<?xml version="1.0" encoding="UTF-8"?>
<compound>
  <version>2.0</version>
  <creation_date>2012-05-31 14:20:36 -0600</creation_date>
  <update_date>2015-09-17 15:41:46 -0600</update_date>
  <accession>ECMDB11731</accession>
  <m2m_id>M2MDB000820</m2m_id>
  <name>5-Keto-D-gluconate</name>
  <description>5-Keto-D-gluconate is metabolized from glucose in certain bacterial species. It is an intermediate in L-idonate degradation and ketogluconate metabolism. 5-Keto-D-gluconate 5-reductase catalyzes the reversible reduction of 5-ketogluconate to D-gluconate. This is the second reaction of the L-idonate catabolic pathway after uptake of L-idonate into the cell. The enzyme specifically reduces 5-ketogluconate using either NADH or NADPH. The enzyme is also specific for D-gluconate oxidation using NADP as the coenzyme, NAD does not serve as a coenzyme.</description>
  <synonyms>
    <synonym>5-Dehydro-D-gluconate</synonym>
    <synonym>5-Dehydro-D-gluconic acid</synonym>
    <synonym>5-Dehydrogluconate</synonym>
    <synonym>5-Dehydrogluconic acid</synonym>
    <synonym>5-k-Gluconate</synonym>
    <synonym>5-k-Gluconic acid</synonym>
    <synonym>5-Keto-D-gluconate</synonym>
    <synonym>5-Keto-D-gluconic acid</synonym>
    <synonym>5-Ketogluconate</synonym>
    <synonym>5-Ketogluconic acid</synonym>
    <synonym>5K-Gluconate</synonym>
    <synonym>5K-Gluconic acid</synonym>
    <synonym>D-tagaturonate</synonym>
    <synonym>D-tagaturonic acid</synonym>
    <synonym>Hex-5-ulosonate</synonym>
    <synonym>Hex-5-ulosonic acid</synonym>
    <synonym>Tagaturonate</synonym>
    <synonym>Tagaturonic acid</synonym>
  </synonyms>
  <chemical_formula>C6H10O7</chemical_formula>
  <average_molecular_weight>194.1394</average_molecular_weight>
  <monisotopic_moleculate_weight>194.042652674</monisotopic_moleculate_weight>
  <iupac_name>(2R,3S,4S)-2,3,4,6-tetrahydroxy-5-oxohexanoic acid</iupac_name>
  <traditional_iupac>5-dehydrogluconate</traditional_iupac>
  <cas_registry_number>3470-36-8</cas_registry_number>
  <smiles>OCC(=O)C(O)C(O)C(O)C(O)=O</smiles>
  <inchi>InChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h3-5,7,9-11H,1H2,(H,12,13)</inchi>
  <inchikey>IZSRJDGCGRAUAR-UHFFFAOYSA-N</inchikey>
  <state>Solid</state>
  <cellular_locations>
    <cellular_location>Cytosol</cellular_location>
    <cellular_location>Extra-organism</cellular_location>
    <cellular_location>Periplasm</cellular_location>
    <cellular_location>Cytosol</cellular_location>
  </cellular_locations>
  <predicted_properties>
    <property>
      <kind>logp</kind>
      <value>-2.51</value>
      <source>ALOGPS</source>
    </property>
    <property>
      <kind>logs</kind>
      <value>-0.24</value>
      <source>ALOGPS</source>
    </property>
    <property>
      <kind>solubility</kind>
      <value>1.12e+02 g/l</value>
      <source>ALOGPS</source>
    </property>
  </predicted_properties>
  <experimental_properties>
  </experimental_properties>
  <property>
    <kind>logp</kind>
    <value>-2.9</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>pka_strongest_acidic</kind>
    <value>3.24</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>pka_strongest_basic</kind>
    <value>-3.3</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>iupac</kind>
    <value>(2R,3S,4S)-2,3,4,6-tetrahydroxy-5-oxohexanoic acid</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>average_mass</kind>
    <value>194.1394</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>mono_mass</kind>
    <value>194.042652674</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>smiles</kind>
    <value>OCC(=O)C(O)C(O)C(O)C(O)=O</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>formula</kind>
    <value>C6H10O7</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>inchi</kind>
    <value>InChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h3-5,7,9-11H,1H2,(H,12,13)</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>inchikey</kind>
    <value>IZSRJDGCGRAUAR-UHFFFAOYSA-N</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>polar_surface_area</kind>
    <value>135.29</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>refractivity</kind>
    <value>37.43</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>polarizability</kind>
    <value>16.32</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>rotatable_bond_count</kind>
    <value>5</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>acceptor_count</kind>
    <value>7</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>donor_count</kind>
