<?xml version="1.0" encoding="UTF-8"?>
<compound>
  <version>2.0</version>
  <creation_date>2012-05-31 10:21:23 -0600</creation_date>
  <update_date>2015-09-13 12:56:06 -0600</update_date>
  <accession>ECMDB00124</accession>
  <m2m_id>M2MDB000047</m2m_id>
  <name>Fructose 6-phosphate</name>
  <description>Fructose-6-phosphate is an important intermediate in glycolysis and gluconeogenesis. The interconversion of glucose-6-phosphate and fructose-6-phosphate, the second step of the Embden-Meyerhof glycolytic pathway, is catalyzed by the enzyme phosphoglucose isomerase (PGI). In gluconeogenesis, fructose-6-phosphate is the immediate precursor of glucose-6-phosphate (wikipedia)</description>
  <synonyms>
    <synonym>&amp;beta;-D-fructofuranose 6-phosphate</synonym>
    <synonym>&amp;beta;-D-fructofuranose 6-phosphoric acid</synonym>
    <synonym>A-D-Fructose-6-P</synonym>
    <synonym>b-D-Fructofuranose 6-phosphate</synonym>
    <synonym>b-D-Fructofuranose 6-phosphoric acid</synonym>
    <synonym>Beta-D-Fructofuranose 6-phosphate</synonym>
    <synonym>beta-D-Fructofuranose 6-phosphoric acid</synonym>
    <synonym>D-Fructofuranose 6-phosphate</synonym>
    <synonym>D-Fructofuranose 6-phosphoric acid</synonym>
    <synonym>D-Fructose 6-phosphate</synonym>
    <synonym>D-Fructose 6-phosphorate</synonym>
    <synonym>D-Fructose 6-phosphoric acid</synonym>
    <synonym>D-Fructose-6-P</synonym>
    <synonym>D-Fructose-6-phosphate</synonym>
    <synonym>D-Fructose-6-phosphoric acid</synonym>
    <synonym>F6P</synonym>
    <synonym>FPC</synonym>
    <synonym>Fru-6-P</synonym>
    <synonym>Fruc6p</synonym>
    <synonym>Fructose 6-phosphate</synonym>
    <synonym>Fructose 6-phosphoric acid</synonym>
    <synonym>Fructose-6-P</synonym>
    <synonym>Fructose-6-phosphate</synonym>
    <synonym>Fructose-6-phosphoric acid</synonym>
    <synonym>Fructose-6P</synonym>
    <synonym>Neuberg ester</synonym>
    <synonym>β-D-Fructofuranose 6-phosphate</synonym>
    <synonym>β-D-Fructofuranose 6-phosphoric acid</synonym>
  </synonyms>
  <chemical_formula>C6H13O9P</chemical_formula>
  <average_molecular_weight>260.1358</average_molecular_weight>
  <monisotopic_moleculate_weight>260.029718526</monisotopic_moleculate_weight>
  <iupac_name>{[(2R,3R,4S)-2,3,4,6-tetrahydroxy-5-oxohexyl]oxy}phosphonic acid</iupac_name>
  <traditional_iupac>D-fructose 6-phosphate</traditional_iupac>
  <cas_registry_number>643-13-0</cas_registry_number>
  <smiles>OCC(=O)[C@@H](O)[C@H](O)[C@H](O)COP(O)(O)=O</smiles>
  <inchi>InChI=1S/C6H13O9P/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14/h4-7,9-11H,1-2H2,(H2,12,13,14)/t4-,5-,6-/m1/s1</inchi>
  <inchikey>GSXOAOHZAIYLCY-HSUXUTPPSA-N</inchikey>
  <state>Solid</state>
  <cellular_locations>
    <cellular_location>Cytosol</cellular_location>
    <cellular_location>Extra-organism</cellular_location>
    <cellular_location>Periplasm</cellular_location>
  </cellular_locations>
  <predicted_properties>
    <property>
      <kind>logp</kind>
      <value>-1.86</value>
      <source>ALOGPS</source>
    </property>
    <property>
      <kind>logs</kind>
      <value>-1.05</value>
      <source>ALOGPS</source>
    </property>
    <property>
      <kind>solubility</kind>
      <value>2.32e+01 g/l</value>
      <source>ALOGPS</source>
    </property>
  </predicted_properties>
  <experimental_properties>
  </experimental_properties>
  <property>
    <kind>logp</kind>
    <value>-3.4</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>pka_strongest_acidic</kind>
    <value>1.49</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>pka_strongest_basic</kind>
    <value>-3.3</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>iupac</kind>
    <value>{[(2R,3R,4S)-2,3,4,6-tetrahydroxy-5-oxohexyl]oxy}phosphonic acid</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>average_mass</kind>
    <value>260.1358</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>mono_mass</kind>
    <value>260.029718526</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>smiles</kind>
    <value>OCC(=O)[C@@H](O)[C@H](O)[C@H](O)COP(O)(O)=O</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>formula</kind>
    <value>C6H13O9P</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>inchi</kind>
    <value>InChI=1S/C6H13O9P/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14/h4-7,9-11H,1-2H2,(H2,12,13,14)/t4-,5-,6-/m1/s1</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>inchikey</kind>
    <value>GSXOAOHZAIYLCY-HSUXUTPPSA-N</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>polar_surface_area</kind>
    <value>164.75</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>refractivity</kind>
    <value>48.43</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>polarizability</kind>
    <value>20.78</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>rotatable_bond_count</kind>
    <value>7</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>acceptor_count</kind>
    <value>8</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>donor_count</kind>
    <value>6</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>physiological_charge</kind>
    <value>-2</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>formal_charge</kind>
    <value>0</value>
    <source>ChemAxon</source>
  </property>
  <pathways>
    <pathway>
      <name>Pentose phosphate pathway</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00030</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Alanine, aspartate and glutamate metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00250</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Starch and sucrose metabolism</name>
      <description>The metabolism of starch and sucrose begins with D-fructose interacting with a D-glucose in a reversible reaction through a maltodextrin glucosidase resulting in a water molecule and a sucrose. D-fructose is phosphorylated through an ATP driven fructokinase resulting in the release of an ADP, a hydrogen ion and a Beta-D-fructofuranose 6-phosphate. This compound can also be introduced into the cytoplasm through either a mannose PTS permease or a hexose-6-phosphate:phosphate antiporter. 
The Beta-D-fructofuranose 6-phosphate is isomerized through a phosphoglucose isomerase resulting in a Beta-D-glucose 6-phosphate. This compound can also be incorporated by glucose PTS permease or a hexose-6-phosphate:phosphate antiporter. 
The beta-D-glucose 6 phosphate can also be produced by a D-glucose being phosphorylated by an ATP-driven glucokinase resulting in a ADP, a hydrogen ion and a Beta-D-glucose 6 phosphate. 

The beta-D-glucose can produce alpha-D-glucose-1-phosphate  by two methods:
1.-Beta-D-glucose is isomerized into an alpha-D-Glucose 6-phosphate and then interacts in a reversible reaction through a phosphoglucomutase-1 resulting in a alpha-D-glucose-1-phosphate.
2.-Beta-D-glucose interacts with a putative beta-phosphoglucomutase resulting in a Beta-D-glucose 1-phosphate.  Beta-D-glucose 1-phosphate can be incorporated into the cytoplasm through a 
glucose PTS permease. This compound is then isomerized into a Alpha-D-glucose-1-phosphate
The beta-D-glucose can cycle back into a D-fructose by first interacting with D-fructose in a reversible reaction through a Polypeptide: predicted glucosyltransferase resulting in the release of a phosphate and a sucrose. The sucrose then interacts in a reversible reaction with a water molecule through a maltodextrin glucosidase resulting in a D-glucose and a D-fructose. 

Alpha-D-glucose-1-phosphate can produce glycogen in by two different sets of reactions:
1.-Alpha-D-glucose-1-phosphate interacts with a hydrogen ion and an ATP through a glucose-1-phosphate adenylyltransferase resulting in a pyrophosphate and an ADP-glucose. The ADP-glucose then interacts with an amylose through a glycogen synthase resulting in the release of an ADP and an Amylose. The amylose then interacts with 1,4-α-glucan branching enzyme resulting in glycogen
2.- Alpha-D-glucose-1-phosphate interacts with amylose through a maltodextrin phosphorylase resulting in a phosphate and a glycogen.

Alpha-D-glucose-1-phosphate can also interacts with UDP-galactose through a galactose-1-phosphate uridylyltransferase resulting in a galactose 1-phosphate and a Uridine diphosphate glucose. The UDP-glucose then interacts with an alpha-D-glucose 6-phosphate through a trehalose-6-phosphate synthase resulting in a uridine 5'-diphosphate, a hydrogen ion and a Trehalose 6- phosphate. The latter compound can also be incorporated into the cytoplasm through a trehalose PTS permease. Trehalose interacts with a water molecule through a trehalose-6-phosphate phosphatase resulting in the release of a phosphate and an alpha,alpha-trehalose.The alpha,alpha-trehalose can also be obtained from glycogen being metabolized through a glycogen debranching enzyme resulting in a the alpha, alpha-trehalose. This compound ca then be hydrated through a cytoplasmic trehalase resulting in the release of an alpha-D-glucose and a beta-d-glucose.

