Record Information
Creation Date2012-05-31 10:26:59 -0600
Update Date2015-09-13 12:56:08 -0600
Secondary Accession Numbers
  • ECMDB00494
DescriptionWater is a chemical substance that is essential to all known forms of life. It appears colorless to the naked eye in small quantities, though it is actually slightly blue in color. Water is vital both as a solvent in which many of the solutes dissolve and as an essential part of many metabolic processes within the living organisms. Metabolism is the sum total of anabolism and catabolism. In anabolism, water is removed from molecules (through energy requiring enzymatic chemical reactions) in order to grow larger molecules (e.g. starches, triglycerides and proteins for storage of fuels and information). In catabolism, water is used to break bonds in order to generate smaller molecules (e.g. glucose, fatty acids and amino acids to be used for fuels for energy use or other purposes). Water is thus essential and central to these metabolic processes..Water is also central to acid-base neutrality and enzyme function. An acid, a hydrogen ion (H+, that is, a proton) donor, can be neutralized by a base, a proton acceptor such as hydroxide ion (OH-) to form water. Water is considered to be neutral, with a pH (the negative log of the hydrogen ion concentration) of 7. Acids have pH values less than 7 while bases have values greater than 7. (Wikipedia)
  • Dihydrogen oxide
  • H20
  • H2O
  • H20
  • Hydrogen oxide
  • Steam
  • Water
Chemical Formula:H2O
Weight:Average: 18.0153
Monoisotopic: 18.010564686
CAS number:7732-18-5
IUPAC Name:water
Traditional IUPAC Name:water
Chemical Taxonomy
Description belongs to the class of inorganic compounds known as homogeneous other non-metal compounds. These are inorganic non-metallic compounds in which the largest atom belongs to the class of 'other non-metals'.
KingdomInorganic compounds
Super ClassHomogeneous non-metal compounds
ClassHomogeneous other non-metal compounds
Sub ClassNot Available
Direct ParentHomogeneous other non-metal compounds
Alternative ParentsNot Available
  • Homogeneous other non metal
Molecular FrameworkNot Available
External Descriptors
Physical Properties
Melting point:0 °C
Experimental Properties:
Water Solubility:55.5 mol/L [Theoretical Calculation]PhysProp
LogP:-1.38 [HANSCH,C ET AL. (1995)]PhysProp
Predicted Properties
pKa (Strongest Acidic)15.7ChemAxon
pKa (Strongest Basic)-1.8ChemAxon
Physiological Charge0ChemAxon
Hydrogen Acceptor Count1ChemAxon
Hydrogen Donor Count1ChemAxon
Polar Surface Area25.3 ŲChemAxon
Rotatable Bond Count0ChemAxon
Refractivity3.7 m³·mol⁻¹ChemAxon
Polarizability1.51 ųChemAxon
Number of Rings0ChemAxon
Rule of FiveYesChemAxon
Ghose FilterYesChemAxon
Veber's RuleYesChemAxon
MDDR-like RuleYesChemAxon
Biological Properties
Cellular Locations:Cytoplasm
ADP + Reduced Thioredoxin > dADP + Water + Oxidized Thioredoxin
Guanosine diphosphate + Reduced Thioredoxin > dGDP + Water + Oxidized Thioredoxin
CDP + Reduced Thioredoxin > dCDP + Water + Oxidized Thioredoxin
Reduced Thioredoxin + Uridine 5'-diphosphate > dUDP + Water + Oxidized Thioredoxin
ADP + Phosphate + 4 Hydrogen ion + Heme + Nickel(2+) + Iron chelate + Taurine + Molybdate + Magnesium + Fe3+ + Potassium + Polyamine + vitamin B12 + Sulfate + glycerol-3-phosphate + Phosphonate + D-Maltose <> Adenosine triphosphate +3 Hydrogen ion + Water
Adenosine triphosphate + Water + Isethionic acid > ADP + Hydrogen ion + Isethionic acid + Phosphate
Cytidine triphosphate + 2 Flavodoxin reduced + 2 Hydrogen ion > dCTP +2 flavodoxin semi oxidized + Water
Adenosine triphosphate + 2 Flavodoxin reduced + 2 Hydrogen ion > dATP +2 flavodoxin semi oxidized + Water
2 Flavodoxin reduced + Guanosine triphosphate + 2 Hydrogen ion > dGTP +2 flavodoxin semi oxidized + Water
2 Flavodoxin reduced + 2 Hydrogen ion + Uridine triphosphate > Deoxyuridine triphosphate +2 flavodoxin semi oxidized + Water
Adenosine triphosphate + Water + Potassium > ADP + Hydrogen ion + Potassium + Phosphate
Adenosine triphosphate + Water + Molybdate > ADP + Hydrogen ion + Molybdate + Phosphate
glutaredoxin + Uridine 5'-diphosphate > dUDP + glutaredoxin + Water
Guanosine diphosphate + glutaredoxin > dGDP + glutaredoxin + Water
CDP + glutaredoxin > dCDP + glutaredoxin + Water
Adenosine triphosphate + Water + Putrescine > ADP + Hydrogen ion + Phosphate + Putrescine
Hydrogen ion + Menaquinol 8 + Trimethylamine N-Oxide > Water + Menaquinone 8 + Trimethylamine
Adenosine triphosphate + Water + Butanesulfonate > ADP + Butanesulfonate + Hydrogen ion + Phosphate
2 Hydrogen ion + Oxygen + Ubiquinol-8 > Water + Ubiquinone-8 +2 Hydrogen ion
2-Demethylmenaquinol 8 + Hydrogen ion + Trimethylamine N-Oxide > 2-Demethylmenaquinone 8 + Water + Trimethylamine
ADP + glutaredoxin > dADP + glutaredoxin + Water
Adenosine triphosphate + Water + Spermidine > ADP + Hydrogen ion + Phosphate + Spermidine
2 Hydrogen ion + Nitrate + Ubiquinol-8 > Water + Nitrite + Ubiquinone-8 +2 Hydrogen ion
2 Hydrogen ion + Menaquinol 8 + Nitrate > Water + Menaquinone 8 + Nitrite +2 Hydrogen ion
Adenosine triphosphate + Water + D-Alanyl-D-alanine > ADP + D-Alanyl-D-alanine + Hydrogen ion + Phosphate
Dimethyl sulfoxide + Menaquinol 8 > Dimethyl sulfide + Water + Menaquinone 8
Methionine sulfoxide + Reduced Thioredoxin > Water + L-Methionine + Oxidized Thioredoxin
Adenosine triphosphate + Water + D-Galactose > ADP + D-Galactose + Hydrogen ion + Phosphate
Ubiquinol-8 + Nitrate > Ubiquinone-8 + Water + Nitrite
Menaquinol 8 + Nitrate > Menaquinone 8 + Water + Nitrite
Adenosine triphosphate + Water + L-Arginine > ADP + L-Arginine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Sulfate > ADP + Hydrogen ion + Phosphate + Sulfate
Adenosine triphosphate + Water + Thiosulfate > ADP + Hydrogen ion + Phosphate + Thiosulfate
Hydrogen peroxide + Reduced Thioredoxin >2 Water + Oxidized Thioredoxin
2-C-Methyl-D-erythritol-2,4-cyclodiphosphate + 2 Flavodoxin reduced + Hydrogen ion >2 flavodoxin semi oxidized + 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + Water
Adenosine triphosphate + Water + L-Leucine > ADP + Hydrogen ion + L-Leucine + Phosphate
Adenosine triphosphate + Water + Nickel > ADP + Hydrogen ion + Nickel + Phosphate
Adenosine triphosphate + Water + Ribose > ADP + Hydrogen ion + Phosphate + Ribose
2 Adenosine triphosphate + L-Glutamine + Water + Hydrogen carbonate >2 ADP + Carbamoylphosphate + L-Glutamate +2 Hydrogen ion + Phosphate
1-Deoxy-D-xylulose 5-phosphate + NAD + O-Phospho-4-hydroxy-L-threonine > Carbon dioxide + Hydrogen ion +2 Water + NADH + Pyridoxine 5'-phosphate + Phosphate
Adenosine triphosphate + Water + Thiamine > ADP + Hydrogen ion + Phosphate + Thiamine
3-Isopropylmalate <> Isopropylmaleate + Water
Isopropylmaleate + Water <> 2-Isopropylmalic acid
Dihydroneopterin triphosphate + Water > Dihydroneopterin monophosphate + Hydrogen ion + Pyrophosphate
Guanosine triphosphate + Water > Guanosine monophosphate + Hydrogen ion + Pyrophosphate
dGTP + Water > 2'-Deoxyguanosine 5'-monophosphate + Hydrogen ion + Pyrophosphate
cis-Aconitic acid + Water <> Isocitric acid
Citric acid <> cis-Aconitic acid + Water
Ubiquinone-8 + D-Glucose + Water > Ubiquinol-8 + Gluconic acid + Hydrogen ion
Carbon dioxide + Water <> Hydrogen ion + Hydrogen carbonate
Adenosine triphosphate + Water + Ferric coprogen > ADP + Ferric coprogen + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Aerobactin > ADP + Aerobactin + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Fe(III)hydroxamate > ADP + Fe(III)hydroxamate + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Ferrichrome > ADP + Ferrichrome + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Ferroxamine > ADP + Ferroxamine + Hydrogen ion + Phosphate
(R)-3-hydroxy-cis-dodec-5-enoyl-[acyl-carrier protein] > Water + trans-3-cis-5-dodecenoyl-[acyl-carrier protein]
(R)-3-hydroxy-cis-palm-9-eoyl-[acyl-carrier protein] > Water + trans-3-cis-9-palmitoleoyl-[acyl-carrier protein]
(R)-3-Hydroxydodecanoyl-[acyl-carrier protein] > Water + trans-Dodec-2-enoyl-[acyl-carrier protein]
Adenosine triphosphate + Water + L-Methionine > ADP + Hydrogen ion + L-Methionine + Phosphate
Adenosine triphosphate + Water + D-Methionine > ADP + Hydrogen ion + D-Methionine + Phosphate
Cysteinylglycine + Water > L-Cysteine + Glycine
Adenosine triphosphate + Water + Taurine > ADP + Hydrogen ion + Phosphate + Taurine
Water + PGP(12:0/12:0) > PG(12:0/12:0) + Phosphate
Water + PGP(14:0/14:0) > PG(14:0/14:0) + Phosphate
Water + PGP(14:1(7Z)/14:1(7Z)) > PG(14:1(7Z)/14:1(7Z)) + Phosphate
Water + PGP(16:0/16:0) > PG(16:0/16:0) + Phosphate
Water + PGP(16:1(9Z)/16:1(9Z)) > PG(16:1(9Z)/16:1(9Z)) + Phosphate
Water + PGP(18:0/18:0) > PG(18:0/18:0) + Phosphate
Water + PGP(18:1(11Z)/18:1(11Z)) > PG(18:1(11Z)/18:1(11Z)) + Phosphate
4 Hydrogen ion + Oxygen + Ubiquinol-8 > Water + Ubiquinone-8 +4 Hydrogen ion
2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate + Water > 4-Amino-2-methyl-5-phosphomethylpyrimidine + Hydrogen ion + Phosphate
Water + Pyridoxal 5'-phosphate > Phosphate + Pyridoxal
Adenosine monophosphate + Water > Adenosine + Phosphate
Cytidine monophosphate + Water > Cytidine + Phosphate
Water + Uridine 5'-monophosphate > Phosphate + Uridine
Water + Xanthylic acid > Phosphate + Xanthosine
Water + Inosinic acid > Inosine + Phosphate
Deoxyadenosine monophosphate + Water > Deoxyadenosine + Phosphate
2'-Deoxyguanosine 5'-monophosphate + Water > Deoxyguanosine + Phosphate
dCMP + Water > Deoxycytidine + Phosphate
5-Thymidylic acid + Water > Phosphate + Thymidine
Guanosine monophosphate + Water > Guanosine + Phosphate
dUMP + Water > Deoxyuridine + Phosphate
DIMP + Water > Deoxyinosine + Phosphate
Adenosine triphosphate + Water + Ferric enterobactin > ADP + Ferric enterobactin + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + ferric 2,3-dihydroxybenzoylserine > ADP + ferric 2,3-dihydroxybenzoylserine + Hydrogen ion + Phosphate
Water + three disacharide linked murein units (pentapeptide crosslinked tetrapeptide (A2pm->D-ala) tetrapeptide corsslinked tetrapeptide (A2pm->D-ala)) (middle of chain) > D-Alanine + three disacharide linked murein units (tetrapeptide crosslinked tetrapeptide (A2pm->D-ala) & tetrapeptide corsslinked tetrapeptide (A2pm->D-ala)) (middle of chain)
Water + two disacharide linked murein units, pentapeptide crosslinked tetrapeptide (A2pm->D-ala) (middle of chain) > D-Alanine + two disacharide linked murein units, tetrapeptide corsslinked tetrapeptide (A2pm->D-ala) (middle of chain)
Water + two linked disacharide pentapeptide and tetrapeptide murein units (uncrosslinked, middle of chain) > D-Alanine + two linked disacharide tetrapeptide murein units (uncrosslinked, middle of chain)
Water + two linked disacharide pentapeptide and tripeptide murein units (uncrosslinked, middle of chain) > D-Alanine + two linked disacharide tetrapeptide and tripeptide murein units (uncrosslinked, middle of chain)
Water + two linked disacharide pentapeptide murein units (uncrosslinked, middle of chain) > D-Alanine + two linked disacharide pentapeptide and tetrapeptide murein units (uncrosslinked, middle of chain)
Adenosine triphosphate + Water > ADP + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Glutamate > ADP + L-Glutamate + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Aspartic acid > ADP + L-Aspartic acid + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Tungstate > ADP + Hydrogen ion + Phosphate + Tungstate
Guanosine triphosphate + Water <> Cyclic pyranopterin monophosphate + Pyrophosphate
Adenosine triphosphate + Water + L-Glutamine > ADP + L-Glutamine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glutathione > ADP + Glutathione + Hydrogen ion + Phosphate
Water + Undecaprenyl diphosphate > Hydrogen ion + Phosphate + Undecaprenyl phosphate
Adenosine triphosphate + L-Cysteine + Water > ADP + Hydrogen ion + Phosphate + L-Cysteine
2-Demethylmenaquinol 8 + Dimethyl sulfoxide > 2-Demethylmenaquinone 8 + Dimethyl sulfide + Water
Adenosine triphosphate + Water + Ethanesulfonate > ADP + Ethanesulfonate + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Methanesulfonate > ADP + Hydrogen ion + Methanesulfonate + Phosphate
Adenosine triphosphate + Water + Sulfoacetate > ADP + Hydrogen ion + Phosphate + Sulfoacetate
(3R)-3-Hydroxyacyl-[acyl-carrier protein] > But-2-enoyl-[acyl-carrier protein] + Water
(R)-3-hydroxy-cis-myristol-7-eoyl-[acyl-carrier protein] > Water + trans-3-cis-7-myristoleoyl-[acyl-carrier protein]
(R)-3-hydroxy-cis-vacc-11-enoyl-[acyl-carrier protein] > Water + trans-3-cis-11-vacceoyl-[acyl-carrier protein]
(R)-3-Hydroxydecanoyl-[acyl-carrier protein] > Water + trans-Dec-2-enoyl-[acyl-carrier protein]
(R)-3-Hydroxyhexanoyl-[acyl-carrier protein] > Water + trans-Hex-2-enoyl-[acyl-carrier protein]
(R)-3-Hydroxyoctadecanoyl-[acyl-carrier protein] > Water + trans-octadec-2-enoyl-[acyl-carrier protein]
(R)-3-Hydroxyoctanoyl-[acyl-carrier protein] > Water + trans-Oct-2-enoyl-[acyl-carrier protein]
(R)-3-Hydroxytetradecanoyl-[acyl-carrier protein] > Water + trans-Tetradec-2-enoyl-[acyl-carrier protein]
R-3-hydroxypalmitoyl-[acyl-carrier protein] > Water + trans-Hexadec-2-enoyl-[acyl-carrier protein]
2 Hydrogen ion + Menaquinol 8 + Oxygen > Water + Menaquinone 8 +2 Hydrogen ion
Adenosine triphosphate + Water + L-Alanine-D-glutamate-meso-2,6-diaminoheptanedioate-D-alanine > L-Alanine-D-glutamate-meso-2,6-diaminoheptanedioate-D-alanine + ADP + Hydrogen ion + Phosphate
Indole + L-Serine > Water + L-Tryptophan
Indoleglycerol phosphate + L-Serine > D-Glyceraldehyde 3-phosphate + Water + L-Tryptophan
Adenosine triphosphate + Water + L-alanine-D-glutamate-meso-2,6-diaminoheptanedioate > L-alanine-D-glutamate-meso-2,6-diaminoheptanedioate + ADP + Hydrogen ion + Phosphate
Hydrogen ion + NADPH + Oxygen + Phenylacetyl-CoA > Water + NADP + Ring 1,2-epoxyphenylacetyl-CoA
Menaquinol 8 + Selenocystathionine > Water + Menaquinone 8 + Selenite
Fumaric acid + Water <> L-Malic acid
L-Cystathionine + Water > L-Homocysteine + Ammonium + Pyruvic acid
[2Fe-1S] desulfurated iron-sulfur cluster + Adenosine triphosphate + Water + SufBCD scaffold complex + SufSE with bound sulfur > ADP +5 Hydrogen ion + Phosphate + SufBCD with bound [2Fe-2S] cluster + SufSE sulfur acceptor complex
Adenosine triphosphate + Water + Adenosylcobalamin > Adenosylcobalamin + ADP + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Cob(I)alamin > ADP + Cob(I)alamin + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Cobinamide > ADP + Cobinamide + Hydrogen ion + Phosphate
2 Hydrogen peroxide <>2 Water + Oxygen
Cytidine triphosphate + Water > Cytidine monophosphate + Hydrogen ion + Pyrophosphate
L-Asparagine + Water > L-Aspartic acid + Ammonium
L-Glutamine + Water > L-Glutamate + Ammonium
Adenosine triphosphate + Water + Zinc > ADP + Hydrogen ion + Phosphate + Zinc
Adenosine triphosphate + Water + L-Arabinose > ADP + L-Arabinose + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Choline > ADP + Choline + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Betaine > ADP + Betaine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + D-Glucose > ADP + D-Glucose + Hydrogen ion + Phosphate
S-Formylglutathione + Water <> Formic acid + Glutathione + Hydrogen ion
Cytidine + Water > Cytosine + Ribose
Water + Uridine > Ribose + Uracil
Adenosine triphosphate + Water + Heme > ADP + Hydrogen ion + Phosphate + Heme
Adenosine triphosphate + Water + L-Histidine > ADP + Hydrogen ion + L-Histidine + Phosphate
Adenosine triphosphate + Water + L-Lysine > ADP + Hydrogen ion + L-Lysine + Phosphate
Adenosine triphosphate + Water + Ornithine > ADP + Hydrogen ion + Ornithine + Phosphate
N-Acetyl-D-glucosamine(anhydrous)N-Acetylmuramyl-tetrapeptide + Water > L-Alanine-D-glutamate-meso-2,6-diaminoheptanedioate-D-alanine + N-Acetyl-D-glucosamine(anhydrous)N-Acetylmuramic acid
N-Acetyl-D-glucosamine(anhydrous)N-Acetylmuramyl-tripeptide + Water > L-alanine-D-glutamate-meso-2,6-diaminoheptanedioate + N-Acetyl-D-glucosamine(anhydrous)N-Acetylmuramic acid
Water + Triphosphate > Hydrogen ion + Phosphate + Pyrophosphate
Adenosine triphosphate + Dehydroglycine + 1-Deoxy-D-xylulose 5-phosphate + Hydrogen ion + IscS with bound sulfur + NADPH > 4-Methyl-5-(2-phosphoethyl)-thiazole + Adenosine monophosphate + Carbon dioxide +2 Water + IscS sulfur acceptor protein + NADP + Pyrophosphate
D-Erythrose 4-phosphate + Water + Phosphoenolpyruvic acid <> 2-Dehydro-3-deoxy-D-arabino-heptonate 7-phosphate + Phosphate
Water + NADP + Succinic acid semialdehyde >2 Hydrogen ion + NADPH + Succinic acid
Adenosine triphosphate + Water + Carnitine > ADP + Carnitine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Proline > ADP + Hydrogen ion + Phosphate + L-Proline
Adenosine triphosphate + Water + Crotonobetaine > ADP + Crotonobetaine + Hydrogen ion + Phosphate
Hydrogen ion + NADH + 2 Nitric oxide > Water + Nitrous oxide + NAD
Water + Pyrophosphate > Hydrogen ion +2 Phosphate
Adenosine triphosphate + Guanosine triphosphate + Water + Sulfate > Adenosine phosphosulfate + Guanosine diphosphate + Phosphate + Pyrophosphate
5 Hydrogen ion + 3 NADPH + Sulfite <>3 Water + Hydrogen sulfide +3 NADP
dATP + Water > Deoxyadenosine monophosphate + Hydrogen ion + Pyrophosphate
dCTP + Water > dCMP + Hydrogen ion + Pyrophosphate
Thymidine 5'-triphosphate + Water > 5-Thymidylic acid + Hydrogen ion + Pyrophosphate
Glucaric acid > 5-Dehydro-4-deoxy-D-glucarate + Water
Water + Hypoxanthine + NAD > Hydrogen ion + NADH + Xanthine
Water + NAD + Xanthine <> Hydrogen ion + NADH + Uric acid
D-Erythrose 4-phosphate + Water + NAD <> 4-Phospho-D-erythronate +2 Hydrogen ion + NADH
Tartaric acid <> Water + Oxalacetic acid
Water + three disacharide linked murein units (tetrapeptide crosslinked tetrapeptide (A2pm->D-ala) & tetrapeptide corsslinked tetrapeptide (A2pm->D-ala)) (middle of chain) > three disacharide linked murein units (tetrapeptide crosslinked tetrapeptide (A2pm->D-ala), one uncrosslinked tetrapaptide) (middle of chain)
Water + two disacharide linked murein units, pentapeptide crosslinked tetrapeptide (A2pm->D-ala) (middle of chain) > two linked disacharide pentapeptide and tetrapeptide murein units (uncrosslinked, middle of chain)
Water + two disacharide linked murein units, tetrapeptide corsslinked tetrapeptide (A2pm->D-ala) (middle of chain) > two linked disacharide tetrapeptide murein units (uncrosslinked, middle of chain)
Water + two disacharide linked murein units, tripeptide crosslinked tetrapeptide (A2pm->D-ala) (middle of chain) > two linked disacharide tetrapeptide and tripeptide murein units (uncrosslinked, middle of chain)
Adenosine triphosphate + Water + (enterobacterial common antigen)x4 core oligosaccharide lipid A > ADP + Hydrogen ion + Phosphate + (enterobacterial common antigen)x4 core oligosaccharide lipid A
Adenosine triphosphate + Water + (O16 antigen)x4 core oligosaccharide lipid A > ADP + Hydrogen ion + Phosphate + (O16 antigen)x4 core oligosaccharide lipid A
Adenosine triphosphate + Water + cold adapted KDO(2)-lipid (A) > ADP + Hydrogen ion + Phosphate + cold adapted KDO(2)-lipid (A)
Adenosine triphosphate + Water + core oligosaccharide lipid A > ADP + Hydrogen ion + Phosphate + core oligosaccharide lipid A
Adenosine triphosphate + Water + core oligosaccharide lipid A diphosphate > ADP + Hydrogen ion + Phosphate + core oligosaccharide lipid A diphosphate
Adenosine triphosphate + Water + KDO2-Lipid A > ADP + Hydrogen ion + Phosphate + KDO2-Lipid A
Adenosine triphosphate + Water + 4-Amino-4-deoxy-L-arabinose modified core oligosaccharide lipid A > ADP + Hydrogen ion + Phosphate + 4-Amino-4-deoxy-L-arabinose modified core oligosaccharide lipid A
Adenosine triphosphate + Water + KDO(2)-lipid IV(A) > ADP + Hydrogen ion + Phosphate + KDO(2)-lipid IV(A)
Adenosine triphosphate + Water + Phosphoethanolamine KDO(2)-lipid (A) > ADP + Hydrogen ion + Phosphate + Phosphoethanolamine KDO(2)-lipid (A)
5 Hydrogen ion + 3 NADH + Nitrite >2 Water +3 NAD + Ammonium
Adenosine diphosphate ribose + Water <> Adenosine monophosphate +2 Hydrogen ion + D-Ribose-5-phosphate
Adenosine triphosphate + Water + Glycerophosphocholine > ADP + Glycerophosphocholine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glycerylphosphorylethanolamine > ADP + Glycerylphosphorylethanolamine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glycerol 3-phosphate > ADP + Glycerol 3-phosphate + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glycerol 2-phosphate > ADP + Glycerol 2-phosphate + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glycerophosphoglycerol > ADP + Glycerophosphoglycerol + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glycerophosphoserine > ADP + Glycerophosphoserine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Sn-Glycero-3-phospho-1-inositol > ADP + Sn-Glycero-3-phospho-1-inositol + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Alanine > ADP + L-Alanine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Threonine > ADP + Hydrogen ion + Phosphate + L-Threonine
Adenosine triphosphate + Water + L-Isoleucine > ADP + Hydrogen ion + L-Isoleucine + Phosphate
Adenosine triphosphate + Water + L-Valine > ADP + Hydrogen ion + Phosphate + L-Valine
Arsenate + 2 Glutathione > Arsenite + Glutathione disulfide + Water
Adenosine triphosphate + Water + Cysteinylglycine > ADP + Cysteinylglycine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Prolinylglycine > ADP + Hydrogen ion + Phosphate + L-Prolinylglycine
Adenosine triphosphate + Water + D-Xylose > ADP + Hydrogen ion + Phosphate + D-Xylose
Deoxyuridine triphosphate + Water <> dUMP + Hydrogen ion + Pyrophosphate
L-Cysteine + Water > Hydrogen sulfide + Ammonium + Pyruvic acid
Adenosine triphosphate + Water + Phosphate > ADP + Hydrogen ion +2 Phosphate
dTDP-D-Glucose <> 4,6-Dideoxy-4-oxo-dTDP-D-glucose + Water
Adenosine triphosphate + FADH2 + 2 Iron + Water + SufBCD scaffold complex + 2 SufSE with bound sulfur > ADP + FAD +7 Hydrogen ion + Phosphate + SufBCD with bound [2Fe-2S] cluster +2 SufSE sulfur acceptor complex
Adenosine triphosphate + FADH2 + 2 Iron + Water + SufBCD with bound [2Fe-2S] cluster + 2 SufSE with bound sulfur > ADP + FAD +7 Hydrogen ion + Phosphate + SufBCD with two bound [2Fe-2S] clusters +2 SufSE sulfur acceptor complex
3-Hydroxybutyryl-CoA <> Crotonoyl-CoA + Water
(S)-3-Hydroxyhexadecanoyl-CoA <> Water + (2E)-Hexadecenoyl-CoA
(S)-3-Hydroxytetradecanoyl-CoA <> Water + (2E)-Tetradecenoyl-CoA
(S)-3-Hydroxydodecanoyl-CoA <> (2E)-Dodecenoyl-CoA + Water
(S)-Hydroxydecanoyl-CoA <> (2E)-Decenoyl-CoA + Water
(S)-Hydroxyoctanoyl-CoA <> Water + (2E)-Octenoyl-CoA
(S)-Hydroxyhexanoyl-CoA <> Water + trans-2-Hexenoyl-CoA
(S)-3-Hydroxyoctadecanoyl-CoA <> Water + Trans-Octadec-2-enoyl-CoA
Fructose 1,6-bisphosphate + Water <> Fructose 6-phosphate + Phosphate
Water + NAD <> Adenosine monophosphate +2 Hydrogen ion + Nicotinamide ribotide + NMN
Acetyl-CoA + Glyoxylic acid + Water <> Coenzyme A + Hydrogen ion + L-Malic acid
Adenosine triphosphate + Water + D-Maltose > ADP + Hydrogen ion + D-Maltose + Phosphate
Adenosine triphosphate + Water + Maltotriose > ADP + Hydrogen ion + Maltotriose + Phosphate
Adenosine triphosphate + Water + Maltotetraose > ADP + Hydrogen ion + Maltotetraose + Phosphate
Adenosine triphosphate + Water + 1,4-alpha-D-glucan > 1,4-alpha-D-glucan + ADP + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Maltohexaose > ADP + Hydrogen ion + Maltohexaose + Phosphate
Adenosine triphosphate + Water + Maltopentaose > ADP + Hydrogen ion + Maltopentaose + Phosphate
3 Ubiquinol-8 + 2 Hydrogen ion + Nitrite >3 Ubiquinone-8 +2 Water + Ammonium
3 Menaquinol 8 + 2 Hydrogen ion + Nitrite >3 Menaquinone 8 +2 Water + Ammonium
Adenosine triphosphate + Water + D-Allose > ADP + D-Allose + Hydrogen ion + Phosphate
Water + Inosine triphosphate > Hydrogen ion + IDP + Phosphate
Water + L-Prolinylglycine > Glycine + L-Proline
Adenosine triphosphate + Water + Fe(III)dicitrate > ADP +2 Citric acid + Fe3+ + Hydrogen ion + Phosphate
Water + O-Phosphohomoserine <> Phosphate + L-Threonine
Water + O-Phospho-4-hydroxy-L-threonine > 4-Hydroxy-L-threonine + Phosphate
Hydrogen ion + 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH > Water + Isopentenyl pyrophosphate + NAD
Hydrogen ion + 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH > Dimethylallylpyrophosphate + Water + NAD
Adenosine + Water > Adenine + Ribose
Water + Inosine > Hypoxanthine + Ribose
Water + Xanthosine > Ribose + Xanthine
L-Carnitinyl-CoA <> Crotonobetainyl-CoA + Water
Diadenosine tetraphosphate + Water <>2 ADP +2 Hydrogen ion
Diadenosine pentaphosphate + Water > ADP + Adenosine triphosphate +2 Hydrogen ion
P1,P4-Bis(5'-guanosyl) tetraphosphate + Water >2 Guanosine diphosphate +2 Hydrogen ion
alpha-Ketoisovaleric acid + Acetyl-CoA + Water + a-Ketoisovaleric acid <> 2-Isopropylmalic acid + Coenzyme A + Hydrogen ion
Water + UDP-3-O-(3-Hydroxymyristoyl)-N-acetylglucosamine <> Acetic acid + UDP-3-O-(3-Hydroxytetradecanoyl)-D-glucosamine
1,6-Anhydrous-N-Acetylmuramyl-tetrapeptide + Water > L-Alanine-D-glutamate-meso-2,6-diaminoheptanedioate-D-alanine + 1,6-Anhydro-N-acetylmuramate
1,6-Anhydrous-N-Acetylmuramyl-tripeptide + Water > L-alanine-D-glutamate-meso-2,6-diaminoheptanedioate + 1,6-Anhydro-N-acetylmuramate
Cis-2-Methylaconitate + Water <> Methylisocitric acid
4 Copper + 4 Hydrogen ion + Oxygen >4 Copper +2 Water
4 Iron + 4 Hydrogen ion + Oxygen >4 Fe3+ +2 Water
alpha-Ketoisovaleric acid + Water + 5,10-Methylene-THF + a-Ketoisovaleric acid <> 2-Dehydropantoate + Tetrahydrofolic acid
S-Adenosylhomocysteine + Water <> Adenine + S-Ribosyl-L-homocysteine
5'-Methylthioadenosine + Water > 5-Methylthioribose + Adenine
5'-Deoxyadenosine + Water > 5'-Deoxyribose + Adenine
Guanosine triphosphate + Water > Guanosine + Triphosphate
dGTP + Water <> Deoxyguanosine + Triphosphate
Water + Succinyl-CoA + Tetrahydrodipicolinate <> Coenzyme A + N-Succinyl-2-amino-6-ketopimelate
3 -Hydroxyglutaryl-[acyl-carrier protein] methyl ester > Enoylglutaryl-[acyl-carrier protein] methyl ester + Water
3 -Hydroxypimeloyl-[acyl-carrier protein] methyl ester > Enoylpimeloyl-[acyl-carrier protein] methyl ester + Water
D-Glycero-D-manno-heptose 1,7-bisphosphate + Water <> D-Glycero-D-manno-heptose 1-phosphate + Phosphate
Water + S-Lactoylglutathione > Glutathione + Hydrogen ion + D-Lactic acid
L-Alanine-L-glutamate + Water > L-Alanine + L-Glutamate
Betaine aldehyde + Water + NADP > Betaine +2 Hydrogen ion + NADPH
Betaine aldehyde + Water + NAD <> Betaine +2 Hydrogen ion + NADH
Water + Oxalacetic acid + Propionyl-CoA <> Methylcitric acid + Coenzyme A + Hydrogen ion + (2S,3S)-2-hydroxybutane-1,2,3-tricarboxylate
Methylcitric acid + (2S,3S)-2-hydroxybutane-1,2,3-tricarboxylate <> Cis-2-Methylaconitate + Water
Cytosine + Hydrogen ion + Water > Ammonium + Uracil
Water + alpha-Lactose > D-Galactose + D-Glucose
3-(3-Hydroxyphenyl)propanoic acid + Hydrogen ion + NADH + Oxygen > 3-(2,3-Dihydroxyphenyl)propionic acid + Water + NAD
3-Hydroxycinnamic acid + Hydrogen ion + NADH + Oxygen > Trans-2,3-Dihydroxycinnamate + Water + NAD
Water + 2-Hydroxy-6-ketononadienedicarboxylate > Hydrogen ion + 2-Hydroxy-2,4-pentadienoate + Succinic acid
Water + 2-Hydroxy-6-ketononatrienedioate > Fumaric acid + Hydrogen ion + 2-Hydroxy-2,4-pentadienoate
Water + 2-Hydroxy-2,4-pentadienoate <> 4-Hydroxy-2-oxopentanoate
2 5-Aminolevulinic acid <> Hydrogen ion +2 Water + Porphobilinogen
Water + Phosphonate > Hydrogen (gas) + Phosphate
Water + Maltotriose > D-Glucose + D-Maltose
Water + Maltotetraose > D-Glucose + Maltotriose
Water + Maltoheptaose > D-Glucose + Maltohexaose
Water + Maltohexaose > D-Glucose + Maltopentaose
Water + Maltopentaose > D-Glucose + Maltotetraose
Decanoyl-ACP (n-C10:0ACP) + Water > acyl carrier protein + Decanoate (N-C10:0) + Hydrogen ion
Dodecanoyl-ACP (n-C12:0ACP) + Water > acyl carrier protein + Dodecanoate (N-C12:0) + Hydrogen ion
Water + cis-hexadec-9-enoyl-[acyl-carrier protein] (n-C16:1) > acyl carrier protein + Hydrogen ion + Hexadecenoate (n-C16:1)
Water + cis-tetradec-7-enoyl-[acyl-carrier protein] (n-C14:1) > acyl carrier protein + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + Myristoyl-ACP (n-C14:0ACP) > acyl carrier protein + Hydrogen ion + tetradecanoate (n-C14:0)
Water + Octanoyl-ACP (n-C8:0ACP) > acyl carrier protein + Hydrogen ion + Caprylic acid
Water + Palmitoyl-ACP (n-C16:0ACP) > acyl carrier protein + Hydrogen ion + Palmitic acid
2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Hydrogen ion + Water > 5-Amino-6-(5'-phosphoribosylamino)uracil + Ammonium
Farnesyl pyrophosphate + Water + Heme > Heme O + Pyrophosphate
Adenosine triphosphate + 7-Deaza-7-carboxyguanine + Ammonium > ADP + Hydrogen ion + Water + Phosphate + 7-Cyano-7-carbaguanine
Water + Octanoyl-CoA > Coenzyme A + Hydrogen ion + Caprylic acid
Water + Palmityl-CoA > Coenzyme A + Hydrogen ion + Palmitic acid
Water + Tetradecanoyl-CoA > Coenzyme A + Hydrogen ion + tetradecanoate (n-C14:0)
Water + Hexanoyl-CoA > Coenzyme A + Hydrogen ion + Hexanoate (N-C6:0)
Water + (2E)-Hexadecenoyl-CoA > Coenzyme A + Hydrogen ion + Hexadecenoate (n-C16:1)
Water + (2E)-Tetradecenoyl-CoA > Coenzyme A + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + Octadecenoyl-CoA (N-C18:1CoA) > Coenzyme A + Hydrogen ion + Octadecenoate (N-C18:1)
Water + Stearoyl-CoA > Coenzyme A + Hydrogen ion + Octadecanoate (N-C18:0)
Lauroyl-CoA + Water > Coenzyme A + Dodecanoate (N-C12:0) + Hydrogen ion
Decanoyl-CoA (N-C10:0CoA) + Water > Coenzyme A + Decanoate (N-C10:0) + Hydrogen ion
Water + Uridine diphosphate-N-acetylglucosamine > N-Acetyl-glucosamine 1-phosphate +2 Hydrogen ion + Uridine 5'-monophosphate
Water + Uridine diphosphategalactose > Galactose 1-phosphate +2 Hydrogen ion + Uridine 5'-monophosphate
Water + Uridine diphosphate-N-acetylgalactosamine > N-Acetyl-D-galactosamine 1-phosphate +2 Hydrogen ion + Uridine 5'-monophosphate
Water + Uridine diphosphate glucuronic acid > D-Glucuronate 1-phosphate +2 Hydrogen ion + Uridine 5'-monophosphate
Water + UDP-Glucose > Glucose 1-phosphate +2 Hydrogen ion + Uridine 5'-monophosphate
Adenosine triphosphate + Copper + Water > ADP + Hydrogen ion + Phosphate + Copper
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C12:0) + Water > Dodecanoate (N-C12:0) + Glycerylphosphorylethanolamine + Hydrogen ion
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:0) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + tetradecanoate (n-C14:0)
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:1) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Tetradecenoate (N-C14:1)
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:0) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Palmitic acid
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:1) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Hexadecenoate (n-C16:1)
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:0) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Octadecanoate (N-C18:0)
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:1) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Octadecenoate (N-C18:1)
1-Acyl-sn-glycero-3-phosphoglycerol (N-C12:0) + Water > Dodecanoate (N-C12:0) + Glycerophosphoglycerol + Hydrogen ion
1-Acyl-sn-glycero-3-phosphoglycerol (N-C14:0) + Water > Glycerophosphoglycerol + Hydrogen ion + tetradecanoate (n-C14:0)
1-Acyl-sn-glycero-3-phosphoglycerol (N-C14:1) + Water > Glycerophosphoglycerol + Hydrogen ion + Tetradecenoate (N-C14:1)
1-Acyl-sn-glycero-3-phosphoglycerol (N-C16:0) + Water > Glycerophosphoglycerol + Hydrogen ion + Palmitic acid
1-Acyl-sn-glycero-3-phosphoglycerol (N-C16:1) + Water > Glycerophosphoglycerol + Hydrogen ion + Hexadecenoate (n-C16:1)
1-Acyl-sn-glycero-3-phosphoglycerol (N-C18:0) + Water > Glycerophosphoglycerol + Hydrogen ion + Octadecanoate (N-C18:0)
1-Acyl-sn-glycero-3-phosphoglycerol (N-C18:1) + Water > Glycerophosphoglycerol + Hydrogen ion + Octadecenoate (N-C18:1)
1-Dodecanoyl-sn-glycerol 3-phosphate + Water > Dodecanoate (N-C12:0) + Glycerol 3-phosphate + Hydrogen ion
1-Hexadec-9-enoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate + Hydrogen ion + Hexadecenoate (n-C16:1)
1-hexadecanoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate + Hydrogen ion + Palmitic acid
1-Octadec-11-enoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate + Hydrogen ion + Octadecenoate (N-C18:1)
1-Octadecanoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate + Hydrogen ion + Octadecanoate (N-C18:0)
1-Tetradec-7-enoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate + Hydrogen ion + Tetradecenoate (N-C14:1)
1-Tetradecanoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate + Hydrogen ion + tetradecanoate (n-C14:0)
2 Hydrogen ion + Water + (S)-Ureidoglycolic acid > Carbon dioxide + Glyoxylic acid +2 Ammonium
Allantoin + Water > Allantoic acid + Hydrogen ion
Allantoic acid + 2 Hydrogen ion + 2 Water > Carbon dioxide +2 Ammonium + (S)-Ureidoglycolic acid
Water + UDP-2,3-Bis(3-hydroxytetradecanoyl)glucosamine <>2 Hydrogen ion + 2,3-Bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl 1-phosphate + Uridine 5'-monophosphate
Water + 5,10-Methenyltetrahydrofolate <> N10-Formyl-THF + Hydrogen ion
Enterochelin + 3 Water >3 2,3-Dihydroxybenzoylserine +3 Hydrogen ion
Ferric enterobactin + 3 Water >3 2,3-Dihydroxybenzoylserine + Fe3+ +3 Hydrogen ion
Water + Isochorismate <> (2S,3S)-2,3-Dihydro-2,3-dihydroxybenzoate + Pyruvic acid
core oligosaccharide lipid A + Hydrogen ion + Palmitic acid > Water + hepta-acylated core oligosaccharide lipid A (E. coli)
Hydrogen ion + Palmitic acid + KDO2-Lipid A > Water + Hepta-acylated KDO2-lipid A
N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole + Water > Phosphate + N1-(alpha-D-ribosyl)-5,6-dimethyl-benzimidazole
L-Aspartic acid + Adenosine triphosphate + L-Glutamine + Water > Adenosine monophosphate + L-Asparagine + L-Glutamate + Hydrogen ion + Pyrophosphate
N-Acetyl-D-Glucosamine 6-Phosphate + Water <> Acetic acid + Glucosamine 6-phosphate
Glucosamine 6-phosphate + Water > Fructose 6-phosphate + Ammonium
Acetyl-CoA + Water + Oxalacetic acid <> Citric acid + Coenzyme A + Hydrogen ion
Water + 2(alpha-D-Mannosyl-6-phosphate)-D-glycerate > Glyceric acid + Mannose 6-phosphate
1,4-Dihydroxy-2-naphthoyl-CoA + Water > Coenzyme A + 1,4-Dihydroxy-2-naphthoic acid + Hydrogen ion
Dihydroxyacetone phosphate + Iminoaspartic acid <>2 Water + Phosphate + Quinolinic acid
Water + Pyridoxine 5'-phosphate > Phosphate + Pyridoxine
6-Phosphonoglucono-D-lactone + Water <> 6-Phosphogluconic acid + Hydrogen ion
