2.0 2012-05-31 10:24:17 -0600 2015-09-13 12:56:07 -0600 ECMDB00229 M2MDB000095 Nicotinamide ribotide Nicotinamide ribotide (NMN) is an important intermediate metabolite in the nicotinate and nicotinamide metabolism pathway. Nicotinamide is directly converted to NMN by nicotinamide phosphoribosyltransferase (NAMPT, EC 2.4.2.12). The enzyme nicotinamide mononucleotide adenylyltransferase (NMNAT, EC 2.7.7.1), a member of the nucleotidyltransferase alpha/beta-phosphodiesterase superfamily, catalyzes the reaction NMN + ATP = Nicotinamide adenine dinucleotide (NAD) + PPi, representing the final step in the biosynthesis of NAD, a molecule playing a fundamental role as a cofactor in cellular redox reactions. Thus NMN is an important metabolite for the maintenance of normal NAD biosynthesis, and circulating NMN levels may play an important role in regulating cell function in physiological and pathophysiological conditions. (PMID: 15078171, 17983582) β-nicotinamide mononucleotide β-nicotinamide nucleotide β-nicotinamide ribonucleotide 3-(Aminocarbonyl)-1-(5-O-phosphono-b-D-ribofuranosyl)-Pyridinium hydroxide inner salt 3-(Aminocarbonyl)-1-(5-O-phosphono-b-D-ribofuranosyl)-Pyridinium inner salt 3-(Aminocarbonyl)-1-(5-O-phosphono-b-delta-ribofuranosyl)-pyridinium hydroxide inner salt 3-(Aminocarbonyl)-1-(5-O-phosphono-b-delta-ribofuranosyl)-pyridinium inner salt 3-(Aminocarbonyl)-1-(5-O-phosphono-b-δ-ribofuranosyl)-pyridinium hydroxide inner salt 3-(Aminocarbonyl)-1-(5-O-phosphono-b-δ-ribofuranosyl)-pyridinium inner salt 3-(Aminocarbonyl)-1-(5-O-phosphono-beta-delta-ribofuranosyl)-Pyridinium hydroxide inner salt 3-(Aminocarbonyl)-1-(5-O-phosphono-beta-delta-ribofuranosyl)-Pyridinium inner salt 3-(Aminocarbonyl)-1-(5-O-phosphono-β-δ-ribofuranosyl)-pyridinium hydroxide inner salt 3-(Aminocarbonyl)-1-(5-O-phosphono-β-δ-ribofuranosyl)-pyridinium inner salt 3-Carbamoyl-1-b-D-ribofuranosylpyridinium hydroxide 5'-phosphate inner salt 3-Carbamoyl-1-b-D-ribofuranosylpyridinium hydroxide 5'-phosphoric acid inner salt 3-Carbamoyl-1-b-delta-ribofuranosylpyridinium hydroxide 5'-phosphate inner salt 3-Carbamoyl-1-b-delta-ribofuranosylpyridinium hydroxide 5'-phosphoric acid inner salt 3-Carbamoyl-1-b-δ-ribofuranosylpyridinium hydroxide 5'-phosphate inner salt 3-Carbamoyl-1-b-δ-ribofuranosylpyridinium hydroxide 5'-phosphoric acid inner salt 3-Carbamoyl-1-beta-delta-ribofuranosylpyridinium hydroxide 5'-phosphate inner salt 3-Carbamoyl-1-beta-delta-ribofuranosylpyridinium hydroxide 5'-phosphoric acid inner salt 3-Carbamoyl-1-β-δ-ribofuranosylpyridinium hydroxide 5'-phosphate inner salt 3-Carbamoyl-1-β-δ-ribofuranosylpyridinium hydroxide 5'-phosphoric acid inner salt 3-Carboxy-1-(5-O-phosphono-b-D-ribofuranosyl)-Pyridinium inner salt 3-Carboxy-1-(5-O-phosphono-b-delta-ribofuranosyl)-pyridinium inner salt 3-Carboxy-1-(5-O-phosphono-b-δ-ribofuranosyl)-pyridinium inner salt 3-Carboxy-1-(5-O-phosphono-beta-D-ribofuranosyl)-Pyridinium inner salt 3-Carboxy-1-(5-O-phosphono-beta-delta-ribofuranosyl)-Pyridinium inner salt 3-Carboxy-1-(5-O-phosphono-β-D-ribofuranosyl)-pyridinium inner salt 3-Carboxy-1-(5-O-phosphono-β-δ-ribofuranosyl)-pyridinium