Glycogen is then metabolized by reacting with a phosphate through a glycogen phosphorylase resulting in a alpha-D-glucose-1-phosphate and a dextrin. The dextrin is then hydrated through a glycogen phosphorylase-limit dextrin α-1,6-glucohydrolase resulting in the release of a debranched limit dextrin and a maltotetraose. This compound can also be incorporated into the cytoplasm through a 
maltose ABC transporter. The maltotetraose interacts with a phosphate through a maltodextrin phosphorylase releasing a alpha-D-glucose-1-phosphate and a maltotriose. The maltotriose can also be incorporated through a maltose ABC transporter. The maltotriose can then interact with water through a maltodextrin glucosidase resulting in a D-glucose and a D-maltose. D-maltose can also be incorporated through a 
maltose ABC transporter 

The D-maltose can then interact with a maltotriose through a amylomaltase resulting in a maltotetraose and a D-glucose. The D-glucose is then phosphorylated through an ATP driven glucokinase resulting in a hydrogen ion, an ADP and a Beta-D-glucose 6-phosphate</description>
      <pathwhiz_id>PW000941</pathwhiz_id>
      <kegg_map_id>ec00500</kegg_map_id>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Carbon fixation in photosynthetic organisms</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00710</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Glycolysis / Gluconeogenesis</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00010</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Fructose and mannose metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00051</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Galactose metabolism</name>
      <description>Galactose can be synthesized through two pathways: melibiose degradation involving an alpha galactosidase and lactose degradation involving a beta galactosidase. Melibiose is first transported inside the cell through the melibiose:Li+/Na+/H+ symporter. Once inside the cell, melibiose is degraded through alpha galactosidase  into an alpha-D-galactose and a beta-D-glucose. The beta-D-glucose is phosphorylated by a glucokinase to produce a beta-D-glucose-6-phosphate which can spontaneously be turned into a alpha D glucose 6 phosphate. This alpha D-glucose-6-phosphate is metabolized into a glucose -1-phosphate through a phosphoglucomutase-1. The glucose -1-phosphate is transformed into a uridine diphosphate glucose through UTP--glucose-1-phosphate uridylyltransferase. The product, uridine diphosphate glucose, can undergo a reversible reaction in which it can be turned into uridine diphosphategalactose through an UDP-glucose 4-epimerase.
Galactose can also be produced by lactose degradation involving a lactose permease to uptake lactose from the environment and a beta-galactosidase to turn lactose into Beta-D-galactose. 
Beta-D-galactose can also be uptaken from the environment through a galactose proton symporter.
Galactose is degraded through the following process:
Beta-D-galactose is introduced into the cytoplasm through a galactose proton symporter, or it can be synthesized from an alpha lactose that is introduced into the cytoplasm through a lactose permease. Alpha lactose interacts with water through a beta-galactosidase resulting in a beta-D-glucose and beta-D-galactose. Beta-D-galactose is isomerized into D-galactose. D-Galactose undergoes phosphorylation through a galactokinase, hence producing galactose 1 phosphate. On the other side of the pathway, a gluose-1-phosphate (product of the interaction of alpha-D-glucose 6-phosphate with a phosphoglucomutase resulting in a alpha-D-glucose-1-phosphate, an isomer of Glucose 1-phosphate, or an isomer of Beta-D-glucose 1-phosphate) interacts with UTP and a hydrogen ion in order to produce a uridine diphosphate glucose. This is followed by the interaction of galactose-1-phosphate with an established amount of uridine diphosphate glucose through a galactose-1-phosphate uridylyltransferase, which in turn output a glucose-1-phosphate and a uridine diphosphate galactose. The glucose -1-phosphate is transformed into a uridine diphosphate glucose through UTP--glucose-1-phosphate uridylyltransferase. The product, uridine diphosphate glucose, can undergo a reversible reaction in which it can be turned into uridine diphosphategalactose through an  UDP-glucose 4-epimerase, and so the cycle can keep going as long as more lactose or galactose is imported into the cell
</description>
      <pathwhiz_id>PW000821</pathwhiz_id>
      <kegg_map_id>ec00052</kegg_map_id>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Amino sugar and nucleotide sugar metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00520</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Methane metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00680</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Pentose and glucuronate interconversions</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00040</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Lipopolysaccharide biosynthesis</name>
      <description>E. coli lipid A is synthesized on the cytoplasmic surface of the inner membrane. The pathway can start from the fructose 6-phosphate that is either produced in the glycolysis and pyruvate dehydrogenase or be obtained from the interaction with D-fructose interacting with a mannose PTS permease. Fructose 6-phosphate interacts with L-glutamine through a D-fructose-6-phosphate aminotransferase resulting into a L-glutamic acid and a glucosamine 6-phosphate. The latter compound is isomerized through a phosphoglucosamine mutase resulting a glucosamine 1-phosphate. This compound is acetylated, interacting with acetyl-CoA through a bifunctional protein glmU resulting in a Coenzyme A, hydrogen ion and N-acetyl-glucosamine 1-phosphate. This compound interact with UTP and hydrogen ion through the bifunctional protein glmU resulting in a pyrophosphate and a UDP-N-acetylglucosamine. This compound interacts with (3R)-3-hydroxymyristoyl-[acp] through an UDP-N-acetylglucosamine acyltransferase resulting in a holo-[acp] and a UDP-3-O[(3R)-3-hydroxymyristoyl]-N-acetyl-alpha-D-glucosamine. This compound interacts with water through UDP-3-O-acyl-N-acetylglucosamine deacetylase resulting in an acetic acid and UDP-3-O-(3-hydroxymyristoyl)-α-D-glucosamine. The latter compound interacts with (3R)-3-hydroxymyristoyl-[acp] through 
UDP-3-O-(R-3-hydroxymyristoyl)-glucosamine N-acyltransferase releasing a hydrogen ion, a holo-acp and UDP-2-N,3-O-bis[(3R)-3-hydroxytetradecanoyl]-α-D-glucosamine. The latter compound is hydrolase by interacting with water and a UDP-2,3-diacylglucosamine hydrolase resulting in UMP, hydrogen ion and  2,3-bis[(3R)-3-hydroxymyristoyl]-α-D-glucosaminyl 1-phosphate. This last compound then interacts with a UDP-2-N,3-O-bis[(3R)-3-hydroxytetradecanoyl]-α-D-glucosamine through a lipid A disaccharide synthase resulting in a release of UDP, hydrogen ion and a lipid A disaccharide.  The lipid A disaccharide is phosphorylated by an ATP mediated 
tetraacyldisaccharide 4'-kinase resulting in the release of hydrogen ion and lipid IVA. 
 A D-ribulose 5-phosphate is isomerized with D-arabinose 5-phosphate isomerase 2  to result in a D-arabinose 5-phosphate. This compounds interacts with water and phosphoenolpyruvic acid through a 3-deoxy-D-manno-octulosonate 8-phosphate synthase resulting in the release of phosphate and  3-deoxy-D-manno-octulosonate 8-phosphate. This compound interacts with water through a 3-deoxy-D-manno-octulosonate 8-phosphate phosphatase thus releasing a phosphate and a 3-deoxy-D-manno-octulosonate. The latter compound interacts with CTP through a 3-deoxy-D-manno-octulosonate cytidylyltransferase resulting in a pyrophosphate and 
CMP-3-deoxy-α-D-manno-octulosonate.

CMP-3-deoxy-α-D-manno-octulosonate and lipid IVA interact with each other through a KDO transferase resulting in CMP, hydrogen ion and alpha-Kdo-(2--&gt;6)-lipid IVA. The latter compound reacts with CMP-3-deoxy-α-D-manno-octulosonate through a KDO transferase resulting in a CMP, hydrogen ion, and a a-Kdo-(2-&gt;4)-a-Kdo-(2-&gt;6)-lipid IVA. The latter compound interacts with a dodecanoyl-[acp] lauroyl acyltransferase resulting in a holo-[acp] and a (KDO)2-(lauroyl)-lipid IVA. The latter compound reacts with a myristoyl-[acp] through a myristoyl-acyl carrier protein (ACP)-dependent acyltransferase resulting in a holo-[acp], (KDO)2-lipid A. The latter compound reacts with ADP-L-glycero-beta-D-manno-heptose through ADP-heptose:LPS heptosyltransferase I resulting hydrogen ion, ADP, heptosyl-KDO2-lipid A. The latter compound interacts with ADP-L-glycero-beta-D-manno-heptose through ADP-heptose:LPS heptosyltransferase II resulting in ADP, hydrogen ion and (heptosyl)2-Kdo2-lipid A. The latter compound UDP-glucose interacts with (heptosyl)2-Kdo2-lipid A resulting in UDP, hydrogen ion and glucosyl-(heptosyl)2-Kdo2-lipid A. Glucosyl-(heptosyl)2-Kdo2-lipid A (Escherichia coli) is phosphorylated through an ATP-mediated lipopolysaccharide core heptose (I) kinase resulting in ADP, hydrogen ion and glucosyl-(heptosyl)2-Kdo2-lipid A-phosphate.
The latter compound interacts with ADP-L-glycero-beta-D-manno-heptose through a lipopolysaccharide core heptosyl transferase III resulting in ADP, hydrogen ion, and  glucosyl-(heptosyl)3-Kdo2-lipid A-phosphate. The latter compound is phosphorylated through an ATP-driven lipopolysaccharide core heptose (II) kinase resulting in ADP, hydrogen ion and glucosyl-(heptosyl)3-Kdo2-lipid A-bisphosphate. The latter compound interacts with UDP-alpha-D-galactose through a UDP-D-galactose:(glucosyl)lipopolysaccharide-1,6-D-galactosyltransferase resulting in a UDP, a hydrogen ion and a galactosyl-glucosyl-(heptosyl)3-Kdo2-lipid A-bisphosphate. The latter compound interacts with UDP-glucose through a (glucosyl)LPS α-1,3-glucosyltransferase resulting in a hydrogen ion, a UDP and galactosyl-(glucosyl)2-(heptosyl)3-Kdo2-lipid A-bisphosphate. This compound then interacts with UDP-glucose through a UDP-glucose:(glucosyl)LPS α-1,2-glucosyltransferase resulting in UDP, a hydrogen ion and galactosyl-(glucosyl)3-(heptosyl)3-Kdo2-lipid A-bisphosphate. This compound then interacts with ADP-L-glycero-beta-D-manno-heptose  through a lipopolysaccharide core biosynthesis; heptosyl transferase IV; probably hexose transferase resulting in a Lipid A-core.
