorismate synthase. Isochorismate then interacts with 2-oxoglutare and a hydrogen ion through a 2-succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate synthase resulting in the release of a carbon dioxide and a 2-succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate. The latter compound then interacts with (1R,6R)-2-succinyl-6-hydroxy-2,4-cyclohexadiene-1-carboxylate synthase resulting in the release of a pyruvate and a (1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate. This compound is the dehydrated through a o-succinylbenzoate synthase resulting in the release of a water molecule and a 2-succinylbenzoate. This compound  then interacts with a coenzyme A and an ATP through a o-succinylbenzoate CoA ligase resulting in the release of a diphosphate, a AMP and a succinylbenzoyl-CoA. The latter compound interacts with a hydrogen ion through a 1,4-dihydroxy-2-naphthoyl-CoA synthase resulting in the release of a water molecule or a 1,4-dihydroxy-2-naphthoyl-CoA. This compound then interacts with water through a 1,4-dihydroxy-2-naphthoyl-CoA thioesterase resulting in the release of a coenzyme A, a hydrogen ion and a 1,4-dihydroxy-2-naphthoate.
The 1,4-dihydroxy-2-naphthoate can interact with either farnesylfarnesylgeranyl-PP or octaprenyl diphosphate  and a hydrogen ion through a 1,4-dihydroxy-2-naphthoate octaprenyltransferase resulting in a release of a carbon dioxide, a pyrophosphate and a demethylmenaquinol-8. This compound then interacts with SAM through a bifunctional 2-octaprenyl-6-methoxy-1,4-benzoquinone methylase and S-adenosylmethionine:2-DMK methyltransferase resulting in a hydrogen ion, a s-adenosyl-L-homocysteine and a menaquinol.</description>
      <pathwhiz_id>PW001897</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>menaquinol-8 biosynthesis</name>
      <ecocyc_pathway_id>MENAQUINONESYN-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>demethylmenaquinol-8 biosynthesis I</name>
      <ecocyc_pathway_id>PWY-5852</ecocyc_pathway_id>
    </pathway>
  </pathways>
  <spectra>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>1088811</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::EiMs</type>
      <spectrum_id>3709</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>302465</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>302466</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>302467</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>302468</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>302469</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>302470</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>302471</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>302472</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>302473</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>302474</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>302475</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>302476</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>302477</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>302478</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>302479</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>302480</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>302481</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>302482</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>302483</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>302484</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>36359</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>36360</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>36361</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>38807</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>38808</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>38809</spectrum_id>
    </spectrum>
  </spectra>
  <hmdb_id/>
  <pubchem_compound_id>45479277</pubchem_compound_id>
  <chemspider_id>26332425</chemspider_id>
  <kegg_id/>
  <chebi_id>61873</chebi_id>
  <biocyc_id>CPD-12115</biocyc_id>
  <het_id/>
  <wikipidia/>
  <foodb_id/>
  <general_references>
    <reference>
      <reference_text>Keseler, I. M., Collado-Vides, J., Santos-Zavaleta, A., Peralta-Gil, M., Gama-Castro, S., Muniz-Rascado, L., Bonavides-Martinez, C., Paley, S., Krummenacker, M., Altman, T., Kaipa, P., Spaulding, A., Pacheco, J., Latendresse, M., Fulcher, C., Sarker, M., Shearer, A. G., Mackie, A., Paulsen, I., Gunsalus, R. P., Karp, P. D. (2011). "EcoCyc: a comprehensive database of Escherichia coli biology." Nucleic Acids Res 39:D583-D590.</reference_text>