Fructose 6-phosphate + Water > D-Fructose + Phosphate
Glycerol 3-phosphate + Water > Glycerol + Phosphate
Water + Mannose 6-phosphate > D-Mannose + Phosphate
Water + D-Ribose-5-phosphate > Phosphate + Ribose
Glucose 6-phosphate + Water > D-Glucose + Phosphate
2 Hydrogen ion + Molybdate + Adenylated molybdopterin > Adenosine monophosphate + Copper + Water + Molybdopterin
2 Hydrogen ion + Adenylated molybdopterin + Tungstate > Adenosine monophosphate + Copper + Water + tungsten binding cofactor
Water + Pyruvic acid + Ubiquinone-8 > Acetic acid + Carbon dioxide + Ubiquinol-8
Adenosine triphosphate + core oligosaccharide lipid A + Water > ADP + Hydrogen ion + Phosphate + core oligosaccharide lipid A
Adenosine triphosphate + Water + cold adapted KDO(2)-lipid (A) > ADP + Hydrogen ion + Phosphate + cold adapted KDO(2)-lipid (A)
Adenosine triphosphate + Water + PA(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PA(16:0/16:0)
Adenosine triphosphate + Water + PE(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PE(14:0/14:0)
Adenosine triphosphate + Water + PG(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PG(16:0/16:0)
Adenosine triphosphate + Water + PG(16:1(9Z)/16:1(9Z)) > ADP + Hydrogen ion + Phosphate + PG(16:1(9Z)/16:1(9Z))
Adenosine triphosphate + Water + PG(18:1(11Z)/18:1(11Z)) > ADP + Hydrogen ion + Phosphate + PG(18:1(11Z)/18:1(11Z))
Adenosine triphosphate + Water + PG(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PG(14:0/14:0)
Adenosine triphosphate + Water + KDO2-Lipid A > ADP + Hydrogen ion + Phosphate + KDO2-Lipid A
Adenosine triphosphate + Water + KDO(2)-lipid IV(A) > ADP + Hydrogen ion + Phosphate + KDO(2)-lipid IV(A)
Adenosine triphosphate + Water + PG(12:0/12:0) > ADP + Hydrogen ion + Phosphate + PG(12:0/12:0)
Adenosine triphosphate + Water + PG(14:1(7Z)/14:1(7Z)) > ADP + Hydrogen ion + Phosphate + PG(14:1(7Z)/14:1(7Z))
Adenosine triphosphate + Water + PG(18:0/18:0) > ADP + Hydrogen ion + Phosphate + PG(18:0/18:0)
Adenosine triphosphate + Water + PGP(12:0/12:0) > ADP + Hydrogen ion + Phosphate + PGP(12:0/12:0)
Adenosine triphosphate + Water + PGP(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PGP(14:0/14:0)
Adenosine triphosphate + Water + PGP(14:1(7Z)/14:1(7Z)) > ADP + Hydrogen ion + Phosphate + PGP(14:1(7Z)/14:1(7Z))
Adenosine triphosphate + Water + PGP(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PGP(16:0/16:0)
Adenosine triphosphate + Water + PGP(16:1(9Z)/16:1(9Z)) > ADP + Hydrogen ion + Phosphate + PGP(16:1(9Z)/16:1(9Z))
Adenosine triphosphate + Water + PGP(18:0/18:0) > ADP + Hydrogen ion + Phosphate + PGP(18:0/18:0)
Adenosine triphosphate + Water + PGP(18:1(11Z)/18:1(11Z)) > ADP + Hydrogen ion + Phosphate + PGP(18:1(11Z)/18:1(11Z))
Adenosine triphosphate + Water + Nicotinic acid + Phosphoribosyl pyrophosphate > ADP + Nicotinamide ribotide + Phosphate + Pyrophosphate
FMNH + Oxygen + Sulfoacetate > Flavin Mononucleotide + Glyoxylic acid + Hydrogen ion + Water + Sulfite
FMNH + Isethionic acid + Oxygen > Flavin Mononucleotide + Glycolaldehyde + Hydrogen ion + Water + Sulfite
FMNH + Methanesulfonate + Oxygen > Formaldehyde + Flavin Mononucleotide + Hydrogen ion + Water + Sulfite
Butanesulfonate + FMNH + Oxygen > Butanal + Flavin Mononucleotide + Hydrogen ion + Water + Sulfite
Ethanesulfonate + FMNH + Oxygen > Acetaldehyde + Flavin Mononucleotide + Hydrogen ion + Water + Sulfite
Water + Hexadecanoyl-phosphate (n-C16:0) >2 Hydrogen ion + Palmitic acid + Phosphate
Water + Hexadecanoyl-phosphate (n-C16:1) >2 Hydrogen ion + Hexadecenoate (n-C16:1) + Phosphate
Water + Octadecanoyl-phosphate (n-C18:0) >2 Hydrogen ion + Octadecanoate (N-C18:0) + Phosphate
Water + Octadecanoyl-phosphate (n-C18:1) >2 Hydrogen ion + Octadecenoate (N-C18:1) + Phosphate
Water + Tetradecanoyl-phosphate (n-C14:0) >2 Hydrogen ion + Phosphate + tetradecanoate (n-C14:0)
Water + Tetradecanoyl-phosphate (n-C14:1) >2 Hydrogen ion + Phosphate + Tetradecenoate (N-C14:1)
Dodecanoly-phosphate (n-C12:0) + Water > Dodecanoate (N-C12:0) +2 Hydrogen ion + Phosphate
Guanosine triphosphate + Water > Guanosine diphosphate + Hydrogen ion + Phosphate
6 Water + Myo-inositol hexakisphosphate > Inositol +6 Phosphate
Glucose 1-phosphate + Water > D-Glucose + Phosphate
Galactose 1-phosphate + Water > D-Galactose + Phosphate
3-Aminoacrylate + Hydrogen ion + Water > Malonic semialdehyde + Ammonium
NADH + Peroxyaminoacrylate > 3-Aminoacrylate + Water + NAD
Water + Ureidoacrylate peracid > Carbamic acid + Hydrogen ion + Peroxyaminoacrylate
L-D-1-Pyrroline-5-carboxylic acid + 2 Water + NAD > L-Glutamate + Hydrogen ion + NADH
Water + Oxygen + Sarcosine > Formaldehyde + Glycine + Hydrogen peroxide
N-Methyltryptophan + Water + Oxygen > Formaldehyde + Hydrogen peroxide + L-Tryptophan
4,5-Dihydroorotic acid + Water <> Ureidosuccinic acid + Hydrogen ion
N-Acetyl-D-glucosamine(anhydrous)N-Acetylmuramic acid + Water > N-Acetyl-D-glucosamine + 1,6-Anhydro-N-acetylmuramate
N-Acetyl-D-glucosamine(anhydrous)N-Acetylmuramyl-tetrapeptide + Water > N-Acetyl-D-glucosamine + 1,6-Anhydrous-N-Acetylmuramyl-tetrapeptide
N-Acetyl-D-glucosamine(anhydrous)N-Acetylmuramyl-tripeptide + Water > N-Acetyl-D-glucosamine + 1,6-Anhydrous-N-Acetylmuramyl-tripeptide
Water + Thiamine pyrophosphate > Hydrogen ion + Phosphate + Thiamine monophosphate
D-Alanine + FAD + Water > FADH2 + Ammonium + Pyruvic acid
Water + UDP-N-acetylmuramoyl-L-alanyl-D-gamma-glutamyl-meso-2,6-diaminopimelate-D-alanine > D-Alanine + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate
1,6-Anhydrous-N-Acetylmuramyl-tetrapeptide + Water > D-Alanine + 1,6-Anhydrous-N-Acetylmuramyl-tripeptide
L-Alanine-D-glutamate-meso-2,6-diaminoheptanedioate-D-alanine + Water > L-alanine-D-glutamate-meso-2,6-diaminoheptanedioate + D-Alanine
N-Acetyl-D-glucosamine(anhydrous)N-Acetylmuramyl-tetrapeptide + Water > D-Alanine + N-Acetyl-D-glucosamine(anhydrous)N-Acetylmuramyl-tripeptide
Water + Trehalose >2 D-Glucose
D-Arabinose 5-phosphate + Water + Phosphoenolpyruvic acid <> 3-Deoxy-D-manno-octulosonate 8-phosphate + Phosphate
N10-Formyl-THF + Water <> Formic acid + Hydrogen ion + Tetrahydrofolic acid
1-(2-Carboxyphenylamino)-1'-deoxy-D-ribulose 5'-phosphate + Hydrogen ion <> Indoleglycerol phosphate + Carbon dioxide + Water
Guanosine triphosphate + 3 Water <> 2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Formic acid +2 Hydrogen ion + Pyrophosphate + 2,5-diamino-6-hydroxy-4-(5-phospho-D-ribosylamino)pyrimidine
Water + PA(16:0/16:0) > 1,2-Diacyl-sn-glycerol (didodecanoyl, n-C12:0) + Phosphate
Water + PA(16:0/16:0) > 1,2-Diacyl-sn-glycerol (dihexadec-9-enoyl, n-C16:1) + Phosphate
Water + PA(16:0/16:0) > 1,2-Diacyl-sn-glycerol (dihexadecanoyl, n-C16:0) + Phosphate
Water + PA(16:0/16:0) > 1,2-Diacyl-sn-glycerol (dioctadec-11-enoyl, n-C18:1) + Phosphate
Water + PA(16:0/16:0) > 1,2-Diacyl-sn-glycerol (dioctadecanoyl, n-C18:0) + Phosphate
Water + PA(16:0/16:0) > 1,2-Diacyl-sn-glycerol (ditetradec-7-enoyl, n-C14:1) + Phosphate
Water + PA(16:0/16:0) > 1,2-Diacyl-sn-glycerol (ditetradecanoyl, n-C14:0) + Phosphate
4-(Glutamylamino) butanoate + Water <> gamma-Aminobutyric acid + L-Glutamate
Acetaldehyde + Water + NAD > Acetic acid +2 Hydrogen ion + NADH
gamma-Glutamyl-gamma-butyraldehyde + Water + NADP <> 4-(Glutamylamino) butanoate +2 Hydrogen ion + NADPH
gamma-Glutamyl-L-putrescine + Water + Oxygen > gamma-Glutamyl-gamma-butyraldehyde + Hydrogen peroxide + Ammonium
L-alanine-D-glutamate-meso-2,6-diaminoheptanedioate + Water > Diaminopimelic acid + L-Alanyl-D-glutamate
Water + NAD + Phenylacetaldehyde <>2 Hydrogen ion + NADH + Benzeneacetic acid
Dopamine + Water + Oxygen > 3,4-Dihydroxyphenylacetaldehyde + Hydrogen peroxide + Ammonium
Water + Oxygen + Tyramine > 4-Hydroxyphenylacetaldehyde + Hydrogen peroxide + Ammonium
Water + Oxygen + Phenylethylamine > Hydrogen peroxide + Ammonium + Phenylacetaldehyde
2-Oxepin-2(3H)-ylideneacetyl-CoA + 2 Water + NADP > 3-Oxo-5,6-dehydrosuberyl-CoA +2 Hydrogen ion + NADPH
5-Carboxy-2-pentenoyl-CoA + Water <> (3S)-3-Hydroxyadipyl-CoA
Water + Lactaldehyde + NAD + (S)-Lactaldehyde <>2 Hydrogen ion + L-Lactic acid + NADH
Glycolaldehyde + Water + NAD > Glycolic acid +2 Hydrogen ion + NADH
4-Aminobutyraldehyde + Water + NAD <> gamma-Aminobutyric acid +2 Hydrogen ion + NADH
D-Alanyl-D-alanine + Water >2 D-Alanine
Cyclic AMP + Water > Adenosine monophosphate + Hydrogen ion
Cyclic GMP + Water > Guanosine monophosphate + Hydrogen ion
Water + NAD + Succinic acid semialdehyde >2 Hydrogen ion + NADH + Succinic acid
Adenosine + Hydrogen ion + Water > Inosine + Ammonium
Deoxyadenosine + Hydrogen ion + Water > Deoxyinosine + Ammonium
Water + Oxygen + Pyridoxamine 5'-phosphate > Hydrogen peroxide + Ammonium + Pyridoxal 5'-phosphate
1,6-Anhydro-N-acetylmuramate + Adenosine triphosphate + Water > N-Acetylmuramic acid 6-phosphate + ADP + Hydrogen ion
5-Amino-6-ribitylamino uracil + 3,4-Dihydroxy-2-butanone-4-P > 6,7-Dimethyl-8-(1-D-ribityl)lumazine +2 Water + Phosphate
3-Dehydroquinate <> 3-Dehydro-shikimate + Water
Adenosine triphosphate + Water + Pyruvic acid <> Adenosine monophosphate +2 Hydrogen ion + Phosphoenolpyruvic acid + Phosphate
2 Glutathione + Hydrogen peroxide <> Glutathione disulfide +2 Water
Diacetylchitobiose-6-phosphate + Water > N-Acetyl-D-glucosamine + N-Acetyl-D-Glucosamine 6-Phosphate
Water + N-Succinyl-L-glutamate <> L-Glutamate + Succinic acid
2 Hydrogen ion + 2 Water + N2-Succinyl-L-arginine > Carbon dioxide +2 Ammonium + N2-Succinyl-L-ornithine
Water + NAD + N2-Succinyl-L-glutamic acid 5-semialdehyde <>2 Hydrogen ion + NADH + N-Succinyl-L-glutamate
L-Glutamate + Water + NADP <> alpha-Ketoglutarate + Hydrogen ion + NADPH + Ammonium
Adenosine triphosphate + Water + Selenium > Adenosine monophosphate + Phosphate + Phosphoroselenoic acid
Water + Niacinamide > Nicotinic acid + Ammonium
6-Phosphogluconic acid <> 2-Keto-3-deoxy-6-phosphogluconic acid + Water
Water + Trehalose 6-phosphate > Phosphate + Trehalose
D-Cysteine + Water > Hydrogen sulfide + Ammonium + Pyruvic acid
Adenosine monophosphate + Water <> Adenine + D-Ribose-5-phosphate
Water + L-Histidinol + 2 NAD >3 Hydrogen ion + L-Histidine +2 NADH
Water + Histidinol phosphate <> L-Histidinol + Phosphate
D-Erythro-imidazole-glycerol-phosphate <> Water + Imidazole acetol-phosphate
Water + Phosphoribosyl-AMP <> PhosphoribosylformiminoAICAR-phosphate
Water + Phosphoribosyl-ATP <> Hydrogen ion + Pyrophosphate + Phosphoribosyl-AMP
Water + 2 NAD + UDP-Glucose <>3 Hydrogen ion +2 NADH + Uridine diphosphate glucuronic acid + UDP-Glucuronic acid
Guanosine diphosphate mannose + Water > Guanosine diphosphate + Hydrogen ion + D-Mannose
Guanosine diphosphate mannose <> GDP-4-Dehydro-6-deoxy-D-mannose + Water
dCTP + Hydrogen ion + Water > Deoxyuridine triphosphate + Ammonium
Deoxycytidine + Hydrogen ion + Water > Deoxyuridine + Ammonium
Cytidine + Hydrogen ion + Water > Ammonium + Uridine
Guanosine triphosphate + Water > Dihydroneopterin triphosphate + Formic acid + Hydrogen ion
Glycerophosphocholine + Water > Choline + Glycerol 3-phosphate + Hydrogen ion
Glycerylphosphorylethanolamine + Water > Ethanolamine + Glycerol 3-phosphate + Hydrogen ion
Glycerophosphoglycerol + Water > Glycerol + Glycerol 3-phosphate + Hydrogen ion
Glycerophosphoserine + Water > Glycerol 3-phosphate + Hydrogen ion + L-Serine
Sn-Glycero-3-phospho-1-inositol + Water > Glycerol 3-phosphate + Hydrogen ion + Inositol
Water + Undecaprenyl phosphate-4-amino-4-formyl-L-arabinose > Formic acid + undecaprenyl phosphate-4-amino-4-deoxy-L-arabinose
(1R,6R)-6-Hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate <> Water + 2-Succinylbenzoate
Hydrogen ion + 2-Succinylbenzoyl-CoA > 1,4-Dihydroxy-2-naphthoyl-CoA + Water
L-Glutamine + Water + Phosphoribosyl pyrophosphate <> L-Glutamate + Pyrophosphate + 5-Phosphoribosylamine
N-Acetylmuramic acid 6-phosphate + Water <> N-Acetyl-D-Glucosamine 6-Phosphate + D-Lactic acid
Coproporphyrin III + 2 Hydrogen ion + Oxygen <>2 Carbon dioxide +2 Water + Protoporphyrinogen IX
Guanosine diphosphate mannose + Water > Guanosine monophosphate +2 Hydrogen ion + D-Mannose 1-phosphate
Water + N-Succinyl-L,L-2,6-diaminopimelate <> Diaminopimelic acid + Succinic acid
L-Aspartate-semialdehyde + Pyruvic acid > 2,3-Dihydrodipicolinic acid + Hydrogen ion +2 Water
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid > Adenosine monophosphate + L-Glutamate + Guanosine monophosphate +2 Hydrogen ion + Pyrophosphate
Water + Inosinic acid + NAD <> Hydrogen ion + NADH + Xanthylic acid
Water + Myo-inositol 1-phosphate > Inositol + Phosphate
Glycerol 2-phosphate + Water > Glycerol + Phosphate
L-Serine + Tetrahydrofolic acid <> Glycine + Water + 5,10-Methylene-THF
Water + 5,10-Methenyltetrahydrofolate > N5-Formyl-H4F + Hydrogen ion
Adenosine triphosphate + 5'-Phosphoribosyl-N-formylglycineamide + L-Glutamine + Water <> ADP + Phosphoribosylformylglycineamidine + L-Glutamate + Hydrogen ion + Phosphate
Hydrogen ion + Prephenate > Carbon dioxide + Water + Phenylpyruvic acid
Dihydroneopterin triphosphate + Water > Acetaldehyde + 6-Carboxy-5,6,7,8-tetrahydropterin + Hydrogen ion + Triphosphate
2-Phospho-D-glyceric acid <> Water + Phosphoenolpyruvic acid
Adenosine triphosphate + L-Glutamine + Water + Uridine triphosphate > ADP + Cytidine triphosphate + L-Glutamate +2 Hydrogen ion + Phosphate
Water + Uridine triphosphate > Hydrogen ion + Pyrophosphate + Uridine 5'-monophosphate
Adenosine triphosphate + Water <> Adenosine monophosphate + Hydrogen ion + Pyrophosphate
2,3-diaminopropionate + Water >2 Ammonium + Pyruvic acid
Guanine + Hydrogen ion + Water > Ammonium + Xanthine
Arbutin 6-phosphate + Water > Glucose 6-phosphate + Hydroquinone
N5-Formyl-H4F + Hydrogen ion > Water + 5,10-Methenyltetrahydrofolate
Agmatine + Water <> Putrescine + Urea + Ethylenediamine
Adenosine triphosphate + Water + L-Methionine <> S-Adenosylmethionine + Phosphate + Pyrophosphate
Water + Inosine triphosphate > Hydrogen ion + Inosinic acid + Pyrophosphate
Water + Xanthosine 5-triphosphate > Hydrogen ion + Pyrophosphate + Xanthylic acid
2'-Deoxyinosine triphosphate + Water > DIMP + Hydrogen ion + Pyrophosphate
Glutathionylspermidine + Water <> Glutathione + Spermidine
D-Altronate <> 2-Keto-3-deoxy-D-gluconic acid + Water
Galactaric acid > 5-Dehydro-4-deoxy-D-glucarate + Water
Water + 3-Deoxy-D-manno-octulosonate 8-phosphate <> 3-Deoxy-D-manno-octulosonate + Phosphate
Fructoselysine-6-phosphate + Water <> Glucose 6-phosphate + L-Lysine
Phosphoglycolic acid + Water <> Glycolic acid + Phosphate + Glycolate
Adenosine triphosphate + Water + Iron > ADP + Iron + Hydrogen ion + Phosphate
Water + Pimeloyl-[acyl-carrier protein] methyl ester > Methanol + Pimeloyl-[acyl-carrier protein]
Glutathione + Water > Cysteinylglycine + L-Glutamate
Adenosine triphosphate + Water + Mercury > ADP + Hydrogen ion + Phosphate + Mercury
Adenosine triphosphate + Cobalt + Water > ADP + Hydrogen ion + Phosphate + Cobalt
Adenosine triphosphate + Cadmium + Water > ADP + Hydrogen ion + Phosphate + Cadmium
Arsenite + Adenosine triphosphate + Water > ADP + Hydrogen ion + Phosphate + Arsenite
D-Biotin D-sulfoxide + Hydrogen ion + NADH > Biotin + Water + NAD
D-Biotin D-sulfoxide + Hydrogen ion + NADPH > Biotin + Water + NADP
Water + NADP + Propanal >2 Hydrogen ion + NADPH + Propionic acid
Acetaldehyde + Water + NADP > Acetic acid +2 Hydrogen ion + NADPH
Water + Guanosine 3',5'-bis(diphosphate) <> Guanosine diphosphate + Pyrophosphate
Guanosine 3'-diphosphate 5'-triphosphate + Water > Guanosine triphosphate + Pyrophosphate
Adenine + Hydrogen ion + Water > Hypoxanthine + Ammonium
Water + L-Tryptophan <> Indole + Ammonium + Pyruvic acid
(R)-2,3-Dihydroxy-isovalerate > alpha-Ketoisovaleric acid + Water
(R) 2,3-Dihydroxy-3-methylvalerate > 3-Methyl-2-oxovaleric acid + Water
Guanosine 3'-diphosphate 5'-triphosphate + Water <> Hydrogen ion + Phosphate + Guanosine 3',5'-bis(diphosphate)
Water + 2 NAD + UDP-N-Acetyl-D-mannosamine <>3 Hydrogen ion +2 NADH + UDP-N-Acetyl-D-mannosaminouronate
Hydroxymethylbilane <> Water + Uroporphyrinogen III
Water + 4 Porphobilinogen > Hydroxymethylbilane +4 Ammonium
Water + PA(16:0/16:0) > 1-Dodecanoyl-sn-glycerol 3-phosphate + Dodecanoate (N-C12:0) + Hydrogen ion
Water + PA(16:0/16:0) > 1-Hexadec-9-enoyl-sn-glycerol 3-phosphate + Hydrogen ion + Hexadecenoate (n-C16:1)
Water + PA(16:0/16:0) > 1-hexadecanoyl-sn-glycerol 3-phosphate + Hydrogen ion + Palmitic acid
Water + PA(16:0/16:0) > 1-Octadec-11-enoyl-sn-glycerol 3-phosphate + Hydrogen ion + Octadecenoate (N-C18:1)
Water + PA(16:0/16:0) > 1-Octadecanoyl-sn-glycerol 3-phosphate + Hydrogen ion + Octadecanoate (N-C18:0)
Water + PA(16:0/16:0) > 1-Tetradec-7-enoyl-sn-glycerol 3-phosphate + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + PA(16:0/16:0) > 1-Tetradecanoyl-sn-glycerol 3-phosphate + Hydrogen ion + tetradecanoate (n-C14:0)
Water + PA(16:0/16:0) > 2-dodecanoyl-sn-glycerol 3-phosphate + Dodecanoate (N-C12:0)
Water + PA(16:0/16:0) > 2-hexadec-9-enoyl-sn-glycerol 3-phosphate + Hexadecenoate (n-C16:1)
Water + PA(16:0/16:0) > 2-hexadecanoyl-sn-glycerol 3-phosphate + Palmitic acid
Water + PA(16:0/16:0) > 2-octadec-11-enoyl-sn-glycerol 3-phosphate + Octadecenoate (N-C18:1)
Water + PA(16:0/16:0) > 2-octadecanoyl-sn-glycerol 3-phosphate + Octadecanoate (N-C18:0)
Water + PA(16:0/16:0) > 2-tetradec-7-enoyl-sn-glycerol 3-phosphate + Tetradecenoate (N-C14:1)
Water + PA(16:0/16:0) > 2-tetradecanoyl-sn-glycerol 3-phosphate + tetradecanoate (n-C14:0)
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C12:0) + Dodecanoate (N-C12:0) + Hydrogen ion
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:0) + Hydrogen ion + tetradecanoate (n-C14:0)
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:1) + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:0) + Hydrogen ion + Palmitic acid
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:1) + Hydrogen ion + Hexadecenoate (n-C16:1)
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:0) + Hydrogen ion + Octadecanoate (N-C18:0)
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:1) + Hydrogen ion + Octadecenoate (N-C18:1)
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C12:0) + Dodecanoate (N-C12:0) + Hydrogen ion
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:0) + Hydrogen ion + tetradecanoate (n-C14:0)
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:1) + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:0) + Hydrogen ion + Palmitic acid
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:1) + Hydrogen ion + Hexadecenoate (n-C16:1)
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:0) + Hydrogen ion + Octadecanoate (N-C18:0)
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:1) + Hydrogen ion + Octadecenoate (N-C18:1)
Water + PG(16:0/16:0) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C16:0) + Hydrogen ion + Palmitic acid
Water + PG(16:0/16:0) > 2-Acyl-sn-glycero-3-phosphoglycerol (N-C16:0) + Hydrogen ion + Palmitic acid
Water + PG(16:1(9Z)/16:1(9Z)) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C16:1) + Hydrogen ion + Hexadecenoate (n-C16:1)
Water + PG(16:1(9Z)/16:1(9Z)) > 2-Acyl-sn-glycero-3-phosphoglycerol (N-C16:1) + Hydrogen ion + Hexadecenoate (n-C16:1)
Water + PG(18:1(11Z)/18:1(11Z)) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C18:1) + Hydrogen ion + Octadecenoate (N-C18:1)
Water + PG(18:1(11Z)/18:1(11Z)) > 2-Acyl-sn-glycero-3-phosphoglycerol (N-C18:1) + Hydrogen ion + Octadecenoate (N-C18:1)
Water + PG(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C14:0) + Hydrogen ion + tetradecanoate (n-C14:0)
Water + PG(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoglycerol (N-C14:0) + Hydrogen ion + tetradecanoate (n-C14:0)
Water + PG(12:0/12:0) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C12:0) + Dodecanoate (N-C12:0) + Hydrogen ion
Water + PG(12:0/12:0) > 2-Acyl-sn-glycero-3-phosphoglycerol (n-C12:0) + Dodecanoate (N-C12:0) + Hydrogen ion
Water + PG(14:1(7Z)/14:1(7Z)) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C14:1) + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + PG(14:1(7Z)/14:1(7Z)) > 2-Acyl-sn-glycero-3-phosphoglycerol (N-C14:1) + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + PG(18:0/18:0) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C18:0) + Hydrogen ion + Octadecanoate (N-C18:0)
Water + PG(18:0/18:0) > 2-Acyl-sn-glycero-3-phosphoglycerol (N-C18:0) + Hydrogen ion + Octadecanoate (N-C18:0)
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C12:0) + Water > Dodecanoate (N-C12:0) + Glycerylphosphorylethanolamine + Hydrogen ion
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:0) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + tetradecanoate (n-C14:0)
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:1) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Tetradecenoate (N-C14:1)
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:0) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Palmitic acid
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:1) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Hexadecenoate (n-C16:1)
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:0) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Octadecanoate (N-C18:0)
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:1) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Octadecenoate (N-C18:1)
2-Acyl-sn-glycero-3-phosphoglycerol (n-C12:0) + Water > Dodecanoate (N-C12:0) + Glycerophosphoglycerol + Hydrogen ion
2-Acyl-sn-glycero-3-phosphoglycerol (N-C14:0) + Water > Glycerophosphoglycerol + Hydrogen ion + tetradecanoate (n-C14:0)
2-Acyl-sn-glycero-3-phosphoglycerol (N-C14:1) + Water > Glycerophosphoglycerol + Hydrogen ion + Tetradecenoate (N-C14:1)
2-Acyl-sn-glycero-3-phosphoglycerol (N-C16:0) + Water > Glycerophosphoglycerol + Hydrogen ion + Palmitic acid
2-Acyl-sn-glycero-3-phosphoglycerol (N-C16:1) + Water > Glycerophosphoglycerol + Hydrogen ion + Hexadecenoate (n-C16:1)
2-Acyl-sn-glycero-3-phosphoglycerol (N-C18:0) + Water > Glycerophosphoglycerol + Hydrogen ion + Octadecanoate (N-C18:0)
2-Acyl-sn-glycero-3-phosphoglycerol (N-C18:1) + Water > Glycerophosphoglycerol + Hydrogen ion + Octadecenoate (N-C18:1)
2-dodecanoyl-sn-glycerol 3-phosphate + Water > Dodecanoate (N-C12:0) + Glycerol 3-phosphate +2 Hydrogen ion
2-hexadec-9-enoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate +2 Hydrogen ion + Hexadecenoate (n-C16:1)
2-hexadecanoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate +2 Hydrogen ion + Palmitic acid
2-octadec-11-enoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate +2 Hydrogen ion + Octadecenoate (N-C18:1)
2-octadecanoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate +2 Hydrogen ion + Octadecanoate (N-C18:0)
2-tetradec-7-enoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate +2 Hydrogen ion + Tetradecenoate (N-C14:1)
2-tetradecanoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate +2 Hydrogen ion + tetradecanoate (n-C14:0)
Oxygen + Protoporphyrinogen IX >3 Water + Protoporphyrin IX
CDP-1,2-didodecanoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
CDP-1,2-dihexadec-9-enoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
CDP-1,2-dihexadecanoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
CDP-1,2-dioctadec-11-enoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
CDP-1,2-Dioctadecanoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
CDP-1,2-ditetradec-7-enoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
CDP-1,2-ditetradecanoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
Carbon dioxide + Water + Phosphoenolpyruvic acid <> Hydrogen ion + Oxalacetic acid + Phosphate + Hydrogen carbonate
N-Acetylornithine + Water <> Acetic acid + Ornithine + L-Ornithine
N-Acetyl-L-glutamate 5-semialdehyde + Water > Acetic acid + L-Glutamic-gamma-semialdehyde
5-Aminoimidazole ribonucleotide + Water + NAD > 4-Amino-2-methyl-5-phosphomethylpyrimidine +2 Formic acid +3 Hydrogen ion + NADH
Water + Inosinic acid <> Phosphoribosyl formamidocarboxamide
Water + Phosphoserine > Phosphate + L-Serine
Water + L-Threonine O-3-phosphate > Phosphate + L-Threonine
Water + Phosphotyrosine > Phosphate + L-Tyrosine
Water + Melibiose > D-Galactose + D-Glucose
D-tartrate > Water + Oxalacetic acid
Cytidine triphosphate + Water > CDP + Hydrogen ion + Phosphate
L-Ascorbate 6-phosphate + Water > 3-Dehydro-L-gulonate 6-phosphate + Hydrogen ion
3'-AMP + Water > Adenosine + Phosphate
Adenosine 2',3'-cyclic phosphate + Water > 3'-AMP + Hydrogen ion
Guanosine 2',3'-cyclic phosphate + Water > Guanosine 3'-phosphate + Hydrogen ion
2',3'-Cyclic UMP + Water > 3'-UMP + Hydrogen ion
3'-CMP + Water > Cytidine + Phosphate
3'-UMP + Water > Phosphate + Uridine
Guanosine 3'-phosphate + Water > Guanosine + Phosphate
2',3'-Cyclic CMP + Water > 3'-CMP + Hydrogen ion
Water + Adenosine 3',5'-diphosphate > Adenosine monophosphate + Phosphate
Water + Trehalose 6-phosphate > Glucose 6-phosphate + D-Glucose
Adenosine triphosphate + Water + Magnesium > ADP + Hydrogen ion + Magnesium + Phosphate
D-Mannonate <> 2-Keto-3-deoxy-D-gluconic acid + Water
Water + Xanthosine 5-triphosphate > Hydrogen ion + Phosphate + XDP
2'-Deoxyinosine triphosphate + Water > DIDP + Hydrogen ion + Phosphate
Galactonic acid <> 2-Dehydro-3-deoxy-D-galactonate + Water
Water + (2R,4S)-2-Methyl-2,4-dihydroxydihydrofuran-3-one > (2R,4S)-2-Methyl-2,3,3,4-tetrahydroxytetrahydrofuran
Adenosine triphosphate + Hydrogen ion + Water > Inosine triphosphate + Ammonium
Guanosine triphosphate + Hydrogen ion + Water > Ammonium + Xanthosine 5-triphosphate
L-Glutamic-gamma-semialdehyde > L-D-1-Pyrroline-5-carboxylic acid + Hydrogen ion + Water
dATP + Hydrogen ion + Water > 2'-Deoxyinosine triphosphate + Ammonium
Hydrogen peroxide + L-Methionine > Water + Methionine sulfoxide
2 [4Fe-4S] iron-sulfur cluster + 2 Hydrogen ion + Hydrogen peroxide >2 [3Fe-4S] damaged iron-sulfur cluster +2 Fe3+ +2 Water
2 [4Fe-4S] iron-sulfur cluster + 2 Hydrogen ion + 2 Nitric oxide >2 [3Fe-4S] damaged iron-sulfur cluster +2 Fe3+ + Water + Nitrous oxide
Trehalose + Water <>2 D-Glucose
Chitobiose + Water <>2 N-Acetyl-D-glucosamine
Cellobiose + Water <>2 b-D-Glucose
D-Maltose + Water <>2 alpha-D-Glucose
2 5-Aminolevulinic acid <> Porphobilinogen +2 Water
Oxygen + 4 Fe2+ + 4 Hydrogen ion + 4 Fe2+ <>4 Fe3+ +2 Water
4 Porphobilinogen + Water <> Hydroxymethylbilane +4 Ammonia
Adenosine triphosphate + Water <> ADP + Phosphate
Adenosine triphosphate + Water <> Adenosine monophosphate + Pyrophosphate
NAD + 2 Cob(II)alamin + 2 Water + Hydrogen ion <> NADH +2 Aquacobalamin
NAD + Water <> Adenosine monophosphate + Nicotinamide ribotide
NADP + Water <> Phosphate + NAD
Diadenosine tetraphosphate + Water <>2 ADP
Carbonic acid <> Carbon dioxide + Water
Phosphate + Pyrophosphate + S-Adenosylmethionine <> Adenosine triphosphate + L-Methionine + Water
Adenosine monophosphate + Water <> Adenosine + Phosphate
Adenosine triphosphate + Pyruvic acid + Water <> Adenosine monophosphate + Phosphoenolpyruvic acid + Phosphate
Pyruvaldehyde + NAD + Water <> Pyruvic acid + NADH + Hydrogen ion
L-Glutamate + NAD + Water <> alpha-Ketoglutarate + Ammonia + NADH + Hydrogen ion
L-Glutamic-gamma-semialdehyde + NAD + Water <> L-Glutamate + NADH + Hydrogen ion
L-Glutamate + NADP + Water <> alpha-Ketoglutarate + Ammonia + NADPH + Hydrogen ion
L-Glutamine + Water <> L-Glutamate + Ammonia
Pyridoxamine 5'-phosphate + Water + Oxygen <> Pyridoxal 5'-phosphate + Ammonia + Hydrogen peroxide
UDP-Glucose + Water + 2 NAD <> Uridine diphosphate glucuronic acid +2 NADH +2 Hydrogen ion
UDP-Glucose + Water <> Uridine 5'-monophosphate + Glucose 1-phosphate
Acetylphosphate + Water <> Acetic acid + Phosphate
Phosphonoacetate + Water <> Acetic acid + Phosphate
Phosphate + Oxalacetic acid <> Water + Phosphoenolpyruvic acid + Carbon dioxide
Citric acid + Coenzyme A <> Acetyl-CoA + Water + Oxalacetic acid
L-Aspartic acid + Water + Oxygen <> Oxalacetic acid + Ammonia + Hydrogen peroxide
Uridine diphosphate-N-acetylglucosamine + Water <> N-Acetylmannosamine + Uridine 5'-diphosphate
Guanosine triphosphate + 3 Water <> Formic acid + 2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Pyrophosphate
Guanosine triphosphate + Water <> Guanosine monophosphate + Pyrophosphate
Guanosine triphosphate + Water <> Formamidopyrimidine nucleoside triphosphate
(S)-Ureidoglycolic acid + Water <> Glyoxylic acid +2 Ammonia + Carbon dioxide
L-Malic acid + Coenzyme A <> Acetyl-CoA + Water + Glyoxylic acid
L-Asparagine + Water <> L-Aspartic acid + Ammonia
Glutathione + Water <> Cysteinylglycine + L-Glutamate
Phosphoadenosine phosphosulfate + Water <> Adenosine phosphosulfate + Phosphate
Cytidine monophosphate + Water <> Cytidine + Phosphate
Cytidine triphosphate + Water <> Cytidine monophosphate + Pyrophosphate
S-Formylglutathione + Water <> Formic acid + Glutathione
Flavin Mononucleotide + Water <> Riboflavin + Phosphate
Cytidine triphosphate + Water <> Uridine triphosphate + Ammonia
Adenosine triphosphate + Uridine triphosphate + L-Glutamine + Water <> ADP + Phosphate + Cytidine triphosphate + L-Glutamate
2 Adenosine triphosphate + L-Glutamine + Hydrogen carbonate + Water <>2 ADP + Phosphate + L-Glutamate + Carbamoylphosphate
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water <> Adenosine monophosphate + Pyrophosphate + L-Asparagine + L-Glutamate
Phosphoserine + Water <> L-Serine + Phosphate
L-Serine <> 2-Aminoacrylic acid + Water
Methanol + Hydrogen peroxide <> Formaldehyde +2 Water
Uridine triphosphate + Water <> Uridine 5'-monophosphate + Pyrophosphate
N-Acetylornithine + Water <> Acetic acid + Ornithine
L-Tryptophan + Water <> Indole + Pyruvic acid + Ammonia
L-Serine + Indole <> L-Tryptophan + Water
L-Arogenate <> L-Phenylalanine + Water + Carbon dioxide
L-D-1-Pyrroline-5-carboxylic acid + NAD + 2 Water <> L-Glutamate + NADH + Hydrogen ion
L-D-1-Pyrroline-5-carboxylic acid + NADP + 2 Water <> L-Glutamate + NADPH + Hydrogen ion
Succinic acid semialdehyde + NAD + Water <> Succinic acid + NADH + Hydrogen ion
Succinic acid semialdehyde + NADP + Water <> Succinic acid + NADPH + Hydrogen ion
Inosine triphosphate + Water <> Inosinic acid + Pyrophosphate
Glucosamine 6-phosphate + Water <> Fructose 6-phosphate + Ammonia
L-Cysteine + Water <> Hydrogen sulfide + Pyruvic acid + Ammonia
Ammonium hydroxide + 3 NAD + Water + Ammonia <> Nitrite +3 NADH +3 Hydrogen ion
Ammonium hydroxide + 3 NADP + Water <> Nitrite +3 NADPH +3 Hydrogen ion
Nitrite + Acceptor + Water + Acceptor <> Nitrate + Reduced acceptor + Reduced acceptor
Sucrose + Water <> D-Fructose + D-Glucose
Sucrose + Water <> beta-D-Fructose + alpha-D-Glucose
Sugar phosphate + Water + Sugar phosphate <> Sugar + Phosphate + Sugar
Water + Trehalose 6-phosphate <> D-Glucose + D-Hexose 6-phosphate
Hydrogen sulfide + 3 NADP + 3 Water <> Sulfite +3 NADPH +3 Hydrogen ion
beta-D-Fructose 2-phosphate + Water <> D-Fructose + Phosphate
Cysteinylglycine + Water <> L-Cysteine + Glycine
Methylcitric acid + Coenzyme A <> Propionyl-CoA + Oxalacetic acid + Water
N10-Formyl-THF + Water <> Formic acid + Tetrahydrofolic acid
5,10-Methylene-THF + Glycine + Water <> Tetrahydrofolic acid + L-Serine
Glucose 1-phosphate + Water <> alpha-D-Glucose + Phosphate
Uridine 5'-monophosphate + Water <> Uridine + Phosphate
Cytosine + Water <> Uracil + Ammonia
Chorismate + Ammonia <> 2-Aminobenzoic acid + Pyruvic acid + Water
O-Succinyl-L-homoserine + Water <> 2-Ketobutyric acid + Succinic acid + Ammonia
Glycerophosphocholine + Water <> Choline + Glycerol 3-phosphate
Adenosine diphosphate ribose + Water <> Adenosine monophosphate + D-Ribose-5-phosphate
5-Phosphoribosylamine + Pyrophosphate + L-Glutamate <> L-Glutamine + Phosphoribosyl pyrophosphate + Water
L-Malic acid <> Fumaric acid + Water
Melibiose + Water <> D-Galactose + D-Glucose
Raffinose + Water <> D-Galactose + Sucrose
Galactosylglycerol + Water <> D-Galactose + Glycerol
Galactan + Water <> D-Galactose + Galactan
2 Ferricytochrome c + Nitrite + Water <> Nitrate +2 Ferrocytochrome c +2 Hydrogen ion
Inosinic acid + Water <> Inosine + Phosphate
Agmatine + Water <> Putrescine + Urea
L-Histidinal + Water + NAD <> L-Histidine + NADH + Hydrogen ion
Myo-inositol 1-phosphate + Water <> Inositol + Phosphate
D-Myo-inositol 4-phosphate + Water <> Inositol + Phosphate
1D-myo-Inositol 3-phosphate + Water <> Inositol + Phosphate
Galactinol + Water <> Inositol + D-Galactose
Chitin + Water <> N-Acetyl-D-glucosamine + Chitin
2,3-Dihydroxyisovaleric acid <> alpha-Ketoisovaleric acid + Water + a-Ketoisovaleric acid
2-Isopropylmalic acid + Coenzyme A <> Acetyl-CoA + alpha-Ketoisovaleric acid + Water
5,10-Methylene-THF + alpha-Ketoisovaleric acid + Water <> Tetrahydrofolic acid + 2-Dehydropantoate
Guanosine monophosphate + Water <> Guanosine + Phosphate
Adenosine triphosphate + Xanthylic acid + L-Glutamine + Water <> Adenosine monophosphate + Pyrophosphate + Guanosine monophosphate + L-Glutamate
Adenine + Water <> Hypoxanthine + Ammonia
Adenosine + Water <> Adenine + Ribose
Niacinamide + Water <> Nicotinic acid + Ammonia
Cystathionine + Water <> L-Homocysteine + Ammonia + Pyruvic acid
L-Cystathionine + Water <> L-Homocysteine + Ammonia + Pyruvic acid
Phosphatidylcholine + Water <> 2-Acyl-sn-glycero-3-phosphocholine + Fatty acid
Epimelibiose + Water <> D-Mannose + D-Galactose
Glycolaldehyde + NAD + Water <> Glycolic acid + NADH + Hydrogen ion
Phosphoglycolic acid + Water <> Glycolic acid + Phosphate
alpha-Amino acid + Water + Acceptor <> 2-Oxo acid + Ammonia + Reduced acceptor
Prephenate <> Phenylpyruvic acid + Water + Carbon dioxide
D-Phenylalanine + Water + Acceptor <> Phenylpyruvic acid + Ammonia + Reduced acceptor
5'-Methylthioadenosine + Water <> Adenine + 5-Methylthioribose
5-Methylcytosine + Water <> Thymine + Ammonia
Benzoyl phosphate + Water <> Benzoic acid + Phosphate
D-Xylose + 1,4-beta-D-Xylan <> 1,4-beta-D-Xylan + Water
Lactaldehyde + NAD + Water <> L-Lactic acid + NADH + Hydrogen ion
Glycerylphosphorylethanolamine + Water <> Ethanolamine + Glycerol 3-phosphate
Water + beta-D-Glucuronoside + beta-D-Glucuronoside <> D-Glucuronic acid + Alcohol + Alcohol
Glyceric acid 1,3-biphosphate + Water <> 3-Phospho-D-glycerate + Phosphate
Adenosine + Water <> Inosine + Ammonia
5-Thymidylic acid + Water <> Thymidine + Phosphate
D-Glutamine + Water <> D-Glutamic acid + Ammonia
Acyl-carrier protein + Water + Acyl-carrier protein <> Pantetheine 4'-phosphate + Apo-[acyl-carrier-protein]
dCMP + Water <> Deoxycytidine + Phosphate
Guanine + Water <> Xanthine + Ammonia