A lipid A-core is then exported into the periplasmic space by a lipopolysaccharide ABC transporter.

The lipid A-core is then flipped to the outer surface of the inner membrane by the ATP-binding cassette (ABC) transporter, MsbA. An additional integral membrane protein, YhjD, has recently been implicated in LPS export across the IM. The smallest LPS derivative that supports viability in E. coli is lipid IVA. However, it requires mutations in either MsbA or YhjD, to suppress the normally lethal consequence of an incomplete lipid A . Recent studies with deletion mutants implicate the periplasmic protein LptA, the cytosolic protein LptB, and the IM proteins LptC, LptF, and LptG in the subsequent transport of nascent LPS to the outer membrane (OM), where the LptD/LptE complex flips LPS to the outer surface. </description>
      <pathwhiz_id>PW000831</pathwhiz_id>
      <kegg_map_id>ec00540</kegg_map_id>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>Microbial metabolism in diverse environments</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec01120</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Metabolic pathways</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>eco01100</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>colanic acid building blocks biosynthesis</name>
      <description>The colonic acid building blocks biosynthesis starts with a Beta-D-Glucose undergoing a transport reaction mediated by a glucose PTS permease. The permease phosphorylates the Beta-D-Glucose, producing a Beta-D-Glucose 6-phosphate. This compound can either change to an Alpha-D-Glucose 6-phosphate spontaneously or into a fructose 6-phosphate through a glucose-6-phosphate isomerase. The latter compound can also be present in E.coli through the interaction of D-fructose and a mannose PTS permease which phosphorylate the D-fructose. 
Fructose 6-phosphate interacts in a reversible reaction with mannose-6-phosphate isomerase in order to produce a Alpha-D-mannose 6-phosphate. This compound can also be present in E.coli through the interaction of Alpha-D-mannose and a mannose PTS permease which phosphorylates the alpha-D-mannose. Alpha-D-mannose 6-phosphate interacts in a reversible reaction with a phosphomannomutase to produce a alpha-D-mannose 1-phosphate. This compound in turn with a hydrogen ion and gtp undergoes a reaction with a mannose-1-phosphate guanylyltransferase, releasing a pyrophosphate and producing a guanosine diphosphate mannose. Guanosine diphosphate mannose interacts with gdp-mannose 4,6-dehydratase releasing a water, and gdp-4-dehydro-6-deoxy-D-mannose. This compound in turn with hydrogen ion and NADPH interact with GDP-L-fucose synthase releasing NADP and producing a GDP-L-fucose.
The Alpha-D-Glucose 6-phosphate interacts in a reversible reaction with phosphoglucomutase-1 to produce a alpha-D-glucose 1-phosphate. This in turn with UTP and hydrogen ion interact with UTP--glucose-1-phosphate uridyleltransferase releasing a pyrophosphate and UDP-glucose.
UDP-glucose can either interact with galactose-1-phosphate uridylyltransferase to produce a UDP-galactose or in turn with NAD and water interact with UDP-glucose 6-dehydrogenase releasing a NADH and a hydrogen ion and producing a UDP-glucuronate.
GDP-L-fucose, UDP-glucose, UDP-galactose and UDP-glucuronate are sugars that need to be activated in the form of nucleotide sugar prior to their assembly into colanic acid, also known as M antigen. 
Colanic acid is an extracellular polysaccharide which has been linked to a cluster of 19 genes(wca).
</description>
      <pathwhiz_id>PW000951</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>glycerol metabolism</name>
      <description>Glycerol metabolism  starts with glycerol is introduced into the cytoplasm through a glycerol channel GlpF Glycerol is then phosphorylated through an ATP mediated glycerol kinase resulting in a Glycerol 3-phosphate. This compound can also be obtained through a glycerophosphodiester reacting with water through a glycerophosphoryl diester phosphodiesterase or it can also be introduced into the cytoplasm through a glycerol-3-phosphate:phosphate antiporter. 
Glycerol 3-phosphate is then metabolized into a dihydroxyacetone phosphate in both aerobic or anaerobic conditions. In anaerobic conditions the metabolism is done through the reaction of glycerol 3-phosphate with a menaquinone mediated by a glycerol-3-phosphate dehydrogenase protein complex. In aerobic conditions, the metabolism is done through the reaction of glycerol 3-phosphate with ubiquinone mediated by a  glycerol-3-phosphate dehydrogenase [NAD(P]+].
Dihydroxyacetone phosphate is then introduced into the fructose metabolism by turning a dihydroxyacetone into an isomer through a triosephosphate isomerase resulting in a D-glyceraldehyde 3-phosphate which in turn reacts with a phosphate through a NAD dependent Glyceraldehyde 3-phosphate dehydrogenase resulting in a glyceric acid 1,3-biphosphate. This compound is desphosphorylated by a phosphoglycerate kinase resulting in a 3-phosphoglyceric acid.This compound in turn can either react with a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase or a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase resulting in a 2-phospho-D-glyceric acid. This compound interacts with an enolase resulting in a phosphoenolpyruvic acid and water. Phosphoenolpyruvic acid can react either through a AMP driven phosphoenoylpyruvate synthase or a ADP driven pyruvate kinase protein complex resulting in a pyruvic acid. Pyruvic acid reacts with CoA through a NAD driven pyruvate dehydrogenase complex resulting in a carbon dioxide and a Acetyl-CoA which gets incorporated into the TCA cycle pathway.</description>
      <pathwhiz_id>PW000914</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>glycerol metabolism II</name>
      <description>Glycerol metabolism starts with glycerol is introduced into the cytoplasm through a glycerol channel GlpF Glycerol is then phosphorylated through an ATP mediated glycerol kinase resulting in a Glycerol 3-phosphate. This compound can also be obtained through sn-glycero-3-phosphocholine reacting with water through a glycerophosphoryl diester phosphodiesterase  producing a benzyl alcohol, a hydrogen ion and a glycerol 3-phosphate or  the campound can be introduced into the cytoplasm through a glycerol-3-phosphate:phosphate antiporter. Glycerol 3-phosphate is then metabolized into a dihydroxyacetone phosphate in both aerobic or anaerobic conditions. In anaerobic conditions the metabolism is done through the reaction of glycerol 3-phosphate with a menaquinone mediated by a glycerol-3-phosphate dehydrogenase protein complex. In aerobic conditions, the metabolism is done through the reaction of glycerol 3-phosphate with ubiquinone mediated by a glycerol-3-phosphate dehydrogenase [NAD(P]+]. Dihydroxyacetone phosphate is then introduced into the fructose metabolism by turning a dihydroxyacetone into an isomer through a triosephosphate isomerase resulting in a D-glyceraldehyde 3-phosphate which in turn reacts with a phosphate through a NAD dependent Glyceraldehyde 3-phosphate dehydrogenase resulting in a glyceric acid 1,3-biphosphate. This compound is desphosphorylated by a phosphoglycerate kinase resulting in a 3-phosphoglyceric acid.This compound in turn can either react with a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase or a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase resulting in a 2-phospho-D-glyceric acid. This compound interacts with an enolase resulting in a phosphoenolpyruvic acid and water. Phosphoenolpyruvic acid can react either through a AMP driven phosphoenoylpyruvate synthase or a ADP driven pyruvate kinase protein complex resulting in a pyruvic acid. Pyruvic acid reacts with CoA through a NAD driven pyruvate dehydrogenase complex resulting in a carbon dioxide and a Acetyl-CoA which gets incorporated into the TCA cycle pathway.</description>
      <pathwhiz_id>PW000915</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>glycerol metabolism III (sn-glycero-3-phosphoethanolamine)</name>
      <description>Glycerol metabolism starts with glycerol is introduced into the cytoplasm through a glycerol channel GlpF Glycerol is then phosphorylated through an ATP mediated glycerol kinase resulting in a Glycerol 3-phosphate. This compound can also be obtained through sn-glycero-3-phosphethanolamine reacting with water through a glycerophosphoryl diester phosphodiesterase producing a benzyl alcohol, a hydrogen ion and a glycerol 3-phosphate or the campound can be introduced into the cytoplasm through a glycerol-3-phosphate:phosphate antiporter. Glycerol 3-phosphate is then metabolized into a dihydroxyacetone phosphate in both aerobic or anaerobic conditions. In anaerobic conditions the metabolism is done through the reaction of glycerol 3-phosphate with a menaquinone mediated by a glycerol-3-phosphate dehydrogenase protein complex. In aerobic conditions, the metabolism is done through the reaction of glycerol 3-phosphate with ubiquinone mediated by a glycerol-3-phosphate dehydrogenase [NAD(P]+]. Dihydroxyacetone phosphate is then introduced into the fructose metabolism by turning a dihydroxyacetone into an isomer through a triosephosphate isomerase resulting in a D-glyceraldehyde 3-phosphate which in turn reacts with a phosphate through a NAD dependent Glyceraldehyde 3-phosphate dehydrogenase resulting in a glyceric acid 1,3-biphosphate. This compound is desphosphorylated by a phosphoglycerate kinase resulting in a 3-phosphoglyceric acid.This compound in turn can either react with a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase or a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase resulting in a 2-phospho-D-glyceric acid. This compound interacts with an enolase resulting in a phosphoenolpyruvic acid and water. Phosphoenolpyruvic acid can react either through a AMP driven phosphoenoylpyruvate synthase or a ADP driven pyruvate kinase protein complex resulting in a pyruvic acid. Pyruvic acid reacts with CoA through a NAD driven pyruvate dehydrogenase complex resulting in a carbon dioxide and a Acetyl-CoA which gets incorporated into the TCA cycle pathway.</description>