      <pubmed_id>21097882</pubmed_id>
    </reference>
  </general_references>
  <synthesis_reference/>
  <msds_url/>
  <enzymes>
    <enzyme>
      <name>Fumarate reductase flavoprotein subunit</name>
      <uniprot_id>P00363</uniprot_id>
      <uniprot_name>FRDA_ECOLI</uniprot_name>
      <gene_name>frdA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P00363.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH dehydrogenase</name>
      <uniprot_id>P00393</uniprot_id>
      <uniprot_name>DHNA_ECOLI</uniprot_name>
      <gene_name>ndh</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P00393.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Fumarate reductase subunit C</name>
      <uniprot_id>P0A8Q0</uniprot_id>
      <uniprot_name>FRDC_ECOLI</uniprot_name>
      <gene_name>frdC</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A8Q0.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Fumarate reductase subunit D</name>
      <uniprot_id>P0A8Q3</uniprot_id>
      <uniprot_name>FRDD_ECOLI</uniprot_name>
      <gene_name>frdD</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A8Q3.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Anaerobic glycerol-3-phosphate dehydrogenase subunit C</name>
      <uniprot_id>P0A996</uniprot_id>
      <uniprot_name>GLPC_ECOLI</uniprot_name>
      <gene_name>glpC</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A996.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Anaerobic glycerol-3-phosphate dehydrogenase subunit A</name>
      <uniprot_id>P0A9C0</uniprot_id>
      <uniprot_name>GLPA_ECOLI</uniprot_name>
      <gene_name>glpA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A9C0.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Fumarate reductase iron-sulfur subunit</name>
      <uniprot_id>P0AC47</uniprot_id>
      <uniprot_name>FRDB_ECOLI</uniprot_name>
      <gene_name>frdB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AC47.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Hydrogenase-1 large chain</name>
      <uniprot_id>P0ACD8</uniprot_id>
      <uniprot_name>MBHL_ECOLI</uniprot_name>
      <gene_name>hyaB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0ACD8.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Hydrogenase-2 large chain</name>
      <uniprot_id>P0ACE0</uniprot_id>
      <uniprot_name>MBHM_ECOLI</uniprot_name>
      <gene_name>hybC</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0ACE0.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Glycolate oxidase subunit glcD</name>
      <uniprot_id>P0AEP9</uniprot_id>
      <uniprot_name>GLCD_ECOLI</uniprot_name>
      <gene_name>glcD</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AEP9.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit A</name>
      <uniprot_id>P0AFC3</uniprot_id>
      <uniprot_name>NUOA_ECOLI</uniprot_name>
      <gene_name>nuoA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AFC3.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit B</name>
      <uniprot_id>P0AFC7</uniprot_id>
      <uniprot_name>NUOB_ECOLI</uniprot_name>
      <gene_name>nuoB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AFC7.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit E</name>
      <uniprot_id>P0AFD1</uniprot_id>
      <uniprot_name>NUOE_ECOLI</uniprot_name>
      <gene_name>nuoE</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AFD1.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit H</name>
      <uniprot_id>P0AFD4</uniprot_id>
      <uniprot_name>NUOH_ECOLI</uniprot_name>
      <gene_name>nuoH</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AFD4.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit I</name>
      <uniprot_id>P0AFD6</uniprot_id>
      <uniprot_name>NUOI_ECOLI</uniprot_name>
      <gene_name>nuoI</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AFD6.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit J</name>
      <uniprot_id>P0AFE0</uniprot_id>
      <uniprot_name>NUOJ_ECOLI</uniprot_name>
      <gene_name>nuoJ</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AFE0.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit K</name>
      <uniprot_id>P0AFE4</uniprot_id>
      <uniprot_name>NUOK_ECOLI</uniprot_name>
      <gene_name>nuoK</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AFE4.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit M</name>
      <uniprot_id>P0AFE8</uniprot_id>