Guanosine + Water <> Guanine + Ribose
alpha-Lactose + Water <> alpha-D-Glucose + D-Galactose
Pyridoxamine + Water + Oxygen <> Pyridoxal + Ammonia + Hydrogen peroxide
Nicotinamide ribotide + Pyrophosphate + Adenosine triphosphate + Water <> Nicotinic acid + Phosphoribosyl pyrophosphate + ADP + Phosphate
S-Lactoylglutathione + Water <> Glutathione + D-Lactic acid
Hypoxanthine + NAD + Water <> Xanthine + NADH + Hydrogen ion
Inosine + Water <> Hypoxanthine + Ribose
CDP-diacylglycerol + Water <> Cytidine monophosphate + PA(16:0/16:0)
D-Erythrose 4-phosphate + NAD + Water <> 4-Phospho-D-erythronate + NADH + Hydrogen ion
dGTP + Water <> 2'-Deoxyguanosine 5'-monophosphate + Pyrophosphate
D-Cysteine + Water <> Hydrogen sulfide + Ammonia + Pyruvic acid
Cytidine + Water <> Uridine + Ammonia
Isocitric acid <> cis-Aconitic acid + Water
2'-Deoxyguanosine 5'-monophosphate + Water <> Deoxyguanosine + Phosphate
4,5-Dihydroorotic acid + Water <> Ureidosuccinic acid
dATP + Thioredoxin disulfide + Water <> Adenosine triphosphate + Thioredoxin
dADP + Thioredoxin disulfide + Water <> Thioredoxin + ADP
dUDP + Thioredoxin disulfide + Water <> Thioredoxin + Uridine 5'-diphosphate
dGDP + Thioredoxin disulfide + Water <> Guanosine diphosphate + Thioredoxin
dGTP + Thioredoxin disulfide + Water <> Guanosine triphosphate + Thioredoxin
dCTP + Thioredoxin disulfide + Water <> Cytidine triphosphate + Thioredoxin
Deoxyuridine triphosphate + Thioredoxin disulfide + Water <> Uridine triphosphate + Thioredoxin
dCDP + Thioredoxin disulfide + Water <> Thioredoxin + CDP
Phosphatidylglycerophosphate + Water <> Phosphatidylglycerol + Phosphate + PG(16:0/16:0)
6-Phosphonoglucono-D-lactone + Water <> 6-Phosphogluconic acid
PE(14:0/14:0) + Water <> 2-Acyl-sn-glycero-3-phosphoethanolamine + Fatty acid
Deoxyadenosine monophosphate + Water <> Deoxyadenosine + Phosphate
Deoxyuridine triphosphate + Water <> dUMP + Pyrophosphate
Starch + Water <> Dextrin + Starch
Cytidine + Water <> Cytosine + Ribose
Dihydrouracil + Water <> Ureidopropionic acid
L-Aspartate-semialdehyde + Pyruvic acid <> 2,3-Dihydrodipicolinic acid +2 Water
N5-Formyl-H4F <> 5,10-Methenyltetrahydrofolate + Water
Nicotinamide ribotide + Water <> Nicotinamide riboside + Phosphate
dCTP + Water <> Deoxyuridine triphosphate + Ammonia
Chitin + Water <> N-Acetyl-D-glucosaminide + Chitin
L-Lyxose + Water <> Methanol + Pectic acid
Tyramine + Water + Oxygen <> 4-Hydroxyphenylacetaldehyde + Ammonia + Hydrogen peroxide
L-Cystine + Water <> Pyruvic acid + Ammonia + Thiocysteine
Allantoic acid + Water <> Ureidoglycine + Ammonia + Carbon dioxide
(S)(+)-Allantoin + Water <> Allantoic acid
Deoxycytidine + Water <> Deoxyuridine + Ammonia
Aminoacetone + Water + Oxygen <> Pyruvaldehyde + Ammonia + Hydrogen peroxide
Phenylacetaldehyde + NAD + Water <> Benzeneacetic acid + NADH + Hydrogen ion
4-Aminobutyraldehyde + NAD + Water <> gamma-Aminobutyric acid + NADH + Hydrogen ion
Deoxyadenosine + Water <> Deoxyinosine + Ammonia
Betaine aldehyde + NADP + Water <> Betaine + NADPH +2 Hydrogen ion
2-Hydroxy-2,4-pentadienoate + Succinic acid <> 2-Hydroxy-6-ketononadienedicarboxylate + Water
Phenylethylamine + Oxygen + Water <> Phenylacetaldehyde + Ammonia + Hydrogen peroxide
N-Acetylmannosamine + Phosphate <> N-Acetyl-D-mannosamine 6-phosphate + Water
Xanthylic acid + Water <> Xanthosine + Phosphate
Xanthosine 5-triphosphate + Water <> Xanthylic acid + Pyrophosphate
L-Serine + Indoleglycerol phosphate <> L-Tryptophan + D-Glyceraldehyde 3-phosphate + Water
D-Glucarate + Glucaric acid <> 5-Dehydro-4-deoxy-D-glucarate + Water
Trehalose 6-phosphate + Water <> Trehalose + Phosphate
Cellulose + Water <> Cellulose + Cellobiose
Cellulose + Water <> Cellulose + b-D-Glucose
Creatinine + Water <> N-Methylhydantoin + Ammonia
Melibiitol + Water <> Sorbitol + D-Galactose
Nicotinic acid adenine dinucleotide + Water <> Adenosine monophosphate + Nicotinamide ribotide
Nitrophenylphosphate + Water <> 4-Nitrophenol + Phosphate
(S)-3-Hydroxybutanoyl-CoA <> Crotonoyl-CoA + Water
3-Hydroxypropionyl-CoA <> Acrylyl-CoA + Water
Dihydrothymine + Water <> Ureidoisobutyric acid
6-Hydroxymethyl dihydropterin + p-Aminobenzoic acid <> 7,8-Dihydropteroic acid + Water
1,3-Diaminopropane + Oxygen + Water <> 3-Aminopropionaldehyde + Ammonia + Hydrogen peroxide
Pyruvic acid + Ubiquinone-1 + Water <> Acetic acid + Ubiquinol-8 + Carbon dioxide
Coproporphyrin III + Oxygen <> Protoporphyrinogen IX +2 Carbon dioxide +2 Water
3-Deoxy-D-manno-octulosonate 8-phosphate + Phosphate <> Phosphoenolpyruvic acid + D-Arabinose 5-phosphate + Water
UDP-N-Acetyl-D-mannosamine + 2 NAD + Water <> UDP-N-Acetyl-D-mannosaminouronate +2 NADH +2 Hydrogen ion
Nicotinamide ribotide + Water <> Nicotinate D-ribonucleoside + Phosphate
beta-D-Galactosyl-1,4-beta-D-glucosylceramide + Water <> Glucosylceramide + D-Galactose
Myo-inositol hexakisphosphate + Water <> 1-Myo-inositol 1,2,3,4,5-pentakisphosphate + Phosphate
Guanosine 3'-diphosphate 5'-triphosphate + Water <> Guanosine 3',5'-bis(diphosphate) + Phosphate
2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Water + 2,5-diamino-6-hydroxy-4-(5-phospho-D-ribosylamino)pyrimidine <> 5-Amino-6-(5'-phosphoribosylamino)uracil + Ammonia
1-(2-Carboxyphenylamino)-1'-deoxy-D-ribulose 5'-phosphate <> Indoleglycerol phosphate + Carbon dioxide + Water
D-Glucoside + Water <> ROH + alpha-D-Glucose
2'-Deoxyinosine triphosphate + Water <> DIMP + Pyrophosphate
Adenosine 2',3'-cyclic phosphate + Water <> 3'-AMP
2',3'-Cyclic UMP + Water <> 3'-UMP
Adenosine triphosphate + Hydrogen selenide + Water <> Adenosine monophosphate + Phosphoroselenoic acid + Phosphate
Hydrogen selenide + 3 NADP + 3 Water <> Selenite +3 NADPH +5 Hydrogen ion
Stachyose + Water <> Raffinose + D-Galactose
L-Rhamnonate + L-Rhamnonate <> 2-Dehydro-3-deoxy-L-rhamnonate + Water
Cis-4-Carboxymethylenebut-2-en-4-olide + Water <> 2-Maleylacetate
(R)-2-Methylmalate <> Citraconic acid + Water
Citraconic acid + Water <> D-Erythro-3-Methylmalate
R-S-Glutathione + Water <> R-S-Cysteinylglycine + L-Glutamate
2',3'-Cyclic CMP + Water <> 3'-CMP
2-Isopropylmalic acid <> Isopropylmaleate + Water
3-Cyano-L-alanine + L-Glutamate <> gamma-Glutamyl-beta-cyanoalanine + Water
beta-Aminopropionitrile + L-Glutamate <> gamma-Glutamyl-beta-aminopropiononitrile + Water
Estrone 3-sulfate + Water <> Sulfate + Estrone
Digalactosylceramide + Water <> Galactosylceramide + D-Galactose
2-Succinylbenzoate + Water <> (1R,6R)-6-Hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate
PS(16:0/16:0) + Water <> 2-Acyl-sn-glycero-3-phosphoserine + Fatty acid
Phosphoribosyl-ATP + Water <> Phosphoribosyl-AMP + Pyrophosphate
N-Acetylmuramoyl-Ala + Water <> N-Acetyl-D-muramoate + L-Alanine
3-Hydroxyisovaleryl-CoA <> 3-Methylcrotonyl-CoA + Water
N2-Succinyl-L-arginine + 2 Water <> N2-Succinyl-L-ornithine + Carbon dioxide +2 Ammonia
2-Methyl-3-hydroxybutyryl-CoA <> Tiglyl-CoA + Water
Methacrylyl-CoA + Water <> (S)-3-Hydroxyisobutyryl-CoA
Quinolinic acid + 2 Water + Phosphate <> Iminoaspartic acid + Dihydroxyacetone phosphate
Dopamine + Water + Oxygen <> 3,4-Dihydroxyphenylacetaldehyde + Ammonia + Hydrogen peroxide
Glycineamideribotide + 5,10-Methenyltetrahydrofolate + Water <> 5'-Phosphoribosyl-N-formylglycineamide + Tetrahydrofolic acid
Methylcitric acid <> Cis-2-Methylaconitate + Water
Methylisocitric acid <> Cis-2-Methylaconitate + Water
(3R)-3-Hydroxybutanoyl-[acyl-carrier protein] <> But-2-enoyl-[acyl-carrier protein] + Water
(R)-2,3-Dihydroxy-isovalerate <> alpha-Ketoisovaleric acid + Water
Pyrroline hydroxycarboxylic acid + NAD + 2 Water <> L-erythro-4-Hydroxyglutamate + NADH + Hydrogen ion
Pyrroline hydroxycarboxylic acid + NADP + 2 Water <> L-erythro-4-Hydroxyglutamate + NADPH + Hydrogen ion
5-Amino-6-ribitylamino uracil + 3,4-Dihydroxy-2-butanone-4-P <> 6,7-Dimethyl-8-(1-D-ribityl)lumazine +2 Water + Phosphate
Adenosine triphosphate + 5'-Phosphoribosyl-N-formylglycineamide + L-Glutamine + Water <> ADP + Phosphate + Phosphoribosylformylglycineamidine + L-Glutamate
Digalactosyl-diacylglycerol + Water <> 1,2-Diacyl-3-beta-D-galactosyl-sn-glycerol + D-Galactose
(3R)-3-Hydroxydecanoyl-[acyl-carrier protein] <> trans-Dec-2-enoyl-[acp] + Water
(3R)-3-Hydroxyoctanoyl-[acyl-carrier protein] <> trans-Oct-2-enoyl-[acp] + Water
(3R)-3-Hydroxypalmitoyl-[acyl-carrier protein] <> trans-Hexadec-2-enoyl-[acp] + Water
UDP-2,3-Bis(3-hydroxytetradecanoyl)glucosamine + Water <> Uridine 5'-monophosphate + 2,3-Bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl 1-phosphate
(3R)-3-Hydroxytetradecanoyl-[acyl-carrier protein] <> trans-Tetradec-2-enoyl-[acp] + Water
N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole + Water <> N1-(alpha-D-ribosyl)-5,6-dimethyl-benzimidazole + Phosphate
Dihydroneopterin triphosphate + 3 Water <> 7,8-Dihydroneopterin +3 Phosphate
Dihydroneopterin triphosphate + Water <> 2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine
Adenosine triphosphate + Selenomethionine + Water <> Phosphate + Pyrophosphate + Se-Adenosylselenomethionine
beta-D-Fructose 1,6-bisphosphate + Water <> beta-D-Fructose 6-phosphate + Phosphate
4-Carboxy-4-hydroxy-2-oxoadipate <> 4-Carboxy-2-oxo-3-hexenedioate + Water
3-Ketolactose + Water <> 3-Keto-beta-D-galactose + b-D-Glucose
Sulfatide + Water <> Galactosylceramide + Sulfate
Selenocystathionine + Water <> Selenohomocysteine + Ammonia + Pyruvic acid
Cyanoglycoside + Water <> Cyanohydrin + D-Glucose
R-S-Cysteinylglycine + Water <> S-Substituted L-cysteine + Glycine
(R)-3-Hydroxyhexanoyl-[acp] <> trans-Hex-2-enoyl-[acp] + Water
(R)-3-Hydroxydodecanoyl-[acp] <> trans-Dodec-2-enoyl-[acp] + Water
Bilirubin diglucuronide + 2 Water + 3 Reduced acceptor <> D-Urobilinogen +2 D-Glucuronic acid +3 Acceptor
2-Octaprenylphenol + Oxygen + NADPH + Hydrogen ion <> 2-Octaprenyl-6-hydroxyphenol + NADP + Water
2-Octaprenyl-6-methoxyphenol + Oxygen + NADPH <> 2-octaprenyl-6-methoxy-1,4-benzoquinone + NADP + Water
cis-beta-D-Glucosyl-2-hydroxycinnamate + Water <> cis-2-Hydroxycinnamate + D-Glucose
Formamidopyrimidine nucleoside triphosphate + Water <> 2,5-Diaminopyrimidine nucleoside triphosphate + Formic acid
N2-Succinyl-L-glutamic acid 5-semialdehyde + NAD + Water <> N-Succinyl-L-glutamate + NADH + Hydrogen ion
L-erythro-4-Hydroxyglutamate + NADH + Hydrogen ion <> L-4-Hydroxyglutamate semialdehyde + NAD + Water
(R) 2,3-Dihydroxy-3-methylvalerate <> 3-Methyl-2-oxovaleric acid + Water
O-Phospho-4-hydroxy-L-threonine + Water <> 4-Hydroxy-L-threonine + Phosphate
Arbutin 6-phosphate + Water <> Hydroquinone + beta-D-Glucose 6-phosphate
Salicin 6-phosphate + Water <> Salicyl alcohol + beta-D-Glucose 6-phosphate
Guanosine 2',3'-cyclic phosphate + Water <> Guanosine 3'-phosphate
Adenosine triphosphate + Nitrogen + 6 Reduced flavodoxin + Water <> Phosphate + ADP +6 Oxidized flavodoxin +2 Ammonia
4-Nitrocatechol + Oxygen + 3 Hydrogen ion <> Benzene-1,2,4-triol + Nitrite + Water
4-Sulfolactone + Water <> HSO3- + 2-Maleylacetate + Hydrogen ion
Protoanemonin + Water <> cis-Acetylacrylate
Cis-2-Chloro-4-carboxymethylenebut-2-en-1,4-olide + Water <> 2-Chloromaleylacetate
D-Gal alpha 1->6D-Gal alpha 1->6D-Glucose + Water <> D-Galactose + Melibiose
Ureidoglycine + Water <> (S)-Ureidoglycolic acid + Ammonia
Crotonoyl-CoA + Water <> 3-Hydroxybutanoyl-CoA
D-Galactarate + Galactaric acid <> 5-Dehydro-4-deoxy-D-glucarate + Water
di-trans,poly-cis-Undecaprenyl diphosphate + Water + Undecaprenyl diphosphate <> Di-trans,poly-cis-undecaprenyl phosphate + Phosphate
Ammonia + 2 Water + 6 Ferricytochrome c + Ferricytochrome c <> Nitrite +6 Ferrocytochrome c +6 Hydrogen ion + Ferrocytochrome c
2-(alpha-D-Mannosyl)-3-phosphoglycerate + Water + 2(alpha-D-mannosyl)-3-phosphoglycerate <> 2(alpha-D-Mannosyl)-D-glycerate + Phosphate
3-Amino-2-oxopropyl phosphate + 1-Deoxy-D-xylulose 5-phosphate + 3-Amino-2-oxopropyl phosphate <> Pyridoxine 5'-phosphate + Phosphate +2 Water
2-Hydroxy-cis-hex-2,4-dienoate + Water <> 4-Hydroxy-2-oxohexanoic acid
1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADPH + Hydrogen ion <> Isopentenyl pyrophosphate + NADP + Water
Water + Globotriaosylceramide <> D-Galactose + Lactosylceramide
Water + Globoside <> N-Acetyl-b-D-galactosamine + Globotriaosylceramide
GM2 + Water <> GM3 + N-Acetyl-b-D-galactosamine
Neohancoside D + Water <> D-Fructose + D-Glucose
Neohancoside D + Water <> beta-D-Fructose + alpha-D-Glucose
Melibiose + Water <> D-Galactose + D-Glucose
Water + Trehalose 6-phosphate <> D-Glucose + D-Hexose 6-phosphate
Lactose + Water <> D-Glucose + D-Galactose
2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinone + Oxygen + NADPH + Hydrogen ion <> 2-octaprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinone + NADP + Water
Methylamine + Oxygen + Water <> Formaldehyde + Ammonia + Hydrogen peroxide
1,4-beta-D-Glucan + Water <> 1,4-beta-D-Glucan + Cellobiose
Penicillin + Water <> Penicilloic acid
alpha-Pinene + Reduced acceptor + Oxygen <> Myrtenol + Water + Acceptor
alpha-Pinene + Oxygen + 2 Hydrogen ion + 2 e- <> Pinocarveol + Water
cis-2-Methyl-5-isopropylhexa-2,5-dienoyl-CoA + Water <> 3-Hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA
trans-2-Methyl-5-isopropylhexa-2,5-dienoyl-CoA + Water <> 3-Hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA
5-Hydroxyisourate + Water + 5-Hydroxyisourate <> 5-Hydroxy-2-oxo-4-ureido-2,5-dihydro-1H-imidazole-5-carboxylate + 5-Hydroxy-2-oxo-4-ureido-2,5-dihydro-1H-imidazole-5-carboxylate
Ecgonine methyl ester + Water <> Ecgonine + Methanol
Cadaverine + Water + Oxygen <> 5-Aminopentanal + Ammonia + Hydrogen peroxide
3-(3-Hydroxyphenyl)propanoic acid + Oxygen + NADH + Hydrogen ion <> 3-(2,3-Dihydroxyphenyl)propionic acid + Water + NAD
3-Hydroxycinnamic acid + Oxygen + NADH + Hydrogen ion <> Trans-2,3-Dihydroxycinnamate + Water + NAD
2-Hydroxy-6-ketononatrienedioate + Water <> 2-Hydroxy-2,4-pentadienoate + Fumaric acid
2,5-Dichloro-carboxymethylenebut-2-en-4-olide + Water <> 2,5-Dichloro-4-oxohex-2-enedioate
Trans-4-Carboxymethylenebut-2-en-4-olide + Water <> 2-Maleylacetate
Bisphenol A + NADH + Hydrogen ion + Oxygen <> 1,2-Bis(4-hydroxyphenyl)-2-propanol + NAD + Water
2,2-Bis(4-hydroxyphenyl)-1-propanol + NADH + Hydrogen ion + Oxygen <> 2,3-Bis(4-hydroxyphenyl)-1,2-propanediol + NAD + Water
2 Glutathione + 5(S)-Hydroperoxyeicosatetraenoic acid <> Glutathione disulfide + 5-HETE + Water
2 Glutathione + 15(S)-HPETE <> Glutathione disulfide + 15(S)-HETE + Water
Benzo[a]pyrene-7,8-diol + Glutathione <> 7,8-Dihydro-7-hydroxy-8-S-glutathionyl-benzo[a]pyrene + Water
Chloral hydrate + NADH + Hydrogen ion <> Trichloroethanol + NAD + Water
Dimethylallylpyrophosphate + NADP + Water <> 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADPH + Hydrogen ion
2-Succinylbenzoyl-CoA <> 1,4-Dihydroxy-2-naphthoyl-CoA + Water
Heme + Water + Farnesyl pyrophosphate <> Heme O + Pyrophosphate
gamma-Glutamyl-L-putrescine + Water + Oxygen <> gamma-Glutamyl-gamma-butyraldehyde + Ammonia + Hydrogen peroxide
gamma-Glutamyl-gamma-butyraldehyde + NAD + Water <> 4-(Glutamylamino) butanoate + NADH + Hydrogen ion
gamma-Glutamyl-gamma-butyraldehyde + NADP + Water <> 4-(Glutamylamino) butanoate + NADPH + Hydrogen ion
L-Ascorbate 6-phosphate + Water <> 3-Dehydro-L-gulonate 6-phosphate
3-Hydroxyoctadecanoyl-[acp] <> (2E)-Octadecenoyl-[acp] + Water
G13033 + Water <> G08421 + N-Acetyl-b-D-galactosamine
G06780 + Water <> G08421 + N-Acetyl-b-D-galactosamine
G13040 + Water <> G09660 + D-Glucuronic acid
Phosphatidylcholine + Water <> 2-Acyl-sn-glycero-3-phosphocholine + alpha-Linolenic acid
(6Z,9Z,12Z,15Z,18Z,21Z)-3-Hydroxytetracosahexa-6,9,12,15,18,21-enoyl-CoA <> (2E,6Z,9Z,12Z,15Z,18Z,21Z)-Tetracosahepta-2,6,9,12,15,18,21-enoyl-CoA + Water
(6Z,9Z,12Z,15Z,18Z)-3-Hydroxytetracosapenta-6,9,12,15,18-enoyl-CoA <> (2E,6Z,9Z,12Z,15Z,18Z)-Tetracosahexa-2,6,9,12,15,18-enoyl-CoA + Water
Trinitrotoluene + 2 NADPH + 2 Hydrogen ion <> 4-Hydroxylamino-2,6-dinitrotoluene +2 NADP + Water
Trinitrotoluene + 2 NADH + 2 Hydrogen ion <> 4-Hydroxylamino-2,6-dinitrotoluene +2 NAD + Water
Trinitrotoluene + 2 NADH + 2 Hydrogen ion <> 2-Hydroxylamino-4,6-dinitrotoluene +2 NAD + Water
D-Glucarate <> 2-Dehydro-3-deoxy-D-glucarate + Water
(2E)-5-Methylhexa-2,4-dienoyl-CoA + Water <> 3-Hydroxy-5-methylhex-4-enoyl-CoA
5-Fluoromuconolactone + Water <> 2-Maleylacetate + Hydrofluoric acid
4-Fluoromuconolactone + Water <> 2-Maleylacetate + Hydrofluoric acid
Fructoselysine 6-phosphate + Water <> Lysine + D-Hexose 6-phosphate
Luteolin 7-O-[beta-D-glucuronosyl-(1->2)-beta-D-glucuronide]-4'-O-beta-D-glucuronide + Water <> Luteolin 7-O-[beta-D-glucuronosyl-(1->2)-beta-D-glucuronide] + D-Glucuronic acid
Isopentenyl pyrophosphate + NAD + Water <> 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH + Hydrogen ion
Dimethylallylpyrophosphate + NAD + Water <> 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH + Hydrogen ion
5'-Deoxy-5-fluorocytidine + Water <> 5'-Deoxy-5-fluorouridine + Ammonia
5,6-Dihydro-5-fluorouracil + Water <> alpha-Fluoro-beta-ureidopropionic acid
6-Thioinosine-5'-monophosphate + NAD + Water <> 6-Thioxanthine 5'-monophosphate + NADH + Hydrogen ion
6-Thioxanthine 5'-monophosphate + Adenosine triphosphate + L-Glutamine + Water <> 6-Thioguanosine monophosphate + Adenosine monophosphate + Pyrophosphate + L-Glutamate
SN38 glucuronide + Water <> SN-38 + D-Glucuronic acid
Aldophosphamide + Glutathione <> 4-Glutathionyl cyclophosphamide + Water
D-Galactosamine 6-phosphate + Water <> D-Tagatose 6-phosphate + Ammonia
2-C-Methyl-D-erythritol-2,4-cyclodiphosphate + 2 Reduced ferredoxin + Oxidized ferredoxin <> 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + Water +2 Oxidized ferredoxin + Reduced ferredoxin
2-Polyprenylphenol + Oxygen + NADPH <> 2-Polyprenyl-6-hydroxyphenol + NADP + Water
2-Polyprenyl-6-methoxyphenol + Oxygen <> 2-Polyprenyl-6-methoxy-1,4-benzoquinone + Water
2-Polyprenyl-3-methyl-6-methoxy-1,4-benzoquinone + Oxygen + NADPH + Hydrogen ion <> 2-Polyprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinone + NADP + Water
3',5'-Cyclic diGMP + Water + Cyclic di-3',5'-guanylate <> Linear dimeric GMP
L-Serine + 5,6,7,8-Tetrahydromethanopterin <> 5,10-Methylenetetrahydromethanopterin + Glycine + Water
4-Hydroxyphenyl-4-hydroxybenzoate + Water <> 4-Hydroxybenzoic acid + Hydroquinone
N-Acetyl-L-citrulline + Water <> Acetic acid + Citrulline
2,3,5-Trichlorodienelactone + Water <> 2,3,5-Trichloromaleylacetate
3-Chloro-2-methyldienelactone + Water <> 3-Chloro-2-methylmaleylacetate
2-Chloro-5-methyl-cis-dienelactone + Water <> 2-Chloro-5-methylmaleylacetate
Se-Methylselenocysteine + Water <> Pyruvic acid + Ammonia + Methaneselenol
2 NADPH + 2 Hydrogen ion + Methylselenic acid <>2 NADP +2 Water + Methaneselenol
[tRNA(Ile2)]-cytidine34 + L-Lysine + Adenosine triphosphate <> [tRNA(Ile2)]-lysidine34 + Adenosine monophosphate + Pyrophosphate + Water
Pimelyl-[acyl-carrier protein] methyl ester + Water + Pimeloyl-[acyl-carrier protein] methyl ester <> Pimelyl-[acyl-carrier protein] + Methanol + Pimeloyl-[acyl-carrier protein]
Adenylated molybdopterin + Molybdate <> Molybdoenzyme molybdenum cofactor + Adenosine monophosphate + Water + Molybdoenzyme molybdenum cofactor
D-glycero-alpha-D-manno-Heptose 1,7-bisphosphate + Water <> D-glycero-alpha-D-manno-Heptose 1-phosphate + Phosphate
3-Oxo-5,6-dehydrosuberyl-CoA semialdehyde + NADP + Water <> 3-Oxo-5,6-dehydrosuberyl-CoA + NADPH + Hydrogen ion
2-Oxepin-2(3H)-ylideneacetyl-CoA + Water <> 3-Oxo-5,6-dehydrosuberyl-CoA semialdehyde + 3-Oxo-5,6-dehydrosuberyl-CoA semialdehyde
Phenylacetyl-CoA + Oxygen + NADPH + Hydrogen ion <> 2-(1,2-Epoxy-1,2-dihydrophenyl)acetyl-CoA + Water + NADP + 2-(1,2-Epoxy-1,2-dihydrophenyl)acetyl-CoA
Phenylacetyl-CoA + Water <> Benzeneacetic acid + Coenzyme A
Ureidoacrylate peracid + Water <> Peroxyaminoacrylate + Carbamic acid
Ureidoacrylate + Water <> 3-Aminoacrylate + Carbamic acid
3-Aminoacrylate + Water <> Malonic semialdehyde + Ammonia
2-Octaprenylphenol + Oxygen + NADPH + Hydrogen ion > 2-Octaprenyl-6-hydroxyphenol + Water + NADP
Adenosine triphosphate + an aliphatic sulfonate + Water > an aliphatic sulfonate + ADP + Phosphate + Hydrogen ion
Water + Deoxyadenosine > Ammonia + Deoxyinosine
5-Amino-6-(5'-phosphoribitylamino)uracil + Water > 5-amino-6-(D-ribitylamino)uracil + Phosphate
(2R,4S)-2-methyl-2,4-dihydroxydihydrofuran-3-one + Water > (2R,4S)-2-Methyl-2,3,3,4-tetrahydroxytetrahydrofuran
(2S,4S)-2-methyl-2,4-dihydroxydihydrofuran-3-one + Water > (2S,4S)-2-methyl-2,3,3,4-tetrahydroxytetrahydrofuran
4-(2-aminophenyl)-2,4-dioxobutanoate > kynurenate + Water + Hydrogen ion
Ammonia + Water <> Ammonium + OH<SUP>-</SUP>
NADH + Water > (<i>S</i>)-NADHX
NADH + Water > (<i>R</i>)-NADHX
L-dehydro-ascorbate + Water > dehydroascorbate (bicyclic form)
Selenite + Glutathione + Hydrogen ion > Selenodiglutathione + Glutathione disulfide + Water
2-carboxy-L-xylonolactone + Water > 2-carboxy-L-<i>threo</i>-pentonate + Hydrogen ion
Dehydroglycine + Water > Glyoxylic acid + Ammonia
Formaldehyde + Tetrahydrofolic acid > 5,10-Methylene-THF + Water
Pyruvic acid + hydroxylamine > pyruvic oxime + Water
Ascorbic acid + Hydrogen peroxide > monodehydroascorbate + Water
a 2(R)-hydroperoxy fatty acid + Hydrogen ion > a fatty aldehyde + Carbon dioxide + Water
5,10-Methenyltetrahydrofolate + Water Hydrogen ion + N5-Formyl-H4F
4-Aminobutyraldehyde > 1-Pyrroline + Water
Hydrogen ion + coumarinate > coumarin + Water
Enterochelin + Water > Hydrogen ion + 2,3-Dihydroxybenzoylserine
UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate-D-alanine + Water > L-Alanine + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate
Glutathione + Adenosine triphosphate + Water > Glutathione + ADP + Phosphate + Hydrogen ion
a 1,2-diacyl-<i>sn</i>-glycerol 3-diphosphate + Water PA(16:0/16:0) + Phosphate + Hydrogen ion
Water a 3'-phosphomononucleotide + a 3' phosphooligonucleotide
3,4-dihydroxyphenylacetyl-CoA + Water 3,4-Dihydroxybenzeneacetic acid + Coenzyme A + Hydrogen ion
Guanosine diphosphate mannose + Water > Hydrogen ion + Guanosine monophosphate + D-Mannose 1-phosphate
OH<SUP>-</SUP> + Hydrogen ion <> Water
2-trans,5-cis-tetradecadienoyl-CoA + Water > 3-hydroxy-5-cis-tetradecenoyl-CoA
4-deoxy-4-formamido-&alpha;-L-arabinopyranosyl <i>ditrans,octacis</i>-undecaprenyl phosphate + Water > 4-amino-4-deoxy-&alpha;-L-arabinopyranosyl <i>ditrans,octacis</i>-undecaprenyl phosphate + Formic acid
poly-&beta;-1,6-N-acetyl-D-glucosamine + Water Hydrogen ion + partially N-deacetylated poly-&beta;-1,6-N-acetyl-D-glucosamine + Acetic acid
Dihydromonapterin-triphosphate + Water > Hydrogen ion + 7,8-Dihydroneopterin + Phosphate
Ureidoacrylate peracid + NADH > 3-ureidoacrylate + NAD + Water
3-ureidoacrylate + Water > Hydrogen ion + Carbamic acid + 3-Aminoacrylate
3-Aminoacrylate + Water > Malonic semialdehyde + Ammonia
Peroxyaminoacrylate + a reduced electron acceptor > 3-Aminoacrylate + Water + Hydrogen ion + an oxidized electron acceptor
Phosphohydroxypyruvic acid + Water > Hydroxypyruvic acid + Phosphate
isoguanine + Water > Xanthine + Ammonia
&alpha;-D-ribose-1,2-cyclic-phosphate-5-phosphate + Water > Hydrogen ion + Ribose 1,5-bisphosphate
P-DPD + Water 3,4,4-trihydroxy-2-pentanone-5-phosphate
L-Methionine + Hydrogen peroxide > L-methionine <i>S</i>-oxide + Water
&alpha;-D-ribose-1-methylphosphonate-5-triphosphate + Water > Hydrogen ion + &alpha;-D-ribose-1-methylphosphonate-5-phosphate + Pyrophosphate
Ferric enterobactin + Water > ferric 2,3-dihydroxybenzoylserine
(2,3-dihydroxybenzoylserine)<sub>3</sub> + Water 2,3-Dihydroxybenzoylserine
L-Ala-gamma-D-Glu-Dap + Water > L-Ala-gamma-D-Glu + <i>meso</i>-diaminopimelate
L-Glutamic-gamma-semialdehyde <> Hydrogen ion + Water + L-D-1-Pyrroline-5-carboxylic acid
Tetrahydrothiophene 1-oxide + a reduced electron acceptor > Tetrahydrothiophene + an oxidized electron acceptor + Water
&beta;-D-galactofuranose + Adenosine triphosphate + Water > &beta;-D-galactofuranose + ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + Water + Phosphate ADP + Phosphate + Hydrogen ion
a lipopolysaccharide + Water + Adenosine triphosphate > a lipopolysaccharide + Phosphate + ADP + Hydrogen ion
Hydrogen ion + Water + Adenosine triphosphate <> Hydrogen ion + Phosphate + ADP
Water + a macrolide antibiotic + Adenosine triphosphate > a macrolide antibiotic + Phosphate + ADP
an aldehyde + Water + an oxidized electron acceptor a carboxylate + a reduced electron acceptor + Hydrogen ion
alpha-Ketoisovaleric acid + Acetyl-CoA + Water > Hydrogen ion + 3-Carboxy-3-hydroxy-isocaproate + Coenzyme A
Methylcitric acid > Water + Cis-2-Methylaconitate
Oxalacetic acid + Water + Propionyl-CoA <> Hydrogen ion + Methylcitric acid + Coenzyme A
2-Octaprenyl-6-methoxyphenol + Oxygen + NADPH + Hydrogen ion > 2-Octaprenyl-6-methoxy-1,4-benzoquinol + Water + NADP
2-oxopent-4-enoate + Water > 4-Hydroxy-2-oxopentanoate
Water + Selenium + Adenosine triphosphate > Phosphate + Selenophosphate + Adenosine monophosphate
3-Carboxy-3-hydroxy-isocaproate <> Isopropylmaleate + Water
a nucleoside 3'-phosphate + Water > a ribonucleoside + Phosphate
DNA<sub><i>n</i></sub> + Water DNA<sub><i>n</i></sub> + a nucleoside monophosphate
Water a single-stranded oligodeoxyribonucleotide
an oligonucleotide + Water a nucleoside monophosphate
Water + tRNA-precursors a single-stranded oligoribonucleotide + mature-tRNA
Water a nucleoside monophosphate
Water + 2-Deoxy-D-glucose 6-phosphate > Phosphate + 2-Deoxyglucose
a peptidoglycan + Water a peptidoglycan with cleaved N-acetyl-glucosamine + N-Acetyl-D-glucosamine
a &beta;-D glucoside + Water a non glucosylated glucose acceptor + b-D-Glucose
a (1->4)-&beta;-D-xylan oligosaccharide + Water &beta;-D-xylopyranose
an <i>N</i>-acetyl-&beta;-D-hexosaminide + Water an organic molecule + an <i>N</i>-acetyl-&beta;-D-hexosamine
an arabinogalactan + Water a galactotetraose
an alkylated DNA + Water DNA<sub><i>n</i></sub> + an alkylated nucleobase
a protein with N-terminal methionine + Water > L-Methionine + Peptides
a tripeptide + Water a dipeptide + a standard &alpha; amino acid
Water + Peptides a standard &alpha; amino acid + Peptides
a dipeptide + Water > a standard &alpha; amino acid
a dipetide with aspartate at N-terminal + Water L-Aspartic acid + a standard &alpha; amino acid
D-Alanyl-D-alanine + Water > D-Alanine
a dipeptide with proline at carboxy terminal + Water L-Proline + a standard &alpha; amino acid
an oligopeptide + Water a dipeptide + Peptides
a lipid II + Water a <i>N</i>-acetylglucosamine--<i>N</i>-acetylmuramyl-(tetrapeptide) pyrophosphoryl-undecaprenol + D-Alanine
Water + Ubiquitin-C-terminal-thioesters a thiol + Ubiquitins
Water + Peptides-with-Leader-Sequence > Peptides + Leader-Sequences
Water + Prolipoproteins Lipoproteins + cleaved-lipoprotein-signal-peptide
Water + General-Protein-Substrates Peptides
Water + formyl-L-methionyl peptide > Hydrogen ion + methionyl peptide + Formic acid
a nucleoside triphosphate + Water > a nucleoside monophosphate + Pyrophosphate + Hydrogen ion
Water + Diadenosine tetraphosphate > Hydrogen ion + ADP
2,3-diaminopropanoate + Water > Hydrogen ion + Ammonia + Pyruvic acid
a ribonucleoside monophosphate + Water > a ribonucleoside + Phosphate
Cellobiose-6-phosphate + Water > Glucose 6-phosphate + b-D-Glucose
6-Phosphonoglucono-D-lactone + Water > Hydrogen ion + 6-Phosphogluconic acid
Adenosine triphosphate + Ferric enterobactin + Water > ADP + Phosphate + Ferric enterobactin + Hydrogen ion
Adenosine triphosphate + Ferric hydroxamate + Water > ADP + Phosphate + Ferric hydroxamate
Adenosine triphosphate + L-Glutamine + Water > ADP + Phosphate + L-Glutamine + Hydrogen ion
Adenosine triphosphate + L-Glutamate + Water > ADP + Phosphate + L-Glutamate + Hydrogen ion
Adenosine triphosphate + L-Histidine + Water > ADP + Phosphate + L-Histidine + Hydrogen ion
Adenosine triphosphate + L-Isoleucine + Water > ADP + Phosphate + L-Isoleucine + Hydrogen ion
Adenosine triphosphate + D-Maltose + Water > ADP + Phosphate + D-Maltose + Hydrogen ion
Adenosine triphosphate + D-Galactose + Water > ADP + Phosphate + D-Galactose + Hydrogen ion
Adenosine triphosphate + Molybdate + Water > ADP + Phosphate + Molybdate + Hydrogen ion
Water + L-Arabinose + Adenosine triphosphate > L-Arabinose + Phosphate + ADP + Hydrogen ion
Ni<SUP>2+</SUP> + Adenosine triphosphate + Water > Ni<SUP>2+</SUP> + ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + Water + an alkylphosphonate > ADP + Phosphate + an alkylphosphonate + Hydrogen ion
Adenosine triphosphate + Spermidine + Water > ADP + Phosphate + Spermidine + Hydrogen ion
Adenosine triphosphate + Putrescine + Water > ADP + Phosphate + Putrescine + Hydrogen ion
Adenosine triphosphate + L-Proline + Water > ADP + Phosphate + L-Proline + Hydrogen ion
Adenosine triphosphate + Phosphate + Water > ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + beta-D-Ribopyranose + Water > ADP + Phosphate + beta-D-Ribopyranose + Hydrogen ion
L-Lysine + Adenosine triphosphate + Water > L-Lysine + ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + Thiamine + Water > ADP + Phosphate + Thiamine + Hydrogen ion
Adenosine triphosphate + D-Xylose + Water > ADP + Phosphate + D-Xylose + Hydrogen ion
Adenosine triphosphate + Glycerol 3-phosphate + Water > ADP + Phosphate + Glycerol 3-phosphate + Hydrogen ion
Adenosine triphosphate + L-Leucine + Water > ADP + Phosphate + L-Leucine + Hydrogen ion
Adenosine triphosphate + L-Valine + Water > ADP + Phosphate + L-Valine + Hydrogen ion
Adenosine triphosphate + Ornithine + Water > ADP + Phosphate + Ornithine + Hydrogen ion
Adenosine triphosphate + L-Arginine + Water > ADP + Phosphate + L-Arginine + Hydrogen ion
D-Allose + Adenosine triphosphate + Water > D-Allose + ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + Cob(I)alamin + Water > ADP + Phosphate + Cob(I)alamin + Hydrogen ion
Taurine + Adenosine triphosphate + Water > Taurine + ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + Thiosulfate + Water > ADP + Phosphate + Thiosulfate + Hydrogen ion
Sulfate + Water + Adenosine triphosphate > Sulfate + Phosphate + ADP + Hydrogen ion
Adenosine triphosphate + a dipeptide + Water > ADP + Phosphate + a dipeptide + Hydrogen ion
Adenosine triphosphate + Fe(III)dicitrate + Water > ADP + Phosphate + Fe(III)dicitrate + Hydrogen ion
Water + an acetic ester > an alcohol + Acetic acid + Hydrogen ion
N-Acetylornithine + Water > Ornithine + Acetic acid
Water + a phosphate monoester <> an alcohol + Phosphate
an acyl-CoA + Water > Coenzyme A + a carboxylate + Hydrogen ion
Water + an acyl phosphate > Phosphate + a carboxylate + Hydrogen ion
Water + Adenine > Ammonia + Hypoxanthine
Water + Adenosine > Ammonia + Inosine
Adenosine + Water > D-ribose + Adenine
S-Ribosyl-L-homocysteine + Adenine < S-Adenosylhomocysteine + Water
an ADP-sugar + Water > Adenosine monophosphate + an &alpha;-D-aldose-1-phosphate
Water + Agmatine > Urea + Putrescine
an aldehyde + Water + NADP a carboxylate + NADPH + Hydrogen ion
Hydrogen ion + Allantoic acid + Water > <i>S</i>-ureidoglycine + Ammonia + Carbon dioxide
<i>S</i>-allantoin + Water > Hydrogen ion + Allantoic acid
a 1,4-&alpha;-D-glucan + Water > a 1,4-&alpha;-D-glucan + Maltopentaose
Water + Melibiose > D-Galactose + b-D-Glucose
D-Altronate > Water + 2-Keto-3-deoxy-D-gluconic acid
Aminoacetone + Water + Oxygen > Hydrogen ion + Pyruvaldehyde + Ammonia + Hydrogen peroxide
an aliphatic amine + Water + Oxygen > an aldehyde + Ammonia + Hydrogen peroxide + Hydrogen ion
Water + Oxygen + Phenylethylamine > Hydrogen ion + Hydrogen peroxide + Ammonia + Phenylacetaldehyde
4-Aminobutyraldehyde + NAD + Water > gamma-Aminobutyric acid + NADH + Hydrogen ion
Adenosine monophosphate + Water > Adenosine + Phosphate
Water + Adenosine monophosphate > D-Ribose-5-phosphate + Adenine
Water + a phenol sulfate <> Sulfate + a phenol
L-Asparagine + Water > Hydrogen ion + L-Aspartic acid + Ammonia
Betaine aldehyde + NAD + Water > Hydrogen ion + Betaine + NADH
Water + a &beta;-D-glucuronoside > D-Glucuronic acid + an alcohol
Water + a &beta;-lactam > a substituted &beta;-amino acid
Water + alpha-Lactose > D-Galactose + b-D-Glucose
a carboxylic ester + Water > an alcohol + a carboxylate + Hydrogen ion
Adenosine triphosphate + L-Glutamine + Hydrogen carbonate + Water > Hydrogen ion + Carbamoylphosphate + L-Glutamate + Phosphate + ADP
L-Carnitinyl-CoA > Crotonobetainyl-CoA + Water
Hydrogen peroxide > Water + Oxygen
a CDP-diacylglycerol + Water <> PA(16:0/16:0) + Cytidine monophosphate + Hydrogen ion
Adenosine triphosphate + Uridine triphosphate + L-Glutamine + Water > Hydrogen ion + ADP + Phosphate + Cytidine triphosphate + L-Glutamate
a nucleoside 2',3'-cyclic phosphate + Water > a nucleoside 3'-phosphate + Hydrogen ion
L-Cystathionine + Water > Hydrogen ion + Pyruvic acid + Ammonia + L-Homocysteine
Water + Cytosine > Ammonia + Uracil
Water + Deoxycytidine > Ammonia + Deoxyuridine
Water + Cytidine > Ammonia + Uridine
D-tartrate Water + Oxalacetic acid
an electron-transfer-related quinone + Water + D-Alanine > an electron-transfer-related quinol + Ammonium + Pyruvic acid
Water + dCTP > Ammonia + Deoxyuridine triphosphate
D-Cysteine + Water <> Pyruvic acid + Hydrogen sulfide + Ammonia + Hydrogen ion
Water + dGTP > Hydrogen ion + Triphosphate + Deoxyguanosine
Pyruvic acid + L-Aspartate-semialdehyde <> Hydrogen ion + Water + 2,3-Dihydrodipicolinic acid
Dihydroneopterin monophosphate + Water > 7,8-Dihydroneopterin + Phosphate
Dimethyl sulfoxide + a menaquinol > Dimethyl sulfide + Water + a menaquinone
Deoxyuridine triphosphate + Water > Hydrogen ion + dUMP + Pyrophosphate
a (3<i>S</i>)-3-hydroxyacyl-CoA < a <i>trans</i>-2-enoyl-CoA + Water
D-Erythrose 4-phosphate + Water + NAD > 4-Phospho-D-erythronate + NADH + Hydrogen ion
long chain polyphosphate + Water > long chain polyphosphate + Phosphate
Fructose 1,6-bisphosphate + Water > Fructose 6-phosphate + Phosphate
Adenosine triphosphate + 5'-Phosphoribosyl-N-formylglycineamide + L-Glutamine + Water > Hydrogen ion + ADP + Phosphate + Phosphoribosylformylglycineamidine + L-Glutamate
Water + N10-Formyl-THF > Hydrogen ion + Tetrahydrofolic acid + Formic acid
D-Galactonate > Water + 2-Dehydro-3-deoxy-D-galactonate
GDP-&alpha;-D-glucose + Water > Hydrogen ion + b-D-Glucose + Guanosine diphosphate
Guanosine diphosphate mannose > Water + GDP-4-Dehydro-6-deoxy-D-mannose
Gluconolactone + Water > Hydrogen ion + Gluconic acid
Glucosamine 6-phosphate + Water <> Hydrogen ion + Fructose 6-phosphate + Ammonia
Water + Glucose 1-phosphate > Phosphate + D-glucose