      <pathwhiz_id>PW000916</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>glycerol metabolism IV (glycerophosphoglycerol)</name>
      <description>Glycerol metabolism starts with glycerol is introduced into the cytoplasm through a glycerol channel GlpF Glycerol is then phosphorylated through an ATP mediated glycerol kinase resulting in a Glycerol 3-phosphate. This compound can also be obtained through glycerophosphoglycerol reacting with water through a glycerophosphoryl diester phosphodiesterase producing a benzyl alcohol, a hydrogen ion and a glycerol 3-phosphate or the campound can be introduced into the cytoplasm through a glycerol-3-phosphate:phosphate antiporter. Glycerol 3-phosphate is then metabolized into a dihydroxyacetone phosphate in both aerobic or anaerobic conditions. In anaerobic conditions the metabolism is done through the reaction of glycerol 3-phosphate with a menaquinone mediated by a glycerol-3-phosphate dehydrogenase protein complex. In aerobic conditions, the metabolism is done through the reaction of glycerol 3-phosphate with ubiquinone mediated by a glycerol-3-phosphate dehydrogenase [NAD(P]+]. Dihydroxyacetone phosphate is then introduced into the fructose metabolism by turning a dihydroxyacetone into an isomer through a triosephosphate isomerase resulting in a D-glyceraldehyde 3-phosphate which in turn reacts with a phosphate through a NAD dependent Glyceraldehyde 3-phosphate dehydrogenase resulting in a glyceric acid 1,3-biphosphate. This compound is desphosphorylated by a phosphoglycerate kinase resulting in a 3-phosphoglyceric acid.This compound in turn can either react with a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase or a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase resulting in a 2-phospho-D-glyceric acid. This compound interacts with an enolase resulting in a phosphoenolpyruvic acid and water. Phosphoenolpyruvic acid can react either through a AMP driven phosphoenoylpyruvate synthase or a ADP driven pyruvate kinase protein complex resulting in a pyruvic acid. Pyruvic acid reacts with CoA through a NAD driven pyruvate dehydrogenase complex resulting in a carbon dioxide and a Acetyl-CoA which gets incorporated into the TCA cycle pathway.</description>
      <pathwhiz_id>PW000917</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>glycerol metabolism V (glycerophosphoserine)</name>
      <description>Glycerol metabolism starts with glycerol is introduced into the cytoplasm through a glycerol channel GlpF Glycerol is then phosphorylated through an ATP mediated glycerol kinase resulting in a Glycerol 3-phosphate. This compound can also be obtained through glycerophosphoserine reacting with water through a glycerophosphoryl diester phosphodiesterase producing a benzyl alcohol, a hydrogen ion and a glycerol 3-phosphate or the campound can be introduced into the cytoplasm through a glycerol-3-phosphate:phosphate antiporter. Glycerol 3-phosphate is then metabolized into a dihydroxyacetone phosphate in both aerobic or anaerobic conditions. In anaerobic conditions the metabolism is done through the reaction of glycerol 3-phosphate with a menaquinone mediated by a glycerol-3-phosphate dehydrogenase protein complex. In aerobic conditions, the metabolism is done through the reaction of glycerol 3-phosphate with ubiquinone mediated by a glycerol-3-phosphate dehydrogenase [NAD(P]+]. Dihydroxyacetone phosphate is then introduced into the fructose metabolism by turning a dihydroxyacetone into an isomer through a triosephosphate isomerase resulting in a D-glyceraldehyde 3-phosphate which in turn reacts with a phosphate through a NAD dependent Glyceraldehyde 3-phosphate dehydrogenase resulting in a glyceric acid 1,3-biphosphate. This compound is desphosphorylated by a phosphoglycerate kinase resulting in a 3-phosphoglyceric acid.This compound in turn can either react with a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase or a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase resulting in a 2-phospho-D-glyceric acid. This compound interacts with an enolase resulting in a phosphoenolpyruvic acid and water. Phosphoenolpyruvic acid can react either through a AMP driven phosphoenoylpyruvate synthase or a ADP driven pyruvate kinase protein complex resulting in a pyruvic acid. Pyruvic acid reacts with CoA through a NAD driven pyruvate dehydrogenase complex resulting in a carbon dioxide and a Acetyl-CoA which gets incorporated into the TCA cycle pathway.</description>
      <pathwhiz_id>PW000918</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>glycolysis and pyruvate dehydrogenase</name>
      <description>Fructose metabolism begins with the transport of Beta-D-glucose 6-phosphate through a glucose PTS permease, resulting in a Beta-D-glucose 6-phosphate. This compound is isomerized by a glucose-6-phosphate isomerase resulting in a fructose 6-phosphate. This compound can be phosphorylated by two different enzymes, a pyridoxal phosphatase/fructose 1,6-bisphosphatase or a ATP driven-6-phosphofructokinase-1 resulting in a fructose 1,6-biphosphate. This compound can either react with a fructose bisphosphate aldolase class 1 resulting in D-glyceraldehyde 3-phosphate and a dihydroxyacetone phosphate or through a fructose biphosphate aldolase class 2 resulting in a D-glyceraldehyde 3-phosphate. This compound can then either react in a reversible triosephosphate isomerase resulting in a dihydroxyacetone phosphate or react with a phosphate through a NAD dependent Glyceraldehyde 3-phosphate dehydrogenase resulting in a glyceric acid 1,3-biphosphate. This compound is desphosphorylated by a phosphoglycerate kinase resulting in a 3-phosphoglyceric acid.This compound in turn can either react with a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase or a 2,3-bisphosphoglycerate-independent phosphoglycerate mutase resulting in a 2-phospho-D-glyceric acid. This compound interacts with an enolase resulting in a phosphoenolpyruvic acid and water. Phosphoenolpyruvic acid can react either through a AMP driven phosphoenoylpyruvate synthase or a ADP driven pyruvate kinase protein complex resulting in a pyruvic acid.
Pyruvic acid reacts with CoA through a NAD driven pyruvate dehydrogenase complex resulting in a carbon dioxide and a Acetyl-CoA which gets incorporated into the TCA cycle pathway.


</description>
      <pathwhiz_id>PW000785</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>lipopolysaccharide biosynthesis II</name>
      <description>E. coli lipid A is synthesized on the cytoplasmic surface of the inner membrane. The pathway can start from the fructose 6-phosphate that is either produced in the glycolysis and pyruvate dehydrogenase or be obtained from the interaction with D-fructose interacting with a mannose PTS permease. Fructose 6-phosphate interacts with L-glutamine through a D-fructose-6-phosphate aminotransferase resulting into a L-glutamic acid and a glucosamine 6-phosphate. The latter compound is isomerized through a phosphoglucosamine mutase resulting a glucosamine 1-phosphate. This compound is acetylated, interacting with acetyl-CoA through a bifunctional protein glmU resulting in a Coenzyme A, hydrogen ion and N-acetyl-glucosamine 1-phosphate. This compound interact with UTP and hydrogen ion through the bifunctional protein glmU resulting in a pyrophosphate and a UDP-N-acetylglucosamine. This compound interacts with (3R)-3-hydroxymyristoyl-[acp] through an UDP-N-acetylglucosamine acyltransferase resulting in a holo-[acp] and a UDP-3-O[(3R)-3-hydroxymyristoyl]-N-acetyl-alpha-D-glucosamine. This compound interacts with water through UDP-3-O-acyl-N-acetylglucosamine deacetylase resulting in an acetic acid and UDP-3-O-(3-hydroxymyristoyl)-α-D-glucosamine. The latter compound interacts with (3R)-3-hydroxymyristoyl-[acp] through UDP-3-O-(R-3-hydroxymyristoyl)-glucosamine N-acyltransferase releasing a hydrogen ion, a holo-acp and UDP-2-N,3-O-bis[(3R)-3-hydroxytetradecanoyl]-α-D-glucosamine. The latter compound is hydrolase by interacting with water and a UDP-2,3-diacylglucosamine hydrolase resulting in UMP, hydrogen ion and 2,3-bis[(3R)-3-hydroxymyristoyl]-α-D-glucosaminyl 1-phosphate. This last compound then interacts with a UDP-2-N,3-O-bis[(3R)-3-hydroxytetradecanoyl]-α-D-glucosamine through a lipid A disaccharide synthase resulting in a release of UDP, hydrogen ion and a lipid A disaccharide. The lipid A disaccharide is phosphorylated by an ATP mediated tetraacyldisaccharide 4'-kinase resulting in the release of hydrogen ion and lipid IVA. A D-ribulose 5-phosphate is isomerized with D-arabinose 5-phosphate isomerase 2 to result in a D-arabinose 5-phosphate. This compounds