inner salt 3-Carboxy-1-b-D-ribofuranosylpyridinium hydroxide 5'-phosphate inner salt 3-Carboxy-1-b-D-ribofuranosylpyridinium hydroxide 5'-phosphoric acid inner salt 3-Carboxy-1-b-delta-ribofuranosylpyridinium hydroxide 5'-phosphate inner salt 3-Carboxy-1-b-delta-ribofuranosylpyridinium hydroxide 5'-phosphoric acid inner salt 3-Carboxy-1-b-δ-ribofuranosylpyridinium hydroxide 5'-phosphate inner salt 3-Carboxy-1-b-δ-ribofuranosylpyridinium hydroxide 5'-phosphoric acid inner salt 3-Carboxy-1-beta-D-ribofuranosylpyridinium hydroxide 5'-phosphate inner salt 3-Carboxy-1-beta-D-ribofuranosylpyridinium hydroxide 5'-phosphoric acid inner salt 3-Carboxy-1-beta-delta-ribofuranosylpyridinium hydroxide 5'-phosphate inner salt 3-Carboxy-1-beta-delta-ribofuranosylpyridinium hydroxide 5'-phosphoric acid inner salt 3-Carboxy-1-β-D-ribofuranosylpyridinium hydroxide 5'-phosphate inner salt 3-Carboxy-1-β-D-ribofuranosylpyridinium hydroxide 5'-phosphoric acid inner salt 3-Carboxy-1-β-δ-ribofuranosylpyridinium hydroxide 5'-phosphate inner salt 3-Carboxy-1-β-δ-ribofuranosylpyridinium hydroxide 5'-phosphoric acid inner salt 3-Pyridinecarboxylate mononucleotide 3-Pyridinecarboxylic acid mononucleotide B-D-NMN b-delta-NMN b-Nicotinamide mononucleotide b-Nicotinamide nucleotide b-Nicotinamide ribonucleotide b-Nicotinamide-D-ribonucleotide b-Nicotinate D-ribonucleotide b-Nicotinate mononucleotide b-Nicotinate-D-nucleotide b-Nicotinic acid D-ribonucleotide b-Nicotinic acid mononucleotide b-Nicotinic acid-D-nucleotide B-NMN b-δ-NMN Beta-delta-NMN Beta-Nicotinamide mononucleotide Beta-Nicotinamide nucleotide Beta-Nicotinamide ribonucleotide Beta-Nicotinamide-D-ribonucleotide Beta-Nicotinate D-ribonucleotide Beta-Nicotinate mononucleotide Beta-Nicotinate-D-nucleotide Beta-Nicotinic acid D-ribonucleotide Beta-Nicotinic acid mononucleotide beta-Nicotinic acid-D-nucleotide Beta-NMN Deamido nicotinamide ribonucleotide Deamido-nicotinamide mononucleotide Deamido-NMN NaMN Nicotinamide D-ribonucleotide Nicotinamide mononucleotide Nicotinamide ribonucleoside 5'-phosphate Nicotinamide ribonucleoside 5'-phosphoric acid Nicotinamide ribonucleotide Nicotinate D-ribonucleoside Nicotinate D-ribonucleotide Nicotinate dinucleotide Nicotinate mononucleotide Nicotinate nucleotide Nicotinate ribonucleotide Nicotinate ribotide Nicotinate-D-ribonucleotide Nicotinate-delta-ribonucleotide Nicotinate-δ-ribonucleotide Nicotinic acid D-ribonucleoside Nicotinic acid D-ribonucleotide Nicotinic acid dinucleotide Nicotinic acid mononucleotide Nicotinic acid nucleotide Nicotinic acid ribonucleotide Nicotinic acid ribotide Nicotinic acid-D-ribonucleotide Nicotinic acid-delta-ribonucleotide Nicotinic acid-δ-ribonucleotide Nicotinic mononucleotide NMN β-Nicotinamide mononucleotide β-Nicotinamide nucleotide β-Nicotinamide ribonucleotide β-Nicotinamide-D-ribonucleotide β-Nicotinate D-ribonucleotide β-Nicotinate mononucleotide β-Nicotinate-D-nucleotide β-Nicotinic acid D-ribonucleotide β-Nicotinic acid mononucleotide β-Nicotinic acid-D-nucleotide β-NMN β-δ-NMN C11H15NO9P 336.2119 336.048442595 