Record Information
Creation Date2012-07-30 14:37:08 -0600
Update Date2015-09-17 16:24:34 -0600
Secondary Accession Numbers
  • ECMDB21225
Name:Hydrogen ion
Description:Hydrogen ion is recommended by IUPAC as a general term for all ions of hydrogen and its isotopes. Depending on the charge of the ion, two different classes can be distinguished: positively charged ions and negatively charged ions. Under aqueous conditions found in biochemistry, hydrogen ions exist as the hydrated form hydronium, H3O+, but these are often still referred to as hydrogen ions or even protons by biochemists. (WikiPedia)
  • H
  • H(+)
  • H+
  • Hydrogen ion
  • Hydron
  • Proton
Chemical Formula:H
Weight:Average: 1.0079
Monoisotopic: 1.007825032
CAS number:Not Available
IUPAC Name:hydron
Traditional IUPAC Name:hydron
Chemical Taxonomy
DescriptionThis compound belongs to the class of inorganic compounds known as other non-metal hydrides. These are inorganic compounds in which the heaviest atom bonded to a hydrogen atom is belongs to the class of 'other non-metals'.
KingdomInorganic compounds
Super ClassHomogeneous non-metal compounds
ClassOther non-metal organides
Sub ClassOther non-metal hydrides
Direct ParentOther non-metal hydrides
Alternative ParentsNot Available
  • Other non-metal hydride
  • Acyclic compound
Molecular FrameworkAcyclic compounds
External Descriptors
Physical Properties
State:Not Available
Melting point:Not Available
Experimental Properties:
Predicted Properties
Physiological Charge0ChemAxon
Hydrogen Acceptor Count0ChemAxon
Hydrogen Donor Count0ChemAxon
Polar Surface Area0 Å2ChemAxon
Rotatable Bond Count0ChemAxon
Polarizability0.52 Å3ChemAxon
Number of Rings0ChemAxon
Rule of FiveYesChemAxon
Ghose FilterYesChemAxon
Veber's RuleYesChemAxon
MDDR-like RuleYesChemAxon
Biological Properties
Cellular Locations:Cytoplasm
ADP + Phosphate + 4 Hydrogen ion + Heme + Nickel(2+) + Iron chelate + Taurine + Molybdate + Magnesium + Fe3+ + Potassium + Polyamine + vitamin B12 + Sulfate + glycerol-3-phosphate + Phosphonate + D-Maltose <> Adenosine triphosphate +3 Hydrogen ion + Water
ADP + Phosphate + 4 Hydrogen ion + Heme + Nickel(2+) + Iron chelate + Taurine + Molybdate + Magnesium + Fe3+ + Potassium + Polyamine + vitamin B12 + Sulfate + glycerol-3-phosphate + Phosphonate + D-Maltose <> Adenosine triphosphate +3 Hydrogen ion + Water
Adenosine triphosphate + Water + Isethionic acid > ADP + Hydrogen ion + Isethionic acid + Phosphate
Coenzyme A + 2 flavodoxin semi oxidized + Pyruvic acid <> Acetyl-CoA + Carbon dioxide +2 Flavodoxin reduced + Hydrogen ion
Cytidine triphosphate + 2 Flavodoxin reduced + 2 Hydrogen ion > dCTP +2 flavodoxin semi oxidized + Water
Adenosine triphosphate + 2 Flavodoxin reduced + 2 Hydrogen ion > dATP +2 flavodoxin semi oxidized + Water
2 Flavodoxin reduced + Guanosine triphosphate + 2 Hydrogen ion > dGTP +2 flavodoxin semi oxidized + Water
2 Flavodoxin reduced + 2 Hydrogen ion + Uridine triphosphate > Deoxyuridine triphosphate +2 flavodoxin semi oxidized + Water
2 flavodoxin semi oxidized + NADPH >2 Flavodoxin reduced + Hydrogen ion + NADP
Adenosine triphosphate + Water + Potassium > ADP + Hydrogen ion + Potassium + Phosphate
Adenosine triphosphate + Water + Molybdate > ADP + Hydrogen ion + Molybdate + Phosphate
Adenosine triphosphate + Water + Putrescine > ADP + Hydrogen ion + Phosphate + Putrescine
Hydrogen ion + Menaquinol 8 + Trimethylamine N-Oxide > Water + Menaquinone 8 + Trimethylamine
Adenosine triphosphate + Water + Butanesulfonate > ADP + Butanesulfonate + Hydrogen ion + Phosphate
2 Hydrogen ion + Hydrogen (gas) + Ubiquinone-8 > Ubiquinol-8 +2 Hydrogen ion
2 Hydrogen ion + Hydrogen (gas) + Ubiquinone-8 > Ubiquinol-8 +2 Hydrogen ion
2-Demethylmenaquinone 8 + 2 Hydrogen ion + Hydrogen (gas) > 2-Demethylmenaquinol 8 +2 Hydrogen ion
2-Demethylmenaquinone 8 + 2 Hydrogen ion + Hydrogen (gas) > 2-Demethylmenaquinol 8 +2 Hydrogen ion
2 Hydrogen ion + Hydrogen (gas) + Menaquinone 8 > Menaquinol 8 +2 Hydrogen ion
2 Hydrogen ion + Hydrogen (gas) + Menaquinone 8 > Menaquinol 8 +2 Hydrogen ion
2 Hydrogen ion + Oxygen + Ubiquinol-8 > Water + Ubiquinone-8 +2 Hydrogen ion
2 Hydrogen ion + Oxygen + Ubiquinol-8 > Water + Ubiquinone-8 +2 Hydrogen ion
2-Demethylmenaquinol 8 + Hydrogen ion + Trimethylamine N-Oxide > 2-Demethylmenaquinone 8 + Water + Trimethylamine
Menaquinol 8 + Hydrogen ion + Trimethylamine N-Oxide > Menaquinone 8 + Water + Trimethylamine
Adenosine triphosphate + Water + Spermidine > ADP + Hydrogen ion + Phosphate + Spermidine
2 Hydrogen ion + Nitrate + Ubiquinol-8 > Water + Nitrite + Ubiquinone-8 +2 Hydrogen ion
2 Hydrogen ion + Nitrate + Ubiquinol-8 > Water + Nitrite + Ubiquinone-8 +2 Hydrogen ion
2 Hydrogen ion + Menaquinol 8 + Nitrate > Water + Menaquinone 8 + Nitrite +2 Hydrogen ion
2 Hydrogen ion + Menaquinol 8 + Nitrate > Water + Menaquinone 8 + Nitrite +2 Hydrogen ion
2 Hydrogen ion + Menaquinone 8 + Formic acid > Menaquinol 8 + Carbon dioxide + Hydrogen ion
2 Hydrogen ion + Menaquinone 8 + Formic acid > Menaquinol 8 + Carbon dioxide + Hydrogen ion
Adenosine triphosphate + Water + D-Alanyl-D-alanine > ADP + D-Alanyl-D-alanine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + D-Galactose > ADP + D-Galactose + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Arginine > ADP + L-Arginine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Sulfate > ADP + Hydrogen ion + Phosphate + Sulfate
Adenosine triphosphate + Water + Thiosulfate > ADP + Hydrogen ion + Phosphate + Thiosulfate
glutaredoxin + Phosphoadenosine phosphosulfate > glutaredoxin +2 Hydrogen ion + Adenosine 3',5'-diphosphate + Sulfite
Phosphoadenosine phosphosulfate + Reduced Thioredoxin >2 Hydrogen ion + Adenosine 3',5'-diphosphate + Sulfite + Oxidized Thioredoxin
2-C-Methyl-D-erythritol-2,4-cyclodiphosphate + 2 Flavodoxin reduced + Hydrogen ion >2 flavodoxin semi oxidized + 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + Water
Undecaprenyl-diphospho-N-acetylmuramoyl-(N-acetylglucosamine)-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine + two linked disacharide pentapeptide murein units (uncrosslinked, middle of chain) > Hydrogen ion + Undecaprenyl diphosphate + three linked disacharide pentapeptide murein units (uncrosslinked, middle of chain)
2 Undecaprenyl-diphospho-N-acetylmuramoyl-(N-acetylglucosamine)-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine >2 Hydrogen ion +2 Undecaprenyl diphosphate + two linked disacharide pentapeptide murein units (uncrosslinked, middle of chain)
Adenosine triphosphate + Water + L-Leucine > ADP + Hydrogen ion + L-Leucine + Phosphate
Adenosine triphosphate + Water + Nickel > ADP + Hydrogen ion + Nickel + Phosphate
2-Ketobutyric acid + Hydrogen ion + Pyruvic acid > 2-Aceto-2-hydroxy-butyrate + Carbon dioxide
Hydrogen ion + 2 Pyruvic acid > (S)-2-Acetolactate + Carbon dioxide
Hydrogen ion + NADPH + Oxidized Thioredoxin > NADP + Reduced Thioredoxin
2 Hydrogen ion + Ubiquinone-8 + Formic acid > Ubiquinol-8 + Carbon dioxide + Hydrogen ion
2 Hydrogen ion + Ubiquinone-8 + Formic acid > Ubiquinol-8 + Carbon dioxide + Hydrogen ion
Formic acid + Hydrogen ion > Carbon dioxide + Hydrogen (gas)
Adenosine triphosphate + Water + Ribose > ADP + Hydrogen ion + Phosphate + Ribose
L-Aspartic acid + Carbamoylphosphate <> Ureidosuccinic acid + Hydrogen ion + Phosphate
2 Adenosine triphosphate + L-Glutamine + Water + Hydrogen carbonate >2 ADP + Carbamoylphosphate + L-Glutamate +2 Hydrogen ion + Phosphate
1-Deoxy-D-xylulose 5-phosphate + NAD + O-Phospho-4-hydroxy-L-threonine > Carbon dioxide + Hydrogen ion +2 Water + NADH + Pyridoxine 5'-phosphate + Phosphate
Adenosine triphosphate + D-Xylulose <> ADP + Hydrogen ion + Xylulose 5-phosphate
Adenosine triphosphate + L-Threo-2-pentulose <> ADP + Hydrogen ion + L-Xylulose 5-phosphate
Adenosine triphosphate + Water + Thiamine > ADP + Hydrogen ion + Phosphate + Thiamine
Dihydroneopterin triphosphate + Water > Dihydroneopterin monophosphate + Hydrogen ion + Pyrophosphate
Guanosine triphosphate + Water > Guanosine monophosphate + Hydrogen ion + Pyrophosphate
dGTP + Water > 2'-Deoxyguanosine 5'-monophosphate + Hydrogen ion + Pyrophosphate
Ubiquinone-8 + D-Glucose + Water > Ubiquinol-8 + Gluconic acid + Hydrogen ion
Carbon dioxide + Water <> Hydrogen ion + Hydrogen carbonate
Adenosine triphosphate + Water + Ferric coprogen > ADP + Ferric coprogen + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Aerobactin > ADP + Aerobactin + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Fe(III)hydroxamate > ADP + Fe(III)hydroxamate + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Ferrichrome > ADP + Ferrichrome + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Ferroxamine > ADP + Ferroxamine + Hydrogen ion + Phosphate
Acetyl-CoA + Adenosine triphosphate + Hydrogen carbonate <> ADP + Hydrogen ion + Malonyl-CoA + Phosphate
Hydrogen ion + L-Lysine <> Cadaverine + Carbon dioxide
Adenosine triphosphate + Water + L-Methionine > ADP + Hydrogen ion + L-Methionine + Phosphate
Adenosine triphosphate + Water + D-Methionine > ADP + Hydrogen ion + D-Methionine + Phosphate
2,5-Diketo-D-gluconate + Hydrogen ion + NADPH >2 -Dehydro-L-gulonate + NADP
Acetaldehyde + Coenzyme A + NAD <> Acetyl-CoA + Hydrogen ion + NADH
Adenosine triphosphate + Water + Taurine > ADP + Hydrogen ion + Phosphate + Taurine
2 D-Alanine + Adenosine triphosphate <> ADP + D-Alanyl-D-alanine + Hydrogen ion + Phosphate
2-Dehydropantoate + Hydrogen ion + NADPH <> NADP + (R)-Pantoate
4 Hydrogen ion + Oxygen + Ubiquinol-8 > Water + Ubiquinone-8 +4 Hydrogen ion
4 Hydrogen ion + Oxygen + Ubiquinol-8 > Water + Ubiquinone-8 +4 Hydrogen ion
2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate + Water > 4-Amino-2-methyl-5-phosphomethylpyrimidine + Hydrogen ion + Phosphate
Tartronate semialdehyde + Hydrogen ion + NADH <> Glyceric acid + NAD
Adenosine triphosphate + Carbon dioxide + Ammonium <> ADP + Carbamoylphosphate +2 Hydrogen ion
Adenosine triphosphate + Water + Ferric enterobactin > ADP + Ferric enterobactin + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + ferric 2,3-dihydroxybenzoylserine > ADP + ferric 2,3-dihydroxybenzoylserine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water > ADP + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Glutamate > ADP + L-Glutamate + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Aspartic acid > ADP + L-Aspartic acid + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Tungstate > ADP + Hydrogen ion + Phosphate + Tungstate
Cyclic pyranopterin monophosphate + Copper + 2 MoaD Protein with thiocarboxylate >5 Hydrogen ion +2 MoaD Protein with carboxylate + Molybdopterin
Adenosine triphosphate + Water + L-Glutamine > ADP + L-Glutamine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glutathione > ADP + Glutathione + Hydrogen ion + Phosphate
Water + Undecaprenyl diphosphate > Hydrogen ion + Phosphate + Undecaprenyl phosphate
Adenosine triphosphate + Glutathione + Water > ADP + Hydrogen ion + Phosphate + Glutathione
Adenosine triphosphate + L-Cysteine + Water > ADP + Hydrogen ion + Phosphate + L-Cysteine
2-Demethylmenaquinol 8 + Hydrogen ion + Trimethylamine N-Oxide > 2-Demethylmenaquinone 8 + Water + Trimethylamine
Adenosine triphosphate + Water + Ethanesulfonate > ADP + Ethanesulfonate + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Methanesulfonate > ADP + Hydrogen ion + Methanesulfonate + Phosphate
Adenosine triphosphate + Water + Sulfoacetate > ADP + Hydrogen ion + Phosphate + Sulfoacetate
Flavin Mononucleotide + Hydrogen ion + NADH > FMNH + NAD
2 Hydrogen ion + Menaquinol 8 + Oxygen > Water + Menaquinone 8 +2 Hydrogen ion
2 Hydrogen ion + Menaquinol 8 + Oxygen > Water + Menaquinone 8 +2 Hydrogen ion
Hydrogen ion + Malonic semialdehyde + NADPH > 3-Hydroxypropanoate + NADP
Hydrogen ion + NADH + Oxygen + Uracil > NAD + Ureidoacrylate peracid
Glyoxylic acid + Hydrogen ion + NADPH + Glycolate <> Glycolic acid + NADP
Hydrogen ion + Hydroxypyruvic acid + NADH > Glyceric acid + NAD
Hydrogen ion + Hydroxypyruvic acid + NADPH > Glyceric acid + NADP
Dodecanoyl-ACP (n-C12:0ACP) + Hydrogen ion + Phosphate > acyl carrier protein + Dodecanoly-phosphate (n-C12:0)
Hydrogen ion + cis-hexadec-9-enoyl-[acyl-carrier protein] (n-C16:1) + Phosphate > acyl carrier protein + Hexadecanoyl-phosphate (n-C16:1)
Hydrogen ion + cis-octadec-11-enoyl-[acyl-carrier protein] (n-C18:1) + Phosphate > acyl carrier protein + Octadecanoyl-phosphate (n-C18:1)
Hydrogen ion + Phosphate + cis-tetradec-7-enoyl-[acyl-carrier protein] (n-C14:1) > acyl carrier protein + Tetradecanoyl-phosphate (n-C14:1)
Hydrogen ion + Myristoyl-ACP (n-C14:0ACP) + Phosphate > acyl carrier protein + Tetradecanoyl-phosphate (n-C14:0)
Hydrogen ion + Octadecanoyl-ACP (n-C18:0ACP) + Phosphate > acyl carrier protein + Octadecanoyl-phosphate (n-C18:0)
Hydrogen ion + Palmitoyl-ACP (n-C16:0ACP) + Phosphate > acyl carrier protein + Hexadecanoyl-phosphate (n-C16:0)
Butyryl-ACP (n-C4:0ACP) + Hydrogen ion + Malonyl-[acyl-carrier protein] >3 -Oxohexanoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
Decanoyl-ACP (n-C10:0ACP) + Hydrogen ion + Malonyl-[acyl-carrier protein] >3 -Oxododecanoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
Hydrogen ion + Malonyl-[acyl-carrier protein] + Palmitoyl-ACP (n-C16:0ACP) >3 -Oxooctadecanoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
Adenosine triphosphate + Water + L-Alanine-D-glutamate-meso-2,6-diaminoheptanedioate-D-alanine > L-Alanine-D-glutamate-meso-2,6-diaminoheptanedioate-D-alanine + ADP + Hydrogen ion + Phosphate
Chorismate + L-Glutamine <> 2-Aminobenzoic acid + L-Glutamate + Hydrogen ion + Pyruvic acid
Water + Undecaprenyl diphosphate > Hydrogen ion + Phosphate + Undecaprenyl phosphate
Adenosine triphosphate + Water + L-alanine-D-glutamate-meso-2,6-diaminoheptanedioate > L-alanine-D-glutamate-meso-2,6-diaminoheptanedioate + ADP + Hydrogen ion + Phosphate
Hydrogen ion + NADPH + Oxygen + Phenylacetyl-CoA > Water + NADP + Ring 1,2-epoxyphenylacetyl-CoA
Ethanol + NAD <> Acetaldehyde + Hydrogen ion + NADH
NADH + NADP + 2 Hydrogen ion >2 Hydrogen ion + NAD + NADPH
NADH + NADP + 2 Hydrogen ion >2 Hydrogen ion + NAD + NADPH
Dihydrofolic acid + Hydrogen ion + NADPH <> NADP + Tetrahydrofolic acid
Adenosine triphosphate + Pyridoxal <> ADP + Hydrogen ion + Pyridoxal 5'-phosphate
[2Fe-1S] desulfurated iron-sulfur cluster + Adenosine triphosphate + Water + SufBCD scaffold complex + SufSE with bound sulfur > ADP +5 Hydrogen ion + Phosphate + SufBCD with bound [2Fe-2S] cluster + SufSE sulfur acceptor complex
FADH2 + 2 Hydrogen ion + SufBCD with two bound [2Fe-2S] clusters > FAD + SufBCD with bound [4Fe-4S] cluster
4 Hydrogen ion + SufBCD with bound [2Fe-2S] cluster > [2Fe-2S] iron-sulfur cluster + SufBCD scaffold complex
4 Hydrogen ion + SufBCD with bound [4Fe-4S] cluster > [4Fe-4S] iron-sulfur cluster + SufBCD scaffold complex
3-Dehydro-shikimate + Hydrogen ion + NADPH <> NADP + Shikimic acid
Adenosine triphosphate + Coenzyme A + Dodecanoate (N-C12:0) + Hydrogen ion > Adenosine monophosphate + Lauroyl-CoA + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Dodecanoate (N-C12:0) + Hydrogen ion > Adenosine monophosphate + Lauroyl-CoA + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Palmitic acid > Adenosine monophosphate + Hydrogen ion + Palmityl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Palmitic acid > Adenosine monophosphate + Hydrogen ion + Palmityl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Octadecanoate (N-C18:0) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + Stearoyl-CoA
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Octadecanoate (N-C18:0) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + Stearoyl-CoA
Adenosine triphosphate + Coenzyme A + Hydrogen ion + tetradecanoate (n-C14:0) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + Tetradecanoyl-CoA
Adenosine triphosphate + Coenzyme A + Hydrogen ion + tetradecanoate (n-C14:0) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + Tetradecanoyl-CoA
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Tetradecenoate (N-C14:1) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + (2E)-Tetradecenoyl-CoA
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Tetradecenoate (N-C14:1) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + (2E)-Tetradecenoyl-CoA
Adenosine triphosphate + Water + Adenosylcobalamin > Adenosylcobalamin + ADP + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Cob(I)alamin > ADP + Cob(I)alamin + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Cobinamide > ADP + Cobinamide + Hydrogen ion + Phosphate
Cytidine triphosphate + Water > Cytidine monophosphate + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Decanoate (N-C10:0) + Hydrogen ion > Adenosine monophosphate + Decanoyl-CoA (N-C10:0CoA) + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Decanoate (N-C10:0) + Hydrogen ion > Adenosine monophosphate + Decanoyl-CoA (N-C10:0CoA) + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Caprylic acid > Adenosine monophosphate + Hydrogen ion + Octanoyl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Caprylic acid > Adenosine monophosphate + Hydrogen ion + Octanoyl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Hexadecenoate (n-C16:1) > Adenosine monophosphate + Hydrogen ion + (2E)-Hexadecenoyl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Hexadecenoate (n-C16:1) > Adenosine monophosphate + Hydrogen ion + (2E)-Hexadecenoyl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Hexanoate (N-C6:0) > Adenosine monophosphate + Hydrogen ion + Hexanoyl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Hexanoate (N-C6:0) > Adenosine monophosphate + Hydrogen ion + Hexanoyl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Octadecenoate (N-C18:1) > Adenosine monophosphate + Hydrogen ion + Octadecenoyl-CoA (N-C18:1CoA) + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Octadecenoate (N-C18:1) > Adenosine monophosphate + Hydrogen ion + Octadecenoyl-CoA (N-C18:1CoA) + Pyrophosphate
ADP + Hydrogen ion + Phosphoenolpyruvic acid <> Adenosine triphosphate + Pyruvic acid
Adenosine triphosphate + Water + Zinc > ADP + Hydrogen ion + Phosphate + Zinc
Adenosine triphosphate + Water + L-Arabinose > ADP + L-Arabinose + Hydrogen ion + Phosphate
L-Glutamine + Phosphoribulosylformimino-AICAR-P > Phosphoribosyl formamidocarboxamide + D-Erythro-imidazole-glycerol-phosphate + L-Glutamate + Hydrogen ion
(O16 antigen)x2 undecaprenyl diphosphate + O16 antigen undecaprenyl diphosphate > Hydrogen ion + (O16 antigen)x3 undecaprenyl diphosphate + Undecaprenyl diphosphate
(O16 antigen)x3 undecaprenyl diphosphate + O16 antigen undecaprenyl diphosphate > Hydrogen ion + (O16 antigen)x4 undecaprenyl diphosphate + Undecaprenyl diphosphate
2 O16 antigen undecaprenyl diphosphate > Hydrogen ion + (O16 antigen)x2 undecaprenyl diphosphate + Undecaprenyl diphosphate
Thymidine 5'-triphosphate + Glucose 1-phosphate + Hydrogen ion <> dTDP-D-Glucose + Pyrophosphate
Adenosine triphosphate + D-Galactose + Alpha-D-Galactose <> ADP + Galactose 1-phosphate + Hydrogen ion
4-Amino-5-hydroxymethyl-2-methylpyrimidine + Adenosine triphosphate <> 4-Amino-2-methyl-5-phosphomethylpyrimidine + ADP + Hydrogen ion + 4-amino-5-phosphonooxymethyl-2-methylpyrimidine
Adenosine triphosphate + Water + Choline > ADP + Choline + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Betaine > ADP + Betaine + Hydrogen ion + Phosphate
D-Lactic acid + NAD <> Hydrogen ion + NADH + Pyruvic acid
Dihydrouracil + NAD <> Hydrogen ion + NADH + Uracil
Adenosine triphosphate + Water + D-Glucose > ADP + D-Glucose + Hydrogen ion + Phosphate
S-Formylglutathione + Water <> Formic acid + Glutathione + Hydrogen ion
Adenosine triphosphate + Water + Heme > ADP + Hydrogen ion + Phosphate + Heme
2-Demethylmenaquinone 8 + 4 Hydrogen ion + NADH > 2-Demethylmenaquinol 8 + NAD +3 Hydrogen ion
2-Demethylmenaquinone 8 + 4 Hydrogen ion + NADH > 2-Demethylmenaquinol 8 + NAD +3 Hydrogen ion
4 Hydrogen ion + NADH + Ubiquinone-8 > NAD + Ubiquinol-8 +3 Hydrogen ion
4 Hydrogen ion + NADH + Ubiquinone-8 > NAD + Ubiquinol-8 +3 Hydrogen ion
4 Hydrogen ion + Menaquinone 8 + NADH > Menaquinol 8 + NAD +3 Hydrogen ion
4 Hydrogen ion + Menaquinone 8 + NADH > Menaquinol 8 + NAD +3 Hydrogen ion
Adenosine triphosphate + Water + L-Histidine > ADP + Hydrogen ion + L-Histidine + Phosphate
Adenosine triphosphate + Water + L-Lysine > ADP + Hydrogen ion + L-Lysine + Phosphate
Adenosine triphosphate + Water + Ornithine > ADP + Hydrogen ion + Ornithine + Phosphate
Acetyl-ACP + Hydrogen ion + Malonyl-[acyl-carrier protein] > acyl carrier protein + Acetoacetyl-ACP + Carbon dioxide
Dodecanoyl-ACP (n-C12:0ACP) + Hydrogen ion + Malonyl-[acyl-carrier protein] >3 -Oxotetradecanoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
Hydrogen ion + Hexanoyl-ACP (n-C6:0ACP) + Malonyl-[acyl-carrier protein] >3 -Oxooctanoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
Hydrogen ion + Malonyl-[acyl-carrier protein] + Myristoyl-ACP (n-C14:0ACP) >3 -Oxohexadecanoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
Hydrogen ion + Malonyl-[acyl-carrier protein] + Octanoyl-ACP (n-C8:0ACP) >3 -Oxodecanoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
O-Acetylserine + Hydrogen sulfide <> Acetic acid + L-Cysteine + Hydrogen ion
Water + Triphosphate > Hydrogen ion + Phosphate + Pyrophosphate
4 Hydrogen ion + IscU with bound [2Fe-2S] cluster > [2Fe-2S] iron-sulfur cluster + IscU scaffold protein
4 Hydrogen ion + IscU with bound [4Fe-4S] cluster > [4Fe-4S] iron-sulfur cluster + IscU scaffold protein
[2Fe-1S] desulfurated iron-sulfur cluster + IscS with bound sulfur + IscU scaffold protein >4 Hydrogen ion + IscS sulfur acceptor protein + IscU with bound [2Fe-2S] cluster
Adenosine triphosphate + Dehydroglycine + 1-Deoxy-D-xylulose 5-phosphate + Hydrogen ion + IscS with bound sulfur + NADPH > 4-Methyl-5-(2-phosphoethyl)-thiazole + Adenosine monophosphate + Carbon dioxide +2 Water + IscS sulfur acceptor protein + NADP + Pyrophosphate
trans-Cinnamic acid + Hydrogen ion + NADH + Oxygen > cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD
Hydrogen ion + NADH + Oxygen + Hydrocinnamic acid > Cis-3-(3-carboxyethyl)-3,5-cyclohexadiene-1,2-diol + NAD
Water + NADP + Succinic acid semialdehyde >2 Hydrogen ion + NADPH + Succinic acid
Adenosine triphosphate + Water + Carnitine > ADP + Carnitine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Proline > ADP + Hydrogen ion + Phosphate + L-Proline
Adenosine triphosphate + Water + Carnitine > ADP + Carnitine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Crotonobetaine > ADP + Crotonobetaine + Hydrogen ion + Phosphate
Hydrogen ion + NADH + 2 Nitric oxide > Water + Nitrous oxide + NAD
Water + Pyrophosphate > Hydrogen ion +2 Phosphate
FAD + Hydrogen ion + NADPH > FADH2 + NADP
5 Hydrogen ion + 3 NADPH + Sulfite <>3 Water + Hydrogen sulfide +3 NADP
dATP + Water > Deoxyadenosine monophosphate + Hydrogen ion + Pyrophosphate
dCTP + Water > dCMP + Hydrogen ion + Pyrophosphate
Thymidine 5'-triphosphate + Water > 5-Thymidylic acid + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Guanosine diphosphate > Adenosine monophosphate + Hydrogen ion + Guanosine 3',5'-bis(diphosphate)
Water + Hypoxanthine + NAD > Hydrogen ion + NADH + Xanthine
Water + NAD + Xanthine <> Hydrogen ion + NADH + Uric acid
D-Erythrose 4-phosphate + Water + NAD <> 4-Phospho-D-erythronate +2 Hydrogen ion + NADH
Hydrogen ion + Ornithine + L-Ornithine <> Carbon dioxide + Putrescine + Ethylenediamine
Hydrogen ion + Pyruvaldehyde + NADPH > Acetol + NADP
Adenosine triphosphate + Water + (enterobacterial common antigen)x4 core oligosaccharide lipid A > ADP + Hydrogen ion + Phosphate + (enterobacterial common antigen)x4 core oligosaccharide lipid A
Adenosine triphosphate + Water + (O16 antigen)x4 core oligosaccharide lipid A > ADP + Hydrogen ion + Phosphate + (O16 antigen)x4 core oligosaccharide lipid A
Adenosine triphosphate + Water + cold adapted KDO(2)-lipid (A) > ADP + Hydrogen ion + Phosphate + cold adapted KDO(2)-lipid (A)
Adenosine triphosphate + Water + core oligosaccharide lipid A > ADP + Hydrogen ion + Phosphate + core oligosaccharide lipid A
Adenosine triphosphate + Water + core oligosaccharide lipid A diphosphate > ADP + Hydrogen ion + Phosphate + core oligosaccharide lipid A diphosphate
Adenosine triphosphate + Water + KDO2-Lipid A > ADP + Hydrogen ion + Phosphate + KDO2-Lipid A
Adenosine triphosphate + Water + 4-Amino-4-deoxy-L-arabinose modified core oligosaccharide lipid A > ADP + Hydrogen ion + Phosphate + 4-Amino-4-deoxy-L-arabinose modified core oligosaccharide lipid A
Adenosine triphosphate + Water + KDO(2)-lipid IV(A) > ADP + Hydrogen ion + Phosphate + KDO(2)-lipid IV(A)
Adenosine triphosphate + Water + Phosphoethanolamine KDO(2)-lipid (A) > ADP + Hydrogen ion + Phosphate + Phosphoethanolamine KDO(2)-lipid (A)
alpha-Ketoglutarate + L-Glutamine + Hydrogen ion + NADPH >2 L-Glutamate + NADP
5 Hydrogen ion + 3 NADH + Nitrite >2 Water +3 NAD + Ammonium
Adenosine triphosphate + Shikimic acid <> ADP + Hydrogen ion + Shikimate 3-phosphate
Adenosine diphosphate ribose + Water <> Adenosine monophosphate +2 Hydrogen ion + D-Ribose-5-phosphate
Adenosine triphosphate + Water + Glycerophosphocholine > ADP + Glycerophosphocholine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glycerylphosphorylethanolamine > ADP + Glycerylphosphorylethanolamine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glycerol 3-phosphate > ADP + Glycerol 3-phosphate + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glycerol 2-phosphate > ADP + Glycerol 2-phosphate + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glycerophosphoglycerol > ADP + Glycerophosphoglycerol + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glycerophosphoserine > ADP + Glycerophosphoserine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Sn-Glycero-3-phospho-1-inositol > ADP + Sn-Glycero-3-phospho-1-inositol + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Alanine > ADP + L-Alanine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Threonine > ADP + Hydrogen ion + Phosphate + L-Threonine
Adenosine triphosphate + Water + L-Isoleucine > ADP + Hydrogen ion + L-Isoleucine + Phosphate
Adenosine triphosphate + Water + L-Valine > ADP + Hydrogen ion + Phosphate + L-Valine
apoprotein [acyl carrier protein] + Coenzyme A > acyl carrier protein + Hydrogen ion + Adenosine 3',5'-diphosphate
L-Glutamate + Hydrogen ion <> gamma-Aminobutyric acid + Carbon dioxide
Adenosine triphosphate + Water + Cysteinylglycine > ADP + Cysteinylglycine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Prolinylglycine > ADP + Hydrogen ion + Phosphate + L-Prolinylglycine
Glyoxylic acid + Hydrogen ion + NADH > Glycolic acid + NAD
Adenosine triphosphate + Water + D-Xylose > ADP + Hydrogen ion + Phosphate + D-Xylose
Deoxyuridine triphosphate + Water <> dUMP + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Water + Phosphate > ADP + Hydrogen ion +2 Phosphate
(enterobacterial common antigen)x2 undecaprenyl-diphosphate + Undecaprenyl-diphospho N-acetylglucosamine-N-acetylmannosaminuronate-N-acetamido-4,6-dideoxy-D-galactose > (enterobacterial common antigen)x3 undecaprenyl-diphosphate + Hydrogen ion + Undecaprenyl diphosphate
(enterobacterial common antigen)x3 undecaprenyl-diphosphate + Undecaprenyl-diphospho N-acetylglucosamine-N-acetylmannosaminuronate-N-acetamido-4,6-dideoxy-D-galactose > (enterobacterial common antigen)x4 undecaprenyl-diphosphate + Hydrogen ion + Undecaprenyl diphosphate
2 Undecaprenyl-diphospho N-acetylglucosamine-N-acetylmannosaminuronate-N-acetamido-4,6-dideoxy-D-galactose > (enterobacterial common antigen)x2 undecaprenyl-diphosphate + Hydrogen ion + Undecaprenyl diphosphate
2 S-Adenosylmethionine + Uroporphyrinogen III >2 S-Adenosylhomocysteine + Precorrin 2 + Hydrogen ion
Adenosine triphosphate + FADH2 + 2 Iron + Water + SufBCD scaffold complex + 2 SufSE with bound sulfur > ADP + FAD +7 Hydrogen ion + Phosphate + SufBCD with bound [2Fe-2S] cluster +2 SufSE sulfur acceptor complex
Adenosine triphosphate + FADH2 + 2 Iron + Water + SufBCD with bound [2Fe-2S] cluster + 2 SufSE with bound sulfur > ADP + FAD +7 Hydrogen ion + Phosphate + SufBCD with two bound [2Fe-2S] clusters +2 SufSE sulfur acceptor complex
FADH2 + 2 Iron + 2 IscS with bound sulfur + IscU scaffold protein > FAD +6 Hydrogen ion +2 IscS sulfur acceptor protein + IscU with bound [2Fe-2S] cluster
FADH2 + 2 Iron + 2 IscS with bound sulfur + IscU with bound [2Fe-2S] cluster > FAD +6 Hydrogen ion +2 IscS sulfur acceptor protein + IscU with two bound [2Fe-2S] clusters
3-Octaprenyl-4-hydroxybenzoate + Hydrogen ion > 2-Octaprenylphenol + Carbon dioxide
Hydrogen ion + NADPH + Riboflavin > NADP + Reduced riboflavin
Flavin Mononucleotide + Hydrogen ion + NADPH <> FMNH + NADP
Acetoacetyl-CoA + Hydrogen ion + NADH <> 3-Hydroxybutyryl-CoA + NAD
3-Oxotetradecanoyl-CoA + Hydrogen ion + NADH <> (S)-3-Hydroxytetradecanoyl-CoA + NAD
3-Oxododecanoyl-CoA + Hydrogen ion + NADH <> (S)-3-Hydroxydodecanoyl-CoA + NAD
3-Oxodecanoyl-CoA + Hydrogen ion + NADH <> (S)-Hydroxydecanoyl-CoA + NAD
3-Oxooctanoyl-CoA + Hydrogen ion + NADH <> (S)-Hydroxyoctanoyl-CoA + NAD
3-Oxohexanoyl-CoA + Hydrogen ion + NADH <> (S)-Hydroxyhexanoyl-CoA + NAD
3-Oxohexadecanoyl-CoA + Hydrogen ion + NADH <> (S)-3-Hydroxyhexadecanoyl-CoA + NAD
3-Oxooctadecanoyl-CoA + Hydrogen ion + NADH <> (S)-3-Hydroxyoctadecanoyl-CoA + NAD
bis-molybdenum cofactor + Guanosine triphosphate + Hydrogen ion > bis-molybdopterin mono-guanine dinucleotide + Pyrophosphate
Guanosine triphosphate + Hydrogen ion + Molybdopterin > Molybdopterin guanine dinucleotide + Pyrophosphate
bis-molybdopterin mono-guanine dinucleotide + Guanosine triphosphate + Hydrogen ion > Bis-molybdopterin guanine dinucleotide + Pyrophosphate
tungsten bispterin cofactor + Guanosine triphosphate + Hydrogen ion > tungsten bispterin cofactor mono-guanine dinucleotide + Pyrophosphate
tungsten bispterin cofactor mono-guanine dinucleotide + Guanosine triphosphate + Hydrogen ion > tungsten bispterin cofactor guanine dinucleotide + Pyrophosphate
Adenosine triphosphate + L-Glutamate + Ammonium > ADP + L-Glutamine + Hydrogen ion + Phosphate
2 Hydrogen ion + 2 Superoxide anion > Hydrogen peroxide + Oxygen
Adenosine triphosphate + Fructose 6-phosphate > ADP + Fructose 1,6-bisphosphate + Hydrogen ion
L-Homoserine + NADP <> L-Aspartate-semialdehyde + Hydrogen ion + NADPH
Water + NAD <> Adenosine monophosphate +2 Hydrogen ion + Nicotinamide ribotide + NMN
Acetyl-CoA + Glyoxylic acid + Water <> Coenzyme A + Hydrogen ion + L-Malic acid