interacts with water and phosphoenolpyruvic acid through a 3-deoxy-D-manno-octulosonate 8-phosphate synthase resulting in the release of phosphate and 3-deoxy-D-manno-octulosonate 8-phosphate. This compound interacts with water through a 3-deoxy-D-manno-octulosonate 8-phosphate phosphatase thus releasing a phosphate and a 3-deoxy-D-manno-octulosonate. The latter compound interacts with CTP through a 3-deoxy-D-manno-octulosonate cytidylyltransferase resulting in a pyrophosphate and CMP-3-deoxy-α-D-manno-octulosonate. CMP-3-deoxy-α-D-manno-octulosonate and lipid IVA interact with each other through a KDO transferase resulting in CMP, hydrogen ion and alpha-Kdo-(2--&gt;6)-lipid IVA. The latter compound reacts with CMP-3-deoxy-α-D-manno-octulosonate through a KDO transferase resulting in a CMP, hydrogen ion, and a a-Kdo-(2-&gt;4)-a-Kdo-(2-&gt;6)-lipid IVA. The latter compound can either interact with a phosphoethanolamine resulting in a 1,2-diacyl-sn-glycerol and a phosphoethanolamine-Kdo2-lipid A which can be exported outside the cell, or it can interact with a dodecanoyl-[acp] lauroyl acyltransferase resulting in a holo-[acp] and a (KDO)2-(lauroyl)-lipid IVA. The latter compound reacts with a myristoyl-[acp] through a myristoyl-acyl carrier protein (ACP)-dependent acyltransferase resulting in a holo-[acp], (KDO)2-lipid A. The latter compound reacts with ADP-L-glycero-beta-D-manno-heptose through ADP-heptose:LPS heptosyltransferase I resulting hydrogen ion, ADP, heptosyl-KDO2-lipid A. The latter compound interacts with ADP-L-glycero-beta-D-manno-heptose through ADP-heptose:LPS heptosyltransferase II resulting in ADP, hydrogen ion and (heptosyl)2-Kdo2-lipid A. The latter compound UDP-glucose interacts with (heptosyl)2-Kdo2-lipid A resulting in UDP, hydrogen ion and glucosyl-(heptosyl)2-Kdo2-lipid A. Glucosyl-(heptosyl)2-Kdo2-lipid A (Escherichia coli) is phosphorylated through an ATP-mediated lipopolysaccharide core heptose (I) kinase resulting in ADP, hydrogen ion and glucosyl-(heptosyl)2-Kdo2-lipid A-phosphate. The latter compound interacts with ADP-L-glycero-beta-D-manno-heptose through a lipopolysaccharide core heptosyl transferase III resulting in ADP, hydrogen ion, and glucosyl-(heptosyl)3-Kdo2-lipid A-phosphate. The latter compound is phosphorylated through an ATP-driven lipopolysaccharide core heptose (II) kinase resulting in ADP, hydrogen ion and glucosyl-(heptosyl)3-Kdo2-lipid A-bisphosphate. The latter compound interacts with UDP-alpha-D-galactose through a UDP-D-galactose:(glucosyl)lipopolysaccharide-1,6-D-galactosyltransferase resulting in a UDP, a hydrogen ion and a galactosyl-glucosyl-(heptosyl)3-Kdo2-lipid A-bisphosphate. The latter compound interacts with UDP-glucose through a (glucosyl)LPS α-1,3-glucosyltransferase resulting in a hydrogen ion, a UDP and galactosyl-(glucosyl)2-(heptosyl)3-Kdo2-lipid A-bisphosphate. This compound then interacts with UDP-glucose through a UDP-glucose:(glucosyl)LPS α-1,2-glucosyltransferase resulting in UDP, a hydrogen ion and galactosyl-(glucosyl)3-(heptosyl)3-Kdo2-lipid A-bisphosphate. This compound then interacts with ADP-L-glycero-beta-D-manno-heptose through a lipopolysaccharide core biosynthesis; heptosyl transferase IV; probably hexose transferase resulting in a Lipid A-core. A lipid A-core is then exported into the periplasmic space by a lipopolysaccharide ABC transporter. The lipid A-core is then flipped to the outer surface of the inner membrane by the ATP-binding cassette (ABC) transporter, MsbA. An additional integral membrane protein, YhjD, has recently been implicated in LPS export across the IM. The smallest LPS derivative that supports viability in E. coli is lipid IVA. However, it requires mutations in either MsbA or YhjD, to suppress the normally lethal consequence of an incomplete lipid A . Recent studies with deletion mutants implicate the periplasmic protein LptA, the cytosolic protein LptB, and the IM proteins LptC, LptF, and LptG in the subsequent transport of nascent LPS to the outer membrane (OM), where the LptD/LptE complex flips LPS to the outer surface.</description>
      <pathwhiz_id>PW001905</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>D-sorbitol degradation II</name>
      <description>Of the six existing hexitols only three (D-mannitol, D-sorbitol [glucitol], and galactitol [owing to symmetry, D- and L-galactitol are identical]) occur naturally and each of these can be utilized by E. coli K-12 as a total source of carbon and energy. Each enters the cell via a specific phosphotransferase system so the first intracellular species is the 6-phospho derivative. D-sorbitol-6-phosphate is converted by a single dehydrogenase reaction to the glycolytic intermediate, D-fructose-6-phosphate and hence flows through the pathways of central metabolism to satisfy the cell's need for precursor metabolites, reducing power, and metabolic energy.</description>
      <pathwhiz_id>PW002022</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>lipopolysaccharide biosynthesis III</name>
      <description>E. coli lipid A is synthesized on the cytoplasmic surface of the inner membrane. The pathway can start from the fructose 6-phosphate that is either produced in the glycolysis and pyruvate dehydrogenase or be obtained from the interaction with D-fructose interacting with a mannose PTS permease. Fructose 6-phosphate interacts with L-glutamine through a D-fructose-6-phosphate aminotransferase resulting into a L-glutamic acid and a glucosamine 6-phosphate. The latter compound is isomerized through a phosphoglucosamine mutase resulting a glucosamine 1-phosphate. This compound is acetylated, interacting with acetyl-CoA through a bifunctional protein glmU resulting in a Coenzyme A, hydrogen ion and N-acetyl-glucosamine 1-phosphate. This compound interact with UTP and hydrogen ion through the bifunctional protein glmU resulting in a pyrophosphate and a UDP-N-acetylglucosamine. This compound interacts with (3R)-3-hydroxymyristoyl-[acp] through an UDP-N-acetylglucosamine acyltransferase resulting in a holo-[acp] and a UDP-3-O[(3R)-3-hydroxymyristoyl]-N-acetyl-alpha-D-glucosamine. This compound interacts with water through UDP-3-O-acyl-N-acetylglucosamine deacetylase resulting in an acetic acid and UDP-3-O-(3-hydroxymyristoyl)-α-D-glucosamine. The latter compound interacts with (3R)-3-hydroxymyristoyl-[acp] through 
UDP-3-O-(R-3-hydroxymyristoyl)-glucosamine N-acyltransferase releasing a hydrogen ion, a holo-acp and UDP-2-N,3-O-bis[(3R)-3-hydroxytetradecanoyl]-α-D-glucosamine. The latter compound is hydrolase by interacting with water and a UDP-2,3-diacylglucosamine hydrolase resulting in UMP, hydrogen ion and  2,3-bis[(3R)-3-hydroxymyristoyl]-α-D-glucosaminyl 1-phosphate. This last compound then interacts with a UDP-2-N,3-O-bis[(3R)-3-hydroxytetradecanoyl]-α-D-glucosamine through a lipid A disaccharide synthase resulting in a release of UDP, hydrogen ion and a lipid A disaccharide.  The lipid A disaccharide is phosphorylated by an ATP mediated 
tetraacyldisaccharide 4'-kinase resulting in the release of hydrogen ion and lipid IVA. 
 A D-ribulose 5-phosphate is isomerized with D-arabinose 5-phosphate isomerase 2  to result in a D-arabinose 5-phosphate. This compounds interacts with water and phosphoenolpyruvic acid through a 3-deoxy-D-manno-octulosonate 8-phosphate synthase resulting in the release of phosphate and  3-deoxy-D-manno-octulosonate 8-phosphate. This compound interacts with water through a 3-deoxy-D-manno-octulosonate 8-phosphate phosphatase thus releasing a phosphate and a 3-deoxy-D-manno-octulosonate. The latter compound interacts with CTP through a 3-deoxy-D-manno-octulosonate cytidylyltransferase resulting in a pyrophosphate and 
CMP-3-deoxy-α-D-manno-octulosonate.

CMP-3-deoxy-α-D-manno-octulosonate and lipid IVA interact with each other through a KDO transferase resulting in CMP, hydrogen ion and alpha-Kdo-(2--&gt;6)-lipid IVA. The latter compound reacts with CMP-3-deoxy-α-D-manno-octulosonate through a KDO transferase resulting in a CMP, hydrogen ion, and a a-Kdo-(2-&gt;4)-a-Kdo-(2-&gt;6)-lipid IVA. The latter compound can either react with a palmitoleoyl-acp through a palmitoleoyl acyltransferase resulting in the release of a holo-acyl carriere protein and a Kdo2-palmitoleoyl-lipid IVa which in turn reacts with a myristoyl-acp through a myristoyl-acp dependent acyltransferase resulting in a release of a holo-acp and a Kdo2-lipid A, cold adapted, or it can interact with a dodecanoyl-[acp] lauroyl acyltransferase resulting in a holo-[acp] and a (KDO)2-(lauroyl)-lipid IVA. The latter compound reacts with a myristoyl-[acp] through a myristoyl-acyl carrier protein (ACP)-dependent acyltransferase resulting in a holo-[acp], (KDO)2-lipid A. The latter compound reacts with ADP-L-glycero-beta-D-manno-heptose through ADP-heptose:LPS heptosyltransferase I resulting hydrogen ion, ADP, heptosyl-KDO2-lipid A. The latter compound interacts with ADP-L-glycero-beta-D-manno-heptose through ADP-heptose:LPS heptosyltransferase II resulting in ADP, hydrogen ion and (heptosyl)2-Kdo2-lipid A. The latter compound UDP-glucose interacts with (heptosyl)2-Kdo2-lipid A resulting in UDP, hydrogen ion and glucosyl-(heptosyl)2-Kdo2-lipid A. Glucosyl-(heptosyl)2-Kdo2-lipid A (Escherichia coli) is phosphorylated through an ATP-mediated lipopolysaccharide core heptose (I) kinase resulting in ADP, hydrogen ion and glucosyl-(heptosyl)2-Kdo2-lipid A-phosphate.
