2.0 2015-09-08 17:50:03 -0600 2015-09-14 16:46:32 -0600 ECMDB24204 M2MDB006321 (2Z)-2-aminobut-2-enoate (2Z)-2-aminobut-2-enoate is an intermediate of pathways L-threonine degradation I and L-isoleucine biosynthesis I in E. coli. It is a product for enzymes threonine dehydratase and threonine deaminase which catalyze the reaction L-threonine -> (2Z)-2-aminobut-2-enoate + H2O + H+ in both pathways. (2Z)-2-aminobut-2-enoate is also a substrate of the spontaneous reaction (2Z)-2-aminobut-2-enoate -> 2-iminobutanoate in both pathways (BioCyc compound: CPD-15056). (2Z)-2-Aminobut-2-enoic acid C4H6NO2 100.098 100.040402017 2-aminobut-2-enoate 2-aminobut-2-enoate CC=C(N)C([O-])=O InChI=1S/C4H7NO2/c1-2-3(5)4(6)7/h2H,5H2,1H3,(H,6,7)/p-1 PAWSVPVNIXFKOS-UHFFFAOYSA-M logp 0.14 ALOGPS logs 0.45 ALOGPS solubility 3.31e+02 g/l ALOGPS logp -2.5 ChemAxon pka_strongest_acidic 2.88 ChemAxon pka_strongest_basic 8.46 ChemAxon iupac 2-aminobut-2-enoate ChemAxon average_mass 100.098 ChemAxon mono_mass 100.040402017 ChemAxon smiles CC=C(N)C([O-])=O ChemAxon formula C4H6NO2 ChemAxon inchi InChI=1S/C4H7NO2/c1-2-3(5)4(6)7/h2H,5H2,1H3,(H,6,7)/p-1 ChemAxon inchikey PAWSVPVNIXFKOS-UHFFFAOYSA-M ChemAxon polar_surface_area 66.15 ChemAxon refractivity 37.43 ChemAxon polarizability 9.33 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge -1 ChemAxon Propanoate metabolism Starting from L-threonine, this compound is deaminated through a threonine deaminase resulting in a hydrogen ion, a water molecule and a (2z)-2-aminobut-2-enoate. The latter compound then isomerizes to a 2-iminobutanoate, This compound then reacts spontaneously with hydrogen ion and a water molecule resulting in a ammonium and a 2-Ketobutyric acid. The latter compound interacts with CoA through a pyruvate formate-lyase / 2-ketobutyrate formate-lyase resulting in a formic acid and a propionyl-CoA. Propionyl-CoA can then be processed either into a 2-methylcitric acid or into a propanoyl phosphate. Propionyl-CoA interacts with oxalacetic acid and a water molecule through a 2-methylcitrate synthase resulting in a hydrogen ion, a CoA and a 2-Methylcitric acid.The latter compound is dehydrated through a 2-methylcitrate dehydratase resulting in a water molecule and cis-2-methylaconitate. The latter compound is then dehydrated by a bifunctional aconitate hydratase 2 and 2-methylisocitrate dehydratase resulting in a water molecule and methylisocitric acid. The latter compound is then processed by 2-methylisocitrate lyase resulting in a release of succinic acid and pyruvic acid. Succinic acid can then interact with a propionyl-CoA through a propionyl-CoA:succinate CoA transferase resulting in a propionic acid and a succinyl CoA. Succinyl-CoA is then isomerized through a methylmalonyl-CoA mutase resulting in a methylmalonyl-CoA. This compound is then decarboxylated through a methylmalonyl-CoA decarboxylase resulting in a release of Carbon dioxide and Propionyl-CoA. ropionyl-CoA interacts with a phosphate through a phosphate acetyltransferase / phosphate propionyltransferase resulting in a CoA and a propanoyl phosphate. Propionyl-CoA can react with a phosphate through a phosphate acetyltransferase / phosphate propionyltransferase resulting in a CoA and a propanoyl phosphate. The latter compound is then dephosphorylated through a ADP driven acetate kinase/propionate kinase protein complex resulting in an ATP and Propionic acid. Propionic acid can be processed by a reaction with CoA through a ATP-driven propionyl-CoA synthetase resulting in a pyrophosphate, an AMP and a propionyl-CoA. PW000940 ec00640 Metabolic isoleucine biosynthesis Isoleucine biosynthesis begins with L-threonine from the threonine biosynthesis pathway. L-threonine interacts with a threonine dehydratase biosynthetic releasing water, a hydrogen ion and (2Z)-2-aminobut-2-enoate. This compound is isomerized into a 2-iminobutanoate which interacts with water and a hydrogen ion spontaneously, resulting in the release of ammonium and 2-ketobutyric acid. This compound reacts with pyruvic acid and hydrogen ion through an acetohydroxybutanoate synthase / acetolactate synthase 2 resulting in carbon dioxide and (S)-2-Aceto-2-hydroxybutanoic acid. The latter compound is reduced by an NADPH driven acetohydroxy acid isomeroreductase releasing NADP and acetohydroxy acid isomeroreductase. The latter compound is dehydrated by a dihydroxy acid dehydratase resulting in 3-methyl-2-oxovaleric acid.This compound reacts in a reversible reaction with L-glutamic acid through a Branched-chain-amino-acid aminotransferase resulting in oxoglutaric acid and L-isoleucine. L-isoleucine can also be transported into the cytoplasm through two different methods: a branched chain amino acid ABC transporter or a branched chain amino acid transporter BrnQ y. PW000818 Metabolic Specdb::MsMs 28793 Specdb::MsMs 28794 Specdb::MsMs 28795 Specdb::MsMs 35351 Specdb::MsMs 35352 Specdb::MsMs 35353 Threonine dehydratase biosynthetic P04968 THD1_ECOLI ilvA http://ecmdb.ca/proteins/P04968.xml L-Threonine + L-Threonine > Hydrogen ion + Water + (2Z)-2-aminobut-2-enoate PW_R002922