5-Methyltetrahydrofolic acid + L-Homocysteine <> Hydrogen ion + L-Methionine + Tetrahydrofolic acid
Adenosine triphosphate + Water + D-Maltose > ADP + Hydrogen ion + D-Maltose + Phosphate
Adenosine triphosphate + Water + Maltotriose > ADP + Hydrogen ion + Maltotriose + Phosphate
Adenosine triphosphate + Water + Maltotetraose > ADP + Hydrogen ion + Maltotetraose + Phosphate
Adenosine triphosphate + Water + 1,4-alpha-D-glucan > 1,4-alpha-D-glucan + ADP + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Maltohexaose > ADP + Hydrogen ion + Maltohexaose + Phosphate
Adenosine triphosphate + Water + Maltopentaose > ADP + Hydrogen ion + Maltopentaose + Phosphate
3 Ubiquinol-8 + 2 Hydrogen ion + Nitrite >3 Ubiquinone-8 +2 Water + Ammonium
3 Menaquinol 8 + 2 Hydrogen ion + Nitrite >3 Menaquinone 8 +2 Water + Ammonium
Adenosine triphosphate + Water + D-Allose > ADP + D-Allose + Hydrogen ion + Phosphate
Water + Inosine triphosphate > Hydrogen ion + IDP + Phosphate
3-Dehydro-L-gulonate 6-phosphate + Hydrogen ion <> Carbon dioxide + L-Xylulose 5-phosphate
Carbamoylphosphate + Ornithine + L-Ornithine <> Citrulline + Hydrogen ion + Phosphate
Adenosine triphosphate + Gluconic acid <> 6-Phosphogluconic acid + ADP + Hydrogen ion
Adenosine triphosphate + Water + Fe(III)dicitrate > ADP +2 Citric acid + Fe3+ + Hydrogen ion + Phosphate
Adenosine triphosphate + Hydrogen ion + Nicotinamide ribotide + NMN <> NAD + Pyrophosphate
Adenosine triphosphate + L-Homoserine <> ADP + Hydrogen ion + O-Phosphohomoserine
Adenosine triphosphate + Hydrogen ion + Molybdopterin <> Adenylated molybdopterin + Pyrophosphate
Adenosine triphosphate + Riboflavin <> ADP + Flavin Mononucleotide + Hydrogen ion
Adenosine triphosphate + Flavin Mononucleotide + Hydrogen ion > FAD + Pyrophosphate
Hydrogen ion + 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH > Water + Isopentenyl pyrophosphate + NAD
Hydrogen ion + 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH > Dimethylallylpyrophosphate + Water + NAD
2,3-Dihydrodipicolinic acid + Hydrogen ion + NADPH > NADP + Tetrahydrodipicolinate
Diadenosine tetraphosphate + Water <>2 ADP +2 Hydrogen ion
Diadenosine pentaphosphate + Water > ADP + Adenosine triphosphate +2 Hydrogen ion
P1,P4-Bis(5'-guanosyl) tetraphosphate + Water >2 Guanosine diphosphate +2 Hydrogen ion
Adenosine triphosphate + L-Ribulose > ADP + Hydrogen ion + L-Ribulose 5-phosphate
3-Isopropylmalate + NAD > 2-Isopropyl-3-oxosuccinate + Hydrogen ion + NADH
alpha-Ketoisovaleric acid + Acetyl-CoA + Water + a-Ketoisovaleric acid <> 2-Isopropylmalic acid + Coenzyme A + Hydrogen ion
Diaminopimelic acid + Adenosine triphosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamate > ADP + Hydrogen ion + Phosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate
D-Alanyl-D-alanine + Adenosine triphosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate > ADP + Hydrogen ion + Phosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-6-carboxy-L-lysyl-D-alanyl-D-alanine
Adenosine triphosphate + D-Glutamic acid + UDP-N-Acetylmuramoyl-L-alanine <> ADP + Hydrogen ion + Phosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamate
Uridine diphosphate-N-acetylglucosamine + Undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine > Hydrogen ion + Undecaprenyl-diphospho-N-acetylmuramoyl-(N-acetylglucosamine)-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine + Uridine 5'-diphosphate
L-Alanine + Adenosine triphosphate + UDP-N-Acetylmuraminate <> ADP + Hydrogen ion + Phosphate + UDP-N-Acetylmuramoyl-L-alanine
Adenosine triphosphate + Dephospho-CoA <> ADP + Coenzyme A + Hydrogen ion
Guanosine monophosphate + 2 Hydrogen ion + NADPH > Inosinic acid + NADP + Ammonium
2 Hydrogen ion + Phosphoribosyl pyrophosphate + Quinolinic acid <> Carbon dioxide + Nicotinamide ribotide + Pyrophosphate
S-Adenosylmethionine + Hydrogen ion <> S-Adenosylmethioninamine + Carbon dioxide
S-Adenosylmethioninamine + Putrescine + Ethylenediamine <> 5'-Methylthioadenosine + Hydrogen ion + Spermidine
Cadaverine + S-Adenosylmethioninamine > 5'-Methylthioadenosine + Hydrogen ion + Aminopropylcadaverine
4 Copper + 4 Hydrogen ion + Oxygen >4 Copper +2 Water
4 Iron + 4 Hydrogen ion + Oxygen >4 Fe3+ +2 Water
L-Aspartic acid + Hydrogen ion <> beta-Alanine + Carbon dioxide
beta-Alanine + Adenosine triphosphate + (R)-Pantoate <> Adenosine monophosphate + Hydrogen ion + Pantothenic acid + Pyrophosphate
6-Hydroxymethyl dihydropterin + Adenosine triphosphate > 6-Hydroxymethyl-dihydropterin pyrophosphate + Adenosine monophosphate + Hydrogen ion
1-Deoxy-D-xylulose 5-phosphate + Hydrogen ion + NADPH <> 2-C-Methyl-D-erythritol-4-phosphate + NADP
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-didodecanoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-dihexadec-9-enoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-dihexadecanoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-dioctadec-11-enoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-Dioctadecanoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-ditetradec-7-enoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-ditetradecanoylglycerol + Pyrophosphate
(R)-3-Hydroxytetradecanoyl-[acyl-carrier protein] + UDP-3-O-(3-Hydroxytetradecanoyl)-D-glucosamine > acyl carrier protein + Hydrogen ion + UDP-2,3-Bis(3-hydroxytetradecanoyl)glucosamine
2,3-Bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl 1-phosphate + UDP-2,3-Bis(3-hydroxytetradecanoyl)glucosamine <> Hydrogen ion + 2,3,2',3'-Tetrakis(3-hydroxytetradecanoyl)-D-glucosaminyl-1,6-beta-D-glucosamine 1-phosphate + Uridine 5'-diphosphate
Water + S-Lactoylglutathione > Glutathione + Hydrogen ion + D-Lactic acid
L-Glutamic acid 5-phosphate + Hydrogen ion + NADPH > L-Glutamic-gamma-semialdehyde + NADP + Phosphate
L-Homocysteine + S-Methylmethionine > Hydrogen ion +2 L-Methionine
S-Adenosylmethionine + L-Homocysteine + S-Methylmethionine <> S-Adenosylhomocysteine + Hydrogen ion + L-Methionine
Choline + NAD > Betaine aldehyde + Hydrogen ion + NADH
Betaine aldehyde + Water + NADP > Betaine +2 Hydrogen ion + NADPH
Betaine aldehyde + Water + NAD <> Betaine +2 Hydrogen ion + NADH
Water + Oxalacetic acid + Propionyl-CoA <> Methylcitric acid + Coenzyme A + Hydrogen ion + (2S,3S)-2-hydroxybutane-1,2,3-tricarboxylate
Cytosine + Hydrogen ion + Water > Ammonium + Uracil
Cyanate + 3 Hydrogen ion + Hydrogen carbonate >2 Carbon dioxide + Ammonium
3-(3-Hydroxyphenyl)propanoic acid + Hydrogen ion + NADH + Oxygen > 3-(2,3-Dihydroxyphenyl)propionic acid + Water + NAD
3-Hydroxycinnamic acid + Hydrogen ion + NADH + Oxygen > Trans-2,3-Dihydroxycinnamate + Water + NAD
3-(2,3-Dihydroxyphenyl)propionic acid + Oxygen > Hydrogen ion + 2-Hydroxy-6-ketononadienedicarboxylate
Trans-2,3-Dihydroxycinnamate + Oxygen > Hydrogen ion + 2-Hydroxy-6-ketononatrienedioate
Water + 2-Hydroxy-6-ketononadienedicarboxylate > Hydrogen ion + 2-Hydroxy-2,4-pentadienoate + Succinic acid
Water + 2-Hydroxy-6-ketononatrienedioate > Fumaric acid + Hydrogen ion + 2-Hydroxy-2,4-pentadienoate
D-Glyceraldehyde + Hydrogen ion + NADH <> Glycerol + NAD
S-(Hydroxymethyl)glutathione + NAD <> S-Formylglutathione + Hydrogen ion + NADH
alpha-Ketoglutarate + Oxygen + Taurine <> Aminoacetaldehyde + Carbon dioxide + Hydrogen ion + Sulfite + Succinic acid
2 5-Aminolevulinic acid <> Hydrogen ion +2 Water + Porphobilinogen
L-D-1-Pyrroline-5-carboxylic acid + 2 Hydrogen ion + NADPH > NADP + L-Proline
Adenosine triphosphate + D-Fructose > ADP + Fructose 6-phosphate + Hydrogen ion
Decanoyl-ACP (n-C10:0ACP) + Water > acyl carrier protein + Decanoate (N-C10:0) + Hydrogen ion
Dodecanoyl-ACP (n-C12:0ACP) + Water > acyl carrier protein + Dodecanoate (N-C12:0) + Hydrogen ion
Water + cis-hexadec-9-enoyl-[acyl-carrier protein] (n-C16:1) > acyl carrier protein + Hydrogen ion + Hexadecenoate (n-C16:1)
Water + cis-tetradec-7-enoyl-[acyl-carrier protein] (n-C14:1) > acyl carrier protein + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + Myristoyl-ACP (n-C14:0ACP) > acyl carrier protein + Hydrogen ion + tetradecanoate (n-C14:0)
Water + Octanoyl-ACP (n-C8:0ACP) > acyl carrier protein + Hydrogen ion + Caprylic acid
Water + Palmitoyl-ACP (n-C16:0ACP) > acyl carrier protein + Hydrogen ion + Palmitic acid
2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Hydrogen ion + Water > 5-Amino-6-(5'-phosphoribosylamino)uracil + Ammonium
5-Amino-6-(5'-phosphoribosylamino)uracil + Hydrogen ion + NADPH > 5-Amino-6-(5'-phosphoribitylamino)uracil + NADP
D-Glyceraldehyde 3-phosphate + Hydrogen ion + Pyruvic acid <> Carbon dioxide + 1-Deoxy-D-xylulose 5-phosphate
Adenosine triphosphate + 7-Deaza-7-carboxyguanine + Ammonium > ADP + Hydrogen ion + Water + Phosphate + 7-Cyano-7-carbaguanine
Water + Octanoyl-CoA > Coenzyme A + Hydrogen ion + Caprylic acid
Water + Palmityl-CoA > Coenzyme A + Hydrogen ion + Palmitic acid
Water + Tetradecanoyl-CoA > Coenzyme A + Hydrogen ion + tetradecanoate (n-C14:0)
Water + Hexanoyl-CoA > Coenzyme A + Hydrogen ion + Hexanoate (N-C6:0)
Water + (2E)-Hexadecenoyl-CoA > Coenzyme A + Hydrogen ion + Hexadecenoate (n-C16:1)
Water + (2E)-Tetradecenoyl-CoA > Coenzyme A + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + Octadecenoyl-CoA (N-C18:1CoA) > Coenzyme A + Hydrogen ion + Octadecenoate (N-C18:1)
Water + Stearoyl-CoA > Coenzyme A + Hydrogen ion + Octadecanoate (N-C18:0)
Lauroyl-CoA + Water > Coenzyme A + Dodecanoate (N-C12:0) + Hydrogen ion
Decanoyl-CoA (N-C10:0CoA) + Water > Coenzyme A + Decanoate (N-C10:0) + Hydrogen ion
Adenosine + Adenosine triphosphate > ADP + Adenosine monophosphate + Hydrogen ion
Iron + Protoporphyrin IX >2 Hydrogen ion + Heme
Adenosine triphosphate + Guanosine > ADP + Guanosine monophosphate + Hydrogen ion
Adenosine triphosphate + Inosine <> ADP + Hydrogen ion + Inosinic acid
Water + Uridine diphosphate-N-acetylglucosamine > N-Acetyl-glucosamine 1-phosphate +2 Hydrogen ion + Uridine 5'-monophosphate
Water + Uridine diphosphategalactose > Galactose 1-phosphate +2 Hydrogen ion + Uridine 5'-monophosphate
Water + Uridine diphosphate-N-acetylgalactosamine > N-Acetyl-D-galactosamine 1-phosphate +2 Hydrogen ion + Uridine 5'-monophosphate
Water + Uridine diphosphate glucuronic acid > D-Glucuronate 1-phosphate +2 Hydrogen ion + Uridine 5'-monophosphate
Water + UDP-Glucose > Glucose 1-phosphate +2 Hydrogen ion + Uridine 5'-monophosphate
Adenosine triphosphate + Copper + Water > ADP + Hydrogen ion + Phosphate + Copper
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C12:0) + Water > Dodecanoate (N-C12:0) + Glycerylphosphorylethanolamine + Hydrogen ion
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:0) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + tetradecanoate (n-C14:0)
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:1) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Tetradecenoate (N-C14:1)
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:0) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Palmitic acid
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:1) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Hexadecenoate (n-C16:1)
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:0) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Octadecanoate (N-C18:0)
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:1) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Octadecenoate (N-C18:1)
1-Acyl-sn-glycero-3-phosphoglycerol (N-C12:0) + Water > Dodecanoate (N-C12:0) + Glycerophosphoglycerol + Hydrogen ion
1-Acyl-sn-glycero-3-phosphoglycerol (N-C14:0) + Water > Glycerophosphoglycerol + Hydrogen ion + tetradecanoate (n-C14:0)
1-Acyl-sn-glycero-3-phosphoglycerol (N-C14:1) + Water > Glycerophosphoglycerol + Hydrogen ion + Tetradecenoate (N-C14:1)
1-Acyl-sn-glycero-3-phosphoglycerol (N-C16:0) + Water > Glycerophosphoglycerol + Hydrogen ion + Palmitic acid
1-Acyl-sn-glycero-3-phosphoglycerol (N-C16:1) + Water > Glycerophosphoglycerol + Hydrogen ion + Hexadecenoate (n-C16:1)
1-Acyl-sn-glycero-3-phosphoglycerol (N-C18:0) + Water > Glycerophosphoglycerol + Hydrogen ion + Octadecanoate (N-C18:0)
1-Acyl-sn-glycero-3-phosphoglycerol (N-C18:1) + Water > Glycerophosphoglycerol + Hydrogen ion + Octadecenoate (N-C18:1)
1-Dodecanoyl-sn-glycerol 3-phosphate + Water > Dodecanoate (N-C12:0) + Glycerol 3-phosphate + Hydrogen ion
1-Hexadec-9-enoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate + Hydrogen ion + Hexadecenoate (n-C16:1)
1-hexadecanoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate + Hydrogen ion + Palmitic acid
1-Octadec-11-enoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate + Hydrogen ion + Octadecenoate (N-C18:1)
1-Octadecanoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate + Hydrogen ion + Octadecanoate (N-C18:0)
1-Tetradec-7-enoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate + Hydrogen ion + Tetradecenoate (N-C14:1)
1-Tetradecanoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate + Hydrogen ion + tetradecanoate (n-C14:0)
2 Hydrogen ion + Water + (S)-Ureidoglycolic acid > Carbon dioxide + Glyoxylic acid +2 Ammonium
2 Glyoxylic acid + Hydrogen ion <> Tartronate semialdehyde + Carbon dioxide
Allantoin + Water > Allantoic acid + Hydrogen ion
Adenosine triphosphate + Glyceric acid > 3-Phosphoglycerate + ADP + Hydrogen ion
Allantoic acid + 2 Hydrogen ion + 2 Water > Carbon dioxide +2 Ammonium + (S)-Ureidoglycolic acid
NAD + (S)-Ureidoglycolic acid <> Hydrogen ion + NADH + Oxalureate
5-Aminoimidazole ribonucleotide + Adenosine triphosphate + Hydrogen carbonate > 5-Phosphoribosyl-5-carboxyaminoimidazole + ADP + Hydrogen ion + Phosphate
Water + UDP-2,3-Bis(3-hydroxytetradecanoyl)glucosamine <>2 Hydrogen ion + 2,3-Bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl 1-phosphate + Uridine 5'-monophosphate
Water + 5,10-Methenyltetrahydrofolate <> N10-Formyl-THF + Hydrogen ion
5,10-Methylene-THF + NADP <> 5,10-Methenyltetrahydrofolate + NADPH + Hydrogen ion
6,7-Dihydropteridine + 3 Hydrogen ion + NADH <> NAD + Tetrahydropteridine
6,7-Dihydropteridine + 3 Hydrogen ion + NADPH <> NADP + Tetrahydropteridine
3 (2,3-Dihydroxybenzoyl)adenylic acid + 3 L-Seryl-AMP >6 Adenosine monophosphate + Enterochelin +9 Hydrogen ion
Enterochelin + 3 Water >3 2,3-Dihydroxybenzoylserine +3 Hydrogen ion
Ferric enterobactin + 3 Water >3 2,3-Dihydroxybenzoylserine + Fe3+ +3 Hydrogen ion
Adenosine triphosphate + Hydrogen ion + L-Serine <> Pyrophosphate + L-Seryl-AMP
2-Pyrocatechuic acid + Adenosine triphosphate + Hydrogen ion > (2,3-Dihydroxybenzoyl)adenylic acid + Pyrophosphate
(2S,3S)-2,3-Dihydro-2,3-dihydroxybenzoate + NAD + 2,3-Dihydro-2,3-dihydroxybenzoic acid <> 2-Pyrocatechuic acid + Hydrogen ion + NADH
core oligosaccharide lipid A + Hydrogen ion + Palmitic acid > Water + hepta-acylated core oligosaccharide lipid A (E. coli)
Hydrogen ion + Palmitic acid + KDO2-Lipid A > Water + Hepta-acylated KDO2-lipid A
[4Fe-4S] iron-sulfur cluster + 2 S-Adenosylmethionine + Hydrogen ion + NAD + octanoate (protein bound) > [2Fe-2S] iron-sulfur cluster +2 5'-Deoxyadenosine +2 Iron + lipoate (protein bound) +2 L-Methionine + NADH
Hydrogen ion + Octanoyl-ACP (n-C8:0ACP) > acyl carrier protein + octanoate (protein bound)
Adenosine triphosphate + Hydrogen ion + Nicotinamide ribotide <> Nicotinic acid adenine dinucleotide + Pyrophosphate
L-Aspartic acid + Adenosine triphosphate + L-Glutamine + Water > Adenosine monophosphate + L-Asparagine + L-Glutamate + Hydrogen ion + Pyrophosphate
Acetyl-CoA + Water + Oxalacetic acid <> Citric acid + Coenzyme A + Hydrogen ion
1,4-Dihydroxy-2-naphthoyl-CoA + Water > Coenzyme A + 1,4-Dihydroxy-2-naphthoic acid + Hydrogen ion
6-Phosphonoglucono-D-lactone + Water <> 6-Phosphogluconic acid + Hydrogen ion
[2Fe-2S] iron-sulfur cluster + S-Adenosylmethionine + Dethiobiotin > [2Fe-1S] desulfurated iron-sulfur cluster + Biotin + 5'-Deoxyadenosine + Hydrogen ion + L-Methionine
Adenosine triphosphate + Carbon dioxide + 7,8-Diaminononanoate <> ADP + Dethiobiotin +3 Hydrogen ion + Phosphate
Adenosine triphosphate + Hydrogen ion + MoaD Protein with carboxylate > MoaD Protein with bound AMP + Pyrophosphate
2 Hydrogen ion + Molybdate + Adenylated molybdopterin > Adenosine monophosphate + Copper + Water + Molybdopterin
2 Hydrogen ion + Adenylated molybdopterin + Tungstate > Adenosine monophosphate + Copper + Water + tungsten binding cofactor
Adenosine triphosphate + core oligosaccharide lipid A + Water > ADP + Hydrogen ion + Phosphate + core oligosaccharide lipid A
Adenosine triphosphate + Water + cold adapted KDO(2)-lipid (A) > ADP + Hydrogen ion + Phosphate + cold adapted KDO(2)-lipid (A)
Adenosine triphosphate + Water + PA(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PA(16:0/16:0)
Adenosine triphosphate + Water + PA(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PA(16:0/16:0)
Adenosine triphosphate + Water + PA(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PA(16:0/16:0)
Adenosine triphosphate + Water + PA(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PA(16:0/16:0)
Adenosine triphosphate + Water + PA(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PA(16:0/16:0)
Adenosine triphosphate + Water + PA(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PA(16:0/16:0)
Adenosine triphosphate + Water + PA(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PA(16:0/16:0)
Adenosine triphosphate + Water + PE(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PE(14:0/14:0)
Adenosine triphosphate + Water + PE(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PE(14:0/14:0)
Adenosine triphosphate + Water + PE(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PE(14:0/14:0)
Adenosine triphosphate + Water + PE(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PE(14:0/14:0)
Adenosine triphosphate + Water + PE(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PE(14:0/14:0)
Adenosine triphosphate + Water + PE(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PE(14:0/14:0)
Adenosine triphosphate + Water + PE(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PE(14:0/14:0)
Adenosine triphosphate + Water + PG(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PG(16:0/16:0)
Adenosine triphosphate + Water + PG(16:1(9Z)/16:1(9Z)) > ADP + Hydrogen ion + Phosphate + PG(16:1(9Z)/16:1(9Z))
Adenosine triphosphate + Water + PG(18:1(11Z)/18:1(11Z)) > ADP + Hydrogen ion + Phosphate + PG(18:1(11Z)/18:1(11Z))
Adenosine triphosphate + Water + PG(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PG(14:0/14:0)
Adenosine triphosphate + Water + KDO2-Lipid A > ADP + Hydrogen ion + Phosphate + KDO2-Lipid A
Adenosine triphosphate + Water + KDO(2)-lipid IV(A) > ADP + Hydrogen ion + Phosphate + KDO(2)-lipid IV(A)
Adenosine triphosphate + Water + PG(12:0/12:0) > ADP + Hydrogen ion + Phosphate + PG(12:0/12:0)
Adenosine triphosphate + Water + PG(14:1(7Z)/14:1(7Z)) > ADP + Hydrogen ion + Phosphate + PG(14:1(7Z)/14:1(7Z))
Adenosine triphosphate + Water + PG(18:0/18:0) > ADP + Hydrogen ion + Phosphate + PG(18:0/18:0)
Adenosine triphosphate + Water + PGP(12:0/12:0) > ADP + Hydrogen ion + Phosphate + PGP(12:0/12:0)
Adenosine triphosphate + Water + PGP(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PGP(14:0/14:0)
Adenosine triphosphate + Water + PGP(14:1(7Z)/14:1(7Z)) > ADP + Hydrogen ion + Phosphate + PGP(14:1(7Z)/14:1(7Z))
Adenosine triphosphate + Water + PGP(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PGP(16:0/16:0)
Adenosine triphosphate + Water + PGP(16:1(9Z)/16:1(9Z)) > ADP + Hydrogen ion + Phosphate + PGP(16:1(9Z)/16:1(9Z))
Adenosine triphosphate + Water + PGP(18:0/18:0) > ADP + Hydrogen ion + Phosphate + PGP(18:0/18:0)
Adenosine triphosphate + Water + PGP(18:1(11Z)/18:1(11Z)) > ADP + Hydrogen ion + Phosphate + PGP(18:1(11Z)/18:1(11Z))
Adenosine triphosphate + 2,3,2',3'-Tetrakis(3-hydroxytetradecanoyl)-D-glucosaminyl-1,6-beta-D-glucosamine 1-phosphate > ADP + Hydrogen ion + 2,3,2'3'-Tetrakis(beta-hydroxymyristoyl)-D-glucosaminyl-1,6-beta-D-glucosamine 1,4'-bisphosphate
FMNH + Oxygen + Sulfoacetate > Flavin Mononucleotide + Glyoxylic acid + Hydrogen ion + Water + Sulfite
FMNH + Isethionic acid + Oxygen > Flavin Mononucleotide + Glycolaldehyde + Hydrogen ion + Water + Sulfite
FMNH + Methanesulfonate + Oxygen > Formaldehyde + Flavin Mononucleotide + Hydrogen ion + Water + Sulfite
Butanesulfonate + FMNH + Oxygen > Butanal + Flavin Mononucleotide + Hydrogen ion + Water + Sulfite
Ethanesulfonate + FMNH + Oxygen > Acetaldehyde + Flavin Mononucleotide + Hydrogen ion + Water + Sulfite
Water + Hexadecanoyl-phosphate (n-C16:0) >2 Hydrogen ion + Palmitic acid + Phosphate
Water + Hexadecanoyl-phosphate (n-C16:1) >2 Hydrogen ion + Hexadecenoate (n-C16:1) + Phosphate
Water + Octadecanoyl-phosphate (n-C18:0) >2 Hydrogen ion + Octadecanoate (N-C18:0) + Phosphate
Water + Octadecanoyl-phosphate (n-C18:1) >2 Hydrogen ion + Octadecenoate (N-C18:1) + Phosphate
Water + Tetradecanoyl-phosphate (n-C14:0) >2 Hydrogen ion + Phosphate + tetradecanoate (n-C14:0)
Water + Tetradecanoyl-phosphate (n-C14:1) >2 Hydrogen ion + Phosphate + Tetradecenoate (N-C14:1)
Dodecanoly-phosphate (n-C12:0) + Water > Dodecanoate (N-C12:0) +2 Hydrogen ion + Phosphate
Guanosine triphosphate + Water > Guanosine diphosphate + Hydrogen ion + Phosphate
3-Aminoacrylate + Hydrogen ion + Water > Malonic semialdehyde + Ammonium
Water + Ureidoacrylate peracid > Carbamic acid + Hydrogen ion + Peroxyaminoacrylate
FAD + L-Proline > L-D-1-Pyrroline-5-carboxylic acid + FADH2 + Hydrogen ion
L-D-1-Pyrroline-5-carboxylic acid + 2 Water + NAD > L-Glutamate + Hydrogen ion + NADH
4,5-Dihydroorotic acid + Water <> Ureidosuccinic acid + Hydrogen ion
Acetyl-CoA + Hydrogen ion + Malonyl-[acyl-carrier protein] > Acetoacetyl-ACP + Carbon dioxide + Coenzyme A
Hydrogen ion + Malonyl-[acyl-carrier protein] + malonyl-CoA methyl ester > Carbon dioxide + Coenzyme A +3 -Oxo-glutaryl-[acyl-carrier protein] methyl ester
3 -oxo-cis-dodec-5-enoyl-[acyl-carrier protein] + Hydrogen ion + NADPH > (R)-3-hydroxy-cis-dodec-5-enoyl-[acyl-carrier protein] + NADP
3 -oxo-cis-myristol-7-eoyl-[acyl-carrier protein] + Hydrogen ion + NADPH > (R)-3-hydroxy-cis-myristol-7-eoyl-[acyl-carrier protein] + NADP
3 -oxo-cis-palm-9-eoyl-[acyl-carrier protein] + Hydrogen ion + NADPH > (R)-3-hydroxy-cis-palm-9-eoyl-[acyl-carrier protein] + NADP
3 -oxo-cis-vacc-11-enoyl-[acyl-carrier protein] + Hydrogen ion + NADPH > (R)-3-hydroxy-cis-vacc-11-enoyl-[acyl-carrier protein] + NADP
3 -Oxodecanoyl-[acyl-carrier protein] + Hydrogen ion + NADPH <> (R)-3-Hydroxydecanoyl-[acyl-carrier protein] + NADP
3 -Oxododecanoyl-[acyl-carrier protein] + Hydrogen ion + NADPH <> (R)-3-Hydroxydodecanoyl-[acyl-carrier protein] + NADP
3 -Oxohexadecanoyl-[acyl-carrier protein] + Hydrogen ion + NADPH <> R-3-hydroxypalmitoyl-[acyl-carrier protein] + NADP
3 -Oxohexanoyl-[acyl-carrier protein] + Hydrogen ion + NADPH <> (R)-3-Hydroxyhexanoyl-[acyl-carrier protein] + NADP
3 -Oxooctadecanoyl-[acyl-carrier protein] + Hydrogen ion + NADPH <> (R)-3-Hydroxyoctadecanoyl-[acyl-carrier protein] + NADP
3 -Oxooctanoyl-[acyl-carrier protein] + Hydrogen ion + NADPH <> (R)-3-Hydroxyoctanoyl-[acyl-carrier protein] + NADP
3 -Oxotetradecanoyl-[acyl-carrier protein] + Hydrogen ion + NADPH <> (R)-3-Hydroxytetradecanoyl-[acyl-carrier protein] + NADP
Acetoacetyl-ACP + Hydrogen ion + NADPH <> (3R)-3-Hydroxyacyl-[acyl-carrier protein] + NADP
Hydrogen ion + NADPH + 3 -Oxo-glutaryl-[acyl-carrier protein] methyl ester >3 -Hydroxyglutaryl-[acyl-carrier protein] methyl ester + NADP
Hydrogen ion + NADPH + 3 -Oxo-pimeloyl-[acyl-carrier protein] methyl ester >3 -Hydroxypimeloyl-[acyl-carrier protein] methyl ester + NADP
Hydrogen ion + cis-hexadec-9-enoyl-[acyl-carrier protein] (n-C16:1) + Malonyl-[acyl-carrier protein] >3 -oxo-cis-vacc-11-enoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
4-Amino-4-deoxychorismate <> p-Aminobenzoic acid + Hydrogen ion + Pyruvic acid
Adenosine triphosphate + Thiamine <> ADP + Hydrogen ion + Thiamine monophosphate
2-Demethylmenaquinone 8 + Hydrogen ion + NADH > 2-Demethylmenaquinol 8 + NAD
Hydrogen ion + NADH + Ubiquinone-8 > NAD + Ubiquinol-8
Hydrogen ion + Menaquinone 8 + NADH > Menaquinol 8 + NAD
N-Acetyl-D-glucosamine + Adenosine triphosphate <> N-Acetyl-D-Glucosamine 6-Phosphate + ADP + Hydrogen ion
Water + Thiamine pyrophosphate > Hydrogen ion + Phosphate + Thiamine monophosphate
Adenosine triphosphate + D-Ribose-5-phosphate <> Adenosine monophosphate + Hydrogen ion + Phosphoribosyl pyrophosphate
4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Adenosine triphosphate <> 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + ADP + Hydrogen ion
L-Glutamyl-tRNA(Glu) + Hydrogen ion + NADPH > (S)-4-Amino-5-oxopentanoate + NADP + tRNA (Glu)
N10-Formyl-THF + Water <> Formic acid + Hydrogen ion + Tetrahydrofolic acid
Glucose 1-phosphate + Hydrogen ion + Uridine triphosphate <> Pyrophosphate + UDP-Glucose
Adenosine triphosphate + Deoxyuridine > ADP + dUMP + Hydrogen ion
Adenosine triphosphate + Thymidine <> ADP + 5-Thymidylic acid + Hydrogen ion
1-(2-Carboxyphenylamino)-1'-deoxy-D-ribulose 5'-phosphate + Hydrogen ion <> Indoleglycerol phosphate + Carbon dioxide + Water
Adenosine triphosphate + Cob(I)alamin + Hydrogen ion <> Adenosylcobalamin + Triphosphate
Adenosine triphosphate + Cobinamide + Hydrogen ion <> Adenosyl cobinamide + Triphosphate
Guanosine triphosphate + 3 Water <> 2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Formic acid +2 Hydrogen ion + Pyrophosphate + 2,5-diamino-6-hydroxy-4-(5-phospho-D-ribosylamino)pyrimidine
Hydrogen ion + Orotidylic acid <> Carbon dioxide + Uridine 5'-monophosphate
But-2-enoyl-[acyl-carrier protein] + Hydrogen ion + NADH > Butyryl-ACP (n-C4:0ACP) + NAD
But-2-enoyl-[acyl-carrier protein] + Hydrogen ion + NADPH > Butyryl-ACP (n-C4:0ACP) + NADP
Hydrogen ion + NADH + trans-3-cis-11-vacceoyl-[acyl-carrier protein] > NAD + cis-octadec-11-enoyl-[acyl-carrier protein] (n-C18:1)
Hydrogen ion + NADH + trans-3-cis-5-dodecenoyl-[acyl-carrier protein] > cis-dodec-5-enoyl-[acyl-carrier protein] (n-C12:1) + NAD
Hydrogen ion + NADH + trans-3-cis-7-myristoleoyl-[acyl-carrier protein] > NAD + cis-tetradec-7-enoyl-[acyl-carrier protein] (n-C14:1)
Hydrogen ion + NADH + trans-3-cis-9-palmitoleoyl-[acyl-carrier protein] > cis-hexadec-9-enoyl-[acyl-carrier protein] (n-C16:1) + NAD
Hydrogen ion + NADH + trans-Dec-2-enoyl-[acyl-carrier protein] > Decanoyl-ACP (n-C10:0ACP) + NAD
Hydrogen ion + NADH + trans-Dodec-2-enoyl-[acyl-carrier protein] > Dodecanoyl-ACP (n-C12:0ACP) + NAD
Hydrogen ion + NADH + trans-Hex-2-enoyl-[acyl-carrier protein] > Hexanoyl-ACP (n-C6:0ACP) + NAD
Hydrogen ion + NADH + trans-Hexadec-2-enoyl-[acyl-carrier protein] > NAD + Palmitoyl-ACP (n-C16:0ACP)
Hydrogen ion + NADH + trans-Oct-2-enoyl-[acyl-carrier protein] > NAD + Octanoyl-ACP (n-C8:0ACP)
Hydrogen ion + NADH + trans-octadec-2-enoyl-[acyl-carrier protein] > NAD + Octadecanoyl-ACP (n-C18:0ACP)
Hydrogen ion + NADH + trans-Tetradec-2-enoyl-[acyl-carrier protein] > Myristoyl-ACP (n-C14:0ACP) + NAD
Hydrogen ion + NADPH + trans-3-cis-11-vacceoyl-[acyl-carrier protein] > NADP + cis-octadec-11-enoyl-[acyl-carrier protein] (n-C18:1)
Hydrogen ion + NADPH + trans-3-cis-5-dodecenoyl-[acyl-carrier protein] > cis-dodec-5-enoyl-[acyl-carrier protein] (n-C12:1) + NADP
Hydrogen ion + NADPH + trans-3-cis-7-myristoleoyl-[acyl-carrier protein] > NADP + cis-tetradec-7-enoyl-[acyl-carrier protein] (n-C14:1)
Hydrogen ion + NADPH + trans-3-cis-9-palmitoleoyl-[acyl-carrier protein] > cis-hexadec-9-enoyl-[acyl-carrier protein] (n-C16:1) + NADP
Hydrogen ion + NADPH + trans-Dec-2-enoyl-[acyl-carrier protein] > Decanoyl-ACP (n-C10:0ACP) + NADP
Hydrogen ion + NADPH + trans-Dodec-2-enoyl-[acyl-carrier protein] > Dodecanoyl-ACP (n-C12:0ACP) + NADP
Hydrogen ion + NADPH + trans-Hex-2-enoyl-[acyl-carrier protein] > Hexanoyl-ACP (n-C6:0ACP) + NADP
Hydrogen ion + NADPH + trans-Hexadec-2-enoyl-[acyl-carrier protein] > NADP + Palmitoyl-ACP (n-C16:0ACP)
Hydrogen ion + NADPH + trans-Oct-2-enoyl-[acyl-carrier protein] > NADP + Octanoyl-ACP (n-C8:0ACP)
Hydrogen ion + NADPH + trans-octadec-2-enoyl-[acyl-carrier protein] > NADP + Octadecanoyl-ACP (n-C18:0ACP)
Hydrogen ion + NADPH + trans-Tetradec-2-enoyl-[acyl-carrier protein] > Myristoyl-ACP (n-C14:0ACP) + NADP
Enoylglutaryl-[acyl-carrier protein] methyl ester + Hydrogen ion + NADPH > Glutaryl-[acyl-carrier protein] methyl ester + NADP
Enoylpimeloyl-[acyl-carrier protein] methyl ester + Hydrogen ion + NADPH > NADP + Pimeloyl-[acyl-carrier protein] methyl ester
Adenosine triphosphate + L-Glutamate + Putrescine + Ethylenediamine <> ADP + gamma-Glutamyl-L-putrescine + Hydrogen ion + Phosphate
Acetaldehyde + Water + NAD > Acetic acid +2 Hydrogen ion + NADH
gamma-Glutamyl-gamma-butyraldehyde + Water + NADP <> 4-(Glutamylamino) butanoate +2 Hydrogen ion + NADPH
Hydrogen cyanide + Thiosulfate > Hydrogen ion + Sulfite + Thiocyanate
Water + NAD + Phenylacetaldehyde <>2 Hydrogen ion + NADH + Benzeneacetic acid
2-Oxepin-2(3H)-ylideneacetyl-CoA + 2 Water + NADP > 3-Oxo-5,6-dehydrosuberyl-CoA +2 Hydrogen ion + NADPH
(3S)-3-Hydroxyadipyl-CoA + NAD <> Hydrogen ion + NADH + 3-Oxoadipyl-CoA
Water + Lactaldehyde + NAD + (S)-Lactaldehyde <>2 Hydrogen ion + L-Lactic acid + NADH
Glycolaldehyde + Water + NAD > Glycolic acid +2 Hydrogen ion + NADH
4-Aminobutyraldehyde + Water + NAD <> gamma-Aminobutyric acid +2 Hydrogen ion + NADH
Cyclic AMP + Water > Adenosine monophosphate + Hydrogen ion
Cyclic GMP + Water > Guanosine monophosphate + Hydrogen ion
D-Altronate + NAD <> Hydrogen ion + NADH + 5-Keto-D-gluconate + D-Tagaturonate
Water + NAD + Succinic acid semialdehyde >2 Hydrogen ion + NADH + Succinic acid
NADP + L-Serine <> 2-Aminomalonate semialdehyde + Hydrogen ion + NADPH
NADP + D-Serine <> 2-Aminomalonate semialdehyde + Hydrogen ion + NADPH
L-Allothreonine + NADP <> L-2-Amino-3-oxobutanoic acid + Hydrogen ion + NADPH
Acetyl-CoA + Spermidine > N1-Acetylspermidine + Coenzyme A + Hydrogen ion
Acetyl-CoA + Spermidine > Coenzyme A + Hydrogen ion + N8-Acetylspermidine
7,8-Dihydroneopterin + Hydrogen ion + NADPH > NADP + Tetrahydromonapterin
Adenosine + Hydrogen ion + Water > Inosine + Ammonium
Deoxyadenosine + Hydrogen ion + Water > Deoxyinosine + Ammonium
1,6-Anhydro-N-acetylmuramate + Adenosine triphosphate + Water > N-Acetylmuramic acid 6-phosphate + ADP + Hydrogen ion
2 Hydrogen ion + 2 Superoxide anion > Hydrogen peroxide + Oxygen
2 S-Adenosylmethionine + PE(14:0/14:0) >2 S-Adenosylhomocysteine + Cyclopropane phosphatidylethanolamine (dihexadec-9,10-cyclo-anoyl, N-C16:0 cyclo) +2 Hydrogen ion
2 S-Adenosylmethionine + PE(14:0/14:0) >2 S-Adenosylhomocysteine + Cyclopropane phosphatidylethanolamine (dioctadec-11,12-cyclo-anoyl, N-C18:0 cyclo) +2 Hydrogen ion