      <uniprot_name>NUOM_ECOLI</uniprot_name>
      <gene_name>nuoM</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AFE8.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit N</name>
      <uniprot_id>P0AFF0</uniprot_id>
      <uniprot_name>NUON_ECOLI</uniprot_name>
      <gene_name>nuoN</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AFF0.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Anaerobic glycerol-3-phosphate dehydrogenase subunit B</name>
      <uniprot_id>P13033</uniprot_id>
      <uniprot_name>GLPB_ECOLI</uniprot_name>
      <gene_name>glpB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P13033.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Anaerobic dimethyl sulfoxide reductase chain A</name>
      <uniprot_id>P18775</uniprot_id>
      <uniprot_name>DMSA_ECOLI</uniprot_name>
      <gene_name>dmsA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P18775.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Anaerobic dimethyl sulfoxide reductase chain B</name>
      <uniprot_id>P18776</uniprot_id>
      <uniprot_name>DMSB_ECOLI</uniprot_name>
      <gene_name>dmsB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P18776.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit F</name>
      <uniprot_id>P31979</uniprot_id>
      <uniprot_name>NUOF_ECOLI</uniprot_name>
      <gene_name>nuoF</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P31979.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>1,4-dihydroxy-2-naphthoate octaprenyltransferase</name>
      <uniprot_id>P32166</uniprot_id>
      <uniprot_name>MENA_ECOLI</uniprot_name>
      <gene_name>menA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P32166.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit C/D</name>
      <uniprot_id>P33599</uniprot_id>
      <uniprot_name>NUOCD_ECOLI</uniprot_name>
      <gene_name>nuoC</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P33599.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit G</name>
      <uniprot_id>P33602</uniprot_id>
      <uniprot_name>NUOG_ECOLI</uniprot_name>
      <gene_name>nuoG</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P33602.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH-quinone oxidoreductase subunit L</name>
      <uniprot_id>P33607</uniprot_id>
      <uniprot_name>NUOL_ECOLI</uniprot_name>
      <gene_name>nuoL</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P33607.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Glycolate oxidase iron-sulfur subunit</name>
      <uniprot_id>P52074</uniprot_id>
      <uniprot_name>GLCF_ECOLI</uniprot_name>
      <gene_name>glcF</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P52074.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Hydrogenase-1 small chain</name>
      <uniprot_id>P69739</uniprot_id>
      <uniprot_name>MBHS_ECOLI</uniprot_name>
      <gene_name>hyaA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P69739.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Hydrogenase-2 small chain</name>
      <uniprot_id>P69741</uniprot_id>
      <uniprot_name>MBHT_ECOLI</uniprot_name>
      <gene_name>hybO</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P69741.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Trimethylamine-N-oxide reductase 2</name>
      <uniprot_id>P46923</uniprot_id>
      <uniprot_name>TORZ_ECOLI</uniprot_name>
      <gene_name>torZ</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P46923.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Modulator of drug activity B</name>
      <uniprot_id>P0AEY5</uniprot_id>
      <uniprot_name>MDAB_ECOLI</uniprot_name>
      <gene_name>mdaB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AEY5.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Cytochrome c-type protein torY</name>
      <uniprot_id>P52005</uniprot_id>
      <uniprot_name>TORY_ECOLI</uniprot_name>
      <gene_name>torY</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P52005.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Anaerobic dimethyl sulfoxide reductase chain C</name>
      <uniprot_id>P18777</uniprot_id>
      <uniprot_name>DMSC_ECOLI</uniprot_name>
      <gene_name>dmsC</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P18777.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Probable Ni/Fe-hydrogenase 1 B-type cytochrome subunit</name>
      <uniprot_id>P0AAM1</uniprot_id>
      <uniprot_name>CYBH_ECOLI</uniprot_name>