    <value>5</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>physiological_charge</kind>
    <value>-1</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>formal_charge</kind>
    <value>0</value>
    <source>ChemAxon</source>
  </property>
  <pathways>
    <pathway>
      <name>Pentose and glucuronate interconversions</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00040</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>ketogluconate metabolism</name>
      <description/>
      <pathwhiz_id>PW002003</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>ketogluconate metabolism</name>
      <ecocyc_pathway_id>KETOGLUCONMET-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>L-idonate degradation</name>
      <ecocyc_pathway_id>IDNCAT-PWY</ecocyc_pathway_id>
    </pathway>
  </pathways>
  <spectra>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>25880</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>25881</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>25882</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>32438</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>32439</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>32440</spectrum_id>
    </spectrum>
  </spectra>
  <hmdb_id>HMDB11731</hmdb_id>
  <pubchem_compound_id>157</pubchem_compound_id>
  <chemspider_id>152</chemspider_id>
  <kegg_id>C01062</kegg_id>
  <chebi_id/>
  <biocyc_id>5-DEHYDROGLUCONATE</biocyc_id>
  <het_id/>
  <wikipidia/>
  <foodb_id/>
  <general_references>
    <reference>
      <reference_text>Keseler, I. M., Collado-Vides, J., Santos-Zavaleta, A., Peralta-Gil, M., Gama-Castro, S., Muniz-Rascado, L., Bonavides-Martinez, C., Paley, S., Krummenacker, M., Altman, T., Kaipa, P., Spaulding, A., Pacheco, J., Latendresse, M., Fulcher, C., Sarker, M., Shearer, A. G., Mackie, A., Paulsen, I., Gunsalus, R. P., Karp, P. D. (2011). "EcoCyc: a comprehensive database of Escherichia coli biology." Nucleic Acids Res 39:D583-D590.</reference_text>
      <pubmed_id>21097882</pubmed_id>
    </reference>
    <reference>
      <reference_text>Kanehisa, M., Goto, S., Sato, Y., Furumichi, M., Tanabe, M. (2012). "KEGG for integration and interpretation of large-scale molecular data sets." Nucleic Acids Res 40:D109-D114.</reference_text>
      <pubmed_id>22080510</pubmed_id>
    </reference>
    <reference>
      <reference_text>van der Werf, M. J., Overkamp, K. M., Muilwijk, B., Coulier, L., Hankemeier, T. (2007). "Microbial metabolomics: toward a platform with full metabolome coverage." Anal Biochem 370:17-25.</reference_text>
      <pubmed_id>17765195</pubmed_id>
    </reference>
    <reference>
      <reference_text>Winder, C. L., Dunn, W. B., Schuler, S., Broadhurst, D., Jarvis, R., Stephens, G. M., Goodacre, R. (2008). "Global metabolic profiling of Escherichia coli cultures: an evaluation of methods for quenching and extraction of intracellular metabolites." Anal Chem 80:2939-2948.</reference_text>
      <pubmed_id>18331064</pubmed_id>
    </reference>
  </general_references>
  <synthesis_reference/>
  <msds_url/>
  <enzymes>
    <enzyme>
      <name>Altronate oxidoreductase</name>
      <uniprot_id>P0A6L7</uniprot_id>
      <uniprot_name>UXAB_ECOLI</uniprot_name>
      <gene_name>uxaB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A6L7.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Uronate isomerase</name>
      <uniprot_id>P0A8G3</uniprot_id>
      <uniprot_name>UXAC_ECOLI</uniprot_name>
      <gene_name>uxaC</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A8G3.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Gluconate 5-dehydrogenase</name>
      <uniprot_id>P0A9P9</uniprot_id>
      <uniprot_name>IDNO_ECOLI</uniprot_name>
      <gene_name>idnO</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A9P9.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Glyoxylate/hydroxypyruvate reductase B</name>
      <uniprot_id>P37666</uniprot_id>
      <uniprot_name>GHRB_ECOLI</uniprot_name>
      <gene_name>ghrB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P37666.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>L-idonate 5-dehydrogenase</name>
      <uniprot_id>P39346</uniprot_id>
      <uniprot_name>IDND_ECOLI</uniprot_name>
      <gene_name>idnD</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P39346.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Putative L-galactonate oxidoreductase</name>
      <uniprot_id>P39400</uniprot_id>
      <uniprot_name>YJJN_ECOLI</uniprot_name>