2 S-Adenosylmethionine + PG(16:1(9Z)/16:1(9Z)) >2 S-Adenosylhomocysteine + Cyclopropane phosphatidylglycerol (dihexadec-9,10-cyclo-anoyl, N-C16:0 cyclo) +2 Hydrogen ion
2 S-Adenosylmethionine + PG(18:1(11Z)/18:1(11Z)) >2 S-Adenosylhomocysteine + Cyclopropane phosphatidylglycerol (dioctadec-11,12-cyclo-anoyl, N-C18:0 cyclo) +2 Hydrogen ion
NAD + Quinate <> 3-Dehydroquinate +2 Hydrogen ion + NADH
Adenosine triphosphate + Water + Pyruvic acid <> Adenosine monophosphate +2 Hydrogen ion + Phosphoenolpyruvic acid + Phosphate
Adenosine triphosphate + Nicotinic acid adenine dinucleotide + Ammonium > Adenosine monophosphate + Hydrogen ion + NAD + Pyrophosphate
2 Hydrogen ion + 2 Water + N2-Succinyl-L-arginine > Carbon dioxide +2 Ammonium + N2-Succinyl-L-ornithine
Water + NAD + N2-Succinyl-L-glutamic acid 5-semialdehyde <>2 Hydrogen ion + NADH + N-Succinyl-L-glutamate
L-Arginine + Succinyl-CoA <> Coenzyme A + Hydrogen ion + N2-Succinyl-L-arginine
L-Glutamate + Water + NADP <> alpha-Ketoglutarate + Hydrogen ion + NADPH + Ammonium
D-Glyceraldehyde 3-phosphate + NAD + Phosphate <> Glyceric acid 1,3-biphosphate + Hydrogen ion + NADH + 3-phospho-D-glyceroyl phosphate
Adenosine triphosphate + Formic acid + Glycineamideribotide > ADP + 5'-Phosphoribosyl-N-formylglycineamide + Hydrogen ion + Phosphate
Hydrogen ion + Oxalacetic acid > Carbon dioxide + Pyruvic acid
Glucose 6-phosphate + NADP <> 6-Phosphonoglucono-D-lactone + Hydrogen ion + NADPH
Glucose 6-phosphate + UDP-Glucose > Hydrogen ion + Trehalose 6-phosphate + Uridine 5'-diphosphate
CDP-1,2-didodecanoylglycerol + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(12:0/12:0)
CDP-1,2-dihexadec-9-enoylglycerol + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(16:1(9Z)/16:1(9Z))
CDP-1,2-dihexadecanoylglycerol + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(16:0/16:0)
CDP-1,2-dioctadec-11-enoylglycerol + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(18:1(11Z)/18:1(11Z))
CDP-1,2-Dioctadecanoylglycerol + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(18:0/18:0)
CDP-1,2-ditetradec-7-enoylglycerol + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(14:1(7Z)/14:1(7Z))
CDP-1,2-ditetradecanoylglycerol + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(14:0/14:0)
Dimethylbenzimidazole + Nicotinamide ribotide <> N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole + Hydrogen ion + Nicotinic acid
Adenosylcobinamide-GDP + N1-(alpha-D-ribosyl)-5,6-dimethyl-benzimidazole > Adenosylcobalamin + Guanosine monophosphate + Hydrogen ion
Adenosyl cobinamide + Adenosine triphosphate > Adenosyl cobinamide phosphate + ADP + Hydrogen ion
Adenosyl cobinamide phosphate + Guanosine triphosphate + Hydrogen ion > Adenosylcobinamide-GDP + Pyrophosphate
Water + L-Histidinol + 2 NAD >3 Hydrogen ion + L-Histidine +2 NADH
Water + Phosphoribosyl-ATP <> Hydrogen ion + Pyrophosphate + Phosphoribosyl-AMP
Water + 2 NAD + UDP-Glucose <>3 Hydrogen ion +2 NADH + Uridine diphosphate glucuronic acid + UDP-Glucuronic acid
6-Phosphogluconic acid + NADP <> Carbon dioxide + NADPH + D-Ribulose 5-phosphate + Hydrogen ion
O-Acetyl-rhamanosyl-N-acetylglucosamyl-undecaprenyl diphosphate + UDP-Glucose > Glucosyl-O-acetyl-rhamanosyl-N-acetylglucosamyl-undecaprenyl diphosphate + Hydrogen ion + Uridine 5'-diphosphate
Glucosyl-O-acetyl-rhamanosyl-N-acetylglucosamyl-undecaprenyl diphosphate + UDP-D-Galacto-1,4-furanose > Galactofuranosyl-glucosyl-O-acetyl-rhamanosyl-N-acetylglucosamyl-undecaprenyl diphosphate + Hydrogen ion + Uridine 5'-diphosphate
dTDP-4-Dehydro-6-deoxy-L-mannose + Hydrogen ion + NADPH <> Deoxythymidine diphosphate-L-rhamnose + NADP
Guanosine diphosphate + Hydrogen ion + D-Mannose 1-phosphate > Guanosine diphosphate mannose + Phosphate
Guanosine diphosphate mannose + Water > Guanosine diphosphate + Hydrogen ion + D-Mannose
GDP-4-Oxo-L-fucose + Hydrogen ion + NADPH > GDP-L-Fucose + NADP
dCTP + Hydrogen ion + Water > Deoxyuridine triphosphate + Ammonium
Cytidine + Guanosine triphosphate > Cytidine monophosphate + Guanosine diphosphate + Hydrogen ion
Guanosine triphosphate + Uridine > Guanosine diphosphate + Hydrogen ion + Uridine 5'-monophosphate
Galactitol 1-phosphate + NAD <> Hydrogen ion + NADH + D-Tagatose 6-phosphate
5-(2-Hydroxyethyl)-4-methylthiazole + Adenosine triphosphate + 4-methyl-5-(2-hydroxyethyl)thiazole <> 4-Methyl-5-(2-phosphoethyl)-thiazole + ADP + Hydrogen ion
Deoxycytidine + Hydrogen ion + Water > Deoxyuridine + Ammonium
Cytidine + Hydrogen ion + Water > Ammonium + Uridine
Guanosine triphosphate + Water > Dihydroneopterin triphosphate + Formic acid + Hydrogen ion
Adenosine triphosphate + Fructose 1-phosphate > ADP + Fructose 1,6-bisphosphate + Hydrogen ion
2-Octaprenyl-6-hydroxyphenol + S-Adenosylmethionine > 2-Octaprenyl-6-methoxyphenol + S-Adenosylhomocysteine + Hydrogen ion
2-Octaprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinol + S-Adenosylmethionine > S-Adenosylhomocysteine + Hydrogen ion + Ubiquinol-8
Glycerophosphocholine + Water > Choline + Glycerol 3-phosphate + Hydrogen ion
Glycerylphosphorylethanolamine + Water > Ethanolamine + Glycerol 3-phosphate + Hydrogen ion
Glycerophosphoglycerol + Water > Glycerol + Glycerol 3-phosphate + Hydrogen ion
Glycerophosphoserine + Water > Glycerol 3-phosphate + Hydrogen ion + L-Serine
Sn-Glycero-3-phospho-1-inositol + Water > Glycerol 3-phosphate + Hydrogen ion + Inositol
N10-Formyl-THF + Uridine 5''-diphospho-{beta}-4-deoxy-4-amino-L-arabinose <> Hydrogen ion + Tetrahydrofolic acid + Uridine 5''-diphospho-{beta}-4-deoxy-4-formamido-L-arabinose
Hydrogen ion + 2-Succinylbenzoyl-CoA > 1,4-Dihydroxy-2-naphthoyl-CoA + Water
alpha-Ketoglutarate + Hydrogen ion + Isochorismate <> 2-Succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate + Carbon dioxide
Adenosine triphosphate + 7,8-Dihydropteroic acid + L-Glutamate <> ADP + Dihydrofolic acid + Hydrogen ion + Phosphate
4-Phospho-D-erythronate + NAD <> Hydrogen ion + NADH + 2-Oxo-3-hydroxy-4-phosphobutanoic acid
cis-dec-3-enoyl-[acyl-carrier protein] (n-C10:1) + Hydrogen ion + Malonyl-[acyl-carrier protein] >3 -oxo-cis-dodec-5-enoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
cis-dodec-5-enoyl-[acyl-carrier protein] (n-C12:1) + Hydrogen ion + Malonyl-[acyl-carrier protein] >3 -oxo-cis-myristol-7-eoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
Hydrogen ion + Malonyl-[acyl-carrier protein] + cis-tetradec-7-enoyl-[acyl-carrier protein] (n-C14:1) >3 -oxo-cis-palm-9-eoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
Hydrogen ion + Malonyl-[acyl-carrier protein] > Acetyl-ACP + Carbon dioxide
Glutaryl-[acyl-carrier protein] methyl ester + Hydrogen ion + Malonyl-[acyl-carrier protein] > acyl carrier protein + Carbon dioxide +3 -Oxo-pimeloyl-[acyl-carrier protein] methyl ester
Hydrogen ion + Oxalyl-CoA <> Carbon dioxide + Formyl-CoA
Adenosine triphosphate + D-Glucose > ADP + Glucose 6-phosphate + Hydrogen ion
Adenosine triphosphate + Pyridoxine > ADP + Hydrogen ion + Pyridoxine 5'-phosphate
Adenosine triphosphate + Pyridoxamine > ADP + Hydrogen ion + Pyridoxamine 5'-phosphate
Coproporphyrin III + 2 Hydrogen ion + Oxygen <>2 Carbon dioxide +2 Water + Protoporphyrinogen IX
Guanosine diphosphate mannose + Water > Guanosine monophosphate +2 Hydrogen ion + D-Mannose 1-phosphate
5-Amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylate + L-Aspartic acid + Adenosine triphosphate <> SAICAR + ADP + Hydrogen ion + Phosphate
L-Aspartate-semialdehyde + Pyruvic acid > 2,3-Dihydrodipicolinic acid + Hydrogen ion +2 Water
Adenosine triphosphate + Phosphoribosylformylglycineamidine <> ADP + 5-Aminoimidazole ribonucleotide +2 Hydrogen ion + Phosphate
N10-Formyl-THF + Glycineamideribotide <> 5'-Phosphoribosyl-N-formylglycineamide + Hydrogen ion + Tetrahydrofolic acid
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid > Adenosine monophosphate + L-Glutamate + Guanosine monophosphate +2 Hydrogen ion + Pyrophosphate
Water + Inosinic acid + NAD <> Hydrogen ion + NADH + Xanthylic acid
Hydrogen cyanide + 3-Mercaptopyruvic acid + Cyanide <> Hydrogen ion + Pyruvic acid + Thiocyanate
FADH2 + 2 Hydrogen ion + IscU with two bound [2Fe-2S] clusters > FAD + IscU with bound [4Fe-4S] cluster
cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD > Trans-2,3-Dihydroxycinnamate + Hydrogen ion + NADH
Cis-3-(3-carboxyethyl)-3,5-cyclohexadiene-1,2-diol + NAD > 3-(2,3-Dihydroxyphenyl)propionic acid + Hydrogen ion + NADH
Water + 5,10-Methenyltetrahydrofolate > N5-Formyl-H4F + Hydrogen ion
NADH + 2 Nitric oxide + 2 Oxygen > Hydrogen ion + NAD +2 Nitrate
NADPH + 2 Nitric oxide + 2 Oxygen > Hydrogen ion + NADP +2 Nitrate
Adenosine triphosphate + 5'-Phosphoribosyl-N-formylglycineamide + L-Glutamine + Water <> ADP + Phosphoribosylformylglycineamidine + L-Glutamate + Hydrogen ion + Phosphate
L-Aspartic acid + Fumaric acid > Hydrogen ion + Iminoaspartic acid + Succinic acid
L-Aspartic acid + Oxygen <> Hydrogen ion + Hydrogen peroxide + Iminoaspartic acid
L-Aspartic acid + Ubiquinone-8 > Hydrogen ion + Iminoaspartic acid + Ubiquinol-8
L-Aspartic acid + Menaquinone 8 > Hydrogen ion + Iminoaspartic acid + Menaquinol 8
CDP-1,2-didodecanoylglycerol + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/16:0)
CDP-1,2-dihexadec-9-enoylglycerol + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/16:0)
CDP-1,2-dihexadecanoylglycerol + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/16:0)
CDP-1,2-dioctadec-11-enoylglycerol + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/16:0)
CDP-1,2-Dioctadecanoylglycerol + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/16:0)
CDP-1,2-ditetradec-7-enoylglycerol + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/16:0)
CDP-1,2-ditetradecanoylglycerol + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/16:0)
Hydrogen ion + Prephenate > Carbon dioxide + Water + Phenylpyruvic acid
Adenosine triphosphate + NAD <> ADP + Hydrogen ion + NADP
Adenosine triphosphate + L-Cysteine + L-Glutamate <> ADP + gamma-Glutamylcysteine + Hydrogen ion + Phosphate
NAD + Sorbitol-6-phosphate <> Fructose 6-phosphate + Hydrogen ion + NADH
2-C-Methyl-D-erythritol-4-phosphate + Cytidine triphosphate + Hydrogen ion <> 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Pyrophosphate
Adenosine phosphosulfate + Adenosine triphosphate <> ADP + Hydrogen ion + Phosphoadenosine phosphosulfate
Dihydroneopterin triphosphate + Water > Acetaldehyde + 6-Carboxy-5,6,7,8-tetrahydropterin + Hydrogen ion + Triphosphate
Adenosine triphosphate + L-Glutamine + Water + Uridine triphosphate > ADP + Cytidine triphosphate + L-Glutamate +2 Hydrogen ion + Phosphate
Water + Uridine triphosphate > Hydrogen ion + Pyrophosphate + Uridine 5'-monophosphate
Adenosine triphosphate + Water <> Adenosine monophosphate + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Guanosine triphosphate <> Adenosine monophosphate + Guanosine 3'-diphosphate 5'-triphosphate + Hydrogen ion
3 Hydrogen ion + 2 NADPH + 7-Cyano-7-carbaguanine >2 NADP + Queuine
Hydrogen ion + Lactaldehyde + NADH <> (S)-Propane-1,2-diol + NAD
Adenosine triphosphate + L-Fuculose <> ADP + L-Fuculose 1-phosphate + Hydrogen ion
3-Sulfinoalanine + 2 Hydrogen ion > L-Alanine + Sulfur dioxide
Acetyl-CoA + L-Glutamate <> N-Acetyl-L-alanine + Coenzyme A + Hydrogen ion + N-Acetylglutamic acid
Diaminopimelic acid + Hydrogen ion > Carbon dioxide + L-Lysine
Cytidine triphosphate + Hydrogen ion + Molybdopterin > Molybdopterin cytosine dinucleotide + Pyrophosphate
Guanine + Hydrogen ion + Water > Ammonium + Xanthine
N5-Formyl-H4F + Hydrogen ion > Water + 5,10-Methenyltetrahydrofolate
3-Phosphoglycerate + NAD > Phosphohydroxypyruvic acid + Hydrogen ion + NADH
Hydrogen ion + (S)-Methylmalonyl-CoA <> Carbon dioxide + Propionyl-CoA
L-Arginine + Hydrogen ion <> Agmatine + Carbon dioxide
Adenosine triphosphate + gamma-Glutamylcysteine + Glycine <> ADP + Glutathione + Hydrogen ion + Phosphate
Water + Inosine triphosphate > Hydrogen ion + Inosinic acid + Pyrophosphate
Water + Xanthosine 5-triphosphate > Hydrogen ion + Pyrophosphate + Xanthylic acid
2'-Deoxyinosine triphosphate + Water > DIMP + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Glutathione + Spermidine <> ADP + Glutathionylspermidine + Hydrogen ion + Phosphate
2-Demethylmenaquinone 8 + Hydrogen ion + NADPH > 2-Demethylmenaquinol 8 + NADP
Hydrogen ion + NADPH + Ubiquinone-8 > NADP + Ubiquinol-8
Hydrogen ion + Menaquinone 8 + NADPH > Menaquinol 8 + NADP
Menaquinol 8 + 2 Oxygen >2 Hydrogen ion + Menaquinone 8 +2 Superoxide anion
2 Oxygen + Ubiquinol-8 >2 Hydrogen ion +2 Superoxide anion + Ubiquinone-8
D-Ribulose 5-phosphate <> 3,4-Dihydroxy-2-butanone-4-P + Formic acid + Hydrogen ion
Adenosine triphosphate + D-Glycero-D-manno-heptose 1-phosphate + Hydrogen ion > ADP-D-Glycero-D-manno-heptose + Pyrophosphate
Adenosine triphosphate + D-Glycero-D-manno-heptose 7-phosphate > ADP + D-Glycero-D-manno-heptose 1,7-bisphosphate + Hydrogen ion
Glycerol 3-phosphate + Hexadecanoyl-phosphate (n-C16:0) > 1-hexadecanoyl-sn-glycerol 3-phosphate + Hydrogen ion + Phosphate
Glycerol 3-phosphate + Hexadecanoyl-phosphate (n-C16:1) > 1-Hexadec-9-enoyl-sn-glycerol 3-phosphate + Hydrogen ion + Phosphate
Glycerol 3-phosphate + Octadecanoyl-phosphate (n-C18:0) > 1-Octadecanoyl-sn-glycerol 3-phosphate + Hydrogen ion + Phosphate
Glycerol 3-phosphate + Octadecanoyl-phosphate (n-C18:1) > 1-Octadec-11-enoyl-sn-glycerol 3-phosphate + Hydrogen ion + Phosphate
Glycerol 3-phosphate + Tetradecanoyl-phosphate (n-C14:0) > 1-Tetradecanoyl-sn-glycerol 3-phosphate + Hydrogen ion + Phosphate
Glycerol 3-phosphate + Tetradecanoyl-phosphate (n-C14:1) > 1-Tetradec-7-enoyl-sn-glycerol 3-phosphate + Hydrogen ion + Phosphate
Dodecanoly-phosphate (n-C12:0) + Glycerol 3-phosphate > 1-Dodecanoyl-sn-glycerol 3-phosphate + Hydrogen ion + Phosphate
Adenosine triphosphate + Glyceric acid > 2-Phospho-D-glyceric acid + ADP + Hydrogen ion
L-Aspartic acid + Adenosine triphosphate + Citrulline <> Adenosine monophosphate + Argininosuccinic acid + Hydrogen ion + Pyrophosphate
N-Acetylmannosamine + Adenosine triphosphate > N-Acetyl-D-mannosamine 6-phosphate + ADP + Hydrogen ion
L-Malic acid + NAD <> Hydrogen ion + NADH + Oxalacetic acid
N10-Formyl-THF + L-Methionyl-tRNA (Met) > N-Formylmethionyl-tRNA + Hydrogen ion + Tetrahydrofolic acid
Iron + Sirohydrochlorin >3 Hydrogen ion + Siroheme
Precorrin 2 + NAD > Hydrogen ion + NADH + Sirohydrochlorin
Adenosine triphosphate + Fructoselysine > ADP + Fructoselysine-6-phosphate + Hydrogen ion
Adenosine triphosphate + Water + Iron > ADP + Iron + Hydrogen ion + Phosphate
Hydrogen cyanide + Thiosulfate > Hydrogen ion + Sulfite + Thiocyanate
ADP-Glucose > ADP + Glycogen + Hydrogen ion
Adenosine triphosphate + Glucose 1-phosphate + Hydrogen ion <> ADP-Glucose + Pyrophosphate
L-Aspartate-semialdehyde + NADP + Phosphate <> L-Aspartyl-4-phosphate + Hydrogen ion + NADPH
Glycerophosphocholine + Water > Choline + Glycerol 3-phosphate + Hydrogen ion
Glycerylphosphorylethanolamine + Water > Ethanolamine + Glycerol 3-phosphate + Hydrogen ion
Glycerophosphoglycerol + Water > Glycerol + Glycerol 3-phosphate + Hydrogen ion
Glycerophosphoserine + Water > Glycerol 3-phosphate + Hydrogen ion + L-Serine
Sn-Glycero-3-phospho-1-inositol + Water > Glycerol 3-phosphate + Hydrogen ion + Inositol
Adenosine triphosphate + Water + Zinc > ADP + Hydrogen ion + Phosphate + Zinc
Adenosine triphosphate + Water + Mercury > ADP + Hydrogen ion + Phosphate + Mercury
Adenosine triphosphate + Water + Nickel > ADP + Hydrogen ion + Phosphate + Nickel
Adenosine triphosphate + Cobalt + Water > ADP + Hydrogen ion + Phosphate + Cobalt
Adenosine triphosphate + Copper + Water > ADP + Hydrogen ion + Phosphate + Copper
Adenosine triphosphate + Cadmium + Water > ADP + Hydrogen ion + Phosphate + Cadmium
Glutathione disulfide + Hydrogen ion + NADPH <>2 Glutathione + NADP
Arsenite + Adenosine triphosphate + Water > ADP + Hydrogen ion + Phosphate + Arsenite
2-Keto-3-deoxy-D-gluconic acid + Adenosine triphosphate <> 2-Keto-3-deoxy-6-phosphogluconic acid + ADP + Hydrogen ion
D-Biotin D-sulfoxide + Hydrogen ion + NADH > Biotin + Water + NAD
D-Biotin D-sulfoxide + Hydrogen ion + NADPH > Biotin + Water + NADP
2 -Dehydro-L-gulonate + Hydrogen ion + NADH > Gluconic acid + NAD
2 -Dehydro-L-gulonate + Hydrogen ion + NADH > D-Galactonate + NAD
2 -Dehydro-L-gulonate + Hydrogen ion + NADPH > Gluconic acid + NADP
2 -Dehydro-L-gulonate + Hydrogen ion + NADPH > D-Galactonate + NADP
2,5-Diketo-D-gluconate + Hydrogen ion + NADH > 5-Keto-D-gluconate + NAD
2,5-Diketo-D-gluconate + Hydrogen ion + NADPH > 5-Keto-D-gluconate + NADP
Adenosine triphosphate + 1-Deoxy-D-xylulose > ADP + 1-Deoxy-D-xylulose 5-phosphate + Hydrogen ion
2,3-Diketo-L-gulonate + Hydrogen ion + NADH > 3-Dehydro-L-gulonate + NAD
3-Dehydro-L-gulonate + Adenosine triphosphate > 3-Dehydro-L-gulonate 6-phosphate + ADP + Hydrogen ion
Water + NADP + Propanal >2 Hydrogen ion + NADPH + Propionic acid
Acetaldehyde + Water + NADP > Acetic acid +2 Hydrogen ion + NADPH
Phosphoroselenoic acid > Hydrogen ion + Phosphate + L-Selenocysteinyl-tRNA(Sec)
Sorbitol-6-phosphate + NAD <> Fructose 6-phosphate + Hydrogen ion + NADH
Glycerol 3-phosphate + NADP <> Dihydroxyacetone phosphate + Hydrogen ion + NADPH
NAD + L-Threonine <> L-2-Amino-3-oxobutanoic acid + Hydrogen ion + NADH
ADP-L-Glycero-D-manno-heptose + heptosyl-kdo2-lipidA > ADP + Hydrogen ion + heptosyl-heptosyl-kdo2-lipidA
ADP-L-Glycero-D-manno-heptose + KDO2-Lipid A > ADP + Hydrogen ion + heptosyl-kdo2-lipidA
core oligosaccharide lipid A + (enterobacterial common antigen)x4 undecaprenyl-diphosphate > (enterobacterial common antigen)x4 core oligosaccharide lipid A + Hydrogen ion + Undecaprenyl diphosphate
core oligosaccharide lipid A + (O16 antigen)x4 undecaprenyl diphosphate > Hydrogen ion + (O16 antigen)x4 core oligosaccharide lipid A + Undecaprenyl diphosphate
ADP-L-Glycero-D-manno-heptose + glucosyl-glucosyl-galactosyl-glucosyl-inner core oligosaccharide lipid A > ADP + core oligosaccharide lipid A + Hydrogen ion
CMP-3-Deoxy-D-manno-octulosonate + Phospho-heptosyl-phospho-heptosyl-heptosyl-kdo2-lipidA > Cytidine monophosphate + Hydrogen ion + Kdo-phospho-heptosyl-phospho-heptosyl-heptosyl-kdo2-lipidA
Adenosine triphosphate + Heptosyl-phospho-heptosyl-heptosyl-kdo2-lipidA > ADP + Hydrogen ion + Phospho-heptosyl-phospho-heptosyl-heptosyl-kdo2-lipidA
glucosyl-galactosyl-glucosyl-inner core oligosaccharide lipid A + UDP-Glucose > glucosyl-glucosyl-galactosyl-glucosyl-inner core oligosaccharide lipid A + Hydrogen ion + Uridine 5'-diphosphate
galactosyl-glucosyl-inner core oligosaccharide lipid A + UDP-Glucose > glucosyl-galactosyl-glucosyl-inner core oligosaccharide lipid A + Hydrogen ion + Uridine 5'-diphosphate
glucosyl-inner core oligosaccharide lipid A + UDP-Glucose > galactosyl-glucosyl-inner core oligosaccharide lipid A + Hydrogen ion + Uridine 5'-diphosphate
Deoxythymidine diphosphate-L-rhamnose + Kdo-phospho-heptosyl-phospho-heptosyl-heptosyl-kdo2-lipidA > dTDP + Hydrogen ion + inner core oligosaccharide lipid A (E coli)
Adenosine triphosphate + heptosyl-heptosyl-kdo2-lipidA > ADP + Hydrogen ion + Phospho-heptosyl-heptosyl-kdo2-lipidA
inner core oligosaccharide lipid A (E coli) + UDP-Glucose > glucosyl-inner core oligosaccharide lipid A + Hydrogen ion + Uridine 5'-diphosphate
ADP-L-Glycero-D-manno-heptose + Phospho-heptosyl-heptosyl-kdo2-lipidA > ADP + Hydrogen ion + Heptosyl-phospho-heptosyl-heptosyl-kdo2-lipidA
CMP-3-Deoxy-D-manno-octulosonate + 2,3,2'3'-Tetrakis(beta-hydroxymyristoyl)-D-glucosaminyl-1,6-beta-D-glucosamine 1,4'-bisphosphate > Cytidine monophosphate + Hydrogen ion + KDO-lipid IV(A)
CMP-3-Deoxy-D-manno-octulosonate + KDO-lipid IV(A) > Cytidine monophosphate + Hydrogen ion + KDO(2)-lipid IV(A)
Adenosine triphosphate + Hydrogen ion + Pantetheine 4'-phosphate <> Dephospho-CoA + Pyrophosphate
D-4'-Phosphopantothenate + Cytidine triphosphate + L-Cysteine > 4-Phosphopantothenoylcysteine + Cytidine monophosphate + Hydrogen ion + Pyrophosphate
4-Phosphopantothenoylcysteine + Hydrogen ion <> Carbon dioxide + Pantetheine 4'-phosphate + pantotheine 4'-phosphate
Adenine + Hydrogen ion + Water > Hypoxanthine + Ammonium
2-Dehydro-3-deoxy-D-galactonate + Adenosine triphosphate <> 2-Dehydro-3-deoxy-D-galactonate-6-phosphate + ADP + Hydrogen ion
Acetyl-CoA + N-Acetyl-glucosamine 1-phosphate > N-Acetyl-glucosamine 1-phosphate + Coenzyme A + Hydrogen ion
N-Acetyl-glucosamine 1-phosphate + Hydrogen ion + Uridine triphosphate > Pyrophosphate + Uridine diphosphate-N-acetylglucosamine
L-Aspartic acid + Adenosine triphosphate + Ammonium > Adenosine monophosphate + L-Asparagine + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Ribose <> ADP + Hydrogen ion + D-Ribose-5-phosphate
2-Aceto-2-hydroxy-butyrate + Hydrogen ion + NADPH <> (R) 2,3-Dihydroxy-3-methylvalerate + NADP
(R)-2,3-Dihydroxy-isovalerate + NADP <> (S)-2-Acetolactate + Hydrogen ion + NADPH
Guanosine 3'-diphosphate 5'-triphosphate + Water <> Hydrogen ion + Phosphate + Guanosine 3',5'-bis(diphosphate)
Water + 2 NAD + UDP-N-Acetyl-D-mannosamine <>3 Hydrogen ion +2 NADH + UDP-N-Acetyl-D-mannosaminouronate
Acetyl-CoA + dTDP-D-Fucosamine > Coenzyme A + dTDP-4-Acetamido-4,6-dideoxy-D-galactose + Hydrogen ion
UDP-N-Acetyl-D-mannosaminouronate + Undecaprenyl-N-acetyl-alpha-D-glucosaminyl-pyrophosphate > Hydrogen ion + Uridine 5'-diphosphate + Undecaprenyl-diphospho-N-acetylglucosamine-N-acetylmannosaminuronate
Water + PA(16:0/16:0) > 1-Dodecanoyl-sn-glycerol 3-phosphate + Dodecanoate (N-C12:0) + Hydrogen ion
Water + PA(16:0/16:0) > 1-Hexadec-9-enoyl-sn-glycerol 3-phosphate + Hydrogen ion + Hexadecenoate (n-C16:1)
Water + PA(16:0/16:0) > 1-hexadecanoyl-sn-glycerol 3-phosphate + Hydrogen ion + Palmitic acid
Water + PA(16:0/16:0) > 1-Octadec-11-enoyl-sn-glycerol 3-phosphate + Hydrogen ion + Octadecenoate (N-C18:1)
Water + PA(16:0/16:0) > 1-Octadecanoyl-sn-glycerol 3-phosphate + Hydrogen ion + Octadecanoate (N-C18:0)
Water + PA(16:0/16:0) > 1-Tetradec-7-enoyl-sn-glycerol 3-phosphate + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + PA(16:0/16:0) > 1-Tetradecanoyl-sn-glycerol 3-phosphate + Hydrogen ion + tetradecanoate (n-C14:0)
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C12:0) + Dodecanoate (N-C12:0) + Hydrogen ion
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:0) + Hydrogen ion + tetradecanoate (n-C14:0)
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:1) + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:0) + Hydrogen ion + Palmitic acid
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:1) + Hydrogen ion + Hexadecenoate (n-C16:1)
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:0) + Hydrogen ion + Octadecanoate (N-C18:0)
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:1) + Hydrogen ion + Octadecenoate (N-C18:1)
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C12:0) + Dodecanoate (N-C12:0) + Hydrogen ion
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:0) + Hydrogen ion + tetradecanoate (n-C14:0)
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:1) + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:0) + Hydrogen ion + Palmitic acid
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:1) + Hydrogen ion + Hexadecenoate (n-C16:1)
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:0) + Hydrogen ion + Octadecanoate (N-C18:0)
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:1) + Hydrogen ion + Octadecenoate (N-C18:1)
Water + PG(16:0/16:0) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C16:0) + Hydrogen ion + Palmitic acid
Water + PG(16:0/16:0) > 2-Acyl-sn-glycero-3-phosphoglycerol (N-C16:0) + Hydrogen ion + Palmitic acid
Water + PG(16:1(9Z)/16:1(9Z)) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C16:1) + Hydrogen ion + Hexadecenoate (n-C16:1)
Water + PG(16:1(9Z)/16:1(9Z)) > 2-Acyl-sn-glycero-3-phosphoglycerol (N-C16:1) + Hydrogen ion + Hexadecenoate (n-C16:1)
Water + PG(18:1(11Z)/18:1(11Z)) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C18:1) + Hydrogen ion + Octadecenoate (N-C18:1)
Water + PG(18:1(11Z)/18:1(11Z)) > 2-Acyl-sn-glycero-3-phosphoglycerol (N-C18:1) + Hydrogen ion + Octadecenoate (N-C18:1)
Water + PG(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C14:0) + Hydrogen ion + tetradecanoate (n-C14:0)
Water + PG(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoglycerol (N-C14:0) + Hydrogen ion + tetradecanoate (n-C14:0)
Water + PG(12:0/12:0) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C12:0) + Dodecanoate (N-C12:0) + Hydrogen ion
Water + PG(12:0/12:0) > 2-Acyl-sn-glycero-3-phosphoglycerol (n-C12:0) + Dodecanoate (N-C12:0) + Hydrogen ion
Water + PG(14:1(7Z)/14:1(7Z)) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C14:1) + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + PG(14:1(7Z)/14:1(7Z)) > 2-Acyl-sn-glycero-3-phosphoglycerol (N-C14:1) + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + PG(18:0/18:0) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C18:0) + Hydrogen ion + Octadecanoate (N-C18:0)
Water + PG(18:0/18:0) > 2-Acyl-sn-glycero-3-phosphoglycerol (N-C18:0) + Hydrogen ion + Octadecanoate (N-C18:0)
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C12:0) + Water > Dodecanoate (N-C12:0) + Glycerylphosphorylethanolamine + Hydrogen ion
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:0) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + tetradecanoate (n-C14:0)
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:1) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Tetradecenoate (N-C14:1)
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:0) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Palmitic acid
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:1) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Hexadecenoate (n-C16:1)
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:0) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Octadecanoate (N-C18:0)
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:1) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Octadecenoate (N-C18:1)
2-Acyl-sn-glycero-3-phosphoglycerol (n-C12:0) + Water > Dodecanoate (N-C12:0) + Glycerophosphoglycerol + Hydrogen ion
2-Acyl-sn-glycero-3-phosphoglycerol (N-C14:0) + Water > Glycerophosphoglycerol + Hydrogen ion + tetradecanoate (n-C14:0)
2-Acyl-sn-glycero-3-phosphoglycerol (N-C14:1) + Water > Glycerophosphoglycerol + Hydrogen ion + Tetradecenoate (N-C14:1)
2-Acyl-sn-glycero-3-phosphoglycerol (N-C16:0) + Water > Glycerophosphoglycerol + Hydrogen ion + Palmitic acid
2-Acyl-sn-glycero-3-phosphoglycerol (N-C16:1) + Water > Glycerophosphoglycerol + Hydrogen ion + Hexadecenoate (n-C16:1)
2-Acyl-sn-glycero-3-phosphoglycerol (N-C18:0) + Water > Glycerophosphoglycerol + Hydrogen ion + Octadecanoate (N-C18:0)
2-Acyl-sn-glycero-3-phosphoglycerol (N-C18:1) + Water > Glycerophosphoglycerol + Hydrogen ion + Octadecenoate (N-C18:1)
2-dodecanoyl-sn-glycerol 3-phosphate + Water > Dodecanoate (N-C12:0) + Glycerol 3-phosphate +2 Hydrogen ion
2-hexadec-9-enoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate +2 Hydrogen ion + Hexadecenoate (n-C16:1)
2-hexadecanoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate +2 Hydrogen ion + Palmitic acid
2-octadec-11-enoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate +2 Hydrogen ion + Octadecenoate (N-C18:1)
2-octadecanoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate +2 Hydrogen ion + Octadecanoate (N-C18:0)
2-tetradec-7-enoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate +2 Hydrogen ion + Tetradecenoate (N-C14:1)
2-tetradecanoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate +2 Hydrogen ion + tetradecanoate (n-C14:0)
2-Demethylmenaquinol 8 + S-Adenosylmethionine > S-Adenosylhomocysteine + Hydrogen ion + Menaquinol 8
2-Octaprenyl-6-methoxy-1,4-benzoquinol + S-Adenosylmethionine > 2-Octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol + S-Adenosylhomocysteine + Hydrogen ion
FADH2 + 2 Fe3+ > FAD +2 Iron +2 Hydrogen ion
FAD + Hydrogen ion + NADH > FADH2 + NAD
Hydrogen ion + NADH + Riboflavin > NAD + Reduced riboflavin
Hydrogen ion + NADH + Succinic acid semialdehyde <> gamma-Hydroxybutyrate + NAD
Adenosine triphosphate + L-Rhamnulose <> ADP + Hydrogen ion + L-Rhamnulose 1-phosphate
Adenosine triphosphate + D-Sedoheptulose 7-phosphate > ADP + Hydrogen ion + Sedoheptulose 1,7-bisphosphate
Adenosine triphosphate + D-Tagatose 6-phosphate > ADP + Hydrogen ion + D-Tagatose 1,6-bisphosphate
CDP-1,2-didodecanoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
CDP-1,2-dihexadec-9-enoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
CDP-1,2-dihexadecanoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
CDP-1,2-dioctadec-11-enoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
CDP-1,2-Dioctadecanoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
CDP-1,2-ditetradec-7-enoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
CDP-1,2-ditetradecanoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
Adenosine triphosphate + Glycerol <> ADP + Glycerol 3-phosphate + Hydrogen ion
1,4-Dihydroxy-2-naphthoic acid + Hydrogen ion + Octaprenyl diphosphate > 2-Demethylmenaquinol 8 + Carbon dioxide + Pyrophosphate
L-Cysteine + O-Succinyl-L-homoserine <> L-Cystathionine + Hydrogen ion + Succinic acid
2 Hydrogen ion + 5,10-Methylene-THF + NADH > 5-Methyltetrahydrofolic acid + NAD
Acetol + Hydrogen ion + NADH > (R)-Propane-1,2-diol + NAD
Glycerol + NAD <> Dihydroxyacetone + Hydrogen ion + NADH
Aminoacetone + Hydrogen ion + NADH <> 1-Amino-2-propanol + NAD
Hydrogen ion + Pyruvaldehyde + NADH > D-Lactaldehyde + NAD
Carbon dioxide + Water + Phosphoenolpyruvic acid <> Hydrogen ion + Oxalacetic acid + Phosphate + Hydrogen carbonate
N-Acetyl-L-glutamate 5-semialdehyde + NADP + Phosphate <> N-Acetyl-L-glutamyl 5-phosphate + Hydrogen ion + NADPH
Hydrogen ion + NADPH + UDP-N-Acetyl-3-(1-carboxyvinyl)-D-glucosamine <> NADP + UDP-N-Acetylmuraminate
Adenosine triphosphate + Pantothenic acid <> D-4'-Phosphopantothenate + ADP + Hydrogen ion
S-Adenosylmethionine + NADPH + L-Tyrosine > p-Cresol + 5'-Deoxyadenosine + Dehydroglycine + Hydrogen ion + L-Methionine + NADP
2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate + 4-Methyl-5-(2-phosphoethyl)-thiazole + Hydrogen ion <> Pyrophosphate + Thiamine monophosphate
5-Aminoimidazole ribonucleotide + Water + NAD > 4-Amino-2-methyl-5-phosphomethylpyrimidine +2 Formic acid +3 Hydrogen ion + NADH
4 Hydrogen ion + Uroporphyrinogen III <>4 Carbon dioxide + Coproporphyrin III