      <gene_name>hyaC</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AAM1.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Glycolate oxidase subunit glcE</name>
      <uniprot_id>P52073</uniprot_id>
      <uniprot_name>GLCE_ECOLI</uniprot_name>
      <gene_name>glcE</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P52073.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Hydrogenase-2 operon protein hybA</name>
      <uniprot_id>P0AAJ8</uniprot_id>
      <uniprot_name>HYBA_ECOLI</uniprot_name>
      <gene_name>hybA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AAJ8.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Trimethylamine-N-oxide reductase 1</name>
      <uniprot_id>P33225</uniprot_id>
      <uniprot_name>TORA_ECOLI</uniprot_name>
      <gene_name>torA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P33225.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Probable Ni/Fe-hydrogenase 2 b-type cytochrome subunit</name>
      <uniprot_id>P37180</uniprot_id>
      <uniprot_name>HYBB_ECOLI</uniprot_name>
      <gene_name>hybB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P37180.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Cytochrome c-type protein torC</name>
      <uniprot_id>P33226</uniprot_id>
      <uniprot_name>TORC_ECOLI</uniprot_name>
      <gene_name>torC</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P33226.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Ubiquinone/menaquinone biosynthesis methyltransferase ubiE</name>
      <uniprot_id>P0A887</uniprot_id>
      <uniprot_name>UBIE_ECOLI</uniprot_name>
      <gene_name>ubiE</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A887.xml</protein_url>
    </enzyme>
  </enzymes>
  <transporters>
  </transporters>
  <reactions>
    <reaction_text>2-Demethylmenaquinone 8 + 2 Hydrogen ion + Hydrogen (gas) &gt; 2-Demethylmenaquinol 8 +2 Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2-Demethylmenaquinol 8 + Hydrogen ion + Trimethylamine N-Oxide &gt; 2-Demethylmenaquinone 8 + Water + Trimethylamine</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2-Demethylmenaquinol 8 + Dimethyl sulfoxide &gt; 2-Demethylmenaquinone 8 + Dimethyl sulfide + Water</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2-Demethylmenaquinone 8 + Glycerol 3-phosphate &gt; 2-Demethylmenaquinol 8 + Dihydroxyacetone phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2-Demethylmenaquinone 8 + 4 Hydrogen ion + NADH &gt; 2-Demethylmenaquinol 8 + NAD +3 Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2-Demethylmenaquinone 8 + Glycolic acid &gt; 2-Demethylmenaquinol 8 + Glyoxylic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2-Demethylmenaquinol 8 + Fumaric acid &gt; 2-Demethylmenaquinone 8 + Succinic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2-Demethylmenaquinone 8 + Hydrogen ion + NADH &gt; 2-Demethylmenaquinol 8 + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2-Demethylmenaquinone 8 + Hydrogen ion + NADPH &gt; 2-Demethylmenaquinol 8 + NADP</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2-Demethylmenaquinol 8 + S-Adenosylmethionine &gt; S-Adenosylhomocysteine + Hydrogen ion + Menaquinol 8</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>ADOMET-DMK-METHYLTRANSFER-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>1,4-Dihydroxy-2-naphthoic acid + Hydrogen ion + Octaprenyl diphosphate &gt; 2-Demethylmenaquinol 8 + Carbon dioxide + Pyrophosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>all-&lt;i&gt;trans&lt;/i&gt;-octaprenyl diphosphate + 1,4-Dihydroxy-2-naphthoic acid + Hydrogen ion &gt; 2-Demethylmenaquinol 8 + Pyrophosphate + Carbon dioxide</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>DMK-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>2-Demethylmenaquinol 8 + S-adenosyl-L-methionine &gt; Hydrogen ion + S-Adenosylhomocysteine + Menaquinol 8</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R005240</pw_reaction_id>
    <reaction_text>1,4-dihydroxy-2-naphthoate + Hydrogen ion + Farnesylfarnesylgeranyl-PP + 1,4-Dihydroxy-2-naphthoyl-CoA &gt; Carbon dioxide + Pyrophosphate + 2-Demethylmenaquinol 8</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R005235</pw_reaction_id>
    <reaction_text>Octaprenyl diphosphate + 1,4-dihydroxy-2-naphthoate + Hydrogen ion + Octaprenyl diphosphate + 1,4-Dihydroxy-2-naphthoyl-CoA &gt; Carbon dioxide + Pyrophosphate + 2-Demethylmenaquinol 8</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R005237</pw_reaction_id>
  </reactions>
  <concentrations>
  </concentrations>
</compound>
