<?xml version="1.0" encoding="UTF-8"?>
<compound>
  <version>2.0</version>
  <creation_date>2012-07-30 14:55:23 -0600</creation_date>
  <update_date>2015-06-03 17:21:12 -0600</update_date>
  <accession>ECMDB21347</accession>
  <m2m_id>M2MDB001745</m2m_id>
  <name>Octadecanoate (N-C18:0)</name>
  <description>Octadecanoate (n-c18:0) belongs to the class of Straight Chain Fatty Acids. These are fatty acids with a straight aliphatic chain. (inferred from compound structure)Stearic acid (STAIR-ik or STEER-ik) is the saturated fatty acid with an 18 carbon chain and has the IUPAC name octadecanoic acid. It is a waxy solid, and its chemical formula is CH3(CH2)16CO2H. Its name comes from the Greek word στέαρ stéar, which means tallow. The salts and esters of stearic acid are called stearates. Stearic acid is one of the most common saturated fatty acids found in nature following palmitic acid. (WikiPedia)</description>
  <synonyms>
    <synonym>Octadecanoate (N-C18:0)</synonym>
    <synonym>Octadecanoic acid (N-C18:0)</synonym>
    <synonym>Stearate</synonym>
    <synonym>Stearic acid</synonym>
  </synonyms>
  <chemical_formula>C18H35O2</chemical_formula>
  <average_molecular_weight>283.4693</average_molecular_weight>
  <monisotopic_moleculate_weight>283.263705364</monisotopic_moleculate_weight>
  <iupac_name>octadecanoate</iupac_name>
  <traditional_iupac>n-octadecanoate</traditional_iupac>
  <cas_registry_number/>
  <smiles>CCCCCCCCCCCCCCCCCC([O-])=O</smiles>
  <inchi>InChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20)/p-1</inchi>
  <inchikey>QIQXTHQIDYTFRH-UHFFFAOYSA-M</inchikey>
  <state/>
  <cellular_locations>
    <cellular_location>Membrane</cellular_location>
  </cellular_locations>
  <predicted_properties>
    <property>
      <kind>logp</kind>
      <value>8.21</value>
      <source>ALOGPS</source>
    </property>
    <property>
      <kind>logs</kind>
      <value>-6.73</value>
      <source>ALOGPS</source>
    </property>
    <property>
      <kind>solubility</kind>
      <value>5.59e-05 g/l</value>
      <source>ALOGPS</source>
    </property>
  </predicted_properties>
  <experimental_properties>
  </experimental_properties>
  <property>
    <kind>logp</kind>
    <value>7.15</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>pka_strongest_acidic</kind>
    <value>4.95</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>iupac</kind>
    <value>octadecanoate</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>average_mass</kind>
    <value>283.4693</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>mono_mass</kind>
    <value>283.263705364</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>smiles</kind>
    <value>CCCCCCCCCCCCCCCCCC([O-])=O</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>formula</kind>
    <value>C18H35O2</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>inchi</kind>
    <value>InChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20)/p-1</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>inchikey</kind>
    <value>QIQXTHQIDYTFRH-UHFFFAOYSA-M</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>polar_surface_area</kind>
    <value>40.13</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>refractivity</kind>
    <value>97.12</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>polarizability</kind>
    <value>38.16</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>rotatable_bond_count</kind>
    <value>16</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>acceptor_count</kind>
    <value>2</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>donor_count</kind>
    <value>0</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>physiological_charge</kind>
    <value>-1</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>formal_charge</kind>
    <value>-1</value>
    <source>ChemAxon</source>
  </property>
  <pathways>
  </pathways>
  <spectra>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>276078</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>276079</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>276080</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>276081</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>276082</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>276083</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>276084</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>276085</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>276086</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>276087</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>276088</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>276089</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>276090</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>276091</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>276092</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>276093</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>276094</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>276095</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>276096</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>276097</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>29567</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>29568</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>29569</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>36125</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>36126</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>36127</spectrum_id>
    </spectrum>
  </spectra>
  <hmdb_id/>
  <pubchem_compound_id>3033836</pubchem_compound_id>
  <chemspider_id>2298422</chemspider_id>
  <kegg_id>C01530</kegg_id>
  <chebi_id>25629</chebi_id>
  <biocyc_id>STEARIC_ACID</biocyc_id>
  <het_id/>
  <wikipidia/>
  <foodb_id/>
  <general_references>
    <reference>
      <reference_text>Yurtsever D. (2007). Fatty acid methyl ester profiling of Enterococcus and Esherichia coli for microbial source tracking. M.sc. Thesis. Villanova University: U.S.A</reference_text>