Adenosine triphosphate + Glycine + 5-Phosphoribosylamine <> ADP + Glycineamideribotide + Hydrogen ion + Phosphate
1,2-Diacyl-sn-glycerol (didodecanoyl, n-C12:0) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
1,2-Diacyl-sn-glycerol (dihexadec-9-enoyl, n-C16:1) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
1,2-Diacyl-sn-glycerol (dihexadecanoyl, n-C16:0) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
1,2-Diacyl-sn-glycerol (dioctadec-11-enoyl, n-C18:1) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
1,2-Diacyl-sn-glycerol (dioctadecanoyl, n-C18:0) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
1,2-Diacyl-sn-glycerol (ditetradec-7-enoyl, n-C14:1) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
1,2-Diacyl-sn-glycerol (ditetradecanoyl, n-C14:0) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
D-Allose + Adenosine triphosphate > ADP + D-Allose 6-phosphate + Hydrogen ion
L-Arginine + Hydrogen ion > Agmatine + Carbon dioxide
2 Adenosine triphosphate + Hydrogen ion > Diadenosine tetraphosphate + Pyrophosphate
Hydrogen ion + PS(16:0/16:0) <> Carbon dioxide + PE(14:0/14:0)
Hydrogen ion + PS(16:0/16:0) > Carbon dioxide + PE(14:0/14:0)
Hydrogen ion + PS(16:0/16:0) > Carbon dioxide + PE(14:0/14:0)
Hydrogen ion + PS(16:0/16:0) > Carbon dioxide + PE(14:0/14:0)
Hydrogen ion + PS(16:0/16:0) > Carbon dioxide + PE(14:0/14:0)
Hydrogen ion + PS(16:0/16:0) > Carbon dioxide + PE(14:0/14:0)
Hydrogen ion + PS(16:0/16:0) > Carbon dioxide + PE(14:0/14:0)
Cytidine triphosphate + Water > CDP + Hydrogen ion + Phosphate
Guanosine triphosphate + Water > Guanosine diphosphate + Hydrogen ion + Phosphate
L-Aspartic acid + Guanosine triphosphate + Inosinic acid <> Adenylsuccinic acid + Guanosine diphosphate +2 Hydrogen ion + Phosphate
L-Ascorbate 6-phosphate + Water > 3-Dehydro-L-gulonate 6-phosphate + Hydrogen ion
Adenosine 2',3'-cyclic phosphate + Water > 3'-AMP + Hydrogen ion
Guanosine 2',3'-cyclic phosphate + Water > Guanosine 3'-phosphate + Hydrogen ion
2',3'-Cyclic UMP + Water > 3'-UMP + Hydrogen ion
2',3'-Cyclic CMP + Water > 3'-CMP + Hydrogen ion
L-Alanine-D-glutamate-meso-2,6-diaminoheptanedioate-D-alanine + Adenosine triphosphate + UDP-N-Acetylmuraminate > ADP + Hydrogen ion + Phosphate + UDP-N-acetylmuramoyl-L-alanyl-D-gamma-glutamyl-meso-2,6-diaminopimelate-D-alanine
L-alanine-D-glutamate-meso-2,6-diaminoheptanedioate + Adenosine triphosphate + UDP-N-Acetylmuraminate > ADP + Hydrogen ion + Phosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate
Adenosine triphosphate + Water + Magnesium > ADP + Hydrogen ion + Magnesium + Phosphate
5-Keto-D-gluconate + Hydrogen ion + NADPH <> Gluconic acid + NADP
5-Keto-D-gluconate + Hydrogen ion + NADH <> D-Galactonate + NAD
5-Keto-D-gluconate + Hydrogen ion + NADPH > D-Galactonate + NADP
D-Mannonate + NAD <> D-Fructuronate + Hydrogen ion + NADH
D-Galactonate + NAD > Hydrogen ion + NADH + 5-Keto-D-gluconate
FADH2 + 2 Ferroxamine > FAD +2 Iron +2 ferroxamine minus Fe(3) +2 Hydrogen ion
2 Ferroxamine + FMNH >2 Iron +2 ferroxamine minus Fe(3) + Flavin Mononucleotide +2 Hydrogen ion
2 Ferroxamine + Reduced riboflavin >2 Iron +2 ferroxamine minus Fe(3) +2 Hydrogen ion + Riboflavin
Adenosine triphosphate + Hydrogen ion + Caprylic acid > Adenosine monophosphate + octanoate (protein bound) + Pyrophosphate
Water + Xanthosine 5-triphosphate > Hydrogen ion + Phosphate + XDP
2'-Deoxyinosine triphosphate + Water > DIDP + Hydrogen ion + Phosphate
dTDP-4-Acetamido-4,6-dideoxy-D-galactose + Undecaprenyl-diphospho-N-acetylglucosamine-N-acetylmannosaminuronate > dTDP + Hydrogen ion + Undecaprenyl-diphospho N-acetylglucosamine-N-acetylmannosaminuronate-N-acetamido-4,6-dideoxy-D-galactose
Adenosine triphosphate + Hydrogen ion + Water > Inosine triphosphate + Ammonium
Guanosine triphosphate + Hydrogen ion + Water > Ammonium + Xanthosine 5-triphosphate
L-Glutamic-gamma-semialdehyde > L-D-1-Pyrroline-5-carboxylic acid + Hydrogen ion + Water
dATP + Hydrogen ion + Water > 2'-Deoxyinosine triphosphate + Ammonium
Carbamic acid + 2 Hydrogen ion > Carbon dioxide + Ammonium
L-2-Amino-3-oxobutanoic acid + Hydrogen ion > Aminoacetone + Carbon dioxide
2-Isopropyl-3-oxosuccinate + Hydrogen ion > Ketoleucine + Carbon dioxide
2 [4Fe-4S] iron-sulfur cluster + 2 Hydrogen ion + Hydrogen peroxide >2 [3Fe-4S] damaged iron-sulfur cluster +2 Fe3+ +2 Water
2 [4Fe-4S] iron-sulfur cluster + 2 Hydrogen ion + 2 Nitric oxide >2 [3Fe-4S] damaged iron-sulfur cluster +2 Fe3+ + Water + Nitrous oxide
Oxygen + 4 Fe2+ + 4 Hydrogen ion + 4 Fe2+ <>4 Fe3+ +2 Water
2 L-Glutamate + NAD <> L-Glutamine + alpha-Ketoglutarate + NADH + Hydrogen ion
2 Glutathione + NAD <> Glutathione disulfide + NADH + Hydrogen ion
NAD + 2 Cob(II)alamin + 2 Water + Hydrogen ion <> NADH +2 Aquacobalamin
2 L-Glutamate + NADP <> L-Glutamine + alpha-Ketoglutarate + NADPH + Hydrogen ion
2 Glutathione + NADP <> Glutathione disulfide + NADPH + Hydrogen ion
S-Adenosylmethionine + Hydrogen ion <> S-Adenosylmethioninamine + Carbon dioxide
L-Lactic acid + 2 Ferricytochrome c + Ferricytochrome c <> Pyruvic acid +2 Ferrocytochrome c +2 Hydrogen ion + Ferrocytochrome c
Pyruvaldehyde + NAD + Water <> Pyruvic acid + NADH + Hydrogen ion
L-Malic acid + NAD <> Pyruvic acid + Carbon dioxide + NADH + Hydrogen ion
(R)-Malate + NAD <> Pyruvic acid + Carbon dioxide + NADH + Hydrogen ion
L-Malic acid + NADP <> Pyruvic acid + Carbon dioxide + NADPH + Hydrogen ion
Acetaldehyde + Coenzyme A + NAD <> Acetyl-CoA + NADH + Hydrogen ion
L-Glutamate + NAD + Water <> alpha-Ketoglutarate + Ammonia + NADH + Hydrogen ion
L-Glutamic-gamma-semialdehyde + NAD + Water <> L-Glutamate + NADH + Hydrogen ion
L-Glutamate + NADP + Water <> alpha-Ketoglutarate + Ammonia + NADPH + Hydrogen ion
Isocitric acid + NADP <> alpha-Ketoglutarate + Carbon dioxide + NADPH + Hydrogen ion
UDP-Glucose + Water + 2 NAD <> Uridine diphosphate glucuronic acid +2 NADH +2 Hydrogen ion
Protoporphyrin IX + Fe2+ <> Heme +2 Hydrogen ion + Fe2+
L-Malic acid + NAD <> Oxalacetic acid + NADH + Hydrogen ion
Glycolic acid + NADP <> Glyoxylic acid + NADPH + Hydrogen ion
Formic acid + NAD <> Hydrogen ion + Carbon dioxide + NADH
Primary alcohol + NAD <> Aldehyde + NADH + Hydrogen ion
D-Lactic acid + NAD <> Pyruvic acid + NADH + Hydrogen ion
L-D-1-Pyrroline-5-carboxylic acid + NAD + 2 Water <> L-Glutamate + NADH + Hydrogen ion
L-D-1-Pyrroline-5-carboxylic acid + NADP + 2 Water <> L-Glutamate + NADPH + Hydrogen ion
Succinic acid semialdehyde + NAD + Water <> Succinic acid + NADH + Hydrogen ion
Succinic acid semialdehyde + NADP + Water <> Succinic acid + NADPH + Hydrogen ion
Ethanol + NAD <> Acetaldehyde + NADH + Hydrogen ion
Ammonium hydroxide + 3 NAD + Water + Ammonia <> Nitrite +3 NADH +3 Hydrogen ion
Ammonium hydroxide + 3 NADP + Water <> Nitrite +3 NADPH +3 Hydrogen ion
Glycerol 3-phosphate + NAD <> Dihydroxyacetone phosphate + NADH + Hydrogen ion
Glycerol 3-phosphate + NADP <> Dihydroxyacetone phosphate + NADPH + Hydrogen ion
Hydrogen sulfide + 3 NADP + 3 Water <> Sulfite +3 NADPH +3 Hydrogen ion
Tetrahydrofolic acid + NAD <> Dihydrofolic acid + NADH + Hydrogen ion
Tetrahydrofolic acid + 2 NAD <> Folic acid +2 NADH +2 Hydrogen ion
Tetrahydrofolic acid + NADP <> Dihydrofolic acid + NADPH + Hydrogen ion
Tetrahydrofolic acid + 2 NADP <> Folic acid +2 NADPH +2 Hydrogen ion
2-Ketobutyric acid + Carbon dioxide + NADH + Hydrogen ion <> D-Erythro-3-Methylmalate + NAD
Glycerol + NAD <> Dihydroxyacetone + NADH + Hydrogen ion
D-Glyceraldehyde 3-phosphate + Phosphate + NAD <> Glyceric acid 1,3-biphosphate + NADH + Hydrogen ion
Dethiobiotin + Sulfur donor + 2 S-Adenosylmethionine + 2 e- + 2 Hydrogen ion <> Biotin +2 L-Methionine +2 5'-Deoxyadenosine
2 Ferricytochrome c + Nitrite + Water <> Nitrate +2 Ferrocytochrome c +2 Hydrogen ion
Inosinic acid + NAD + Water <> Xanthylic acid + NADH + Hydrogen ion
Inosinic acid + Ammonia + NADP <> Guanosine monophosphate + NADPH + Hydrogen ion
L-Histidinal + Water + NAD <> L-Histidine + NADH + Hydrogen ion
Butanal + Coenzyme A + NAD <> Butanoyl-CoA + NADH + Hydrogen ion
2 Reduced ferredoxin + Acetyl-CoA + Carbon dioxide + 2 Hydrogen ion + Oxidized ferredoxin <>2 Oxidized ferredoxin + Pyruvic acid + Coenzyme A + Reduced ferredoxin
Glycine + Tetrahydrofolic acid + NAD <> 5,10-Methylene-THF + Ammonia + Carbon dioxide + NADH + Hydrogen ion
5-Methyltetrahydrofolic acid + NADP <> 5,10-Methylene-THF + NADPH + Hydrogen ion
L-Proline + NAD <> L-D-1-Pyrroline-5-carboxylic acid + NADH + Hydrogen ion
L-Proline + NADP <> L-D-1-Pyrroline-5-carboxylic acid + NADPH + Hydrogen ion
Glycolaldehyde + NAD + Water <> Glycolic acid + NADH + Hydrogen ion
Glyceric acid + NAD <> Hydroxypyruvic acid + NADH + Hydrogen ion
Glyceric acid + NADP <> Hydroxypyruvic acid + NADPH + Hydrogen ion
Lactaldehyde + NAD + Water <> L-Lactic acid + NADH + Hydrogen ion
L-Threonine + NAD <> L-2-Amino-3-oxobutanoic acid + NADH + Hydrogen ion
(2S,3S)-2,3-Dihydro-2,3-dihydroxybenzoate + NAD <> 2-Pyrocatechuic acid + NADH + Hydrogen ion
3-Phospho-D-glycerate + NAD <> Phosphohydroxypyruvic acid + NADH + Hydrogen ion
6-Phosphogluconic acid + NADP <> D-Ribulose 5-phosphate + Carbon dioxide + NADPH + Hydrogen ion
2-Keto-3-deoxy-D-gluconic acid + NAD <> (4S)-4,6-Dihydroxy-2,5-dioxohexanoate + NADH + Hydrogen ion
5,10-Methenyltetrahydrofolate + Water <> N10-Formyl-THF + Hydrogen ion
Dihydrolipoamide + NAD <> Lipoamide + NADH + Hydrogen ion
Prephenate + NAD <> 4-Hydroxyphenylpyruvic acid + Carbon dioxide + NADH + Hydrogen ion
Gluconic acid + NADP <> 2-Keto-D-gluconic acid + NADPH + Hydrogen ion + 2-Dehydro-D-gluconate
Glyceric acid + NAD <> Tartronate semialdehyde + NADH + Hydrogen ion
Glyceric acid + NADP <> Tartronate semialdehyde + NADPH + Hydrogen ion
Hypoxanthine + NAD + Water <> Xanthine + NADH + Hydrogen ion
L-Homoserine + NAD <> L-Aspartate-semialdehyde + NADH + Hydrogen ion
L-Homoserine + NADP <> L-Aspartate-semialdehyde + NADPH + Hydrogen ion
Ethylene glycol + NAD <> Glycolaldehyde + NADH + Hydrogen ion
D-Erythrose 4-phosphate + NAD + Water <> 4-Phospho-D-erythronate + NADH + Hydrogen ion
Quinate + NAD <> 3-Dehydroquinate + NADH + Hydrogen ion
Isocitric acid + NADP <> Oxalosuccinic acid + NADPH + Hydrogen ion
Oxoadipic acid + Coenzyme A + NAD <> Glutaryl-CoA + Carbon dioxide + NADH + Hydrogen ion
(S)-3-Hydroxybutanoyl-CoA + NAD <> Acetoacetyl-CoA + NADH + Hydrogen ion
(S)-3-Hydroxybutanoyl-CoA + NADP + 3-Hydroxybutyryl-CoA <> Acetoacetyl-CoA + NADPH + Hydrogen ion
2 Reduced rubredoxin + NAD <>2 Oxidized rubredoxin + NADH + Hydrogen ion
Thioredoxin + NADP + Thioredoxin <> Thioredoxin disulfide + NADPH + Hydrogen ion + Thioredoxin disulfide
Xanthine + NAD + Water <> Uric acid + NADH + Hydrogen ion
Retinol + NAD <> Retinal + NADH + Hydrogen ion
Dihydrofolic acid + NAD <> Folic acid + NADH + Hydrogen ion
Dihydrofolic acid + NADP <> Folic acid + NADPH + Hydrogen ion
Propylene glycol + NAD <> Lactaldehyde + NADH + Hydrogen ion
L-Aspartate-semialdehyde + Phosphate + NADP <> L-Aspartyl-4-phosphate + NADPH + Hydrogen ion
Nicotinate D-ribonucleoside + Phosphate <> Nicotinic acid + alpha-D-Ribose 1-phosphate + Hydrogen ion
Shikimic acid + NADP <> 3-Dehydro-shikimate + NADPH + Hydrogen ion
D-Mannonate + NAD <> D-Fructuronate + NADH + Hydrogen ion
(R)-Pantoate + NADP <> 2-Dehydropantoate + NADPH + Hydrogen ion
D-Lactaldehyde + NAD <> Pyruvaldehyde + NADH + Hydrogen ion
Phenylacetaldehyde + NAD + Water <> Benzeneacetic acid + NADH + Hydrogen ion
Meso-Tartaric acid + NAD <> 2-Hydroxy-3-oxosuccinate + NADH + Hydrogen ion
4-Aminobutyraldehyde + NAD + Water <> gamma-Aminobutyric acid + NADH + Hydrogen ion
D-Altronate + NAD <> 5-Keto-D-gluconate + NADH + Hydrogen ion
Betaine aldehyde + NAD + Water <> Betaine + NADH +2 Hydrogen ion
Betaine aldehyde + NADP + Water <> Betaine + NADPH +2 Hydrogen ion
3-Dehydro-L-gulonate + NAD <> 2,3-Diketo-L-gulonate + NADH + Hydrogen ion
3-Dehydro-L-gulonate + NADP <> 2,3-Diketo-L-gulonate + NADPH + Hydrogen ion
2 3-Hydroxyanthranilic acid + 4 Oxygen <> Cinnavalininate +2 Superoxide anion +2 Hydrogen peroxide +2 Hydrogen ion
Sorbitol-6-phosphate + NAD <> beta-D-Fructose 6-phosphate + NADH + Hydrogen ion
beta-D-Glucose 6-phosphate + NADP <> 6-Phosphonoglucono-D-lactone + NADPH + Hydrogen ion
Deoxythymidine diphosphate-L-rhamnose + NADP <> dTDP-4-Dehydro-6-deoxy-L-mannose + NADPH + Hydrogen ion
Siroheme + 2 Hydrogen ion <> Fe2+ + Sirohydrochlorin
(S)-Ureidoglycolic acid + NAD <> Oxalureate + NADH + Hydrogen ion
(S)-Ureidoglycolic acid + NADP <> Oxalureate + NADPH + Hydrogen ion
L-Histidinol + NAD <> L-Histidinal + NADH + Hydrogen ion
2-Acetolactate + NADPH + Hydrogen ion <> 2,3-Dihydroxyisovaleric acid + NADP
UDP-N-Acetylmuraminate + NAD <> UDP-N-Acetyl-3-(1-carboxyvinyl)-D-glucosamine + NADH + Hydrogen ion
UDP-N-Acetylmuraminate + NADP <> UDP-N-Acetyl-3-(1-carboxyvinyl)-D-glucosamine + NADPH + Hydrogen ion
Hydroxyproline + NAD <> Pyrroline hydroxycarboxylic acid + NADH + Hydrogen ion
Hydroxyproline + NADP <> Pyrroline hydroxycarboxylic acid + NADPH + Hydrogen ion
L-Glutamic-gamma-semialdehyde + Phosphate + NADP <> L-Glutamyl 5-phosphate + NADPH + Hydrogen ion + L-Glutamic acid 5-phosphate
UDP-N-Acetyl-D-mannosamine + 2 NAD + Water <> UDP-N-Acetyl-D-mannosaminouronate +2 NADH +2 Hydrogen ion
N-Acetyl-L-glutamate 5-semialdehyde + Phosphate + NADP <> N-Acetyl-L-glutamyl 5-phosphate + NADPH + Hydrogen ion
5-Amino-6-(5'-phosphoribitylamino)uracil + NADP <> 5-Amino-6-(5'-phosphoribosylamino)uracil + NADPH + Hydrogen ion
Cyanate + Hydrogen ion + Hydrogen carbonate <> Carbon dioxide + Carbamic acid
Hydrogen selenide + 3 NADP + 3 Water <> Selenite +3 NADPH +5 Hydrogen ion
Dihydrolipoylprotein + NAD <> Lipoylprotein + NADH + Hydrogen ion
Precorrin 2 + NAD <> Sirohydrochlorin + NADH + Hydrogen ion
N-Methylputrescine + Oxygen + Hydrogen ion <> 1-Methylpyrrolinium + Hydrogen peroxide + Ammonia
L-Glutamyl-tRNA(Glu) + NADPH + Hydrogen ion + tRNA(Glu) <> (S)-4-Amino-5-oxopentanoate + tRNA(Glu) + NADP + L-Glutamyl-tRNA(Glu)
Nicotinamide ribotide + Dimethylbenzimidazole <> Nicotinic acid + N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole + Hydrogen ion
Tetrahydrodipicolinate + NAD <> 2,3-Dihydrodipicolinic acid + NADH + Hydrogen ion
Tetrahydrodipicolinate + NADP <> 2,3-Dihydrodipicolinic acid + NADPH + Hydrogen ion
2-Methyl-3-hydroxybutyryl-CoA + NAD <> 2-Methylacetoacetyl-CoA + NADH + Hydrogen ion
4-Phospho-D-erythronate + NAD <> 2-Oxo-3-hydroxy-4-phosphobutanoic acid + NADH + Hydrogen ion
3-Isopropylmalate + NAD <> 2-Isopropyl-3-oxosuccinate + NADH + Hydrogen ion
Butyryl-[acp] + NAD <> But-2-enoyl-[acyl-carrier protein] + NADH + Hydrogen ion
(R)-2,3-Dihydroxy-isovalerate + NADP <> 3-Hydroxy-3-methyl-2-oxobutanoic acid + NADPH + Hydrogen ion
Pyrroline hydroxycarboxylic acid + NAD + 2 Water <> L-erythro-4-Hydroxyglutamate + NADH + Hydrogen ion
Pyrroline hydroxycarboxylic acid + NADP + 2 Water <> L-erythro-4-Hydroxyglutamate + NADPH + Hydrogen ion
(3R)-3-Hydroxybutanoyl-[acyl-carrier protein] + NADP <> Acetoacetyl-[acp] + NADPH + Hydrogen ion
(3R)-3-Hydroxyoctanoyl-[acyl-carrier protein] + NADP <> 3-Oxooctanoyl-[acp] + NADPH + Hydrogen ion
(3R)-3-Hydroxypalmitoyl-[acyl-carrier protein] + NADP <> 3-Oxohexadecanoyl-[acp] + NADPH + Hydrogen ion
(3R)-3-Hydroxytetradecanoyl-[acyl-carrier protein] + NADP <> 3-Oxotetradecanoyl-[acp] + NADPH + Hydrogen ion
Dodecanoyl-[acyl-carrier protein] + NAD <> trans-Dodec-2-enoyl-[acp] + NADH + Hydrogen ion
(S)-3-Hydroxyhexadecanoyl-CoA + NAD <> 3-Oxohexadecanoyl-CoA + NADH + Hydrogen ion
(S)-3-Hydroxydodecanoyl-CoA + NAD <> 3-Oxododecanoyl-CoA + NADH + Hydrogen ion
(S)-Hydroxyoctanoyl-CoA + NAD <> 3-Oxooctanoyl-CoA + NADH + Hydrogen ion
(S)-Hydroxyhexanoyl-CoA + NAD <> 3-Oxohexanoyl-CoA + NADH + Hydrogen ion
O-Acetylserine + Thiosulfate + Thioredoxin + Hydrogen ion <> L-Cysteine + Sulfite + Thioredoxin disulfide + Acetic acid
3,4-Dihydroxyphenylglycol + NAD <> 3,4-Dihydroxymandelaldehyde + NADH + Hydrogen ion
(R)-3-Hydroxyhexanoyl-[acp] + NADP <> 3-Oxohexanoyl-[acp] + NADPH + Hydrogen ion
Hexanoyl-[acp] + NAD <> trans-Hex-2-enoyl-[acp] + NADH + Hydrogen ion
Octanoyl-[acp] + NAD <> trans-Oct-2-enoyl-[acp] + NADH + Hydrogen ion
Decanoyl-[acp] + NAD <> trans-Dec-2-enoyl-[acp] + NADH + Hydrogen ion
(R)-3-Hydroxydodecanoyl-[acp] + NADP <> 3-Oxododecanoyl-[acp] + NADPH + Hydrogen ion
Tetradecanoyl-[acp] + NAD <> trans-Tetradec-2-enoyl-[acp] + NADH + Hydrogen ion
Hexadecanoyl-[acp] + NAD <> trans-Hexadec-2-enoyl-[acp] + NADH + Hydrogen ion
2-Octaprenylphenol + Oxygen + NADPH + Hydrogen ion <> 2-Octaprenyl-6-hydroxyphenol + NADP + Water
N2-Succinyl-L-glutamic acid 5-semialdehyde + NAD + Water <> N-Succinyl-L-glutamate + NADH + Hydrogen ion
L-erythro-4-Hydroxyglutamate + NADH + Hydrogen ion <> L-4-Hydroxyglutamate semialdehyde + NAD + Water
(S)-3-Hydroxyisobutyrate + NAD <> (S)-Methylmalonic acid semialdehyde + NADH + Hydrogen ion
(R) 2,3-Dihydroxy-3-methylvalerate + NADP <> (R)-3-Hydroxy-3-methyl-2-oxopentanoate + NADPH + Hydrogen ion
trans-3-Chloro-2-propene-1-ol + NAD <> trans-3-Chloroallyl aldehyde + NADH + Hydrogen ion
cis-3-Chloro-2-propene-1-ol + NAD <> cis-3-Chloroallyl aldehyde + NADH + Hydrogen ion
4-Chlorobiphenyl + Oxygen + NADH + Hydrogen ion <> cis-2,3-Dihydro-2,3-dihydroxy-4'-chlorobiphenyl + NAD
4-Chlorobiphenyl + Oxygen + NADPH + Hydrogen ion <> cis-2,3-Dihydro-2,3-dihydroxy-4'-chlorobiphenyl + NADP
Biphenyl + Oxygen + NADH + Hydrogen ion <> cis-2,3-Dihydro-2,3-dihydroxybiphenyl + NAD
Biphenyl + Oxygen + NADPH + Hydrogen ion <> cis-2,3-Dihydro-2,3-dihydroxybiphenyl + NADP
4-Nitrocatechol + Oxygen + 3 Hydrogen ion <> Benzene-1,2,4-triol + Nitrite + Water
4-Sulfolactone + Water <> HSO3- + 2-Maleylacetate + Hydrogen ion
Ethylbenzene + Oxygen + NADH + Hydrogen ion <> cis-1,2-Dihydro-3-ethylcatechol + NAD
Galactitol 1-phosphate + NAD <> D-Tagatose 6-phosphate + NADH + Hydrogen ion
3-Hydroxybutanoyl-CoA + NADP <> Acetoacetyl-CoA + NADPH + Hydrogen ion
Sorbitol-6-phosphate + NAD <> beta-D-Fructose 6-phosphate + NADH + Hydrogen ion
O-Phospho-4-hydroxy-L-threonine + NAD <> 2-Amino-3-oxo-4-phosphonooxybutyrate + NADH + Hydrogen ion
L-Idonate + NADP <> 5-Dehydro-D-gluconate + NADPH + Hydrogen ion
2-C-Methyl-D-erythritol-4-phosphate + NADP <> 1-Deoxy-D-xylulose 5-phosphate + NADPH + Hydrogen ion
GDP-L-Fucose + NADP <> GDP-4-Dehydro-6-deoxy-D-mannose + NADPH + Hydrogen ion
FMNH + NAD <> Flavin Mononucleotide + NADH + Hydrogen ion
FMNH + NADP <> Flavin Mononucleotide + NADPH + Hydrogen ion
Ammonia + 2 Water + 6 Ferricytochrome c + Ferricytochrome c <> Nitrite +6 Ferrocytochrome c +6 Hydrogen ion + Ferrocytochrome c
1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADPH + Hydrogen ion <> Isopentenyl pyrophosphate + NADP + Water
2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinone + Oxygen + NADPH + Hydrogen ion <> 2-octaprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinone + NADP + Water
Tartaric acid + NAD <> 2-Hydroxy-3-oxosuccinate + NADH + Hydrogen ion
alpha-Pinene + Oxygen + 2 Hydrogen ion + 2 e- <> Pinocarveol + Water
Hydrocinnamic acid + Oxygen + NADH + Hydrogen ion <> cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD
trans-Cinnamic acid + Oxygen + NADH + Hydrogen ion <> cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD
cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD <> 3-(2,3-Dihydroxyphenyl)propionic acid + NADH + Hydrogen ion
cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD <> Trans-2,3-Dihydroxycinnamate + NADH + Hydrogen ion
3-(3-Hydroxyphenyl)propanoic acid + Oxygen + NADH + Hydrogen ion <> 3-(2,3-Dihydroxyphenyl)propionic acid + Water + NAD
3-Hydroxycinnamic acid + Oxygen + NADH + Hydrogen ion <> Trans-2,3-Dihydroxycinnamate + Water + NAD
Quinate + NADP <> 3-Dehydroquinate + NADPH + Hydrogen ion
Shikimic acid + NAD <> 3-Dehydro-shikimate + NADH + Hydrogen ion
Bisphenol A + NADH + Hydrogen ion + Oxygen <> 1,2-Bis(4-hydroxyphenyl)-2-propanol + NAD + Water
2,2-Bis(4-hydroxyphenyl)-1-propanol + NADH + Hydrogen ion + Oxygen <> 2,3-Bis(4-hydroxyphenyl)-1,2-propanediol + NAD + Water
1-Hydroxymethylnaphthalene + NAD <> 1-Naphthaldehyde + NADH + Hydrogen ion
(2-Naphthyl)methanol + NAD <> 2-Naphthaldehyde + NADH + Hydrogen ion
(3S)-3-Hydroxyadipyl-CoA + NAD <> 3-Oxoadipyl-CoA + NADH + Hydrogen ion
S-(Hydroxymethyl)glutathione + NAD <> S-Formylglutathione + NADH + Hydrogen ion
Chloral hydrate + NADH + Hydrogen ion <> Trichloroethanol + NAD + Water
1,2-Dibromoethane + Glutathione + Hydrogen ion <> Glutathione episulfonium ion +2 Hydrobromic acid
3-Dehydro-L-gulonate 6-phosphate + Hydrogen ion <> L-Xylulose 5-phosphate + Carbon dioxide
5-Methyltetrahydrofolic acid + NAD <> 5,10-Methylene-THF + NADH + Hydrogen ion
Dimethylallylpyrophosphate + NADP + Water <> 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADPH + Hydrogen ion
gamma-Glutamyl-gamma-butyraldehyde + NAD + Water <> 4-(Glutamylamino) butanoate + NADH + Hydrogen ion
gamma-Glutamyl-gamma-butyraldehyde + NADP + Water <> 4-(Glutamylamino) butanoate + NADPH + Hydrogen ion
Enzyme N6-(dihydrolipoyl)lysine + NAD <> Enzyme N6-(lipoyl)lysine + NADH + Hydrogen ion
Uridine diphosphate glucuronic acid + NAD <> UDP-4-Keto-pyranose + Carbon dioxide + NADH + Hydrogen ion
Anthracene + Oxygen + 2 Hydrogen ion + 2 e- <> Anthracene-9,10-dihydrodiol
3-Oxooctadecanoyl-CoA + NADPH + Hydrogen ion <> 3-Hydroxyoctadecanoyl-CoA + NADP
3-Oxostearoyl-[acp] + NADPH + Hydrogen ion <> 3-Hydroxyoctadecanoyl-[acp] + NADP
(2E)-Octadecenoyl-[acp] + NADH + Hydrogen ion <> Octadecanoyl-[acyl-carrier protein] + NAD
Trinitrotoluene + 2 NADPH + 2 Hydrogen ion <> 4-Hydroxylamino-2,6-dinitrotoluene +2 NADP + Water
Trinitrotoluene + 2 NADH + 2 Hydrogen ion <> 4-Hydroxylamino-2,6-dinitrotoluene +2 NAD + Water
Trinitrotoluene + 2 NADH + 2 Hydrogen ion <> 2-Hydroxylamino-4,6-dinitrotoluene +2 NAD + Water
3-Hydroxy-5-methylhex-4-enoyl-CoA + NAD <> 5-Methyl-3-oxo-4-hexenoyl-CoA + NADH + Hydrogen ion
Isopentenyl pyrophosphate + NAD + Water <> 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH + Hydrogen ion
Dimethylallylpyrophosphate + NAD + Water <> 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH + Hydrogen ion
6-Thioinosine-5'-monophosphate + NAD + Water <> 6-Thioxanthine 5'-monophosphate + NADH + Hydrogen ion
Aldophosphamide + NADH + Hydrogen ion <> Alcophosphamide + NAD
2-Phenyl-1,3-propanediol monocarbamate + NAD <> 3-Carbamoyl-2-phenylpropionaldehyde + NADH + Hydrogen ion
4-Hydroxy-5-phenyltetrahydro-1,3-oxazin-2-one + NAD <> 5-Phenyl-1,3-oxazinane-2,4-dione + NADH + Hydrogen ion
2-Polyprenyl-3-methyl-6-methoxy-1,4-benzoquinone + Oxygen + NADPH + Hydrogen ion <> 2-Polyprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinone + NADP + Water
3-Hydroxypropanoate + NADP <> Malonic semialdehyde + NADPH + Hydrogen ion
2 NADPH + 2 Hydrogen ion + Methylselenic acid <>2 NADP +2 Water + Methaneselenol
3-Oxo-5,6-dehydrosuberyl-CoA semialdehyde + NADP + Water <> 3-Oxo-5,6-dehydrosuberyl-CoA + NADPH + Hydrogen ion
Phenylacetyl-CoA + Oxygen + NADPH + Hydrogen ion <> 2-(1,2-Epoxy-1,2-dihydrophenyl)acetyl-CoA + Water + NADP + 2-(1,2-Epoxy-1,2-dihydrophenyl)acetyl-CoA
2-Octaprenylphenol + Oxygen + NADPH + Hydrogen ion > 2-Octaprenyl-6-hydroxyphenol + Water + NADP
Adenosine triphosphate + an aliphatic sulfonate + Water > an aliphatic sulfonate + ADP + Phosphate + Hydrogen ion
D-Ribulose + Adenosine triphosphate > Hydrogen ion + D-Ribulose-1-phosphate + ADP
4,6-Dideoxy-4-oxo-dTDP-D-glucose + NADH + Hydrogen ion <> Deoxythymidine diphosphate-L-rhamnose + NAD
(2,3-Dihydroxybenzoyl)adenylic acid + L-Seryl-AMP <> Hydrogen ion + Enterochelin + Adenosine monophosphate
Hydrogen ion + Formic acid > Carbon dioxide + Hydrogen (gas)
NAD + Glycine + Tetrahydrofolic acid > Hydrogen ion + 5,10-Methylene-THF + Ammonia + Carbon dioxide + NADH
NAD + Ethylene glycol <> Hydrogen ion + Glycolaldehyde + NADH
Hydrogen ion + L-Glutamate + Adenosine triphosphate + NADPH > ADP + L-Glutamic-gamma-semialdehyde + NADP + Phosphate
4-(2-aminophenyl)-2,4-dioxobutanoate > kynurenate + Water + Hydrogen ion
an oxidized electron acceptor + Ascorbic acid + Hydrogen ion > a reduced electron acceptor + monodehydroascorbate
Guanosine triphosphate + hydroxyl radical > Hydrogen ion + 8-oxo-GTP
dGTP + hydroxyl radical > Hydrogen ion + 8-oxo-dGTP
2-Oxo-4-methylthiobutanoic acid + hydroxyl radical > Hydrogen ion + ethylene + methanethiol + Carbon dioxide
Hydrogen ion + Hydrogen peroxide + Iron > hydroxyl radical + OH<SUP>-</SUP> + Fe<SUP>3+</SUP>
dehydroascorbate (bicyclic form) > 2,3-Diketo-L-gulonate + Hydrogen ion
dehydroascorbate (bicyclic form) + Hydrogen peroxide > L-threonate + Oxalic acid + Hydrogen ion
Selenite + Glutathione + Hydrogen ion > Selenodiglutathione + Glutathione disulfide + Water
dehydroascorbate (bicyclic form) > cyclic-2,3-<i>O</i>-oxalyl-L-threonate + Hydrogen ion
2-carboxy-L-xylonolactone + Water > 2-carboxy-L-<i>threo</i>-pentonate + Hydrogen ion
monodehydroascorbate + Hydrogen ion > Ascorbic acid + L-dehydro-ascorbate
a 2(R)-hydroperoxy fatty acid + Hydrogen ion > a fatty aldehyde + Carbon dioxide + Water
(<i>S</i>)-2-acetolactate + an oxidized electron acceptor + Hydrogen ion > diacetyl + Carbon dioxide + a reduced electron acceptor
5,10-Methenyltetrahydrofolate + Water Hydrogen ion + N5-Formyl-H4F
Hydrogen ion + 2-Isopropyl-3-oxosuccinate > Ketoleucine + Carbon dioxide
Hydrogen ion + coumarinate > coumarin + Water
Hydrogen ion + Sulfite <> bisulfite
2-Amino-3-oxo-4-phosphonooxybutyrate + Hydrogen ion > 1-Amino-propan-2-one-3-phosphate + Carbon dioxide
Propylene glycol + NAD <> acetol + NADH + Hydrogen ion
S-Adenosylmethionine + a [protein]-L-glutamine > Hydrogen ion + S-Adenosylhomocysteine + a [protein]-N<sup>5</sup>-methyl-L-glutamine
Ribose-1-phosphate + Adenosine triphosphate > Hydrogen ion + Ribose 1,5-bisphosphate + ADP
Enterochelin + Water > Hydrogen ion + 2,3-Dihydroxybenzoylserine
Hydrogen ion + Pyruvic acid + Acetaldehyde > acetoin + Carbon dioxide
Glutathione + Adenosine triphosphate + Water > Glutathione + ADP + Phosphate + Hydrogen ion
2-Pyrocatechuic acid + Oxygen > Hydrogen ion + 2-Carboxymuconate
Hydrogen ion > Hydrogen (gas)
menadiol + Oxygen > Hydrogen ion + menadione + Superoxide anion
Thiamine pyrophosphate + Water > Hydrogen ion + Thiamine monophosphate + Phosphate
2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate + Water > Hydrogen ion + 4-Amino-2-methyl-5-phosphomethylpyrimidine + Phosphate
a 1,2-diacyl-<i>sn</i>-glycerol 3-diphosphate + Water PA(16:0/16:0) + Phosphate + Hydrogen ion
&alpha;-Kdo-(2->4)-&alpha;-Kdo-(2->6)-lipid IV<SUB>A</SUB> + ADP-L-Glycero-D-manno-heptose Hydrogen ion + heptosyl-Kdo<sub>2</sub>-lipid IV<sub>A</sub> + ADP
3,4-dihydroxyphenylacetyl-CoA + Water 3,4-Dihydroxybenzeneacetic acid + Coenzyme A + Hydrogen ion
Guanosine diphosphate mannose + Water > Hydrogen ion + Guanosine monophosphate + D-Mannose 1-phosphate
Cadaverine + S-Adenosylmethioninamine > Hydrogen ion + Aminopropylcadaverine + 5'-Methylthioadenosine
Ammonia + Hydrogen ion <> Ammonium
OH<SUP>-</SUP> + Hydrogen ion <> Water
Carbamic acid + Hydrogen ion > Ammonia + Carbon dioxide
an L-1-phosphatidyl-glycerol + Adenosine triphosphate > an L-1-phosphatidylglycerol-phosphate + ADP + Hydrogen ion
L-Galactonate + NAD > Hydrogen ion + D-tagaturonate + NADH
Hydrogen ion + Lipid A-core + Undecaprenyl diphosphate lipid A-core 1-diphosphate + Di-trans,poly-cis-undecaprenyl phosphate
poly-&beta;-1,6-N-acetyl-D-glucosamine + Water Hydrogen ion + partially N-deacetylated poly-&beta;-1,6-N-acetyl-D-glucosamine + Acetic acid
4,5-Dihydroxy-2,3-pentanedione + Adenosine triphosphate > Hydrogen ion + P-DPD + ADP
Hydrogen ion + Heme Protoporphyrin IX + Iron
Dihydromonapterin-triphosphate + Water > Hydrogen ion + 7,8-Dihydroneopterin + Phosphate
3-ureidoacrylate + Water > Hydrogen ion + Carbamic acid + 3-Aminoacrylate
Peroxyaminoacrylate + a reduced electron acceptor > 3-Aminoacrylate + Water + Hydrogen ion + an oxidized electron acceptor
D-Sedoheptulose 7-phosphate + Adenosine triphosphate > Hydrogen ion + Sedoheptulose 1,7-bisphosphate + ADP
bromoacetate + Glutathione Hydrogen ion + glutathione-S-acetate + Br<SUP>-</SUP>
curcumin + NADPH + Hydrogen ion > dihydrocurcumin + NADP
dihydrocurcumin + NADPH + Hydrogen ion > tetrahydrocurcumin + NADP
&alpha;-D-ribose-1,2-cyclic-phosphate-5-phosphate + Water > Hydrogen ion + Ribose 1,5-bisphosphate
D-Galactose + NAD 3-keto-&beta;-D-galactose + NADH + Hydrogen ion
&alpha;-D-ribose-1-methylphosphonate-5-triphosphate + Water > Hydrogen ion + &alpha;-D-ribose-1-methylphosphonate-5-phosphate + Pyrophosphate
Hydrogen ion + &alpha;-D-ribose-1-methylphosphonate-5-phosphate + S-Adenosylmethionine > &alpha;-D-ribose-1,2-cyclic-phosphate-5-phosphate + methane + 5'-Deoxyadenosine + L-Methionine
Hydrogen ion + 3-Mercaptopyruvic acid > Pyruvic acid + Hydrogen sulfide
3-Dehydro-L-gulonate + Adenosine triphosphate > Hydrogen ion + 3-Dehydro-L-gulonate 6-phosphate + ADP
Fructoselysine + Adenosine triphosphate > Hydrogen ion + Fructoselysine-6-phosphate + ADP
L-Glutamic-gamma-semialdehyde <> Hydrogen ion + Water + L-D-1-Pyrroline-5-carboxylic acid
Hydrogen ion + L-2-Amino-3-oxobutanoic acid > Aminoacetone + Carbon dioxide
&beta;-D-galactofuranose + Adenosine triphosphate + Water > &beta;-D-galactofuranose + ADP + Phosphate + Hydrogen ion
S-Adenosylmethionine + Uroporphyrinogen III <> S-Adenosylhomocysteine + precorrin-1 + Hydrogen ion
Adenosine triphosphate + Water + Phosphate ADP + Phosphate + Hydrogen ion
a lipopolysaccharide + Water + Adenosine triphosphate > a lipopolysaccharide + Phosphate + ADP + Hydrogen ion
Hydrogen ion + Water + Adenosine triphosphate <> Hydrogen ion + Phosphate + ADP
Hydrogen ion + Water + Adenosine triphosphate <> Hydrogen ion + Phosphate + ADP
NADP + NADH + Hydrogen ion > NADPH + NAD + Hydrogen ion
NADP + NADH + Hydrogen ion > NADPH + NAD + Hydrogen ion
NADP + Gluconic acid <> Hydrogen ion + 2-Dehydro-D-gluconate + NADPH
O-Phospho-4-hydroxy-L-threonine + NAD > Hydrogen ion + NADH + 2-Amino-3-oxo-4-phosphonooxybutyrate
NAD(P)<sup>+</sup> + L-Idonate <> NAD(P)H + 5-Keto-D-gluconate + Hydrogen ion
GDP-L-Fucose + NADP < Hydrogen ion + NADPH + GDP-4-Dehydro-6-deoxy-D-mannose
Hydrogen ion + NADPH + 2,5-Diketo-D-gluconate <> 2-Dehydro-D-gluconate + NADP
3-(2,3-Dihydroxyphenyl)propionic acid + Oxygen > Hydrogen ion + 2-Hydroxy-6-ketononadienedicarboxylate
an aldehyde + Water + an oxidized electron acceptor a carboxylate + a reduced electron acceptor + Hydrogen ion
5-Methyltetrahydrofolic acid + NAD <> 5,10-Methylene-THF + Hydrogen ion + NADH
NAD(P)<sup>+</sup> + Tetrahydropteridine <> NAD(P)H + 6,7-Dihydropteridine + Hydrogen ion
