2.0 2015-06-04 15:29:43 -0600 2015-07-23 12:07:15 -0600 ECMDB23803 M2MDB004402 Pimeloyl-[acyl-carrier protein] 1,6-dihydro-6-oxo-3-Pyridinecarboxylate 1,6-dihydro-6-oxo-3-Pyridinecarboxylic acid 1,6-dihydro-6-oxo-Nicotinate 1,6-dihydro-6-oxo-Nicotinic acid 2-Hydroxy-5-carboxypyridine 2-Hydroxypyridine-5-carboxylate 2-Hydroxypyridine-5-carboxylic acid 2-Pyridone-5-carboxylate 2-Pyridone-5-carboxylic acid 5-Carboxy-2-pyridone 6-Hydroxy-nicotinate 6-Hydroxy-nicotinic acid 6-Hydroxyniacin 6-Hydroxynicotinate 6-Hydroxynicotinic acid 6-Hydroxypyridine-3-carboxylate 6-Hydroxypyridine-3-carboxylic acid 6-oxo-1H-Pyridine-3-carboxylate 6-oxo-1H-Pyridine-3-carboxylic acid C6H5NO3 139.1088 139.026943031 6-hydroxypyridine-3-carboxylic acid 6-hydroxynicotinic acid OC(=O)C1=CN=C(O)C=C1 InChI=1S/C6H5NO3/c8-5-2-1-4(3-7-5)6(9)10/h1-3H,(H,7,8)(H,9,10) BLHCMGRVFXRYRN-UHFFFAOYSA-N logp 0.71 ALOGPS logs -1.01 ALOGPS solubility 1.37e+01 g/l ALOGPS logp 0.7 ChemAxon pka_strongest_acidic 3.77 ChemAxon pka_strongest_basic 0.51 ChemAxon iupac 6-hydroxypyridine-3-carboxylic acid ChemAxon average_mass 139.1088 ChemAxon mono_mass 139.026943031 ChemAxon smiles OC(=O)C1=CN=C(O)C=C1 ChemAxon formula C6H5NO3 ChemAxon inchi InChI=1S/C6H5NO3/c8-5-2-1-4(3-7-5)6(9)10/h1-3H,(H,7,8)(H,9,10) ChemAxon inchikey BLHCMGRVFXRYRN-UHFFFAOYSA-N ChemAxon polar_surface_area 70.42 ChemAxon refractivity 33.45 ChemAxon polarizability 12.31 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Tropane, piperidine and pyridine alkaloid biosynthesis ec00960 Drug metabolism - other enzymes ec00983 Biotin metabolism Biotin (vitamin H or vitamin B7) is the essential cofactor of biotin-dependent carboxylases, such as pyruvate carboxylase and acetyl-CoA carboxylase.In E. coli and many organisms, pimelate thioester is derived from malonyl-ACP. The pathway starts with a malonyl-[acp] interacting with S-adenosylmethionine through a biotin synthesis protein BioC resulting in a S-adenosylhomocysteine and a malonyl-[acp] methyl ester. The latter compound is then involved in the synthesis of a 3-ketoglutaryl-[acp] methyl ester through a 3-oxoacyl-[acyl-carrier-protein] synthase. The compound 3-ketoglutaryl-[acp] methyl ester is reduced by a NADPH mediated 3-oxoacyl-[acyl-carrier-protein] reductase resulting in a 3R-hydroxyglutaryl-[acp] methyl ester. This compound is then dehydrated through ad (3R)-hydroxymyristoyl-[acp] dehydratase producing a enoylglutaryl-[acp] methyl ester. This compound is then reduced through a NADPH mediated enoyl-acp-reductase [NADH] resulting in a glutaryl-[acp] methyl ester. This compound interacts with a malonyl-[acp] through a 3-oxoacyl-[acp] synthase 2 resulting in a 3-ketopimeloyl [acp] methyl ester. This compound is then reduced through a NADPH 3-oxoacyl [acp] reductase producing a 3-hydroxypimeloyl-[acp] methyl ester and then dehydrated by (3R)-hydroxymyristoyl-[acp] dehydratase to produce a enoylpimeloyl-[acp] methyl ester. This compound is then reduced