L-Glutamine + Water > Hydrogen ion + L-Glutamate + Ammonia
Hydrogen peroxide + Glutathione > Glutathione disulfide + Water
L-Glutamate + Water + NADP <> Hydrogen ion + Oxoglutaric acid + Ammonia + NADPH
glycerol 1-phosphate + Water Glycerol + Phosphate
Water + NAD + Glycolaldehyde > Hydrogen ion + NADH + Glycolic acid
a glycerophosphodiester + Water > an alcohol + Glycerol 3-phosphate + Hydrogen ion
D-Lactic acid + Hydrogen ion < Pyruvaldehyde + Water
Water + L-Glutamine + Xanthylic acid + Adenosine triphosphate > Hydrogen ion + L-Glutamate + Guanosine monophosphate + Pyrophosphate + Adenosine monophosphate
Water + Phosphoglycolic acid > Glycolic acid + Phosphate
Glutathionylspermidine + Water > Glutathione + Spermidine
Water + Guanosine triphosphate > Hydrogen ion + Pyrophosphate + 2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Formic acid
Water + Guanine > Ammonia + Xanthine
Guanosine diphosphate + Water > Hydrogen ion + Guanosine monophosphate + Phosphate
histidinal + NAD + Water > Hydrogen ion + L-Histidine + NADH
Phosphoribosyl-AMP + Water > PhosphoribosylformiminoAICAR-phosphate
Histidinol phosphate + Water > L-Histidinol + Phosphate
Phosphoribosyl-ATP + Water > Hydrogen ion + Phosphoribosyl-AMP + Pyrophosphate
Propionyl-CoA + Water + Glyoxylic acid <> 2-hydroxyglutarate + Hydrogen ion + Coenzyme A
Ammonia + Water + an oxidized electron acceptor < a reduced electron acceptor + hydroxylamine
Hydrogen ion + 1-(2-Carboxyphenylamino)-1'-deoxy-D-ribulose 5'-phosphate > Indoleglycerol phosphate + Carbon dioxide + Water
D-Erythro-imidazole-glycerol-phosphate > Imidazole acetol-phosphate + Water
Water + NAD + Inosinic acid > Hydrogen ion + NADH + Xanthylic acid
Water + Pyrophosphate > Hydrogen ion + Phosphate
Inosine + Water > D-ribose + Hypoxanthine
Isopentenyl pyrophosphate + NAD(P)<sup>+</sup> + Water < 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NAD(P)H + Hydrogen ion
3-Deoxy-D-manno-octulosonate 8-phosphate + Water > 3-Deoxy-D-manno-octulosonate + Phosphate
D-Arabinose 5-phosphate + Water + Phosphoenolpyruvic acid > 3-Deoxy-D-manno-octulosonate 8-phosphate + Phosphate
L-rhamnonate 2-keto-3-deoxy-L-rhamnonate + Water
Water + NAD + Lactaldehyde > Hydrogen ion + NADH + L-Lactic acid
L-Cysteine + Water > Pyruvic acid + Ammonia + Hydrogen sulfide + Hydrogen ion
Water + UDP-2,3-Bis(3-hydroxytetradecanoyl)glucosamine > Hydrogen ion + 2,3-Bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl 1-phosphate + Uridine 5'-monophosphate
5-amino-6-(D-ribitylamino)uracil + 3,4-Dihydroxy-2-butanone-4-P > Hydrogen ion + 6,7-Dimethyl-8-(1-D-ribityl)lumazine + Phosphate + Water
2-Acylglycerophosphocholine + Water a carboxylate + Glycerophosphocholine + Hydrogen ion
Acetyl-CoA + Water + Glyoxylic acid > Hydrogen ion + L-Malic acid + Coenzyme A
a 1,4-&alpha;-D-glucan + Water > a 1,4-&alpha;-D-glucan + D-Glucose
D-Mannonate > Water + 2-Keto-3-deoxy-D-gluconic acid
Hydrogen ion + 2-Ketobutyric acid + Succinic acid + Ammonia O-Succinyl-L-homoserine + Water
Hydrogen ion + 3-(3-Hydroxyphenyl)propionate + NADH + Oxygen > Water + 3-(2,3-Dihydroxyphenyl)propionic acid + NAD
Adenosine triphosphate + Nicotinic acid adenine dinucleotide + L-Glutamine + Water > Hydrogen ion + Adenosine monophosphate + Pyrophosphate + NAD + L-Glutamate
Water + NAD <> Hydrogen ion + Adenosine diphosphate ribose + Niacinamide
Water + NAD > Hydrogen ion + Nicotinamide ribotide + Adenosine monophosphate
Water + N-Acetyl-D-Glucosamine 6-Phosphate > Glucosamine 6-phosphate + Acetic acid
Niacinamide + Water > Hydrogen ion + Nicotinic acid + Ammonia
Nitrous oxide + Water + Cytochromes-C-Oxidized Nitric oxide + Hydrogen ion + Cytochromes-C-Reduced
Nicotinamide ribotide + Water > Hydrogen ion + Nicotinamide ribotide + Ammonia
Water + Nicotinamide ribotide <> Hydrogen ion + D-Ribose-5-phosphate + Niacinamide
a nucleoside diphosphate + Water > a nucleoside monophosphate + Phosphate + Hydrogen ion
(1R,6R)-6-Hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate > 2-Succinylbenzoate + Water
2-Octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol + Oxygen + a reduced electron acceptor > 2-octaprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinone + Water + an oxidized electron acceptor
Water + Porphobilinogen <> Hydrogen ion + Ammonia + Hydroxymethylbilane
1-Amino-propan-2-one-3-phosphate + 1-Deoxy-D-xylulose 5-phosphate > Hydrogen ion + Pyridoxine 5'-phosphate + Phosphate + Water
Water + Pyruvic acid + Adenosine triphosphate > Hydrogen ion + Phosphate + Phosphoenolpyruvic acid + Adenosine monophosphate
a phenolic donor + Hydrogen peroxide a phenoxyl radical of a phenolic donor + Water
6-Phosphogluconic acid > 2-Keto-3-deoxy-6-phosphogluconic acid + Water
an L-1-phosphatidylglycerol-phosphate + Water <> an L-1-phosphatidyl-glycerol + Phosphate
Water + NAD + Phenylacetaldehyde <> Hydrogen ion + NADH + phenylacetate
Oxygen + Water + Pyridoxamine 5'-phosphate > Hydrogen ion + Hydrogen peroxide + Ammonia + Pyridoxal 5'-phosphate
5-Aminolevulinic acid <> Hydrogen ion + Water + Porphobilinogen
Guanosine 3',5'-bis(diphosphate) + Water > Hydrogen ion + Pyrophosphate + Guanosine diphosphate
Water + Guanosine 3'-diphosphate 5'-triphosphate > Hydrogen ion + Phosphate + Guanosine 3',5'-bis(diphosphate)
5-Phosphoribosylamine + Pyrophosphate + L-Glutamate < Phosphoribosyl pyrophosphate + L-Glutamine + Water
+ Water Hydrogen ion + Pyrazinic acid + Ammonia
L-D-1-Pyrroline-5-carboxylic acid + NAD + Water > Hydrogen ion + L-Glutamate + NADH
Iminoaspartic acid + Dihydroxyacetone phosphate > Quinolinic acid + Water + Phosphate
Nitrite + Water + Cytochromes-C-Oxidized <> Nitrate + Cytochromes-C-Reduced
an alcohol + Water + NAD < an organic hydroperoxide + NADH + Hydrogen ion
Water + 2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine > 5-Amino-6-(5'-phosphoribosylamino)uracil + Ammonia
a pyrimidine nucleoside + Water > D-ribose + a pyrimidine base
Myo-inositol hexakisphosphate + Water > 1-Myo-inositol 1,2,3,4,5-pentakisphosphate + Phosphate
Water + a D-amino acid + an electron-transfer-related quinone > Ammonium + a 2-oxo carboxylate + an electron-transfer-related quinol
a peptidoglycan dimer (<I>meso</I>-diaminopimelate containing) + Water > a peptidoglycan with D,D cross-links (<I>meso</I>-diaminopimelate containing) + Undecaprenyl diphosphate + D-Alanine
8-oxo-dGTP + Water > Hydrogen ion + 8-oxo-dGMP + Pyrophosphate
Pyruvic acid + Water + a ubiquinone > Carbon dioxide + a ubiquinol + Acetic acid
7-carboxy-7-deazaguanine + Ammonia + Adenosine triphosphate > 7-Cyano-7-carbaguanine + ADP + Phosphate + Water
a reduced electron acceptor + Hydrogen peroxide > an oxidized electron acceptor + Water
Hydrogen peroxide > Water + Oxygen
Uridine 5'-diphosphate + Water > Phosphate + Uridine 5'-monophosphate + Hydrogen ion
CDP + Water > Phosphate + Cytidine monophosphate + Hydrogen ion
a ubiquinol + Oxygen > a ubiquinone + Water
isoprimeverose + Water b-D-Glucose + D-Xylose
Ascorbic acid + Hydrogen peroxide + Hydrogen ion > Ascorbic acid + L-dehydro-ascorbate + Water
(<i>Z</i>)-2-methylureidoacrylate peracid + Water > (<i>Z</i>)-2-methyl-peroxyaminoacrylate + Carbamic acid + Hydrogen ion
Hydrogen ion + Tetrahydrodipicolinate + Water > L-&alpha;-amino-&epsilon;-keto-pimelate
NADP + Water < NAD + Phosphate
Cyclic pyranopterin monophosphate + Water + Thiocarboxylated-MPT-synthases > Molybdopterin + MPT-Synthases
Adenylated molybdopterin + Molybdate > molybdenum cofactor + Adenosine monophosphate + Water
a quaternary amine + Water + Adenosine triphosphate > a quaternary amine + Phosphate + ADP + Hydrogen ion
adenosylcobalamin 5'-phosphate + Water > Adenosylcobalamin + Phosphate
3-Isopropylmalate < Isopropylmaleate + Water
a primary amine + Water + Oxygen > an aldehyde + Ammonia + Hydrogen peroxide
an oxidized electron acceptor + Water + a deoxyribonucleoside diphosphate < a reduced electron acceptor + a ribonucleoside diphosphate
Myo-inositol hexakisphosphate + Water > D-<i>myo</i>-inositol (1,2,4,5,6)-pentakisphosphate + Phosphate
Adenosine diphosphate ribose + Water > Hydrogen ion + Adenosine monophosphate + D-Ribose-5-phosphate
Coproporphyrinogen III + Oxygen + Hydrogen ion > Protoporphyrinogen IX + Carbon dioxide + Water
Iron + Hydrogen ion + Oxygen > Fe<SUP>3+</SUP> + Water
DNA containing a base with lesion + Water a DNA containing abasic site + base with lesion
Phenylacetyl-CoA + Oxygen + NADPH + Hydrogen ion > 2-(1,2-epoxy-1,2-dihydrophenyl)acetyl-CoA + NADP + Water
Selenite + Water + an oxidized electron acceptor < selenate + a reduced electron acceptor
Phenylhydantoin + Water <> corresponding carbamoyl amino acid
3-Sulfinoalanine + Water Hydrogen ion + L-Alanine + Sulfite
an alkanesulfonate + Oxygen + FMNH > an aldehyde + Sulfite + Water + Flavin Mononucleotide + Hydrogen ion
Cu<SUP>+</SUP> + Hydrogen ion + Oxygen > Copper + Water
L-Cysteine + Adenosine triphosphate + Water > L-Cysteine + ADP + Phosphate + Hydrogen ion
Water + cleaved-lipoprotein-signal-peptide Peptides
Water + General-Protein-Substrates Peptides + Peptides
&beta;-aspartyl dipeptide + Water &beta;-aspartate + a standard &alpha; amino acid
Water + a-precursor-of-large-subunit-of-hydrogen a C terminal 32 aminoacid peptide + Precursor-of-hydrogenase-3
peptidoglycan D-alanyl-DAP crosslink + Water <> peptidoglycan tetrapeptide, glycan chain 2 + peptidoglycan tetrapeptide, glycan chain 1
a menaquinol + Nitrate + Hydrogen ion > a menaquinone + Nitrite + Water + Hydrogen ion
Cytidine + Water > D-ribose + Cytosine
Xanthosine + Water > D-ribose + Xanthine
a deoxyribonucleoside monophosphate + Water > a deoxynucleoside + Phosphate
Cytidine triphosphate + Water > Hydrogen ion + Cytidine monophosphate + Pyrophosphate
dGTP + Water > Hydrogen ion + 2'-Deoxyguanosine 5'-monophosphate + Pyrophosphate
NAD(P)<sup>+</sup> + gamma-Glutamyl-gamma-butyraldehyde + Water > 4-(Glutamylamino) butanoate + NAD(P)H + Hydrogen ion
4-(Glutamylamino) butanoate + Water > gamma-Aminobutyric acid + L-Glutamate
Acetaldehyde + NADP + Water > Acetic acid + NADPH + Hydrogen ion
GMP-Lysine + Water > Guanosine monophosphate + N-alpha-acetyl lysine methyl ester
cyclic di-3',5'-guanylate + Water > Hydrogen ion + Linear dimeric GMP
D-Glycero-D-manno-heptose 1,7-bisphosphate + Water > D-<i>glycero</i>-&beta;-D-<i>manno</i>-heptose 1-phosphate + Phosphate
NADH + Water > Hydrogen ion + NMNH + Adenosine monophosphate
Water + Adenosine triphosphate + L-Methionine > Phosphate + ADP + L-Methionine + Hydrogen ion
xylan + Water D-Xylose
Water + p-Aminobenzoyl glutamate > p-Aminobenzoic acid + L-Glutamate
Water + General-Protein-Substrates a standard &alpha; amino acid + Peptides
a limit dextrin + Water > a debranched limit dextrin + Maltotetraose
a 1,4-&alpha;-D-glucan + Water > a 1,4-&alpha;-D-glucan + Maltohexaose
Maltotriose + Water > D-Maltose + D-Glucose
6-Phosphogluconic acid + Water > Gluconic acid + Phosphate
Fructose 1-phosphate + Water > D-fructose + Phosphate
Flavin Mononucleotide + Water > Riboflavin + Phosphate
L-Ascorbate 6-phosphate + Water > 3-Dehydro-L-gulonate 6-phosphate
Hydrogen carbonate + Hydrogen ion <> Carbon dioxide + Water
GlcNAc-1,6-anhMurNAc-L-Ala-&gamma;-D-Glu-DAP-D-Ala + Water > <i>N</i>-acetyl-&beta;-D-glucosamine(anhydrous)-<i>N</i>-acetylmuramate + L-Ala-gamma-D-Glu-DAP-D-Ala
<i>N</i>-acetyl-&beta;-D-glucosamine(anhydrous)-<i>N</i>-acetylmuramate + Water N-Acetyl-D-glucosamine + 1,6-Anhydro-N-acetylmuramate
L-Ala-gamma-D-Glu-DAP-D-Ala + Water L-Ala-gamma-D-Glu-Dap + D-Alanine
a menaquinol + Hydrogen ion + Trimethylamine N-Oxide > a menaquinone + Water + Trimethylamine
Oxygen + Hydrogen ion + a ubiquinol > a ubiquinone + Water + Hydrogen ion
Salicin 6-phosphate + Water > Glucose 6-phosphate + salicyl alcohol
3,5-Tetradecadienoyl-CoA + Water > Hydrogen ion + 3,5-tetradecadienoate + Coenzyme A
nigerose + Water D-Glucose
D-Ribose-5-phosphate + Uracil <> Water + Pseudouridine 5'-phosphate
peptidoglycan DAP-DAP crosslink + Water > peptidoglycan tripeptide, glycan chain 1 + peptidoglycan tetrapeptide, glycan chain 2
Water + D-Myo-inositol (1)-monophosphate > Phosphate + Inositol
3-hydroxypropionaldehyde + NAD + Water > Hydrogen ion + 3-Hydroxypropanoate + NADH
Benzo[a]pyrene-4,5-oxide + Red-Thioredoxin Biotin + Water + Ox-Thioredoxin
Nitrate + a ubiquinol > Nitrite + Water + a ubiquinone
Nitrate + Hydrogen ion > Nitrite + Water
an aldose + an oxidized electron acceptor + Water an aldonate + a reduced electron acceptor
Acetic acid + Carbon dioxide + Hydrogen ion <> Pyruvic acid + Water
NAD(P)H + Nitrite + Hydrogen ion > NAD(P)<sup>+</sup> + Ammonium + Water
Guanosine 3'-diphosphate 5'-triphosphate + Water > Hydrogen ion + Guanosine triphosphate + Pyrophosphate
2-Oxepin-2(3H)-ylideneacetyl-CoA + NADP + Water > 3-Oxo-5,6-dehydrosuberyl-CoA + NADPH + Hydrogen ion
3-Hydroxyadipyl-CoA <> 2,3-dehydroadipyl-CoA + Water
PE(14:0/14:0) + Water a fatty acid + a 2-lyso-phosphatidyl-ethanolamine + Hydrogen ion
PE(14:0/14:0) + Water > a 1-lyso-2-acyl-<i>sn</i>-glycero-3-phosphoethanolamine + a fatty acid + Hydrogen ion
2-Hydroxydeoxyadenosine 5'-triphosphate + Water > 2-hydroxydeoxyadenosine 5'-monophosphate + Pyrophosphate
Butanesulfonate + Oxygen + FMNH > Butanal + Sulfite + Water + Flavin Mononucleotide + Hydrogen ion
gly-met + Water > Glycine + L-Methionine
ala-asp + Water > L-Alanine + L-Aspartic acid
ala-gln + Water > L-Alanine + L-Glutamine
ala-gly + Water > L-Alanine + Glycine
ala-his + Water > L-Alanine + L-Histidine
ala-leu + Water > L-Alanine + L-Leucine
ala-thr + Water > L-Alanine + L-Threonine
L-Alanyl-L-Glutamate + Water > L-Alanine + L-Glutamate
gly-asn + Water > Glycine + L-Asparagine
gly-gln + Water > Glycine + L-Glutamine
glycyl-L-glutamate + Water > Glycine + L-Glutamate
methionine-alanine dipeptide + Water > L-Methionine + L-Alanine
gly-asp + Water > Glycine + L-Aspartic acid
glycylproline + Water > Glycine + L-Proline
1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + Water + Oxidized-ferredoxins < 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate + Hydrogen ion + Reduced-ferredoxins
NAD(P)<sup>+</sup> + Dimethylallylpyrophosphate + Water < NAD(P)H + Hydrogen ion + 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate
Xanthine + NAD + Water > Uric acid + NADH + Hydrogen ion
2-Oxepin-2(3H)-ylideneacetyl-CoA + Water > 3-oxo-5,6-dehydrosuberyl-CoA semialdehyde
3-oxo-5,6-dehydrosuberyl-CoA semialdehyde + NADP + Water > 3-Oxo-5,6-dehydrosuberyl-CoA + NADPH + Hydrogen ion
Adenosine triphosphate + L-Methionine + Water > Phosphate + Pyrophosphate + S-Adenosylmethionine
S-Formylglutathione + Water > Hydrogen ion + Formic acid + Glutathione
N2-Succinyl-L-arginine + Water > N2-Succinyl-L-ornithine + Ammonia + Carbon dioxide
N2-Succinyl-L-glutamic acid 5-semialdehyde + NAD + Water > N<SUP>2</SUP>-succinylglutamate + NADH + Hydrogen ion
N<SUP>2</SUP>-succinylglutamate + Water > Succinic acid + L-Glutamate
Water + NAD + Succinic acid semialdehyde > Hydrogen ion + NADH + Succinic acid
Succinic acid semialdehyde + NADP + Water > Succinic acid + NADPH + Hydrogen ion
Water + a sugar phosphate > a sugar + Phosphate
Water + NADP + Hydrogen sulfide < Hydrogen ion + NADPH + Sulfite
a 2,3,4-saturated fatty acyl CoA + Water a 2,3,4-saturated fatty acid + Coenzyme A + Hydrogen ion
O-Phosphohomoserine + Water > Phosphate + L-Threonine
Trimethylamine N-Oxide + NADH + Hydrogen ion > Trimethylamine + NAD + Water
Potassium + Water + Adenosine triphosphate > Potassium + Phosphate + ADP + Hydrogen ion
Magnesium + Water + Adenosine triphosphate > Magnesium + Phosphate + ADP + Hydrogen ion
Adenosine triphosphate + Arsenate + Water > ADP + Arsenate + Phosphate + Hydrogen ion
Heme + Adenosine triphosphate + Water > Phosphate + ADP + Heme + Hydrogen ion
Water + Adenosine triphosphate + D-Methionine > Phosphate + ADP + D-Methionine + Hydrogen ion
Cu<SUP>+</SUP> + Water + Adenosine triphosphate > Cu<SUP>+</SUP> + Phosphate + ADP + Hydrogen ion
Adenosine triphosphate + Water + N-Acetyl-D-glucosamine > N-Acetyl-D-glucosamine + ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + L-Aspartic acid + Water > L-Aspartic acid + ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + L-Ala-D-Glu-meso-A2pm + Water > L-Ala-D-Glu-meso-A2pm + ADP + Phosphate + Hydrogen ion
(2R,4S)-2-Methyl-2,3,3,4-tetrahydroxytetrahydrofuran + Adenosine triphosphate + Water > (2R,4S)-2-Methyl-2,3,3,4-tetrahydroxytetrahydrofuran + ADP + Phosphate + Hydrogen ion
Glycerol 2-phosphate + Water + Adenosine triphosphate > Glycerol 2-phosphate + ADP + Hydrogen ion + Phosphate
selenate + Water + Adenosine triphosphate > selenate + ADP + Phosphate + Hydrogen ion
Selenite + Water + Adenosine triphosphate > Selenite + ADP + Phosphate + Hydrogen ion
&alpha;-D-galactofuranose + Adenosine triphosphate + Water > &alpha;-D-galactofuranose + Phosphate + ADP + Hydrogen ion
Maltotriose + Adenosine triphosphate + Water > ADP + Phosphate + Maltotriose + Hydrogen ion
Maltotetraose + Adenosine triphosphate + Water > ADP + Maltotetraose + Phosphate + Hydrogen ion
Trehalose 6-phosphate + Water > Glucose 6-phosphate + b-D-Glucose
Trehalose + Water > b-D-Glucose + D-Glucose
L-Tryptophan + Water <> Hydrogen ion + Indole + Pyruvic acid + Ammonia
UDP-3-O-(3-Hydroxymyristoyl)-N-acetylglucosamine + Water > UDP-3-O-(3-Hydroxytetradecanoyl)-D-glucosamine + Acetic acid
UDP-N-Acetyl-D-mannosamine + NAD + Water <> UDP-N-Acetyl-D-mannosaminouronate + NADH + Hydrogen ion
a UDP-sugar + Water > Uridine 5'-monophosphate + an &alpha;-D-aldose-1-phosphate + Hydrogen ion
UDP-Glucose + Water + NAD > Hydrogen ion + NADH + Uridine diphosphate glucuronic acid
Undecaprenyl diphosphate + Water > Hydrogen ion + Di-trans,poly-cis-undecaprenyl phosphate + Phosphate
Uridine + Water > D-ribose + Uracil
6-Phosphonoglucono-D-lactone + Water > 6-Phosphogluconic acid
4-Aminobutyraldehyde + NAD + Water > gamma-Aminobutyric acid + NADH
(2S,3R)-3-hydroxybutane-1,2,3-tricarboxylate > Cis-2-Methylaconitate + Water
Holo-[acyl-carrier-protein] + Water > Pantetheine 4'-phosphate + apo-[acyl-carrier-protein]
An acylphosphate + Water > a carboxylate + Inorganic phosphate
Adenosine diphosphate ribose + Water > Adenosine monophosphate + D-Ribose-5-phosphate
Cyclic di-3',5'-guanylate + Water > 5'-phosphoguanylyl(3'->5')guanosine
N-Acetyl-D-galactosamine 6-phosphate + Water > D-Galactosamine 6-phosphate + Acetic acid
D-Galactosamine 6-phosphate + Water > D-Tagatose 6-phosphate + Ammonia
Alpha-D-glucose 1-phosphate + Water > D-Glucose + Inorganic phosphate
2 R'-SH + ROOH > R'-S-S-R' + Water + ROH
Lactaldehyde + NAD + Water > L-Lactic acid + NADH
Glycolaldehyde + NAD + Water > Glycolic acid + NADH
(S)-Ureidoglycolic acid + Water > Glyoxylic acid +2 Ammonia + Carbon dioxide
(S)(+)-Allantoin + Water > Allantoic acid
Adenosine triphosphate + Water + monosaccharide(Out) > ADP + Inorganic phosphate + monosaccharide(In)
RCH(2)NH(2) + Water + Oxygen > RCHO + Ammonia + Hydrogen peroxide
Phenylethylamine + Water + Oxygen > Phenylacetaldehyde + Ammonia + Hydrogen peroxide
A beta-lactam + Water > a substituted beta-amino acid
Adenosine triphosphate + 1,6-Anhydro-N-acetyl-beta-muramate + Water > ADP + N-Acetylmuramic acid 6-phosphate
Diadenosine tetraphosphate + Water >2 ADP
A phosphate monoester + Water > an alcohol + Inorganic phosphate
N-substituted aminoacyl-tRNA + Water > N-substituted amino acid + tRNA
4-deoxy-4-formamido-beta-L-arabinose di-trans,poly-cis-undecaprenyl phosphate + Water > 4-amino-4-deoxy-alpha-L-arabinose di-trans,poly-cis-undecaprenyl phosphate + Formic acid
3-Dehydroquinate > 3-dehydroshikimate + Water
Phosphoenolpyruvic acid + D-Erythrose 4-phosphate + Water > 2-Dehydro-3-deoxy-D-arabino-heptonate 7-phosphate + Inorganic phosphate
Arsenate + glutaredoxin > Arsenite + glutaredoxin disulfide + Water
6-Phospho-beta-D-glucosyl-(1,4)-D-glucose + Water > D-Glucose + Glucose 6-phosphate
A phenol sulfate + Water > a phenol + Sulfate
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water > Adenosine monophosphate + Pyrophosphate + L-Asparagine + L-Glutamate
L-Asparagine + Water > L-Aspartic acid + Ammonia
N2-Succinyl-L-arginine + 2 Water > N2-Succinyl-L-ornithine +2 Ammonia + Carbon dioxide
N2-Succinyl-L-glutamic acid 5-semialdehyde + NAD + Water > N-Succinyl-L-glutamate + NADH
N-Succinyl-L-glutamate + Water > Succinic acid + L-Glutamate
Adenosine triphosphate + Water + K(+)(Out) > ADP + Inorganic phosphate + K(+)(In)
Adenosine triphosphate + Water + Mg(2+)(Out) > ADP + Inorganic phosphate + Mg(2+)(In)
Adenosine triphosphate + Water + H(+)(In) > ADP + Inorganic phosphate + H(+)(Out)
Adenosine triphosphate + Water + Cd(2+)(In) > ADP + Inorganic phosphate + Cd(2+)(Out)
Adenosine triphosphate + Water + Zn(2+)(In) > ADP + Inorganic phosphate + Zn(2+)(Out)
Betaine aldehyde + NAD + Water > Betaine + NADH
A beta-D-glucuronoside + Water > D-Glucuronic acid + an alcohol
Pimelyl-[acyl-carrier protein] methyl ester + Water > pimelyl-[acyl-carrier protein] + Methanol
Adenosine triphosphate + Water + vitamin B12(Out) > ADP + Inorganic phosphate + vitamin B12(In)
Carbonic acid > Carbon dioxide + Water
Inorganic phosphate + Oxalacetic acid > Water + Phosphoenolpyruvic acid + Carbonic acid
2 Adenosine triphosphate + L-Glutamine + Carbonic acid + Water >2 ADP + Inorganic phosphate + L-Glutamate + Carbamoylphosphate
2 Hydrogen peroxide > Oxygen +2 Water
Adenosine triphosphate + Water + heme(In) > ADP + Inorganic phosphate + heme(Out)
CDP-diacylglycerol + Water > Cytidine monophosphate + phosphatidate
Protein L-glutamate O(5)-methyl ester + Water > protein L-glutamate + Methanol
Acetyl-CoA + Water + Oxalacetic acid > Citric acid + CoA
Adenosylcobalamin + Water > Adenosylcobalamin + Inorganic phosphate
N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole + Water > alpha-ribazole + Inorganic phosphate
Adenosine triphosphate + Water + Cu(+)(In) > ADP + Inorganic phosphate + Cu(+)(Out)
Cyclic AMP + Water > Adenosine monophosphate
Nucleoside 2',3'-cyclic phosphate + Water > nucleoside 3'-phosphate
A 3'-ribonucleotide + Water > a ribonucleoside + Inorganic phosphate
Ubiquinol-8 + Oxygen > Ubiquinone-8 + Water
Adenosine triphosphate + Water + sulfate(Out) > ADP + Inorganic phosphate + sulfate(In)
Hydrogen sulfide + 3 NADP + 3 Water > Sulfite +3 NADPH
Adenosine 3',5'-diphosphate + Water > Adenosine monophosphate + Inorganic phosphate
A D-amino acid + Water + acceptor > a 2-oxo acid + Ammonia + reduced acceptor
L-Aspartate-semialdehyde + Pyruvic acid > (S)-2,3-dihydrodipicolinate +2 Water
Succinyl-CoA + (S)-2,3,4,5-tetrahydropyridine-2,6-dicarboxylate + Water > CoA + N-Succinyl-2-amino-6-ketopimelate
N-succinyl-L-2,6-diaminoheptanedioate + Water > Succinic acid + Diaminopimelic acid
Adenosine triphosphate + Water > ADP + Inorganic phosphate
D-Cysteine + Water > Hydrogen sulfide + Ammonia + Pyruvic acid
Formyl-L-methionyl peptide + Water > Formic acid + methionyl peptide
Galactonic acid > 2-Dehydro-3-deoxy-D-galactonate + Water
dGTP + Water > Deoxyguanosine + Triphosphate
L-Glutamate + Water + NADP > Oxoglutaric acid + Ammonia + NADPH
Cis-4-Carboxymethylenebut-2-en-4-olide + Water > 4-Oxohex-2-enedioate
Dimethyl sulfide + Menaquinone + Water > Dimethyl sulfoxide + Menaquinol 6
2,3-diaminopropionate + Water > Pyruvic acid +2 Ammonia
2 Iron + Hydrogen peroxide + 2 Hydrogen ion >2 Fe3+ +2 Water
Deoxyuridine triphosphate + Water > dUMP + Pyrophosphate
D-Erythrose 4-phosphate + NAD + Water > 4-Phospho-D-erythronate + NADH
2-Phospho-D-glyceric acid > Phosphoenolpyruvic acid + Water
Isochorismate + Water > 2,3-dihydroxy-2,3-dihydrobenzoate + Pyruvic acid
Protein tyrosine phosphate + Water > protein tyrosine + Inorganic phosphate
Fructose 1,6-bisphosphate + Water > Fructose 6-phosphate + Inorganic phosphate
(3R)-3-hydroxydecanoyl-[acyl-carrier-protein] > trans-dec-2-enoyl-[acyl-carrier-protein] + Water
(3R)-3-hydroxydecanoyl-[acyl-carrier-protein] > cis-dec-3-enoyl-[acyl-carrier-protein] + Water
(3S)-3-hydroxyacyl-CoA > trans-2(or 3)-enoyl-CoA + Water
Adenosine triphosphate + Water + Fe(3+)(Out) > ADP + Inorganic phosphate + Fe(3+)(In)
Phenylacetaldehyde + NAD + Water > Benzeneacetic acid + NADH
Adenosine triphosphate + Water + iron chelate(Out) > ADP + Inorganic phosphate + iron chelate(In)
5,10-Methenyltetrahydrofolate + Water > N10-Formyl-THF
Fructoselysine-6-phosphate + Water > Glucose 6-phosphate + L-Lysine
L-Malic acid > Fumaric acid + Water
Succinic acid semialdehyde + NADP + Water > Succinic acid + NADPH
Guanosine triphosphate + Water > Formic acid + 2-amino-4-hydroxy-6-(erythro-1,2,3-trihydroxypropyl)-dihydropteridine triphosphate
S-(2-hydroxyacyl)glutathione + Water > Glutathione + a 2-hydroxy carboxylate
A glycerophosphodiester + Water > an alcohol + Glycerol 3-phosphate
L-Glutamine + Water > L-Glutamate + Ammonia
5,10-Methylene-THF + Glycine + Water > Tetrahydrofolic acid + L-Serine
D-Glycero-D-manno-heptose 1,7-bisphosphate + Water > D-glycero-beta-D-manno-heptose 1-phosphate + Inorganic phosphate
Guanosine diphosphate mannose + Water > Guanosine diphosphate + D-Mannose
Phosphoglycolic acid + Water > Glycolic acid + Inorganic phosphate
Guanosine 3'-diphosphate 5'-triphosphate + Water > Guanosine 3',5'-bis(diphosphate) + Inorganic phosphate
Adenosine triphosphate + Xanthylic acid + L-Glutamine + Water > Adenosine monophosphate + Pyrophosphate + Guanosine monophosphate + L-Glutamate
D-glucarate > 5-Dehydro-4-deoxy-D-glucarate + Water
D-Lactic acid > Pyruvaldehyde + Water
2 5-Aminolevulinic acid > Porphobilinogen +2 Water
4 Porphobilinogen + Water > Hydroxymethylbilane +4 Ammonia
Hydroxymethylbilane > Uroporphyrinogen III + Water
Coproporphyrinogen III + Oxygen + 2 Hydrogen ion > Protoporphyrinogen IX +2 Carbon dioxide +2 Water
Phosphoribosyl-ATP + Water > 1-(5-phosphoribosyl)-AMP + Pyrophosphate
1-(5-phosphoribosyl)-AMP + Water > 1-(5-phosphoribosyl)-5-((5-phosphoribosylamino)methylideneamino)imidazole-4-carboxamide
5-((5-phospho-1-deoxyribulos-1-ylamino)methylideneamino)-1-(5-phosphoribosyl)imidazole-4-carboxamide + L-Glutamine > imidazole-glycerol phosphate + N5-Carboxyaminoimidazole ribonucleotide + L-Glutamate + Water
Histidinol phosphate + Water > L-Histidinol + Inorganic phosphate
L-Histidinol + Water + 2 NAD > L-Histidine +2 NADH
5-Hydroxyisourate + Water > 5-Hydroxy-2-oxo-4-ureido-2,5-dihydro-1H-imidazole-5-carboxylate
2,3-Dihydroxyisovaleric acid > a-Ketoisovaleric acid + Water
Inosinic acid + NAD + Water > Xanthylic acid + NADH
Pyrophosphate + Water >2 Inorganic phosphate
1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + Water + 2 oxidized ferredoxin > 2-C-Methyl-D-erythritol 2,4-cyclodiphosphate +2 reduced ferredoxin
Isopentenyl pyrophosphate + NAD(P)(+) + Water > 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NAD(P)H
Dimethylallylpyrophosphate + NAD(P)(+) + Water > 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NAD(P)H
Donor + Hydrogen peroxide > oxidized donor +2 Water
Phosphoenolpyruvic acid + D-Arabinose 5-phosphate + Water > 3-Deoxy-D-manno-octulosonate 8-phosphate + Inorganic phosphate
3-Deoxy-D-manno-octulosonate 8-phosphate + Water > 3-Deoxy-D-manno-octulosonate + Inorganic phosphate
GlcNAc-MurNAc-L-alanyl-gamma-D-glutamyl-meso-diaminopimelyl-D-alanine + Water > GlcNAc-MurNAc-L-alanyl-gamma-D-glutamyl-meso-diaminopimelate + D-Alanine
Guanosine triphosphate + Water > Guanosine diphosphate + Inorganic phosphate
Acetyl-CoA + a-Ketoisovaleric acid + Water > 2-Isopropylmalic acid + CoA
3-Isopropylmalate > Isopropylmaleate + Water
Isopropylmaleate + Water > 2-Isopropylmalic acid
UDP-3-O-(3-Hydroxymyristoyl)-N-acetylglucosamine + Water > UDP-3-O-(3-hydroxytetradecanoyl)-glucosamine + Acetic acid
UDP-2,3-bis((3R)-3-hydroxymyristoyl)-alpha-D-glucosamine + Water > 2,3-bis((3R)-3-hydroxymyristoyl)-beta-D-glucosaminyl 1-phosphate + Uridine 5'-monophosphate
Adenosine triphosphate + Water + D-Maltose > ADP + Inorganic phosphate + D-Maltose
L-Cystathionine + Water > L-Homocysteine + Ammonia + Pyruvic acid
Acetyl-CoA + Water + Glyoxylic acid > L-Malic acid + CoA
Adenosine triphosphate + Water > Adenosine monophosphate + Pyrophosphate
Adenosine triphosphate + Water + xenobiotic(In) > ADP + Inorganic phosphate + xenobiotic(Out)
4-(2-Carboxyphenyl)-4-oxobutanoyl-CoA > 1,4-Dihydroxy-2-naphthoyl-CoA + Water
Adenosine triphosphate + L-Methionine + Water > Inorganic phosphate + Pyrophosphate + S-adenosyl-L-methionine
3-(3-Hydroxyphenyl)propanoic acid + NADH + Oxygen > 3-(2,3-Dihydroxyphenyl)propanoate + Water + NAD
3-Hydroxycinnamic acid + NADH + Oxygen > Trans-2,3-Dihydroxycinnamate + Water + NAD
(2E,4Z)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate + Water > 2-oxopent-4-enoate + Succinic acid
(2E,4Z,7E)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate + Water > 2-oxopent-4-enoate + Fumaric acid
4-Hydroxy-2-oxopentanoate > 2-Hydroxy-2,4-pentadienoate + Water
2-O-(6-Phospho-alpha-D-mannosyl)-D-glycerate + Water > Mannose 6-phosphate + Glyceric acid
Cyclic pyranopterin monophosphate + 2 [molybdopterin-synthase sulfur-carrier protein]-Gly-NH-CH(2)-C(O)SH + Water > molybdopterin forma +2 [molybdopterin-synthase sulfur-carrier protein]
Adenosine triphosphate + Water + Molybdate > ADP + Inorganic phosphate + Molybdate
2(alpha-D-mannosyl)-3-phosphoglycerate + Water > 2(alpha-D-Mannosyl)-D-glycerate + Inorganic phosphate
Peptide-L-methionine + thioredoxin disulfide + Water > peptide-L-methionine (S)-S-oxide + thioredoxin
L-Methionine + thioredoxin disulfide + Water > L-methionine (S)-S-oxide + thioredoxin
Peptide-L-methionine + thioredoxin disulfide + Water > peptide-L-methionine (R)-S-oxide + thioredoxin
L-Methionine + thioredoxin disulfide + Water > L-Methionine (R)-S-oxide + thioredoxin
S-Adenosylhomocysteine + Water > S-Ribosyl-L-homocysteine + Adenine
5'-Methylthioadenosine + Water > S-methyl-5-thio-D-ribose + Adenine
N-methyl-L-tryptophan + Water + Oxygen > L-Tryptophan + Formaldehyde + Hydrogen peroxide
N-Acetylmuramic acid 6-phosphate + Water > N-Acetyl-D-Glucosamine 6-Phosphate + D-Lactic acid
8-oxo-dGTP + Water > 8-oxo-dGMP + Pyrophosphate
Dihydroxyacetone phosphate + Iminoaspartic acid > Quinolinic acid +2 Water + Inorganic phosphate
N-Acetyl-D-Glucosamine 6-Phosphate + Water > D-glucosamine 6-phosphate + Acetic acid
D-glucosamine 6-phosphate + Water > Fructose 6-phosphate + Ammonia
A 5'-ribonucleotide + Water > a ribonucleoside + Inorganic phosphate
A nucleoside triphosphate + Water > a nucleoside diphosphate + Inorganic phosphate
Adenosine triphosphate + Water + Ni(2+)(Out) > ADP + Inorganic phosphate + Ni(2+)(In)
Adenosine triphosphate + Water + Nickel > ADP + Inorganic phosphate + Nickel
Ammonium hydroxide + 3 NAD(P)(+) + Water > Nitrite +3 NAD(P)H
2'-deoxyribonucleoside triphosphate + thioredoxin disulfide + Water > ribonucleoside triphosphate + thioredoxin
Ammonia + 2 Water + 6 Ferricytochrome c > Nitrite +6 Ferrocytochrome c +7 Hydrogen ion
NAD + Water > Adenosine monophosphate + NMN
Cytidine triphosphate + Water > Cytidine monophosphate + Pyrophosphate
Nucleoside triphosphate + Water > nucleoside monophosphate + Pyrophosphate
Guanosine diphosphate mannose + Water > Guanosine monophosphate + Alpha-D-mannose 1-phosphate
Trehalose 6-phosphate + Water > Trehalose + Inorganic phosphate
Phosphatidylcholine + Water > 2-Acylglycerophosphocholine + a carboxylate
Phosphatidylcholine + Water > 1-acylglycerophosphocholine + a carboxylate
Phenylacetyl-CoA + NADPH + Oxygen > 2-(1,2-Epoxy-1,2-dihydrophenyl)acetyl-CoA + NADP + Water
2-Oxepin-2(3H)-ylideneacetyl-CoA + Water > 3-Oxo-5,6-dehydrosuberyl-CoA semialdehyde
3-Oxo-5,6-dehydrosuberyl-CoA semialdehyde + NADP + Water > 3-Oxo-5,6-dehydrosuberyl-CoA + NADPH
5,10-Methylene-THF + a-Ketoisovaleric acid + Water > Tetrahydrofolic acid + 2-Dehydropantoate
Putrescine + Oxoglutaric acid > L-Glutamate + 1-Pyrroline + Water
Pyridoxamine 5'-phosphate + Water + Oxygen > Pyridoxal 5'-phosphate + Ammonia + Hydrogen peroxide
1-Deoxy-D-xylulose 5-phosphate + 2-Amino-3-phosphonopropionic acid > Pyridoxine 5'-phosphate + Inorganic phosphate +2 Water
Phosphatidylglycerophosphate + Water > phosphatidylglycerol + Inorganic phosphate
1,2-diacyl-sn-glycerol 3-diphosphate + Water > 1,2-diacyl-sn-glycerol 3-phosphate + Inorganic phosphate
A 1,2-diacylglycerol 3-phosphate + Water > a 1,2-diacyl-sn-glycerol + Inorganic phosphate
Undecaprenyl diphosphate + Water > di-trans,octa-cis-undecaprenyl phosphate + Inorganic phosphate
Prephenate > Phenylpyruvic acid + Water + Carbon dioxide
Adenosine triphosphate + Water + phosphonate(Out) > ADP + Inorganic phosphate + phosphonate(In)
2-lysophosphatidylcholine + Water > Glycerophosphocholine + a carboxylate
Niacinamide + Water > Nicotinic acid + Ammonia
Adenosine triphosphate + Water + polyamine(Out) > ADP + Inorganic phosphate + polyamine(In)
Pyruvic acid + Ubiquinone-10 + Water > Acetic acid + Carbon dioxide + Ubiquinol-1
Myo-inositol hexakisphosphate + Water > 1D-myo-inositol 1,2,3,5,6-pentakisphosphate + Inorganic phosphate
Adenosine triphosphate + Pyruvic acid + Water > Adenosine monophosphate + Phosphoenolpyruvic acid + Inorganic phosphate
(Polyphosphate)(n) + Water > (polyphosphate)(n-1) + Inorganic phosphate
A phosphoprotein + Water > a protein + Inorganic phosphate
Propionyl-CoA + Water + Oxalacetic acid > (2R,3S)-2-Hydroxybutane-1,2,3-tricarboxylate + CoA
(2S,3S)-2-hydroxybutane-1,2,3-tricarboxylate > Cis-2-Methylaconitate + Water
Adenosine triphosphate + Water + phosphate(Out) > ADP + Inorganic phosphate + phosphate(In)
Pseudouridine 5'-phosphate + Water > Uracil + D-Ribose-5-phosphate
5-Phosphoribosylamine + Pyrophosphate + L-Glutamate > L-Glutamine + Phosphoribosyl pyrophosphate + Water
Adenosine triphosphate + 5'-phosphoribosyl-N-formylglycinamide + L-Glutamine + Water > ADP + Inorganic phosphate + 2-(Formamido)-N(1)-(5-phospho-D-ribosyl)acetamidine + L-Glutamate
Inosinic acid + Water > Phosphoribosyl formamidocarboxamide
N10-Formyl-THF + Water > Formic acid + Tetrahydrofolic acid
(S)-1-pyrroline-5-carboxylate + NAD(P)(+) + 2 Water > L-Glutamate + NAD(P)H
gamma-Glutamyl-L-putrescine + Water + Oxygen > Gamma-glutamyl-gamma-aminobutyraldehyde + Ammonia + Hydrogen peroxide
Gamma-glutamyl-gamma-aminobutyraldehyde + NAD + Water > 4-(Glutamylamino) butanoate + NADH
Aldehyde + NAD(P)(+) + Water > a carboxylate + NAD(P)H
(S)-dihydroorotate + Water > Ureidosuccinic acid
7-Deaza-7-carboxyguanine + Ammonia + Adenosine triphosphate > 7-Cyano-7-carbaguanine + ADP + Inorganic phosphate + Water
Dihydroneopterin triphosphate + Water > 6-Carboxy-5,6,7,8-tetrahydropterin + Acetaldehyde + Triphosphate