Adenosine triphosphate + Fructose 1-phosphate > Hydrogen ion + ADP + Fructose 1,6-bisphosphate
(R)-Pantoate + NADP < Hydrogen ion + 2-Dehydropantoate + NADPH
alpha-Ketoisovaleric acid + Acetyl-CoA + Water > Hydrogen ion + 3-Carboxy-3-hydroxy-isocaproate + Coenzyme A
Oxalacetic acid + Water + Propionyl-CoA <> Hydrogen ion + Methylcitric acid + Coenzyme A
2-Octaprenyl-6-methoxyphenol + Oxygen + NADPH + Hydrogen ion > 2-Octaprenyl-6-methoxy-1,4-benzoquinol + Water + NADP
2-Octaprenyl-6-hydroxyphenol + S-Adenosylmethionine > Hydrogen ion + 2-Octaprenyl-6-methoxyphenol + S-Adenosylhomocysteine
2-Octaprenyl-6-methoxy-1,4-benzoquinol + S-Adenosylmethionine > Hydrogen ion + 2-Octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol + S-Adenosylhomocysteine
S-Adenosylmethionine + a [protein]-L-&beta;-isoaspartate > S-Adenosylhomocysteine + a protein L-&beta;-isoaspartate &alpha;-methyl ester + Hydrogen ion
a phospholipid olefinic fatty acid + S-Adenosylmethionine > a phospholipid cyclopropane fatty acid + S-Adenosylhomocysteine + Hydrogen ion
Glucosamine-1P + Acetyl-CoA > Hydrogen ion + <i>N</i>-acetyl-&alpha;-D-glucosamine 1-phosphate + Coenzyme A
Hydrogen ion + Isochorismate + Oxoglutaric acid > 2-Succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate + Carbon dioxide
4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Adenosine triphosphate > Hydrogen ion + 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + ADP
Adenosine triphosphate + a [protein]-L-tyrosine > ADP + a protein-L-tyrosine phosphate + Hydrogen ion
Adenosine triphosphate + a [protein]-L-tyrosine a protein-L-tyrosine phosphate + ADP + Hydrogen ion
Hydrogen ion + Nicotinamide ribotide + Adenosine triphosphate <> NAD + Pyrophosphate
Hydrogen ion + D-Mannose 1-phosphate + Guanosine triphosphate > Guanosine diphosphate mannose + Pyrophosphate
Hydrogen ion + 2-C-Methyl-D-erythritol-4-phosphate + Cytidine triphosphate > 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Pyrophosphate
Hydrogen ion + Dephospho-CoA + Adenosine triphosphate > 2'-(5-Triphosphoribosyl)-3'-dephospho-CoA + Adenine
<i>S</i>-sulfanyl-[acceptor] + Dethiobiotin + S-Adenosylmethionine > an unsulfurated sulfur acceptor + Biotin + 5'-Deoxyadenosine + L-Methionine + Hydrogen ion
3-Isopropylmalate + NAD <> 2-Isopropyl-3-oxosuccinate + NADH + Hydrogen ion
Hydrogen ion + 3-Octaprenyl-4-hydroxybenzoate > 2-Octaprenylphenol + Carbon dioxide
Water + formyl-L-methionyl peptide > Hydrogen ion + methionyl peptide + Formic acid
a nucleoside triphosphate + Water > a nucleoside monophosphate + Pyrophosphate + Hydrogen ion
Water + Diadenosine tetraphosphate > Hydrogen ion + ADP
Guanosine triphosphate + Water > Hydrogen ion + Guanosine diphosphate + Phosphate
NAD + gamma-Hydroxybutyrate <> Hydrogen ion + NADH + Succinic acid semialdehyde
2,3-diaminopropanoate + Water > Hydrogen ion + Ammonia + Pyruvic acid
L-Serine > Hydrogen ion + Pyruvic acid + Ammonia
Fructose 6-phosphate + Adenosine triphosphate > Hydrogen ion + ADP + Fructose 1,6-bisphosphate
6-Phosphonoglucono-D-lactone + Water > Hydrogen ion + 6-Phosphogluconic acid
NAD + cholate Hydrogen ion + NADH + 3-alpha,12-alpha-dihydroxy-7-oxo-5-beta-cholanate
Hydrogen ion + L-Alanine + pimeloyl-CoA > Carbon dioxide + Coenzyme A + 8-Amino-7-oxononanoate
Adenosine triphosphate + Ferric enterobactin + Water > ADP + Phosphate + Ferric enterobactin + Hydrogen ion
Adenosine triphosphate + L-Glutamine + Water > ADP + Phosphate + L-Glutamine + Hydrogen ion
Adenosine triphosphate + L-Glutamate + Water > ADP + Phosphate + L-Glutamate + Hydrogen ion
Adenosine triphosphate + L-Histidine + Water > ADP + Phosphate + L-Histidine + Hydrogen ion
Adenosine triphosphate + L-Isoleucine + Water > ADP + Phosphate + L-Isoleucine + Hydrogen ion
Adenosine triphosphate + D-Maltose + Water > ADP + Phosphate + D-Maltose + Hydrogen ion
Adenosine triphosphate + D-Galactose + Water > ADP + Phosphate + D-Galactose + Hydrogen ion
Adenosine triphosphate + Molybdate + Water > ADP + Phosphate + Molybdate + Hydrogen ion
Water + L-Arabinose + Adenosine triphosphate > L-Arabinose + Phosphate + ADP + Hydrogen ion
Ni<SUP>2+</SUP> + Adenosine triphosphate + Water > Ni<SUP>2+</SUP> + ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + Water + an alkylphosphonate > ADP + Phosphate + an alkylphosphonate + Hydrogen ion
Adenosine triphosphate + Spermidine + Water > ADP + Phosphate + Spermidine + Hydrogen ion
Adenosine triphosphate + Putrescine + Water > ADP + Phosphate + Putrescine + Hydrogen ion
Adenosine triphosphate + L-Proline + Water > ADP + Phosphate + L-Proline + Hydrogen ion
Adenosine triphosphate + Phosphate + Water > ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + beta-D-Ribopyranose + Water > ADP + Phosphate + beta-D-Ribopyranose + Hydrogen ion
L-Lysine + Adenosine triphosphate + Water > L-Lysine + ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + Thiamine + Water > ADP + Phosphate + Thiamine + Hydrogen ion
Adenosine triphosphate + D-Xylose + Water > ADP + Phosphate + D-Xylose + Hydrogen ion
Adenosine triphosphate + Glycerol 3-phosphate + Water > ADP + Phosphate + Glycerol 3-phosphate + Hydrogen ion
Adenosine triphosphate + L-Leucine + Water > ADP + Phosphate + L-Leucine + Hydrogen ion
Adenosine triphosphate + L-Valine + Water > ADP + Phosphate + L-Valine + Hydrogen ion
Adenosine triphosphate + Ornithine + Water > ADP + Phosphate + Ornithine + Hydrogen ion
Adenosine triphosphate + L-Arginine + Water > ADP + Phosphate + L-Arginine + Hydrogen ion
D-Allose + Adenosine triphosphate + Water > D-Allose + ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + Cob(I)alamin + Water > ADP + Phosphate + Cob(I)alamin + Hydrogen ion
Zinc + Water + Adenosine triphosphate > Zinc + ADP + Phosphate + Hydrogen ion
Taurine + Adenosine triphosphate + Water > Taurine + ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + Thiosulfate + Water > ADP + Phosphate + Thiosulfate + Hydrogen ion
Sulfate + Water + Adenosine triphosphate > Sulfate + Phosphate + ADP + Hydrogen ion
Adenosine triphosphate + a dipeptide + Water > ADP + Phosphate + a dipeptide + Hydrogen ion
Adenosine triphosphate + Fe(III)dicitrate + Water > ADP + Phosphate + Fe(III)dicitrate + Hydrogen ion
NAD + Coenzyme A + Acetaldehyde <> Hydrogen ion + NADH + Acetyl-CoA
Acetoacetic acid + Hydrogen ion acetone + Carbon dioxide
acetoin + NADP diacetyl + NADPH + Hydrogen ion
(R)-2,3-Dihydroxy-isovalerate + NADP <> (<i>S</i>)-2-acetolactate + NADPH + Hydrogen ion
Hydrogen ion + Pyruvic acid <> (<i>S</i>)-2-acetolactate + Carbon dioxide
(R) 2,3-Dihydroxy-3-methylvalerate + NADP <> Hydrogen ion + 2-Aceto-2-hydroxy-butyrate + NADPH
Hydrogen ion + Pyruvic acid + 2-Ketobutyric acid > 2-Aceto-2-hydroxy-butyrate + Carbon dioxide
Adenosine triphosphate + Acetyl-CoA + Hydrogen carbonate > Hydrogen ion + Malonyl-CoA + Phosphate + ADP
Water + an acetic ester > an alcohol + Acetic acid + Hydrogen ion
O-Acetylserine + Hydrogen sulfide <> Hydrogen ion + L-Cysteine + Acetic acid
an acyl-CoA + Water > Coenzyme A + a carboxylate + Hydrogen ion
Water + an acyl phosphate > Phosphate + a carboxylate + Hydrogen ion
4-Amino-4-deoxychorismate <> Hydrogen ion + p-Aminobenzoic acid + Pyruvic acid
Water + Adenosine triphosphate > Hydrogen ion + Phosphate + ADP
L-Aspartic acid + Inosinic acid + Guanosine triphosphate > Hydrogen ion + adenylo-succinate + Phosphate + Guanosine diphosphate
Adenosine phosphosulfate + Adenosine triphosphate > Hydrogen ion + Phosphoadenosine phosphosulfate + ADP
2-Demethylmenaquinol 8 + S-Adenosylmethionine > Menaquinol 8 + Hydrogen ion + S-Adenosylhomocysteine
Adenosine triphosphate + Phosphoribosylformylglycineamidine > Hydrogen ion + ADP + Phosphate + 5-Aminoimidazole ribonucleotide
Glycine + Acetyl-CoA <> Hydrogen ion + L-2-Amino-3-oxobutanoic acid + Coenzyme A
3-chloro-D-alanine + thioglycolate <> Hydrogen ion + S-Carboxymethyl-D-cysteine + Chloride
a primary alcohol + NAD <> an aldehyde + NADH + Hydrogen ion
Ethanol + NAD <> Acetaldehyde + NADH + Hydrogen ion
NADP + an alcohol an aldehyde + NADPH + Hydrogen ion
an aldehyde + Water + NADP a carboxylate + NADPH + Hydrogen ion
Hydrogen ion + Allantoic acid + Water > <i>S</i>-ureidoglycine + Ammonia + Carbon dioxide
<i>S</i>-allantoin + Water > Hydrogen ion + Allantoic acid
D-Allose + Adenosine triphosphate > Hydrogen ion + D-Allose 6-phosphate + ADP
NAD + D-Altronate <> Hydrogen ion + NADH + D-tagaturonate
Aminoacetone + Water + Oxygen > Hydrogen ion + Pyruvaldehyde + Ammonia + Hydrogen peroxide
an aliphatic amine + Water + Oxygen > an aldehyde + Ammonia + Hydrogen peroxide + Hydrogen ion
Water + Oxygen + Phenylethylamine > Hydrogen ion + Hydrogen peroxide + Ammonia + Phenylacetaldehyde
4-Aminobutyraldehyde + NAD + Water > gamma-Aminobutyric acid + NADH + Hydrogen ion
1-Amino-2-propanol + NAD < Hydrogen ion + Aminoacetone + NADH
Chorismate + L-Glutamine > Hydrogen ion + 2-Aminobenzoic acid + Pyruvic acid + L-Glutamate
Hydrogen ion + L-Arginine > Carbon dioxide + Agmatine
L-Arginine + Succinyl-CoA > Hydrogen ion + N2-Succinyl-L-arginine + Coenzyme A
L-Aspartic acid + Citrulline + Adenosine triphosphate > Hydrogen ion + L-arginino-succinate + Pyrophosphate + Adenosine monophosphate
L-Glutamine + L-Aspartic acid + Adenosine triphosphate + Water > Hydrogen ion + L-Glutamate + L-Asparagine + Pyrophosphate + Adenosine monophosphate
L-Asparagine + Water > Hydrogen ion + L-Aspartic acid + Ammonia
L-Aspartic acid <> Hydrogen ion + Fumaric acid + Ammonia
NADP + Phosphate + L-Aspartate-semialdehyde <> Hydrogen ion + NADPH + L-Aspartyl-4-phosphate
L-Aspartic acid + Carbamoylphosphate > Hydrogen ion + Ureidosuccinic acid + Phosphate
Hydrogen ion + L-Aspartic acid > beta-Alanine + Carbon dioxide
Betaine aldehyde + NAD + Water > Hydrogen ion + Betaine + NADH
Ammonia + Carbon dioxide + Adenosine triphosphate < Hydrogen ion + Carbamoylphosphate + ADP
a carboxylic ester + Water > an alcohol + a carboxylate + Hydrogen ion
Adenosine triphosphate + L-Glutamine + Hydrogen carbonate + Water > Hydrogen ion + Carbamoylphosphate + L-Glutamate + Phosphate + ADP
a CDP-diacylglycerol + Water <> PA(16:0/16:0) + Cytidine monophosphate + Hydrogen ion
Cytidine triphosphate + PA(16:0/16:0) + Hydrogen ion > Pyrophosphate + a CDP-diacylglycerol
Oxalacetic acid + Acetyl-CoA + Water <> Hydrogen ion + Citric acid + Coenzyme A
Adenosylcobinamide-GDP + N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole > adenosylcobalamin 5'-phosphate + Guanosine monophosphate + Hydrogen ion
Adenosylcobinamide-GDP + N1-(alpha-D-ribosyl)-5,6-dimethyl-benzimidazole Hydrogen ion + Adenosylcobalamin + Guanosine monophosphate
Adenosyl cobinamide + Adenosine triphosphate > Hydrogen ion + Adenosyl cobinamide phosphate + ADP
Hydrogen ion + Adenosyl cobinamide phosphate + Guanosine triphosphate > Adenosylcobinamide-GDP + Pyrophosphate
Adenosine triphosphate + Uridine triphosphate + L-Glutamine + Water > Hydrogen ion + ADP + Phosphate + Cytidine triphosphate + L-Glutamate
a nucleoside 2',3'-cyclic phosphate + Water > a nucleoside 3'-phosphate + Hydrogen ion
L-Cystathionine + Water > Hydrogen ion + Pyruvic acid + Ammonia + L-Homocysteine
Cytidine + Guanosine triphosphate > Hydrogen ion + Cytidine monophosphate + Guanosine diphosphate
D-Alanine + Adenosine triphosphate > Hydrogen ion + D-Alanyl-D-alanine + Phosphate + ADP
dCTP + Water > Hydrogen ion + dCMP + Pyrophosphate
D-Cysteine + Water <> Pyruvic acid + Hydrogen sulfide + Ammonia + Hydrogen ion
2-Dehydro-3-deoxy-D-galactonate + Adenosine triphosphate > Hydrogen ion + 2-Dehydro-3-deoxy-D-galactonate-6-phosphate + ADP
(<i>R</i>)-pantolactone + NADP <> 2-Dehydropantoyl lactone + NADPH + Hydrogen ion
2-Keto-3-deoxy-D-gluconic acid + Adenosine triphosphate > Hydrogen ion + 2-Keto-3-deoxy-6-phosphogluconic acid + ADP
Dephospho-CoA + Adenosine triphosphate > Hydrogen ion + Coenzyme A + ADP
Carbon dioxide + 7,8-Diaminononanoate + Adenosine triphosphate > Hydrogen ion + Dethiobiotin + Phosphate + ADP
Water + dGTP > Hydrogen ion + Triphosphate + Deoxyguanosine
Hydrogen ion + Adenosine triphosphate + 2-Pyrocatechuic acid > Pyrophosphate + (2,3-Dihydroxybenzoyl)adenylic acid
NAD + (2S,3S)-2,3-Dihydro-2,3-dihydroxybenzoate > Hydrogen ion + NADH + 2-Pyrocatechuic acid
2-octaprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinone + S-Adenosylmethionine > Hydrogen ion + Ubiquinol-8 + S-Adenosylhomocysteine
Adenosine triphosphate + a 1,2-diacylglycerol <> Hydrogen ion + PA(16:0/16:0) + ADP
an aliphatic &alpha;,&omega;-diamine + Acetyl-CoA <> an aliphatic <i>N</i>-acetyl-diamine + Coenzyme A + Hydrogen ion
Hydrogen ion + <i>meso</i>-diaminopimelate > L-Lysine + Carbon dioxide
(2E)-Decenoyl-CoA + NADP <> Hydrogen ion + trans-Delta2, cis-delta4-decadienoyl-CoA + NADPH
Pyruvic acid + L-Aspartate-semialdehyde <> Hydrogen ion + Water + 2,3-Dihydrodipicolinic acid
NADP + Tetrahydrofolic acid < Hydrogen ion + NADPH + Dihydrofolic acid
L-Glutamate + 7,8-Dihydropteroic acid + Adenosine triphosphate > Hydrogen ion + Dihydrofolic acid + Phosphate + ADP
4,5-Dihydroorotic acid + Water <> Hydrogen ion + Ureidosuccinic acid
NAD(P)<sup>+</sup> + Tetrahydrodipicolinate < NAD(P)H + 2,3-Dihydrodipicolinic acid + Hydrogen ion
NAD + Dihydrouracil <> Hydrogen ion + NADH + Uracil
Precorrin 2 + NAD <> Hydrogen ion + Sirohydrochlorin + NADH
D-Ribulose 5-phosphate > Hydrogen ion + 3,4-Dihydroxy-2-butanone-4-P + Formic acid
NAD + D-Lactic acid < Hydrogen ion + NADH + Pyruvic acid
Nicotinamide ribotide + Dimethylbenzimidazole > Hydrogen ion + Nicotinic acid + N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole
all-<i>trans</i>-octaprenyl diphosphate + 1,4-Dihydroxy-2-naphthoic acid + Hydrogen ion > 2-Demethylmenaquinol 8 + Pyrophosphate + Carbon dioxide
D-Serine > Hydrogen ion + Pyruvic acid + Ammonia
NADP + Deoxythymidine diphosphate-L-rhamnose <> Hydrogen ion + NADPH + dTDP-4-dehydro-6-deoxy-&beta;-L-mannose
Hydrogen ion + Glucose 1-phosphate + Thymidine 5'-triphosphate <> dTDP-D-Glucose + Pyrophosphate
Deoxyuridine + Adenosine triphosphate > Hydrogen ion + dUMP + ADP
Deoxyuridine triphosphate + Water > Hydrogen ion + dUMP + Pyrophosphate
2-C-Methyl-D-erythritol-4-phosphate + NADP <> Hydrogen ion + 1-Deoxy-D-xylulose 5-phosphate + NADPH
Pyruvic acid + D-Glyceraldehyde 3-phosphate + Hydrogen ion > Carbon dioxide + 1-Deoxy-D-xylulose 5-phosphate
Adenosine triphosphate + L-Serine + 2-Pyrocatechuic acid > Hydrogen ion + Pyrophosphate + Adenosine monophosphate + Enterochelin
D-Erythrose 4-phosphate + Water + NAD > 4-Phospho-D-erythronate + NADH + Hydrogen ion
4-Phospho-D-erythronate + NAD > Hydrogen ion + 2-Oxo-3-hydroxy-4-phosphobutanoic acid + NADH
Ethanolamine > Hydrogen ion + Acetaldehyde + Ammonia
Flavin Mononucleotide + Adenosine triphosphate + Hydrogen ion > FAD + Pyrophosphate
Adenosine triphosphate + 5'-Phosphoribosyl-N-formylglycineamide + L-Glutamine + Water > Hydrogen ion + ADP + Phosphate + Phosphoribosylformylglycineamidine + L-Glutamate
NAD(P)<sup>+</sup> + FMNH <> NAD(P)H + Flavin Mononucleotide + Hydrogen ion
Formic acid + Hydrogen ion + a menaquinone > Hydrogen ion + Carbon dioxide + a menaquinol
Formic acid + Hydrogen ion + a menaquinone > Hydrogen ion + Carbon dioxide + a menaquinol
Water + N10-Formyl-THF > Hydrogen ion + Tetrahydrofolic acid + Formic acid
D-Fructose + Adenosine triphosphate > Hydrogen ion + Fructose 6-phosphate + ADP
Undecaprenyl phosphate + dTDP-4-Acetamido-4,6-dideoxy-D-galactose > Hydrogen ion + undecaprenyl N-acetyl-glucosaminyl-N-acetyl-mannosaminuronate-4-acetamido-4,6-dideoxy-D-galactose pyrophosphate + dTDP
L-Fuculose + Adenosine triphosphate > Hydrogen ion + L-Fuculose 1-phosphate + ADP
Galactitol 1-phosphate + NAD <> Hydrogen ion + D-Tagatose 6-phosphate + NADH
D-Galactose + Adenosine triphosphate > Hydrogen ion + Galactose 1-phosphate + ADP
D-Glyceraldehyde 3-phosphate + Phosphate + NAD <> Hydrogen ion + Glyceric acid 1,3-biphosphate + NADH
N10-Formyl-THF + Glycineamideribotide <> Hydrogen ion + Tetrahydrofolic acid + 5'-Phosphoribosyl-N-formylglycineamide
Glycineamideribotide + Formic acid + Adenosine triphosphate > Hydrogen ion + Phosphate + 5'-Phosphoribosyl-N-formylglycineamide + ADP
GDP-&alpha;-D-glucose + Water > Hydrogen ion + b-D-Glucose + Guanosine diphosphate
Guanosine diphosphate mannose + Water > D-Mannose + Hydrogen ion + Guanosine diphosphate
Adenosine triphosphate + Glyceric acid > Hydrogen ion + 2-Phospho-D-glyceric acid + ADP
Glucose 6-phosphate + NADP <> 6-Phosphonoglucono-D-lactone + NADPH + Hydrogen ion
Hydrogen ion + Glucose 1-phosphate + Adenosine triphosphate > ADP-Glucose + Pyrophosphate
Hydrogen ion + Glucose 1-phosphate + Uridine triphosphate > UDP-Glucose + Pyrophosphate
b-D-Glucose + Adenosine triphosphate > Hydrogen ion + Glucose 6-phosphate + ADP
NAD(P)<sup>+</sup> + Gluconic acid <> NAD(P)H + 5-Keto-D-gluconate + Hydrogen ion
Adenosine triphosphate + Gluconic acid > Hydrogen ion + ADP + 6-Phosphogluconic acid
Gluconolactone + Water > Hydrogen ion + Gluconic acid
Glucosamine 6-phosphate + Water <> Hydrogen ion + Fructose 6-phosphate + Ammonia
L-Glutamate + NADP < Hydrogen ion + L-Glutamine + Oxoglutaric acid + NADPH
Phosphoribulosylformimino-AICAR-P + L-Glutamine > Hydrogen ion + L-Glutamate + D-Erythro-imidazole-glycerol-phosphate + AICAR
L-Glutamine + Water > Hydrogen ion + L-Glutamate + Ammonia
Glutathione + NADP < Glutathione disulfide + NADPH + Hydrogen ion
Glycine + gamma-Glutamylcysteine + Adenosine triphosphate > Hydrogen ion + Glutathione + Phosphate + ADP
L-Cysteine + L-Glutamate + Adenosine triphosphate > Hydrogen ion + gamma-Glutamylcysteine + Phosphate + ADP
Hydrogen ion + L-Glutamate > Carbon dioxide + gamma-Aminobutyric acid
L-Glutamate + Water + NADP <> Hydrogen ion + Oxoglutaric acid + Ammonia + NADPH
L-Glutamic-gamma-semialdehyde + Phosphate + NADP < L-Glutamic acid 5-phosphate + NADPH + Hydrogen ion
Glyceric acid + Adenosine triphosphate > Hydrogen ion + 3-Phosphoglycerate + ADP
NAD(P)<sup>+</sup> + Glycerol 3-phosphate < NAD(P)H + Dihydroxyacetone phosphate + Hydrogen ion
Glycerol + NAD <> Dihydroxyacetone + NADH + Hydrogen ion
Glycerol + Adenosine triphosphate > Hydrogen ion + Glycerol 3-phosphate + ADP
Water + NAD + Glycolaldehyde > Hydrogen ion + NADH + Glycolic acid
a glycerophosphodiester + Water > an alcohol + Glycerol 3-phosphate + Hydrogen ion
Hydrogen ion + Glyoxylic acid > Carbon dioxide + Tartronate semialdehyde
S-Lactoylglutathione + Water > Hydrogen ion + Glutathione + D-Lactic acid
D-Lactic acid + Hydrogen ion < Pyruvaldehyde + Water
Glycolic acid + NADP < Hydrogen ion + NADPH + Glyoxylic acid
Adenosine triphosphate + 5-Phosphoribosylamine + Glycine <> Hydrogen ion + ADP + Phosphate + Glycineamideribotide
Ammonia + Inosinic acid + NADP < Hydrogen ion + Guanosine monophosphate + NADPH
Water + L-Glutamine + Xanthylic acid + Adenosine triphosphate > Hydrogen ion + L-Glutamate + Guanosine monophosphate + Pyrophosphate + Adenosine monophosphate
Adenosine triphosphate + Xanthylic acid + Ammonia > Hydrogen ion + Adenosine monophosphate + Pyrophosphate + Guanosine monophosphate
Spermidine + Glutathione + Adenosine triphosphate > Hydrogen ion + Glutathionylspermidine + ADP + Phosphate
1-chloro-2,4-dinitrobenzene + Glutathione <> Hydrogen ion + 2,4-dinitrophenyl-S-glutathione + Chloride
Guanosine triphosphate + Water > Hydrogen ion + Formic acid + Dihydroneopterin triphosphate
Water + Guanosine triphosphate > Hydrogen ion + Pyrophosphate + 2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Formic acid
Guanosine diphosphate + Water > Hydrogen ion + Guanosine monophosphate + Phosphate
Guanosine + Adenosine triphosphate > Hydrogen ion + Guanosine monophosphate + ADP
Dihydroneopterin triphosphate + Water > Hydrogen ion + Dihydroneopterin monophosphate + Pyrophosphate
6-Hydroxymethyl dihydropterin + Adenosine triphosphate > Hydrogen ion + 6-Hydroxymethyl-dihydropterin pyrophosphate + Adenosine monophosphate
Hydrocinnamic acid + NADH + Oxygen + Hydrogen ion > cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD
histidinal + NAD + Water > Hydrogen ion + L-Histidine + NADH
L-Histidinol + NAD > Hydrogen ion + histidinal + NADH
Phosphoribosyl-ATP + Water > Hydrogen ion + Phosphoribosyl-AMP + Pyrophosphate
L-Homocysteine + S-Adenosylmethionine Hydrogen ion + L-Methionine + S-Adenosylhomocysteine
NAD(P)<sup>+</sup> + L-Homoserine < NAD(P)H + L-Aspartate-semialdehyde + Hydrogen ion
L-Homoserine + Adenosine triphosphate > Hydrogen ion + O-Phosphohomoserine + ADP
Propionyl-CoA + Water + Glyoxylic acid <> 2-hydroxyglutarate + Hydrogen ion + Coenzyme A
Hydrogen ion + 1-(2-Carboxyphenylamino)-1'-deoxy-D-ribulose 5'-phosphate > Indoleglycerol phosphate + Carbon dioxide + Water
Water + NAD + Inosinic acid > Hydrogen ion + NADH + Xanthylic acid
Water + Pyrophosphate > Hydrogen ion + Phosphate
Inosine + Adenosine triphosphate > Hydrogen ion + Inosinic acid + ADP
Isopentenyl pyrophosphate + NAD(P)<sup>+</sup> + Water < 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NAD(P)H + Hydrogen ion
CMP-3-Deoxy-D-manno-octulosonate + lipid IV<sub>A</sub> <> Hydrogen ion + KDO-lipid IV(A) + Cytidine monophosphate
KDO-lipid IV(A) + CMP-3-Deoxy-D-manno-octulosonate <> Hydrogen ion + &alpha;-Kdo-(2->4)-&alpha;-Kdo-(2->6)-lipid IV<SUB>A</SUB> + Cytidine monophosphate
NAD + 2-Deoxygluconate <> Hydrogen ion + NADH + 3-Dehydro-2-deoxy-D-gluconate
Oxygen + L-Aspartic acid > Hydrogen ion + Hydrogen peroxide + Iminoaspartic acid
Water + NAD + Lactaldehyde > Hydrogen ion + NADH + L-Lactic acid
Hydrogen ion + NADH + Lactaldehyde <> NAD + Propylene glycol
L-Cysteine + Water > Pyruvic acid + Ammonia + Hydrogen sulfide + Hydrogen ion
2,3-Bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl 1-phosphate + UDP-2,3-Bis(3-hydroxytetradecanoyl)glucosamine > Hydrogen ion + 2,3,2',3'-Tetrakis(3-hydroxytetradecanoyl)-D-glucosaminyl-1,6-beta-D-glucosamine 1-phosphate + Uridine 5'-diphosphate
Water + UDP-2,3-Bis(3-hydroxytetradecanoyl)glucosamine > Hydrogen ion + 2,3-Bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl 1-phosphate + Uridine 5'-monophosphate
5-amino-6-(D-ribitylamino)uracil + 3,4-Dihydroxy-2-butanone-4-P > Hydrogen ion + 6,7-Dimethyl-8-(1-D-ribityl)lumazine + Phosphate + Water
Hydrogen ion + L-Lysine > Carbon dioxide + Cadaverine
2-Acylglycerophosphocholine + Water a carboxylate + Glycerophosphocholine + Hydrogen ion
L-xylulose + Adenosine triphosphate > Hydrogen ion + L-Xylulose 5-phosphate + ADP
L-Malic acid + NAD <> Hydrogen ion + Oxalacetic acid + NADH
Acetyl-CoA + Water + Glyoxylic acid > Hydrogen ion + L-Malic acid + Coenzyme A
D-Mannose + Adenosine triphosphate > Hydrogen ion + Mannose 6-phosphate + ADP
NAD + D-Mannonate <> D-Fructuronate + Hydrogen ion + NADH
Sorbitol-6-phosphate + NAD <> Hydrogen ion + Fructose 6-phosphate + NADH
Hydrogen cyanide + 3-Mercaptopyruvic acid Hydrogen ion + Pyruvic acid + Thiocyanate
Hydrogen ion + 2-Ketobutyric acid + Succinic acid + Ammonia O-Succinyl-L-homoserine + Water
Water + 5,10-Methenyltetrahydrofolate <> Hydrogen ion + N10-Formyl-THF
2-Hydroxy-6-ketononadienedicarboxylate + Water > 2-Hydroxy-2,4-pentadienoate + Succinic acid + Hydrogen ion
Hydrogen ion + 3-(3-Hydroxyphenyl)propionate + NADH + Oxygen > Water + 3-(2,3-Dihydroxyphenyl)propionic acid + NAD
S-methyl-L-methionine + L-Homocysteine Hydrogen ion + L-Methionine
N-Acetyl-D-glucosamine + Adenosine triphosphate > Hydrogen ion + N-Acetyl-D-Glucosamine 6-Phosphate + ADP
N-Acetyl-L-glutamate 5-semialdehyde + NADP + Phosphate <> Hydrogen ion + N-Acetyl-L-glutamyl 5-phosphate + NADPH
L-Glutamate + Acetyl-CoA <> Hydrogen ion + <i>N</i>-acetyl-L-glutamate + Coenzyme A
N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimelyl-D-alanyl-D-alanine-diphosphoundecaprenol + Uridine diphosphate-N-acetylglucosamine <> Hydrogen ion + N-Acetylmuramoyl-L-alanyl-D-glutamyl-L-lysyl-D-alanyl-D-alanine-diphosphoundecaprenyl-N-acetylglucosamine + Uridine 5'-diphosphate
NAD + Adenosine triphosphate > Hydrogen ion + NADP + ADP
Adenosine triphosphate + Nicotinic acid adenine dinucleotide + L-Glutamine + Water > Hydrogen ion + Adenosine monophosphate + Pyrophosphate + NAD + L-Glutamate
Hydrogen ion + a ubiquinone + NADH <> a ubiquinol + NAD
menadione + NADH + Hydrogen ion menadiol + NAD
Water + NAD <> Hydrogen ion + Adenosine diphosphate ribose + Niacinamide
Reduced riboflavin + NADP < Hydrogen ion + Riboflavin + NADPH
Water + NAD > Hydrogen ion + Nicotinamide ribotide + Adenosine monophosphate
Hydrogen ion + <i>N</i>-acetyl-&alpha;-D-glucosamine 1-phosphate + Uridine triphosphate > Uridine diphosphate-N-acetylglucosamine + Pyrophosphate
N-Acetylmannosamine + Adenosine triphosphate > Hydrogen ion + N-Acetyl-D-mannosamine 6-phosphate + ADP
Hydrogen ion + 2-Succinylbenzoyl-CoA > 1,4-Dihydroxy-2-naphthoyl-CoA + Water
Hydrogen ion + Adenosine triphosphate + Nicotinamide ribotide > Pyrophosphate + Nicotinic acid adenine dinucleotide
Niacinamide + Water > Hydrogen ion + Nicotinic acid + Ammonia
Nicotinamide ribotide + Pyrophosphate < Hydrogen ion + Nicotinic acid + Phosphoribosyl pyrophosphate
Nitrous oxide + Water + Cytochromes-C-Oxidized Nitric oxide + Hydrogen ion + Cytochromes-C-Reduced
Nicotinamide ribotide + Water > Hydrogen ion + Nicotinamide ribotide + Ammonia
Water + Nicotinamide ribotide <> Hydrogen ion + D-Ribose-5-phosphate + Niacinamide
NAD(P)H + Hydrogen ion + a quinone a quinol + NAD(P)<sup>+</sup>
a nucleoside diphosphate + Water > a nucleoside monophosphate + Phosphate + Hydrogen ion
L-Cysteine + O-Succinyl-L-homoserine > Hydrogen ion + Succinic acid + L-Cystathionine
NAD + a (3<i>S</i>)-3-hydroxyacyl-CoA > NADH + a 3-oxoacyl-CoA + Hydrogen ion
Water + Porphobilinogen <> Hydrogen ion + Ammonia + Hydroxymethylbilane
Adenosine triphosphate + 4-Amino-5-hydroxymethyl-2-methylpyrimidine <> Hydrogen ion + ADP + 4-Amino-2-methyl-5-phosphomethylpyrimidine
Ornithine + Carbamoylphosphate <> Hydrogen ion + Citrulline + Phosphate
Hydrogen ion + Ornithine > Carbon dioxide + Putrescine
Hydrogen ion + Orotidylic acid > Carbon dioxide + Uridine 5'-monophosphate
Hydrogen ion + Oxalacetic acid > Pyruvic acid + Carbon dioxide
Hydrogen ion + Oxalyl-CoA Carbon dioxide + Formyl-CoA
Hydrogen ion + 4-Phosphopantothenoylcysteine > Pantetheine 4'-phosphate + Carbon dioxide
D-4'-Phosphopantothenate + L-Cysteine + Cytidine triphosphate > Hydrogen ion + Pyrophosphate + Cytidine monophosphate + 4-Phosphopantothenoylcysteine
Hydrogen ion + Pantetheine 4'-phosphate + Adenosine triphosphate <> Dephospho-CoA + Pyrophosphate
beta-Alanine + (R)-Pantoate + Adenosine triphosphate > Hydrogen ion + Pantothenic acid + Pyrophosphate + Adenosine monophosphate
Pantothenic acid + Adenosine triphosphate > Hydrogen ion + D-4'-Phosphopantothenate + ADP
1-Amino-propan-2-one-3-phosphate + 1-Deoxy-D-xylulose 5-phosphate > Hydrogen ion + Pyridoxine 5'-phosphate + Phosphate + Water
Pyruvic acid + Adenosine triphosphate <> Hydrogen ion + ADP + Phosphoenolpyruvic acid
Water + Pyruvic acid + Adenosine triphosphate > Hydrogen ion + Phosphate + Phosphoenolpyruvic acid + Adenosine monophosphate
3-Phosphoglycerate + NAD <> Hydrogen ion + Phosphohydroxypyruvic acid + NADH
Water + NAD + Phenylacetaldehyde <> Hydrogen ion + NADH + phenylacetate
cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD > Hydrogen ion + 3-(2,3-Dihydroxyphenyl)propionic acid + NADH
a CDP-diacylglycerol + Glycerol 3-phosphate <> Cytidine monophosphate + an L-1-phosphatidylglycerol-phosphate + Hydrogen ion
an L-1-phosphatidylserine + Hydrogen ion > PE(14:0/14:0) + Carbon dioxide
a CDP-diacylglycerol + L-Serine <> Cytidine monophosphate + an L-1-phosphatidylserine + Hydrogen ion
Oxygen + Water + Pyridoxamine 5'-phosphate > Hydrogen ion + Hydrogen peroxide + Ammonia + Pyridoxal 5'-phosphate
Adenosine triphosphate + Pyridoxine > Hydrogen ion + ADP + Pyridoxine 5'-phosphate
5-Aminolevulinic acid <> Hydrogen ion + Water + Porphobilinogen
Guanosine 3',5'-bis(diphosphate) + Water > Hydrogen ion + Pyrophosphate + Guanosine diphosphate
Water + Guanosine 3'-diphosphate 5'-triphosphate > Hydrogen ion + Phosphate + Guanosine 3',5'-bis(diphosphate)
Hydrogen ion + Prephenate > Phenylpyruvic acid + Water + Carbon dioxide
Adenosine triphosphate + Hydrogen carbonate + Propionyl-CoA > Hydrogen ion + ADP + Phosphate + (S)-Methylmalonyl-CoA
Iron + Protoporphyrin IX > Heme + Hydrogen ion
Adenosine triphosphate + D-Ribose-5-phosphate <> Hydrogen ion + Phosphoribosyl pyrophosphate + Adenosine monophosphate
Pseudouridine + Adenosine triphosphate > Hydrogen ion + Pseudouridine 5'-phosphate + ADP
Adenosine triphosphate + Pyridoxamine <> Hydrogen ion + ADP + Pyridoxamine 5'-phosphate
+ Water Hydrogen ion + Pyrazinic acid + Ammonia
Adenosine triphosphate + Pyridoxal > Hydrogen ion + ADP + Pyridoxal 5'-phosphate
5-Aminoimidazole ribonucleotide + S-Adenosylmethionine 4-Amino-2-methyl-5-phosphomethylpyrimidine + 5'-Deoxyadenosine + L-Methionine + Formic acid + carbon monoxide + Hydrogen ion
L-D-1-Pyrroline-5-carboxylic acid + NAD + Water > Hydrogen ion + L-Glutamate + NADH
NAD(P)<sup>+</sup> + L-Proline < NAD(P)H + L-D-1-Pyrroline-5-carboxylic acid + Hydrogen ion
Hydrogen ion + Pyruvic acid + Lipoamide S-Acetyldihydrolipoamide + Carbon dioxide
Nicotinamide ribotide + Pyrophosphate + Carbon dioxide < Phosphoribosyl pyrophosphate + Quinolinic acid + Hydrogen ion
NAD(P)<sup>+</sup> + (S)-Ureidoglycolic acid > NAD(P)H + Oxalureate + Hydrogen ion
NADH + Copper Hydrogen ion + NAD + Cu<SUP>+</SUP>
an alcohol + Water + NAD < an organic hydroperoxide + NADH + Hydrogen ion
Cyanate + Hydrogen carbonate + Hydrogen ion > Carbamic acid + Carbon dioxide
NAD(P)H + Nitric oxide + Oxygen > NAD(P)<sup>+</sup> + Nitrate + Hydrogen ion
L-Rhamnulose + Adenosine triphosphate > Hydrogen ion + L-Rhamnulose 1-phosphate + ADP
Hydrogen ion + 6,7-Dimethyl-8-(1-D-ribityl)lumazine > 5-amino-6-(D-ribitylamino)uracil + Riboflavin
Riboflavin + Adenosine triphosphate > Hydrogen ion + Flavin Mononucleotide + ADP
5-Amino-6-(5'-phosphoribitylamino)uracil + NADP < 5-Amino-6-(5'-phosphoribosylamino)uracil + NADPH + Hydrogen ion
D-ribose + Adenosine triphosphate > Hydrogen ion + D-Ribose-5-phosphate + ADP
Nicotinamide riboside + Adenosine triphosphate > Hydrogen ion + Nicotinamide ribotide + ADP
3-Hydroxycinnamic acid + Oxygen + NADH + Hydrogen ion > Trans-2,3-Dihydroxycinnamate + Water + NAD
Adenosine triphosphate + Water > Hydrogen ion + ADP + Phosphate
L-Tyrosine + S-Adenosylmethionine + a reduced electron acceptor > Dehydroglycine + p-Cresol + 5'-Deoxyadenosine + L-Methionine + an oxidized electron acceptor + Hydrogen ion
8-oxo-dGTP + Water > Hydrogen ion + 8-oxo-dGMP + Pyrophosphate
L-Alanine + Hydrogen ion + Pimeloyl-ACPs > 8-Amino-7-oxononanoate + Carbon dioxide + ACP
