<?xml version="1.0" encoding="UTF-8"?>
<compound>
  <version>2.0</version>
  <creation_date>2012-10-10 12:22:43 -0600</creation_date>
  <update_date>2015-08-05 16:22:04 -0600</update_date>
  <accession>ECMDB23222</accession>
  <m2m_id>M2MDB003612</m2m_id>
  <name>NMN</name>
  <description>3-Carbamoyl-1-beta-D-ribofuranosyl pyridinium hydroxide-5'phosphate, inner salt. A nucleotide in which the nitrogenous base, nicotinamide, is in beta-N-glycosidic linkage with the C-1 position of D-ribose</description>
  <synonyms>
    <synonym>&amp;beta;-nicotinamide mononucleotide</synonym>
    <synonym>&amp;beta;-nicotinamide nucleotide</synonym>
    <synonym>&amp;beta;-nicotinamide ribonucleotide</synonym>
    <synonym>NicRN</synonym>
    <synonym>NMN</synonym>
  </synonyms>
  <chemical_formula>C11H16N2O8P</chemical_formula>
  <average_molecular_weight>335.2271</average_molecular_weight>
  <monisotopic_moleculate_weight>335.06442701</monisotopic_moleculate_weight>
  <iupac_name>3-carbamoyl-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(phosphonooxy)methyl]oxolan-2-yl]-1lambda5-pyridin-1-ylium</iupac_name>
  <traditional_iupac>3-carbamoyl-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(phosphonooxy)methyl]oxolan-2-yl]-1lambda5-pyridin-1-ylium</traditional_iupac>
  <cas_registry_number>1094-61-7</cas_registry_number>
  <smiles>[H][C@]1(COP(O)(O)=O)O[C@@]([H])([N+]2=CC=CC(=C2)C(O)=N)[C@]([H])(O)[C@]1([H])O</smiles>
  <inchi>InChI=1S/C11H15N2O8P/c12-10(16)6-2-1-3-13(4-6)11-9(15)8(14)7(21-11)5-20-22(17,18)19/h1-4,7-9,11,14-15H,5H2,(H3-,12,16,17,18,19)/p+1/t7-,8-,9-,11-/m1/s1</inchi>
  <inchikey>DAYLJWODMCOQEW-TURQNECASA-O</inchikey>
  <state>Solid</state>
  <cellular_locations>
    <cellular_location>Cytoplasm</cellular_location>
    <cellular_location> mitochondria</cellular_location>
    <cellular_location> nucleus</cellular_location>
  </cellular_locations>
  <predicted_properties>
    <property>
      <kind>logp</kind>
      <value>-1.50</value>
      <source>ALOGPS</source>
    </property>
    <property>
      <kind>logs</kind>
      <value>-2.31</value>
      <source>ALOGPS</source>
    </property>
    <property>
      <kind>solubility</kind>
      <value>1.80e+00 g/l</value>
      <source>ALOGPS</source>
    </property>
  </predicted_properties>
  <experimental_properties>
  </experimental_properties>
  <property>
    <kind>logp</kind>
    <value>-6.2</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>pka_strongest_acidic</kind>
    <value>1.21</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>pka_strongest_basic</kind>
    <value>-1.6</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>iupac</kind>
    <value>3-carbamoyl-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(phosphonooxy)methyl]oxolan-2-yl]-1lambda5-pyridin-1-ylium</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>average_mass</kind>
    <value>335.2271</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>mono_mass</kind>
    <value>335.06442701</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>smiles</kind>
    <value>[H][C@]1(COP(O)(O)=O)O[C@@]([H])([N+]2=CC=CC(=C2)C(O)=N)[C@]([H])(O)[C@]1([H])O</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>formula</kind>
    <value>C11H16N2O8P</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>inchi</kind>
    <value>InChI=1S/C11H15N2O8P/c12-10(16)6-2-1-3-13(4-6)11-9(15)8(14)7(21-11)5-20-22(17,18)19/h1-4,7-9,11,14-15H,5H2,(H3-,12,16,17,18,19)/p+1/t7-,8-,9-,11-/m1/s1</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>inchikey</kind>
    <value>DAYLJWODMCOQEW-TURQNECASA-O</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>polar_surface_area</kind>
    <value>163.42</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>refractivity</kind>
    <value>71.71</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>polarizability</kind>
    <value>29.05</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>rotatable_bond_count</kind>
    <value>5</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>acceptor_count</kind>
    <value>7</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>donor_count</kind>
    <value>5</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>physiological_charge</kind>
    <value>-1</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>formal_charge</kind>
    <value>1</value>
    <source>ChemAxon</source>
  </property>
  <pathways>
    <pathway>
      <name>Nicotinate and nicotinamide metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00760</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>DNA replication</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>eco03030</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Metabolic pathways</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>eco01100</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>NAD salvage</name>
      <description>Even though NAD molecules are not consumed during oxidation reactions, they have a relatively short half-life. For example, in E. coli the NAD+ half-life is 90 minutes. Once enzymatically degraded, the pyrimidine moiety of the molecule can be recouped via the NAD salvage cycles. This pathway is used for two purposes: it recycles the internally degraded NAD products nicotinamide D-ribonucleotide (also known as nicotinamide mononucleotide, or NMN) and nicotinamide, and it is used for the assimilation of exogenous NAD+.