The latter compound interacts with ADP-L-glycero-beta-D-manno-heptose through a lipopolysaccharide core heptosyl transferase III resulting in ADP, hydrogen ion, and  glucosyl-(heptosyl)3-Kdo2-lipid A-phosphate. The latter compound is phosphorylated through an ATP-driven lipopolysaccharide core heptose (II) kinase resulting in ADP, hydrogen ion and glucosyl-(heptosyl)3-Kdo2-lipid A-bisphosphate. The latter compound interacts with UDP-alpha-D-galactose through a UDP-D-galactose:(glucosyl)lipopolysaccharide-1,6-D-galactosyltransferase resulting in a UDP, a hydrogen ion and a galactosyl-glucosyl-(heptosyl)3-Kdo2-lipid A-bisphosphate. The latter compound interacts with UDP-glucose through a (glucosyl)LPS α-1,3-glucosyltransferase resulting in a hydrogen ion, a UDP and galactosyl-(glucosyl)2-(heptosyl)3-Kdo2-lipid A-bisphosphate. This compound then interacts with UDP-glucose through a UDP-glucose:(glucosyl)LPS α-1,2-glucosyltransferase resulting in UDP, a hydrogen ion and galactosyl-(glucosyl)3-(heptosyl)3-Kdo2-lipid A-bisphosphate. This compound then interacts with ADP-L-glycero-beta-D-manno-heptose  through a lipopolysaccharide core biosynthesis; heptosyl transferase IV; probably hexose transferase resulting in a Lipid A-core.
A lipid A-core is then exported into the periplasmic space by a lipopolysaccharide ABC transporter.

The lipid A-core is then flipped to the outer surface of the inner membrane by the ATP-binding cassette (ABC) transporter, MsbA. An additional integral membrane protein, YhjD, has recently been implicated in LPS export across the IM. The smallest LPS derivative that supports viability in E. coli is lipid IVA. However, it requires mutations in either MsbA or YhjD, to suppress the normally lethal consequence of an incomplete lipid A . Recent studies with deletion mutants implicate the periplasmic protein LptA, the cytosolic protein LptB, and the IM proteins LptC, LptF, and LptG in the subsequent transport of nascent LPS to the outer membrane (OM), where the LptD/LptE complex flips LPS to the outer surface. </description>
      <pathwhiz_id>PW002059</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>&lt;i&gt;N&lt;/i&gt;-acetylglucosamine degradation I</name>
      <ecocyc_pathway_id>GLUAMCAT-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>gluconeogenesis I</name>
      <ecocyc_pathway_id>GLUCONEO-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>glycolysis I</name>
      <ecocyc_pathway_id>GLYCOLYSIS</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>mannitol degradation I</name>
      <ecocyc_pathway_id>MANNIDEG-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>sorbitol degradation II</name>
      <ecocyc_pathway_id>SORBDEG-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>pentose phosphate pathway (non-oxidative branch)</name>
      <ecocyc_pathway_id>NONOXIPENT-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>UDP-&lt;i&gt;N&lt;/i&gt;-acetyl-D-glucosamine biosynthesis I</name>
      <ecocyc_pathway_id>UDPNAGSYN-PWY</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>D-allose degradation</name>
      <ecocyc_pathway_id>PWY0-44</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>GDP-mannose biosynthesis</name>
      <ecocyc_pathway_id>PWY-5659</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>D-mannose degradation</name>
      <ecocyc_pathway_id>MANNCAT-PWY</ecocyc_pathway_id>
    </pathway>
  </pathways>
  <spectra>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>341</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>342</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>343</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>344</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>345</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>346</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>347</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>1918</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>1920</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>3381</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>30180</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>30288</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>30289</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>30511</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>30512</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>30513</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>30514</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>31012</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>31013</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>32337</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>37306</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>150303</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>1050555</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>1050557</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>1050559</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>1095</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>142350</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>142351</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>142352</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>142353</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>142354</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>142355</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>142356</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>142357</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>142358</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>142359</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>142360</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>142361</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>142362</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>142363</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>142364</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>142365</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>142366</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>142367</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>142368</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>142369</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>183</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>184</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>185</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2935</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2936</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2937</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2938</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2939</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>180066</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>180067</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>180068</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>182400</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>182401</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>182402</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>437634</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2226272</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2228452</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2228667</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2827935</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2827936</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2827937</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2850892</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2850893</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2850894</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrTwoD</type>
      <spectrum_id>960</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrTwoD</type>
      <spectrum_id>1153</spectrum_id>
    </spectrum>
  </spectra>
  <hmdb_id>HMDB00124</hmdb_id>
  <pubchem_compound_id>69507</pubchem_compound_id>
  <chemspider_id>62713</chemspider_id>
  <kegg_id>C00085</kegg_id>
  <chebi_id>15946</chebi_id>
  <biocyc_id>FRUCTOSE-6P</biocyc_id>
  <het_id>F6R</het_id>
  <wikipidia>Fructose 6-phosphate</wikipidia>
  <foodb_id/>
  <general_references>
    <reference>
      <reference_text>Keseler, I. M., Collado-Vides, J., Santos-Zavaleta, A., Peralta-Gil, M., Gama-Castro, S., Muniz-Rascado, L., Bonavides-Martinez, C., Paley, S., Krummenacker, M., Altman, T., Kaipa, P., Spaulding, A., Pacheco, J., Latendresse, M., Fulcher, C., Sarker, M., Shearer, A. G., Mackie, A., Paulsen, I., Gunsalus, R. P., Karp, P. D. (2011). "EcoCyc: a comprehensive database of Escherichia coli biology." Nucleic Acids Res 39:D583-D590.</reference_text>
      <pubmed_id>21097882</pubmed_id>
    </reference>
    <reference>
      <reference_text>Kanehisa, M., Goto, S., Sato, Y., Furumichi, M., Tanabe, M. (2012). "KEGG for integration and interpretation of large-scale molecular data sets." Nucleic Acids Res 40:D109-D114.</reference_text>
      <pubmed_id>22080510</pubmed_id>
    </reference>
    <reference>
      <reference_text>Vijayendran, C., Barsch, A., Friehs, K., Niehaus, K., Becker, A., Flaschel, E. (2008). "Perceiving molecular evolution processes in Escherichia coli by comprehensive metabolite and gene expression profiling." Genome Biol 9:R72.</reference_text>
      <pubmed_id>18402659</pubmed_id>
    </reference>
    <reference>
      <reference_text>van der Werf, M. J., Overkamp, K. M., Muilwijk, B., Coulier, L., Hankemeier, T. (2007). "Microbial metabolomics: toward a platform with full metabolome coverage." Anal Biochem 370:17-25.</reference_text>
      <pubmed_id>17765195</pubmed_id>
    </reference>
    <reference>
      <reference_text>Winder, C. L., Dunn, W. B., Schuler, S., Broadhurst, D., Jarvis, R., Stephens, G. M., Goodacre, R. (2008). "Global metabolic profiling of Escherichia coli cultures: an evaluation of methods for quenching and extraction of intracellular metabolites." Anal Chem 80:2939-2948.</reference_text>
      <pubmed_id>18331064</pubmed_id>
    </reference>
    <reference>
      <reference_text>Buchholz, A., Takors, R., Wandrey, C. (2001). "Quantification of intracellular metabolites in Escherichia coli K12 using liquid chromatographic-electrospray ionization tandem mass spectrometric techniques." Anal Biochem 295:129-137.</reference_text>
      <pubmed_id>11488613</pubmed_id>
    </reference>
    <reference>
      <reference_text>Peng, L., Arauzo-Bravo, M. J., Shimizu, K. (2004). "Metabolic flux analysis for a ppc mutant Escherichia coli based on 13C-labelling experiments together with enzyme activity assays and intracellular metabolite measurements." FEMS Microbiol Lett 235:17-23.</reference_text>
      <pubmed_id>15158257</pubmed_id>
    </reference>
    <reference>
      <reference_text>Sreekumar A, Poisson LM, Rajendiran TM, Khan AP, Cao Q, Yu J, Laxman B, Mehra R, Lonigro RJ, Li Y, Nyati MK, Ahsan A, Kalyana-Sundaram S, Han B, Cao X, Byun J, Omenn GS, Ghosh D, Pennathur S, Alexander DC, Berger A, Shuster JR, Wei JT, Varambally S, Beecher C, Chinnaiyan AM: Metabolomic profiles delineate potential role for sarcosine in prostate cancer progression. Nature. 2009 Feb 12;457(7231):910-4.</reference_text>