2-Hydroxy-6-ketononatrienedioate + Water > 2-Hydroxy-2,4-pentadienoate + Fumaric acid + Hydrogen ion
cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD > Trans-2,3-Dihydroxycinnamate + NADH + Hydrogen ion
trans-Cinnamic acid + NADH + Oxygen + Hydrogen ion > cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD
Trans-2,3-Dihydroxycinnamate + Oxygen > 2-Hydroxy-6-ketononatrienedioate + Hydrogen ion
2,5-Diketo-D-gluconate + NAD(P)H + Hydrogen ion > 2-keto-L-gulonate + NAD(P)<sup>+</sup>
2-keto-L-gulonate + NAD(P)H + Hydrogen ion > L-Idonate + NAD(P)<sup>+</sup>
Uridine 5'-diphosphate + Water > Phosphate + Uridine 5'-monophosphate + Hydrogen ion
CDP + Water > Phosphate + Cytidine monophosphate + Hydrogen ion
a methylated nucleobase within DNA + Oxygen + Oxoglutaric acid Hydrogen ion + a nucleobase within DNA + Carbon dioxide + Formaldehyde + Succinic acid
Ascorbic acid + Hydrogen peroxide + Hydrogen ion > Ascorbic acid + L-dehydro-ascorbate + Water
FMNH + NADP < Flavin Mononucleotide + NADPH + Hydrogen ion
Reduced riboflavin + NAD(P)<sup>+</sup> Riboflavin + NAD(P)H + Hydrogen ion
Hydrogen ion + Pyruvic acid + Thiamine pyrophosphate > 2-(a-Hydroxyethyl)thiamine diphosphate + Carbon dioxide
L-Cysteine + a sulfur acceptor + Hydrogen ion L-Alanine + <i>S</i>-sulfanyl-[acceptor]
2-[(2<i>R</i>,5<i>Z</i>)-(2-carboxy-4-methylthiazol-5(2<i>H</i>)-ylidene]ethyl phosphate + 2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate + Hydrogen ion > Thiamine monophosphate + Carbon dioxide + Pyrophosphate
Thymine + Oxygen + FMNH > (<i>Z</i>)-2-methylureidoacrylate peracid + Flavin Mononucleotide + Hydrogen ion
(<i>Z</i>)-2-methylureidoacrylate peracid + Water > (<i>Z</i>)-2-methyl-peroxyaminoacrylate + Carbamic acid + Hydrogen ion
(<i>S</i>)-NADPHX + ADP NADPH + Adenosine monophosphate + Phosphate + Hydrogen ion
Adenosine triphosphate + Hydrogen carbonate + Ammonia > ADP + Phosphate + Carbamoylphosphate + Hydrogen ion
Isethionic acid + FMNH + Oxygen > Glycolaldehyde + Sulfite + Water + Flavin Mononucleotide + Hydrogen ion
NAD(P)<sup>+</sup> + S-(Hydroxymethyl)glutathione <> NAD(P)H + S-Formylglutathione + Hydrogen ion
Hydrogen ion + Tetrahydrodipicolinate + Water > L-&alpha;-amino-&epsilon;-keto-pimelate
Hypoxanthine + NAD + Water > Xanthine + NADH + Hydrogen ion
NAD(P)<sup>+</sup> + Quinate NAD(P)H + 3-Dehydroquinate + Hydrogen ion
NAD(P)<sup>+</sup> + Shikimic acid < NAD(P)H + 3-Dehydro-shikimate + Hydrogen ion
L-Proline + an oxidized electron acceptor > L-D-1-Pyrroline-5-carboxylic acid + a reduced electron acceptor + Hydrogen ion
Hydrogen ion + Molybdopterin + Adenosine triphosphate > Adenylated molybdopterin + Pyrophosphate
Lactaldehyde + NADP < Pyruvaldehyde + NADPH + Hydrogen ion
a quaternary amine + Water + Adenosine triphosphate > a quaternary amine + Phosphate + ADP + Hydrogen ion
Oxalosuccinic acid + Hydrogen ion > Oxoglutaric acid + Carbon dioxide
2-hydroxyglutarate + NAD <> Hydrogen ion + Oxoglutaric acid + NADH
Hydrogen ion + Lipoic acid + Adenosine triphosphate > Lipoyl-AMP + Pyrophosphate
3-Hydroxypropanoate + NADP < Malonic semialdehyde + NADPH + Hydrogen ion
1,4-Dihydroxy-2-naphthoyl-CoA + Water > Hydrogen ion + 1,4-Dihydroxy-2-naphthoic acid + Coenzyme A
L-Aspartic acid + Fumaric acid > Hydrogen ion + Iminoaspartic acid + Succinic acid
Isocitric acid + NADP > Oxalosuccinic acid + NADPH + Hydrogen ion
Adenosine triphosphate + Water > Hydrogen ion + ADP + Phosphate
Glutathione + Adenosine triphosphate + Water > Glutathione + ADP + Phosphate + Hydrogen ion
Adenosine diphosphate ribose + Water > Hydrogen ion + Adenosine monophosphate + D-Ribose-5-phosphate
Coproporphyrinogen III + Oxygen + Hydrogen ion > Protoporphyrinogen IX + Carbon dioxide + Water
Iron + Hydrogen ion + Oxygen > Fe<SUP>3+</SUP> + Water
2'-Deoxyinosine triphosphate + Water > Hydrogen ion + DIMP + Pyrophosphate
Xanthosine 5-triphosphate + Water > Hydrogen ion + Xanthylic acid + Pyrophosphate
Uridine 5''-diphospho-{beta}-4-deoxy-4-amino-L-arabinose + N10-Formyl-THF > Hydrogen ion + Uridine 5''-diphospho-{beta}-4-deoxy-4-formamido-L-arabinose + Tetrahydrofolic acid
Hydrogen ion + Ethyl-2-methylacetoacetate + NADPH <> Ethyl-(2R)-methyl-(3S)-hydroxybutanoate + NADP
Phenylacetyl-CoA + Oxygen + NADPH + Hydrogen ion > 2-(1,2-epoxy-1,2-dihydrophenyl)acetyl-CoA + NADP + Water
3-Hydroxyadipyl-CoA + NAD <> Hydrogen ion + 3-Oxoadipyl-CoA + NADH
L-Serine + NADP 2-Aminomalonate semialdehyde + NADPH + Hydrogen ion
UDP-N-Acetylmuraminate + L-Ala-D-Glu-meso-A2pm + Adenosine triphosphate > Hydrogen ion + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate + ADP + Phosphate
Hydrogen ion + molybdenum cofactor + Guanosine triphosphate <> Molybdopterin guanine dinucleotide + Pyrophosphate
NADPH + Hydrogen ion + an electron-transfer-related quinone > NADP + an electron-transfer-related quinol
3-Sulfinoalanine + Water Hydrogen ion + L-Alanine + Sulfite
an alkanesulfonate + Oxygen + FMNH > an aldehyde + Sulfite + Water + Flavin Mononucleotide + Hydrogen ion
Cu<SUP>+</SUP> + Hydrogen ion + Oxygen > Copper + Water
Taurine + Oxoglutaric acid + Oxygen > Hydrogen ion + Aminoacetaldehyde + Sulfite + Succinic acid + Carbon dioxide
L-Cysteine + Adenosine triphosphate + Water > L-Cysteine + ADP + Phosphate + Hydrogen ion
Glyceric acid + NADP <> Hydrogen ion + Hydroxypyruvic acid + NADPH
Hydrogen ion + R-Methylmalonyl-CoA > Propionyl-CoA + Carbon dioxide
Formic acid + an oxidized electron acceptor + Hydrogen ion > Carbon dioxide + a reduced electron acceptor
a menaquinol + Nitrate + Hydrogen ion > a menaquinone + Nitrite + Water + Hydrogen ion
a menaquinol + Nitrate + Hydrogen ion > a menaquinone + Nitrite + Water + Hydrogen ion
Adenosine triphosphate + 1-Deoxy-D-xylulose > Hydrogen ion + 1-Deoxy-D-xylulose 5-phosphate + ADP
Cytidine triphosphate + Water > Hydrogen ion + Cytidine monophosphate + Pyrophosphate
dATP + Water > Hydrogen ion + Deoxyadenosine monophosphate + Pyrophosphate
dGTP + Water > Hydrogen ion + 2'-Deoxyguanosine 5'-monophosphate + Pyrophosphate
Putrescine + L-Glutamate + Adenosine triphosphate > Hydrogen ion + gamma-Glutamyl-L-putrescine + ADP + Phosphate
NAD(P)<sup>+</sup> + gamma-Glutamyl-gamma-butyraldehyde + Water > 4-(Glutamylamino) butanoate + NAD(P)H + Hydrogen ion
Acetaldehyde + NADP + Water > Acetic acid + NADPH + Hydrogen ion
preQ<sub>1</sub> + NADP < 7-Cyano-7-carbaguanine + NADPH + Hydrogen ion
cyclic di-3',5'-guanylate + Water > Hydrogen ion + Linear dimeric GMP
Hydrogen ion + Pyruvaldehyde + NADPH > acetol + NADP
D-Glycero-D-manno-heptose 7-phosphate + Adenosine triphosphate > Hydrogen ion + D-Glycero-D-manno-heptose 1,7-bisphosphate + ADP
Hydrogen ion + D-<i>glycero</i>-&beta;-D-<i>manno</i>-heptose 1-phosphate + Adenosine triphosphate > ADP-D-Glycero-D-manno-heptose + Pyrophosphate
NADH + Water > Hydrogen ion + NMNH + Adenosine monophosphate
Water + Adenosine triphosphate + L-Methionine > Phosphate + ADP + L-Methionine + Hydrogen ion
1,6-Anhydro-N-acetylmuramate + Adenosine triphosphate + Water > Hydrogen ion + N-Acetylmuramic acid 6-phosphate + ADP
Cyclic AMP + Water > Hydrogen ion + Adenosine monophosphate
Heptosyl-KDO2-lipid A + ADP-L-Glycero-D-manno-heptose > Hydrogen ion + Heptosyl2-KDO2-lipid A + ADP
N-6-isopentyl adenosine-37 tRNA + S-Adenosylmethionine + <i>S</i>-sulfanyl-[acceptor] 2-methylthio-N-6-isopentyl adenosine-37 tRNA + S-Adenosylhomocysteine + L-Methionine + 5'-Deoxyadenosine + an unsulfurated sulfur acceptor + Hydrogen ion
Inosine triphosphate + Water > Hydrogen ion + IDP + Phosphate
Xanthosine 5-triphosphate + Water > Hydrogen ion + XDP + Phosphate
Hydrogen ion + <i>N</i>-ethylmaleimide N-Ethylsuccinimide
Thymidine 5'-triphosphate + Water > Hydrogen ion + 5-Thymidylic acid + Pyrophosphate
L-Ribulose + Adenosine triphosphate > Hydrogen ion + L-Ribulose 5-phosphate + ADP
Hydrogen ion + KDO2-Lipid A + ADP-L-Glycero-D-manno-heptose > Heptosyl-KDO2-lipid A + ADP
UDP-Glucose + Heptosyl2-KDO2-lipid A > Hydrogen ion + Glucosyl-heptosyl2-KDO2-lipid A + Uridine 5'-diphosphate
Glucosyl-heptosyl2-KDO2-lipid A + Adenosine triphosphate > Hydrogen ion + Glucosyl-heptosyl2-KDO2-lipid A-phosphate + ADP
Glucosyl-heptosyl2-KDO2-lipid A-phosphate + ADP-L-Glycero-D-manno-heptose > Hydrogen ion + Glucosyl-heptosyl3-KDO2-lipid A-phosphate + ADP
Glucosyl-heptosyl3-KDO2-lipid A-phosphate + Adenosine triphosphate > Hydrogen ion + Glucosyl-heptosyl3-KDO2-lipid A-bisphosphate + ADP
Glucosyl-heptosyl3-KDO2-lipid A-bisphosphate + Uridine diphosphategalactose > Hydrogen ion + Galactosyl-glucosyl-heptosyl3-KDO2-lipid A-bisphosphate + Uridine 5'-diphosphate
UDP-Glucose + Galactosyl-glucosyl-heptosyl3-KDO2-lipid A-bisphosphate > Hydrogen ion + Galactosyl-glucosyl2-heptosyl3-KDO2-lipid A-bisphosphate + Uridine 5'-diphosphate
UDP-Glucose + Galactosyl-glucosyl2-heptosyl3-KDO2-lipid A-bisphosphate > Hydrogen ion + Galactosyl-glucosyl3-heptosyl3-KDO2-lipid A-bisphosphate + Uridine 5'-diphosphate
Galactosyl-glucosyl3-heptosyl3-KDO2-lipid A-bisphosphate + ADP-L-Glycero-D-manno-heptose > Hydrogen ion + Lipid A-core + ADP
Hydrogen ion + 4-nitrobenzaldehyde + NADPH 4-nitrobenzyl alcohol + NADP
an aminated amine donor + 2-Ketobutyric acid + Hydrogen ion 2-aminobutyrate + a deaminated amine donor
Zinc + Water + Adenosine triphosphate > Zinc + ADP + Phosphate + Hydrogen ion
Hydrogen ion + Adenosine triphosphate + Adenosine triphosphate Diadenosine tetraphosphate + Pyrophosphate
Hydrogen ion + Adenosine triphosphate + ADP > Diadenosine triphosphate + Pyrophosphate
octyl alpha-D-glucopyranoside + UDP-D-Galacto-1,4-furanose Hydrogen ion + octyl beta-1,6-D-galactofuranosyl-alpha-D-glucopyranoside + Uridine 5'-diphosphate
Hydrogen ion + Pyruvaldehyde + NADH acetol + NAD
Hydrogen carbonate + Hydrogen ion <> Carbon dioxide + Water
a menaquinone + Hydrogen ion + Hydrogen (gas) > a menaquinol + Hydrogen ion
a menaquinone + Hydrogen ion + Hydrogen (gas) > a menaquinol + Hydrogen ion
a menaquinol + Hydrogen ion + Trimethylamine N-Oxide > a menaquinone + Water + Trimethylamine
Oxygen + Hydrogen ion + a ubiquinol > a ubiquinone + Water + Hydrogen ion
Oxygen + Hydrogen ion + a ubiquinol > a ubiquinone + Water + Hydrogen ion
Oxygen + Hydrogen ion + a ubiquinol > a ubiquinone + Water + Hydrogen ion
Oxygen + Hydrogen ion + a ubiquinol > a ubiquinone + Water + Hydrogen ion
Pyruvic acid + Hydrogen ion > L-Lactic acid
Glyceric acid + NAD <> Hydrogen ion + Tartronate semialdehyde + NADH
Hydrogen ion + Thiamine pyrophosphate + ADP <> adenosine thiamine triphosphate + Phosphate
Ubiquinone-8 + Hydrogen ion > Ubiquinol-8
Hydrogen ion + a ubiquinone + NADH > a ubiquinol + NAD
Hydrogen ion + methyl red + NADH 2-Aminobenzoic acid + N,N'-dimethyl-p-phenylenediamine + NAD
methyl-1,4-benzoquinone + NADPH + Hydrogen ion methyl-1,4-benzoquinol + NADP
NADH + Hydrogen ion + a menaquinone > a menaquinol + NAD
3,5-Tetradecadienoyl-CoA + Water > Hydrogen ion + 3,5-tetradecadienoate + Coenzyme A
N-Acetylmuramoyl-L-alanyl-D-glutamyl-L-lysyl-D-alanyl-D-alanine-diphosphoundecaprenyl-N-acetylglucosamine > Hydrogen ion + a peptidoglycan dimer (<I>meso</I>-diaminopimelate containing) + Undecaprenyl diphosphate
Glycerol 3-phosphate + NADP < Hydrogen ion + L-Glyceraldehyde 3-phosphate + NADPH
3-hydroxypropionaldehyde + NAD + Water > Hydrogen ion + 3-Hydroxypropanoate + NADH
Guanosine triphosphate + Water > Hydrogen ion + Guanosine diphosphate + Phosphate
Dihydroneopterin triphosphate + Water > Hydrogen ion + 6-Carboxy-5,6,7,8-tetrahydropterin + Triphosphate + Acetaldehyde
Cytidine triphosphate + a 2,3,4-saturated L-phosphatidate + Hydrogen ion > Pyrophosphate + a CDP-2,3,4-saturated-diacylglycerol
Hydrogen ion + molybdenum cofactor + Cytidine triphosphate > Molybdopterin cytosine dinucleotide + Pyrophosphate
<i>S</i>-sulfanyl-[acceptor] + Hydrogen cyanide an unsulfurated sulfur acceptor + Thiocyanate + Hydrogen ion
Tetrahydromonapterin + NADP < Hydrogen ion + 7,8-Dihydroneopterin + NADPH
Nitrate + Hydrogen ion > Nitrite + Water
Gluconolactone + Hydrogen ion <> b-D-Glucose
Acetic acid + Carbon dioxide + Hydrogen ion <> Pyruvic acid + Water
NAD(P)H + Nitrite + Hydrogen ion > NAD(P)<sup>+</sup> + Ammonium + Water
Inosine triphosphate + Water > Hydrogen ion + Inosinic acid + Pyrophosphate
Guanosine 3'-diphosphate 5'-triphosphate + Water > Hydrogen ion + Guanosine triphosphate + Pyrophosphate
Uracil + Oxygen + FMNH > Hydrogen ion + Ureidoacrylate peracid + Flavin Mononucleotide
Ureidoacrylate peracid + Water > Hydrogen ion + Carbamic acid + Peroxyaminoacrylate
3-hydroxypropionaldehyde + NADPH + Hydrogen ion 1,3-propanediol + NADP
2-Oxepin-2(3H)-ylideneacetyl-CoA + NADP + Water > 3-Oxo-5,6-dehydrosuberyl-CoA + NADPH + Hydrogen ion
Iron + a siderophore + NADP < an Fe(III)-siderophore + NADPH + Hydrogen ion
4-Hydroxy-L-threonine + Adenosine triphosphate > Hydrogen ion + O-Phospho-4-hydroxy-L-threonine + ADP
Dihydrothymine + NAD <> Thymine + NADH + Hydrogen ion
6-Carboxy-5,6,7,8-tetrahydropterin + S-Adenosylmethionine + Hydrogen ion > 7-carboxy-7-deazaguanine + 5'-Deoxyadenosine + L-Methionine + Ammonia
PE(14:0/14:0) + Water a fatty acid + a 2-lyso-phosphatidyl-ethanolamine + Hydrogen ion
(<i>S</i>)-NADHX + ADP > Hydrogen ion + NADH + Adenosine monophosphate + Phosphate
a guanine<sup>1516</sup> in 16S rRNA + S-Adenosylmethionine > an <i>N</i><sup>2</sup>-methylguanine<sup>1516</sup> in 16S rRNA + S-Adenosylhomocysteine + Hydrogen ion
Iron + (2,3-dihydroxybenzoylserine)<sub>3</sub> + NADP < ferric 2,3-dihydroxybenzoylserine + NADPH + Hydrogen ion
PE(14:0/14:0) + Water > a 1-lyso-2-acyl-<i>sn</i>-glycero-3-phosphoethanolamine + a fatty acid + Hydrogen ion
Butanesulfonate + Oxygen + FMNH > Butanal + Sulfite + Water + Flavin Mononucleotide + Hydrogen ion
3-Dehydro-L-gulonate + NAD < Hydrogen ion + 2,3-Diketo-L-gulonate + NADH
Hydrogen ion + 3-Dehydro-L-gulonate 6-phosphate > L-Xylulose 5-phosphate + Carbon dioxide
5-Aminoimidazole ribonucleotide + Adenosine triphosphate + Hydrogen carbonate > Hydrogen ion + N5-Carboxyaminoimidazole ribonucleotide + ADP + Phosphate
1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + Water + Oxidized-ferredoxins < 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate + Hydrogen ion + Reduced-ferredoxins
NAD(P)<sup>+</sup> + Dimethylallylpyrophosphate + Water < NAD(P)H + Hydrogen ion + 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate
Xanthine + NAD + Water > Uric acid + NADH + Hydrogen ion
N1-Methyladenine + Oxygen + Oxoglutaric acid > Hydrogen ion + Adenine + Carbon dioxide + Formaldehyde + Succinic acid
N3-Methylcytosine + Oxygen + Oxoglutaric acid > Hydrogen ion + Cytosine + Carbon dioxide + Formaldehyde + Succinic acid
3-oxo-5,6-dehydrosuberyl-CoA semialdehyde + NADP + Water > 3-Oxo-5,6-dehydrosuberyl-CoA + NADPH + Hydrogen ion
S-Formylglutathione + Water > Hydrogen ion + Formic acid + Glutathione
Adenosine triphosphate + 5-Amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylate + L-Aspartic acid > Hydrogen ion + ADP + Phosphate + SAICAR
Hydrogen ion + S-Adenosylmethionine > Carbon dioxide + S-Adenosylmethioninamine
a reduced electron acceptor + Selenocysteine <> L-Alanine + Selenium + an oxidized electron acceptor + Hydrogen ion
NADP + Shikimic acid < Hydrogen ion + NADPH + 3-Dehydro-shikimate
Shikimic acid + Adenosine triphosphate > Hydrogen ion + Shikimate 3-phosphate + ADP
Sirohydrochlorin + Iron <> Hydrogen ion + Siroheme
Sorbitol-6-phosphate + NAD <> Hydrogen ion + Fructose 6-phosphate + NADH
Acetyl-CoA + Spermidine <> N1-Acetylspermidine + Hydrogen ion + Coenzyme A
Putrescine + S-Adenosylmethioninamine > Hydrogen ion + Spermidine + 5'-Methylthioadenosine
N2-Succinyl-L-glutamic acid 5-semialdehyde + NAD + Water > N<SUP>2</SUP>-succinylglutamate + NADH + Hydrogen ion
Water + NAD + Succinic acid semialdehyde > Hydrogen ion + NADH + Succinic acid
Succinic acid semialdehyde + NADP + Water > Succinic acid + NADPH + Hydrogen ion
Hydrogen ion + Sulfate + Adenosine triphosphate > Adenosine phosphosulfate + Pyrophosphate
Water + NADP + Hydrogen sulfide < Hydrogen ion + NADPH + Sulfite
Hydrogen ion + Superoxide anion > Hydrogen peroxide + Oxygen
D-Tagatose 6-phosphate + Adenosine triphosphate > Hydrogen ion + D-Tagatose 1,6-bisphosphate + ADP
dTDP-D-Fucosamine + Acetyl-CoA > Hydrogen ion + dTDP-4-Acetamido-4,6-dideoxy-D-galactose + Coenzyme A
2,3,2',3'-Tetrakis(3-hydroxytetradecanoyl)-D-glucosaminyl-1,6-beta-D-glucosamine 1-phosphate + Adenosine triphosphate <> Hydrogen ion + lipid IV<sub>A</sub> + ADP
Hydrogen ion + 4-Methyl-5-(2-phosphoethyl)-thiazole + 2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate > Thiamine monophosphate + Pyrophosphate
Adenosine triphosphate + 5-(2-Hydroxyethyl)-4-methylthiazole > Hydrogen ion + ADP + 4-Methyl-5-(2-phosphoethyl)-thiazole
Thiamine + Adenosine triphosphate > Hydrogen ion + Thiamine monophosphate + ADP
a 2,3,4-saturated fatty acyl CoA + Water a 2,3,4-saturated fatty acid + Coenzyme A + Hydrogen ion
Hydrogen cyanide + Thiosulfate > Hydrogen ion + Thiocyanate + Sulfite
L-Threonine > Hydrogen ion + 2-Ketobutyric acid + Ammonia
L-Threonine + NAD > Hydrogen ion + L-2-Amino-3-oxobutanoic acid + NADH
Thymidine + Adenosine triphosphate > Hydrogen ion + 5-Thymidylic acid + ADP
Trimethylamine N-Oxide + NADH + Hydrogen ion > Trimethylamine + NAD + Water
Potassium + Water + Adenosine triphosphate > Potassium + Phosphate + ADP + Hydrogen ion
Magnesium + Water + Adenosine triphosphate > Magnesium + Phosphate + ADP + Hydrogen ion
Adenosine triphosphate + Arsenate + Water > ADP + Arsenate + Phosphate + Hydrogen ion
Heme + Adenosine triphosphate + Water > Phosphate + ADP + Heme + Hydrogen ion
Water + Adenosine triphosphate + D-Methionine > Phosphate + ADP + D-Methionine + Hydrogen ion
Cu<SUP>+</SUP> + Water + Adenosine triphosphate > Cu<SUP>+</SUP> + Phosphate + ADP + Hydrogen ion
Adenosine triphosphate + Water + N-Acetyl-D-glucosamine > N-Acetyl-D-glucosamine + ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + L-Aspartic acid + Water > L-Aspartic acid + ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + L-Ala-D-Glu-meso-A2pm + Water > L-Ala-D-Glu-meso-A2pm + ADP + Phosphate + Hydrogen ion
(2R,4S)-2-Methyl-2,3,3,4-tetrahydroxytetrahydrofuran + Adenosine triphosphate + Water > (2R,4S)-2-Methyl-2,3,3,4-tetrahydroxytetrahydrofuran + ADP + Phosphate + Hydrogen ion
Glycerol 2-phosphate + Water + Adenosine triphosphate > Glycerol 2-phosphate + ADP + Hydrogen ion + Phosphate
selenate + Water + Adenosine triphosphate > selenate + ADP + Phosphate + Hydrogen ion
Selenite + Water + Adenosine triphosphate > Selenite + ADP + Phosphate + Hydrogen ion
&alpha;-D-galactofuranose + Adenosine triphosphate + Water > &alpha;-D-galactofuranose + Phosphate + ADP + Hydrogen ion
Maltotriose + Adenosine triphosphate + Water > ADP + Phosphate + Maltotriose + Hydrogen ion
Maltotetraose + Adenosine triphosphate + Water > ADP + Maltotetraose + Phosphate + Hydrogen ion
a 2,3,4-saturated fatty acyl CoA + NADP > a <i>trans</i>-2-enoyl-CoA + NADPH + Hydrogen ion
UDP-Glucose + &alpha;-D-glucose 6-phosphate > Hydrogen ion + Uridine 5'-diphosphate + Trehalose 6-phosphate
L-Tryptophan + Water <> Hydrogen ion + Indole + Pyruvic acid + Ammonia
NAD(P)<sup>+</sup> + Glyceric acid < NAD(P)H + Tartronate semialdehyde + Hydrogen ion
L-Alanine + UDP-N-Acetylmuraminate + Adenosine triphosphate <> Hydrogen ion + UDP-N-Acetylmuramoyl-L-alanine + Phosphate + ADP
D-Glutamic acid + UDP-N-Acetylmuramoyl-L-alanine + Adenosine triphosphate > Hydrogen ion + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamate + Phosphate + ADP
D-Alanyl-D-alanine + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate + Adenosine triphosphate > Hydrogen ion + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-6-carboxy-L-lysyl-D-alanyl-D-alanine + Phosphate + ADP
<i>meso</i>-diaminopimelate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamate + Adenosine triphosphate > Hydrogen ion + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate + Phosphate + ADP
Undecaprenyl-N-acetyl-alpha-D-glucosaminyl-pyrophosphate + UDP-N-Acetyl-D-mannosaminouronate <> Hydrogen ion + Undecaprenyl phosphate + Uridine 5'-diphosphate
UDP-N-Acetyl-D-mannosamine + NAD + Water <> UDP-N-Acetyl-D-mannosaminouronate + NADH + Hydrogen ion
NADP + UDP-N-Acetylmuraminate < Hydrogen ion + NADPH + UDP-N-Acetyl-3-(1-carboxyvinyl)-D-glucosamine
a UDP-sugar + Water > Uridine 5'-monophosphate + an &alpha;-D-aldose-1-phosphate + Hydrogen ion
UDP-Glucose + Water + NAD > Hydrogen ion + NADH + Uridine diphosphate glucuronic acid
Undecaprenyl diphosphate + Water > Hydrogen ion + Di-trans,poly-cis-undecaprenyl phosphate + Phosphate
Uridine + Guanosine triphosphate > Hydrogen ion + Uridine 5'-monophosphate + Guanosine diphosphate
Hydrogen ion + Uroporphyrinogen III > Carbon dioxide + Coproporphyrinogen III
<i>S</i>-ureidoglycine + Water > Hydrogen ion + Ammonia + (S)-Ureidoglycolic acid
D-Xylulose + Adenosine triphosphate > Hydrogen ion + Xylulose 5-phosphate + ADP
Hydrogen ion + 2,5-Diketo-D-gluconate + NADPH <> 5-Keto-D-gluconate + NADP
Hydrogen ion + 2-Dehydro-D-gluconate + NADPH <> L-Idonate + NADP
4 Iron + 4 Hydrogen ion + Oxygen >4 Fe3+ +2 Water
Cyanate + Carbonic acid + 2 Hydrogen ion > Ammonia +2 Carbon dioxide
Siroheme + 2 Hydrogen ion > Sirohydrochlorin + Iron
2 Iron + Hydrogen peroxide + 2 Hydrogen ion >2 Fe3+ +2 Water
2 reduced ferredoxin + NADP + Hydrogen ion >2 oxidized ferredoxin + NADPH
4 Iron + 4 Hydrogen ion + Oxygen >4 Fe3+ +2 Water
Coproporphyrinogen III + Oxygen + 2 Hydrogen ion > Protoporphyrinogen IX +2 Carbon dioxide +2 Water
Heme + 2 Hydrogen ion > Protoporphyrin IX + Iron
L-Lactic acid + 2 Ferricytochrome c > Pyruvic acid +2 Ferrocytochrome c +2 Hydrogen ion
Ammonia + 2 Water + 6 Ferricytochrome c > Nitrite +6 Ferrocytochrome c +7 Hydrogen ion
2 superoxide + 2 Hydrogen ion > Oxygen + Hydrogen peroxide
2 superoxide + 2 Hydrogen ion > Oxygen + Hydrogen peroxide
2 superoxide + 2 Hydrogen ion > Oxygen + Hydrogen peroxide
L-Tyrosine + S-adenosyl-L-methionine + reduced acceptor > 2-iminoacetate + p-Cresol + 5'-Deoxyadenosine + L-Methionine + acceptor +2 Hydrogen ion
Trimethylamine + 2 (ferricytochrome c)-subunit + Water > Trimethylamine N-Oxide +2 (ferrocytochrome c)-subunit +2 Hydrogen ion
Trimethylamine + 2 (ferricytochrome c)-subunit + Water > Trimethylamine N-Oxide +2 (ferrocytochrome c)-subunit +2 Hydrogen ion
Quercetin + Oxygen > 2-(3,4-dihydroxybenzoyloxy)-4,6-dihydroxybenzoate + CO + Hydrogen ion
2 Iron + 2 an apo-siderophore + NADP + Hydrogen ion >2 an Fe(III)-siderophore + NADPH
2 Hydrogen ion + 2 superoxide <> Oxygen + Hydrogen peroxide
Succinic acid semialdehyde + NAD + NADP + Water <> Succinic acid + NADH + NADPH +2 Hydrogen ion
Glyceric acid + NAD + NADP <> Tartronate semialdehyde + NADH + NADPH + Hydrogen ion
Protein dithiol + NAD + NADP <> Protein disulfide + NADH + NADPH + Hydrogen ion
Isopentenyl pyrophosphate + NAD + NADP + Water + Dimethylallylpyrophosphate <> 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH + NADPH + Hydrogen ion
Tetrahydrodipicolinate + NAD + NADP + Water <> (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate + NADH + NADPH + Hydrogen ion
Protein N6-(dihydrolipoyl)lysine + NAD <> Protein N6-(lipoyl)lysine + NADH + Hydrogen ion
NADP <> 2,5-Diketo-D-gluconate + NADPH + Hydrogen ion
Cyanate + Hydrogen carbonate + 2 Hydrogen ion + Carbamic acid <> Ammonia +2 Carbon dioxide
3-(3-Hydroxyphenyl)propanoic acid + NADH + Hydrogen ion + Oxygen + 3-Hydroxycinnamic acid <> 3-(2,3-Dihydroxyphenyl)propionic acid + Water + NAD + Trans-2,3-Dihydroxycinnamate
NADH + Hydrogen ion + Acceptor <> NAD + Reduced acceptor
L-Allothreonine + NADP + L-2-Amino-3-oxobutanoic acid <> Aminoacetone + Carbon dioxide + NADPH + Hydrogen ion
Quinate + NAD + NADP + Shikimic acid <> 3-Dehydroquinate + NADH + NADPH + Hydrogen ion + 3-Dehydro-shikimate
Tartaric acid + NAD <> 2-Hydroxy-3-oxosuccinate + NADH + Hydrogen ion
L-Histidinol + 2 NAD + Water <> L-Histidine +2 NADH +3 Hydrogen ion
Dihydrouracil + NAD + Dihydrothymine <> Uracil + NADH + Hydrogen ion + Thymine
NADH + Hydrogen ion + Oxygen + Hydrocinnamic acid <> cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD + Trans-2,3-Dihydroxycinnamate
cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD + cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol <> 3-(2,3-Dihydroxyphenyl)propionic acid + NADH + Hydrogen ion + Trans-2,3-Dihydroxycinnamate
NAD + Hydrogen ion <> NADH
Nitric oxide + 2 Oxygen + NADH + NADPH <>2 Nitrate + NAD + NADP + Hydrogen ion
Sorbitol 6-phosphate + NAD <> Fructose 6-phosphate + NADH + Hydrogen ion
7-Aminomethyl-7-carbaguanine + NADP <> 7-Cyano-7-carbaguanine + NADPH +2 Hydrogen ion
trans-2,3-Dehydroacyl-CoA + NADP <> trans,trans-2,3,4,5-Tetradehydroacyl-CoA + NADPH + Hydrogen ion
2 L-Glutamate + NADP + Ammonia + Water <> L-Glutamine + alpha-Ketoglutarate + NADPH + Hydrogen ion
3-Dehydro-L-gulonate + NAD + NADP <> 2,3-Diketo-L-gulonate + NADH + NADPH + Hydrogen ion
Mannitol 1-phosphate + NAD <> Fructose 6-phosphate + NADH + Hydrogen ion
(R)-2,3-Dihydroxy-isovalerate + NADP <> (S)-2-Acetolactate + NADPH + Hydrogen ion
5-Methyltetrahydrofolic acid + NAD + NADP <> 5,10-Methylene-THF + NADH + NADPH + Hydrogen ion
NAD + 2-Amino-3-oxo-4-phosphonooxybutyrate + O-Phospho-4-hydroxy-L-threonine <> 3-Amino-2-oxopropyl phosphate + Carbon dioxide + NADH + Hydrogen ion
3-Isopropylmalate + NAD + 2-Isopropyl-3-oxosuccinate <> Ketoleucine + Carbon dioxide + NADH + Hydrogen ion
S-(Hydroxymethyl)glutathione + NAD + NADP <> S-Formylglutathione + NADH + NADPH + Hydrogen ion
L-Proline + NAD + NADP <> (S)-1-pyrroline-5-carboxylate + NADH + NADPH + Hydrogen ion
Tetrahydropteridine + NAD + NADP <> 6,7-Dihydropteridine + NADH + NADPH + Hydrogen ion
NADH + NADPH + Hydrogen ion + Quinone <> NAD + NADP + Hydroquinone
Acyl-[acyl-carrier protein] + NAD <> trans-2,3-Dehydroacyl-[acyl-carrier protein] + NADH + Hydrogen ion
Primary alcohol + NAD + Secondary alcohol <> Aldehyde + NADH + Hydrogen ion + Ketone
L-Gulonate + NAD <> D-Fructuronate + NADH + Hydrogen ion
Cholic acid + NAD <> NADH + Hydrogen ion
Glucose 6-phosphate + NADP <> 6-Phosphonoglucono-D-lactone + NADPH + Hydrogen ion
NAD + Galactitol 1-phosphate <> L-Tagatose-6-phosphate + NADH + Hydrogen ion
(3S)-3-Hydroxyacyl-CoA + NAD <> 3-Oxoacyl-CoA + NADH + Hydrogen ion
(R)-Propane-1,2-diol + (S)-Propane-1,2-diol + NAD <> D-Lactaldehyde + (S)-Lactaldehyde + NADH + Hydrogen ion
2-Deoxygluconate + NAD <> 3-Dehydro-2-deoxy-D-gluconate + NADH + Hydrogen ion
3-Phospho-D-glycerate + NAD + D-2-Hydroxyglutaric acid <> Phosphohydroxypyruvic acid + NADH + Hydrogen ion + alpha-Ketoglutarate
NADP + Hydrogen ion <> NADPH
Glycerol 3-phosphate + NAD + NADP <> Dihydroxyacetone phosphate + NADH + NADPH + Hydrogen ion
4-Hydroxybutanoic acid + NAD <> Succinic acid semialdehyde + NADH + Hydrogen ion
Reduced ferredoxin + NADP + Hydrogen ion <> Oxidized ferredoxin + NADPH
L-Tyrosine + S-Adenosylmethionine + NADPH <> 2-iminoacetate + p-Cresol + 5'-Deoxyadenosine + L-Methionine + NADP + Hydrogen ion
NADPH + Hydrogen ion + 2 Quinone <> NADP +2 Semiquinone
Gluconic acid + NAD + NADP <> 5-Keto-D-gluconate + NADH + NADPH + Hydrogen ion
L-Idonate + NAD + NADP <> 5-Keto-D-gluconate + NADH + NADPH + Hydrogen ion
Alcohol + NADP <> Aldehyde + NADPH + Hydrogen ion
Propionyl-CoA + NADP <> Acrylyl-CoA + NADPH + Hydrogen ion
Isocitric acid + NADP + Oxalosuccinic acid <> alpha-Ketoglutarate + Carbon dioxide + NADPH + Hydrogen ion
Ammonia + NAD + 3 NADP + 2 Water <> Nitrite + NADH +3 NADPH +5 Hydrogen ion
(3R)-3-Hydroxyacyl-[acyl-carrier protein] + NADP <> 3-Oxoacyl-[acyl-carrier protein] + NADPH + Hydrogen ion
2-Dehydro-D-gluconate + NADP <> 2,5-Diketo-D-gluconate + NADPH + Hydrogen ion
(S)-Ureidoglycolic acid + NAD + NADP <> Oxalureate + NADH + NADPH + Hydrogen ion
O-Phospho-4-hydroxy-L-threonine + NAD > NADH + Hydrogen ion + 2-Amino-3-oxo-4-phosphonooxybutyrate
1-Deoxy-D-xylulose 5-phosphate + 2-Amino-3-phosphonopropionic acid + 1-Deoxy-D-xylulose 5-phosphate + 2-Amino-3-phosphonopropionic acid > Pyridoxine 5'-phosphate + Phosphate + Hydrogen ion +2 Water
D-Glyceraldehyde 3-phosphate + Pyruvic acid + Hydrogen ion + D-Glyceraldehyde 3-phosphate > 1-Deoxy-D-xylulose 5-phosphate + Carbon dioxide + 1-Deoxy-D-xylulose 5-phosphate
D-Glyceraldehyde 3-phosphate + Hydrogen ion + D-Glyceraldehyde 3-phosphate > Carbon dioxide + 1-Deoxy-D-xylulose 5-phosphate + 1-Deoxy-D-xylulose 5-phosphate
Pyridoxine + Adenosine triphosphate > Pyridoxine 5'-phosphate + Adenosine diphosphate + Hydrogen ion + ADP
4-amino-2-methyl-5-diphosphomethylpyrimidine + 2-((2R,5Z)-2-Carboxy-4-methylthiazol-5(2H)-ylidene)ethyl phosphate + 2 Hydrogen ion + 2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate > Thiamine monophosphate + Carbon dioxide + diphosphate + Thiamine monophosphate + Pyrophosphate
beta-D-Glucose 6-phosphate + NADP > 6-Phosphonoglucono-D-lactone + NADPH + Hydrogen ion + NADPH
6-Phosphonoglucono-D-lactone + Water > 6-Phosphogluconic acid + Hydrogen ion
Selenate + 2 Hydrogen ion + 2 Electron > Selenite + Water
Nitrite + 3 NADH + 5 Hydrogen ion + Nitrite Ammonia +2 Water +3 NAD
Nitrite + 6 ferrocytochrome c + 7 Hydrogen ion + Nitrite + 6 Ferrocytochrome c <> Ammonia +6 ferricytochrome c +2 Water +6 Ferricytochrome c
Hydrogen carbonate + Cyanate + Hydrogen ion + Cyanate > Carbamic acid
L-Glutamic acid + Adenosine triphosphate + Ammonium + L-Glutamate > L-Glutamine + Hydrogen ion + Adenosine diphosphate + Phosphate + ADP
Hydrogen ion + NADPH + Ammonia + NADPH <> Water + NADP + L-Glutamic acid + L-Glutamate
Oxoglutaric acid + NADPH + Ammonium + Hydrogen ion + NADPH > L-Glutamic acid + Water + NADP + L-Glutamate
2 L-Glutamic acid + NADP + 2 L-Glutamate > L-Glutamine + NADPH + Hydrogen ion + Oxoglutaric acid + NADPH
L-Glutamine + Oxoglutaric acid + NADPH + Hydrogen ion + NADPH >2 L-Glutamic acid + NADP +2 L-Glutamate
(3S)-3-hydroxyacyl-CoA + NAD > NADH + Hydrogen ion + a 3-oxoacyl-CoA 
3-Hydroxybutyryl-CoA + NAD + 3-Hydroxybutyryl-CoA > NADH + Hydrogen ion + Acetoacetyl-CoA + Acetoacetyl-CoA
(S)-Hydroxydecanoyl-CoA + NAD > NADH + Hydrogen ion + 3-Oxodecanoyl-CoA
(S)-Hydroxyhexanoyl-CoA + NAD > NADH + Hydrogen ion + 3-Oxohexanoyl-CoA
(S)-3-Hydroxydodecanoyl-CoA + NAD > NADH + Hydrogen ion + 3-Oxododecanoyl-CoA
(S)-3-Hydroxytetradecanoyl-CoA + NAD > NADH + Hydrogen ion + 3-Oxotetradecanoyl-CoA
(S)-Hydroxyoctanoyl-CoA + NAD + (S)-Hydroxyoctanoyl-CoA NADH + Hydrogen ion + 3-Oxooctanoyl-CoA
(S)-3-Hydroxyhexadecanoyl-CoA + NAD > NADH + Hydrogen ion + 3-Oxohexadecanoyl-CoA
