2.0 2012-05-31 14:26:01 -0600 2015-06-03 17:19:15 -0600 ECMDB20072 M2MDB000921 3-Hydroxy-5-oxohexanoate 3-hydroxy-5-oxohexanoate is a member of the chemical class known as Medium-chain Keto Acids and Derivatives. These are keto acids with a 6 to 12 carbon atoms long side chain. It is a substrate for butyryl coenzyme A transferase (EC 2.8.3.8) and it sometimes an associated byproduct of gallic acid degradation. 3-Hydroxy-5-ketohexanoate 3-Hydroxy-5-ketohexanoic acid 3-Hydroxy-5-oxo-Hexanoate 3-Hydroxy-5-oxo-Hexanoic acid 3-Hydroxy-5-oxohexanoic acid C6H10O4 146.1412 146.057908808 3-hydroxy-5-oxohexanoic acid 3-hydroxy-5-oxohexanoic acid 109138-72-9 CC(=O)CC(O)CC(O)=O InChI=1S/C6H10O4/c1-4(7)2-5(8)3-6(9)10/h5,8H,2-3H2,1H3,(H,9,10) APWDZEIBFNZVND-UHFFFAOYSA-N Cytoplasm Periplasm logp -0.88 ALOGPS logs -0.07 ALOGPS solubility 1.24e+02 g/l ALOGPS logp -0.7 ChemAxon pka_strongest_acidic 4.18 ChemAxon pka_strongest_basic -2.9 ChemAxon iupac 3-hydroxy-5-oxohexanoic acid ChemAxon average_mass 146.1412 ChemAxon mono_mass 146.057908808 ChemAxon smiles CC(=O)CC(O)CC(O)=O ChemAxon formula C6H10O4 ChemAxon inchi InChI=1S/C6H10O4/c1-4(7)2-5(8)3-6(9)10/h5,8H,2-3H2,1H3,(H,9,10) ChemAxon inchikey APWDZEIBFNZVND-UHFFFAOYSA-N ChemAxon polar_surface_area 74.6 ChemAxon refractivity 33.05 ChemAxon polarizability 13.85 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon 1,4-Dichlorobenzene degradation ec00627 Microbial metabolism in diverse environments ec01120 Aminobenzoate Degradation Delete This pathway shows the various process by which various compounds reach Benzoate degradation. The top most reaction catalyzes (3s)-3-hydroxyacyl-Coa from crotonoyl-Coa and Water through 2,3-dehydroadipyl-CoA hydratase. The second reaction catalyzes Benzoic Acid from benzoyl phosphate through a weak acylphosphatase. The third reaction is 1,2,4 Benzenetriol which is catalyzed from 4-nitrocatechol through a predicted 2Fe-2s cluster-containing protein. This is a isomer of 4-nitrophenol which is produced from 4-phenylphosphate or 4-nitrophenylphosphate through a phosphoanhydride phosphorylase or alkaline phosphatase respectively The fourth reaction is the production of pyrocatechol from phenol, aniline or Nitrobenzene through a predicted 2Fe-2S cluster-containing protein. The fifth reaction is the production of (3s)-3 hydroxyacyl CoA from acetyl oa and 3-hydroxy-5-oxohexanoic through Acetate CoA-transferase (3s)-3-hydroxyacyl-Coa, Benzoic Acid, pyrocatechol and 1,2,4 Benzenetriol then go into Benzoate degradation. PW000757 Metabolic Specdb::CMs 1085719 Specdb::NmrOneD 288135 Specdb::NmrOneD 288136 Specdb::NmrOneD 288137 Specdb::NmrOneD 288138 Specdb::NmrOneD 288139 Specdb::NmrOneD 288140 Specdb::NmrOneD 288141 Specdb::NmrOneD 288142 Specdb::NmrOneD 288143 Specdb::NmrOneD 288144 Specdb::NmrOneD 288145 Specdb::NmrOneD 288146 Specdb::NmrOneD 288147 Specdb::NmrOneD 288148 Specdb::NmrOneD 288149 Specdb::NmrOneD 288150 Specdb::NmrOneD 288151 Specdb::NmrOneD 288152 Specdb::NmrOneD 288153 Specdb::NmrOneD 288154 Specdb::MsMs 26048 Specdb::MsMs 26049 Specdb::MsMs 26050 Specdb::MsMs 32606 Specdb::MsMs 32607 Specdb::MsMs 32608 376 367 C16272 37032 CPD-19 Kanehisa, M., Goto, S., Sato, Y., Furumichi, M., Tanabe, M. (2012). "KEGG for integration and interpretation of large-scale molecular data sets." Nucleic Acids Res 40:D109-D114. 22080510 Acetate CoA-transferase subunit alpha P76458 ATOD_ECOLI atoD http://ecmdb.ca/proteins/P76458.xml Acetate CoA-transferase subunit beta P76459 ATOA_ECOLI atoA http://ecmdb.ca/proteins/P76459.xml 3-Hydroxy-5-oxohexanoate + Acetyl-CoA <> 3-Hydroxy-5-oxohexanoyl-CoA + Acetic acid R07832 Acetyl-CoA + 3-Hydroxy-5-oxohexanoate > Acetic acid + 3-Hydroxy-5-oxohexanoyl-CoA + 3-Hydroxy-5-oxohexanoyl-CoA PW_R002438