<?xml version="1.0" encoding="UTF-8"?>
<compound>
  <version>2.0</version>
  <creation_date>2015-06-04 19:21:40 -0600</creation_date>
  <update_date>2015-09-17 15:42:02 -0600</update_date>
  <accession>ECMDB23841</accession>
  <m2m_id>M2MDB004860</m2m_id>
  <name>(S)-Lactaldehyde</name>
  <description/>
  <synonyms>
    <synonym>(+-)-2-Hydroxypropanal</synonym>
    <synonym>(S)-Lactaldehyde</synonym>
    <synonym>2-Hydroxypropanal</synonym>
    <synonym>2-Hydroxypropionaldehyde</synonym>
    <synonym>a-Hydroxypropionaldehyde</synonym>
    <synonym>alpha-Hydroxypropionaldehyde</synonym>
    <synonym>Hydroxypropionaldehyde</synonym>
    <synonym>L-2-Hydroxypropionaldehyde</synonym>
    <synonym>L-Lactaldehyde</synonym>
    <synonym>α-Hydroxypropionaldehyde</synonym>
  </synonyms>
  <chemical_formula>C3H6O2</chemical_formula>
  <average_molecular_weight>74.079</average_molecular_weight>
  <monisotopic_moleculate_weight>74.036779433</monisotopic_moleculate_weight>
  <iupac_name>(2S)-2-hydroxypropanal</iupac_name>
  <traditional_iupac>L-lactaldehyde</traditional_iupac>
  <cas_registry_number>3913-64-2</cas_registry_number>
  <smiles>[H]C(=O)C(C)O</smiles>
  <inchi>InChI=1S/C3H6O2/c1-3(5)2-4/h2-3,5H,1H3</inchi>
  <inchikey>BSABBBMNWQWLLU-UHFFFAOYSA-N</inchikey>
  <state/>
  <cellular_locations>
  </cellular_locations>
  <predicted_properties>
    <property>
      <kind>logp</kind>
      <value>-1.04</value>
      <source>ALOGPS</source>
    </property>
    <property>
      <kind>logs</kind>
      <value>0.95</value>
      <source>ALOGPS</source>
    </property>
    <property>
      <kind>solubility</kind>
      <value>6.58e+02 g/l</value>
      <source>ALOGPS</source>
    </property>
  </predicted_properties>
  <experimental_properties>
  </experimental_properties>
  <property>
    <kind>logp</kind>
    <value>-0.63</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>pka_strongest_acidic</kind>
    <value>14.01</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>pka_strongest_basic</kind>
    <value>-3.2</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>iupac</kind>
    <value>(2S)-2-hydroxypropanal</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>average_mass</kind>
    <value>74.079</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>mono_mass</kind>
    <value>74.036779433</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>smiles</kind>
    <value>[H]C(=O)C(C)O</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>formula</kind>
    <value>C3H6O2</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>inchi</kind>
    <value>InChI=1S/C3H6O2/c1-3(5)2-4/h2-3,5H,1H3</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>inchikey</kind>
    <value>BSABBBMNWQWLLU-UHFFFAOYSA-N</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>polar_surface_area</kind>
    <value>37.3</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>refractivity</kind>
    <value>17.91</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>polarizability</kind>
    <value>7.16</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>rotatable_bond_count</kind>
    <value>1</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>acceptor_count</kind>
    <value>2</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>donor_count</kind>
    <value>1</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>physiological_charge</kind>
    <value>0</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>formal_charge</kind>
    <value>0</value>
    <source>ChemAxon</source>
  </property>
  <pathways>
    <pathway>
      <name>Fructose and mannose metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00051</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Pyruvate metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00620</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Pentose and glucuronate interconversions</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00040</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Glyoxylate and dicarboxylate metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00630</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Propanoate metabolism</name>
      <description>
Starting from L-threonine, this compound is deaminated through a threonine deaminase resulting in a hydrogen ion, a water molecule and a (2z)-2-aminobut-2-enoate. The latter compound then isomerizes to a 2-iminobutanoate, This compound then reacts spontaneously with hydrogen ion and a water molecule resulting in a ammonium and a 2-Ketobutyric acid. The latter compound interacts with CoA through a pyruvate formate-lyase / 2-ketobutyrate formate-lyase resulting in a formic acid and a propionyl-CoA. 
Propionyl-CoA can then be processed either into a 2-methylcitric acid or into a propanoyl phosphate.
Propionyl-CoA interacts with oxalacetic acid and a water molecule through a 2-methylcitrate synthase resulting in a hydrogen ion, a CoA and a 2-Methylcitric acid.The latter compound is dehydrated through a 2-methylcitrate dehydratase resulting in a water molecule and cis-2-methylaconitate. The latter compound is then dehydrated by a 
bifunctional aconitate hydratase 2 and 2-methylisocitrate dehydratase  resulting in a water molecule and methylisocitric acid. The latter compound is then processed by 2-methylisocitrate lyase resulting in a release of succinic acid and pyruvic acid.