3-carboxy-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(phosphonooxy)methyl]oxolan-2-yl]-1lambda5-pyridin-1-ylium 3-carboxy-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(phosphonooxy)methyl]oxolan-2-yl]-1lambda5-pyridin-1-ylium 1094-61-7 O[C@H]1[C@@H](O)[C@@H](O[C@@H]1COP(O)(O)=O)[N+]1=CC=CC(=C1)C(O)=O InChI=1S/C11H14NO9P/c13-8-7(5-20-22(17,18)19)21-10(9(8)14)12-3-1-2-6(4-12)11(15)16/h1-4,7-10,13-14H,5H2,(H2-,15,16,17,18,19)/p+1/t7-,8-,9-,10-/m1/s1 JOUIQRNQJGXQDC-ZYUZMQFOSA-O Solid Cytosol Extra-organism Periplasm logp -0.99 ALOGPS logs -2.34 ALOGPS solubility 1.71e+00 g/l ALOGPS logp -5.4 ChemAxon pka_strongest_acidic 1.2 ChemAxon pka_strongest_basic -3.7 ChemAxon iupac 3-carboxy-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(phosphonooxy)methyl]oxolan-2-yl]-1lambda5-pyridin-1-ylium ChemAxon average_mass 336.2119 ChemAxon mono_mass 336.048442595 ChemAxon smiles O[C@H]1[C@@H](O)[C@@H](O[C@@H]1COP(O)(O)=O)[N+]1=CC=CC(=C1)C(O)=O ChemAxon formula C11H15NO9P ChemAxon inchi InChI=1S/C11H14NO9P/c13-8-7(5-20-22(17,18)19)21-10(9(8)14)12-3-1-2-6(4-12)11(15)16/h1-4,7-10,13-14H,5H2,(H2-,15,16,17,18,19)/p+1/t7-,8-,9-,10-/m1/s1 ChemAxon inchikey JOUIQRNQJGXQDC-ZYUZMQFOSA-O ChemAxon polar_surface_area 157.63 ChemAxon refractivity 69.89 ChemAxon polarizability 28.66 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 8 ChemAxon donor_count 5 ChemAxon physiological_charge -2 ChemAxon formal_charge 1 ChemAxon Porphyrin and chlorophyll metabolism ec00860 Nicotinate and nicotinamide metabolism ec00760 Riboflavin metabolism ec00740 Metabolic pathways eco01100 NAD biosynthesis Nicotinamide adenine dinucleotide (NAD) can be biosynthesized from L-aspartic acid.This amino acid reacts with oxygen through an L-aspartate oxidase resulting in a hydrogen ion, hydrogen peroxide and an iminoaspartic acid. The latter compound interacts with dihydroxyacetone phosphate through a quinolinate synthase A, resulting in a phosphate, water, and a quinolic acid. Quinolic acid interacts with phosphoribosyl pyrophosphate and hydrogen ion through a quinolinate phosphoribosyltransferase resulting in pyrophosphate, carbon dioxide and nicotinate beta-D-ribonucleotide. This last compound is adenylated through an ATP driven nicotinate-mononucleotide adenylyltransferase releasing a pyrophosphate and resulting in a nicotinic acid adenine dinucleotide. Nicotinic acid adenine dinucleotide is processed through an NAD synthetase, NH3-dependent in two different manners. In the first case, Nicotinic acid adenine dinucleotide interacts with ATP, L-glutamine and water through the enzyme and results in hydrogen ion, AMP, pyrophosphate, L-glutamic acid and NAD. In the second case, Nicotinic acid adenine dinucleotide interacts with ATP and ammonium through the enzyme resulting in a pyrophosphate, AMP, hydrogen ion and NAD. NAD then proceeds to regulate its own pathway by repressing L-aspartate oxidase. As a general rule, most prokaryotes utilize the aspartate de novo pathway, in which the nicotinate moiety of NAD is synthesized from aspartate , while in eukaryotes, the de novo pathway starts with tryptophan. PW000829 Metabolic NAD salvage Even though NAD