      <pubmed_id/>
    </reference>
  </general_references>
  <synthesis_reference/>
  <msds_url/>
  <enzymes>
    <enzyme>
      <name>Lysophospholipase L2</name>
      <uniprot_id>P07000</uniprot_id>
      <uniprot_name>PLDB_ECOLI</uniprot_name>
      <gene_name>pldB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P07000.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Phospholipase A1</name>
      <uniprot_id>P0A921</uniprot_id>
      <uniprot_name>PA1_ECOLI</uniprot_name>
      <gene_name>pldA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A921.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Acylphosphatase</name>
      <uniprot_id>P0AB65</uniprot_id>
      <uniprot_name>ACYP_ECOLI</uniprot_name>
      <gene_name>yccX</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AB65.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Acyl-CoA thioesterase I</name>
      <uniprot_id>P0ADA1</uniprot_id>
      <uniprot_name>TESA_ECOLI</uniprot_name>
      <gene_name>tesA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0ADA1.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Bifunctional protein aas</name>
      <uniprot_id>P31119</uniprot_id>
      <uniprot_name>AAS_ECOLI</uniprot_name>
      <gene_name>aas</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P31119.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Long-chain-fatty-acid--CoA ligase</name>
      <uniprot_id>P69451</uniprot_id>
      <uniprot_name>LCFA_ECOLI</uniprot_name>
      <gene_name>fadD</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P69451.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Short-chain-fatty-acid--CoA ligase</name>
      <uniprot_id>P38135</uniprot_id>
      <uniprot_name>FADK_ECOLI</uniprot_name>
      <gene_name>fadK</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P38135.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Acyl-CoA thioesterase 2</name>
      <uniprot_id>P0AGG2</uniprot_id>
      <uniprot_name>TESB_ECOLI</uniprot_name>
      <gene_name>tesB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AGG2.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Acyl carrier protein</name>
      <uniprot_id>P0A6A8</uniprot_id>
      <uniprot_name>ACP_ECOLI</uniprot_name>
      <gene_name>acpP</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A6A8.xml</protein_url>
    </enzyme>
  </enzymes>
  <transporters>
    <enzyme>
      <name>Long-chain fatty acid transport protein</name>
      <uniprot_id>P10384</uniprot_id>
      <uniprot_name>FADL_ECOLI</uniprot_name>
      <gene_name>fadL</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P10384.xml</protein_url>
    </enzyme>
  </transporters>
  <reactions>
    <reaction_text>Adenosine triphosphate + Coenzyme A + Hydrogen ion + Octadecanoate (N-C18:0) &gt; Adenosine monophosphate + Hydrogen ion + Pyrophosphate + Stearoyl-CoA</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>acyl carrier protein + Adenosine triphosphate + Octadecanoate (N-C18:0) &gt; Adenosine monophosphate + Octadecanoyl-ACP (n-C18:0ACP) + Pyrophosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Water + Stearoyl-CoA &gt; Coenzyme A + Hydrogen ion + Octadecanoate (N-C18:0)</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>1-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:0) + Water &gt; Glycerylphosphorylethanolamine + Hydrogen ion + Octadecanoate (N-C18:0)</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>1-Acyl-sn-glycero-3-phosphoglycerol (N-C18:0) + Water &gt; Glycerophosphoglycerol + Hydrogen ion + Octadecanoate (N-C18:0)</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>1-Octadecanoyl-sn-glycerol 3-phosphate + Water &gt; Glycerol 3-phosphate + Hydrogen ion + Octadecanoate (N-C18:0)</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Water + Octadecanoyl-phosphate (n-C18:0) &gt;2 Hydrogen ion + Octadecanoate (N-C18:0) + Phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:0) + Adenosine triphosphate + Octadecanoate (N-C18:0) &gt; Adenosine monophosphate + PE(14:0/14:0) + Pyrophosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2-Acyl-sn-glycero-3-phosphoglycerol (N-C18:0) + Adenosine triphosphate + Octadecanoate (N-C18:0) &gt; Adenosine monophosphate + PG(18:0/18:0) + Pyrophosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Water + PA(16:0/16:0) &gt; 1-Octadecanoyl-sn-glycerol 3-phosphate + Hydrogen ion + Octadecanoate (N-C18:0)</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Water + PA(16:0/16:0) &gt; 2-octadecanoyl-sn-glycerol 3-phosphate + Octadecanoate (N-C18:0)</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Water + PE(14:0/14:0) &gt; 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:0) + Hydrogen ion + Octadecanoate (N-C18:0)</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Water + PE(14:0/14:0) &gt; 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:0) + Hydrogen ion + Octadecanoate (N-C18:0)</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Water + PG(18:0/18:0) &gt; 1-Acyl-sn-glycero-3-phosphoglycerol (N-C18:0) + Hydrogen ion + Octadecanoate (N-C18:0)</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Water + PG(18:0/18:0) &gt; 2-Acyl-sn-glycero-3-phosphoglycerol (N-C18:0) + Hydrogen ion + Octadecanoate (N-C18:0)</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:0) + Water &gt; Glycerylphosphorylethanolamine + Hydrogen ion + Octadecanoate (N-C18:0)</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2-Acyl-sn-glycero-3-phosphoglycerol (N-C18:0) + Water &gt; Glycerophosphoglycerol + Hydrogen ion + Octadecanoate (N-C18:0)</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2-octadecanoyl-sn-glycerol 3-phosphate + Water &gt; Glycerol 3-phosphate +2 Hydrogen ion + Octadecanoate (N-C18:0)</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
  </reactions>
  <concentrations>
  </concentrations>
</compound>