NAD reacts spontaneously with water resulting in the release of hydrogen ion, AMP and beta-nicotinamide D-ribonucleotide. This enzyme can either interact spontaneously with water resulting in the release of D-ribofuranose 5-phosphate, hydrogen ion and Nacinamide. On the other hand beta-nicotinamide D-ribonucleotide can also react with water through NMN amidohydrolase resulting in ammonium, and Nicotinate beta-D-ribonucleotide. Also it can interact with water spontaneously resulting in the release of phosphate resulting in a Nicotinamide riboside.
Niacinamide interacts with water through a nicotinamidase resulting in a release of ammonium and nicotinic acid. This compound interacts with water and phosphoribosyl pyrophosphate through an ATP driven nicotinate phosphoribosyltransferase resulting in the release of ADP, pyrophosphate and phosphate and nicotinate beta-D-ribonucleotide.
Nicotinamide riboside interacts with an ATP driven NadR DNA-binding transcriptional repressor and NMN adenylyltransferase (Escherichia coli) resulting in a ADP, hydrogen ion and beta-nicotinamide D-ribonucleotide. This compound interacts with ATP and hydrogen ion through NadR DNA-binding transcriptional repressor and NMN adenylyltransferase resulting in pyrophosphate and NAD. 
Nicotinate beta-D-ribonucleotide is adenylated through the interaction with ATP and a hydrogen ion through a nicotinate-mononucleotide adenylyltransferase resulting in pyrophosphate and Nicotinic acid adenine dinucleotide. Nicotinic acid adenine dinucleotide interacts with L-glutamine and water through an ATP driven NAD synthetase, NH3-dependent resulting in AMP, pyrophosphate, hydrogen ion, L-glutamic acid and NAD. 
</description>
      <pathwhiz_id>PW000830</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
  </pathways>
  <spectra>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>35350</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>47836</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>162072</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>6192</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>6193</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>6194</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>6195</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>6196</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>6197</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>6198</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>6199</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>6200</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>6201</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>6202</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>6203</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>6204</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>6205</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>6206</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>6207</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>6208</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>6209</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>6210</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>6211</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>28391</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>28392</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>28393</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>34949</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>34950</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>34951</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2352172</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2352173</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2352174</spectrum_id>
    </spectrum>
  </spectra>
  <hmdb_id>HMDB00229</hmdb_id>
  <pubchem_compound_id>14180</pubchem_compound_id>
  <chemspider_id/>
  <kegg_id>C00455</kegg_id>
  <chebi_id>16171</chebi_id>
  <biocyc_id>NICOTINAMIDE_NUCLEOTIDE</biocyc_id>
  <het_id>NMN</het_id>
  <wikipidia/>
  <foodb_id>FDB021912</foodb_id>
  <general_references>
  </general_references>
  <synthesis_reference/>
  <msds_url/>
  <enzymes>
    <enzyme>
      <name>Protein ushA</name>
      <uniprot_id>P07024</uniprot_id>
      <uniprot_name>USHA_ECOLI</uniprot_name>
      <gene_name>ushA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P07024.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Nicotinate-nucleotide adenylyltransferase</name>
      <uniprot_id>P0A752</uniprot_id>
