2.0 2012-11-06 04:55:28 -0700 2015-06-03 17:27:29 -0600 ECMDB23731 M2MDB004121 (S)-Succinyldihydrolipoamide (S)-Succinyldihydrolipoamide is a metabolite (a product as well as a substrate) in glutamate degradation. It is also invovled in citrate cycle and is a reactant for oxoglutarate dehydrogenase (EC 1.2.4.2) and dihydrolipoyllysine-residue succinyltransferase (EC 2.3.1.61). 4-[(3R)-8-amino-8-oxo-1-Sulfanyloctan-3-yl]sulfanyl-4-oxobutanoate 4-[(3R)-8-amino-8-oxo-1-sulfanyloctan-3-yl]sulfanyl-4-oxobutanoic acid 4-[(3R)-8-amino-8-oxo-1-Sulphanyloctan-3-yl]sulphanyl-4-oxobutanoate 4-[(3R)-8-amino-8-oxo-1-Sulphanyloctan-3-yl]sulphanyl-4-oxobutanoic acid S-succinyl-dihydrolipoamide S-Succinyldihydrolipoamide C12H21NO4S2 307.429 307.091199545 4-{[(3R)-7-carbamoyl-1-sulfanylheptan-3-yl]sulfanyl}-4-oxobutanoic acid 4-{[(3R)-7-carbamoyl-1-sulfanylheptan-3-yl]sulfanyl}-4-oxobutanoic acid NC(=O)CCCC[C@H](CCS)SC(=O)CCC(O)=O InChI=1S/C12H21NO4S2/c13-10(14)4-2-1-3-9(7-8-18)19-12(17)6-5-11(15)16/h9,18H,1-8H2,(H2,13,14)(H,15,16)/t9-/m1/s1 RJCJWONCSKSHES-SECBINFHSA-N logp 1.97 ALOGPS logs -3.47 ALOGPS solubility 1.05e-01 g/l ALOGPS logp 1.06 ChemAxon pka_strongest_acidic 4.38 ChemAxon pka_strongest_basic -0.58 ChemAxon iupac 4-{[(3R)-7-carbamoyl-1-sulfanylheptan-3-yl]sulfanyl}-4-oxobutanoic acid ChemAxon average_mass 307.429 ChemAxon mono_mass 307.091199545 ChemAxon smiles NC(=O)CCCC[C@H](CCS)SC(=O)CCC(O)=O ChemAxon formula C12H21NO4S2 ChemAxon inchi InChI=1S/C12H21NO4S2/c13-10(14)4-2-1-3-9(7-8-18)19-12(17)6-5-11(15)16/h9,18H,1-8H2,(H2,13,14)(H,15,16)/t9-/m1/s1 ChemAxon inchikey RJCJWONCSKSHES-SECBINFHSA-N ChemAxon polar_surface_area 97.46 ChemAxon refractivity 78.12 ChemAxon polarizability 32.86 ChemAxon rotatable_bond_count 12 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon glycolysis and pyruvate dehydrogenase Fructose metabolism begins with the transport of Beta-D-glucose 6-phosphate through a glucose PTS permease, resulting in a Beta-D-glucose 6-phosphate. This compound is isomerized by a glucose-6-phosphate isomerase resulting in a fructose 6-phosphate. This compound can be phosphorylated by two different enzymes, a pyridoxal phosphatase/fructose 1,6-bisphosphatase or a ATP driven-6-phosphofructokinase-1 resulting in a fructose 1,6-biphosphate. This compound can either react with a fructose bisphosphate aldolase class 1 resulting in D-glyceraldehyde 3-phosphate and a dihydroxyacetone phosphate or through a fructose biphosphate aldolase class 2 resulting in a D-glyceraldehyde 3-phosphate. This compound can then either react in a reversible triosephosphate isomerase resulting in a dihydroxyacetone phosphate or react with a phosphate through a NAD dependent Glyceraldehyde 3-phosphate dehydrogenase resulting in a glyceric acid 1,3-biphosphate. This compound is desphosphorylated by a phosphoglycerate kinase resulting in a 3-phosphoglyceric acid.This compound in turn can either react with a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase or a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase resulting in a 2-phospho-D-glyceric acid. This compound interacts with an enolase resulting in a phosphoenolpyruvic acid and water. Phosphoenolpyruvic acid can react either through a AMP driven phosphoenoylpyruvate synthase or a ADP driven pyruvate kinase protein complex resulting in a pyruvic acid. Pyruvic acid reacts with CoA through a NAD driven pyruvate dehydrogenase complex resulting in a carbon dioxide and a Acetyl-CoA which gets incorporated into the TCA cycle pathway. PW000785 Metabolic Specdb::CMs 18917 Specdb::CMs 37959 Specdb::CMs 159476 Specdb::MsMs 23840 Specdb::MsMs 23841 Specdb::MsMs 23842 Specdb::MsMs 24296 Specdb::MsMs 24297 Specdb::MsMs 24298 Specdb::MsMs 30638 Specdb::MsMs 30639 Specdb::MsMs 30640 Specdb::MsMs 2683953 Specdb::MsMs 2683954 Specdb::MsMs 2683955 Specdb::MsMs 3022257 Specdb::MsMs 3022258 Specdb::MsMs 3022259 HMDB01177 439425 Dihydrolipoyllysine-residue acetyltransferase component of pyruvate dehydrogenase complex P06959 ODP2_ECOLI aceF http://ecmdb.ca/proteins/P06959.xml Succinyl-CoA + Dihydrolipoamide + Succinyl-CoA + Dihydrolipoamide > Coenzyme A + (S)-Succinyldihydrolipoamide PW_R005173