      <gene_name>yjjN</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P39400.xml</protein_url>
    </enzyme>
  </enzymes>
  <transporters>
    <enzyme>
      <name>Gnt-II system L-idonate transporter</name>
      <uniprot_id>P39344</uniprot_id>
      <uniprot_name>IDNT_ECOLI</uniprot_name>
      <gene_name>idnT</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P39344.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Outer membrane protein N</name>
      <uniprot_id>P77747</uniprot_id>
      <uniprot_name>OMPN_ECOLI</uniprot_name>
      <gene_name>ompN</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P77747.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Outer membrane pore protein E</name>
      <uniprot_id>P02932</uniprot_id>
      <uniprot_name>PHOE_ECOLI</uniprot_name>
      <gene_name>phoE</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P02932.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Outer membrane protein F</name>
      <uniprot_id>P02931</uniprot_id>
      <uniprot_name>OMPF_ECOLI</uniprot_name>
      <gene_name>ompF</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P02931.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Outer membrane protein C</name>
      <uniprot_id>P06996</uniprot_id>
      <uniprot_name>OMPC_ECOLI</uniprot_name>
      <gene_name>ompC</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P06996.xml</protein_url>
    </enzyme>
  </transporters>
  <reactions>
    <reaction_text>D-Altronate + NAD &lt;&gt; Hydrogen ion + NADH + 5-Keto-D-gluconate + D-Tagaturonate</reaction_text>
    <kegg_reaction_id>R02555</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>D-Galacturonate &lt;&gt; 5-Keto-D-gluconate</reaction_text>
    <kegg_reaction_id>R01983</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2,5-Diketo-D-gluconate + Hydrogen ion + NADH &gt; 5-Keto-D-gluconate + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2,5-Diketo-D-gluconate + Hydrogen ion + NADPH &gt; 5-Keto-D-gluconate + NADP</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>YIAE1-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>5-Keto-D-gluconate + Hydrogen ion + NADPH &lt;&gt; Gluconic acid + NADP</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>5-Keto-D-gluconate + Hydrogen ion + NADH &lt;&gt; D-Galactonate + NAD</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>5-Keto-D-gluconate + Hydrogen ion + NADPH &gt; D-Galactonate + NADP</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>D-Galactonate + NAD &gt; Hydrogen ion + NADH + 5-Keto-D-gluconate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>D-Altronate + NAD &lt;&gt; 5-Keto-D-gluconate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R02555</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>NAD(P)&lt;sup&gt;+&lt;/sup&gt; + L-Idonate &lt;&gt; NAD(P)H + 5-Keto-D-gluconate + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>1.1.1.264-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>NAD(P)&lt;sup&gt;+&lt;/sup&gt; + Gluconic acid &lt;&gt; NAD(P)H + 5-Keto-D-gluconate + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>GLUCONATE-5-DEHYDROGENASE-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + 2,5-Diketo-D-gluconate + NADPH &lt;&gt; 5-Keto-D-gluconate + NADP</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>YIAE1-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>L-Idonate + NAD(P)(+) &gt; 5-Keto-D-gluconate + NAD(P)H</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Gluconic acid + NAD(P)(+) &gt; 5-Keto-D-gluconate + NAD(P)H</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Gluconic acid + NAD + NADP &lt;&gt; 5-Keto-D-gluconate + NADH + NADPH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R01738 R01740 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-Idonate + NAD + NADP &lt;&gt; 5-Keto-D-gluconate + NADH + NADPH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R05683 R05684 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>2,5-Diketo-D-gluconate + NADPH + Hydrogen ion + NADPH &gt; NADP + 5-Keto-D-gluconate + 5-Keto-D-gluconate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R005647</pw_reaction_id>
    <reaction_text>L-Idonate + NADP &gt; Hydrogen ion + NADPH + 5-Keto-D-gluconate + NADPH + 5-Keto-D-gluconate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R005652</pw_reaction_id>
    <reaction_text>5-Keto-D-gluconate + Hydrogen ion + NADPH + 5-Keto-D-gluconate + NADPH &gt; NADP + Gluconic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R005687</pw_reaction_id>
  </reactions>
  <concentrations>
  </concentrations>
</compound>
