2.0 2012-05-31 13:52:42 -0600 2015-06-03 15:54:07 -0600 ECMDB01437 M2MDB000387 N-Succinyl-L-glutamate N-succinyl-L-glutamate is a member of the chemical class known as Tricarboxylic Acids and Derivatives. These are organic compounds containing three carboxylic acid groups (or salt/ester derivatives thereof). (2S)-2-(3-Carboxypropanoylamino)pentanedioate (2S)-2-(3-Carboxypropanoylamino)pentanedioic acid N-(3-Carboxy-1-oxopropyl)-L-glutamate N-(3-Carboxy-1-oxopropyl)-L-glutamic acid N-(3-Carboxypropanoyl)-L-glutamate N-(3-Carboxypropanoyl)-L-glutamic acid N-Succinyl-L-glutamate N-Succinyl-L-glutamic acid N2-Succinyl-L-glutamate N2-Succinyl-L-glutamic acid N2SucGlu C9H13NO7 247.202 247.069201775 (2S)-2-[(3-carboxy-1-hydroxypropylidene)amino]pentanedioic acid (2S)-2-[(3-carboxy-1-hydroxypropylidene)amino]pentanedioic acid 33981-72-5 [H][C@@](CCC(O)=O)(N=C(O)CCC(O)=O)C(O)=O InChI=1S/C9H13NO7/c11-6(2-4-8(14)15)10-5(9(16)17)1-3-7(12)13/h5H,1-4H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17)/t5-/m0/s1 JCNBNOQGFSXOML-YFKPBYRVSA-N Cytosol logp -0.85 ALOGPS logs -1.90 ALOGPS solubility 3.14e+00 g/l ALOGPS logp -0.47 ChemAxon pka_strongest_acidic 3.16 ChemAxon pka_strongest_basic 0.84 ChemAxon iupac (2S)-2-[(3-carboxy-1-hydroxypropylidene)amino]pentanedioic acid ChemAxon average_mass 247.202 ChemAxon mono_mass 247.069201775 ChemAxon smiles [H][C@@](CCC(O)=O)(N=C(O)CCC(O)=O)C(O)=O ChemAxon formula C9H13NO7 ChemAxon inchi InChI=1S/C9H13NO7/c11-6(2-4-8(14)15)10-5(9(16)17)1-3-7(12)13/h5H,1-4H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17)/t5-/m0/s1 ChemAxon inchikey JCNBNOQGFSXOML-YFKPBYRVSA-N ChemAxon polar_surface_area 144.49 ChemAxon refractivity 52.15 ChemAxon polarizability 22.53 ChemAxon rotatable_bond_count 8 ChemAxon acceptor_count 8 ChemAxon donor_count 4 ChemAxon physiological_charge -3 ChemAxon formal_charge 0 ChemAxon Arginine and proline metabolism ec00330 Specdb::CMs 1084526 Specdb::MsMs 29111 Specdb::MsMs 29112 Specdb::MsMs 29113 Specdb::MsMs 35669 Specdb::MsMs 35670 Specdb::MsMs 35671 440847 389689 C05931 48957 Kanehisa, M., Goto, S., Sato, Y., Furumichi, M., Tanabe, M. (2012). "KEGG for integration and interpretation of large-scale molecular data sets." Nucleic Acids Res 40:D109-D114. 22080510 van der Werf, M. J., Overkamp, K. M., Muilwijk, B., Coulier, L., Hankemeier, T. (2007). "Microbial metabolomics: toward a platform with full metabolome coverage." Anal Biochem 370:17-25. 17765195 Succinylglutamate desuccinylase P76215 ASTE_ECOLI astE http://ecmdb.ca/proteins/P76215.xml N-succinylglutamate 5-semialdehyde dehydrogenase P76217 ASTD_ECOLI astD http://ecmdb.ca/proteins/P76217.xml Water + N-Succinyl-L-glutamate <> L-Glutamate + Succinic acid R00411 Water + NAD + N2-Succinyl-L-glutamic acid 5-semialdehyde <>2 Hydrogen ion + NADH + N-Succinyl-L-glutamate R05049 N2-Succinyl-L-glutamic acid 5-semialdehyde + NAD + Water <> N-Succinyl-L-glutamate + NADH + Hydrogen ion R05049 N2-Succinyl-L-glutamic acid 5-semialdehyde + NAD + Water > N-Succinyl-L-glutamate + NADH N-Succinyl-L-glutamate + Water > Succinic acid + L-Glutamate Water + NAD + N2-Succinyl-L-glutamic acid 5-semialdehyde <>2 Hydrogen ion + NADH + N-Succinyl-L-glutamate