2.0 2015-06-04 16:52:06 -0600 2015-08-05 16:22:04 -0600 ECMDB23829 M2MDB004631 Polyphosphate The phosphorus oxoanion formed from polyphosphoric acid by proton loss from each of the phosphate units. The major species at pH 7.3. (Phosphate)N (Phosphate)n+1 (Phosphate)N-1 (Phosphoric acid)N (Phosphoric acid)n+1 (Phosphoric acid)N-1 Acide triphosphorique Bis(dihydroxidodioxidophosphato)hydroxidooxidophosphorus Bis(phosphonooxy)phosphinate Bis(phosphonooxy)phosphinic acid Catena-triphosphate Catena-triphosphoric acid DAD DCT DGT diphosphono Hydrogen phosphate diphosphono Hydrogen phosphoric acid DTP GTP H5P3O10 Inorganic open chain tripolyphosphate Inorganic open chain tripolyphosphoric acid Inorganic triphosphate Inorganic triphosphoric acid Polyphosphoric acid Triphospate TRIphosphATE Triphosphate analogs TRIphosphoric acid Triphosphoric acid analogs Triphosphorsaeure Triphospic acid Tripolyphosphate Tripolyphosphoric acid TTP H5O10P3 257.955 257.909555916 {[hydroxy(phosphonooxy)phosphoryl]oxy}phosphonic acid tripolyphosphate OP(O)(=O)OP(O)(=O)OP(O)(O)=O InChI=1S/H5O10P3/c1-11(2,3)9-13(7,8)10-12(4,5)6/h(H,7,8)(H2,1,2,3)(H2,4,5,6) UNXRWKVEANCORM-UHFFFAOYSA-N logp -1.9 ChemAxon pka_strongest_acidic 0.89 ChemAxon iupac {[hydroxy(phosphonooxy)phosphoryl]oxy}phosphonic acid ChemAxon average_mass 257.955 ChemAxon mono_mass 257.909555916 ChemAxon smiles OP(O)(=O)OP(O)(=O)OP(O)(O)=O ChemAxon formula H5O10P3 ChemAxon inchi InChI=1S/H5O10P3/c1-11(2,3)9-13(7,8)10-12(4,5)6/h(H,7,8)(H2,1,2,3)(H2,4,5,6) ChemAxon inchikey UNXRWKVEANCORM-UHFFFAOYSA-N ChemAxon polar_surface_area 170.82 ChemAxon refractivity 36.4 ChemAxon polarizability 14.67 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 8 ChemAxon donor_count 5 ChemAxon physiological_charge -4 ChemAxon formal_charge 0 ChemAxon Oxidative phosphorylation The process of oxidative phosphorylation involves multiple interactions of ubiquinone with succinic acid, resulting in a fumaric acid and ubiquinol. Ubiquinone interacts with succinic acid through a succinate:quinone oxidoreductase resulting in a fumaric acid an ubiquinol. This enzyme has various cofactors, ferroheme b, 2FE-2S, FAD, and 3Fe-4S iron-sulfur cluster. Then 2 ubiquinol interact with oxygen and 4 hydrogen ion through a cytochrome bd-I terminal oxidase resulting in a 4 hydrogen ion transferred into the periplasmic space, 2 water returned into the cytoplasm and 2 ubiquinone, which stay in the inner membrane. The ubiquinone interacts with succinic acid through a succinate:quinone oxidoreductase resulting in a fumaric acid an ubiquinol. Then 2 ubiquinol interacts with oxygen and 4 hydrogen ion through a cytochrome bd-II terminal oxidase resulting in a 4 hydrogen ion transferred into the periplasmic space, 2 water returned into the cytoplasm and 2 ubiquinone, which stay in the inner membrane. The ubiquinone interacts with succinic acid through a succinate:quinone oxidoreductase resulting in a fumaric acid an ubiquinol. The 2 ubiquinol interact with oxygen and 8 hydrogen ion through a cytochrome bo terminal oxidase resulting in a 8 hydrogen ion transferred into the periplasmic space, 2 water returned into the cytoplasm and 2 ubiquinone, which stays in the inner membrane. The ubiquinone then interacts with 5 hydrogen ion through a NADH dependent ubiquinone oxidoreductase I resulting in NAD, hydrogen ion released into the periplasmic space and an ubiquinol. The ubiquinol is then processed reacting with oxygen, and 4 hydrogen through a ion cytochrome bd-I terminal oxidase resulting in 4 hydrogen ions released into the periplasmic space, 2 water molecules into the cytoplasm and 2 ubiquinones. The ubiquinone then interacts with 5 hydrogen ion through a NADH dependent ubiquinone oxidoreductase I resulting in NAD, hydrogen ion released into the periplasmic space and an ubiquinol. The 2 ubiquinol interact with oxygen and 8 hydrogen ion through a cytochrome bo terminal oxidase resulting in a 8 hydrogen ion transferred into the periplasmic space, 2 water returned into the cytoplasm and 2 ubiquinone, which stays in the inner membrane. PW000919 ec00190 Metabolic Purine metabolism ec00230 adenosylcobalamin salvage from cobinamide Cobinamide is incorporated from the extracellular space through a transport system into the cytosol. Once inside the cytosol, cobinamide interacts with ATP through a cobinamide adenosyl transferase resulting in the release of a triphosphate and an adenosylcobinamide. The latter compound is then phosphorylated through an ATP-dependent cobinamide kinase resulting in the release of ADP, a hydrogen ion and adenosyl-cobinamide phosphate. This last compound then interacts with GTP and a hydrogen ion through a cobinamide-P guanylyltransferase resulting in the release of a pyrophosphate and an adenosylcobinamide-GDP. A dimethylbenzimidazole interacts with a nicotinate D-ribonucleotide through a nicotinate-nucleotide dimethylbenzumidazole phosphoribosyltransferase resulting in the release of a nicotinate, a hydrogen ion and an alpha-ribazole 5' phosphate. The adenosylcobinamide-GDP and the alpha-ribazole 5' phosphate interact together through a cobalamin 5' phosphate synthase resulting in the release of a hydrogen ion, a GMP and Adenosylcobalamin 5'-phosphate. The latter compound then interacts with a water molecule through an adenosylcbalamin 5' phosphate phosphatase resulting in the release of a phosphate and a coenzyme B12. Likewise a cobalamin molecule can interact with ATP through a cobalamin adenosyltransferase resulting in the release of a triphosphate and a coenzyme B12 PW001884 Metabolic Specdb::CMs 3136 Specdb::CMs 133951 Specdb::CMs 141685 Specdb::MsMs 23885 Specdb::MsMs 23886 Specdb::MsMs 23887 Specdb::MsMs 30683 Specdb::MsMs 30684 Specdb::MsMs 30685 Specdb::MsMs 2437252 Specdb::MsMs 2437253 Specdb::MsMs 2437254 Specdb::MsMs 2529150 Specdb::MsMs 2529151 Specdb::MsMs 2529152 C00404 Cob(I)yrinic acid a,c-diamide adenosyltransferase P0A9H5 BTUR_ECOLI btuR http://ecmdb.ca/proteins/P0A9H5.xml Adenosine triphosphate + Polyphosphate <> ADP R02184 Polyphosphate + Water <> Phosphate R03042 Cobalamin + Adenosine triphosphate + vitamin B12 > coenzyme B12 + Triphosphate + Polyphosphate PW_R005145 Adenosine triphosphate + Polyphosphate <> ADP