A nucleoside triphosphate + Water > a nucleotide + Pyrophosphate
L-Rhamnonate > 2-Dehydro-3-deoxy-L-rhamnonate + Water
Guanosine triphosphate + 3 Water > Formic acid + 2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Pyrophosphate
Iminobutyrate + Water > 2-Ketobutyric acid + Ammonia
A pyrimidine nucleoside + Water > Ribose + a pyrimidine base
2'-deoxyribonucleoside diphosphate + thioredoxin disulfide + Water > ribonucleoside diphosphate + thioredoxin
L-3,4-Dihydroxybutan-2-one 4-phosphate + 5-amino-6-ribitylamino-2,4(1h,3h)-pyrimidinedione > 6,7-dimethyl-8-(D-ribityl)lumazine +2 Water + Inorganic phosphate
dTDP-glucose > dTDP-4-dehydro-6-deoxy-D-glucose + Water
Uracil + FMNH(2) + Oxygen > Ureidoacrylate peracid + Flavin Mononucleotide + Water
Thymine + FMNH(2) + Oxygen > (Z)-2-Methyl-ureidoacrylate peracid + Flavin Mononucleotide + Water
Ureidoacrylate peracid + Water > Peroxyaminoacrylate + Ammonia
(Z)-3-Ureidoacrylate + Water > 3-Aminoacrylate + Carbon dioxide + Ammonia
(Z)-2-Methyl-ureidoacrylate peracid + Water > (Z)-2-Methyl-peroxyaminoacrylate + Carbon dioxide + Ammonia
3-Aminoacrylate + Water > Malonic acid + Ammonia
Succinic acid semialdehyde + NAD(P)(+) + Water > Succinic acid + NAD(P)H
Adenosine triphosphate + Hydrogen selenide + Water > Adenosine monophosphate + Phosphoroselenoic acid + Inorganic phosphate
O-Phospho-D-serine + Water > L-Serine + Inorganic phosphate
S-Formylglutathione + Water > Glutathione + Formic acid
Guanosine 3',5'-bis(diphosphate) + Water > Guanosine diphosphate + Pyrophosphate
An alkanesufonate (R-CH(2)-SO(3)H) + FMNH(2) + Oxygen > an aldehyde (R-CHO) + Flavin Mononucleotide + Sulfite + Water
Myo-inositol phosphate + Water > Myoinositol + Inorganic phosphate
Sugar phosphate + Water > Sucrose + Inorganic phosphate
Adenosine triphosphate + Water + Taurine > ADP + Inorganic phosphate + Taurine
1-Deoxy-D-xylulose 5-phosphate + 2-iminoacetate + thiocarboxy-adenylate-[sulfur-carrier protein ThiS] > 2-((2R,5Z)-2-Carboxy-4-methylthiazol-5(2H)-ylidene)ethyl phosphate + [sulfur-carrier protein ThiS] +2 Water
O-Phosphohomoserine + Water > L-Threonine + Inorganic phosphate
(tRNA(Ile2))-cytidine(34) + L-Lysine + Adenosine triphosphate > (tRNA(Ile2))-lysidine(34) + Adenosine monophosphate + Pyrophosphate + Water
L-Tryptophan + Water > Indole + Pyruvic acid + Ammonia
Trimethylamine + 2 (ferricytochrome c)-subunit + Water > Trimethylamine N-Oxide +2 (ferrocytochrome c)-subunit +2 Hydrogen ion
Trehalose + Water > b-D-Glucose + alpha-D-Glucose
L-Serine + Indoleglycerol phosphate > L-Tryptophan + glyceraldehyde 3-phosphate + Water
1-(2-Carboxyphenylamino)-1'-deoxy-D-ribulose 5'-phosphate > 1-C-(3-indolyl)-glycerol 3-phosphate + Carbon dioxide + Water
Tartaric acid > Oxalacetic acid + Water
UDP-Glucose + 2 NAD + Water > UDP-Glucuronic acid +2 NADH
Adenosine triphosphate + Water + Glycerol 3-phosphate > ADP + Inorganic phosphate + Glycerol 3-phosphate
UDP-sugar + Water > Uridine 5'-monophosphate + alpha-D-aldose 1-phosphate
UDP-N-Acetyl-D-mannosamine + 2 NAD + Water > UDP-N-Acetyl-D-mannosaminouronate +2 NADH
Xanthine + NAD + Water > Uric acid + NADH
Hypoxanthine + NAD + Water > Xanthine + NADH
Pyridoxal 5'-phosphate + Water > Pyridoxal + Inorganic phosphate
2 Ferrocytochrome c + Hydrogen peroxide >2 Ferricytochrome c +2 Water
2-Deoxy-D-glucose 6-phosphate + Water > 2-Deoxyglucose + Inorganic phosphate
Succinic acid semialdehyde + NAD + NADP + Water <> Succinic acid + NADH + NADPH +2 Hydrogen ion
L-Threonine + 2-Aminobut-2-enoate + 2-Iminobutanoate + Water <> 2-Ketobutyric acid + Ammonia
Adenosine triphosphate + Uridine triphosphate + L-Glutamine + Water + Ammonia <> ADP + Phosphate + Cytidine triphosphate + L-Glutamate
2'-Deoxyribonucleoside diphosphate + Thioredoxin disulfide + Water <> Ribonucleoside diphosphate + Thioredoxin
Protein tyrosine phosphate + Water <> Protein tyrosine + Phosphate
Cellobiose-6-phosphate + Water <> D-Glucose + Glucose 6-phosphate
N-Substituted aminoacyl-tRNA + Water <> N-Substituted amino acid + tRNA
Isopentenyl pyrophosphate + NAD + NADP + Water + Dimethylallylpyrophosphate <> 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH + NADPH + Hydrogen ion
Tetrahydrodipicolinate + NAD + NADP + Water <> (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate + NADH + NADPH + Hydrogen ion
2 Adenosine triphosphate + L-Glutamine + Hydrogen carbonate + Water + Ammonia + Carbamic acid + Carboxyphosphate <>2 ADP + Phosphate + L-Glutamate + Carbamoylphosphate
8-oxo-dGTP + Water <> 8-oxo-dGMP + Pyrophosphate
Citric acid + cis-Aconitic acid + Water <> Isocitric acid
(3R)-3-Hydroxyacyl-[acyl-carrier protein] <> trans-2,3-Dehydroacyl-[acyl-carrier protein] + Water
Pyruvic acid + L-Aspartate-semialdehyde <> (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate + Water
3-(3-Hydroxyphenyl)propanoic acid + NADH + Hydrogen ion + Oxygen + 3-Hydroxycinnamic acid <> 3-(2,3-Dihydroxyphenyl)propionic acid + Water + NAD + Trans-2,3-Dihydroxycinnamate
2-Hydroxy-6-ketononadienedicarboxylate + Water + 2-Hydroxy-6-ketononatrienedioate <> Succinic acid + Fumaric acid
Orthophosphoric monoester + Water <> Alcohol + Phosphate
5'-Ribonucleotide + Water <> Ribonucleoside + Phosphate
2 Thiol-containing reductant + ROOH <> Oxidized thiol-containing reductant + Water + ROH
2(alpha-D-Mannosyl-6-phosphate)-D-glycerate + Water <> Mannose 6-phosphate + Glyceric acid
Menaquinone + Water + Dimethyl sulfide <> Menaquinol 6
Water <> Carboxylate + Phosphate
Glucose 1-phosphate + Water <> D-Glucose + Phosphate
D-Amino acid + Water + Acceptor <> 2-Oxo acid + Ammonia + Reduced acceptor
(3S)-3-Hydroxyacyl-CoA <> trans-2,3-Dehydroacyl-CoA + trans-3-Enoyl-CoA + Water
Selenite + Water + Acceptor <> Selenate + Reduced acceptor
L-Cystathionine + Water + 2-Aminoacrylic acid + 2-Iminopropanoate <> L-Homocysteine + Pyruvic acid + Ammonia
Cytidine triphosphate + Water + dCTP <> Cytidine monophosphate + Pyrophosphate + dCMP
L-Serine + 2-Aminoacrylic acid + 2-Iminopropanoate + Water <> Pyruvic acid + Ammonia
D-Lactic acid <> Pyruvaldehyde + Water
L-Histidinol + 2 NAD + Water <> L-Histidine +2 NADH +3 Hydrogen ion
Cytidine + Water + Deoxycytidine <> Uridine + Ammonia + Deoxyuridine
Deoxynucleoside 5'-phosphate + Water <> Deoxynucleoside + Phosphate
D-Serine + 2-Aminoacrylic acid + 2-Iminopropanoate + Water <> Pyruvic acid + Ammonia
Arsenate ion + Glutaredoxin <> Arsenite + Glutaredoxin disulfide + Water
Polyphosphate + Water <> Phosphate
myo-Inositol phosphate + Water <> Inositol + Phosphate
Water <> Phosphate
2,3-Diaminopropanoate + Water <> Pyruvic acid +2 Ammonia
Xanthosine 5-triphosphate + Water + 2'-Deoxyinosine triphosphate <> Xanthylic acid + Pyrophosphate + DIMP
Ethylenediamine + alpha-Ketoglutarate + 4-Aminobutyraldehyde <> 1-Pyrroline + L-Glutamate + Water
2 L-Glutamate + NADP + Ammonia + Water <> L-Glutamine + alpha-Ketoglutarate + NADPH + Hydrogen ion
Formyl-L-methionyl peptide + Water <> Formic acid + Methionyl peptide
Trehalose + Water <> b-D-Glucose + alpha-D-Glucose
L-Tryptophan + Water + 2-Aminoacrylic acid + 2-Iminopropanoate <> Indole + Pyruvic acid + Ammonia
Phosphatidylcholine + Water <> Carboxylate + 2-Acylglycerophosphocholine
1-Acyl-sn-glycero-3-phosphocholine + Water <> Glycerophosphocholine + Carboxylate
Reduced acceptor + Hydrogen peroxide <> Acceptor + Water + Oxygen
Adenosine 3',5'-diphosphate + Water <> Adenosine monophosphate + Phosphate
Phosphoserine + O-Phospho-D-serine + Water <> L-Serine + D-Serine + Phosphate
L-Carnitinyl-CoA <> (E)-4-(Trimethylammonio)but-2-enoyl-CoA + Water
3-Isopropylmalate + Isopropylmaleate + Water <> 2-Isopropylmalic acid
S-(2-Hydroxyacyl)glutathione + Water <> Glutathione + 2-Hydroxy carboxylate
7-Deaza-7-carboxyguanine + Ammonia + Adenosine triphosphate <> 7-Cyano-7-carbaguanine + ADP + Phosphate + Water
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water + Ammonia <> Adenosine monophosphate + Pyrophosphate + L-Asparagine + L-Glutamate
Pectin + Water <> Methanol + Pectic acid
Ammonia + Water + Acceptor <> Hydroxylamine + Reduced acceptor
Alkanesulfonate + FMNH + Oxygen <> Aldehyde + Flavin Mononucleotide + Sulfite + Water
Ureidoacrylate peracid + Water + Carbamic acid + (Z)-2-Methyl-ureidoacrylate peracid <> Peroxyaminoacrylate + Carbon dioxide + Ammonia + (Z)-2-Methyl-peroxyaminoacrylate
L-Serine + Indoleglycerol phosphate + Indole <> L-Tryptophan + D-Glyceraldehyde 3-phosphate + Water
Primary amine + Water + Oxygen <> Aldehyde + Ammonia + Hydrogen peroxide
D-Alanyl-D-alanine + Water <> D-Alanine
Pyridoxamine 5'-phosphate + Water + Oxygen + Pyridoxine 5'-phosphate <> Pyridoxal 5'-phosphate + Ammonia + Hydrogen peroxide
Adenosine triphosphate + 1,6-Anhydro-N-acetyl-beta-muramate + Water <> ADP + N-Acetylmuramic acid 6-phosphate
Peptide-L-methionine + Thioredoxin disulfide + Water <> Peptide-L-methionine (R)-S-oxide + Thioredoxin
Protein glutamate methyl ester + Water <> Protein glutamate + Methanol
Guanosine triphosphate + Water <> Formic acid + Dihydroneopterin triphosphate
Pyrimidine nucleoside + Water <> Ribose + Pyrimidine
Glycerophosphodiester + Water <> Alcohol + Glycerol 3-phosphate
Adenosine triphosphate + Xanthylic acid + L-Glutamine + Water + Ammonia <> Adenosine monophosphate + Pyrophosphate + Guanosine monophosphate + L-Glutamate
Water <> Ammonia
NMN + Water <> Nicotinamide ribotide + Ammonia
Triphosphate + Water <> Pyrophosphate + Phosphate
L-Threonine + Adenosine triphosphate + Hydrogen carbonate <> L-Threonylcarbamoyladenylate + Pyrophosphate + Water
Ferrocytochrome c + Hydrogen peroxide <> Ferricytochrome c + Water
Aryl sulfate + Water <> Phenol + Sulfate
1-Deoxy-D-xylulose 5-phosphate + 2-iminoacetate <> 2-[(2R,5Z)-2-Carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate +2 Water
Water <> Ribose 1,5-bisphosphate
alpha-D-Ribose 1-methylphosphonate 5-triphosphate + Water <> alpha-D-Ribose 1-methylphosphonate 5-phosphate + Pyrophosphate
beta-Lactam + Water <> Substituted beta-amino acid
2',3'-Cyclic nucleotide + Water <> Nucleoside 3'-phosphate
Peptide-L-methionine + Thioredoxin disulfide + Water + L-Methionine <> Peptide-L-methionine (S)-S-oxide + Thioredoxin + L-methionine (S)-S-oxide
Pyrophosphate + Water <> Phosphate
2'-Deoxyribonucleoside triphosphate + Thioredoxin disulfide + Water <> Ribonucleoside triphosphate + Thioredoxin
Trehalose 6-phosphate + Water <> D-Glucose + Glucose 6-phosphate
UDP-sugar + Water <> Uridine 5'-monophosphate + alpha-D-Aldose 1-phosphate
Ammonia + NAD + 3 NADP + 2 Water <> Nitrite + NADH +3 NADPH +5 Hydrogen ion
3'-Ribonucleotide + Water <> Ribonucleoside + Phosphate
Ester + Water <> Alcohol + Carboxylate
Nucleoside triphosphate + Water <> NDP + Phosphate
1-Deoxy-D-xylulose 5-phosphate + 2-Amino-3-phosphonopropionic acid + 1-Deoxy-D-xylulose 5-phosphate + 2-Amino-3-phosphonopropionic acid > Pyridoxine 5'-phosphate + Phosphate + Hydrogen ion +2 Water
Nitrate + cytochrome c nitrite reductase + Nitrate <> Nitrite + cytochrome c nitrite reductase + Water + Nitrite
Selenate + 2 Hydrogen ion + 2 Electron > Selenite + Water
Nitrite + 3 NADH + 5 Hydrogen ion + Nitrite Ammonia +2 Water +3 NAD
Nitrite + 6 ferrocytochrome c + 7 Hydrogen ion + Nitrite + 6 Ferrocytochrome c <> Ammonia +6 ferricytochrome c +2 Water +6 Ferricytochrome c
Hydroxylamine + cytochrome c nitrite reductase <> Ammonia + Water + cytochrome c nitrite reductase
Carbon dioxide + Water > Hydrogen carbonate
Carbon dioxide + Water > Carbamic acid
Hydrogen ion + NADPH + Ammonia + NADPH <> Water + NADP + L-Glutamic acid + L-Glutamate
Oxoglutaric acid + NADPH + Ammonium + Hydrogen ion + NADPH > L-Glutamic acid + Water + NADP + L-Glutamate
Water + Benzoyl phosphate > Benzoic acid + Phosphate
Crotonoyl-CoA + Water > (3S)-3-hydroxyacyl-CoA + (3S)-3-Hydroxyacyl-CoA
(2E)-5-Methylhexa-2,4-dienoyl-CoA + Water > 3-Hydroxy-5-methylhex-4-enoyl-CoA
Water + 5-Carboxy-2-pentenoyl-CoA > (3S)-3-Hydroxyadipyl-CoA
a trans-2-enoyl-CoA  > Water + (3S)-3-hydroxyacyl-CoA
Crotonoyl-CoA > Water + 3-Hydroxybutyryl-CoA + 3-Hydroxybutyryl-CoA
(2E)-Decenoyl-CoA > Water + (S)-Hydroxydecanoyl-CoA
trans-2-Hexenoyl-CoA > (S)-Hydroxyhexanoyl-CoA + Water
(2E)-Dodecenoyl-CoA > Water + (S)-3-Hydroxydodecanoyl-CoA
(2E)-Tetradecenoyl-CoA > Water + (S)-3-Hydroxytetradecanoyl-CoA
(2E)-Octenoyl-CoA > Water + (S)-Hydroxyoctanoyl-CoA + (S)-Hydroxyoctanoyl-CoA
(2E)-Hexadecenoyl-CoA > Water + (S)-3-Hydroxyhexadecanoyl-CoA
trans-Octadec-2-enoyl-CoA + Trans-Octadec-2-enoyl-CoA > (S)-3-Hydroxyoctadecanoyl-CoA + Water
Water + 4-nitrophenylphosphate > Phosphate + 4-Nitrophenol
Water + isochorismate + Isochorismate > Pyruvic acid + 2,3-dihydroxy-2,3-dihydrobenzoate
3-Hydroxyglutaryl-[acp] methyl ester > Water + Enoylglutaryl-[acp] methyl ester
3-Hydroxypimeloyl-[acp] methyl ester > an enoylpimeloyl-[acp] methyl ester + Water
a 3R-hydroxy cis Δ7-tetradecenoyl-[acp] > Water + trans-Δ3-cis-Δ7-tetradecenoyl-[acp]
3R-hydroxy cis Δ9-hexadecenoyl-[acp] > Water + trans-Δ3-cis-Δ9-hexadecenoyl-[acp]
(R)-3-hydroxy-cis-vaccenoyl-[acp] > Water + cis-vaccen-2-enoyl-[acp]
(3R)-3-hydroxyacyl-[acyl-carrier protein] > Water + trans-2-enoyl-[acyl-carrier protein]
(R)-3-hydroxybutanoyl-[acp] > Water + crotonyl-[acp]
(R)-3-hydroxyhexanoyl-[acp] > Water + trans hex-2-enoyl-[acp]
an (R)-3-hydroxydecanoyl-[acp]  > Water + a trans-Δ2-decenoyl-[acp] 
(R)-3-hydroxydodecanoyl-[acp] > Water + trans dodec-2-enoyl-[acp]
(R)-3-hydroxypalmitoyl-[acp] > Water + trans hexadecenoyl-[acp]
a 3R-hydroxyglutaryl-[acp] methyl ester > Water + Enoylglutaryl-[acp] methyl ester
a pimeloyl-[acp] methyl ester + Water > Methanol + a pimeloyl-[acp]
(S)-3-Hydroxyhexadecanoyl-CoA <> (2E)-Hexadecenoyl-CoA + Water
(S)-3-Hydroxytetradecanoyl-CoA <> (2E)-Tetradecenoyl-CoA + Water
(S)-Hydroxydecanoyl-CoA <> (2E)-Decenoyl-CoA + Water
(S)-Hydroxyoctanoyl-CoA + (S)-Hydroxyoctanoyl-CoA <> (2E)-Octenoyl-CoA + Water
(S)-Hydroxyhexanoyl-CoA <> trans-2-Hexenoyl-CoA + Water
3-Hydroxybutyryl-CoA + 3-Hydroxybutyryl-CoA <> Crotonoyl-CoA + Water
(S)-3-Hydroxydodecanoyl-CoA > (2E)-Tetradecenoyl-CoA + Water
Biocytin + Water > Biotin + L-Lysine + L-Lysine
L-Glutamine + Water > L-Glutamic acid + Ammonia + L-Glutamate
D-Glutamine + Water > D-Glutamic acid + Ammonia
L-Aspartate-semialdehyde + Pyruvic acid > Hydrogen ion + Water + (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate
(2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + Hydrogen ion + NADPH + (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate + NADPH > Water + NADP + (S)-2,3,4,5-tetrahydrodipicolinate
(S)-2,3,4,5-tetrahydrodipicolinate + Succinyl-CoA + Water + Succinyl-CoA > Coenzyme A + N-Succinyl-2-amino-6-ketopimelate
N-Succinyl-L,L-2,6-diaminopimelate + Water > Succinic acid + Diaminopimelic acid
Water + 5,10-Methenyltetrahydrofolic acid > N5-Formyl-THF + N5-Formyl-H4F
Tetrahydrofolic acid + L-Serine + Tetrahydrofolic acid + L-Serine <> 5,10-Methylene-THF + Glycine + Water + 5,10-Methylene-THF
Tetrahydrofolic acid + 5'-Phosphoribosyl-N-formylglycinamide + Tetrahydrofolic acid + 5'-Phosphoribosyl-N-formylglycineamide > Water + 5,10-Methenyltetrahydrofolic acid + Glycineamideribotide + Glycineamideribotide
5'-phosphoribosyl-a-N-formylglycineamidine + Tetrahydrofolic acid + Tetrahydrofolic acid > Water + Glycineamideribotide + 5,10-Methenyltetrahydrofolic acid + Glycineamideribotide
Formic acid + Tetrahydrofolic acid + Tetrahydrofolic acid > Water + 10-Formyltetrahydrofolate + N10-Formyl-THF
10-Formyltetrahydrofolate + Hydrogen ion <> 5,10-Methenyltetrahydrofolic acid + Water
Acetyl-CoA + Water + Oxalacetic acid > Citric acid + Coenzyme A
L-Malic acid + L-Malic acid <> Fumaric acid + Water
Citric acid <> cis-Aconitic acid + Water
cis-Aconitic acid + Water <> Isocitric acid + Isocitric acid
Oxalacetic acid + Water + Acetyl-CoA > Citric acid + Coenzyme A + Hydrogen ion
Citric acid > Water + cis-Aconitic acid
cis-Aconitic acid + Water > D-threo-Isocitric acid
Fumaric acid + Water > L-Malic acid + L-Malic acid
Fructose 6-phosphate + Phosphate + Fructose 6-phosphate > Fructose 1,6-bisphosphate + Water + Fructose 1,6-bisphosphate
Phosphoenolpyruvic acid > Water + 2-Phosphoglyceric acid + 2-Phosphoglyceric acid
2-Phosphoglyceric acid + 2-Phosphoglyceric acid <> Water + Phosphoenolpyruvic acid
Phosphoenolpyruvic acid + Adenosine monophosphate + Phosphate + 2 Hydrogen ion > Adenosine triphosphate + Water + Pyruvic acid
Water + Adenosine triphosphate + Pyruvic acid > Adenosine monophosphate + Phosphate +2 Hydrogen ion + Phosphoenolpyruvic acid
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water + L-Aspartic acid > Adenosine monophosphate + Pyrophosphate + L-Asparagine + L-Glutamic acid + L-Asparagine + L-Glutamate
L-Aspartic acid + Water + Oxygen + L-Aspartic acid > Oxalacetic acid + Ammonia + Hydrogen peroxide
D-Alanine + Water + Quinone > Ammonium + Pyruvic acid + Hydroquinone
Phenylpyruvic acid + Ammonia + cytochrome c nitrite reductase <> D-Phenylalanine + Water + cytochrome c nitrite reductase
D-Alanine + Water + an electron-transfer quinone > Ammonium + Pyruvic acid + electron-transfer quinol
N-Acetylornithine + Water > Acetic acid + L-Ornithine monochlorohydrate/ornithine
N-Acetylornithine + Water > Ornithine + Acetic acid + Ornithine
Hydrogen carbonate + Water + L-Glutamine + 2 Adenosine triphosphate >2 Adenosine diphosphate + Phosphate + L-Glutamic acid +2 Hydrogen ion + Carbamoylphosphate +2 ADP + L-Glutamate
N2-succinyl-L-arginine + 2 Water + 2 Hydrogen ion + N2-succinyl-L-arginine > Carbon dioxide +2 Ammonium + N2-Succinyl-L-ornithine
N2-Succinyl-L-glutamic acid 5-semialdehyde + Water + NAD >2 Hydrogen ion + NADH + N2-succinylglutamate + N2-succinylglutamate
N2-succinylglutamate + Water + N2-succinylglutamate > L-Glutamic acid + Succinic acid + L-Glutamate
gamma-Glutamyl-L-putrescine + Oxygen + Water > 4-(γ-glutamylamino)butanal + Ammonium + Hydrogen peroxide
4-(γ-glutamylamino)butanal + Water + NADP > 4-(Glutamylamino) butanoate +2 Hydrogen ion + NADPH + NADPH
4-(Glutamylamino) butanoate + Water > L-Glutamic acid + gamma-Aminobutyric acid + L-Glutamate
Succinic acid semialdehyde + Water + NADP > NADPH +2 Hydrogen ion + Succinic acid + NADPH
L-ascorbate 6-phosphate + Water + L-Ascorbate 6-phosphate > 3-keto-L-gulonate 6-phosphate + 3-Keto-L-gulonate 6-phosphate
L-Glutamic-gamma-semialdehyde + NAD + Water >2 Hydrogen ion + NADH + L-Glutamic acid + L-Glutamate
Galactaric acid > Water + 5-dehydro-4-deoxy-D-glucarate(2−)
D-Glucaric acid + Glucaric acid > Water + 5-dehydro-4-deoxy-D-glucarate(2−)
D-glucarate > 5-dehydro-4-deoxy-D-glucarate(2−) + Water
(R)-3-hydroxyoctanoyl-[acp] > Water + trans oct-2-enoyl-[acp]
(3R)-3-hydroxymyristoyl-[acp] > Water + trans tetradec-2-enoyl-[acp]
a (3R)-hydroxy cis Δ5-dodecenoyl-[acp] > Water + trans-Δ3-cis-Δ5-dodecenoyl-[acp]
Water + a palmitoleoyl-[acp]  > a holo-[acyl-carrier protein] + Hydrogen ion + Hexadecenoate (n-C16:1)
a cis-vaccenoyl-[acp] + Water > Hydrogen ion + a holo-[acyl-carrier protein] + Vaccenic acid
DL-O-Phosphoserine + Water > Phosphate + L-Serine + L-Serine
3 NADPH + 5 Hydrogen ion + Sulfite + 3 NADPH + Sulfite > Hydrogen sulfide +3 Water +3 NADP
Sulfite + 3 NADPH + 5 Hydrogen ion + Sulfite + 3 NADPH >3 Water + NADP + Hydrogen sulfide
Sulfide + Water + 3 NADP > Sulfite +3 NADPH + Sulfite +3 NADPH
Phosphoribosyl-ATP + Water + Phosphoribosyl-ATP > Hydrogen ion + Pyrophosphate + Phosphoribosyl-AMP
Phosphoribosyl-AMP + Water > AICAR
L-histidinol-phosphate + Water > Phosphate + L-Histidinol
Water + NAD + Histidinal >2 Hydrogen ion + NADH + L-Histidine + L-Histidine
3-Methyl-2-oxovaleric acid + Water + Acetyl-CoA + 3-Methyl-2-oxovaleric acid > Coenzyme A + Hydrogen ion + 2-Isopropylmalic acid
2-Isopropylmalic acid > Water + Isopropylmaleate
Isopropylmaleate + Water > 3-Isopropylmalate
(R)-2,3-Dihydroxy-isovalerate > Water + Isovaleric acid
(R) 2,3-Dihydroxy-3-methylvalerate > Water + 3-Methyl-2-oxovaleric acid + 3-Methyl-2-oxovaleric acid
L-Aspartic acid + Water + Adenosine triphosphate + L-Glutamine + L-Aspartic acid > L-Asparagine + Hydrogen ion + Adenosine monophosphate + L-Glutamic acid + Pyrophosphate + L-Asparagine + L-Glutamate
1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate + Hydrogen ion + 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate > Water + Carbon dioxide
1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate + Hydrogen ion + 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate > Water + Carbon dioxide + (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate + (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate
Indole + L-Serine + L-Serine > Water + L-Tryptophan
D-Erythrose 4-phosphate + Water + Phosphoenolpyruvic acid > Phosphate + 3-deoxy-D-arabino-heptulosonate-7-phosphate
3-Dehydroquinate > Water + 3-dehydroshikimate + 3-Dehydro-shikimate
O-Phosphohomoserine + Water > Phosphate + L-Threonine + L-Threonine
L-Threonine + L-Threonine > Hydrogen ion + Water + (2Z)-2-aminobut-2-enoate
Fructose 1,6-bisphosphate + Water + Fructose 1,6-bisphosphate > Phosphate + D-tagatofuranose 6-phosphate
Galactonic acid + Galactonic acid > Water + 2-dehydro-3-deoxy-D-galactonate + 2-Dehydro-3-deoxy-D-galactonate
alpha-Lactose + Water > beta-D-Galactose + Beta-D-Glucose + b-D-Glucose
Guanosine diphosphate mannose > Water + GDP-4-dehydro-6-deoxy-α-D-mannose
NAD + Water + (S)-lactaldehyde + Lactaldehyde > NADH +2 Hydrogen ion + L-Lactic acid + L-Lactic acid
Glyoxylic acid + Water + Acetyl-CoA > Coenzyme A + Hydrogen ion + L-Malic acid + L-Malic acid
Allantoic acid + Water + 2 Hydrogen ion > Carbon dioxide + Ammonium + S-ureidoglycine
S-ureidoglycine + Water > Ammonium + (S)-Ureidoglycolic acid
Pantetheine + Water + Pantetheine > Pantothenic acid + Cysteamine + Pantothenic acid
Dephospho-CoA + Water <> Pantetheine 4'-phosphate + Adenosine monophosphate + pantotheine 4'-phosphate
a-Ketoisovaleric acid + 5,10-Methylene-THF + Water + 5,10-Methylene-THF > Tetrahydrofolic acid + 2-dehydropantoate + Tetrahydrofolic acid + 2-Dehydropantoate
Iminoaspartic acid + Dihydroxyacetone phosphate > Phosphate +2 Water + Quinolinic acid
Nicotinic acid adenine dinucleotide + Water + L-Glutamine + Adenosine triphosphate > Hydrogen ion + Adenosine monophosphate + Pyrophosphate + L-Glutamic acid + NAD + L-Glutamate
Nicotinic acid + Water + Adenosine triphosphate + Phosphoribosyl pyrophosphate > Phosphate + Adenosine diphosphate + Pyrophosphate + nicotinate beta-D-ribonucleotide + ADP + Nicotinamide ribotide
beta-nicotinamide D-ribonucleotide + Water + NMN > Ammonium + nicotinate beta-D-ribonucleotide + Nicotinamide ribotide
UDP-3-O-[(3R)-3-hydroxymyristoyl]-N-acetyl-α-D-glucosamine + Water > Acetic acid + UDP-3-O-(3-Hydroxytetradecanoyl)-D-glucosamine
UDP-2-N,3-O-bis[(3R)-3-hydroxytetradecanoyl]-α-D-glucosamine + Water > Uridine 5'-monophosphate + Hydrogen ion + 2,3-bis[(3R)-3-hydroxymyristoyl]-α-D-glucosaminyl 1-phosphate
D-Arabinose 5-phosphate + Phosphoenolpyruvic acid + Water > Phosphate + 3-deoxy-D-manno-octulosonate 8-phosphate + 3-Deoxy-D-manno-octulosonate 8-phosphate
3-deoxy-D-manno-octulosonate 8-phosphate + Water + 3-Deoxy-D-manno-octulosonate 8-phosphate > Phosphate + 3-deoxy-D-manno-octulosonate + 3-Deoxy-D-manno-octulosonate
Bilirubin diglucuronide + Water > Benzyl alcohol + D-glucuronate
Bilirubin diglucuronide + Water > D-Glucuronic acid + Ribitol + Ribitol
D-altronate > Water + 2-Dehydro-3-deoxy-D-galactonate + 2-Keto-3-deoxy-D-gluconic acid
D-altronate + D-altronate > Water + 2-Dehydro-3-deoxy-D-galactonate + 2-Keto-3-deoxy-D-gluconic acid
S-Adenosylhomocysteine + Water > Adenine + S-ribosyl-L-homocysteine + S-ribosyl-L-homocysteine
5'-S-methyl-5'-thioadenosine + Water > 5-Methylthioribose + Adenine
L-Methionine + Water + Adenosine triphosphate > Phosphate + Pyrophosphate
L-Methionine + Water + Adenosine triphosphate > Phosphate + Pyrophosphate + S-adenosyl-L-methionine
Water + PS(15:0/19:iso) > Carbon dioxide + PE(15:0/17:0cycw7c)
Water + an L-1-phosphatidylethanolamine Phosphate + an L-1-phosphatidyl-glycerol 
Water + PGP(16:0/16:1(9Z)) > Phosphate + PG(16:0/16:1(9Z))
Water + PGP(16:0/18:1(11Z)) > Phosphate + PG(16:0/18:1(11Z))
PGP(16:1(9Z)/16:0) + Water > PG(16:1(9Z)/16:0) + Phosphate
Water + PGP(16:1(9Z)/18:1(11Z)) > Phosphate + PG(16:1(9Z)/18:1(11Z))
PGP(18:1(11Z)/16:0) + Water > PG(18:1(11Z)/16:0) + Phosphate
PGP(18:0/18:0) + Water > Phosphate + PG(18:0/18:0) + PG(18:0/18:0)
PGP(18:2(9Z,12Z)/18:2(9Z,12Z)) + Water > Phosphate + PG(18:2(9Z,12Z)/18:2(9Z,12Z))
PGP(18:1(9Z)/18:1(9Z)) + Water > Phosphate + PG(18:1(9Z)/18:1(9Z))
PGP(14:0/14:0) + Water > Phosphate + PG(14:0(3-OH)/15:0)
PGP(14:0/14:0) + Water > Phosphate + PG(14:0/16:0)
PGP(16:0/16:0) + Water > PG(15:0/16:1) + Phosphate
Water + PGP(14:0/14:0) > Phosphate + PG(15:0/14:0(3-OH))
PGP(16:0/16:0) + Water + PGP(15:0/17:0cycw7c) > PG(15:0/17:0cycw7c) + Phosphate
Water + PGP(16:1(9Z)/18:1(9Z)) > Phosphate + PG(15:0/19:iso)
PGP(14:0/14:0) + Water + PGP(15:0cyclo/14:0(3-OH)) > PG(15:0cyclo/14:0(3-OH)) + Phosphate
Water + PGP(16:1(9Z)/18:1(11Z)) > Phosphate + PG(17:0/17:0)
PGP(18:1(9Z)/18:1(9Z)) + Water > PG(17:0/19:0) + Phosphate
PGP(16:0/16:0) + Water > PG(16:0/17:0) + Phosphate
PGP(16:0/22:5(7Z,10Z,13Z,16Z,19Z)) + Water > PG(19:0cycv8c/19:iso) + Phosphate
PGP(16:0/18:0) + Water > PG(16:0/18:0) + Phosphate
PGP(16:0/16:0) + Water + PGP(16:0/14:0) > PG(16:0/14:0) + Phosphate
PGP(16:0/16:0) + Water > PG(10:0/19:iso) + Phosphate
PGP(16:0/18:1(9Z)) + Water > PG(16:0/18:1(9Z)) + Phosphate
PGP(16:0/16:1(9Z)) + Water > PG(16:0/17:0cycw7c) + Phosphate
PGP(16:0/18:1(11Z)) + Water > PG(16:0/19:0cycw8c) + Phosphate
PGP(14:1(7Z)/14:1(7Z)) + Water > PG(14:0/16:1(9Z)) + Phosphate
PGP(16:0/18:0) + Water > PG(16:1(9Z)/17:0) + Phosphate
PGP(18:0/18:0) + Water > PG(16:1(9Z)/18:1(9Z)) + Phosphate
PGP(18:0/18:0) + Water > PG(16:1(9Z)/19:iso) + Phosphate
PGP(18:0/18:0) + Water > PE(16:1(9Z)/18:1(9Z)) + Phosphate
PGP(14:0/14:0) + Water > PG(16:1(9Z)/12:0(3-OH)) + Phosphate
PGP(14:0/14:0) + Water > PG(14:0(3-OH)/14:0) + Phosphate
PGP(18:1(9Z)/16:0) + Water > PG(18:1(9Z)/16:0) + Phosphate
PGP(18:1(9Z)/16:1(9Z)) + Water > PG(18:1(9Z)/16:1(9Z)) + Phosphate
PGP(16:1(9Z)/18:1(9Z)) + Water > PG(16:1(9Z)/18:1(9Z)) + Phosphate
PGP(18:1(9Z)/19:0cycv8c) + Water > PG(18:1(9Z)/19:0cycv8c) + Phosphate
PGP(19:0cycv8c/15:0cyclo) + Water PG(19:0cycv8c/15:0cyclo) + Phosphate
PGP(19:0cycv8c/15:0cyclo) + Water > PG(19:0cycv8c/15:0cyclo) + Phosphate
PGP(19:0cycv8c/16:0) + Water > PG(19:0cycv8c/16:0) + Phosphate
PGP(19:0cycv8c/16:1(9Z)) + Water > PG(19:0cycv8c/16:1(9Z)) + Phosphate
PGP(14:0/17:0cycw7c) + Water > PG(14:0/17:0cycw7c) + Phosphate
PGP(19:0cycv8c/18:1(9Z)) + Water > PG(19:0cycv8c/18:1(9Z)) + Phosphate
PGP(14:0/16:0) + Water > PG(14:0/16:0) + Phosphate
PGP(19:0cycv8c/14:0) + Water > PG(19:0cycv8c/14:0) + Phosphate
Melibiose + Water > Alpha-D-Galactose + Beta-D-Glucose + b-D-Glucose
MurNAc-6-P + Water > D-Lactic acid + N-Acetylglucosamine 6-phosphate
N-Acetyl-D-Glucosamine 6-Phosphate + Water + N-Acetyl-D-Glucosamine 6-Phosphate > Acetic acid + Glucosamine 6-phosphate
Glucosamine 6-phosphate + Water > Ammonium + D-tagatofuranose 6-phosphate
Water + Chitobiose + Chitobiose >2 N-Acetyl-D-glucosamine +2 N-Acetylglucosamine
Chitin + Water > Chitobiose + Chitin + Chitobiose
Chitin + Water > N-Acetyl-D-glucosamine + Chitin + N-Acetylglucosamine
UDP-N-acetyl-D-mannosamine + 2 NAD + Water + UDP-N-Acetyl-D-mannosamine > UDP-N-acetyl-α-D-mannosaminuronate +2 NADH +3 Hydrogen ion
UDP-Glucose + 2 NAD + Water > UDP-Glucuronic acid +2 NADH +3 Hydrogen ion
L-Asparagine + Water + L-Asparagine > L-Aspartic acid + Ammonium + L-Aspartic acid
Guanosine triphosphate + Water > Formic acid + Hydrogen ion + 7,8-dihydroneopterin 3'-triphosphate
7,8-dihydroneopterin 3'-triphosphate + Water > Pyrophosphate + Hydrogen ion + Dihydroneopterin monophosphate
Phosphoribosyl pyrophosphate + Water + L-Glutamine > 5-Phosphoribosylamine + L-Glutamic acid + Pyrophosphate + 5-Phosphoribosylamine + L-Glutamate
5'-Phosphoribosyl-N-formylglycinamide + Water + L-Glutamine + Adenosine triphosphate + 5'-Phosphoribosyl-N-formylglycineamide > 2-(Formamido)-N1-(5-phospho-D-ribosyl)acetamidine + L-Glutamic acid + Phosphate + Adenosine diphosphate + Hydrogen ion + L-Glutamate + ADP
FAICAR <> Inosinic acid + Water
Xanthylic acid + Adenosine triphosphate + L-Glutamine + Water > Adenosine monophosphate + Pyrophosphate + L-Glutamic acid +2 Hydrogen ion + Guanosine monophosphate + L-Glutamate
Guanosine triphosphate + a reduced flavodoxin > dGTP + an oxidized flavodoxin + Water
Adenosine triphosphate + a reduced flavodoxin > an oxidized flavodoxin + Water + dATP + dATP
Cytidine triphosphate + a reduced flavodoxin > Water + an oxidized flavodoxin + dCTP
Uridine triphosphate + a reduced flavodoxin + Uridine triphosphate > Water + an oxidized flavodoxin + Deoxyuridine triphosphate
Guanosine diphosphate + reduced thioredoxin > oxidized thioredoxin + Water + dGDP + dGDP
Adenosine diphosphate + reduced thioredoxin + ADP <> Water + oxidized thioredoxin + dADP + dADP
Uridine 5'-diphosphate + reduced thioredoxin + Uridine 5'-diphosphate oxidized thioredoxin + Water + dUDP + dUDP
Guanosine diphosphate + a reduced NrdH glutaredoxin-like protein > Water + an oxidized NrdH glutaredoxin-like protein + dGDP + dGDP
Adenosine diphosphate + a reduced NrdH glutaredoxin-like protein + ADP > an oxidized NrdH glutaredoxin-like protein + Water + dADP + dADP
CDP + a reduced NrdH glutaredoxin-like protein > Water + dCDP + an oxidized NrdH glutaredoxin-like protein
Adenosine diphosphate + Phosphate + 4 Hydrogen ion + ADP <> Water +3 Hydrogen ion + Adenosine triphosphate
a glycerophosphodiester + Water > Hydrogen ion + Alcohol + Glycerol 3-phosphate
sn-glycero-3-phosphocholine + Water > Hydrogen ion + Benzyl alcohol + Glycerol 3-phosphate
sn-glycero-3-phosphoethanolamine + Water > Benzyl alcohol + Hydrogen ion + Glycerol 3-phosphate
Glycerophosphoglycerol + Water > Benzyl alcohol + Hydrogen ion + Glycerol 3-phosphate
glycerophosphoserine + Water > Hydrogen ion + Benzyl alcohol + Glycerol 3-phosphate
alkylsulfonate + FMNH2 + Oxygen > Betaine aldehyde + Sulfite + Flavin Mononucleotide + Water +2 Hydrogen ion + Sulfite
Butanesulfonate + Oxygen + FMNH2 > Hydrogen ion + Water + Sulfite + Flavin Mononucleotide + Betaine aldehyde + Sulfite
Oxygen + FMNH2 + 3-(N-morpholino)propanesulfonate > Sulfite + Water + Hydrogen ion + Flavin Mononucleotide + Betaine aldehyde + Sulfite
ethanesulfonate + Oxygen + FMNH2 > Hydrogen ion + Water + Flavin Mononucleotide + Sulfite + Betaine aldehyde + Sulfite
isethionate + Oxygen + FMNH2 > Betaine aldehyde + Flavin Mononucleotide + Hydrogen ion + Water + Sulfite + Sulfite
Oxygen + methanesulfonate + FMNH2 + Methanesulfonate > Hydrogen ion + Water + Flavin Mononucleotide + Sulfite + Betaine aldehyde + Sulfite
8 5-Aminolevulinic acid >4 Hydrogen ion +8 Water +4 Porphobilinogen
ferroheme b + Water + Farnesyl pyrophosphate + Farnesyl pyrophosphate > Heme O + Pyrophosphate
Propionyl-CoA + Water + Oxalacetic acid + Propionyl-CoA > Coenzyme A + Hydrogen ion + 2-Methylcitric acid + Methylcitric acid
2-Methylcitric acid + Methylcitric acid > Water + Cis-2-Methylaconitate
Cis-2-Methylaconitate > Water + Methylisocitric acid
Sucrose + Water <> D-Fructose + D-Glucose + D-Fructose
Trehalose 6-phosphate + Water > Phosphate + α,α-trehalose
α,α-trehalose + Water > alpha-D-Glucose + Beta-D-Glucose + b-D-Glucose
Dextrin + Water + Dextrin > debranched limit dextrin + Maltotetraose
N-carbamoyl-L-aspartate + Hydrogen ion > Water + 4,5-Dihydroorotic acid + 4,5-Dihydroorotic acid
Uridine triphosphate + L-Glutamine + Water + Adenosine triphosphate + Uridine triphosphate > Adenosine diphosphate + Hydrogen ion + Phosphate + L-Glutamic acid + Cytidine triphosphate + ADP + L-Glutamate
CDP + reduced thioredoxin > Water + oxidized thioredoxin + dCDP
Deoxyuridine triphosphate + Water > Phosphate + Hydrogen ion + dUMP
L-Serine + L-Serine > Water + Hydrogen ion + 2-Aminoacrylic acid
2-C-Methyl-D-erythritol-2,4-cyclodiphosphate + a reduced flavodoxin > Water + Hydrogen ion + an oxidized flavodoxin + 1-Hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate
1-Hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate + Hydrogen ion + NADPH + NADPH > Water + NADPH + Isopentenyl pyrophosphate + Isopentenyl pyrophosphate
1-Hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate + Hydrogen ion + NADPH + NADPH > NADP + Water + Dimethylallylpyrophosphate + Dimethylallylpyrophosphate
dTDP-D-Glucose > dTDP-4-dehydro-6-deoxy-D-glucose + Water
2-Octaprenylphenol + Hydrogen ion + NADPH + Oxygen + NADPH > NADP + Water + 2-Octaprenyl-6-hydroxyphenol + 2-Octaprenyl-6-hydroxyphenol
Hydrogen ion + NADPH + Oxygen + 2-methoxy-6-(all-trans-octaprenyl)phenol + NADPH > Water + NADP + 2-Octaprenyl-6-methoxy-1,4-benzoquinol
Oxygen + Reduced acceptor + 6-Methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol > Water + oxidized electron acceptor + 3-demethylubiquinol-8
3-Hydroxycinnamic acid + Hydrogen ion + NADH + Oxygen > NAD + Water + 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid + 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid
trans-Octadec-2-enoyl-CoA + Water + Trans-Octadec-2-enoyl-CoA > Coenzyme A + Hydrogen ion + Elaidic acid
Citraconic acid + Water > Citramalic acid
Adenosylcobalamin 5'-phosphate + Water > Phosphate + coenzyme B12
Pseudouridine 5'-phosphate + Water > Uracil + D-ribofuranose 5-phosphate + D-ribofuranose 5-phosphate
Cyclic pyranopterin monophosphate + Water + thiocarboxylated small subunit of molybdopterin synthase >4 Hydrogen ion +2 thiocarboxylated small subunit of molybdopterin synthase + Molybdopterin + Molybdopterin
2-Hydroxy-6-ketononatrienedioate + Water > Hydrogen ion + Fumaric acid + 2-Hydroxy-2,4-pentadienoate + 2-Hydroxy-2,4-pentadienoate
2-oxopent-4-enoate + 2-Hydroxy-2,4-pentadienoate > Water + 4-hydroxy-2-oxopentanoate + 4-Hydroxy-2-oxopentanoate
Adenosine triphosphate + Nitrogen + 6 a reduced flavodoxin + Water <> Phosphate + Adenosine diphosphate + an oxidized flavodoxin +2 Ammonia + ADP
7,8-dihydroneopterin 3'-triphosphate + Water > Acetaldehyde + Triphosphate +2 Hydrogen ion + 6-Carboxy-5,6,7,8-tetrahydropterin + Triphosphate
7-Deaza-7-carboxyguanine + Adenosine triphosphate + Ammonium > Water + Phosphate + Adenosine diphosphate + Hydrogen ion + 7-Cyano-7-carbaguanine + ADP
(1R,6R)-6-hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate + (1R,6R)-6-Hydroxy-2-succinylcyclohexa-2,4-diene-1-carboxylate > 2-succinylbenzoate + Water + 2-Succinylbenzoate
