2.0 2015-06-11 10:46:25 -0600 2015-08-05 16:22:05 -0600 ECMDB23898 M2MDB005689 L-Ornithine An optically active form of ornithine having L-configuration (S)-2,5-Diaminopentanoate (S)-2,5-Diaminopentanoic acid (S)-2,5-Diaminovalerate (S)-2,5-Diaminovaleric acid C5H12N2O2 132.161 132.089877638 (2S)-2,5-diaminopentanoic acid ornithine 70-26-8 NCCC[C@H](N)C(O)=O InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m0/s1 AHLPHDHHMVZTML-BYPYZUCNSA-N logp -3.64 ALOGPS logs 0.11 ALOGPS solubility 1.72e+02 g/l ALOGPS logp -3.7 ChemAxon pka_strongest_acidic 2.67 ChemAxon pka_strongest_basic 10.29 ChemAxon iupac (2S)-2,5-diaminopentanoic acid ChemAxon average_mass 132.161 ChemAxon mono_mass 132.089877638 ChemAxon smiles NCCC[C@H](N)C(O)=O ChemAxon formula C5H12N2O2 ChemAxon inchi InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m0/s1 ChemAxon inchikey AHLPHDHHMVZTML-BYPYZUCNSA-N ChemAxon polar_surface_area 89.34 ChemAxon refractivity 33.21 ChemAxon polarizability 13.85 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Glutathione metabolism The biosynthesis of glutathione starts with the introduction of L-glutamic acid through either a glutamate:sodium symporter, glutamate / aspartate : H+ symporter GltP or a glutamate / aspartate ABC transporter. Once in the cytoplasm, L-glutamice acid reacts with L-cysteine through an ATP glutamate-cysteine ligase resulting in gamma-glutamylcysteine. This compound reacts which Glycine through an ATP driven glutathione synthetase thus catabolizing Glutathione. This compound is metabolized through a spontaneous reaction with an oxidized glutaredoxin resulting in a reduced glutaredoxin and an oxidized glutathione. This compound is reduced by a NADPH glutathione reductase resulting in a glutathione. PW000833 ec00480 Metabolic Arginine and proline metabolism ec00330 Metabolic pathways eco01100 Specdb::CMs 472 Specdb::CMs 473 Specdb::CMs 474 Specdb::CMs 1291 Specdb::CMs 1415 Specdb::CMs 1484 Specdb::CMs 1750 Specdb::CMs 2994 Specdb::CMs 30085 Specdb::CMs 30379 Specdb::CMs 30606 Specdb::CMs 30798 Specdb::CMs 31079 Specdb::CMs 31080 Specdb::CMs 31081 Specdb::CMs 31082 Specdb::CMs 31791 Specdb::CMs 32270 Specdb::CMs 32271 Specdb::CMs 32273 Specdb::CMs 37363 Specdb::CMs 130647 Specdb::CMs 138381 Specdb::CMs 1054761 Specdb::CMs 1054763 Specdb::NmrOneD 1206 Specdb::NmrOneD 1207 Specdb::NmrOneD 4859 Specdb::NmrOneD 6152 Specdb::NmrOneD 6153 Specdb::NmrOneD 6154 Specdb::NmrOneD 6155 Specdb::NmrOneD 6156 Specdb::NmrOneD 6157 Specdb::NmrOneD 6158 Specdb::NmrOneD 6159 Specdb::NmrOneD 6160 Specdb::NmrOneD 6161 Specdb::NmrOneD 6162 Specdb::NmrOneD 6163 Specdb::NmrOneD 6164 Specdb::NmrOneD 6165 Specdb::NmrOneD 6166 Specdb::NmrOneD 6167 Specdb::NmrOneD 6168 Specdb::NmrOneD 6169 Specdb::NmrOneD 6170 Specdb::NmrOneD 6171 Specdb::NmrOneD 166442 Specdb::MsMs 349 Specdb::MsMs 350 Specdb::MsMs 351 Specdb::MsMs 3635 Specdb::MsMs 3636 Specdb::MsMs 3637 Specdb::MsMs 3638 Specdb::MsMs 3639 Specdb::MsMs 3640 Specdb::MsMs 3641 Specdb::MsMs 3642 Specdb::MsMs 3643 Specdb::MsMs 3644 Specdb::MsMs 3645 Specdb::MsMs 3646 Specdb::MsMs 3647 Specdb::MsMs 3648 Specdb::MsMs 3649 Specdb::MsMs 3650 Specdb::MsMs 3651 Specdb::MsMs 3652 Specdb::MsMs 3653 Specdb::MsMs 179271 Specdb::MsMs 179272 Specdb::MsMs 179273 Specdb::NmrTwoD 996 Specdb::NmrTwoD 1212 C00077 Ornithine carbamoyltransferase chain I P04391 OTC1_ECOLI argI http://ecmdb.ca/proteins/P04391.xml Ornithine carbamoyltransferase chain F P06960 OTC2_ECOLI argF http://ecmdb.ca/proteins/P06960.xml Ornithine decarboxylase, constitutive P21169 DCOR_ECOLI speC http://ecmdb.ca/proteins/P21169.xml Acetylornithine deacetylase P23908 ARGE_ECOLI argE http://ecmdb.ca/proteins/P23908.xml Ornithine decarboxylase, inducible P24169 DCOS_ECOLI speF http://ecmdb.ca/proteins/P24169.xml N-Acetylornithine + Water <> Acetic acid + Ornithine + L-Ornithine R00669 ACETYLORNDEACET-RXN Carbamoylphosphate + Ornithine + L-Ornithine <> Citrulline + Hydrogen ion + Phosphate R01398 ORNCARBAMTRANSFER-RXN Hydrogen ion + Ornithine + L-Ornithine <> Carbon dioxide + Putrescine + Ethylenediamine R00670 ORNDECARBOX-RXN Carbamoylphosphate + Ornithine + L-Ornithine <> Citrulline + Hydrogen ion + Phosphate Hydrogen ion + Ornithine + L-Ornithine <> Carbon dioxide + Putrescine + Ethylenediamine N-Acetylornithine + Water <> Acetic acid + Ornithine + L-Ornithine N-Acetylornithine + Water <> Acetic acid + Ornithine + L-Ornithine