molecules are not consumed during oxidation reactions, they have a relatively short half-life. For example, in E. coli the NAD+ half-life is 90 minutes. Once enzymatically degraded, the pyrimidine moiety of the molecule can be recouped via the NAD salvage cycles. This pathway is used for two purposes: it recycles the internally degraded NAD products nicotinamide D-ribonucleotide (also known as nicotinamide mononucleotide, or NMN) and nicotinamide, and it is used for the assimilation of exogenous NAD+. NAD reacts spontaneously with water resulting in the release of hydrogen ion, AMP and beta-nicotinamide D-ribonucleotide. This enzyme can either interact spontaneously with water resulting in the release of D-ribofuranose 5-phosphate, hydrogen ion and Nacinamide. On the other hand beta-nicotinamide D-ribonucleotide can also react with water through NMN amidohydrolase resulting in ammonium, and Nicotinate beta-D-ribonucleotide. Also it can interact with water spontaneously resulting in the release of phosphate resulting in a Nicotinamide riboside. Niacinamide interacts with water through a nicotinamidase resulting in a release of ammonium and nicotinic acid. This compound interacts with water and phosphoribosyl pyrophosphate through an ATP driven nicotinate phosphoribosyltransferase resulting in the release of ADP, pyrophosphate and phosphate and nicotinate beta-D-ribonucleotide. Nicotinamide riboside interacts with an ATP driven NadR DNA-binding transcriptional repressor and NMN adenylyltransferase (Escherichia coli) resulting in a ADP, hydrogen ion and beta-nicotinamide D-ribonucleotide. This compound interacts with ATP and hydrogen ion through NadR DNA-binding transcriptional repressor and NMN adenylyltransferase resulting in pyrophosphate and NAD. Nicotinate beta-D-ribonucleotide is adenylated through the interaction with ATP and a hydrogen ion through a nicotinate-mononucleotide adenylyltransferase resulting in pyrophosphate and Nicotinic acid adenine dinucleotide. Nicotinic acid adenine dinucleotide interacts with L-glutamine and water through an ATP driven NAD synthetase, NH3-dependent resulting in AMP, pyrophosphate, hydrogen ion, L-glutamic acid and NAD. PW000830 Metabolic adenosylcobalamin salvage from cobinamide Cobinamide is incorporated from the extracellular space through a transport system into the cytosol. Once inside the cytosol, cobinamide interacts with ATP through a cobinamide adenosyl transferase resulting in the release of a triphosphate and an adenosylcobinamide. The latter compound is then phosphorylated through an ATP-dependent cobinamide kinase resulting in the release of ADP, a hydrogen ion and adenosyl-cobinamide phosphate. This last compound then interacts with GTP and a hydrogen ion through a cobinamide-P guanylyltransferase resulting in the release of a pyrophosphate and an adenosylcobinamide-GDP. A dimethylbenzimidazole interacts with a nicotinate D-ribonucleotide through a nicotinate-nucleotide dimethylbenzumidazole phosphoribosyltransferase resulting in the release of a nicotinate, a hydrogen ion and an alpha-ribazole 5' phosphate. The adenosylcobinamide-GDP