      <pubmed_id>19212411</pubmed_id>
    </reference>
    <reference>
      <reference_text>Nakayama Y, Kinoshita A, Tomita M: Dynamic simulation of red blood cell metabolism and its application to the analysis of a pathological condition. Theor Biol Med Model. 2005 May 9;2(1):18.</reference_text>
      <pubmed_id>15882454</pubmed_id>
    </reference>
    <reference>
      <reference_text>Roberts NB, Dutton J, Helliwell T, Rothwell PJ, Kavanagh JP: Pyrophosphate in synovial fluid and urine and its relationship to urinary risk factors for stone disease. Ann Clin Biochem. 1992 Sep;29 ( Pt 5):529-34.</reference_text>
      <pubmed_id>1332571</pubmed_id>
    </reference>
    <reference>
      <reference_text>Sanchez B, Champomier-Verges MC, Anglade P, Baraige F, de Los Reyes-Gavilan CG, Margolles A, Zagorec M: Proteomic analysis of global changes in protein expression during bile salt exposure of Bifidobacterium longum NCIMB 8809. J Bacteriol. 2005 Aug;187(16):5799-808.</reference_text>
      <pubmed_id>16077128</pubmed_id>
    </reference>
    <reference>
      <reference_text>Markuszewski MJ, Szczykowska M, Siluk D, Kaliszan R: Human red blood cells targeted metabolome analysis of glycolysis cycle metabolites by capillary electrophoresis using an indirect photometric detection method. J Pharm Biomed Anal. 2005 Sep 15;39(3-4):636-42.</reference_text>
      <pubmed_id>15925468</pubmed_id>
    </reference>
    <reference>
      <reference_text>Wamelink MM, Struys EA, Huck JH, Roos B, van der Knaap MS, Jakobs C, Verhoeven NM: Quantification of sugar phosphate intermediates of the pentose phosphate pathway by LC-MS/MS: application to two new inherited defects of metabolism. J Chromatogr B Analyt Technol Biomed Life Sci. 2005 Aug 25;823(1):18-25.       Epub 2005 Jan 23.</reference_text>
      <pubmed_id>16055050</pubmed_id>
    </reference>
    <reference>
      <reference_text>Karlander S, Roovete A, Vranic M, Efendic S: Glucose and fructose 6-phosphate cycle in humans.  Am J Physiol. 1986 Nov;251(5 Pt 1):E530-6.</reference_text>
      <pubmed_id>3777162</pubmed_id>
    </reference>
    <reference>
      <reference_text>Gapparov MM, Virovets OA: [Nonenzymatic glycosylation of serum albumin and thymic DNA by food monosugars and their natural metabolites that form in the body] Vopr Pitan. 1990 Jan-Feb;(1):36-40.</reference_text>
      <pubmed_id>2346009</pubmed_id>
    </reference>
    <reference>
      <reference_text>Alton G, Hasilik M, Niehues R, Panneerselvam K, Etchison JR, Fana F, Freeze HH: Direct utilization of mannose for mammalian glycoprotein biosynthesis.  Glycobiology. 1998 Mar;8(3):285-95.</reference_text>
      <pubmed_id>9451038</pubmed_id>
    </reference>
    <reference>
      <reference_text>Gagnon M, Kheadr EE, Le Blay G, Fliss I: In vitro inhibition of Escherichia coli O157:H7 by bifidobacterial strains of human origin. Int J Food Microbiol. 2004 Apr 1;92(1):69-78.</reference_text>
      <pubmed_id>15033269</pubmed_id>
    </reference>
  </general_references>
  <synthesis_reference/>
  <msds_url>http://hmdb.ca/system/metabolites/msds/000/000/085/original/HMDB00124.pdf?1358462910</msds_url>
  <enzymes>
    <enzyme>
      <name>Mannose-6-phosphate isomerase</name>
      <uniprot_id>P00946</uniprot_id>
      <uniprot_name>MANA_ECOLI</uniprot_name>
      <gene_name>manA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P00946.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Sorbitol-6-phosphate 2-dehydrogenase</name>
      <uniprot_id>P05707</uniprot_id>
      <uniprot_name>SRLD_ECOLI</uniprot_name>
      <gene_name>srlD</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P05707.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>6-phosphofructokinase isozyme 2</name>
      <uniprot_id>P06999</uniprot_id>
      <uniprot_name>K6PF2_ECOLI</uniprot_name>
      <gene_name>pfkB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P06999.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Phosphoenolpyruvate-protein phosphotransferase</name>
      <uniprot_id>P08839</uniprot_id>
      <uniprot_name>PT1_ECOLI</uniprot_name>
      <gene_name>ptsI</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P08839.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Mannitol-1-phosphate 5-dehydrogenase</name>
      <uniprot_id>P09424</uniprot_id>
      <uniprot_name>MTLD_ECOLI</uniprot_name>
      <gene_name>mtlD</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P09424.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Glucose-6-phosphate isomerase</name>
      <uniprot_id>P0A6T1</uniprot_id>
      <uniprot_name>G6PI_ECOLI</uniprot_name>
      <gene_name>pgi</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A6T1.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Glucosamine-6-phosphate deaminase</name>
      <uniprot_id>P0A759</uniprot_id>
      <uniprot_name>NAGB_ECOLI</uniprot_name>
      <gene_name>nagB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A759.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>6-phosphofructokinase isozyme 1</name>
      <uniprot_id>P0A796</uniprot_id>
      <uniprot_name>K6PF1_ECOLI</uniprot_name>
      <gene_name>pfkA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A796.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Transaldolase A</name>
      <uniprot_id>P0A867</uniprot_id>
      <uniprot_name>TALA_ECOLI</uniprot_name>
      <gene_name>talA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A867.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Transaldolase B</name>
      <uniprot_id>P0A870</uniprot_id>
      <uniprot_name>TALB_ECOLI</uniprot_name>
      <gene_name>talB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A870.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Fructose-1,6-bisphosphatase class 1</name>
      <uniprot_id>P0A993</uniprot_id>
      <uniprot_name>F16PA_ECOLI</uniprot_name>
      <gene_name>fbp</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A993.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Fructose-1,6-bisphosphatase class 2</name>
      <uniprot_id>P0A9C9</uniprot_id>
      <uniprot_name>GLPX_ECOLI</uniprot_name>
      <gene_name>glpX</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0A9C9.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Glucosamine--fructose-6-phosphate aminotransferase [isomerizing]</name>
      <uniprot_id>P17169</uniprot_id>
      <uniprot_name>GLMS_ECOLI</uniprot_name>
      <gene_name>glmS</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P17169.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Phosphatase ybhA</name>
      <uniprot_id>P21829</uniprot_id>
      <uniprot_name>YBHA_ECOLI</uniprot_name>
      <gene_name>ybhA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P21829.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Fructokinase</name>
      <uniprot_id>P23917</uniprot_id>
      <uniprot_name>MAK_ECOLI</uniprot_name>
      <gene_name>mak</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P23917.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Transketolase 1</name>
      <uniprot_id>P27302</uniprot_id>
      <uniprot_name>TKT1_ECOLI</uniprot_name>
      <gene_name>tktA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P27302.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>D-allulose-6-phosphate 3-epimerase</name>
      <uniprot_id>P32719</uniprot_id>
      <uniprot_name>ALSE_ECOLI</uniprot_name>
      <gene_name>alsE</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P32719.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Transketolase 2</name>
      <uniprot_id>P33570</uniprot_id>
      <uniprot_name>TKT2_ECOLI</uniprot_name>
      <gene_name>tktB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P33570.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>PTS system mannose-specific EIIAB component</name>
      <uniprot_id>P69797</uniprot_id>
      <uniprot_name>PTNAB_ECOLI</uniprot_name>
      <gene_name>manX</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P69797.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Sugar phosphatase supH</name>
      <uniprot_id>P75792</uniprot_id>
      <uniprot_name>SUPH_ECOLI</uniprot_name>
      <gene_name>supH</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P75792.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Mannose permease IIC component</name>
      <uniprot_id>P69801</uniprot_id>
      <uniprot_name>PTNC_ECOLI</uniprot_name>
      <gene_name>manY</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P69801.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Mannose permease IID component</name>
      <uniprot_id>P69805</uniprot_id>
      <uniprot_name>PTND_ECOLI</uniprot_name>
      <gene_name>manZ</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P69805.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Uncharacterized protein yggF</name>
      <uniprot_id>P21437</uniprot_id>
      <uniprot_name>YGGF_ECOLI</uniprot_name>
      <gene_name>yggF</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P21437.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Fructose-6-phosphate aldolase 2</name>
      <uniprot_id>P32669</uniprot_id>
      <uniprot_name>FSAB_ECOLI</uniprot_name>
      <gene_name>fsaB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P32669.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Fructose-6-phosphate aldolase 1</name>
      <uniprot_id>P78055</uniprot_id>
      <uniprot_name>FSAA_ECOLI</uniprot_name>
      <gene_name>fsaA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P78055.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Phosphocarrier protein HPr</name>
      <uniprot_id>P0AA04</uniprot_id>
      <uniprot_name>PTHP_ECOLI</uniprot_name>
      <gene_name>ptsH</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AA04.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>deacetylase of acs and cheY, regulates chemotaxis</name>
      <uniprot_id>P75960</uniprot_id>
      <uniprot_name/>
      <gene_name>cobB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P75960.xml</protein_url>
    </enzyme>
  </enzymes>
  <transporters>
    <enzyme>
      <name>Mannose permease IIC component</name>
      <uniprot_id>P69801</uniprot_id>
      <uniprot_name>PTNC_ECOLI</uniprot_name>
      <gene_name>manY</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P69801.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Mannose permease IID component</name>
      <uniprot_id>P69805</uniprot_id>
      <uniprot_name>PTND_ECOLI</uniprot_name>
      <gene_name>manZ</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P69805.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Outer membrane protein N</name>
      <uniprot_id>P77747</uniprot_id>
      <uniprot_name>OMPN_ECOLI</uniprot_name>
      <gene_name>ompN</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P77747.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Outer membrane pore protein E</name>
      <uniprot_id>P02932</uniprot_id>
      <uniprot_name>PHOE_ECOLI</uniprot_name>