2-Succinylbenzoyl-CoA + Hydrogen ion > Water + 1,4-dihydroxy-2-naphthoyl-CoA + 1,4-Dihydroxy-2-naphthoyl-CoA
1,4-dihydroxy-2-naphthoyl-CoA + Water + 1,4-Dihydroxy-2-naphthoyl-CoA > Coenzyme A + Hydrogen ion + 1,4-dihydroxy-2-naphthoate
L-Arginine + Adenosine triphosphate + Water > L-Arginine + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
L-Glutamic acid + Adenosine triphosphate + Water + L-Glutamate > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Glutamic acid + ADP
L-Leucine + Adenosine triphosphate + Water > L-Leucine + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
L-Valine + Adenosine triphosphate + Water + L-Valine > L-Valine + Adenosine diphosphate + Pyrophosphate + Hydrogen ion + ADP
L-Isoleucine + Adenosine triphosphate + Water + L-Isoleucine > L-Isoleucine + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
L-Glutamine + Adenosine triphosphate + Water > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Glutamine + ADP
L-Aspartic acid + Adenosine triphosphate + Water + L-Aspartic acid > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Aspartic acid + ADP
L-Histidine + Adenosine triphosphate + Water + L-Histidine > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Histidine + ADP
L-Lysine + Adenosine triphosphate + Water + L-Lysine > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Lysine + ADP
L-Methionine + Adenosine triphosphate + Water > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Methionine + ADP
L-Proline + Adenosine triphosphate + Water + L-Proline > L-Proline + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
D-allopyranose + Adenosine triphosphate + Water > D-allopyranose + Adenosine diphosphate + Hydrogen ion + Phosphate + ADP
Lipid A-core + Adenosine triphosphate + Water > Adenosine diphosphate + Phosphate + Hydrogen ion + Lipid A-core + ADP
(2R,4S)-2-methyl-2,3,3,4-tetrahydroxytetrahydrofuran + Phosphoribosyl-ATP + Water + (2R,4S)-2-Methyl-2,3,3,4-tetrahydroxytetrahydrofuran + Phosphoribosyl-ATP > (2R,4S)-2-methyl-2,3,3,4-tetrahydroxytetrahydrofuran + Adenosine diphosphate + Hydrogen ion + Pyrophosphate + ADP
L-Methionine + Adenosine triphosphate + Water > Adenosine diphosphate + Pyrophosphate + Hydrogen ion + L-Methionine + ADP
Ferric enterobactin + Adenosine triphosphate + Water Ferric enterobactin + Adenosine diphosphate + Hydrogen ion + ADP
2 Ubiquinol-1 + Oxygen + 4 Hydrogen ion >2 Ubiquinone-1 +2 Water +4 Hydrogen ion
Oxygen + 8 Hydrogen ion + 2 Ubiquinol-1 >2 Water +8 Hydrogen ion +2 Ubiquinone-1
Adenosine triphosphate + Water + Sulfate + Sulfate > Adenosine diphosphate + Phosphate + Hydrogen ion + Sulfate + ADP
Alkyl Sulfate + Adenosine triphosphate + Water > Adenosine diphosphate + Phosphate + Hydrogen ion + Alkyl Sulfate + ADP
Adenosine triphosphate + Water + Butanesulfonate > Adenosine diphosphate + Phosphate + Hydrogen ion + Butanesulfonate + ADP
Adenosine triphosphate + Water + 3-(N-morpholino)propanesulfonate > Phosphate + Hydrogen ion + Adenosine diphosphate + 3-(N-morpholino)propanesulfonate + ADP
Adenosine triphosphate + Water + ethanesulfonate > Hydrogen ion + Phosphate + Adenosine diphosphate + ethanesulfonate + ADP
Adenosine triphosphate + Water + isethionate > Adenosine diphosphate + Hydrogen ion + Phosphate + isethionate + ADP
Adenosine triphosphate + Water + methanesulfonate + Methanesulfonate > Adenosine diphosphate + Phosphate + Hydrogen ion + methanesulfonate + ADP
Maltotetraose + Adenosine triphosphate + Water > Maltotetraose + Phosphate + Hydrogen ion + Adenosine diphosphate + ADP
Maltotriose + Adenosine triphosphate + Water > Adenosine diphosphate + Phosphate + Hydrogen ion + Maltotriose + ADP
D-Maltose + Adenosine triphosphate + Water > D-Maltose + Phosphate + Hydrogen ion + Adenosine diphosphate + ADP
Adenosine triphosphate + Water + DL-O-Phosphoserine > Hydrogen ion + Phosphate + Adenosine diphosphate + DL-O-Phosphoserine + ADP
Taurine + Adenosine triphosphate + Water > Taurine + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
Cysteine-S-sulfate + Adenosine triphosphate + Water > Cysteine-S-sulfate + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
Homocarnosine + Adenosine triphosphate + Water + Homocarnosine > Homocarnosine + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
Cobinamide + Adenosine triphosphate + Water + Cobinamide > Adenosine diphosphate + Phosphate + Hydrogen ion + Cobinamide + ADP
Cyanocobalamin + Adenosine triphosphate + Water + Cyanocobalamin > Adenosine diphosphate + Phosphate + Hydrogen ion + Cyanocobalamin + ADP
Trimethylamine N-Oxide + 3 Hydrogen ion + Menaquinol 8 + 2 Electron > Trimethylamine + Water +2 Hydrogen ion + menaquinone-8
Menaquinol 8 + Dimethyl sulfoxide + 2 Hydrogen ion + 2 Electron > menaquinone-8 + Dimethyl sulfide + Water +2 Hydrogen ion
Myo-inositol hexakisphosphate + Water + Myo-inositol hexakisphosphate > 1-Myo-inositol 1,2,3,4,5-pentakisphosphate + Phosphate
Putrescine + Oxoglutaric acid <> L-Glutamic acid + 1-Pyrroline + Water + L-Glutamate
2,3-Dihydroxyisovaleric acid <>2 a-Ketoisovaleric acid + Water
1-(2-Carboxyphenylamino)-1'-deoxyribulose-5'-phosphate + Hydrogen ion > Carbon dioxide + Water + (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate + (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate
2 PGP(10:0(3-OH)/10:0) + Water >2 PG(10:0(3-OH)/10:0) + Phosphate
2 PGP(10:0(3-OH)/12:0(3-OH)) + Water >2 PG(10:0(3-OH)/12:0(3-OH)) + Phosphate
2 PGP(10:0(3-OH)/12:0) + Water >2 PG(10:0(3-OH)/12:0) + Phosphate
2 PGP(10:0(3-OH)/15:0cyclo) + Water >2 PG(10:0(3-OH)/15:0cyclo) + Phosphate
2 PGP(10:0(3-OH)/16:0) + Water >2 PG(10:0(3-OH)/16:0) + Phosphate
2 PGP(10:0(3-OH)/16:1(9Z)) + Water >2 PG(10:0(3-OH)/16:1(9Z)) + Phosphate
2 PGP(10:0(3-OH)/17:0cycw7c) + Water >2 PG(10:0(3-OH)/17:0cycw7c) + Phosphate
2 PGP(10:0(3-OH)/19:0cycv8c) + Water >2 PG(10:0(3-OH)/19:0cycv8c) + Phosphate
2 PGP(10:0(3-OH)/19:iso) + Water >2 PG(10:0(3-OH)/19:iso) + Phosphate
2 PGP(10:0/10:0(3-OH)) + Water >2 PG(10:0/10:0(3-OH)) + Phosphate
2 PGP(10:0/12:0(3-OH)) + Water >2 PG(10:0/12:0(3-OH)) + Phosphate
2 PGP(14:0/14:0) + Water > PG(14:0/14:0) + Phosphate
2 PGP(12:0(3-OH)/10:0(3-OH)) + Water >2 PG(12:0(3-OH)/10:0(3-OH)) + Phosphate
2 PGP(12:0(3-OH)/10:0) + Water >2 PG(12:0(3-OH)/10:0) + Phosphate
2 PGP(12:0/12:0) + Water >2 PG(12:0/12:0) + Phosphate
2 PGP(12:0(3-OH)/14:0(3-OH)) + Water >2 PG(12:0(3-OH)/14:0(3-OH)) + Phosphate
2 PGP(12:0(3-OH)/14:0) + Water >2 PG(12:0(3-OH)/14:0) + Phosphate
2 PGP(12:0(3-OH)/15:0) + Water >2 PG(12:0(3-OH)/15:0) + Phosphate
2 PGP(12:0(3-OH)/15:0cyclo) + Water >2 PG(12:0(3-OH)/15:0cyclo) + Phosphate
2 PGP(12:0(3-OH)/17:0cycw7c) + Water >2 PG(12:0(3-OH)/17:0cycw7c) + Phosphate
2 PGP(12:0(3-OH)/18:1(9Z)) + Water >2 PG(12:0(3-OH)/18:1(9Z)) + Phosphate
2 PGP(12:0(3-OH)/19:0cycv8c) + Water >2 PG(12:0(3-OH)/19:0cycv8c) + Phosphate
2 PGP(12:0(3-OH)/19:iso) + Water >2 PG(12:0(3-OH)/19:iso) + Phosphate
2 PGP(12:0/10:0(3-OH)) + Water >2 PG(12:0/10:0(3-OH)) + Phosphate
2 PGP(12:0/14:0(3-OH)) + Water >2 PG(12:0/14:0(3-OH)) + Phosphate
2 PGP(12:0/19:iso) + Water >2 PG(12:0/19:iso) + Phosphate
2 PGP(14:0(3-OH)/12:0(3-OH)) + Water >2 PG(14:0(3-OH)/12:0(3-OH)) + Phosphate
2 PGP(14:0(3-OH)/12:0) + Water >2 PG(14:0(3-OH)/12:0) + Phosphate
2 PGP(14:0(3-OH)/16:1(9Z)) + Water >2 PG(14:0(3-OH)/16:1(9Z)) + Phosphate
2 PGP(14:0(3-OH)/17:0cycw7c) + Water >2 PG(14:0(3-OH)/17:0cycw7c) + Phosphate
2 PGP(14:0/12:0(3-OH)) + Water >2 PG(14:0/12:0(3-OH)) + Phosphate
2 PGP(15:0/10:0(3-OH)) + Water >2 PG(15:0/10:0(3-OH)) + Phosphate
2 PGP(15:0/12:0(3-OH)) + Water >2 PG(15:0/12:0(3-OH)) + Phosphate
2 PGP(15:0cyclo/10:0(3-OH)) + Water >2 PG(15:0cyclo/10:0(3-OH)) + Phosphate
2 PGP(16:0/10:0(3-OH)) + Water >2 PG(16:0/10:0(3-OH)) + Phosphate
2 PGP(16:0/14:0(3-OH)) + Water >2 PG(16:0/14:0(3-OH)) + Phosphate
2 PGP(16:1(9Z)/14:0(3-OH)) + Water >2 PG(16:1(9Z)/14:0(3-OH)) + Phosphate
2 PGP(16:1(9Z)/17:0cycw7c) + Water >2 PG(16:1(9Z)/17:0cycw7c) + Phosphate
2 PGP(17:0cycw7c/10:0(3-OH)) + Water >2 PG(17:0cycw7c/10:0(3-OH)) + Phosphate
2 PGP(17:0cycw7c/12:0(3-OH)) + Water >2 PG(17:0cycw7c/12:0(3-OH)) + Phosphate
Guanosine triphosphate + 3 Water > Formic acid + Pyrophosphate +2 Hydrogen ion + 2,5-Diamino-6-(5'-phosphoribosylamino)-4-pyrimidineone
Adenosine triphosphate + Water + 1,6-Anhydro-N-acetylmuramate <> Adenosine diphosphate + MurNAc-6-P + ADP
2 PGP(17:0cycw7c/19:iso) + Water >2 PG(17:0cycw7c/19:iso) + Phosphate
2 PGP(10:0/10:0) + Water >2 PG(10:0/10:0) + Phosphate
2 PGP(18:1(11Z)/19:0) + Water >2 PG(18:1(11Z)/19:0) + Phosphate
2 PGP(18:1(9Z)/12:0(3-OH)) + Water >2 PG(18:1(9Z)/12:0(3-OH)) + Phosphate
2 PGP(19:0/16:1(9Z)) + Water >2 PG(19:0/16:1(9Z)) + Phosphate
2 PGP(19:0/18:1(11Z)) + Water >2 PG(19:0/18:1(11Z)) + Phosphate
2 PGP(19:0cycv8c/10:0(3-OH)) + Water >2 PG(19:0cycv8c/10:0(3-OH)) + Phosphate
2 PGP(19:0cycv8c/12:0(3-OH)) + Water >2 PG(19:0cycv8c/12:0(3-OH)) + Phosphate
2 PGP(19:1(9Z)/16:1(9Z)) + Water >2 PG(19:1(9Z)/16:1(9Z)) + Phosphate
2 PGP(19:iso/10:0(3-OH)) + Water >2 PG(19:iso/10:0(3-OH)) + Phosphate
2 PGP(19:iso/10:0) + Water >2 PG(19:iso/10:0) + Phosphate
2 PGP(19:iso/12:0(3-OH)) + Water >2 PG(19:iso/12:0(3-OH)) + Phosphate
2 PGP(19:iso/12:0) + Water >2 PG(19:iso/12:0) + Phosphate
2 PGP(19:iso/14:0(3-OH)) + Water >2 PG(19:iso/14:0(3-OH)) + Phosphate
2 PGP(19:iso/14:0) + Water >2 PG(19:iso/14:0) + Phosphate
2 PGP(19:iso/17:0cycw7c) + Water >2 PG(19:iso/17:0cycw7c) + Phosphate
2 PGP(19:iso/19:0cycv8c) + Water >2 PG(19:iso/19:0cycv8c) + Phosphate
2 PGP(19:iso/19:iso) + Water >2 PG(19:iso/19:iso) + Phosphate
Guanosine triphosphate + Water > 2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Hydrogen ion + Formic acid + Pyrophosphate
2,5-Diamino-6-(5'-phosphoribosylamino)-4-pyrimidineone + Water + Hydrogen ion > Ammonium + 5-Amino-6-(5'-phosphoribosylamino)uracil
5-Amino-6-(5'-phosphoribitylamino)uracil + Water + 5-Amino-6-(5'-phosphoribitylamino)uracil > Phosphate + 5-Amino-6-ribitylamino uracil
5-Amino-6-ribitylamino uracil + 1-Deoxy-L-glycero-tetrulose 4-phosphate > Water + Phosphate + Hydrogen ion + 6,7-Dimethyl-8-(1-D-ribityl)lumazine + 6,7-Dimethyl-8-(1-D-ribityl)lumazine
2 PGP(16:0/16:0) + Water >2 PG(16:0/16:0) + Phosphate
2 PGP(16:0/17:0cycw7c) + Water >2 PG(16:0/17:0cycw7c) + Phosphate
gluconate 6-phosphate > Water + 2-Keto-3-deoxy-6-phosphogluconic acid
2 PGP(14:0(3-OH)/14:0) + Water >2 PG(14:0(3-OH)/14:0) + Phosphate
2 PGP(10:0(3-OH)/10:0(3-OH)) + Water >2 PG(10:0(3-OH)/10:0(3-OH)) + Phosphate
2 PGP(10:0(3-OH)/14:0) + Water >2 PG(10:0(3-OH)/14:0) + Phosphate
2 PGP(10:0(3-OH)/14:0(3-OH)) + Water >2 PG(10:0(3-OH)/14:0(3-OH)) + Phosphate
2 PGP(10:0/14:0(3-OH)) + Water >2 PG(10:0/14:0(3-OH)) + Phosphate
2 PGP(10:0/19:iso) + Water >2 PG(10:0/19:iso) + Phosphate
2 PGP(14:0(3-OH)/10:0(3-OH)) + Water >2 PG(14:0(3-OH)/10:0(3-OH)) + Phosphate
2 PGP(14:0(3-OH)/10:0) + Water >2 PG(14:0(3-OH)/10:0) + Phosphate
2 PGP(14:0(3-OH)/14:0(3-OH)) + Water >2 PG(14:0(3-OH)/14:0(3-OH)) + Phosphate
2 PGP(14:0/10:0(3-OH)) + Water >2 PG(14:0/10:0(3-OH)) + Phosphate
2 PGP(14:0/14:0(3-OH)) + Water >2 PG(14:0/14:0(3-OH)) + Phosphate
2 PGP(14:0(3-OH)/15:0) + Water >2 PG(14:0(3-OH)/15:0) + Phosphate
2 PGP(14:0/15:0cyclo) + Water >2 PG(14:0/15:0cyclo) + Phosphate
2 PGP(14:0(3-OH)/15:0cyclo) + Water >2 Phosphate + PG(14:0(3-OH)/15:0cyclo)
2 PGP(15:0cyclo/14:0) + Water >2 PG(15:0cyclo/14:0) + Phosphate
2 PGP(14:0(3-OH)/15:0cyclo) + Water >2 PG(14:0(3-OH)/15:0cyclo) + Phosphate
2 PGP(18:1(9Z)/14:0(3-OH)) + Water >2 PG(18:1(9Z)/14:0(3-OH)) + Phosphate
2 PGP(18:1(9Z)/14:0) + Water >2 PG(18:1(9Z)/14:0) + Phosphate
2 PGP(14:0/18:1(9Z)) + Water >2 PG(14:0/18:1(9Z)) + Phosphate
2 PGP(14:0(3-OH)/18:1(9Z)) + Water >2 PG(14:0(3-OH)/18:1(9Z)) + Phosphate
2 PGP(14:0(3-OH)/19:iso) + Water >2 PG(14:0(3-OH)/19:iso) + Phosphate
2 PGP(14:0/16:1(9Z)) + Water >2 PG(14:0/16:1(9Z)) + Phosphate
2 PGP(14:0/18:1(11Z)) + Water >2 PG(14:0/18:1(11Z)) + Phosphate
2 PGP(14:0/19:iso) + Water >2 PG(14:0/19:iso) + Phosphate
2 PGP(15:0/19:iso) + Water >2 PG(15:0/19:iso) + Phosphate
2 PGP(15:0cyclo/19:iso) + Water >2 PG(15:0cyclo/19:iso) + Phosphate
2 PGP(16:0/19:0cycw8c) + Water >2 PG(16:0/19:0cycw8c) + Phosphate
2 PGP(16:0/19:iso) + Water >2 PG(16:0/19:iso) + Phosphate
2 PGP(16:1(9Z)/12:0(3-OH)) + Water >2 PG(16:1(9Z)/12:0(3-OH)) + Phosphate
2 PGP(16:1(9Z)/14:0) + Water >2 PG(16:1(9Z)/14:0) + Phosphate
2 PGP(16:1(9Z)/17:0) + Water >2 PG(16:1(9Z)/17:0) + Phosphate
2 PGP(16:1(9Z)/19:0) + Water >2 PG(16:1(9Z)/19:0) + Phosphate
2 PGP(16:1(9Z)/19:iso) + Water >2 PG(16:1(9Z)/19:iso) + Phosphate
2 PGP(17:0/16:1(9Z)) + Water >2 PG(17:0/16:1(9Z)) + Phosphate
2 PGP(17:0/17:0) + Water >2 PG(17:0/17:0) + Phosphate
2 PGP(17:0/18:1(11Z)) + Water >2 PG(17:0/18:1(11Z)) + Phosphate
2 PGP(17:0/19:0) + Water >2 PG(17:0/19:0) + Phosphate
2 PGP(17:0cycw7c/14:0(3-OH)) + Water >2 PG(17:0cycw7c/14:0(3-OH)) + Phosphate
2 PGP(18:1(11Z)/17:0) + Water >2 PG(18:1(11Z)/17:0) + Phosphate
2 PGP(18:1(9Z)/19:iso) + Water >2 PG(18:1(9Z)/19:iso) + Phosphate
2 PGP(19:0/19:0) + Water >2 PG(19:0/19:0) + Phosphate
2 PGP(19:0cycv8c/14:0(3-OH)) + Water >2 PG(19:0cycv8c/14:0(3-OH)) + Phosphate
2 PGP(19:0cycv8c/19:iso) + Water >2 PG(19:0cycv8c/19:iso) + Phosphate
2 PGP(19:iso/15:0) + Water >2 PG(19:iso/15:0) + Phosphate
2 PGP(19:iso/15:0cyclo) + Water >2 PG(19:iso/15:0cyclo) + Phosphate
2 PGP(19:iso/16:1(9Z)) + Water >2 PG(19:iso/16:1(9Z)) + Phosphate
2 PGP(19:iso/18:1(9Z)) + Water >2 PG(19:iso/18:1(9Z)) + Phosphate
2 PGP(10:0(3-OH)/18:1(9Z)) + Water >2 PG(10:0(3-OH)/18:1(9Z)) + Phosphate
2 PGP(12:0(3-OH)/12:0(3-OH)) + Water >2 PG(12:0(3-OH)/12:0(3-OH)) + Phosphate
2 PGP(12:0(3-OH)/12:0) + Water >2 PG(12:0(3-OH)/12:0) + Phosphate
2 PGP(12:0/12:0(3-OH)) + Water >2 PG(12:0/12:0(3-OH)) + Phosphate
2 PGP(12:0(3-OH)/16:0) + Water >2 PG(12:0(3-OH)/16:0) + Phosphate
2 PGP(16:0/12:0(3-OH)) + Water >2 PG(16:0/12:0(3-OH)) + Phosphate
2 PGP(12:0(3-OH)/16:1(9Z)) + Water >2 PG(12:0(3-OH)/16:1(9Z)) + Phosphate
2 PGP(16:1(9Z)/12:0) + Water >2 PG(16:1(9Z)/12:0) + Phosphate
2 PGP(14:0/17:0) + Water >2 PG(14:0/17:0) + Phosphate
2 PGP(17:0/14:0) + Water >2 PG(17:0/14:0) + Phosphate
2 PGP(14:0/19:0) + Water >2 PG(14:0/19:0) + Phosphate
2 PGP(19:0/14:0) + Water >2 PG(19:0/14:0) + Phosphate
2 PGP(14:0/19:0cycv8c) + Water >2 PG(14:0/19:0cycv8c) + Phosphate
2 PGP(15:0cyclo/12:0(3-OH)) + Water >2 PG(15:0cyclo/12:0(3-OH)) + Phosphate
2 PGP(15:0cyclo/15:0cyclo) + Water >2 PG(15:0cyclo/15:0cyclo) + Phosphate
2 PGP(15:0cyclo/16:0) + Water >2 PG(15:0cyclo/16:0) + Phosphate
2 PGP(16:0/15:0) + Water >2 PG(16:0/15:0) + Phosphate
2 PGP(15:0cyclo/17:0cycw7c) + Water >2 PG(15:0cyclo/17:0cycw7c) + Phosphate
2 PGP(15:0cyclo/19:0cycv8c) + Water >2 PG(15:0cyclo/19:0cycv8c) + Phosphate
2 PGP(16:0/17:0) + Water >2 PG(16:0/17:0) + Phosphate
2 PGP(17:0/16:0) + Water >2 PG(17:0/16:0) + Phosphate
2 PGP(16:1(9Z)/10:0(3-OH)) + Water >2 PG(16:1(9Z)/10:0(3-OH)) + Phosphate
2 PGP(16:1(9Z)/15:0) + Water >2 PG(16:1(9Z)/15:0) + Phosphate
2 PGP(16:1(9Z)/19:0cycv8c) + Water >2 PG(16:1(9Z)/19:0cycv8c) + Phosphate
2 PGP(17:0cycw7c/14:0) + Water >2 PG(17:0cycw7c/14:0) + Phosphate
2 PGP(17:0cycw7c/16:0) + Water >2 PG(17:0cycw7c/16:0) + Phosphate
2 PGP(17:0cycw7c/16:1(9Z)) + Water >2 PG(17:0cycw7c/16:1(9Z)) + Phosphate
2 PGP(17:0cycw7c/17:0cycw7c) + Water >2 PG(17:0cycw7c/17:0cycw7c) + Phosphate
2 PGP(17:0cycw7c/18:1(9Z)) + Water >2 PG(17:0cycw7c/18:1(9Z)) + Phosphate
2 PGP(18:1(9Z)/17:0cycw7c) + Water >2 PG(18:1(9Z)/17:0cycw7c) + Phosphate
2 PGP(17:0cycw7c/19:0cycv8c) + Water >2 PG(17:0cycw7c/19:0cycv8c) + Phosphate
2 PGP(19:0cycv8c/17:0cycw7c) + Water >2 PG(19:0cycv8c/17:0cycw7c) + Phosphate
2 PGP(18:0/12:0) + Water >2 PG(18:0/12:0) + Phosphate
2 PGP(18:0/18:1(9Z)) + Water >2 PG(18:0/18:1(9Z)) + Phosphate
2 PGP(18:1(11Z)/14:0) + Water >2 PG(18:1(11Z)/14:0) + Phosphate
2 PGP(18:1(9Z)/10:0(3-OH)) + Water >2 PG(18:1(9Z)/10:0(3-OH)) + Phosphate
2 PGP(18:1(9Z)/12:0) + Water >2 PG(18:1(9Z)/12:0) + Phosphate
2 PGP(18:1(9Z)/15:0) + Water >2 PG(18:1(9Z)/15:0) + Phosphate
2 PGP(18:1(9Z)/15:0cyclo) + Water >2 PG(18:1(9Z)/15:0cyclo) + Phosphate
2 PGP(19:0/16:0) + Water >2 PG(19:0/16:0) + Phosphate
2 PGP(19:0/17:0) + Water >2 PG(19:0/17:0) + Phosphate
2 PGP(19:0cycv8c/19:0cycv8c) + Water >2 PG(19:0cycv8c/19:0cycv8c) + Phosphate
2-(alpha-D-Mannosyl)-3-phosphoglycerate + Water > 2(alpha-D-Mannosyl)-D-glycerate + Phosphate
Phenylhydantoin + Water <> phenylureidoacetic acid
Salicin 6-phosphate + Water > β-D-glucose 1-phosphate + Salicyl alcohol
Glucaric acid > Water + 2-Dehydro-3-deoxy-D-glucarate
2 PGP(10:0(3-OH)/15:0) + Water >2 PG(10:0(3-OH)/15:0) + Phosphate
2 PGP(14:0(3-OH)/16:0) + Water >2 PG(14:0(3-OH)/16:0) + Phosphate
2 PGP(14:0(3-OH)/19:0cycv8c) + Water >2 PG(14:0(3-OH)/19:0cycv8c) + Phosphate
2 PGP(16:0/19:0) + Water >2 PG(16:0/19:0) + Phosphate
2 PGP(16:0/19:1(9Z)) + Water >2 PG(16:0/19:1(9Z)) + Phosphate
2 PGP(18:1(11Z)/18:1(11Z)) + Water >2 PG(18:1(11Z)/18:1(11Z)) + Phosphate
2 PGP(18:1(11Z)/18:1(11Z)) + Water >2 PG(18:1(11Z)/18:1(9Z)) + Phosphate
2 PGP(19:1(9Z)/16:0) + Water >2 PG(19:1(9Z)/16:0) + Phosphate
2 PGP(18:1(11Z)/18:1(11Z)) + Water >2 PG(18:1(9Z)/18:1(11Z)) + Phosphate
Trimethylamine N-Oxide + NADH + 2 Hydrogen ion > Trimethylamine + NAD + Water
(2E,4Z)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate + Water > (2Z)-2-hydroxypenta-2,4-dienoate + Succinic acid + Hydrogen ion
Water + cis-Aconitic acid <> Citric acid
Water + 2-Hydroxydeoxyadenosine 5'-triphosphate > Pyrophosphate + 2-hydroxy-dAMP
Ureidoacrylate peracid + Water > Peroxyaminoacrylate + Carbamic acid + Hydrogen ion + 3-Aminoacrylate
2-Aminoacrylic acid + Water + Hydrogen ion > Malonic semialdehyde + Ammonium
Hydrofluoric acid + Water > 2-Maleylacetate + hydrofluoric acid
5-Fluoromuconolactone + Water > 2-Maleylacetate + hydrofluoric acid
2-trans,5-cis-tetradecadienoyl-CoA + Water > 3-hydroxy-5-cis-tetradecenoyl-CoA
3-Oxo-5,6-dehydrosuberyl-CoA semialdehyde + Water + NADP > Hydrogen ion + NADPH + 3-Oxo-5,6-dehydrosuberyl-CoA
L-Glutamate + 3-Cyano-L-alanine > Water + gamma-Glutamyl-beta-cyanoalanine
Phenylacetaldehyde + NAD + Water > NADH + Hydrogen ion + Benzeneacetic acid
Phenylacetyl-CoA + Hydrogen ion + NADPH + Oxygen > Water + NADP + 2-(1,2-Epoxy-1,2-dihydrophenyl)acetyl-CoA
2,3-didehydroadipyl-CoA + Water > 3-Hydroxyadipyl-CoA
3-Aminopropylphosphonate + Adenosine triphosphate + Water > ADP + Phosphate + Hydrogen ion
1-Deoxy-D-xylulose 5-phosphate + Dehydroglycine + a thiocarboxy-[ThiS-Protein] > 2-((2R,5Z)-2-Carboxy-4-methylthiazol-5(2H)-ylidene)ethyl phosphate + a ThiS sulfur-carrier protein +2 Water
Fructoselysine-6-phosphate + Water <> β-D-glucose 6-phosphate + L-Lysine
Diacetylchitobiose-6-phosphate + Water > N'-monoacetylchitobiose-6'-phosphate + Acetic acid
N'-monoacetylchitobiose-6'-phosphate + Water > N-Acetyl-D-Glucosamine 6-Phosphate + Glucosamine
GlcNAc-1,6-anhMurNAc-L-Ala-?-D-Glu-DAP-D-Ala + Water > N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramate + L-Ala-gamma-D-Glu-DAP-D-Ala
N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramate + Water > N-Acetylglucosamine + anhydro-n-acetylmuramic acid
Pyruvaldehyde + Water > D-Lactic acid + Hydrogen ion
L-Cysteine + Adenosine triphosphate + Water > ADP + Phosphate + Hydrogen ion
NADP + Water > NAD + Phosphate
gamma-Glutamyl-gamma-butyraldehyde + NADP + Water > gamma-glutamyl-gamma-aminobutyrate + NADPH +2 Hydrogen ion
gamma-glutamyl-gamma-aminobutyrate + Water > gamma-Aminobutyric acid + L-Glutamate
S-Adenosylhomocysteine + Water > Adenine
N-Acetylmuramate 6-phosphate + Water <> N-Acetyl-D-Glucosamine 6-Phosphate + D-Lactic acid
D-glucosamine 6-phosphate + Water > Ammonium + D-tagatofuranose 6-phosphate
D-Erythrose 4-phosphate + NAD + Water > 4-Phospho-D-erythronate + NADH +2 Hydrogen ion
TDP-Glucose > dTDP-4-dehydro-6-deoxy-D-glucose + Water
2-Octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol + Oxygen + Reduced acceptor > 2-octaprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinone + Water + oxidized electron acceptor
anhydro-n-acetylmuramic acid + Adenosine triphosphate + Water > N-Acetylmuramate 6-phosphate + ADP + Hydrogen ion
Adenosine + Water > beta-D-ribofuranose + Adenine
Adenylyl-molybdopterin + Hydrogen ion + Molybdate > Adenosine monophosphate + Water + molybdenum cofactor
D-Carnitinyl-CoA > Crotonobetainyl-CoA + Water
dTDP-D-Glucose > Water + 4,6-Dideoxy-4-oxo-dTDP-D-glucose
alpha-D-Ribose 1-methylphosphonate 5-triphosphate + Water > Hydrogen ion + Pyrophosphate + alpha-D-Ribose 1-methylphosphonate 5-phosphate
alpha-D-Ribose 1,2-cyclic phosphate 5-phosphate + Water > Hydrogen ion + Ribose 1,5-bisphosphate
a biotinylated [BCCP dimer] + Hydrogen ion + Phosphate + ADP + Malonyl-CoA < Water + Acetyl-CoA + Adenosine triphosphate + carboxylated-biotinylated [BCCP dimer]
Deoxyinosine + Ammonium < Water + Hydrogen ion + Deoxyadenosine
Zinc + Adenosine triphosphate + Water > ADP + Phosphate + Hydrogen ion
Thiosulfate + Adenosine triphosphate + Water > ADP + Phosphate + Hydrogen ion
D-Glycero-D-manno-heptose 1,7-bisphosphate + Water > D-glycero-beta-D-manno-heptose 1-phosphate + Phosphate
2-O-(6-Phospho-alpha-D-mannosyl)-D-glycerate + Water > Mannose 6-phosphate + Glyceric acid
alpha,alpha-Trehalose 6-phosphate + Water > β-D-glucose 6-phosphate + Beta-D-Glucopyranuronic acid
beta-D-Ribopyranose + Adenosine triphosphate + Water > ADP + Phosphate + Hydrogen ion
Carbon dioxide + Water > Hydrogen ion + Hydrogen carbonate
Oxygen + 4 Hydrogen ion + Electron >2 Water
alpha,alpha-Trehalose 6-phosphate + Water > α,α-trehalose + Phosphate
Aminoacetone + Oxygen + Water > Hydrogen peroxide + Ammonium + Pyruvaldehyde
2 Pyruvic acid + 2 Water > Carbon dioxide + Acetic acid + Hydrogen ion + Electron
D-Serine > Water + Hydrogen ion + 2-Aminoacrylic acid
S-Lactoylglutathione + Water > Glutathione + Hydrogen ion + L-Lactic acid
Nitrate + 2 Hydrogen ion + a menaquinol > Nitrite + Water + a menaquinone
Formyl-L-methionyl peptide + Water <> Formic acid + Methionyl peptide
L-Threonine + Adenosine triphosphate + Hydrogen carbonate <> L-Threonylcarbamoyladenylate + Pyrophosphate + Water
Coproporphyrin III + 2 Hydrogen ion + Oxygen <>2 Carbon dioxide +2 Water + Protoporphyrinogen IX
Indole + L-Serine > Water + L-Tryptophan
Phosphonoacetate + Water <> Acetic acid + Phosphate
2 Thiol-containing reductant + ROOH <> Oxidized thiol-containing reductant + Water + ROH
Protein glutamate methyl ester + Water <> Protein glutamate + Methanol
Water + NADP + Succinic acid semialdehyde >2 Hydrogen ion + NADPH + Succinic acid
Glycerophosphocholine + Water > Choline + Glycerol 3-phosphate + Hydrogen ion
(R)-2,3-Dihydroxy-isovalerate > alpha-Ketoisovaleric acid + Water
1-Deoxy-D-xylulose 5-phosphate + 2 2-iminoacetate <>2 2-[(2R,5Z)-2-Carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate +2 Water
Guanosine triphosphate + Water > Guanosine monophosphate + Hydrogen ion + Pyrophosphate
Cytosine + Water <> Uracil + Ammonia
5 5-Methylcytosine + Water <> Thymine + Ammonia
Acetyl-CoA + Glyoxylic acid + Water <> Coenzyme A + Hydrogen ion + L-Malic acid
Adenosine triphosphate + Water + L-Methionine <> S-Adenosylmethionine + Phosphate + Pyrophosphate
D-Erythrose 4-phosphate + Water + NAD <>4 4-Phospho-D-erythronate +2 Hydrogen ion + NADH
Diadenosine tetraphosphate + Water <>2 ADP +2 Hydrogen ion
Chorismate + Ammonia <>2 2-Aminobenzoic acid + Pyruvic acid + Water
1-(2-Carboxyphenylamino)-1'-deoxy-D-ribulose 5'-phosphate + Hydrogen ion <> Indoleglycerol phosphate + Carbon dioxide + Water
3 3-Amino-2-oxopropyl phosphate + 1-Deoxy-D-xylulose 5-phosphate <> Pyridoxine 5'-phosphate + Phosphate +2 Water
L-D-1-Pyrroline-5-carboxylic acid + 2 Water + NAD > L-Glutamate + Hydrogen ion + NADH
Methylcitric acid + (2S,3S)-2-hydroxybutane-1,2,3-tricarboxylate <> Cis-2-Methylaconitate + Water
Water + Oxalacetic acid + Propionyl-CoA <> Methylcitric acid + Coenzyme A + Hydrogen ion + (2S,3S)-2-hydroxybutane-1,2,3-tricarboxylate
Fumaric acid + Water <> L-Malic acid
L-Malic acid <> Fumaric acid + Water
Water + NAD + N2-Succinyl-L-glutamic acid 5-semialdehyde <>2 Hydrogen ion + NADH + N-Succinyl-L-glutamate
N2-Succinyl-L-arginine + 2 Water <> N2-Succinyl-L-ornithine + Carbon dioxide +2 Ammonia
Dihydroxyacetone phosphate + Iminoaspartic acid <>2 Water + Phosphate + Quinolinic acid
Quinolinic acid + 2 Water + Phosphate <> Iminoaspartic acid + Dihydroxyacetone phosphate
L-Aspartate-semialdehyde + Pyruvic acid >2 2,3-Dihydrodipicolinic acid + Hydrogen ion +2 Water
dGTP + Water <> Deoxyguanosine + Triphosphate
D-Lactic acid <> Pyruvaldehyde + Water
dADP + Thioredoxin disulfide + Water <> Thioredoxin + ADP
Water + N-Succinyl-L,L-2,6-diaminopimelate <> Diaminopimelic acid + Succinic acid
Nitrite + Acceptor + Water <> Nitrate + Reduced acceptor
Glucosamine 6-phosphate + Water <> Fructose 6-phosphate + Ammonia
N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole + Water > Phosphate + N1-(alpha-D-ribosyl)-5,6-dimethyl-benzimidazole
Farnesyl pyrophosphate + Water + Heme > Heme O + Pyrophosphate
L-Asparagine + Water <> L-Aspartic acid + Ammonia
Glutathione + Water > Cysteinylglycine + L-Glutamate
5 5-Thymidylic acid + Water > Phosphate + Thymidine
(S)-Ureidoglycolic acid + Water <> Glyoxylic acid +2 Ammonia + Carbon dioxide
Guanine + Water <> Xanthine + Ammonia
Water + Hypoxanthine + NAD > Hydrogen ion + NADH + Xanthine
Water + NAD <> Adenosine monophosphate +2 Hydrogen ion + Nicotinamide ribotide + NMN
cis-Aconitic acid + Water <> Isocitric acid
Citric acid <> cis-Aconitic acid + Water
Acetyl-CoA + Water + Oxalacetic acid <> Citric acid + Coenzyme A + Hydrogen ion
(3R)-3-Hydroxydecanoyl-[acyl-carrier protein] <> trans-Dec-2-enoyl-[acp] + Water
L-Glutamine + Water <> L-Glutamate + Ammonia
D-Glutamine + Water <> D-Glutamic acid + Ammonia
Adenosine triphosphate + Hydrogen selenide + Water <> Adenosine monophosphate + Phosphoroselenoic acid + Phosphate
Cellobiose + Water <>2 b-D-Glucose
D-Erythrose 4-phosphate + Water + Phosphoenolpyruvic acid <>2 2-Dehydro-3-deoxy-D-arabino-heptonate 7-phosphate + Phosphate
Adenosine triphosphate + Water + Pyruvic acid <> Adenosine monophosphate +2 Hydrogen ion + Phosphoenolpyruvic acid + Phosphate
Ammonia + NAD + 3 NADP + 2 Water <> Nitrite + NADH +3 NADPH +5 Hydrogen ion
Water + 5 5,10-Methenyltetrahydrofolate <> N10-Formyl-THF + Hydrogen ion
NAD + Water <> Adenosine monophosphate + Nicotinamide ribotide
5 Hydrogen ion + 3 NADPH + Sulfite <>3 Water + Hydrogen sulfide +3 NADP
dATP + Thioredoxin disulfide + Water <> Adenosine triphosphate + Thioredoxin
dGTP + Thioredoxin disulfide + Water <> Guanosine triphosphate + Thioredoxin
di-trans,octa-cis-undecaprenyl diphosphate + Water + Undecaprenyl diphosphate <> Di-trans,poly-cis-undecaprenyl phosphate + Phosphate
Carbonic acid <> Carbon dioxide + Water
2 Hydrogen peroxide <>2 Water + Oxygen
Arsenate ion + Glutaredoxin <> Arsenite + Glutaredoxin disulfide + Water
Water + Trehalose >2 D-Glucose
Hydrogen selenide + 3 NADP + 3 Water <> Selenite +3 NADPH
gamma-Glutamyl-L-putrescine + Water + Oxygen <> gamma-Glutamyl-gamma-butyraldehyde + Ammonia + Hydrogen peroxide
Peptide-L-methionine + Thioredoxin disulfide + Water <> Peptide-L-methionine (R)-S-oxide + Thioredoxin
1-Acyl-sn-glycero-3-phosphocholine + Water <> Glycerophosphocholine + Carboxylate
Trinitrotoluene + 2 NADPH + 2 Hydrogen ion <>4 4-Hydroxylamino-2,6-dinitrotoluene +2 NADP + Water
Chitobiose + Water <>2 N-Acetyl-D-glucosamine
L-Glutamine + Water + Phosphoribosyl pyrophosphate <> L-Glutamate + Pyrophosphate +5 5-Phosphoribosylamine
5 5-Phosphoribosylamine + Pyrophosphate + L-Glutamate <> L-Glutamine + Phosphoribosyl pyrophosphate + Water
3 3-Isopropylmalate <> Isopropylmaleate + Water
Hydrogen ion + Prephenate > Carbon dioxide + Water + Phenylpyruvic acid
6 6-Phosphonoglucono-D-lactone + Water <>6 6-Phosphogluconic acid + Hydrogen ion
6 6-Phosphonoglucono-D-lactone + Water <>6 6-Phosphogluconic acid
6 6-Phosphogluconic acid <>2 2-Keto-3-deoxy-6-phosphogluconic acid + Water
Dihydroneopterin triphosphate + 3 Water <>7 7,8-Dihydroneopterin +3 Phosphate
N-Acetylmuramoyl-Ala + Water <> N-Acetyl-D-muramoate + L-Alanine
alpha-D-Ribose 1-methylphosphonate 5-triphosphate + Water <> alpha-D-Ribose 1-methylphosphonate 5-phosphate + Pyrophosphate
Alkanesulfonate + FMNH + Oxygen <> Aldehyde + Flavin Mononucleotide + Sulfite + Water
4 4,5-Dihydroorotic acid + Water <> Ureidosuccinic acid + Hydrogen ion
Oxygen + 4 Fe2+ + 4 Hydrogen ion <>4 Fe3+ +2 Water
NMN + Water <> Nicotinamide ribotide + Ammonia
Deoxyadenosine monophosphate + Water > Deoxyadenosine + Phosphate
S-Formylglutathione + Water <> Formic acid + Glutathione + Hydrogen ion
2 2-Phospho-D-glyceric acid <> Water + Phosphoenolpyruvic acid
D-Arabinose 5-phosphate + Water + Phosphoenolpyruvic acid <>3 3-Deoxy-D-manno-octulosonate 8-phosphate + Phosphate
Adenosine triphosphate + L-Glutamine + Water + Uridine triphosphate > ADP + Cytidine triphosphate + L-Glutamate +2 Hydrogen ion + Phosphate
(3R)-3-Hydroxybutanoyl-[acyl-carrier protein] <> But-2-enoyl-[acyl-carrier protein] + Water
Water + Succinyl-CoA + Tetrahydrodipicolinate <> Coenzyme A + N-Succinyl-2-amino-6-ketopimelate
Carbon dioxide + Water + Phosphoenolpyruvic acid <> Hydrogen ion + Oxalacetic acid + Phosphate + Hydrogen carbonate
Water + O-Phosphohomoserine <> Phosphate + L-Threonine
Adenosine triphosphate + 5 5'-Phosphoribosyl-N-formylglycineamide + L-Glutamine + Water <> ADP + Phosphoribosylformylglycineamidine + L-Glutamate + Hydrogen ion + Phosphate
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid > Adenosine monophosphate + L-Glutamate + Guanosine monophosphate +2 Hydrogen ion + Pyrophosphate
Water + Inosinic acid + NAD <> Hydrogen ion + NADH + Xanthylic acid
alpha-Ketoisovaleric acid + Acetyl-CoA + Water + a-Ketoisovaleric acid <>2 2-Isopropylmalic acid + Coenzyme A + Hydrogen ion
2 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate + 2 Reduced ferredoxin + Oxidized ferredoxin <> 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + Water
Water + Myo-inositol 1-phosphate > Inositol + Phosphate
Cysteinylglycine + Water > L-Cysteine + Glycine
Guanosine triphosphate + Water <> Cyclic pyranopterin monophosphate + Pyrophosphate
Adenosine monophosphate + Water <> Adenine + D-Ribose-5-phosphate
Pyrophosphate + Water <> Phosphate
Guanosine triphosphate + 3 Water <>2 2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Formic acid +2 Hydrogen ion + Pyrophosphate +2 2,5-diamino-6-hydroxy-4-(5-phospho-D-ribosylamino)pyrimidine
Phosphatidylglycerophosphate + Water <> PG(16:0/16:0) + Phosphate
Penicillin + Water <> Penicilloic acid
Water + Adenosine > Ammonia + Inosine
Water + UDP-3-O-(3-Hydroxymyristoyl)-N-acetylglucosamine <> Acetic acid + UDP-3-O-(3-Hydroxytetradecanoyl)-D-glucosamine
L-Histidinal + Water + NAD <> L-Histidine + NADH + Hydrogen ion
Hydrogen ion + 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH > Water + Isopentenyl pyrophosphate + NAD
L-Glutamate + NAD + Water <> alpha-Ketoglutarate + Ammonia + NADH + Hydrogen ion
N-Substituted aminoacyl-tRNA + Water <> N-Substituted amino acid + tRNA
alpha-Ketoisovaleric acid + Water + 5 5,10-Methylene-THF + a-Ketoisovaleric acid <>2 2-Dehydropantoate + Tetrahydrofolic acid
6 6-Hydroxymethyl dihydropterin + p-Aminobenzoic acid <>7 7,8-Dihydropteroic acid + Water
2 Adenosine triphosphate + L-Glutamine + Water + Hydrogen carbonate >2 ADP + Carbamoylphosphate + L-Glutamate +2 Hydrogen ion + Phosphate
Water + Inosinic acid <> Phosphoribosyl formamidocarboxamide
Nicotinamide ribotide + Pyrophosphate + Adenosine triphosphate + Water <> Nicotinic acid + Phosphoribosyl pyrophosphate + ADP + Phosphate
Adenosine diphosphate ribose + Water <> Adenosine monophosphate +2 Hydrogen ion + D-Ribose-5-phosphate
Peptide-L-methionine + Thioredoxin disulfide + Water + L-Methionine <> Peptide-L-methionine (S)-S-oxide + Thioredoxin + L-methionine (S)-S-oxide
2 2-Octaprenylphenol + Oxygen + NADPH + Hydrogen ion <>2 2-Octaprenyl-6-hydroxyphenol + NADP + Water
Water + Phosphoribosyl-AMP <> PhosphoribosylformiminoAICAR-phosphate
Fructose 1,6-bisphosphate + Water <> Fructose 6-phosphate + Phosphate
Water + Histidinol phosphate <> L-Histidinol + Phosphate
dTDP-D-Glucose <>4 4,6-Dideoxy-4-oxo-dTDP-D-glucose + Water
Phosphoadenosine phosphosulfate + Water <> Adenosine phosphosulfate + Phosphate
N-Acetylornithine + Water <> Acetic acid + Ornithine + L-Ornithine
N5-Formyl-H4F + Hydrogen ion > Water +5 5,10-Methenyltetrahydrofolate
2 2-Polyprenyl-6-methoxyphenol + Oxygen <>2 2-Polyprenyl-6-methoxy-1,4-benzoquinone + Water
Guanosine 3'-diphosphate 5'-triphosphate + Water <> Hydrogen ion + Phosphate + Guanosine 3',5'-bis(diphosphate)
2 5-Aminolevulinic acid <> Hydrogen ion +2 Water + Porphobilinogen
2 5-Aminolevulinic acid <> Porphobilinogen +2 Water
Hydroxymethylbilane <> Water + Uroporphyrinogen III
4 Porphobilinogen + Water <> Hydroxymethylbilane +4 Ammonia
Pyruvic acid + Ubiquinone-1 + Water <> Acetic acid + Ubiquinol-8 + Carbon dioxide
alpha-Amino acid + Water + Acceptor <>2 2-Oxo acid + Ammonia + Reduced acceptor
gamma-Glutamyl-gamma-butyraldehyde + Water + NADP <>4 4-(Glutamylamino) butanoate +2 Hydrogen ion + NADPH
Deoxyuridine triphosphate + Water <> dUMP + Hydrogen ion + Pyrophosphate
Betaine aldehyde + Water + NADP > Betaine +2 Hydrogen ion + NADPH
Guanosine diphosphate mannose <> GDP-4-Dehydro-6-deoxy-D-mannose + Water
Formyl-L-methionyl peptide + Water <> Formic acid + Methionyl peptide
Indole + L-Serine > Water + L-Tryptophan
L-Serine + Indole <> L-Tryptophan + Water
2 Thiol-containing reductant + ROOH <> Oxidized thiol-containing reductant + Water + ROH
Glycerophosphocholine + Water > Choline + Glycerol 3-phosphate + Hydrogen ion
Guanosine triphosphate + Water > Guanosine monophosphate + Hydrogen ion + Pyrophosphate
Cytosine + Water <> Uracil + Ammonia
alpha-D-Ribose 1-methylphosphonate 5-triphosphate + Water <> alpha-D-Ribose 1-methylphosphonate 5-phosphate + Pyrophosphate
L-D-1-Pyrroline-5-carboxylic acid + 2 Water + NAD > L-Glutamate + Hydrogen ion + NADH
Methylcitric acid + (2S,3S)-2-hydroxybutane-1,2,3-tricarboxylate <> Cis-2-Methylaconitate + Water
N2-Succinyl-L-arginine + 2 Water <> N2-Succinyl-L-ornithine + Carbon dioxide +2 Ammonia
Dihydroxyacetone phosphate + Iminoaspartic acid <>2 Water + Phosphate + Quinolinic acid
L-Aspartate-semialdehyde + Pyruvic acid >2 2,3-Dihydrodipicolinic acid + Hydrogen ion +2 Water
D-Lactic acid <> Pyruvaldehyde + Water
dADP + Thioredoxin disulfide + Water <> Thioredoxin + ADP
Nitrite + Acceptor + Water <> Nitrate + Reduced acceptor