by a NADPH dependent enoyl-[acp]reductase resulting in a pimeloyl-[acp] methyl ester. This compound then reacts with water through a carboxylesterase resulting in a pimeloyl-[acp] and a methanol. The pimeloyl-acp reacts with L-alanine through a 8-amino-7-oxononanoate synthase resulting in 8-amino-7-oxononanoate which in turn reacts with S-adenosylmethionine through a 7,8 diaminonanoate transaminase resulting in a S-adenosyl-4-methylthio-2-oxobutanoate and 7,8 diaminononanoate. The latter compound is then dephosphorylated through a dethiobiotin synthetase resulting in a dethiobiotin. This compound interacts with a sulfurated[sulfur carrier), a hydrogen ion and a S-adenosylmethionine through a biotin synthase to produce Biotin and releasing l-methionine and a 5-deoxyadenosine. Biotin is then metabolized by a bifunctional protein resulting in pyrophosphate and Biotinyl-5-AMP which in turn reacts with the same protein (bifunctional protein birA resulting ina biotin caroxyl carrying protein.This product then enters the fatty acid biosynthesis. PW000762 ec00780 Metabolic Microbial metabolism in diverse environments ec01120 Metabolic pathways eco01100 Specdb::CMs 870 Specdb::CMs 1266 Specdb::CMs 14933 Specdb::CMs 30061 Specdb::CMs 30467 Specdb::CMs 31423 Specdb::CMs 32034 Specdb::CMs 38456 Specdb::CMs 166170 Specdb::NmrOneD 1898 Specdb::NmrOneD 122778 Specdb::NmrOneD 122779 Specdb::NmrOneD 122780 Specdb::NmrOneD 122781 Specdb::NmrOneD 122782 Specdb::NmrOneD 122783 Specdb::NmrOneD 122784 Specdb::NmrOneD 122785 Specdb::NmrOneD 122786 Specdb::NmrOneD 122787 Specdb::NmrOneD 122788 Specdb::NmrOneD 122789 Specdb::NmrOneD 122790 Specdb::NmrOneD 122791 Specdb::NmrOneD 122792 Specdb::NmrOneD 122793 Specdb::NmrOneD 122794 Specdb::NmrOneD 122795 Specdb::NmrOneD 122796 Specdb::NmrOneD 122797 Specdb::MsMs 6347 Specdb::MsMs 6348 Specdb::MsMs 6349 Specdb::MsMs 6350 Specdb::MsMs 6351 Specdb::MsMs 6352 Specdb::MsMs 6353 Specdb::MsMs 6354 Specdb::MsMs 6355 Specdb::MsMs 6356 Specdb::MsMs 6358 Specdb::MsMs 6359 Specdb::MsMs 6360 Specdb::MsMs 299074 Specdb::MsMs 299075 Specdb::MsMs 299076 Specdb::MsMs 340993 Specdb::MsMs 340994 Specdb::MsMs 340995 Specdb::MsMs 437796 Specdb::MsMs 437797 Specdb::MsMs 437798 Specdb::MsMs 437799 Specdb::MsMs 437800 Specdb::MsMs 439174 Specdb::NmrTwoD 1834 C19845 8-amino-7-oxononanoate synthase P12998 BIOF_ECOLI bioF http://ecmdb.ca/proteins/P12998.xml Carboxylesterase BioH P13001 BIOH_ECOLI bioH http://ecmdb.ca/proteins/P13001.xml Pimelyl-[acyl-carrier protein] methyl ester + Water + Pimeloyl-[acyl-carrier protein] methyl ester <> Pimelyl-[acyl-carrier protein] + Methanol + Pimeloyl-[acyl-carrier protein] R09725 6-Carboxyhexanoyl-CoA + L-Alanine + Pimeloyl-[acyl-carrier protein] <> 8-Amino-7-oxononanoate + Coenzyme A + Carbon dioxide + Acyl-carrier protein R03210 6 6-carboxyhexanoyl-CoA + L-Alanine + Pimeloyl-[acyl-carrier protein] <>8 8-Amino-7-oxononanoate + Coenzyme A + Carbon dioxide + Acyl-carrier protein