2.0 2015-09-08 17:50:23 -0600 2015-09-14 16:46:45 -0600 ECMDB24247 M2MDB006364 β-D-fructofuranose 1-phosphate beta-D-fructofuranose 1-phosphate is an intermediate in fructose degradation pathway in E.coli. It is a substrate for the enzyme 1-phosphofructokinase which catalyzes the reaction ATP + beta-D-fructofuranose 1-phosphate -> ADP + fructose 1,6-bisphosphate + H+ (BioCyc compound: FRU1P). β-D-fructofuranose 1-phosphoric acid C6H11O9P 258.12 258.015166092 [2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl phosphate [2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl phosphate OCC1OC(O)(COP([O-])([O-])=O)C(O)C1O InChI=1S/C6H13O9P/c7-1-3-4(8)5(9)6(10,15-3)2-14-16(11,12)13/h3-5,7-10H,1-2H2,(H2,11,12,13)/p-2 RHKKZBWRNHGJEZ-UHFFFAOYSA-L logp -2.15 ALOGPS logs -0.60 ALOGPS solubility 7.33e+01 g/l ALOGPS logp -2.9 ChemAxon pka_strongest_acidic 1.16 ChemAxon pka_strongest_basic -3 ChemAxon iupac [2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl phosphate ChemAxon average_mass 258.12 ChemAxon mono_mass 258.015166092 ChemAxon smiles OCC1OC(O)(COP([O-])([O-])=O)C(O)C1O ChemAxon formula C6H11O9P ChemAxon inchi InChI=1S/C6H13O9P/c7-1-3-4(8)5(9)6(10,15-3)2-14-16(11,12)13/h3-5,7-10H,1-2H2,(H2,11,12,13)/p-2 ChemAxon inchikey RHKKZBWRNHGJEZ-UHFFFAOYSA-L ChemAxon polar_surface_area 162.57 ChemAxon refractivity 44.99 ChemAxon polarizability 20.38 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 8 ChemAxon donor_count 4 ChemAxon physiological_charge -2 ChemAxon formal_charge -2 ChemAxon fructose metabolism Fructose metabolism begins with the transport of Beta-D-fructofuranose through a fructose PTS permease, resulting in a Beta-D-fructofuranose 1-phosphate. This compound is phosphorylated by an ATP driven 1-phosphofructokinase resulting in a fructose 1,6-biphosphate. This compound can either react with a fructose bisphosphate aldolase class 1 resulting in D-glyceraldehyde 3-phosphate and a dihydroxyacetone phosphate or through a fructose biphosphate aldolase class 2 resulting in a D-glyceraldehyde 3-phosphate. This compound can then either react in a reversible triosephosphate isomerase resulting in a dihydroxyacetone phosphate or react with a phosphate through a NAD dependent Glyceraldehyde 3-phosphate dehydrogenase resulting in a glyceric acid 1,3-biphosphate. This compound is desphosphorylated by a phosphoglycerate kinase resulting in a 3-phosphoglyceric acid.This compound in turn can either react with a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase or a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase resulting in a 2-phospho-D-glyceric acid. This compound interacts with an enolase resulting in a phosphoenolpyruvic acid and water. Phosphoenolpyruvic acid can react either through a AMP driven phosphoenoylpyruvate synthase or a ADP driven pyruvate kinase protein complex resulting in a pyruvic acid. Pyruvic acid reacts with CoA through a NAD driven pyruvate dehydrogenase complex resulting in a carbon dioxide and a Acetyl-CoA which gets incorporated into the TCA cycle pathway. PW000913 Metabolic Specdb::NmrOneD 288195 Specdb::NmrOneD 288196 Specdb::NmrOneD 288197 Specdb::NmrOneD 288198 Specdb::NmrOneD 288199 Specdb::NmrOneD 288200 Specdb::NmrOneD 288201 Specdb::NmrOneD 288202 Specdb::NmrOneD 288203 Specdb::NmrOneD 288204 Specdb::NmrOneD 288205 Specdb::NmrOneD 288206 Specdb::NmrOneD 288207 Specdb::NmrOneD 288208 Specdb::NmrOneD 288209 Specdb::NmrOneD 288210 Specdb::NmrOneD 288211 Specdb::NmrOneD 288212 Specdb::NmrOneD 288213 Specdb::NmrOneD 288214 Specdb::MsMs 23447 Specdb::MsMs 23448 Specdb::MsMs 23449 Specdb::MsMs 30245 Specdb::MsMs 30246 Specdb::MsMs 30247 1-phosphofructokinase P0AEW9 K1PF_ECOLI fruK http://ecmdb.ca/proteins/P0AEW9.xml PTS system fructose-specific EIIBC component P20966 PTFBC_ECOLI fruA http://ecmdb.ca/proteins/P20966.xml Multiphosphoryl transfer protein P69811 PTFAH_ECOLI fruB http://ecmdb.ca/proteins/P69811.xml PTS system fructose-specific EIIBC component P20966 PTFBC_ECOLI fruA http://ecmdb.ca/proteins/P20966.xml β-D-fructofuranose 1-phosphate + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + Fructose 1,6-bisphosphate + ADP + Fructose 1,6-bisphosphate PW_R003439 β-D-fructofuranose + PtsI - his 189 phosphorylated + D-Fructose > β-D-fructofuranose 1-phosphate + PTS enzyme I PW_RCT000139