Glucosamine 6-phosphate + Water <> Fructose 6-phosphate + Ammonia
N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole + Water > Phosphate + N1-(alpha-D-ribosyl)-5,6-dimethyl-benzimidazole
Farnesyl pyrophosphate + Water + Heme > Heme O + Pyrophosphate
Glutathione + Water > Cysteinylglycine + L-Glutamate
(S)-Ureidoglycolic acid + Water <> Glyoxylic acid +2 Ammonia + Carbon dioxide
Water + Hypoxanthine + NAD > Hydrogen ion + NADH + Xanthine
Water + NAD <> Adenosine monophosphate +2 Hydrogen ion + Nicotinamide ribotide + NMN
Acetyl-CoA + Water + Oxalacetic acid <> Citric acid + Coenzyme A + Hydrogen ion
(3R)-3-Hydroxydecanoyl-[acyl-carrier protein] <> trans-Dec-2-enoyl-[acp] + Water
L-Glutamine + Water <> L-Glutamate + Ammonia
D-Erythrose 4-phosphate + Water + Phosphoenolpyruvic acid <>2 2-Dehydro-3-deoxy-D-arabino-heptonate 7-phosphate + Phosphate
Ammonia + NAD + 3 NADP + 2 Water <> Nitrite + NADH +3 NADPH +5 Hydrogen ion
Water + 5 5,10-Methenyltetrahydrofolate <> N10-Formyl-THF + Hydrogen ion
5 Hydrogen ion + 3 NADPH + Sulfite <>3 Water + Hydrogen sulfide +3 NADP
Water + Hypoxanthine + NAD > Hydrogen ion + NADH + Xanthine
L-Asparagine + Water > Hydrogen ion + L-Aspartic acid + Ammonia
Trehalose + Water <>2 D-Glucose
Trinitrotoluene + 2 NADPH + 2 Hydrogen ion <>4 4-Hydroxylamino-2,6-dinitrotoluene +2 NADP + Water
Chitobiose + Water <>2 N-Acetyl-D-glucosamine
L-Glutamine + Water + Phosphoribosyl pyrophosphate <> L-Glutamate + Pyrophosphate +5 5-Phosphoribosylamine
3 3-Isopropylmalate <> Isopropylmaleate + Water
6 6-Phosphonoglucono-D-lactone + Water <>6 6-Phosphogluconic acid + Hydrogen ion
D-Erythrose 4-phosphate + Water + NAD <>4 4-Phospho-D-erythronate +2 Hydrogen ion + NADH
N-Acetylmuramoyl-Ala + Water <> N-Acetyl-D-muramoate + L-Alanine
Oxygen + 4 Fe2+ + 4 Hydrogen ion <>4 Fe3+ +2 Water
D-Arabinose 5-phosphate + Water + Phosphoenolpyruvic acid <>3 3-Deoxy-D-manno-octulosonate 8-phosphate + Phosphate
Adenosine triphosphate + L-Glutamine + Water + Uridine triphosphate > ADP + Cytidine triphosphate + L-Glutamate +2 Hydrogen ion + Phosphate
(3R)-3-Hydroxybutanoyl-[acyl-carrier protein] <> But-2-enoyl-[acyl-carrier protein] + Water
Adenosine triphosphate + 5 5'-Phosphoribosyl-N-formylglycineamide + L-Glutamine + Water <> ADP + Phosphoribosylformylglycineamidine + L-Glutamate + Hydrogen ion + Phosphate
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid > Adenosine monophosphate + L-Glutamate + Guanosine monophosphate +2 Hydrogen ion + Pyrophosphate
Water + Inosinic acid + NAD <> Hydrogen ion + NADH + Xanthylic acid
Water + Myo-inositol 1-phosphate > Inositol + Phosphate
Nitrite + Acceptor + Water <> Nitrate + Reduced acceptor
Nitrite + Acceptor + Water <> Nitrate + Reduced acceptor
Phosphatidylglycerophosphate + Water <> PG(16:0/16:0) + Phosphate
Penicillin + Water <> Penicilloic acid
Water <> Ammonia
Guanosine triphosphate + Water > Guanosine monophosphate + Hydrogen ion + Pyrophosphate
Water + UDP-3-O-(3-Hydroxymyristoyl)-N-acetylglucosamine <> Acetic acid + UDP-3-O-(3-Hydroxytetradecanoyl)-D-glucosamine
N-Substituted aminoacyl-tRNA + Water <> N-Substituted amino acid + tRNA
6 6-Hydroxymethyl dihydropterin + p-Aminobenzoic acid <>7 7,8-Dihydropteroic acid + Water
2 Adenosine triphosphate + L-Glutamine + Water + Hydrogen carbonate >2 ADP + Carbamoylphosphate + L-Glutamate +2 Hydrogen ion + Phosphate
Water + Inosinic acid <> Phosphoribosyl formamidocarboxamide
Nicotinamide ribotide + Pyrophosphate + Adenosine triphosphate + Water <> Nicotinic acid + Phosphoribosyl pyrophosphate + ADP + Phosphate
Peptide-L-methionine + Thioredoxin disulfide + Water + L-Methionine <> Peptide-L-methionine (S)-S-oxide + Thioredoxin + L-methionine (S)-S-oxide
2 2-Octaprenylphenol + Oxygen + NADPH + Hydrogen ion <>2 2-Octaprenyl-6-hydroxyphenol + NADP + Water
1-Acyl-sn-glycero-3-phosphocholine + Water <> Glycerophosphocholine + Carboxylate
Water + Histidinol phosphate <> L-Histidinol + Phosphate
Phosphoadenosine phosphosulfate + Water <> Adenosine phosphosulfate + Phosphate
N-Acetylornithine + Water <> Acetic acid + Ornithine + L-Ornithine
N5-Formyl-H4F + Hydrogen ion > Water +5 5,10-Methenyltetrahydrofolate
Guanosine 3'-diphosphate 5'-triphosphate + Water <> Hydrogen ion + Phosphate + Guanosine 3',5'-bis(diphosphate)
2 5-Aminolevulinic acid <> Hydrogen ion +2 Water + Porphobilinogen
4 Porphobilinogen + Water <> Hydroxymethylbilane +4 Ammonia
Pyruvic acid + Ubiquinone-1 + Water <> Acetic acid + Ubiquinol-8 + Carbon dioxide
alpha-Amino acid + Water + Acceptor <>2 2-Oxo acid + Ammonia + Reduced acceptor
Deoxyuridine triphosphate + Water <> dUMP + Hydrogen ion + Pyrophosphate
Betaine aldehyde + Water + NADP > Betaine +2 Hydrogen ion + NADPH
Guanosine diphosphate mannose <> GDP-4-Dehydro-6-deoxy-D-mannose + Water

SMPDB Pathways:
1,6-anhydro-<i>N</i>-acetylmuramic acid recyclingPW002064 ThumbThumb?image type=greyscaleThumb?image type=simple
2,3-dihydroxybenzoate biosynthesisPW000751 ThumbThumb?image type=greyscaleThumb?image type=simple
2-O-alpha-mannosyl-D-glycerate degradationPW002096 ThumbThumb?image type=greyscaleThumb?image type=simple
2-Oxopent-4-enoate metabolismPW001890 ThumbThumb?image type=greyscaleThumb?image type=simple
2-Oxopent-4-enoate metabolism 2PW002035 ThumbThumb?image type=greyscaleThumb?image type=simple
4-aminobutanoate degradation IPW002068 ThumbThumb?image type=greyscaleThumb?image type=simple
ADP-L-glycero-Beta-D-manno-heptose biosynthesisPW002095 ThumbThumb?image type=greyscaleThumb?image type=simple
Amino sugar and nucleotide sugar metabolism IPW000886 ThumbThumb?image type=greyscaleThumb?image type=simple
Amino sugar and nucleotide sugar metabolism IIPW000887 ThumbThumb?image type=greyscaleThumb?image type=simple
Amino sugar and nucleotide sugar metabolism IIIPW000895 ThumbThumb?image type=greyscaleThumb?image type=simple
Aminobenzoate DegradationPW000757 ThumbThumb?image type=greyscaleThumb?image type=simple
Arachidonic acid metabolismPW000759 ThumbThumb?image type=greyscaleThumb?image type=simple
Ascorbate metabolismPW000793 ThumbThumb?image type=greyscaleThumb?image type=simple
Asparagine biosynthesisPW000813 ThumbThumb?image type=greyscaleThumb?image type=simple
Aspartate metabolismPW000787 ThumbThumb?image type=greyscaleThumb?image type=simple
Biosynthesis of siderophore group nonribosomal peptidesPW000760 ThumbThumb?image type=greyscaleThumb?image type=simple
Biotin metabolismPW000762 ThumbThumb?image type=greyscaleThumb?image type=simple
Chitobiose DegradationPW002042 ThumbThumb?image type=greyscaleThumb?image type=simple
Chorismate biosynthesisPW000816 ThumbThumb?image type=greyscaleThumb?image type=simple
Citrate lyase activationPW002075 ThumbThumb?image type=greyscaleThumb?image type=simple
Collection of Reactions without pathwaysPW001891 ThumbThumb?image type=greyscaleThumb?image type=simple
D-Alanine metabolismPW000768 ThumbThumb?image type=greyscaleThumb?image type=simple
D-Glutamine and D-glutamate metabolismPW000769 ThumbThumb?image type=greyscaleThumb?image type=simple
D-allulose degradationPW000825 ThumbThumb?image type=greyscaleThumb?image type=simple
D-arabinose degradation IPW002038 ThumbThumb?image type=greyscaleThumb?image type=simple
D-serine degradationPW002101 ThumbThumb?image type=greyscaleThumb?image type=simple
Enterobactin BiosynthesisPW002048 ThumbThumb?image type=greyscaleThumb?image type=simple
Ethylene Glycol DegradationPW002093 ThumbThumb?image type=greyscaleThumb?image type=simple
Fatty acid biosynthesisPW000900 ThumbThumb?image type=greyscaleThumb?image type=simple
Fatty acid metabolismPW000796 ThumbThumb?image type=greyscaleThumb?image type=simple
Flavin biosynthesisPW001971 ThumbThumb?image type=greyscaleThumb?image type=simple
Fluorobenzoate degradationPW000766 ThumbThumb?image type=greyscaleThumb?image type=simple
Folate biosynthesisPW000908 ThumbThumb?image type=greyscaleThumb?image type=simple
Fructoselysine and Psicoselysine DegradationPW002049 ThumbThumb?image type=greyscaleThumb?image type=simple
GLYCINE BIOSYNTHESISPW000808 ThumbThumb?image type=greyscaleThumb?image type=simple
GTP degradationPW001888 ThumbThumb?image type=greyscaleThumb?image type=simple
Galactitol and galactonate degradationPW000820 ThumbThumb?image type=greyscaleThumb?image type=simple
Galactose metabolismPW000821 ThumbThumb?image type=greyscaleThumb?image type=simple
Gluconeogenesis from L-malic acidPW000819 ThumbThumb?image type=greyscaleThumb?image type=simple
Glutathione metabolismPW000833 ThumbThumb?image type=greyscaleThumb?image type=simple
Hydrogen Sulfide Biosynthesis IPW002066 ThumbThumb?image type=greyscaleThumb?image type=simple
L-alanine metabolismPW000788 ThumbThumb?image type=greyscaleThumb?image type=simple
L-carnitine degradation IPW002037 ThumbThumb?image type=greyscaleThumb?image type=simple
L-cysteine degradationPW002110 ThumbThumb?image type=greyscaleThumb?image type=simple
L-glutamate metabolismPW000789 ThumbThumb?image type=greyscaleThumb?image type=simple
L-glutamate metabolism IIPW001886 ThumbThumb?image type=greyscaleThumb?image type=simple
L-lactaldehyde degradation (aerobic)PW002073 ThumbThumb?image type=greyscaleThumb?image type=simple
L-threonine degradation to methylglyoxalPW002106 ThumbThumb?image type=greyscaleThumb?image type=simple
Leucine BiosynthesisPW000811 ThumbThumb?image type=greyscaleThumb?image type=simple
Lipopolysaccharide biosynthesisPW000831 ThumbThumb?image type=greyscaleThumb?image type=simple
Lysine biosynthesisPW000771 ThumbThumb?image type=greyscaleThumb?image type=simple
Mannose MetabolismPW000822 ThumbThumb?image type=greyscaleThumb?image type=simple
Menaquinol biosythesisPW001897 ThumbThumb?image type=greyscaleThumb?image type=simple
N-acetylneuraminate and N-acetylmannosamine and N-acetylglucosamine degradationPW002030 ThumbThumb?image type=greyscaleThumb?image type=simple
N-oxide electron transferPW001889 ThumbThumb?image type=greyscaleThumb?image type=simple
NAD biosynthesisPW000829 ThumbThumb?image type=greyscaleThumb?image type=simple
NAD phosphorylation and dephosphorylationPW002081 ThumbThumb?image type=greyscaleThumb?image type=simple
NAD salvagePW000830 ThumbThumb?image type=greyscaleThumb?image type=simple
Nitrogen metabolismPW000755 ThumbThumb?image type=greyscaleThumb?image type=simple
O-antigen building blocks biosynthesisPW002089 ThumbThumb?image type=greyscaleThumb?image type=simple
Oleic acid OxidationPW002025 ThumbThumb?image type=greyscaleThumb?image type=simple
One Carbon Pool by Folate IPW001735 ThumbThumb?image type=greyscaleThumb?image type=simple
One carbon pool by folatePW000773 ThumbThumb?image type=greyscaleThumb?image type=simple
Oxidative phosphorylationPW000919 ThumbThumb?image type=greyscaleThumb?image type=simple
Pantothenate and CoA biosynthesisPW000828 ThumbThumb?image type=greyscaleThumb?image type=simple
Pentose PhosphatePW000893 ThumbThumb?image type=greyscaleThumb?image type=simple
Phenylalanine metabolismPW000921 ThumbThumb?image type=greyscaleThumb?image type=simple
Phenylethylamine metabolismPW002027 ThumbThumb?image type=greyscaleThumb?image type=simple
Porphyrin metabolismPW000936 ThumbThumb?image type=greyscaleThumb?image type=simple
Propanoate metabolismPW000940 ThumbThumb?image type=greyscaleThumb?image type=simple
Purine degradationPW001887 ThumbThumb?image type=greyscaleThumb?image type=simple
Putrescine Degradation IIPW002054 ThumbThumb?image type=greyscaleThumb?image type=simple
Pyrimidine metabolismPW000942 ThumbThumb?image type=greyscaleThumb?image type=simple
Pyrimidine ribonucleosides degradtionPW002024 ThumbThumb?image type=greyscaleThumb?image type=simple
Quorum SensingPW000836 ThumbThumb?image type=greyscaleThumb?image type=simple
Ribose DegradationPW002102 ThumbThumb?image type=greyscaleThumb?image type=simple
S-adenosyl-L-methionine biosynthesisPW000837 ThumbThumb?image type=greyscaleThumb?image type=simple
S-adenosyl-L-methionine cyclePW002080 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolite: Leucine biosynthesisPW000980 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolites: Glyoxylate cyclePW000967 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolites: Histidine biosynthesisPW000984 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolites: Shikimate PathwayPW000985 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolites: Ubiquinol biosynthesisPW000981 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolites: Ubiquinol biosynthesis 2PW002036 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolites: Valine and I-leucine biosynthesis from pyruvatePW000978 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolites: cysteine biosynthesis from serinePW000977 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolites: enterobacterial common antigen biosynthesisPW000959 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolites: enterobacterial common antigen biosynthesis 2PW002045 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolites: enterobacterial common antigen biosynthesis 3PW002046 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolites: threonine biosynthesis from aspartatePW000976 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary metabolites: Trehalose Biosynthesis and MetabolismPW000968 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary metabolites: isoprenoid biosynthesis (nonmevalonate pathway)PW000975 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary metabolites: methylerythritol phosphate and polyisoprenoid biosynthesisPW000958 ThumbThumb?image type=greyscaleThumb?image type=simple
Selenium metabolismPW001894 ThumbThumb?image type=greyscaleThumb?image type=simple
Spermidine Biosynthesis IPW002040 ThumbThumb?image type=greyscaleThumb?image type=simple
Spermidine biosynthesis and metabolismPW002085 ThumbThumb?image type=greyscaleThumb?image type=simple
Starch and sucrose metabolismPW000941 ThumbThumb?image type=greyscaleThumb?image type=simple
Sulfur metabolismPW000922 ThumbThumb?image type=greyscaleThumb?image type=simple
Superoxide Radicals DegradationPW002053 ThumbThumb?image type=greyscaleThumb?image type=simple
TCA cyclePW000779 ThumbThumb?image type=greyscaleThumb?image type=simple
TCA cycle (ubiquinol-0)PW002023 ThumbThumb?image type=greyscaleThumb?image type=simple
TCA cycle (ubiquinol-10)PW001010 ThumbThumb?image type=greyscaleThumb?image type=simple
TCA cycle (ubiquinol-2)PW001002 ThumbThumb?image type=greyscaleThumb?image type=simple
TCA cycle (ubiquinol-3)PW001003 ThumbThumb?image type=greyscaleThumb?image type=simple
TCA cycle (ubiquinol-4)PW001004 ThumbThumb?image type=greyscaleThumb?image type=simple
TCA cycle (ubiquinol-5)PW001005 ThumbThumb?image type=greyscaleThumb?image type=simple
TCA cycle (ubiquinol-6)PW001006 ThumbThumb?image type=greyscaleThumb?image type=simple
TCA cycle (ubiquinol-7)PW001007 ThumbThumb?image type=greyscaleThumb?image type=simple
TCA cycle (ubiquinol-8)PW001008 ThumbThumb?image type=greyscaleThumb?image type=simple
TCA cycle (ubiquinol-9)PW001009 ThumbThumb?image type=greyscaleThumb?image type=simple
Taurine MetabolismPW000774 ThumbThumb?image type=greyscaleThumb?image type=simple
Taurine Metabolism IPW001028 ThumbThumb?image type=greyscaleThumb?image type=simple
Tetrahydromonapterin BiosynthesisPW002043 ThumbThumb?image type=greyscaleThumb?image type=simple
Thiamin diphosphate biosynthesisPW002028 ThumbThumb?image type=greyscaleThumb?image type=simple
Thiazole Biosynthesis IPW002041 ThumbThumb?image type=greyscaleThumb?image type=simple
Thiosulfate Disproportionation IIIPW002060 ThumbThumb?image type=greyscaleThumb?image type=simple
Trehalose Degradation I (low osmolarity)PW002097 ThumbThumb?image type=greyscaleThumb?image type=simple
Tryptophan metabolismPW000815 ThumbThumb?image type=greyscaleThumb?image type=simple
Uracil degradation IIIPW002026 ThumbThumb?image type=greyscaleThumb?image type=simple
Valine BiosynthesisPW000812 ThumbThumb?image type=greyscaleThumb?image type=simple
Vitamin B6 1430936196PW000891 ThumbThumb?image type=greyscaleThumb?image type=simple
adenine and adenosine salvage IPW002069 ThumbThumb?image type=greyscaleThumb?image type=simple
adenine and adenosine salvage IIPW002071 ThumbThumb?image type=greyscaleThumb?image type=simple
adenine and adenosine salvage IIIPW002072 ThumbThumb?image type=greyscaleThumb?image type=simple
adenosine nucleotides degradationPW002091 ThumbThumb?image type=greyscaleThumb?image type=simple
adenosylcobalamin salvage from cobinamidePW001884 ThumbThumb?image type=greyscaleThumb?image type=simple
allantoin degradation (anaerobic)PW002050 ThumbThumb?image type=greyscaleThumb?image type=simple
arginine metabolismPW000790 ThumbThumb?image type=greyscaleThumb?image type=simple
beta-Alanine metabolismPW000896 ThumbThumb?image type=greyscaleThumb?image type=simple
biotin-carboxyl carrier protein assemblyPW002067 ThumbThumb?image type=greyscaleThumb?image type=simple
colanic acid building blocks biosynthesisPW000951 ThumbThumb?image type=greyscaleThumb?image type=simple
cyanate degradationPW002099 ThumbThumb?image type=greyscaleThumb?image type=simple
cysteine biosynthesisPW000800 ThumbThumb?image type=greyscaleThumb?image type=simple
dimethyl sulfoxide electron transferPW001892 ThumbThumb?image type=greyscaleThumb?image type=simple
fatty acid elongation -- saturatedPW000798 ThumbThumb?image type=greyscaleThumb?image type=simple
fatty acid oxidationPW000758 ThumbThumb?image type=greyscaleThumb?image type=simple
fatty acid oxidation (Butanoate)PW001017 ThumbThumb?image type=greyscaleThumb?image type=simple
fatty acid oxidation (Decanoate)PW001018 ThumbThumb?image type=greyscaleThumb?image type=simple
fatty acid oxidation (hexanoate)PW001019 ThumbThumb?image type=greyscaleThumb?image type=simple
fatty acid oxidation (laurate)PW001020 ThumbThumb?image type=greyscaleThumb?image type=simple
fatty acid oxidation (myristate)PW001021 ThumbThumb?image type=greyscaleThumb?image type=simple
fatty acid oxidation (octanoate)PW001022 ThumbThumb?image type=greyscaleThumb?image type=simple
fatty acid oxidation (palmitate)PW001023 ThumbThumb?image type=greyscaleThumb?image type=simple
fatty acid oxidation (steareate)PW001024 ThumbThumb?image type=greyscaleThumb?image type=simple
fructose metabolismPW000913 ThumbThumb?image type=greyscaleThumb?image type=simple
fucose and rhamnose degradationPW000826 ThumbThumb?image type=greyscaleThumb?image type=simple
galactose degradation/Leloir PathwayPW000884 ThumbThumb?image type=greyscaleThumb?image type=simple
glutathione metabolism IIPW001927 ThumbThumb?image type=greyscaleThumb?image type=simple
glutathione metabolism IIIPW002018 ThumbThumb?image type=greyscaleThumb?image type=simple
glycerol metabolismPW000914 ThumbThumb?image type=greyscaleThumb?image type=simple
glycerol metabolism IIPW000915 ThumbThumb?image type=greyscaleThumb?image type=simple
glycerol metabolism III (sn-glycero-3-phosphoethanolamine)PW000916 ThumbThumb?image type=greyscaleThumb?image type=simple
glycerol metabolism IV (glycerophosphoglycerol)PW000917 ThumbThumb?image type=greyscaleThumb?image type=simple
glycerol metabolism V (glycerophosphoserine)PW000918 ThumbThumb?image type=greyscaleThumb?image type=simple
glycolate and glyoxylate degradationPW000827 ThumbThumb?image type=greyscaleThumb?image type=simple
glycolate and glyoxylate degradation IIPW002021 ThumbThumb?image type=greyscaleThumb?image type=simple
glycolysis and pyruvate dehydrogenasePW000785 ThumbThumb?image type=greyscaleThumb?image type=simple
hexuronide and hexuronate degradationPW000834 ThumbThumb?image type=greyscaleThumb?image type=simple
histidine biosynthesisPW000810 ThumbThumb?image type=greyscaleThumb?image type=simple
inner membrane transportPW000786 ThumbThumb?image type=greyscaleThumb?image type=simple
isoleucine biosynthesisPW000818 ThumbThumb?image type=greyscaleThumb?image type=simple
ketogluconate metabolismPW002003 ThumbThumb?image type=greyscaleThumb?image type=simple
lipopolysaccharide biosynthesis IIPW001905 ThumbThumb?image type=greyscaleThumb?image type=simple
lipopolysaccharide biosynthesis IIIPW002059 ThumbThumb?image type=greyscaleThumb?image type=simple
methylglyoxal degradation IIPW002084 ThumbThumb?image type=greyscaleThumb?image type=simple
methylglyoxal degradation IVPW002078 ThumbThumb?image type=greyscaleThumb?image type=simple
methylphosphonate degradation IPW002065 ThumbThumb?image type=greyscaleThumb?image type=simple
nitrate reduction VIIIPW002092 ThumbThumb?image type=greyscaleThumb?image type=simple
ornithine metabolismPW000791 ThumbThumb?image type=greyscaleThumb?image type=simple
palmitate biosynthesisPW000797 ThumbThumb?image type=greyscaleThumb?image type=simple
palmitate biosynthesis 2PW002044 ThumbThumb?image type=greyscaleThumb?image type=simple
phenylalanine biosynthesisPW000807 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/15:0cyclo/18:1(9Z))PW001064 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/15:0cyclo/19:0cycv8c)PW001065 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/18:1(9Z)/15:0cyclo)PW001082 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/10:0/10:0(3-OH)/10:0))PW001899 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/12:0(3-OH)/10:0(3-OH)/12:0(3-OH)))PW001900 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/12:0/10:0(3-OH)/12:0))PW001901 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/15:0cyclo/10:0(3-OH)/15:0cyclo))PW001902 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/16:0/10:0(3-OH)/16:0))PW001904 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/16:1(9Z)/10:0(3-OH)/16:1(9Z)))PW001903 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/17:0cycw7c/10:0(3-OH)/17:0cycw7c))PW001906 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/17:0cycw7c/14:0/14:0))PW001907 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/19:0cycv8c/10:0(3-OH)/19:0cycv8c))PW001908 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/19:iso/10:0(3-OH)/19:iso))PW001909 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0/10:0(3-OH)/10:0/10:0(3-OH)))PW001910 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0/12:0(3-OH)/10:0/12:0(3-OH)))PW001911 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0/17:0cycw7c/14:0/14:0))PW001912 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/10:0(3-OH)/12:0(3-OH)/10:0(3-OH)))PW001913 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/10:0/12:0(3-OH)/10:0))PW001914 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/12:0(3-OH)/12:0/12:0))PW001915 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/14:0(3-OH)/12:0(3-OH)/14:0(3-OH)))PW001918 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/14:0/12:0(3-OH)/14:0))PW001919 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/15:0/12:0(3-OH)/15:0))PW001920 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/15:0cyclo/12:0(3-OH)/15:0cyclo))PW001921 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/17:0cycw7c/12:0(3-OH)/17:0cycw7c))PW001922 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/18:1(9Z)/12:0(3-OH)/18:1(9Z)))PW001924 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/19:0cycv8c/12:0(3-OH)/19:0cycv8c))PW001925 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/19:iso/12:0(3-OH)/19:iso))PW001926 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0/10:0(3-OH)/12:0/10:0(3-OH)))PW001928 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0/12:0/12:0/12:0))PW001930 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0/14:0(3-OH)/12:0/14:0(3-OH)))PW001931 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0/19:iso/12:0/19:iso))PW001933 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0(3-OH)/12:0(3-OH)/14:0(3-OH)/12:0(3-OH)))PW001934 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0(3-OH)/12:0/14:0(3-OH)/12:0))PW001935 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0(3-OH)/16:1(9Z)/14:0(3-OH)/16:1(9Z)))PW001939 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0(3-OH)/17:0cycw7c/14:0(3-OH)/17:0cycw7c))PW001941 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0/12:0(3-OH)/14:0/12:0(3-OH)))PW001943 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0/15:0cyclo/17:0cycw7c/14:0)PW001030 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(15:0/10:0(3-OH)/15:0/10:0(3-OH)))PW001945 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(15:0/12:0(3-OH)/15:0/12:0(3-OH)))PW001946 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(15:0cyclo/10:0(3-OH)/15:0cyclo/10:0(3-OH)))PW001948 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(15:0cyclo/15:0cyclo/18:1(9Z)/16:0)) 1442599180PW002016 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(15:0cyclo/15:0cyclo/19:0cycv8c/19:0cycv8c))PW001789 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(15:0cyclo/16:0/19:0cycv8c/15:0cyclo))PW001114 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:0/10:0(3-OH)/16:0/10:0(3-OH)))PW001949 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:0/12:0/12:0/12:0)) 2PW001952 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:0/14:0(3-OH)/16:0/14:0(3-OH)))PW001951 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:0/16:0/16:0/16:0))PW002010 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/10:0/14:0/14:0))PW001954 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/12:0/12:0/12:0))PW001955 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/14:0(3-OH)/16:1(9Z)/14:0(3-OH)))PW001958 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/17:0cycw7c/14:0/17:0cycw7c))PW001959 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/18:1(9Z)/16:1(9Z)/14:0))PW001759 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/19:0/16:0/16:0))PW001961 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/19:0/16:1(9Z)/19:0))PW001962 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/19:0cycv8c/16:1(9Z)/19:0cycv8c))PW002017 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0/16:1(9Z)/14:0/14:0))PW001963 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0/16:1(9Z)/16:0/16:0))PW001964 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/10:0(3-OH)/14:0/14:0))PW001966 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/10:0(3-OH)/17:0cycw7c/10:0(3-OH)))PW001967 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/10:0/14:0/14:0))PW001968 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/12:0(3-OH)/12:0/12:0))PW001969 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/12:0(3-OH)/17:0cycw7c/12:0(3-OH)))PW001970 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/16:1(9Z)/14:0))PW001694 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/17:0cycw7c/16:1(9Z)))PW001696 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/17:0cycw7c/17:0cycw7c))PW001697 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/17:0cycw7c/18:1(9Z)))PW001698 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/18:1(9Z)/17:0cycw7c))PW001700 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/15:0cyclo))PW001702 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/17:0cycw7c))PW001705 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/19:0cycv8c))PW001707 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/14:0/18:1(9Z)))PW001712 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/17:0cycw7c/17:0cycw7c))PW001465 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/17:0cycw7c/18:1(9Z)))PW001466 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/18:1(9Z)/14:0))PW001473 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/14:0/14:0))PW001475 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/14:0/17:0cycw7c))PW001476 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/19:0cycv8c/14:0))PW001485 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/19:iso/17:0cycw7c/19:iso))PW001973 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:0/10:0/10:0/10:0))PW001974 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:0/12:0/12:0/12:0))PW001975 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(11Z)/10:0/10:0/10:0))PW001976 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(11Z)/19:0/14:0/14:0))PW001979 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(11Z)/19:0/18:1(11Z)/19:0))PW001980 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(11Z)/19:0/19:0/19:0))PW001981 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/12:0(3-OH)/18:1(9Z)/12:0(3-OH)))PW001982 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/14:0/14:0))PW001493 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/14:0/18:1(9Z)))PW001494 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/17:0cycw7c/14:0))PW001498 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/18:1(9Z)/14:0))PW001500 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/19:0cycv8c/14:0))PW001502 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/14:0/15:0cyclo) 5)PW001717 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/14:0/18:1(9Z)))PW001514 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/16:0/18:1(9Z)))PW001518 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/16:1(9Z)/18:1(9Z)))PW001519 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/17:0cycw7c/15:0cyclo))PW001527 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/15:0cyclo))PW001531 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/16:0))PW001532 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/16:1(9Z)))PW001533 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/18:1(9Z)))PW001540 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/19:0cycv8c/19:0cycv8c))PW001579 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/14:0/14:0))PW001580 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/14:0/16:0))PW001581 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/14:0/18:1(9Z)))PW001582 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/16:0/17:0cycw7c))PW002012 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/16:0/19:0cycv8c) 2)PW001783 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/16:0/19:0cycv8c))PW001583 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/17:0cycw7c/17:0cycw7c))PW001585 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/17:0cycw7c/18:1(9Z)))PW001586 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/14:0))PW001587 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/16:0))PW001588 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/16:1(9Z)))PW001594 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/17:0cycw7c))PW001595 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/18:1(9Z)))PW001596 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/19:0cycv8c))PW001597 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/19:0cycv8c/16:0))PW001598 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/19:0cycv8c/18:1(9Z)))PW001599 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/19:0cycv8c/19:0cycv8c))PW001600 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/14:0/14:0))PW001601 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/14:0/16:1(9Z)))PW001607 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/14:0/18:1(9Z)))PW001608 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/16:1(9Z)/14:0))PW001609 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/16:1(9Z)/17:0cycw7c))PW001610 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/16:1(9Z)/19:0cycv8c))PW001612 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/17:0cycw7c/16:1(9Z)))PW001613 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/17:0cycw7c/17:0cycw7c))PW001618 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/17:0cycw7c/18:1(9Z)))PW001619 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/18:1(9Z)/14:0))PW001620 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/18:1(9Z)/16:1(9Z)))PW001621 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/18:1(9Z)/18:1(9Z)))PW001622 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/18:1(9Z)/19:0cycv8c))PW001623 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/19:0cycv8c/16:1(9Z)))PW001629 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/19:0cycv8c/18:1(9Z)))PW001630 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/19:0cycv8c/19:0cycv8c))PW001632 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/14:0/18:1(9Z)))PW001635 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/17:0cycw7c/18:1(9Z)))PW001644 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/18:1(9Z)/14:0))PW001646 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/18:1(9Z)/17:0cycw7c))PW001647 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/14:0))PW001649 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/15:0cyclo))PW001664 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/16:0))PW001665 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/16:1(9Z)))PW001666 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/17:0cycw7c))PW001667 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/18:1(9Z)))PW001668 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/19:0cycv8c))PW001669 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/14:0))PW001670 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/16:0))PW001672 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/16:1(9Z)))PW001673 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/17:0cycw7c))PW001679 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/18:1(9Z)))PW001680 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/19:0cycv8c))PW001685 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/18:1(9Z)/14:0))PW001686 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/18:1(9Z)/17:0cycw7c))PW001687 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/18:1(9Z)/19:0cycv8c))PW001026 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/18:1(9Z)/19:0cycv8c)) 1440195714PW001034 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/18:1(9Z)/19:0cycv8c)) 2PW001186 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/14:0))PW001688 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/15:0cyclo))PW001185 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/16:0))PW001194 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/16:0)) 1442332377PW001956 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/16:1(9Z))PW001212 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/17:0cycw7c))PW001210 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/14:0/14:0))PW001211 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/14:0/18:1(9Z)))PW001233 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/14:0/19:0cycv8c))PW001234 