      <gene_name>phoE</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P02932.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Hexose phosphate transport protein</name>
      <uniprot_id>P0AGC0</uniprot_id>
      <uniprot_name>UHPT_ECOLI</uniprot_name>
      <gene_name>uhpT</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AGC0.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Outer membrane protein F</name>
      <uniprot_id>P02931</uniprot_id>
      <uniprot_name>OMPF_ECOLI</uniprot_name>
      <gene_name>ompF</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P02931.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Outer membrane protein C</name>
      <uniprot_id>P06996</uniprot_id>
      <uniprot_name>OMPC_ECOLI</uniprot_name>
      <gene_name>ompC</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P06996.xml</protein_url>
    </enzyme>
  </transporters>
  <reactions>
    <reaction_text>Fructose 6-phosphate &lt;&gt; Dihydroxyacetone + D-Glyceraldehyde 3-phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN0-313</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Phosphoenolpyruvic acid + D-Fructose &gt; Fructose 6-phosphate + Pyruvic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>D-Glyceraldehyde 3-phosphate + D-Sedoheptulose 7-phosphate &lt;&gt; D-Erythrose 4-phosphate + Fructose 6-phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>TRANSALDOL-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>D-Erythrose 4-phosphate + Xylulose 5-phosphate &lt;&gt; Fructose 6-phosphate + D-Glyceraldehyde 3-phosphate</reaction_text>
    <kegg_reaction_id>R01067</kegg_reaction_id>
    <ecocyc_id>2TRANSKETO-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Adenosine triphosphate + Fructose 6-phosphate &gt; ADP + Fructose 1,6-bisphosphate + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>6PFRUCTPHOS-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Fructose 1,6-bisphosphate + Water &lt;&gt; Fructose 6-phosphate + Phosphate</reaction_text>
    <kegg_reaction_id>R00762</kegg_reaction_id>
    <ecocyc_id>F16BDEPHOS-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Adenosine triphosphate + D-Fructose &gt; ADP + Fructose 6-phosphate + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>FRUCTOKINASE-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Glucosamine 6-phosphate + Water &gt; Fructose 6-phosphate + Ammonium</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Fructose 6-phosphate + Water &gt; D-Fructose + Phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Mannose 6-phosphate &lt;&gt; Fructose 6-phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>MANNPISOM-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>NAD + Sorbitol-6-phosphate &lt;&gt; Fructose 6-phosphate + Hydrogen ion + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>MANNPDEHYDROG-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Fructose 6-phosphate + L-Glutamine &lt;&gt; Glucosamine 6-phosphate + L-Glutamate</reaction_text>
    <kegg_reaction_id>R00768</kegg_reaction_id>
    <ecocyc_id>L-GLN-FRUCT-6-P-AMINOTRANS-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Glucose 6-phosphate &lt;&gt; Fructose 6-phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>PGLUCISOM-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>D-Allulose-6-phosphate &lt;&gt; Fructose 6-phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN0-304</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Glucosamine 6-phosphate + Water &lt;&gt; Fructose 6-phosphate + Ammonia</reaction_text>
    <kegg_reaction_id>R00765</kegg_reaction_id>
    <ecocyc_id>GLUCOSAMINE-6-P-DEAMIN-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Fructose 6-phosphate + D-Glyceraldehyde 3-phosphate &lt;&gt; D-Erythrose 4-phosphate + Xylulose 5-phosphate</reaction_text>
    <kegg_reaction_id>R01067</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Fructose 1,6-bisphosphate + Water &gt; Fructose 6-phosphate + Phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>F16BDEPHOS-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Glucosamine 6-phosphate + Water &lt;&gt; Hydrogen ion + Fructose 6-phosphate + Ammonia</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>GLUCOSAMINE-6-P-DEAMIN-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Fructose 6-phosphate + L-Glutamine &gt; Glucosamine 6-phosphate + L-Glutamate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>L-GLN-FRUCT-6-P-AMINOTRANS-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>D-Allulose-6-phosphate &gt; Fructose 6-phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN0-304</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>D-fructose + Phosphoenolpyruvic acid &gt; Fructose 6-phosphate + Pyruvic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>TRANS-RXN-158A</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Fructose 1,6-bisphosphate + Water &gt; Fructose 6-phosphate + Inorganic phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Fructose 6-phosphate &gt; Dihydroxyacetone + D-Glyceraldehyde 3-phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Glucose 6-phosphate &gt; Fructose 6-phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-Glutamine + Fructose 6-phosphate &gt; L-Glutamate + D-glucosamine 6-phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Adenosine triphosphate + Fructose 6-phosphate &gt; ADP + Fructose 1,6-bisphosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Adenosine triphosphate + D-Fructose &gt; ADP + Fructose 6-phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Mannose 6-phosphate &gt; Fructose 6-phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Mannitol 1-phosphate + NAD &gt; Fructose 6-phosphate + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>D-glucosamine 6-phosphate + Water &gt; Fructose 6-phosphate + Ammonia</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Sorbitol-6-phosphate + NAD &gt; Fructose 6-phosphate + NADH</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Sedoheptulose 7-phosphate + D-Glyceraldehyde 3-phosphate &gt; D-Erythrose 4-phosphate + Fructose 6-phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Adenosine triphosphate + D-Fructose &lt;&gt; ADP + Fructose 6-phosphate</reaction_text>
    <kegg_reaction_id>R00760 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Adenosine triphosphate + Fructose 6-phosphate &lt;&gt; ADP + Fructose 1,6-bisphosphate</reaction_text>
    <kegg_reaction_id>R00756 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Sorbitol 6-phosphate + NAD &lt;&gt; Fructose 6-phosphate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R07133 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Mannitol 1-phosphate + NAD &lt;&gt; Fructose 6-phosphate + NADH + Hydrogen ion</reaction_text>
    <kegg_reaction_id>R00758 </kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>beta-D-Glucose 6-phosphate &gt; Fructose 6-phosphate + Fructose 6-phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002631</pw_reaction_id>
    <reaction_text>Fructose 6-phosphate + Phosphate + Fructose 6-phosphate &gt; Fructose 1,6-bisphosphate + Water + Fructose 1,6-bisphosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002632</pw_reaction_id>
    <reaction_text>Fructose 6-phosphate + Adenosine triphosphate + Fructose 6-phosphate &gt; Fructose 1,6-bisphosphate + Adenosine diphosphate + Hydrogen ion + Fructose 1,6-bisphosphate + ADP</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R002633</pw_reaction_id>
    <reaction_text>Fructose 6-phosphate + L-Glutamine + Fructose 6-phosphate &gt; L-Glutamic acid + Glucosamine 6-phosphate + L-Glutamate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R003565</pw_reaction_id>
    <reaction_text>Fructose 6-phosphate + NADH + Hydrogen ion + Fructose 6-phosphate &lt;&gt; NAD + Mannitol 1-phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R005148</pw_reaction_id>
    <reaction_text>D-Fructose + HPr - phosphorylated + D-Fructose &gt; HPr + Fructose 6-phosphate + Fructose 6-phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_RCT000164</pw_reaction_id>
    <reaction_text>D-Erythrose 4-phosphate + Xylulose 5-phosphate &lt;&gt; Fructose 6-phosphate + D-Glyceraldehyde 3-phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Fructose 6-phosphate + D-Glyceraldehyde 3-phosphate &lt;&gt; D-Erythrose 4-phosphate + Xylulose 5-phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Glucosamine 6-phosphate + Water &lt;&gt; Fructose 6-phosphate + Ammonia</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Fructose 1,6-bisphosphate + Water &lt;&gt; Fructose 6-phosphate + Phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Fructose 6-phosphate + L-Glutamine &lt;&gt; Glucosamine 6-phosphate + L-Glutamate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>D-Erythrose 4-phosphate + Xylulose 5-phosphate &lt;&gt; Fructose 6-phosphate + D-Glyceraldehyde 3-phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Glucosamine 6-phosphate + Water &lt;&gt; Fructose 6-phosphate + Ammonia</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Fructose 6-phosphate + L-Glutamine &lt;&gt; Glucosamine 6-phosphate + L-Glutamate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
  </reactions>
  <concentrations>
    <growth_media>0.2 g/L NH4Cl, 2.0 g/L (NH4)2SO4, 3.25 g/L KH2PO4, 2.5 g/L K2HPO4, 1.5 g/L NaH2PO4, 0.5 g/L MgSO4; trace substances: 10 mg/L CaCl2, 0.5 mg/L ZnSO4, 0.25 mg/L CuCl2, 0.25 mg/L  MnSO4, 0.175 mg/L CoCl2, 0.125 mg/L H3BO3, 2.5 mg/L AlCl3, 0.5 mg/L Na2MoO4, 10</growth_media>
    <growth_system>Bioreactor, pH controlled, aerated, dilution rate=0.125 L/h</growth_system>
    <concentration>250.0</concentration>
    <concentration_units>uM</concentration_units>
    <internal/>
    <error>19.0</error>
    <temperature>37 oC</temperature>
    <strain>K12</strain>
    <growth_status>Stationary Phase, glucose limited</growth_status>
    <molecules>1000000</molecules>
    <molecules_error>76000</molecules_error>
    <reference>
      <reference_text>Buchholz, A., Takors, R., Wandrey, C. (2001). "Quantification of intracellular metabolites in Escherichia coli K12 using liquid chromatographic-electrospray ionization tandem mass spectrometric techniques." Anal Biochem 295:129-137.</reference_text>
      <pubmed_id>11488613</pubmed_id>
    </reference>
    <growth_media>M9 Minimal Media, 4 g/L Glucose</growth_media>
    <growth_system>Bioreactor, pH controlled, O2 controlled, dilution rate: 0.2/h</growth_system>
    <concentration>290.0</concentration>
    <concentration_units>uM</concentration_units>
    <internal/>
    <error>60.0</error>
    <temperature>37 oC</temperature>
    <strain>BW25113</strain>
    <growth_status>Mid-Log Phase</growth_status>
    <molecules>1160000</molecules>
    <molecules_error>240000</molecules_error>
    <reference>
      <reference_text>Peng, L., Arauzo-Bravo, M. J., Shimizu, K. (2004). "Metabolic flux analysis for a ppc mutant Escherichia coli based on 13C-labelling experiments together with enzyme activity assays and intracellular metabolite measurements." FEMS Microbiol Lett 235:17-23.</reference_text>
      <pubmed_id>15158257</pubmed_id>
    </reference>
  </concentrations>
</compound>