and the alpha-ribazole 5' phosphate interact together through a cobalamin 5' phosphate synthase resulting in the release of a hydrogen ion, a GMP and Adenosylcobalamin 5'-phosphate. The latter compound then interacts with a water molecule through an adenosylcbalamin 5' phosphate phosphatase resulting in the release of a phosphate and a coenzyme B12. Likewise a cobalamin molecule can interact with ATP through a cobalamin adenosyltransferase resulting in the release of a triphosphate and a coenzyme B12 PW001884 Metabolic NAD salvage pathway I PYRIDNUCSAL-PWY NAD biosynthesis I (from aspartate) PYRIDNUCSYN-PWY adenosylcobalamin salvage from cobinamide I COBALSYN-PWY-1 Specdb::CMs 2925 Specdb::CMs 47837 Specdb::CMs 154102 Specdb::NmrOneD 8722 Specdb::NmrOneD 8723 Specdb::NmrOneD 8724 Specdb::NmrOneD 8725 Specdb::NmrOneD 8726 Specdb::NmrOneD 8727 Specdb::NmrOneD 8728 Specdb::NmrOneD 8729 Specdb::NmrOneD 8730 Specdb::NmrOneD 8731 Specdb::NmrOneD 8732 Specdb::NmrOneD 8733 Specdb::NmrOneD 8734 Specdb::NmrOneD 8735 Specdb::NmrOneD 8736 Specdb::NmrOneD 8737 Specdb::NmrOneD 8738 Specdb::NmrOneD 8739 Specdb::NmrOneD 8740 Specdb::NmrOneD 8741 Specdb::MsMs 27119 Specdb::MsMs 27120 Specdb::MsMs 27121 Specdb::MsMs 33677 Specdb::MsMs 33678 Specdb::MsMs 33679 Specdb::MsMs 2520494 Specdb::MsMs 2520495 Specdb::MsMs 2520496 HMDB00229 14180 13553 C01185 16171 NICOTINAMIDE_NUCLEOTIDE NCN Keseler, I. M., Collado-Vides, J., Santos-Zavaleta, A., Peralta-Gil, M., Gama-Castro, S., Muniz-Rascado, L., Bonavides-Martinez, C., Paley, S., Krummenacker, M., Altman, T., Kaipa, P., Spaulding, A., Pacheco, J., Latendresse, M., Fulcher, C., Sarker, M., Shearer, A. G., Mackie, A., Paulsen, I., Gunsalus, R. P., Karp, P. D. (2011). "EcoCyc: a comprehensive database of Escherichia coli biology." Nucleic Acids Res 39:D583-D590. 21097882 Kanehisa, M., Goto, S., Sato, Y., Furumichi, M., Tanabe, M. (2012). "KEGG for integration and interpretation of large-scale molecular data sets." Nucleic Acids Res 40:D109-D114. 22080510 van der Werf, M. J., Overkamp, K. M., Muilwijk, B., Coulier, L., Hankemeier, T. (2007). "Microbial metabolomics: toward a platform with full metabolome coverage." Anal Biochem 370:17-25. 17765195 Magni, G., Amici, A., Emanuelli, M., Orsomando, G., Raffaelli, N., Ruggieri, S. (2004). "Structure and function of nicotinamide mononucleotide adenylyltransferase." Curr Med Chem 11:873-885. 15078171 Liu, Rihe; Visscher, Johannes. A novel preparation of nicotinamide mononucleotide. Nucleosides & Nucleotides (1994), 13(5), 1215-16. http://hmdb.ca/system/metabolites/msds/000/000/166/original/HMDB00229.pdf?1358463254 Protein ushA P07024 USHA_ECOLI ushA http://ecmdb.ca/proteins/P07024.xml Nicotinate-nucleotide adenylyltransferase P0A752 NADD_ECOLI nadD http://ecmdb.ca/proteins/P0A752.xml Multifunctional protein surE P0A840 SURE_ECOLI surE http://ecmdb.ca/proteins/P0A840.xml 5'-nucleotidase yjjG P0A8Y1 YJJG_ECOLI yjjG http://ecmdb.ca/proteins/P0A8Y1.xml DNA ligase P15042 DNLJ_ECOLI ligA http://ecmdb.ca/proteins/P15042.xml Nicotinate phosphoribosyltransferase P18133 PNCB_ECOLI pncB http://ecmdb.ca/proteins/P18133.xml DNA