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/17:0cycw7c/17:0cycw7c))PW001240 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/17:0cycw7c/18:1(9Z)))PW001241 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/18:1(9Z)/14:0))PW001244 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/18:1(9Z)/17:0cycw7c))PW001248 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/19:0cycv8c/14:0))PW001249 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1/18:1/18:1/18:1))PW001027 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0/16:1(9Z)/14:0/14:0))PW001983 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0/16:1(9Z)/16:0/16:0))PW001984 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0/16:1(9Z)/19:0/16:1(9Z)))PW001985 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0/18:1(11Z)/14:0/14:0))PW001986 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0/18:1(11Z)/19:0/18:1(11Z)))PW001987 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0/18:1(11Z)/19:0/19:0))PW001988 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/10:0(3-OH)/10:0/10:0))PW001989 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/10:0(3-OH)/19:0cycv8c/10:0(3-OH)))PW001991 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/12:0(3-OH)/12:0/12:0))PW001992 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/12:0(3-OH)/19:0cycv8c/12:0(3-OH)))PW001993 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/14:0/15:0cyclo))PW001276 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/14:0/19:0cycv8c))PW001291 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/17:0cycw7c/17:0cycw7c))PW001302 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/14:0))PW001309 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/16:0))PW001316 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/14:0/14:0))PW001320 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/14:0/16:0))PW001321 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/16:0/14:0))PW001323 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/16:0/17:0cycw7c))PW001324 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/16:1(9Z)/19:0cycv8c))PW001326 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/17:0cycw7c/16:0))PW001331 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/17:0cycw7c/19:0cycv8c))PW001333 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/18:1(9Z)/19:0cycv8c))PW001334 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/19:0cycv8c/16:1(9Z)))PW001341 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/19:0cycv8c/17:0cycw7c))PW001372 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/19:0cycv8c/18:1(9Z)))PW001373 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/14:0/14:0))PW001374 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/14:0/16:1(9Z)))PW001375 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/16:1(9Z)/14:0))PW001377 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/16:1(9Z)/17:0cycw7c))PW001383 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/17:0cycw7c/16:1(9Z)))PW001384 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/17:0cycw7c/17:0cycw7c))PW001385 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/17:0cycw7c/19:0cycv8c))PW001386 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/18:1(9Z)/19:0cycv8c))PW001387 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/14:0/14:0))PW001397 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/14:0/17:0cycw7c))PW001403 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/17:0cycw7c/19:0cycv8c))PW001406 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/14:0/18:1(9Z)))PW001415 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/17:0cycw7c/17:0cycw7c))PW001422 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/17:0cycw7c/18:1(9Z)))PW001423 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/18:1(9Z)/14:0))PW001424 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/18:1(9Z)/17:0cycw7c))PW001426 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/14:0))PW001432 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/16:0))PW001434 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/18:1(9Z)))PW001438 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:1(9Z)/16:1(9Z)/19:1(9Z)/16:1(9Z)))PW001995 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/10:0(3-OH)/10:0/10:0))PW001996 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/10:0(3-OH)/19:iso/10:0(3-OH)))PW001997 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/10:0/19:iso/10:0))PW001998 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/12:0(3-OH)/12:0/12:0))PW001999 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/12:0(3-OH)/19:iso/12:0(3-OH)))PW002000 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/12:0/19:iso/12:0))PW002001 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/14:0(3-OH)/14:0/14:0))PW002002 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/14:0(3-OH)/19:iso/14:0(3-OH)))PW002004 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/14:0/14:0/14:0))PW002005 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/14:0/19:iso/14:0))PW002006 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/17:0cycw7c/19:0/19:0))PW002007 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/19:0cycv8c/19:0/19:0))PW002008 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/19:iso/19:iso/19:iso))PW002009 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/15:0cyclo/14:0/17:0cycw7c)PW001029 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:0/14:0/14:0)PW001031 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:0/14:0/16:0)PW001032 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:0/14:0/16:1(9Z))PW001871 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:0/14:0/18:1(9Z))PW001033 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:0/14:0/19:0cycv8c)PW001035 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:0/16:1(9Z)/14:0)PW001036 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:0/18:1(9Z)/14:0)PW001037 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:0/19:0cycv8c/14:0)PW001038 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:1(9Z)/14:0/16:1(9Z))PW001039 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:1(9Z)/14:0/18:1(9Z))PW001040 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:1(9Z)/14:0/19:0cycv8c)PW001041 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:1(9Z)/18:1(9Z)/14:0)PW001042 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:1(9Z)/19:0cycv8c/14:0)PW001043 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/14:0/14:0)PW001044 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/14:0/17:0cycw7c)PW001045 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/14:0/18:1(9Z))PW001046 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/14:0/19:0cycv8c)PW001047 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/17:0cycw7c/14:0)PW001048 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/19:0cycv8c/14:0)PW001049 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/19:0cycv8c/14:0/17:0cycw7c)PW001050 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/19:0cycv8c/14:0/19:0cycv8c)PW001051 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/19:0cycv8c/17:0cycw7c/14:0)PW001052 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/14:0/14:0/17:0cycw7c)PW001053 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/14:0/16:1(9Z)/16:1(9Z))PW001054 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/14:0/17:0cycw7c/14:0)PW001055 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/14:0/17:0cycw7c/17:0cycw7c)PW001056 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/14:0/18:1(9Z)/18:1(9Z))PW001057 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/14:0/19:0cycv8c/19:0cycv8c)PW001058 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/14:0/16:0)PW001059 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/14:0/16:1(9Z))PW001060 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/14:0/18:1(9Z))PW001061 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/14:0/19:0cycv8c)PW001062 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:0/14:0)PW001066 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:0/16:1(9Z))PW001063 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:0/17:0cycw7c)PW001067 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:0/18:1(9Z))PW001069 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:0/19:0cycv8c)PW001070 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:1(9Z)/14:0)PW001071 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:1(9Z)/16:0)PW001072 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:1(9Z)/16:1(9Z))PW001068 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:1(9Z)/17:0cycw7c)PW001073 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:1(9Z)/18:1(9Z))PW001074 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:1(9Z)/19:0cycv8c)PW001075 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/17:0cycw7c/16:0)PW001076 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/17:0cycw7c/16:1(9Z))PW001077 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/17:0cycw7c/17:0cycw7c)PW001078 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/17:0cycw7c/18:1(9Z))PW001079 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/17:0cycw7c/19:0cycv8c)PW001080 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/18:1(9Z)/14:0)PW001081 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/18:1(9Z)/16:1(9Z))PW001083 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/18:1(9Z)/17:0cycw7c)PW001084 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/18:1(9Z)/18:1(9Z))PW001085 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/18:1(9Z)/19:0cycv8c)PW001086 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/14:0)PW001087 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/15:0cyclo)PW001088 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/16:0)PW001089 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/16:1(9Z))PW001090 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/17:0cycw7c)PW001091 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/18:1(9Z))PW001092 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/19:0cycv8c)PW001093 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/14:0/15:0cyclo)PW001094 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/15:0cyclo/14:0)PW001095 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/15:0cyclo/16:1(9Z))PW001096 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/15:0cyclo/17:0cycw7c)PW001097 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/15:0cyclo/18:1(9Z))PW001098 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/15:0cyclo/19:0cycv8c)PW001099 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:0/16:0)PW001100 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:0/16:1(9Z))PW001102 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:0/17:0cycw7c)PW001103 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:0/18:1(9Z))PW001104 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:0/19:0cycv8c)PW001105 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:1(9Z)/15:0cyclo)PW001107 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:1(9Z)/16:0)PW001106 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:1(9Z)/16:1(9Z))PW001108 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/17:0cycw7c/15:0cyclo)PW001101 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/17:0cycw7c/16:0)PW001109 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/17:0cycw7c/17:0cycw7c)PW001110 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/18:1(9Z)/15:0cyclo)PW001111 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/18:1(9Z)/16:0)PW001112 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/18:1(9Z)/18:1(9Z))PW001113 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/19:0cycv8c/16:0)PW001115 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/19:0cycv8c/19:0cycv8c)PW001116 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/14:0/15:0cyclo)PW001117 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/14:0/16:1(9Z))PW001118 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/15:0cyclo/14:0)PW001119 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/15:0cyclo/16:1(9Z))PW001120 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/15:0cyclo/17:0cycw7c)PW001121 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/15:0cyclo/18:1(9Z))PW001122 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/15:0cyclo/19:0cycv8c)PW001123 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:0/16:0)PW001124 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:0/16:1(9Z))PW001125 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:1(9Z)/14:0)PW001126 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:1(9Z)/15:0cyclo)PW001127 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:1(9Z)/16:0)PW001128 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:1(9Z)/16:1(9Z))PW001129 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:1(9Z)/17:0cycw7c)PW001130 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:1(9Z)/18:1(9Z))PW001131 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:1(9Z)/19:0cycv8c)PW001132 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/17:0cycw7c/15:0cyclo)PW001133 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/17:0cycw7c/16:1(9Z))PW001134 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/17:0cycw7c/17:0cycw7c)PW001135 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/18:1(9Z)/15:0cyclo)PW001136 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/18:1(9Z)/16:1(9Z))PW001137 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/18:1(9Z)/18:1(9Z))PW001138 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/19:0cycv8c/15:0cyclo)PW001139 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/19:0cycv8c/16:1(9Z))PW001140 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/19:0cycv8c/19:0cycv8c)PW001141 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/14:0/14:0)PW001142 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/14:0/17:0cycw7c)PW001143 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/15:0cyclo/17:0cycw7c)PW001144 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/16:0/16:0)PW001145 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/16:0/17:0cycw7c)PW001146 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/16:1(9Z)/16:1(9Z))PW001147 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/16:1(9Z)/17:0cycw7c)PW001148 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/17:0cycw7c)/16:0)PW001151 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/17:0cycw7c/14:0)PW001149 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/17:0cycw7c/15:0cyclo)PW001150 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/17:0cycw7c/16:1(9Z))PW001152 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/17:0cycw7c/17:0cycw7c)PW001153 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/17:0cycw7c/18:1(9Z))PW001154 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/17:0cycw7c/19:0cycv8c)PW001155 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/18:1(9Z)/17:0cycw7c)PW001156 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/18:1(9Z)/18:1(9Z))PW001157 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/19:0cycv8c/17:0cycw7c)PW001158 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/14:0/15:0cyclo)PW001159 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/14:0/18:1(9Z))PW001160 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/15:0cyclo/14:0)PW001161 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/15:0cyclo/17:0cycw7c)PW001162 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/15:0cyclo/18:1(9Z))PW001163 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/15:0cyclo/19:0cycv8c)PW001164 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/16:0/16:0)PW001165 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/16:0/18:1(9Z))PW001166 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/16:1(9Z)/16:1(9Z))PW001167 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/16:1(9Z)/18:1(9Z))PW001168 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/17:0cycw7c/15:0cyclo)PW001169 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/17:0cycw7c/17:0cycw7c)PW001170 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/17:0cycw7c/18:1(9Z))PW001171 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/18:1(9Z)/14:0)PW001172 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/18:1(9Z)/15:0cyclo)PW001173 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/18:1(9Z)/16:0)PW001174 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/18:1(9Z)/16:1(9Z))PW001175 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/18:1(9Z)/17:0cycw7c)PW001176 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/18:1(9Z)/18:1(9Z))PW001177 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/18:1(9Z)/19:0cycv8c)PW001178 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/19:0cycv8c/15:0cyclo)PW001179 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/19:0cycv8c/18:1(9Z))PW001180 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/14:0/15:0cyclo)PW001182 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/14:0/19:0cycv8c)PW001183 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/15:0cyclo/14:0)PW001184 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/15:0cyclo/17:0cycw7c)PW001187 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/15:0cyclo/19:0cycv8c)PW001188 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/16:0/16:0)PW001189 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/16:0/19:0cycv8c)PW001190 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/16:1(9Z)/16:1(9Z))PW001191 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/16:1(9Z)/19:0cycv8c)PW001192 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/17:0cycw7c/15:0cyclo)PW001193 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/17:0cycw7c/17:0cycw7c)PW001195 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/18:1(9Z)/18:1(9Z))PW001196 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/18:1(9Z)/19:0cycv8c)PW001197 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/19:0cycv8c/14:0)PW001198 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/19:0cycv8c/15:0cyclo)PW001199 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/19:0cycv8c/16:0)PW001200 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/19:0cycv8c/16:1(9Z))PW001201 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/19:0cycv8c/18:1(9Z))PW001202 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/19:0cycv8c/19:0cycv8c)PW001203 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/14:0/14:0)PW001204 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/14:0/16:0)PW001205 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/14:0/16:1(9Z))PW001206 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/14:0/18:1(9Z))PW001207 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/14:0/19:0cycv8c)PW001208 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/16:0/14:0)PW001209 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/16:1(9Z)/14:0)PW001213 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/16:1(9Z)/16:1(9Z))PW001214 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/17:0cycw7c/17:0cycw7c)PW001215 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/18:1(9Z)/14:0)PW001216 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/18:1(9Z)/18:1(9Z))PW001217 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/19:0cycv8c/14:0)PW001218 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/19:0cycv8c/19:0cycv8c)PW001219 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/14:0/15:0cyclo)PW001220 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/15:0cyclo/14:0)PW001221 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/15:0cyclo/16:1(9Z))PW001222 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/15:0cyclo/17:0cycw7c)PW001223 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/15:0cyclo/18:1(9Z))PW001224 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/15:0cyclo/19:0cycv8c)PW001225 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/16:0/16:0)PW001226 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/16:0/16:1(9Z))PW001227 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/16:0/17:0cycw7c)PW001228 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/16:0/18:1(9Z))PW001229 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/16:0/19:0cycv8c)PW001230 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/16:1(9Z)/15:0cyclo)PW001231 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/16:1(9Z)/16:0)PW001232 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/16:1(9Z)/16:1(9Z))PW001235 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/17:0cycw7c/15:0cyclo)PW001236 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/17:0cycw7c/16:0)PW001237 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/17:0cycw7c/17:0cycw7c)PW001238 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/18:1(9Z)/15:0cyclo)PW001239 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/18:1(9Z)/16:0)PW001242 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/18:1(9Z)/18:1(9Z))PW001243 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/19:0cycv8c/15:0cyclo)PW001245 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/19:0cycv8c/16:0)PW001246 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/19:0cycv8c/19:0cycv8c)PW001247 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/14:0/14:0)PW001250 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/14:0/16:1(9Z))PW001252 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/14:0/17:0cycw7c)PW001254 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/14:0/18:1(9Z))PW001255 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/14:0/19:0cycv8c)PW001256 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/16:0/17:0cycw7c)PW001257 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/16:0/18:1(9Z))PW001258 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/16:0/19:0cycv8c)PW001259 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/16:1(9Z)/14:0)PW001260 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/16:1(9Z)/15:0cyclo)PW001261 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/16:1(9Z)/16:0)PW001264 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/16:1(9Z)/16:1(9Z))PW001265 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/16:1(9Z)/17:0cycw7c)PW001267 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/16:1(9Z)/18:1(9Z))PW001268 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/16:1(9Z)/19:0cycv8c)PW001269 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/17:0cycw7c/14:0)PW001270 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/17:0cycw7c/15:0cyclo)PW001271 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/17:0cycw7c/16:0)PW001272 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/17:0cycw7c/16:1(9Z))PW001273 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/17:0cycw7c/17:0cycw7c)PW001274 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/17:0cycw7c/18:1(9Z))PW001277 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/17:0cycw7c/19:0cycv8c)PW001278 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/18:1(9Z)/14:0)PW001266 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/18:1(9Z)/15:0cyclo)PW001279 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/18:1(9Z)/16:0)PW001280 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/18:1(9Z)/16:1(9Z))PW001281 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/18:1(9Z)/17:0cycw7c)PW001282 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/18:1(9Z)/18:1(9Z))PW001283 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/18:1(9Z)/19:0cycv8c)PW001284 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/19:0cycv8c/14:0)PW001285 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/19:0cycv8c/15:0cyclo)PW001286 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/19:0cycv8c/16:0)PW001287 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/19:0cycv8c/16:1(9Z))PW001288 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/19:0cycv8c/17:0cycw7c)PW001289 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/19:0cycv8c/18:1(9Z))PW001290 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/14:0/14:0)PW001293 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/14:0/16:0)PW001294 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/14:0/16:1(9Z))PW001295 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:0/14:0)PW001296 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:0/16:1(9Z))PW001297 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:0/17:0cycw7c)PW001303 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:0/18:1(9Z))PW001305 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:0/19:0cycv8c)PW001306 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:1(9Z)/14:0)PW001307 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:1(9Z)/16:0)PW001308 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:1(9Z)/16:1(9Z))PW001311 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:1(9Z)/17:0cycw7c)PW001312 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:1(9Z)/18:1(9Z))PW001313 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/17:0cycw7c/16:0)PW001315 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/17:0cycw7c/16:1(9Z))PW001325 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/17:0cycw7c/17:0cycw7c)PW001327 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/18:1(9Z)/16:0)PW001328 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/18:1(9Z)/16:1(9Z))PW001329 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/18:1(9Z)/18:1(9Z))PW001330 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/19:0cycv8c/16:0)PW001335 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/19:0cycv8c/16:1(9Z))PW001336 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/19:0cycv8c/19:0cycv8c)PW001337 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/14:0/16:0)PW001338 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/14:0/17:0cycw7c)PW001339 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/16:0/14:0)PW001342 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/16:0/17:0cycw7c)PW001343 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/16:1(9Z)/16:1(9Z))PW001344 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/16:1(9Z)/17:0cycw7c)PW001345 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/17:0cycw7c/14:0)PW001346 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/17:0cycw7c/16:1(9Z))PW001347 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/17:0cycw7c/17:0cycw7c)PW001351 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/17:0cycw7c/18:1(9Z))PW001348 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/17:0cycw7c/19:0cycv8c)PW001349 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/18:1(9Z)/17:0cycw7c)PW001350 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/18:1(9Z)/18:1(9Z))PW001352 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/19:0cycv8c/17:0cycw7c)PW001353 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/14:0/14:0)PW001355 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/14:0/16:0)PW001356 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/14:0/18:1(9Z))PW001357 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/16:0/14:0)PW001358 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/16:0/17:0cycw7c)PW001359 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/16:0/18:1(9Z))PW001360 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/16:0/19:0cycv8c)PW001361 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/16:1(9Z)/16:1(9Z))PW001362 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/16:1(9Z)/18:1(9Z))PW001363 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/17:0cycw7c/16:0)PW001364 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/17:0cycw7c/17:0cycw7c)PW001365 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/17:0cycw7c/18:1(9Z))PW001366 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/18:1(9Z)/14:0)PW001367 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/18:1(9Z)/16:0)PW001368 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/18:1(9Z)/16:1(9Z))PW001369 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/18:1(9Z)/17:0cycw7c)PW001370 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/18:1(9Z)/18:1(9Z))PW001371 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/18:1(9Z)/19:0cycv8c)PW001378 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/19:0cycv8c/16:0)PW001379 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/19:0cycv8c/18:1(9Z))PW001380 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/19:0cycv8c/19:0cycv8c)PW001381 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/14:0/14:0)PW001382 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/14:0/16:0)PW001389 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/14:0/19:0cycv8c)PW001390 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/16:0/14:0)PW001391 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/16:0/17:0cycw7c)PW001392 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/16:1(9Z)/16:1(9Z))PW001393 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/16:1(9Z)/19:0cycv8c)PW001398 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/17:0cycw7c/16:0)PW001399 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/17:0cycw7c/17:0cycw7c)PW001400 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/17:0cycw7c/19:0cycv8c)PW001401 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/18:1(9Z)/18:1(9Z))PW001402 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/18:1(9Z)/19:0cycv8c)PW001409 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/19:0cycv8c/14:0)PW001410 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/19:0cycv8c/16:1(9Z))PW001411 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/19:0cycv8c/17:0cycw7c)PW001412 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/19:0cycv8c/18:1(9Z))PW001413 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/14:0/16:1(9Z))PW001416 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/14:0/18:1(9Z))PW001417 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/14:0/19:0cycv8c)PW001418 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/16:1(9Z)/14:0)PW001419 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/17:0cycw7c/17:0cycw7c)PW001421 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/18:1(9Z)/14:0)PW001425 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/18:1(9Z)/18:1(9Z))PW001427 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/19:0cycv8c/14:0)PW001429 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/19:0cycv8c/19:0cycv8c)PW001430 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/14:0/15:0cyclo)PW001431 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/14:0/16:1(9Z))PW001437 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/15:0cyclo/14:0) )PW001724 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/15:0cyclo/17:0cycw7c)PW001440 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/15:0cyclo/18:1(9Z))PW001441 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/15:0cyclo/19:0cycv8c)PW001442 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/16:0/16:1(9Z))PW001449 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/16:1(9Z)/14:0)PW001450 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/16:1(9Z)/15:0cyclo)PW001451 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/16:1(9Z)/16:0)PW001452 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/16:1(9Z)/16:1(9Z))PW001453 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/16:1(9Z)/18:1(9Z))PW001455 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/16:1(9Z)/19:0cycv8c)PW001456 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/17:0cycw7c/15:0cyclo)PW001457 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/17:0cycw7c/16:1(9Z))PW001458 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/17:0cycw7c/17:0cycw7c)PW001459 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/18:1(9Z)/15:0cyclo)PW001460 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/18:1(9Z)/16:1(9Z))PW001461 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/18:1(9Z)/18:1(9Z))PW001462 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/19:0cycv8c/15:0cyclo)PW001463 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/19:0cycv8c/16:1(9Z))PW001468 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/19:0cycv8c/19:0cycv8c)PW001469 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/14:0/14:0)PW001470 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/14:0/16:0)PW001471 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/14:0/16:1(9Z))PW001472 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:0/14:0)PW001477 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:0/17:0cycw7c)PW001478 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:0/18:1(9Z))PW001479 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:0/19:0cycv8c)PW001480 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:1(9Z)/14:0)PW001481 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:1(9Z)/16:0)PW001486 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:1(9Z)/16:1(9Z))PW001487 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:1(9Z)/17:0cycw7c)PW001488 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:1(9Z)/18:1(9Z))PW001489 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:1(9Z)/19:0cycv8c)PW001490 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/17:0cycw7c/16:0)PW001491 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/17:0cycw7c/16:1(9Z))PW001496 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/17:0cycw7c/17:0cycw7c)PW001497 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/18:1(9Z)/16:0)PW001501 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/18:1(9Z)/16:1(9Z))PW001503 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/18:1(9Z)/18:1(9Z))PW001504 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/19:0cycv8c/16:0)PW001505 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/19:0cycv8c/16:1(9Z))PW001508 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/19:0cycv8c/19:0cycv8c)PW001509 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/14:0/14:0)PW001510 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/14:0/15:0cyclo)PW001511 Thumb