(S)-3-Hydroxyoctadecanoyl-CoA + NAD > NADH + Hydrogen ion + 3-Oxooctadecanoyl-CoA + 3-Oxooctadecanoyl-CoA
2,3-dihydroxy-2,3-dihydrobenzoate + NAD > 2,3-Dihydroxybenzoic acid + NADH + Hydrogen ion
2,3-dihydroxy-2,3-dihydrobenzoate + NAD > 2-Pyrocatechuic acid + NADH + Hydrogen ion
a malonyl-[acp] + a malonyl-[acp] methyl ester + Hydrogen ion > Carbon dioxide + a holo-[acyl-carrier protein] + 3-Ketoglutaryl-[acp] methyl ester
3-Ketoglutaryl-[acp] methyl ester + NADPH + Hydrogen ion + NADPH > NADP + a 3R-hydroxyglutaryl-[acp] methyl ester
3-Ketopimeloyl-[acp] methyl ester + NADPH + Hydrogen ion + NADPH > NADP + 3-Hydroxypimeloyl-[acp] methyl ester
3-oxo-cis-Δ5-dodecenoyl-[acp]  + Hydrogen ion + NADPH + NADPH > 3R-hydroxy cis Δ9-hexadecenoyl-[acp] + NADP
a 3-oxo-cis-Δ7-tetradecenoyl-[acp]  + Hydrogen ion + NADPH + NADPH > a 3R-hydroxy cis Δ7-tetradecenoyl-[acp] + NADP
3-oxo-cis-Δ9-hexadecenoyl-[acp]  + Hydrogen ion + NADPH + NADPH > NADP + 3R-hydroxy cis Δ9-hexadecenoyl-[acp]
3-oxo-cis-vaccenoyl-[acp]  + Hydrogen ion + NADPH + NADPH > NADP + (R)-3-hydroxy-cis-vaccenoyl-[acp]
3-oxoacyl-[acp]  + Hydrogen ion + NADPH + NADPH > NADP + (3R)-3-hydroxyacyl-[acyl-carrier protein]
acetoacetyl-[acp] + Hydrogen ion + NADPH + NADPH > NADP + (R)-3-hydroxybutanoyl-[acp]
3-oxo-hexanoyl-[acp]  + Hydrogen ion + NADPH + NADPH > (R)-3-hydroxyhexanoyl-[acp] + NADP
3-oxo-octanoyl-[acp]  + Hydrogen ion + NADPH + NADPH > NADP + (R)-3-hydroxyoctanoyl-[acp]
3-oxo-decanoyl-[acp]  + Hydrogen ion + NADPH + NADPH > NADP + an (R)-3-hydroxydecanoyl-[acp] 
3-oxo-dodecanoyl-[acp]  + Hydrogen ion + NADPH + NADPH > NADP + (R)-3-hydroxydodecanoyl-[acp]
3-oxo-myristoyl-[acp]  + Hydrogen ion + NADPH + NADPH > NADP + (3R)-3-hydroxymyristoyl-[acp]
3-oxo-palmitoyl-[acp]  + Hydrogen ion + NADPH + NADPH > NADP + (R)-3-hydroxypalmitoyl-[acp]
3-oxo-cis-Δ5-dodecenoyl-[acp]  + Hydrogen ion + NADPH + NADPH > NADP + a (3R)-hydroxy cis Δ5-dodecenoyl-[acp]
Glutaryl-[acp] methyl ester + NADP < NADPH + Hydrogen ion + Enoylglutaryl-[acp] methyl ester + NADPH
NADPH + Hydrogen ion + an enoylpimeloyl-[acp] methyl ester + NADPH > NADP + a pimeloyl-[acp] methyl ester
trans-2-enoyl-[acyl-carrier protein] + Hydrogen ion + NADPH + NADPH > NADP + 2,3,4-saturated fatty acyl-[acp]
(S)-3-Hydroxyhexadecanoyl-CoA + NAD <> 3-Oxohexadecanoyl-CoA + NADH + Hydrogen ion
(S)-3-Hydroxytetradecanoyl-CoA + NAD <> 3-Oxotetradecanoyl-CoA + NADH + Hydrogen ion
(S)-3-Hydroxydodecanoyl-CoA + NAD <> 3-Oxododecanoyl-CoA + NADH + Hydrogen ion
(S)-Hydroxydecanoyl-CoA + NAD <> 3-Oxodecanoyl-CoA + Hydrogen ion + NADH
(S)-Hydroxyoctanoyl-CoA + NAD + (S)-Hydroxyoctanoyl-CoA <> 3-Oxooctanoyl-CoA + Hydrogen ion + NADH
(S)-Hydroxyhexanoyl-CoA + NAD <> 3-Oxohexanoyl-CoA + NADH + Hydrogen ion
3-Hydroxybutyryl-CoA + NAD + 3-Hydroxybutyryl-CoA <> Acetoacetyl-CoA + NADH + Hydrogen ion + Acetoacetyl-CoA
NAD + 3-Hydroxy-5-methylhex-4-enoyl-CoA > NADH + Hydrogen ion + 5-Methyl-3-oxo-4-hexenoyl-CoA
(3S)-3-Hydroxyadipyl-CoA + NAD > 3-Oxoadipyl-CoA + NADH + Hydrogen ion
Dethiobiotin + 2 S-adenosyl-L-methionine + 2 Hydrogen ion + a sulfurated [sulfur carrier] > Biotin +2 L-Methionine +2 5'-Deoxyadenosine
Octanoyl-[acyl-carrier protein] + a [lipoyl-carrier protein]-L-lysine > Hydrogen ion + a holo-[acyl-carrier protein] + Protein N6-(octanoyl)lysine
(R)-lipoic acid + Adenosine triphosphate + Hydrogen ion + Lipoic acid > Pyrophosphate + Lipoyl-AMP + Lipoyl-AMP
Lipoyl-AMP + a [lipoyl-carrier protein]-L-lysine + Lipoyl-AMP > Adenosine monophosphate + Hydrogen ion + Protein N6-(lipoyl)lysine
Caprylic acid + Adenosine triphosphate + a [lipoyl-carrier protein]-L-lysine > Hydrogen ion + Pyrophosphate + Adenosine monophosphate + Protein N6-(octanoyl)lysine
L-Aspartyl-4-phosphate + NADPH + Hydrogen ion + NADPH > Phosphate + NADP + L-Aspartate-semialdehyde
L-Aspartyl-4-phosphate + NADPH + Hydrogen ion + NADPH > Phosphate + NADP + L-Aspartate-semialdehyde
L-Aspartate-semialdehyde + Pyruvic acid > Hydrogen ion + Water + (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate
(2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + Hydrogen ion + NADPH + (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate + NADPH > Water + NADP + (S)-2,3,4,5-tetrahydrodipicolinate
Meso-2,6-Diaminoheptanedioate + Hydrogen ion > L-Lysine + Carbon dioxide + L-Lysine
L-Lysine + Hydrogen ion + L-Lysine > Cadaverine + Carbon dioxide
L-Lysine + Hydrogen ion + L-Lysine > Cadaverine + Carbon dioxide
Dihydrofolic acid + NADP + Dihydrofolic acid > Folic acid + NADPH + Hydrogen ion + NADPH
Dihydrofolic acid + NADPH + Hydrogen ion + Dihydrofolic acid + NADPH > Tetrahydrofolic acid + NADP + Tetrahydrofolic acid
7,8-dihydrofolate monoglutamate + Hydrogen ion + NADPH + Dihydrofolic acid + NADPH > NADP + Tetrahydrofolic acid + Tetrahydrofolic acid
Folic acid + 2 NADPH + 2 Hydrogen ion + 2 NADPH > Tetrahydrofolic acid +2 NADP + Tetrahydrofolic acid
5,10-Methylene-THF + NADPH + Hydrogen ion + 5,10-Methylene-THF + NADPH > 5-Methyltetrahydrofolic acid + NADP + 5-Methyltetrahydrofolic acid
N1-(5-phospho-β-D-ribosyl)glycinamide + Adenosine triphosphate + Formic acid > 5'-Phosphoribosyl-N-formylglycinamide + Adenosine diphosphate + Phosphate + Hydrogen ion + 5'-Phosphoribosyl-N-formylglycineamide + ADP
10-Formyltetrahydrofolate + Hydrogen ion <> 5,10-Methenyltetrahydrofolic acid + Water
L-Glutamic acid + Hydrogen ion + L-Glutamate > Carbon dioxide + 4-(Glutamylamino) butanoate
Taurine + Oxoglutaric acid + Oxygen > Sulfite + Succinic acid + Carbon dioxide + Hydrogen ion + Aminoacetaldehyde + Sulfite
Isocitric acid + NAD + Isocitric acid > Oxoglutaric acid + Carbon dioxide + NADH + Hydrogen ion
Oxoglutaric acid + NAD + Coenzyme A > Succinyl-CoA + NADH + Hydrogen ion + Carbon dioxide + Succinyl-CoA
L-Malic acid + NAD + L-Malic acid <> Oxalacetic acid + NADH + Hydrogen ion
Oxalacetic acid + Water + Acetyl-CoA > Citric acid + Coenzyme A + Hydrogen ion
L-Malic acid + NAD + L-Malic acid > Oxalacetic acid + NADH + Hydrogen ion
Fructose 6-phosphate + Adenosine triphosphate + Fructose 6-phosphate > Fructose 1,6-bisphosphate + Adenosine diphosphate + Hydrogen ion + Fructose 1,6-bisphosphate + ADP
D-Glyceraldehyde 3-phosphate + NAD + Phosphate + D-Glyceraldehyde 3-phosphate > Glyceric acid 1,3-biphosphate + NADH + Hydrogen ion + Glyceric acid 1,3-biphosphate
Glyceric acid 1,3-biphosphate + NADH + Hydrogen ion + Glyceric acid 1,3-biphosphate > NAD + Phosphate + D-Glyceraldehyde 3-phosphate + D-Glyceraldehyde 3-phosphate
Phosphoenolpyruvic acid + Adenosine monophosphate + Phosphate + 2 Hydrogen ion > Adenosine triphosphate + Water + Pyruvic acid
Water + Adenosine triphosphate + Pyruvic acid > Adenosine monophosphate + Phosphate +2 Hydrogen ion + Phosphoenolpyruvic acid
Phosphoenolpyruvic acid + Adenosine diphosphate + Hydrogen ion + ADP > Adenosine triphosphate + Pyruvic acid
L-Aspartic acid + Oxygen + L-Aspartic acid > Hydrogen peroxide + Hydrogen ion + Iminoaspartic acid
Inosinic acid + L-Aspartic acid + Guanosine triphosphate + L-Aspartic acid > Guanosine diphosphate + Phosphate +2 Hydrogen ion + N(6)-(1,2-dicarboxyethyl)AMP + Adenylsuccinic acid
L-Glutamic acid + Acetyl-CoA + L-Glutamate > Coenzyme A + Hydrogen ion + N-Acetylglutamic acid + N-Acetylglutamic acid
N-Acetyl-L-glutamyl 5-phosphate + NADPH + Hydrogen ion + NADPH > N-acetyl-L-glutamate + Phosphate + NADP
Ornithine + Carbamoylphosphate + Ornithine > Phosphate + Hydrogen ion + Citrulline
Hydrogen carbonate + Water + L-Glutamine + 2 Adenosine triphosphate >2 Adenosine diphosphate + Phosphate + L-Glutamic acid +2 Hydrogen ion + Carbamoylphosphate +2 ADP + L-Glutamate
L-Arginine + Succinyl-CoA + Succinyl-CoA > Coenzyme A + Hydrogen ion + N2-succinyl-L-arginine + N2-succinyl-L-arginine
N2-succinyl-L-arginine + 2 Water + 2 Hydrogen ion + N2-succinyl-L-arginine > Carbon dioxide +2 Ammonium + N2-Succinyl-L-ornithine
N2-Succinyl-L-glutamic acid 5-semialdehyde + Water + NAD >2 Hydrogen ion + NADH + N2-succinylglutamate + N2-succinylglutamate
L-Arginine + Hydrogen ion + Carbon dioxide > Agmatine
Putrescine + Adenosine triphosphate + L-Glutamic acid + L-Glutamate > Phosphate + Adenosine diphosphate + Hydrogen ion + gamma-Glutamyl-L-putrescine + ADP
4-(γ-glutamylamino)butanal + Water + NADP > 4-(Glutamylamino) butanoate +2 Hydrogen ion + NADPH + NADPH
4-Aminobutyraldehyde + Water + NAD > Hydrogen ion + NADH + gamma-Aminobutyric acid
Succinic acid semialdehyde + Water + NADP > NADPH +2 Hydrogen ion + Succinic acid + NADPH
Succinic acid semialdehyde + NAD + Water >2 Hydrogen ion + NADH + Succinic acid
Ornithine + Hydrogen ion + Ornithine > Putrescine + Carbon dioxide
3-Dehydro-L-gulonate + Adenosine triphosphate > 3-keto-L-gulonate 6-phosphate + Adenosine diphosphate + Hydrogen ion + 3-Keto-L-gulonate 6-phosphate + ADP
2,3-Diketo-L-gulonate + NADH + Hydrogen ion + 2,3-Diketo-L-gulonate > 3-Dehydro-L-gulonate + NAD
3-keto-L-gulonate 6-phosphate + Hydrogen ion + 3-Keto-L-gulonate 6-phosphate > Xylulose 5-phosphate + Carbon dioxide + Xylulose 5-phosphate
2,3-Diketo-L-gulonate + Hydrogen ion + 2,3-Diketo-L-gulonate > Carbon dioxide + Xylulose 5-phosphate + Xylulose 5-phosphate
3-keto-L-gulonate 6-phosphate + Hydrogen ion + 3-Keto-L-gulonate 6-phosphate > L-xylulose -5-phosphate + Carbon dioxide + L-Xylulose 5-phosphate
3-keto-L-gulonate 6-phosphate + Hydrogen ion + 3-Keto-L-gulonate 6-phosphate > Carbon dioxide + Xylulose 5-phosphate + Xylulose 5-phosphate
3-keto-L-gulonate 6-phosphate + Hydrogen ion + 3-Keto-L-gulonate 6-phosphate > Carbon dioxide + L-xylulose -5-phosphate + L-Xylulose 5-phosphate
3-keto-L-gulonate 6-phosphate + Hydrogen ion + 3-Keto-L-gulonate 6-phosphate > L-xylulose -5-phosphate + Carbon dioxide + L-Xylulose 5-phosphate
L-Glutamic acid 5-phosphate + Hydrogen ion + NADPH + NADPH > L-Glutamic-gamma-semialdehyde + NADP + Phosphate
1-Pyrroline-5-carboxylic acid + Hydrogen ion + NADPH + L-D-1-Pyrroline-5-carboxylic acid + NADPH > NADP + L-Proline + L-Proline
L-Proline + Ubiquinone-1 + L-Proline > Hydrogen ion + Ubiquinol-1 + 1-Pyrroline-5-carboxylic acid + L-D-1-Pyrroline-5-carboxylic acid
L-Glutamic-gamma-semialdehyde + NAD + Water >2 Hydrogen ion + NADH + L-Glutamic acid + L-Glutamate
Tartronate semialdehyde + Hydrogen ion + NADPH + NADPH > NADP + Glyceric acid
Glyceric acid + Adenosine triphosphate > Hydrogen ion + Adenosine diphosphate + 2-Phosphoglyceric acid + ADP + 2-Phosphoglyceric acid
Glyceric acid + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + 3-Phosphoglyceric acid + ADP + 3-Phosphoglycerate
cis-Δ3-decenoyl-ACP + Hydrogen ion + a malonyl-[acp] > Carbon dioxide + a holo-[acyl-carrier protein] + 3-oxo-cis-Δ5-dodecenoyl-[acp] 
cis-Δ5-dodecenoyl-[acp]  + Hydrogen ion + a malonyl-[acp] > a 3-oxo-cis-Δ7-tetradecenoyl-[acp]  + a holo-[acyl-carrier protein] + Carbon dioxide
trans-Δ3-cis-Δ7-tetradecenoyl-[acp] + Hydrogen ion + NADH > NAD + cis-Δ7-tetradecenoyl-[acp] 
cis-Δ7-tetradecenoyl-[acp]  + Hydrogen ion + a malonyl-[acp] > Carbon dioxide + a holo-[acyl-carrier protein] + 3-oxo-cis-Δ9-hexadecenoyl-[acp] 
2,3,4-saturated fatty acyl-[acp] + a malonyl-[acp] + Hydrogen ion > Carbon dioxide + a holo-[acyl-carrier protein] + 3-oxoacyl-[acp] 
butyryl-[acp] + Hydrogen ion + a malonyl-[acp] > a holo-[acyl-carrier protein] + Carbon dioxide + 3-oxo-hexanoyl-[acp] 
hexanoyl-[acyl-carrier-protein] + Hydrogen ion + a malonyl-[acp] > a holo-[acyl-carrier protein] + Carbon dioxide + 3-oxo-octanoyl-[acp] 
Octanoyl-[acyl-carrier protein] + Hydrogen ion + a malonyl-[acp] > a holo-[acyl-carrier protein] + 3-oxo-decanoyl-[acp]  + Carbon dioxide
dodecanoyl-[acp]  + Hydrogen ion + a malonyl-[acp] > a holo-[acyl-carrier protein] + Carbon dioxide + 3-oxo-myristoyl-[acp] 
trans tetradec-2-enoyl-[acp] + Hydrogen ion + NADH > NAD + myristoyl-[acp]
myristoyl-[acp] + Hydrogen ion + a malonyl-[acp] > a holo-[acyl-carrier protein] + Carbon dioxide + 3-oxo-palmitoyl-[acp] 
a malonyl-[acp] + Hydrogen ion > Carbon dioxide + an acetyl-[acp]
a malonyl-[acp] + Hydrogen ion + an acetyl-[acp] > Carbon dioxide + a holo-[acyl-carrier protein] + acetoacetyl-[acp]
trans-Δ3-cis-Δ5-dodecenoyl-[acp] + Hydrogen ion + NADH > cis-Δ5-dodecenoyl-[acp]  + NAD
trans-Δ3-cis-Δ7-tetradecenoyl-[acp] + Hydrogen ion + NADH > NAD + cis-Δ7-tetradecenoyl-[acp] 
trans-Δ3-cis-Δ9-hexadecenoyl-[acp] + Hydrogen ion + NADH > NAD + a palmitoleoyl-[acp] 
cis-vaccen-2-enoyl-[acp] + Hydrogen ion + NADH > NAD + a cis-vaccenoyl-[acp]
trans-2-enoyl-[acyl-carrier protein] + Hydrogen ion + NADH > NAD + 2,3,4-saturated fatty acyl-[acp]
crotonyl-[acp] + Hydrogen ion + NADH > NAD + butyryl-[acp]
trans hex-2-enoyl-[acp] + Hydrogen ion + NADH > NAD + hexanoyl-[acyl-carrier-protein]
trans oct-2-enoyl-[acp] + Hydrogen ion + NADH > NAD + Octanoyl-[acyl-carrier protein]
a trans-Δ2-decenoyl-[acp]  + Hydrogen ion + NADH > NAD + decanoyl-[acp]
trans dodec-2-enoyl-[acp] + Hydrogen ion + NADH > NAD + dodecanoyl-[acp] 
trans tetradec-2-enoyl-[acp] + Hydrogen ion + NADH > NAD + myristoyl-[acp]
Hydrogen ion + NADH + trans hexadecenoyl-[acp] > NAD + palmitoyl-[acp]
Water + a palmitoleoyl-[acp]  > a holo-[acyl-carrier protein] + Hydrogen ion + Hexadecenoate (n-C16:1)
a cis-vaccenoyl-[acp] + Water > Hydrogen ion + a holo-[acyl-carrier protein] + Vaccenic acid
a palmitoleoyl-[acp]  + a malonyl-[acp] + Hydrogen ion > a holo-[acyl-carrier protein] + Carbon dioxide + 3-oxo-cis-vaccenoyl-[acp] 
Acetyl-CoA + Hydrogen carbonate + Adenosine triphosphate > Adenosine diphosphate + Phosphate + Hydrogen ion + Malonyl-CoA + ADP + Malonyl-CoA
a malonyl-[acp] + Hydrogen ion + Acetyl-CoA > Carbon dioxide + Coenzyme A + acetoacetyl-[acp]
L-Arginine + tRNA(Arg) + Adenosine triphosphate + Hydrogen ion > Pyrophosphate + Adenosine monophosphate + L-arginyl-tRNA(Arg)
L-Cysteine + tRNA(Cys) + Adenosine triphosphate + Hydrogen ion > Pyrophosphate + Adenosine monophosphate + L-cysteinyl-tRNA(Cys)
L-Glutamic acid + Adenosine triphosphate + Hydrogen ion + tRNA(Glu) + L-Glutamate > Pyrophosphate + Adenosine monophosphate + L-glutamyl-tRNA(Glu)
8 L-Glutamic acid + 8 Hydrogen ion + 8 Adenosine triphosphate + 8 tRNA(Glu) + 8 L-Glutamate >8 Adenosine monophosphate +8 Pyrophosphate +8 L-glutamyl-tRNA(Glu)
L-Alanine + Adenosine triphosphate + Hydrogen ion + tRNA(Ala) + L-Alanine > Pyrophosphate + Adenosine monophosphate + L-alanyl-tRNA(Ala)
Glycine + Adenosine triphosphate + Hydrogen ion + tRNA(gly) > Adenosine monophosphate + Pyrophosphate + Glycyl-tRNA(Gly)
L-Threonine + Adenosine triphosphate + Hydrogen ion + tRNA(Thr) + L-Threonine > Pyrophosphate + Adenosine monophosphate + L-Threonyl-tRNA(Thr)
L-Serine + Adenosine triphosphate + Hydrogen ion + tRNA(Ser) + L-Serine > Adenosine monophosphate + Pyrophosphate + L-Seryl-tRNA(Ser)
L-Leucine + Adenosine triphosphate + Hydrogen ion + tRNA(Leu) > Adenosine monophosphate + Pyrophosphate + L-Leucyl-tRNA(Leu)
L-Valine + Adenosine triphosphate + Hydrogen ion + tRNA(Val) + L-Valine > Adenosine monophosphate + Pyrophosphate + L-Valyl-tRNA(Val)
L-Isoleucine + Adenosine triphosphate + Hydrogen ion + tRNA(Ile) + L-Isoleucine > L-Isoleucyl-tRNA(Ile) + Adenosine monophosphate + Pyrophosphate
L-Glutamine + Adenosine triphosphate + Hydrogen ion + tRNA(Gln) > Adenosine diphosphate + Pyrophosphate + L-Glutaminyl-tRNA(Gln) + ADP
L-Aspartic acid + Adenosine triphosphate + Hydrogen ion + tRNA(Asp) + L-Aspartic acid > Pyrophosphate + Adenosine monophosphate + L-aspartyl-tRNA(Asp)
L-Tyrosine + Adenosine triphosphate + Hydrogen ion + tRNA(Tyr) + L-Tyrosine > Adenosine monophosphate + Pyrophosphate + L-tyrosyl-tRNA(Tyr)
L-Tryptophan + Adenosine triphosphate + Hydrogen ion + tRNA(Trp) > Adenosine monophosphate + Pyrophosphate + L-tryptophyl-tRNA(Trp)
L-Phenylalanine + Adenosine triphosphate + Hydrogen ion + tRNA(Phe) + L-Phenylalanine > Adenosine monophosphate + Pyrophosphate + L-phenylalanyl-tRNA(Phe)
L-Asparagine + Adenosine triphosphate + Hydrogen ion + tRNA(Asn) + L-Asparagine > Pyrophosphate + Adenosine monophosphate + L-asparaginyl-tRNA(Asn)
L-Histidine + Adenosine triphosphate + Hydrogen ion + tRNA(His) + L-Histidine > Adenosine monophosphate + Pyrophosphate + L-histidyl-tRNA(His)
L-Lysine + Adenosine triphosphate + Hydrogen ion + tRNA(Lys) + L-Lysine > Adenosine monophosphate + Pyrophosphate + L-Lysyl-tRNA
L-Methionine + Adenosine triphosphate + Hydrogen ion + tRNA(Met) > Adenosine monophosphate + Pyrophosphate + L-methionyl-tRNA(Met)
L-Proline + Adenosine triphosphate + Hydrogen ion + tRNA(Pro) + L-Proline > Adenosine monophosphate + Pyrophosphate + L-prolyl-tRNA(Pro)
3-Phosphoglyceric acid + NAD + 3-Phosphoglycerate > NADH + Hydrogen ion + Phosphohydroxypyruvic acid
O-Acetylserine > Hydrogen ion + Acetic acid + L-Cysteine
O-Acetylserine + Hydrogen sulfide > Hydrogen ion + Acetic acid + L-Cysteine
Hydrogen sulfide + O-Acetylserine <> L-Cysteine + Acetic acid + Hydrogen ion
L-Cysteine > Hydrogen ion + Hydrogen sulfide + 2-Aminoacrylic acid
3 NADPH + 5 Hydrogen ion + Sulfite + 3 NADPH + Sulfite > Hydrogen sulfide +3 Water +3 NADP
Sulfite + 3 NADPH + 5 Hydrogen ion + Sulfite + 3 NADPH >3 Water + NADP + Hydrogen sulfide
Phosphoadenosine phosphosulfate + reduced thioredoxin > Sulfite +2 Hydrogen ion + Adenosine 3',5'-diphosphate +2 oxidized thioredoxin + Sulfite + Adenosine 3',5'-diphosphate
Phosphoadenosine phosphosulfate + reduced thioredoxin > Sulfite + oxidized thioredoxin + Hydrogen ion + Adenosine 3',5'-diphosphate + Sulfite + Adenosine 3',5'-diphosphate
Adenosine phosphosulfate + Adenosine triphosphate > Phosphoadenosine phosphosulfate + Adenosine diphosphate + Hydrogen ion + ADP
Adenosine triphosphate + Hydrogen ion + Sulfate + Sulfate > Adenosine phosphosulfate + Pyrophosphate
Prephenate + Hydrogen ion > Carbon dioxide + Water + Phenylpyruvic acid
3-Phosphoglyceric acid + NAD + 3-Phosphoglycerate > NADH + Hydrogen ion + Phosphohydroxypyruvic acid
Phosphoribosyl pyrophosphate + Hydrogen ion > Pyrophosphate + Phosphoribosyl-ATP + Phosphoribosyl-ATP
Phosphoribosyl-ATP + Water + Phosphoribosyl-ATP > Hydrogen ion + Pyrophosphate + Phosphoribosyl-AMP
Phosphoribulosylformimino-AICAR-P + L-Glutamine > L-Glutamic acid + Hydrogen ion + 5-Amino-4-imidazolecarboxyamide + D-Erythro-imidazole-glycerol-phosphate + L-Glutamate
L-Histidinol + NAD > NADH + Hydrogen ion + Histidinal
Water + NAD + Histidinal >2 Hydrogen ion + NADH + L-Histidine + L-Histidine
3-Methyl-2-oxovaleric acid + Water + Acetyl-CoA + 3-Methyl-2-oxovaleric acid > Coenzyme A + Hydrogen ion + 2-Isopropylmalic acid
3-Isopropylmalate + NAD > NADH + Hydrogen ion + 2-Isopropyl-3-oxosuccinate
2 Pyruvic acid + Hydrogen ion > Carbon dioxide + (S)-2-Acetolactate
2 Pyruvic acid + Hydrogen ion > Carbon dioxide + (S)-2-Acetolactate
(R)-2,3-Dihydroxy-isovalerate + Hydrogen ion + NADPH + NADPH > NADP + (R) 2,3-Dihydroxy-3-methylvalerate
2-Aceto-2-hydroxy-butyrate + NADPH + Hydrogen ion + NADPH > NADP + (R) 2,3-Dihydroxy-3-methylvalerate
2-dehydropantoate + NADPH + Hydrogen ion + 2-Dehydropantoate + NADPH > NADP + (R)-pantoate + (R)-Pantoate
(S)-2-Acetolactate + Hydrogen ion + NADPH + NADPH > NADP + (R)-2,3-Dihydroxy-isovalerate
L-Aspartic acid + Water + Adenosine triphosphate + L-Glutamine + L-Aspartic acid > L-Asparagine + Hydrogen ion + Adenosine monophosphate + L-Glutamic acid + Pyrophosphate + L-Asparagine + L-Glutamate
L-Aspartic acid + Adenosine triphosphate + Ammonium + L-Aspartic acid > L-Asparagine + Adenosine monophosphate + Pyrophosphate + Hydrogen ion + L-Asparagine
O-Succinyl-L-homoserine + L-Cysteine > Succinic acid + Hydrogen ion + L-Cystathionine
L-Cystathionine > Hydrogen ion + Homocysteine + 2-aminoprop-2-enoate + Homocysteine
Chorismate + L-Glutamine > L-Glutamic acid + Pyruvic acid + Hydrogen ion + 2-Aminobenzoic acid + L-Glutamate
1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate + Hydrogen ion + 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate > Water + Carbon dioxide
1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate + Hydrogen ion + 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate > Water + Carbon dioxide + (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate + (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate
L-Tryptophan > Hydrogen ion + Indole + 2-Aminoacrylic acid
3-dehydroshikimate + Hydrogen ion + NADPH + 3-Dehydro-shikimate + NADPH > NADP + Shikimic acid
3-dehydroshikimate + NADPH + Hydrogen ion + 3-Dehydro-shikimate + NADPH > NADP + Shikimic acid
Shikimic acid + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + shikimate 3-phosphate + ADP + Shikimate 3-phosphate
L-Aspartate-semialdehyde + Hydrogen ion + NADPH + NADPH > NADP + L-Homoserine + L-Homoserine
L-Homoserine + Adenosine triphosphate + L-Homoserine > Adenosine diphosphate + Hydrogen ion + O-Phosphohomoserine + ADP
L-Threonine + L-Threonine > Hydrogen ion + Water + (2Z)-2-aminobut-2-enoate
2-Ketobutyric acid + Hydrogen ion + Pyruvic acid > Carbon dioxide + 2-Aceto-2-hydroxy-butyrate
2-dehydro-3-deoxy-D-galactonate + Adenosine triphosphate + 2-Dehydro-3-deoxy-D-galactonate > Adenosine diphosphate + Hydrogen ion + 2-dehydro-3-deoxy-D-galactonate 6-phosphate + ADP + 2-Dehydro-3-deoxy-D-galactonate 6-phosphate
Galactose 1-phosphate + NAD + Galactose 1-phosphate > NADH + Hydrogen ion + D-tagatofuranose 6-phosphate
D-tagatofuranose 6-phosphate + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + D-tagatofuranose 1,6-bisphosphate + ADP
Glucose 1-phosphate + Uridine triphosphate + Hydrogen ion + Uridine triphosphate > Pyrophosphate + UDP-Glucose
β-D-glucose 1-phosphate + Uridine triphosphate + Hydrogen ion + Uridine triphosphate > UDP-Glucose + Pyrophosphate
Alpha-D-glucose 1-phosphate + Uridine triphosphate + Hydrogen ion + Uridine triphosphate > Pyrophosphate + UDP-Glucose
Alpha-D-Galactose + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + Galactose 1-phosphate + ADP + Galactose 1-phosphate
D-Mannose 1-phosphate + Guanosine triphosphate + Hydrogen ion > Pyrophosphate + Guanosine diphosphate mannose
α-D-mannose 1-phosphate + Guanosine triphosphate + Hydrogen ion > Guanosine diphosphate mannose + Pyrophosphate
GDP-4-Dehydro-6-deoxy-D-mannose + NADPH + Hydrogen ion + NADPH > GDP-L-Fucose + NADP
GDP-4-dehydro-6-deoxy-α-D-mannose + NADPH + Hydrogen ion + NADPH > NADP + GDP-β-L-fucose
D-allopyranose + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + aldehydo-D-allose 6-phosphate + ADP + aldehydo-D-allose 6-phosphate
L-rhamnulofuranose + Adenosine triphosphate + L-rhamnulofuranose > Adenosine diphosphate + Hydrogen ion + L-rhamnulose 1-phosphate + ADP + L-Rhamnulose 1-phosphate
Adenosine triphosphate + keto-L-rhamnulose > L-fuculose 1-phosphate + Adenosine diphosphate + Hydrogen ion + L-Fuculose 1-phosphate + ADP
D-Ribulose + Adenosine triphosphate + D-Ribulose > Adenosine diphosphate + Hydrogen ion + D-Ribulose-1-phosphate + ADP
NAD + Water + (S)-lactaldehyde + Lactaldehyde > NADH +2 Hydrogen ion + L-Lactic acid + L-Lactic acid
(S)-lactaldehyde + NADH + Hydrogen ion + Lactaldehyde > NAD + Propylene glycol
Glyoxylic acid + Water + Acetyl-CoA > Coenzyme A + Hydrogen ion + L-Malic acid + L-Malic acid
2 Glyoxylic acid + Hydrogen ion > Carbon dioxide + Tartronate semialdehyde
Tartronate semialdehyde + NADH + Hydrogen ion > NAD + Glyceric acid
Allantoin + Water > Allantoic acid + Hydrogen ion
Allantoic acid + Water + 2 Hydrogen ion > Carbon dioxide + Ammonium + S-ureidoglycine
L-Aspartic acid + Hydrogen ion + L-Aspartic acid Carbon dioxide + beta-Alanine
L-Aspartic acid + Hydrogen ion + L-Aspartic acid > Carbon dioxide + beta-Alanine
beta-Alanine + Adenosine triphosphate + (R)-pantoate + (R)-Pantoate > Adenosine monophosphate + Pyrophosphate + Hydrogen ion + Pantothenic acid + Pantothenic acid
beta-Alanine + Adenosine triphosphate > Adenosine monophosphate + Pyrophosphate + Hydrogen ion
Pantothenic acid + Adenosine triphosphate + Pantothenic acid > Adenosine diphosphate + Hydrogen ion + D-4'-Phosphopantothenate + ADP + D-4'-Phosphopantothenate
D-4'-Phosphopantothenate + Cytidine triphosphate + L-Cysteine + D-4'-Phosphopantothenate > Cytidine monophosphate + Pyrophosphate + Hydrogen ion + 4-Phosphopantothenoylcysteine + Cytidine monophosphate
4-Phosphopantothenoylcysteine + Hydrogen ion > Carbon dioxide + 4'-phosphopantetheine + 4'-phosphopantetheine
4'-phosphopantetheine + Adenosine triphosphate + Hydrogen ion + 4'-phosphopantetheine > Pyrophosphate + Dephospho-CoA
Dephospho-CoA + Adenosine triphosphate > Hydrogen ion + Adenosine diphosphate + Coenzyme A + ADP
Quinolinic acid + Hydrogen ion + Phosphoribosyl pyrophosphate > Carbon dioxide + Pyrophosphate + nicotinate beta-D-ribonucleotide + Nicotinamide ribotide
nicotinate beta-D-ribonucleotide + Adenosine triphosphate + Hydrogen ion + Nicotinamide ribotide > Pyrophosphate + Nicotinic acid adenine dinucleotide
Nicotinic acid adenine dinucleotide + Water + L-Glutamine + Adenosine triphosphate > Hydrogen ion + Adenosine monophosphate + Pyrophosphate + L-Glutamic acid + NAD + L-Glutamate
Nicotinic acid adenine dinucleotide + Adenosine triphosphate + Ammonium > Hydrogen ion + Adenosine monophosphate + Pyrophosphate + NAD
nicotinate beta-D-ribonucleotide + Adenosine triphosphate + Hydrogen ion + Nicotinamide ribotide > Pyrophosphate + Nicotinic acid adenine dinucleotide
Nicotinamide riboside + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + beta-nicotinamide D-ribonucleotide + ADP + NMN
beta-nicotinamide D-ribonucleotide + Adenosine triphosphate + Hydrogen ion + NMN > Pyrophosphate + NAD
UDP-3-O-(3-Hydroxytetradecanoyl)-D-glucosamine + (3R)-3-hydroxymyristoyl-[acp] > Hydrogen ion + a holo-[acyl-carrier protein] + UDP-2-N,3-O-bis[(3R)-3-hydroxytetradecanoyl]-α-D-glucosamine
UDP-2-N,3-O-bis[(3R)-3-hydroxytetradecanoyl]-α-D-glucosamine + Water > Uridine 5'-monophosphate + Hydrogen ion + 2,3-bis[(3R)-3-hydroxymyristoyl]-α-D-glucosaminyl 1-phosphate
2,3-bis[(3R)-3-hydroxymyristoyl]-α-D-glucosaminyl 1-phosphate + UDP-2-N,3-O-bis[(3R)-3-hydroxytetradecanoyl]-α-D-glucosamine > Uridine 5'-diphosphate + Hydrogen ion + (2-N,3-O-bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl)-(1->6)-(2-N,3-O-bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl phosphate)
(2-N,3-O-bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl)-(1->6)-(2-N,3-O-bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl phosphate) + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + (2-N,3-O-bis(3-Hydroxytetradecanoyl)-4-O-phosphono-beta-D-glucosaminyl)-(1->6)-(2-N,3-O-bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl phosphate) + ADP
CMP-3-Deoxy-D-manno-octulosonate + (2-N,3-O-bis(3-Hydroxytetradecanoyl)-4-O-phosphono-beta-D-glucosaminyl)-(1->6)-(2-N,3-O-bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl phosphate) > Cytidine monophosphate + Hydrogen ion + alpha-Kdo-(2→6)-lipid IVA + Cytidine monophosphate
alpha-Kdo-(2→6)-lipid IVA + CMP-3-Deoxy-D-manno-octulosonate > Cytidine monophosphate + Hydrogen ion + a-Kdo-(2->4)-a-Kdo-(2->6)-lipid IVA + Cytidine monophosphate + a-Kdo-(2->4)-a-Kdo-(2->6)-lipid IVA
(KDO)2-lipid A + ADP-L-glycero-beta-D-manno-heptose > Hydrogen ion + Adenosine diphosphate + heptosyl-Kdo2-lipid A + ADP + Heptosyl-KDO2-lipid A
heptosyl-Kdo2-lipid A + ADP-L-glycero-beta-D-manno-heptose + Heptosyl-KDO2-lipid A > Adenosine diphosphate + Hydrogen ion + (heptosyl)2-Kdo2-lipid A + ADP
(heptosyl)2-Kdo2-lipid A + UDP-Glucose > Uridine 5'-diphosphate + Hydrogen ion + glucosyl-(heptosyl)2-Kdo2-lipid A
glucosyl-(heptosyl)2-Kdo2-lipid A + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + glucosyl-(heptosyl)2-Kdo2-lipid A-phosphate + ADP
glucosyl-(heptosyl)2-Kdo2-lipid A-phosphate + ADP-L-glycero-beta-D-manno-heptose > Adenosine diphosphate + Hydrogen ion + glucosyl-(heptosyl)3-Kdo2-lipid A-phosphate + ADP
glucosyl-(heptosyl)3-Kdo2-lipid A-phosphate + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + glucosyl-(heptosyl)3-Kdo2-lipid A-bisphosphate + ADP
glucosyl-(heptosyl)3-Kdo2-lipid A-bisphosphate + UDP-α-D-galactose > galactosyl-glucosyl-(heptosyl)3-Kdo2-lipid A-bisphosphate + Uridine 5'-diphosphate + Hydrogen ion
galactosyl-glucosyl-(heptosyl)3-Kdo2-lipid A-bisphosphate + UDP-Glucose > Uridine 5'-diphosphate + Hydrogen ion + galactosyl-(glucosyl)2-(heptosyl)3-Kdo2-lipid A-bisphosphate
galactosyl-(glucosyl)2-(heptosyl)3-Kdo2-lipid A-bisphosphate + UDP-Glucose > Uridine 5'-diphosphate + Hydrogen ion + galactosyl-(glucosyl)3-(heptosyl)3-Kdo2-lipid A-bisphosphate
galactosyl-(glucosyl)3-(heptosyl)3-Kdo2-lipid A-bisphosphate + ADP-L-glycero-beta-D-manno-heptose > Hydrogen ion + Adenosine diphosphate + Lipid A-core + ADP
L-Glutamic acid + Adenosine triphosphate + L-Cysteine + L-Glutamate > Adenosine diphosphate + Phosphate + Hydrogen ion + gamma-Glutamylcysteine + ADP
gamma-Glutamylcysteine + Glycine + Adenosine triphosphate > Hydrogen ion + Phosphate + Adenosine diphosphate + Glutathione + ADP
Oxidized glutathione + Hydrogen ion + NADPH + Glutathione disulfide + NADPH > NADP +2 Glutathione
D-Fructuronate + NADH + Hydrogen ion > NAD + D-altronate
D-tagaturonate + NADH + Hydrogen ion + D-Tagaturonate > NAD + D-altronate + D-altronate
2-Dehydro-3-deoxy-D-galactonate + Adenosine triphosphate + 2-Keto-3-deoxy-D-gluconic acid > Hydrogen ion + 2-Keto-3-deoxy-6-phosphogluconic acid + Adenosine diphosphate + ADP
(2R,4S)-2-methyl-2,3,3,4-tetrahydroxytetrahydrofuran + Adenosine triphosphate + (2R,4S)-2-Methyl-2,3,3,4-tetrahydroxytetrahydrofuran > Adenosine diphosphate + Hydrogen ion + (4S)-4-hydroxy-2,3-pentanedione 5-phosphate + ADP + (4S)-4-hydroxy-2,3-pentanedione 5-phosphate
Dihydroxyacetone phosphate + Hydrogen ion + NADPH + NADPH > NADP + Glycerol 3-phosphate
Cytidine triphosphate + Hydrogen ion + PA(18:0/18:0) > Pyrophosphate + CDP-1,2-Dioctadecanoylglycerol
DG(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:1(11Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) + Pyrophosphate + CDP-DG(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z))
DG(19:1(9Z)/18:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate > Pyrophosphate + CDP-DG(19:1(9Z)/18:1(9Z))
DG(18:1(9Z)/18:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate + DG(18:1(9Z)/18:1(9Z)/0:0) > Pyrophosphate + CDP-DG(18:1(9Z)/18:0) + CDP-DG(18:1(9Z)/18:0)
DG(16:0/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:0/10:0) + Pyrophosphate
DG(10:0/10:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(10:0/10:0) + Pyrophosphate
DG(16:0/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:0/12:0) + Pyrophosphate
DG(16:0/15:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(16:0/15:0/0:0) > CDP-DG(16:0/15:0) + Pyrophosphate
Hydrogen ion + Cytidine triphosphate + CDP-DG(10:0/12:0) > Pyrophosphate + DG(10:0/12:0/0:0)