ligase B P25772 LIGB_ECOLI ligB http://ecmdb.ca/proteins/P25772.xml Transcriptional regulator nadR P27278 NADR_ECOLI nadR http://ecmdb.ca/proteins/P27278.xml Nicotinate-nucleotide pyrophosphorylase [carboxylating] P30011 NADC_ECOLI nadC http://ecmdb.ca/proteins/P30011.xml NADH pyrophosphatase P32664 NUDC_ECOLI nudC http://ecmdb.ca/proteins/P32664.xml Nicotinate-nucleotide--dimethylbenzimidazole phosphoribosyltransferase P36562 COBT_ECOLI cobT http://ecmdb.ca/proteins/P36562.xml 5'-nucleotidase yfbR P76491 YFBR_ECOLI yfbR http://ecmdb.ca/proteins/P76491.xml Nicotinamide-nucleotide amidohydrolase PncC P0A6G3 PNCC_ECOLI pncC http://ecmdb.ca/proteins/P0A6G3.xml Nicotinamide riboside transporter pnuC P0AFK2 PNUC_ECOLI pnuC http://ecmdb.ca/proteins/P0AFK2.xml Outer membrane protein N P77747 OMPN_ECOLI ompN http://ecmdb.ca/proteins/P77747.xml Outer membrane pore protein E P02932 PHOE_ECOLI phoE http://ecmdb.ca/proteins/P02932.xml Outer membrane protein F P02931 OMPF_ECOLI ompF http://ecmdb.ca/proteins/P02931.xml Outer membrane protein C P06996 OMPC_ECOLI ompC http://ecmdb.ca/proteins/P06996.xml Water + NAD <> Adenosine monophosphate +2 Hydrogen ion + Nicotinamide ribotide + NMN R00103 NADPYROPHOSPHAT-RXN Adenosine triphosphate + Hydrogen ion + Nicotinamide ribotide + NMN <> NAD + Pyrophosphate R00137 2.7.7.1-RXN 2 Hydrogen ion + Phosphoribosyl pyrophosphate + Quinolinic acid <> Carbon dioxide + Nicotinamide ribotide + Pyrophosphate R03348 QUINOPRIBOTRANS-RXN Adenosine triphosphate + Hydrogen ion + Nicotinamide ribotide <> Nicotinic acid adenine dinucleotide + Pyrophosphate R03005 NICONUCADENYLYLTRAN-RXN Adenosine triphosphate + Water + Nicotinic acid + Phosphoribosyl pyrophosphate > ADP + Nicotinamide ribotide + Phosphate + Pyrophosphate Dimethylbenzimidazole + Nicotinamide ribotide <> N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole + Hydrogen ion + Nicotinic acid R04148 DMBPPRIBOSYLTRANS-RXN NAD + Water <> Adenosine monophosphate + Nicotinamide ribotide R00103 NADPYROPHOSPHAT-RXN Adenosine triphosphate + Nicotinamide ribotide <> Pyrophosphate + NAD R00137 2.7.7.1-RXN Nicotinamide ribotide + Pyrophosphate + Adenosine triphosphate + Water <> Nicotinic acid + Phosphoribosyl pyrophosphate + ADP + Phosphate R01724 Nicotinamide ribotide + Water <> Nicotinamide riboside + Phosphate R02323 Nicotinic acid adenine dinucleotide + Water <> Adenosine monophosphate + Nicotinamide ribotide R03004 Adenosine triphosphate + Nicotinamide ribotide <> Pyrophosphate + Nicotinic acid adenine dinucleotide R03005 Nicotinamide ribotide + Water <> Nicotinate D-ribonucleoside + Phosphate R03346 Nicotinamide ribotide + Pyrophosphate + Carbon dioxide <> Quinolinic acid + Phosphoribosyl pyrophosphate R03348 Hydrogen ion + Nicotinamide ribotide + Adenosine triphosphate <> NAD + Pyrophosphate 2.7.7.1-RXN Nicotinamide ribotide + Dimethylbenzimidazole > Hydrogen ion + Nicotinic acid + N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole DMBPPRIBOSYLTRANS-RXN DNAn + (deoxynucleotides)(m) + NAD > (deoxynucleotides)(m) + Nicotinamide ribotide + Adenosine monophosphate DNA-LIGASE-NAD+-RXN Water + NAD > Hydrogen ion + Nicotinamide ribotide + Adenosine monophosphate NADPYROPHOSPHAT-RXN Hydrogen ion + Adenosine triphosphate + Nicotinamide ribotide > Pyrophosphate + Nicotinic acid adenine dinucleotide NICONUCADENYLYLTRAN-RXN Nicotinamide ribotide + Pyrophosphate < Hydrogen ion + Nicotinic acid + Phosphoribosyl pyrophosphate R01724 NICOTINATEPRIBOSYLTRANS-RXN Nicotinamide ribotide + Water > Hydrogen ion + Nicotinamide ribotide + Ammonia NMNAMIDOHYDRO-RXN Nicotinamide ribotide + Water > Hydrogen ion + Nicotinamide ribotide + Ammonia NMNAMIDOHYDRO-RXN Water + Nicotinamide ribotide <> Hydrogen ion + D-Ribose-5-phosphate + Niacinamide NMNNUCLEOSID-RXN Nicotinamide ribotide + Pyrophosphate + Carbon dioxide < Phosphoribosyl pyrophosphate + Quinolinic acid + Hydrogen ion QUINOPRIBOTRANS-RXN Nicotinamide riboside + Adenosine triphosphate > Hydrogen ion + Nicotinamide ribotide + ADP RIBOSYLNICOTINAMIDE-KINASE-RXN Nicotinamide ribotide + Dimethylbenzimidazole > Nicotinic acid + N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole Nicotinamide ribotide + Pyrophosphate + Carbon dioxide > Quinolinic acid + Phosphoribosyl pyrophosphate Adenosine triphosphate + Nicotinamide ribotide > Pyrophosphate + Nicotinic acid adenine dinucleotide Nicotinamide ribotide + Pyrophosphate > Nicotinic acid + Phosphoribosyl pyrophosphate R01724 NICOTINATEPRIBOSYLTRANS-RXN NMN + Water <> Nicotinamide ribotide + Ammonia R02322 Quinolinic acid + Hydrogen ion + Phosphoribosyl pyrophosphate > Carbon dioxide + Pyrophosphate + nicotinate beta-D-ribonucleotide + Nicotinamide ribotide PW_R003009 nicotinate beta-D-ribonucleotide + Adenosine triphosphate + Hydrogen ion + Nicotinamide ribotide > Pyrophosphate + Nicotinic acid adenine dinucleotide PW_R003010 Nicotinic acid + Water + Adenosine triphosphate + Phosphoribosyl pyrophosphate > Phosphate + Adenosine diphosphate + Pyrophosphate + nicotinate beta-D-ribonucleotide + ADP + Nicotinamide ribotide PW_R003016 beta-nicotinamide D-ribonucleotide + Water + NMN > Ammonium + nicotinate beta-D-ribonucleotide + Nicotinamide ribotide PW_R003017 Dimethylbenzimidazole + nicotinate beta-D-ribonucleotide + Nicotinamide ribotide > Hydrogen ion + Nicotinic acid + N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole PW_R005142 Water + NAD <> Adenosine monophosphate +2 Hydrogen ion + Nicotinamide ribotide + NMN NAD + Water <> Adenosine monophosphate + Nicotinamide ribotide NMN + Water <> Nicotinamide ribotide + Ammonia Adenosine triphosphate + Hydrogen ion + Nicotinamide ribotide + NMN <> NAD + Pyrophosphate 2 Hydrogen ion + Phosphoribosyl pyrophosphate + Quinolinic acid <> Carbon dioxide + Nicotinamide ribotide + Pyrophosphate Nicotinamide ribotide + Pyrophosphate + Adenosine triphosphate + Water <> Nicotinic acid + Phosphoribosyl pyrophosphate + ADP + Phosphate Water + NAD <> Adenosine monophosphate +2 Hydrogen ion + Nicotinamide ribotide + NMN 2 Hydrogen ion + Phosphoribosyl pyrophosphate + Quinolinic acid <> Carbon dioxide + Nicotinamide ribotide + Pyrophosphate Nicotinamide ribotide + Pyrophosphate + Adenosine triphosphate + Water <> Nicotinic acid + Phosphoribosyl pyrophosphate + ADP + Phosphate