      <uniprot_name>NADD_ECOLI</uniprot_name>
      <gene_name>nadD</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A752.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Multifunctional protein surE</name>
      <uniprot_id>P0A840</uniprot_id>
      <uniprot_name>SURE_ECOLI</uniprot_name>
      <gene_name>surE</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A840.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>5'-nucleotidase yjjG</name>
      <uniprot_id>P0A8Y1</uniprot_id>
      <uniprot_name>YJJG_ECOLI</uniprot_name>
      <gene_name>yjjG</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A8Y1.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>DNA ligase</name>
      <uniprot_id>P15042</uniprot_id>
      <uniprot_name>DNLJ_ECOLI</uniprot_name>
      <gene_name>ligA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P15042.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>DNA ligase B</name>
      <uniprot_id>P25772</uniprot_id>
      <uniprot_name>LIGB_ECOLI</uniprot_name>
      <gene_name>ligB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P25772.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Transcriptional regulator nadR</name>
      <uniprot_id>P27278</uniprot_id>
      <uniprot_name>NADR_ECOLI</uniprot_name>
      <gene_name>nadR</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P27278.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>NADH pyrophosphatase</name>
      <uniprot_id>P32664</uniprot_id>
      <uniprot_name>NUDC_ECOLI</uniprot_name>
      <gene_name>nudC</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P32664.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Nicotinamide-nucleotide amidohydrolase PncC</name>
      <uniprot_id>P0A6G3</uniprot_id>
      <uniprot_name>PNCC_ECOLI</uniprot_name>
      <gene_name>pncC</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A6G3.xml</protein_url>
    </enzyme>
  </enzymes>
  <transporters>
  </transporters>
  <reactions>
    <reaction_text>NAD + (deoxyribonucleotide)(n) + (deoxyribonucleotide)(m) &gt; Adenosine monophosphate + NMN + (deoxyribonucleotide)(n+m)</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Adenosine triphosphate + NMN &gt; Pyrophosphate + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Adenosine triphosphate + Nicotinamide riboside &gt; ADP + NMN</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>NAD + Water &gt; Adenosine monophosphate + NMN</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Water + NAD &lt;&gt; Adenosine monophosphate +2 Hydrogen ion + Nicotinamide ribotide + NMN</reaction_text>
    <kegg_reaction_id>R00103</kegg_reaction_id>
    <ecocyc_id>NADPYROPHOSPHAT-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Adenosine triphosphate + Hydrogen ion + Nicotinamide ribotide + NMN &lt;&gt; NAD + Pyrophosphate</reaction_text>
    <kegg_reaction_id>R00137</kegg_reaction_id>
    <ecocyc_id>2.7.7.1-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>NAD + DNA &lt;&gt; Adenosine monophosphate + NMN</reaction_text>
    <kegg_reaction_id>R00382 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>NMN + Water &lt;&gt; Nicotinamide ribotide + Ammonia</reaction_text>
    <kegg_reaction_id>R02322 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>beta-nicotinamide D-ribonucleotide + Water + NMN &gt; Ammonium + nicotinate beta-D-ribonucleotide + Nicotinamide ribotide</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R003017</pw_reaction_id>
    <reaction_text>Nicotinamide riboside + Adenosine triphosphate &gt; Adenosine diphosphate + Hydrogen ion + beta-nicotinamide D-ribonucleotide + ADP + NMN</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R003022</pw_reaction_id>
    <reaction_text>beta-nicotinamide D-ribonucleotide + Adenosine triphosphate + Hydrogen ion + NMN &gt; Pyrophosphate + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R003023</pw_reaction_id>
    <reaction_text>Water + NAD &lt;&gt; Adenosine monophosphate +2 Hydrogen ion + Nicotinamide ribotide + NMN</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>NMN + Water &lt;&gt; Nicotinamide ribotide + Ammonia</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Adenosine triphosphate + Hydrogen ion + Nicotinamide ribotide + NMN &lt;&gt; NAD + Pyrophosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Water + NAD &lt;&gt; Adenosine monophosphate +2 Hydrogen ion + Nicotinamide ribotide + NMN</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
  </reactions>
  <concentrations>
  </concentrations>
</compound>