Succinic acid can then interact with a propionyl-CoA through a propionyl-CoA:succinate CoA transferase resulting in a propionic acid and a succinyl CoA. Succinyl-CoA is then isomerized through a methylmalonyl-CoA mutase resulting in a methylmalonyl-CoA. This compound is then decarboxylated through a methylmalonyl-CoA decarboxylase resulting in a release of Carbon dioxide and Propionyl-CoA.
ropionyl-CoA interacts with a phosphate through a phosphate acetyltransferase / phosphate propionyltransferase resulting in a CoA and a propanoyl phosphate.
Propionyl-CoA can react with a phosphate through a phosphate acetyltransferase / phosphate propionyltransferase resulting in a CoA and a propanoyl phosphate. The latter compound is then dephosphorylated through a ADP driven acetate kinase/propionate kinase protein complex resulting in an ATP and Propionic acid.
Propionic acid can be processed by a reaction with CoA through a ATP-driven propionyl-CoA synthetase resulting in a pyrophosphate, an AMP and a propionyl-CoA.</description>
      <pathwhiz_id>PW000940</pathwhiz_id>
      <kegg_map_id>ec00640</kegg_map_id>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Microbial metabolism in diverse environments</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec01120</kegg_map_id>
      <subject/>
    </pathway>
  </pathways>
  <spectra>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>2435</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>38515</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>174313</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>27830</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>27831</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>27832</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>34388</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>34389</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>34390</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2669014</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2669015</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2669016</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>3013694</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>3013695</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>3013696</spectrum_id>
    </spectrum>
  </spectra>
  <hmdb_id/>
  <pubchem_compound_id/>
  <chemspider_id/>
  <kegg_id>C00424</kegg_id>
  <chebi_id/>
  <biocyc_id/>
  <het_id/>
  <wikipidia/>
  <foodb_id/>
  <general_references>
  </general_references>
  <synthesis_reference/>
  <msds_url/>
  <enzymes>
    <enzyme>
      <name>Lactaldehyde reductase</name>
      <uniprot_id>P0A9S1</uniprot_id>
      <uniprot_name>FUCO_ECOLI</uniprot_name>
      <gene_name>fucO</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A9S1.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Glycerol dehydrogenase</name>
      <uniprot_id>P0A9S5</uniprot_id>
      <uniprot_name>GLDA_ECOLI</uniprot_name>
      <gene_name>gldA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A9S5.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>L-fuculose phosphate aldolase</name>
      <uniprot_id>P0AB87</uniprot_id>
      <uniprot_name>FUCA_ECOLI</uniprot_name>
      <gene_name>fucA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AB87.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Lactaldehyde dehydrogenase</name>
      <uniprot_id>P25553</uniprot_id>
      <uniprot_name>ALDA_ECOLI</uniprot_name>
      <gene_name>aldA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P25553.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Rhamnulose-1-phosphate aldolase</name>
      <uniprot_id>P32169</uniprot_id>
      <uniprot_name>RHAD_ECOLI</uniprot_name>
      <gene_name>rhaD</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P32169.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>2-keto-3-deoxy-L-rhamnonate aldolase</name>
      <uniprot_id>P76469</uniprot_id>
      <uniprot_name>RHMA_ECOLI</uniprot_name>
      <gene_name>rhmA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P76469.xml</protein_url>
    </enzyme>
  </enzymes>
  <transporters>
  </transporters>
  <reactions>
    <reaction_text>Water + Lactaldehyde + NAD + (S)-Lactaldehyde &lt;&gt;2 Hydrogen ion + L-Lactic acid + NADH</reaction_text>
    <kegg_reaction_id>R01446</kegg_reaction_id>
    <ecocyc_id>LACTALDDEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>2-Dehydro-3-deoxy-L-rhamnonate &lt;&gt; Lactaldehyde + Pyruvic acid + (S)-Lactaldehyde</reaction_text>
    <kegg_reaction_id>R02261</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>(R)-Propane-1,2-diol + (S)-Propane-1,2-diol + NAD &lt;&gt; D-Lactaldehyde + (S)-Lactaldehyde + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R02258 R03080 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-Fuculose 1-phosphate &lt;&gt; Dihydroxyacetone phosphate + Lactaldehyde + (S)-Lactaldehyde</reaction_text>
    <kegg_reaction_id>R02262</kegg_reaction_id>
    <ecocyc_id>FUCPALDOL-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>L-Rhamnulose 1-phosphate &lt;&gt; Dihydroxyacetone phosphate + Lactaldehyde + (S)-Lactaldehyde</reaction_text>
    <kegg_reaction_id>R02263</kegg_reaction_id>
    <ecocyc_id>RHAMNULPALDOL-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>2 2-Dehydro-3-deoxy-L-rhamnonate &lt;&gt; Lactaldehyde + Pyruvic acid + (S)-Lactaldehyde</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
  </reactions>
  <concentrations>
  </concentrations>
</compound>