1-hexadecanoyl-2-octadecanoyl-sn-glycerol + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:0/18:0) + Pyrophosphate + CDP-DG(16:0/18:0)
DG(10:0/12:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(10:0/12:0) + Pyrophosphate
DG(10:0/14:0/0:0) + Hydrogen ion + Cytidine triphosphate CDP-DG(10:0/14:0) + Pyrophosphate
DG(10:0/15:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(10:0/15:0) + Pyrophosphate
DG(10:0/16:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(10:0/16:0) + Pyrophosphate
DG(16:0/19:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:0/19:1(9Z)) + Pyrophosphate
DG(16:1(9Z)/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:1(9Z)/10:0) + Pyrophosphate
DG(10:0/16:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(10:0/16:1(9Z)) + Pyrophosphate
DG(16:1(9Z)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:1(9Z)/12:0) + Pyrophosphate
DG(10:0/18:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(10:0/18:0) + Pyrophosphate
DG(16:1(9Z)/15:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(16:1(9Z)/15:0/0:0) > CDP-DG(16:1(9Z)/15:0) + Pyrophosphate
DG(16:1(9Z)/18:0/0:0) + Hydrogen ion + Cytidine triphosphate + DG(16:1(9Z)/18:0/0:0) > CDP-DG(16:1(9Z)/18:0) + Pyrophosphate
DG(16:1(9Z)/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion + DG(16:1(9Z)/18:1(9Z)/0:0) > CDP-DG(16:1(9Z)/18:1(9Z)) + Pyrophosphate
DG(16:1(9Z)/19:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:1(9Z)/19:1(9Z)) + Pyrophosphate
DG(18:0/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:0/10:0) + Pyrophosphate
DG(10:0/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(10:0/18:1(9Z)) + Pyrophosphate
DG(18:0/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:0/12:0) + Pyrophosphate
DG(18:0/14:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:0/14:0/0:0) > CDP-DG(18:0/14:0) + Pyrophosphate
DG(10:0/19:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(10:0/19:1(9Z)) + Pyrophosphate
DG(18:0/15:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:0/15:0/0:0) > CDP-DG(18:0/15:0) + Pyrophosphate
DG(12:0/10:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(12:0/10:0) + Pyrophosphate
DG(18:0/16:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:0/16:0/0:0) > CDP-DG(18:0/16:0) + Pyrophosphate + CDP-DG(18:0/16:0)
DG(12:0/14:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0/14:0) + Pyrophosphate
DG(12:0/15:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(12:0/15:0) + Pyrophosphate
DG(18:0/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:0/16:1(9Z)/0:0) > CDP-DG(18:0/16:1(9Z)) + Pyrophosphate
1,2-Diacyl-sn-glycerol (dioctadecanoyl, n-C18:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:0/18:0) + Pyrophosphate + CDP-DG(18:0/18:0)
DG(12:0/16:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(12:0/16:0) + Pyrophosphate
DG(12:0/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0/16:1(9Z)) + Pyrophosphate
DG(18:0/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:0/18:1(9Z)/0:0) > CDP-DG(18:0/18:1(9Z)) + Pyrophosphate + CDP-DG(18:0/18:1(9Z))
DG(12:0/18:0/0:0) + Cytidine triphosphate + Hydrogen ion CDP-DG(12:0/18:0) + Pyrophosphate
DG(18:0/19:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:0/19:1(9Z)) + Pyrophosphate
DG(18:1(9Z)/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(9Z)/10:0) + Pyrophosphate
DG(18:1(9Z)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(9Z)/12:0) + Pyrophosphate
DG(18:1(9Z)/14:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:1(9Z)/14:0/0:0) > CDP-DG(18:1(9Z)/14:0) + Pyrophosphate
DG(12:0/18:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(12:0/18:1(9Z)) + Pyrophosphate
DG(18:1(9Z)/15:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:1(9Z)/15:0/0:0) > CDP-DG(18:1(9Z)/15:0) + Pyrophosphate
DG(18:1(9Z)/16:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:1(9Z)/16:0/0:0) > CDP-DG(18:1(9Z)/16:0) + Pyrophosphate + CDP-DG(18:1(9Z)/16:0)
DG(18:1(9Z)/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:1(9Z)/16:1(9Z)/0:0) > CDP-DG(18:1(9Z)/16:1(9Z)) + Pyrophosphate
DG(18:1(9Z)/19:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(9Z)/19:1(9Z)) + Pyrophosphate
DG(19:1(9Z)/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/10:0) + Pyrophosphate
DG(19:1(9Z)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/12:0) + Pyrophosphate
DG(19:1(9Z)/14:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/14:0) + Pyrophosphate
DG(19:1(9Z)/15:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/15:0) + Pyrophosphate
DG(19:1(9Z)/16:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/16:0) + Pyrophosphate
DG(19:1(9Z)/18:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/18:0) + Pyrophosphate
DG(12:0/19:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0/19:1(9Z)) + Pyrophosphate
DG(19:1(9Z)/19:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/19:1(9Z)) + Pyrophosphate
DG(14:0/10:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(14:0/10:0) + Pyrophosphate
DG(14:0/12:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(14:0/12:0) + Pyrophosphate
DG(14:0/15:0/0:0) + Hydrogen ion + Cytidine triphosphate + DG(14:0/15:0/0:0) > CDP-DG(14:0/15:0) + Pyrophosphate
Hydrogen ion + Cytidine triphosphate + DG(14:0/18:0/0:0) + DG(14:0/18:0/0:0) > CDP-DG(14:0/18:0) + Pyrophosphate
DG(14:0/18:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate + DG(14:0/18:1(9Z)/0:0) > CDP-DG(14:0/18:1(9Z)) + Pyrophosphate
DG(14:0/19:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(14:0/19:1(9Z)) + Pyrophosphate
DG(15:0/10:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(15:0/10:0) + Pyrophosphate
DG(15:0/12:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(15:0/12:0) + Pyrophosphate
DG(15:0/14:0/0:0) + Hydrogen ion + Cytidine triphosphate + DG(15:0/14:0/0:0) > CDP-DG(15:0/14:0) + Pyrophosphate
DG(15:0/15:0/0:0) + Hydrogen ion + Cytidine triphosphate + DG(15:0/15:0/0:0) > CDP-DG(15:0/15:0) + Pyrophosphate
DG(15:0/16:0/0:0) + Hydrogen ion + Cytidine triphosphate + DG(15:0/16:0/0:0) > CDP-DG(15:0/16:0) + Pyrophosphate
DG(15:0/16:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate + DG(15:0/16:1(9Z)/0:0) > CDP-DG(15:0/16:1(9Z)) + Pyrophosphate
DG(15:0/18:0/0:0) + Hydrogen ion + Cytidine triphosphate + DG(15:0/18:0/0:0) > CDP-DG(15:0/18:0) + Pyrophosphate
DG(15:0/18:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate + DG(15:0/18:1(9Z)/0:0) > Pyrophosphate + CDP-DG(15:0/18:1(9Z))
DG(15:0/19:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(15:0/19:1(9Z)) + Pyrophosphate
DG(17:0cycw7c/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/17:0cycw7c) + Pyrophosphate
2 DG(18:1(9Z)/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(18:1(9Z)/19:0cycv8c) + Carbon dioxide
2 DG(19:0cycv8c/15:0cyclo/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0cycv8c/15:0cyclo) + Pyrophosphate
DG(19:0cycv8c/14:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:0cycv8c/14:0) + Pyrophosphate
DG(19:0cycv8c/16:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:0cycv8c/16:0) + Pyrophosphate
DG(14:0/16:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(14:0/16:0/0:0) > CDP-DG(14:0/16:0) + Pyrophosphate
2 DG(19:0cycv8c/16:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0cycv8c/16:0) + Pyrophosphate
DG(17:0cycw7c/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/19:0cycv8c) + Pyrophosphate
DG(19:0cycv8c/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:0cycv8c/16:1(9Z)) + Pyrophosphate
2 DG(19:0cycv8c/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0cycv8c/16:1(9Z)) + Pyrophosphate
DG(17:0cycw7c/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/16:1(9Z)) + Pyrophosphate
DG(19:0cycv8c/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:0cycv8c/17:0cycw7c) + Pyrophosphate
2 DG(14:0/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(14:0/17:0cycw7c) + Pyrophosphate
2 DG(19:0cycv8c/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0cycv8c/18:1(9Z)) + Pyrophosphate
DG(19:0cycv8c/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:0cycv8c/19:0cycv8c) + Pyrophosphate
2 DG(14:0/16:0/0:0) + Cytidine triphosphate + Hydrogen ion + 2 DG(14:0/16:0/0:0) >2 CDP-DG(14:0/16:0) + Pyrophosphate
2 DG(19:0cycv8c/14:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0cycv8c/14:0) + Pyrophosphate
CDP-DG(16:0/14:0) + L-Serine + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/14:0) + Cytidine monophosphate
CDP-DG(16:0/16:0) + L-Serine + CDP-DG(16:0/16:0) + L-Serine > Hydrogen ion + Cytidine monophosphate + PS(16:0/16:0) + Cytidine monophosphate
L-Serine + CDP-DG(16:0/16:1(9Z)) + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/16:1(9Z)) + Cytidine monophosphate
CDP-DG(16:0/18:1(11Z)) + L-Serine + L-Serine > Hydrogen ion + Cytidine monophosphate + PS(16:0/18:1(11Z)) + Cytidine monophosphate
CDP-DG(16:1(9Z)/14:0) + L-Serine + L-Serine > Hydrogen ion + Cytidine monophosphate + PS(16:1(9Z)/14:0) + Cytidine monophosphate
L-Serine + CDP-DG(16:1(9Z)/16:0) + L-Serine > Hydrogen ion + Cytidine monophosphate + PS(16:1(9Z)/16:0) + Cytidine monophosphate
Hydrogen ion + PS(17:0/19:0) > Carbon dioxide + PE(17:0/19:0)
CDP-DG(18:1(11Z)/16:0) + L-Serine + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(18:1(11Z)/16:0) + Cytidine monophosphate
CDP-DG(18:1(11Z)/18:1(11Z)) + L-Serine + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(18:1(11Z)/18:1(11Z)) + Cytidine monophosphate
Hydrogen ion + PS(19:0/17:0) > Carbon dioxide + PE(19:0/17:0)
L-Serine + CDP-1,2-Dioctadecanoylglycerol + L-Serine > Hydrogen ion + Cytidine monophosphate + PS(18:0/18:0) + Cytidine monophosphate
L-Serine + CDP-DG(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) + L-Serine + CDP-DG(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) > Hydrogen ion + Cytidine monophosphate + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:2(9Z,12Z)) + Cytidine monophosphate
L-Serine + CDP-DG(19:1(9Z)/18:1(9Z)) + L-Serine > Hydrogen ion + Cytidine monophosphate + PS(19:iso/18:1(9Z)) + Cytidine monophosphate
CDP-DG(18:1(9Z)/18:0) + L-Serine + CDP-DG(18:1(9Z)/18:0) + L-Serine > Hydrogen ion + Cytidine monophosphate + PS(18:1(9Z)/18:0) + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + L-Serine + L-Serine > PS(16:0/18:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + L-Serine + L-Serine > PS(17:0/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + L-Serine + L-Serine > PS(17:0/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + L-Serine + L-Serine > PS(19:0/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + L-Serine + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(19:0/17:0) + Cytidine monophosphate
CDP-DG(16:0/10:0) + L-Serine + L-Serine > PS(16:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:0/12:0) + L-Serine + L-Serine > PS(16:0/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:0/18:0) + L-Serine + CDP-DG(16:0/18:0) + L-Serine > PS(16:0/18:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:1(9Z)/10:0) + L-Serine + L-Serine > PS(16:1(9Z)/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:1(9Z)/12:0) + L-Serine + L-Serine > PS(16:1(9Z)/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:1(9Z)/18:0) + L-Serine + L-Serine > PS(16:1(9Z)/18:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:1(9Z)/18:1(9Z)) + L-Serine + L-Serine > PS(16:1(9Z)/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:0/14:0) + L-Serine + L-Serine > PS(18:0/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:0/16:0) + L-Serine + CDP-DG(18:0/16:0) + L-Serine > PS(18:0/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:0/16:1(9Z)) + L-Serine + L-Serine > PS(18:0/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:0/18:0) + L-Serine + CDP-DG(18:0/18:0) + L-Serine > PS(18:0/18:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:0/18:1(9Z)) + L-Serine + CDP-DG(18:0/18:1(9Z)) + L-Serine > PS(18:0/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:1(9Z)/10:0) + L-Serine + L-Serine > PS(18:1(9Z)/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:1(9Z)/14:0) + L-Serine + L-Serine > PS(18:1(9Z)/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:1(9Z)/16:0) + L-Serine + CDP-DG(18:1(9Z)/16:0) + L-Serine > PS(18:1(9Z)/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:1(9Z)/16:1(9Z)) + L-Serine + L-Serine > PS(18:1(9Z)/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:1(9Z)/19:1(9Z)) + L-Serine + L-Serine > PS(16:1(9Z)/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/10:0) + L-Serine + L-Serine > PS(19:iso/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:0/19:1(9Z)) + L-Serine + L-Serine > PS(16:0/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/15:0) + L-Serine + L-Serine > PS(19:iso/15:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:1(9Z)/12:0) + L-Serine + L-Serine > PS(18:1(9Z)/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/12:0) + L-Serine + L-Serine > PS(19:iso/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/10:0) + L-Serine + L-Serine > PS(10:0(3-OH)/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/10:0) + L-Serine + L-Serine > PS(10:0(3-OH)/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/10:0) + L-Serine + L-Serine > PS(10:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/12:0) + L-Serine + L-Serine > PS(10:0(3-OH)/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/12:0) + L-Serine + L-Serine > PS(10:0(3-OH)/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/12:0) + L-Serine + L-Serine > PS(10:0/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/14:0) + L-Serine + L-Serine > PS(10:0(3-OH)/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/14:0) + L-Serine + L-Serine > PS(10:0(3-OH)/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/14:0) + L-Serine + L-Serine > PS(10:0/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/15:0) + L-Serine + L-Serine > PS(10:0(3-OH)/15:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/15:0) + L-Serine + L-Serine > PS(10:0(3-OH)/15:0cyclo) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/16:0) + L-Serine + L-Serine > PS(10:0(3-OH)/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/16:1(9Z)) + L-Serine + L-Serine > PS(10:0(3-OH)/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/18:0) + L-Serine + L-Serine > PS(10:0(3-OH)/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/18:1(9Z)) + L-Serine + L-Serine > PS(10:0(3-OH)/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/19:1(9Z)) + L-Serine + L-Serine > PS(10:0(3-OH)/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/19:1(9Z)) + L-Serine + L-Serine > PS(10:0(3-OH)/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/19:1(9Z)) + L-Serine + L-Serine > PS(10:0/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/10:0) + L-Serine + L-Serine > PS(12:0(3-OH)/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/10:0) + L-Serine + L-Serine > PS(12:0(3-OH)/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/14:0) + L-Serine + L-Serine > PS(12:0(3-OH)/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/14:0) + L-Serine + L-Serine > PS(12:0(3-OH)/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/15:0) + L-Serine + L-Serine > PS(12:0(3-OH)/15:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/14:0) + L-Serine + L-Serine > PS(12:0/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/15:0) + L-Serine + L-Serine > PS(12:0(3-OH)/15:0cyclo) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/16:0) + L-Serine + L-Serine > PS(12:0(3-OH)/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/16:1(9Z)) + L-Serine + L-Serine > PS(12:0(3-OH)/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/18:0) + L-Serine + L-Serine > PS(12:0(3-OH)/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/18:1(9Z)) + L-Serine + L-Serine > PS(12:0(3-OH)/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/19:1(9Z)) + L-Serine + L-Serine > PS(12:0(3-OH)/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/10:0) + L-Serine + L-Serine > PS(12:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/19:1(9Z)) + L-Serine + L-Serine > PS(12:0(3-OH)/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/19:1(9Z)) + L-Serine + L-Serine > PS(12:0/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/10:0) + L-Serine + L-Serine > PS(14:0(3-OH)/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/10:0) + L-Serine + L-Serine > PS(14:0(3-OH)/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/10:0) + L-Serine + L-Serine > PS(14:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/12:0) + L-Serine + L-Serine > PS(14:0(3-OH)/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/12:0) + L-Serine + L-Serine > PS(14:0(3-OH)/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/12:0) + L-Serine + L-Serine > PS(14:0/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/15:0) + L-Serine + L-Serine > PS(14:0(3-OH)/15:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/15:0) + L-Serine + L-Serine > PS(14:0(3-OH)/15:0cyclo) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/19:1(9Z)) + L-Serine + L-Serine > PS(14:0(3-OH)/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/19:1(9Z)) + L-Serine + L-Serine > PS(14:0(3-OH)/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(15:0/10:0) + L-Serine + L-Serine > PS(15:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(15:0/10:0) + L-Serine + L-Serine > PS(15:0cyclo/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(15:0/12:0) + L-Serine + L-Serine > PS(15:0/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(15:0/12:0) + L-Serine + L-Serine > PS(15:0cyclo/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:0/12:0) + L-Serine + L-Serine > PS(16:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(17:0cycw7c/17:0cycw7c) + L-Serine + L-Serine > PS(17:0cycw7c/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/18:1(9Z)) + L-Serine + L-Serine > PS(14:0/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:0cycv8c/14:0) + L-Serine + L-Serine > PS(19:0cycv8c/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:0cycv8c/16:0) + L-Serine + L-Serine > PS(19:0cycv8c/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/16:0) + L-Serine + L-Serine > PS(14:0/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(17:0cycw7c/19:0cycv8c) + L-Serine + L-Serine > PS(17:0cycw7c/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:0cycv8c/16:1(9Z)) + L-Serine + L-Serine > PS(19:0cycv8c/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(17:0cycw7c/16:1(9Z)) + L-Serine + L-Serine > PS(17:0cycw7c/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:0cycv8c/17:0cycw7c) + L-Serine + L-Serine > PS(19:0cycv8c/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:0cycv8c/19:0cycv8c) + L-Serine + L-Serine > PS(19:0cycv8c/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(17:0cycw7c/18:1(9Z)) + L-Serine + L-Serine > PS(17:0cycw7c/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
an L-1-phosphatidylserine + Hydrogen ion > Carbon dioxide + an L-1-phosphatidylethanolamine
PS(14:0/14:0) + Hydrogen ion > PE(14:0/14:0) + Carbon dioxide
PS(14:0/16:0) + Hydrogen ion > Carbon dioxide + PE(14:0/16:0)
PS(14:0/16:1(9Z)) + Hydrogen ion > Carbon dioxide + PE(14:0/16:1(9Z))
PS(14:0/17:0) + Hydrogen ion > Carbon dioxide + PE(14:0/17:0)
PS(14:0/18:1(11Z)) + Hydrogen ion > Carbon dioxide + PE(14:0/18:1(11Z))
PS(14:0/19:0) + Hydrogen ion > Carbon dioxide + PE(14:0/19:0)
PS(16:0/14:0) + Hydrogen ion > PE(16:0/14:0) + Carbon dioxide
PS(16:0/16:0) + Hydrogen ion > PE(16:0/16:0) + Carbon dioxide
PS(16:0/16:1(9Z)) + Hydrogen ion > Carbon dioxide + PE(16:0/16:1(9Z))
PS(16:0/17:0) + Hydrogen ion > Carbon dioxide + PE(16:0/17:0)
PS(16:0/18:1(11Z)) + Hydrogen ion > Carbon dioxide + PE(16:0/18:1(11Z))
PS(16:0/19:0) + Hydrogen ion > Carbon dioxide + PE(16:0/19:0)
PS(16:1(9Z)/14:0) + Hydrogen ion > Carbon dioxide + PE(16:1(9Z)/14:0)
PS(16:1(9Z)/16:0) + Hydrogen ion > Carbon dioxide + PE(16:1(9Z)/16:0)
PS(16:1(9Z)/16:1(9Z)) + Hydrogen ion > PE(16:1(9Z)/16:1(9Z)) + Carbon dioxide
PS(16:1(9Z)/18:1(11Z)) + Hydrogen ion > PE(16:1(9Z)/18:1(11Z)) + Carbon dioxide
PS(17:0/14:0) + Hydrogen ion > PE(17:0/14:0) + Carbon dioxide
PS(17:0/16:0) + Hydrogen ion > PE(17:0/16:0) + Carbon dioxide
PS(17:0/17:0) + Hydrogen ion > Carbon dioxide + PE(17:0/17:0)
PS(18:1(11Z)/14:0) + Hydrogen ion > Carbon dioxide + PE(18:1(11Z)/14:0)
PS(18:1(11Z)/16:0) + Hydrogen ion > PE(18:1(11Z)/16:0) + Carbon dioxide
PS(18:1(11Z)/16:1(9Z)) + Hydrogen ion > Carbon dioxide + PE(18:1(11Z)/16:1(9Z))
Hydrogen ion + PS(18:1(11Z)/18:1(11Z)) > Carbon dioxide + PE(18:1(11Z)/18:1(11Z))
Hydrogen ion + PS(19:0/14:0) > Carbon dioxide + PE(19:0/14:0)
Hydrogen ion + PS(19:0/16:0) > Carbon dioxide + PE(19:0/16:0)
Hydrogen ion + PS(19:0/19:0) > Carbon dioxide + PE(19:0/19:0)
Hydrogen ion + PS(18:0/18:0) > PE(18:0/18:0) + Carbon dioxide
PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:2(9Z,12Z)) + Hydrogen ion > Carbon dioxide + PE(22:5(7Z,10Z,13Z,16Z,19Z)/18:2(9Z,12Z))
PS(19:iso/18:1(9Z)) + Hydrogen ion > PE(18:1(9Z)/18:0) + Carbon dioxide
PS(18:1(9Z)/18:0) + Hydrogen ion > Carbon dioxide + PE(18:1(11Z)/17:0)
PS(14:0/18:0) + Hydrogen ion > Carbon dioxide + PE(14:0/17:0cycw7c)
PS(15:0/19:iso) + Hydrogen ion > PE(15:0/17:0cycw7c) + Coenzyme A
PS(14:0/17:0) + Hydrogen ion > PE(14:0/16:0) + Carbon dioxide
PS(14:0/17:0) + Hydrogen ion > PE(14:0/16:1(9Z)) + Carbon dioxide
PS(14:0/19:0) + Hydrogen ion > PE(14:0/18:1(9Z)) + Carbon dioxide
PS(16:0/19:iso) + Hydrogen ion > PE(16:0/19:0cycw8c) + Carbon dioxide
PS(14:0/18:1(9Z)) + Hydrogen ion > PE(14:0/18:1(9Z)) + Carbon dioxide
Hydrogen ion + PS(16:1(9Z)/16:1(9Z)) > PE(16:1(9Z)/16:1(9Z)) + Carbon dioxide
PS(16:1(9Z)/18:1(9Z)) + Hydrogen ion > PE(16:1(9Z)/18:1(9Z)) + Carbon dioxide
PS(16:1(9Z)/19:iso) + Hydrogen ion > PE(16:1(9Z)/19:iso) + Carbon dioxide
PS(16:1(9Z)/19:iso) + Hydrogen ion > PE(16:1(9Z)/19:iso) + Carbon dioxide
PS(17:0/18:1(11Z)) + Hydrogen ion > PE(17:0/18:1(11Z)) + Carbon dioxide
PS(18:1(9Z)/18:1(9Z)) + Hydrogen ion > PE(18:1(9Z)/18:1(9Z)) + Carbon dioxide
PS(18:1(9Z)/19:iso) + Hydrogen ion > PE(18:1(9Z)/19:iso) + Carbon dioxide
PS(17:0cycw7c/19:iso) + Hydrogen ion > PE(17:0cycw7c/19:iso) + Carbon dioxide
Hydrogen ion + PS(19:0cycv8c/19:iso) > Carbon dioxide + PE(19:0cycv8c/19:iso)
PS(15:0cyclo/19:iso) + Hydrogen ion > PE(15:0cyclo/19:iso) + Carbon dioxide
PS(15:0cyclo/14:0(3-OH)) + Hydrogen ion > PE(15:0cyclo/14:0(3-OH)) + Carbon dioxide
PS(14:0/17:0) + Hydrogen ion > PE(14:0/17:0cycw7c) + Carbon dioxide
PS(17:0/17:0) + Hydrogen ion > PE(17:0cycw7c/17:0cycw7c) + Carbon dioxide
Hydrogen ion + PS(18:1(9Z)/16:0) > Carbon dioxide + PE(18:1(9Z)/15:0)
Hydrogen ion + PS(19:iso/15:0cyclo) > PE(19:iso/15:0cyclo) + Carbon dioxide
PS(16:0/16:0) + Hydrogen ion > PE(16:0/15:0) + Carbon dioxide
PS(16:0/14:1(9Z)) + Hydrogen ion > PE(15:0/15:0) + Carbon dioxide
PS(17:0/16:0) + Hydrogen ion > PE(15:0/17:0cycw7c) + Carbon dioxide
PS(15:0/19:iso) + Hydrogen ion > PE(15:0/19:iso) + Carbon dioxide
PS(15:0/19:iso) + Hydrogen ion > PE(15:0/18:1(9Z)) + Carbon dioxide
PS(16:0/16:0) + Hydrogen ion > PE(15:0/16:0) + Carbon dioxide
PS(16:0/16:1(9Z)) + Hydrogen ion > PE(15:0/16:1(9Z)) + Carbon dioxide
PS(14:0/16:0) + Hydrogen ion > PE(15:0/14:0) + Carbon dioxide
PS(19:iso/15:0) + Hydrogen ion > PE(19:iso/15:0) + Carbon dioxide
PS(18:0/14:0) + Hydrogen ion > PE(18:0/16:0) + Carbon dioxide
PS(16:0/18:0) + Hydrogen ion > PE(16:0/18:0) + Carbon dioxide
PS(16:0/18:0) + Hydrogen ion > PE(14:0/20:0) + Carbon dioxide
PS(16:0/18:1(9Z)) + Hydrogen ion > PE(16:0/18:1(9Z)) + Carbon dioxide
PS(17:0/14:0) + Hydrogen ion > PE(17:0/14:0) + Carbon dioxide
PS(17:0/16:0) + Hydrogen ion > PE(17:0/16:0) + Carbon dioxide
PS(14:0/19:iso) + Hydrogen ion > PE(14:0/19:iso) + Carbon dioxide
PS(16:0/17:0) + Hydrogen ion > PE(15:0/17:0cycw7c) + Carbon dioxide
PS(19:0/16:0) + Hydrogen ion > PE(19:0/16:0) + Carbon dioxide
PS(16:1(9Z)/17:0) + Hydrogen ion > PE(16:1(9Z)/17:0) + Carbon dioxide
PS(18:0/18:0) + Hydrogen ion > PE(18:0/17:0cycw7c) + Carbon dioxide
PS(19:0/17:0) + Hydrogen ion > PE(19:0/17:0) + Carbon dioxide
PS(18:0/20:0) + Hydrogen ion > PE(19:iso/19:0cycv8c) + Carbon dioxide
PS(14:0/14:1(9Z)) + Hydrogen ion > PE(14:0/15:0) + Carbon dioxide
PS(16:0/10:0(3-OH)) + Hydrogen ion > PE(16:0/10:0(3-OH)) + Carbon dioxide
PS(16:0/12:0(3-OH)) + Hydrogen ion > PE(16:0/12:0(3-OH)) + Carbon dioxide
PS(16:1(9Z)/10:0(3-OH)) + Hydrogen ion > PE(16:1(9Z)/10:0(3-OH)) + Carbon dioxide
PS(16:1(9Z)/12:0(3-OH)) + Hydrogen ion > PE(16:1(9Z)/12:0(3-OH)) + Carbon dioxide
PS(16:1(9Z)/18:0) + Hydrogen ion > PE(16:1(9Z)/18:0) + Carbon dioxide
PS(16:1(9Z)/18:1(9Z)) + Hydrogen ion > PE(16:1(9Z)/18:1(9Z)) + Carbon dioxide
PS(18:0/14:0) + Hydrogen ion > PE(18:0/14:0) + Carbon dioxide
PS(18:0/16:0) + Hydrogen ion > PE(18:0/16:0) + Carbon dioxide
PS(18:0/16:1(9Z)) + Hydrogen ion > PE(18:0/16:1(9Z)) + Carbon dioxide
PS(18:0/18:1(9Z)) + Hydrogen ion > PE(18:0/18:1(9Z)) + Carbon dioxide
PS(18:1(9Z)/10:0(3-OH)) + Hydrogen ion > PE(18:1(9Z)/10:0(3-OH)) + Carbon dioxide
PS(18:1(9Z)/14:0) + Hydrogen ion > PE(18:1(9Z)/14:0) + Carbon dioxide
PS(18:1(9Z)/16:0) + Hydrogen ion > PE(18:1(9Z)/16:0) + Carbon dioxide
PS(18:1(9Z)/16:1(9Z)) + Hydrogen ion > PE(18:1(9Z)/16:1(9Z)) + Carbon dioxide
PS(19:iso/10:0) + Hydrogen ion > PE(19:iso/10:0) + Carbon dioxide
PS(16:0/19:iso) + Hydrogen ion > PE(16:0/19:iso) + Carbon dioxide
PS(18:1(9Z)/12:0(3-OH)) + Hydrogen ion > PE(18:1(9Z)/12:0(3-OH)) + Carbon dioxide
PS(19:iso/12:0) + Hydrogen ion > PE(19:iso/12:0) + Carbon dioxide
PS(10:0(3-OH)/10:0(3-OH)) + Hydrogen ion > PE(10:0(3-OH)/10:0(3-OH)) + Carbon dioxide
PS(10:0(3-OH)/10:0) + Hydrogen ion > PE(10:0(3-OH)/10:0) + Carbon dioxide
PS(10:0(3-OH)/10:0) + Hydrogen ion > Carbon dioxide + PE(10:0/10:0)
PS(10:0/10:0(3-OH)) + Hydrogen ion > PE(10:0/10:0(3-OH)) + Carbon dioxide
PS(10:0(3-OH)/12:0(3-OH)) + Hydrogen ion > PE(10:0(3-OH)/12:0(3-OH)) + Carbon dioxide
PS(10:0(3-OH)/12:0) + Hydrogen ion > PE(10:0(3-OH)/12:0) + Carbon dioxide
PS(10:0(3-OH)/12:0) + Hydrogen ion > PE(10:0/12:0) + Carbon dioxide
PS(10:0/12:0(3-OH)) + Hydrogen ion > PE(10:0/12:0(3-OH)) + Carbon dioxide
PS(10:0(3-OH)/14:0(3-OH)) + Hydrogen ion > PE(10:0(3-OH)/14:0(3-OH)) + Carbon dioxide
PS(10:0(3-OH)/14:0) + Hydrogen ion > PE(10:0(3-OH)/14:0) + Carbon dioxide
PS(10:0(3-OH)/14:0) + Hydrogen ion > PE(10:0/14:0) + Carbon dioxide
PS(10:0/14:0(3-OH)) + Hydrogen ion > PE(10:0/14:0(3-OH)) + Carbon dioxide
PS(10:0(3-OH)/15:0) + Hydrogen ion > PE(10:0(3-OH)/15:0) + Carbon dioxide
PS(10:0(3-OH)/15:0cyclo) + Hydrogen ion > PE(10:0(3-OH)/15:0cyclo) + Carbon dioxide
PS(10:0(3-OH)/15:0cyclo) + Hydrogen ion > PE(10:0/15:0) + Carbon dioxide
PS(10:0(3-OH)/16:0) + Hydrogen ion > PE(10:0(3-OH)/16:0) + Carbon dioxide
PS(10:0(3-OH)/16:0) + Hydrogen ion > PE(10:0/16:0) + Carbon dioxide
PS(10:0(3-OH)/16:1(9Z)) + Hydrogen ion > PE(10:0(3-OH)/16:1(9Z)) + Carbon dioxide
PS(10:0(3-OH)/16:1(9Z)) + Hydrogen ion > PE(10:0/16:1(9Z)) + Carbon dioxide
PS(10:0(3-OH)/16:1(9Z)) + Hydrogen ion > PE(10:0/18:0) + Carbon dioxide
PS(10:0(3-OH)/18:1(9Z)) + Hydrogen ion > PE(10:0/18:0) + Carbon dioxide
PS(10:0(3-OH)/18:1(9Z)) + Hydrogen ion > PE(10:0(3-OH)/18:1(9Z)) + Carbon dioxide
PS(10:0(3-OH)/19:0cycv8c) + Hydrogen ion > PE(10:0(3-OH)/19:0cycv8c) + Carbon dioxide
PS(19:iso/17:0cycw7c) + Hydrogen ion > PE(19:0cycw8c/17:0cycw7c) + Carbon dioxide
PS(10:0(3-OH)/19:0cycv8c) + Hydrogen ion > PE(10:0/19:0cycw8c) + Carbon dioxide
PS(10:0(3-OH)/19:0cycv8c) + Hydrogen ion > PE(10:0/19:1(12Z)) + Carbon dioxide
PS(19:0cycv8c/14:0(3-OH)) + Hydrogen ion > PE(19:0cycv8c/14:0(3-OH)) + Carbon dioxide
PS(10:0(3-OH)/19:iso) + Hydrogen ion > PE(10:0(3-OH)/19:iso) + Carbon dioxide
PS(10:0/19:iso) + Hydrogen ion > PE(10:0/19:iso) + Carbon dioxide
PS(10:0(3-OH)/18:1(9Z)) + Hydrogen ion > PE(10:0/18:1(11Z)) + Carbon dioxide
PS(12:0(3-OH)/10:0(3-OH)) + Hydrogen ion > PE(12:0(3-OH)/10:0(3-OH)) + Carbon dioxide
PS(12:0(3-OH)/10:0(3-OH)) + Hydrogen ion > PE(12:0/10:0) + Carbon dioxide
PS(12:0(3-OH)/10:0) + Hydrogen ion > PE(12:0(3-OH)/10:0) + Carbon dioxide
PS(12:0(3-OH)/14:0(3-OH)) + Hydrogen ion > PE(12:0(3-OH)/14:0(3-OH)) + Carbon dioxide
PS(12:0(3-OH)/14:0) + Hydrogen ion > PE(12:0(3-OH)/14:0) + Carbon dioxide
PS(12:0(3-OH)/14:0) + Hydrogen ion > PE(12:0/14:0) + Carbon dioxide
PS(12:0(3-OH)/15:0) + Hydrogen ion > PE(12:0(3-OH)/15:0) + Carbon dioxide
PS(12:0(3-OH)/15:0) + Hydrogen ion > PE(12:0/15:0) + Carbon dioxide
PS(12:0/14:0(3-OH)) + Hydrogen ion > PE(12:0/14:0(3-OH)) + Carbon dioxide
PS(12:0(3-OH)/15:0cyclo) + Hydrogen ion > PE(12:0(3-OH)/15:0cyclo) + Carbon dioxide
PS(12:0(3-OH)/16:0) + Hydrogen ion > PE(12:0(3-OH)/16:0) + Carbon dioxide
PS(12:0(3-OH)/16:0) + Hydrogen ion > PE(12:0/16:0) + Carbon dioxide
PS(12:0(3-OH)/16:1(9Z)) + Hydrogen ion > PE(12:0(3-OH)/16:1(9Z)) + Carbon dioxide
PS(12:0(3-OH)/16:1(9Z)) + Hydrogen ion > PE(12:0/16:1(9Z)) + Carbon dioxide
PS(12:0(3-OH)/18:1(9Z)) + Hydrogen ion > PE(12:0/18:0) + Carbon dioxide
PS(12:0(3-OH)/18:1(9Z)) + Hydrogen ion > PE(12:0(3-OH)/18:1(9Z)) + Carbon dioxide
PS(12:0(3-OH)/18:1(9Z)) + Hydrogen ion > PE(12:0/18:1(11Z)) + Carbon dioxide
PS(14:0(3-OH)/19:0cycv8c) + Hydrogen ion > PE(14:0(3-OH)/19:0cycv8c) + Carbon dioxide
PS(12:0(3-OH)/19:0cycv8c) + Hydrogen ion > PE(12:0(3-OH)/19:0cycv8c) + Carbon dioxide
PS(12:0/10:0(3-OH)) + Hydrogen ion > PE(12:0/10:0(3-OH)) + Carbon dioxide
PS(12:0(3-OH)/19:iso) + Hydrogen ion > PE(12:0(3-OH)/19:iso) + Carbon dioxide
PS(12:0/19:iso) + Hydrogen ion > PE(12:0/19:iso) + Carbon dioxide
PS(17:0cycw7c/14:0(3-OH)) + Hydrogen ion > PE(17:0cycw7c/14:0(3-OH)) + Carbon dioxide
PS(12:0(3-OH)/19:0cycv8c) + Hydrogen ion > PE(12:0/19:0cycw8c) + Carbon dioxide
PS(12:0/19:iso) + Hydrogen ion > PE(12:0/19:1(12Z)) + Carbon dioxide
PS(14:0(3-OH)/10:0(3-OH)) + Hydrogen ion > PE(14:0(3-OH)/10:0(3-OH)) + Carbon dioxide
PS(14:0(3-OH)/10:0) + Hydrogen ion > PE(14:0(3-OH)/10:0) + Carbon dioxide
PS(14:0/10:0(3-OH)) + Hydrogen ion > PE(14:0/10:0(3-OH)) + Carbon dioxide
PS(14:0(3-OH)/10:0) + Hydrogen ion > PE(14:0/10:0) + Carbon dioxide
PS(14:0(3-OH)/12:0(3-OH)) + Hydrogen ion > PE(14:0(3-OH)/12:0(3-OH)) + Carbon dioxide
PS(14:0(3-OH)/12:0) + Hydrogen ion > PE(14:0(3-OH)/12:0) + Carbon dioxide
PS(14:0/12:0(3-OH)) + Hydrogen ion > PE(14:0/12:0(3-OH)) + Carbon dioxide
PS(14:0(3-OH)/12:0) + Hydrogen ion > PE(14:0/12:0) + Carbon dioxide
PS(14:0(3-OH)/15:0) + Hydrogen ion > PE(14:0(3-OH)/15:0) + Carbon dioxide
PS(14:0(3-OH)/17:0cycw7c) + Hydrogen ion > PE(14:0/17:0cycw7c) + Carbon dioxide
PS(14:0(3-OH)/15:0cyclo) + Hydrogen ion > PE(14:0(3-OH)/15:0cyclo) + Carbon dioxide
PS(14:0(3-OH)/19:iso) + Hydrogen ion > PE(14:0(3-OH)/19:iso) + Carbon dioxide
PS(15:0/10:0(3-OH)) + Hydrogen ion > PE(15:0/10:0(3-OH)) + Carbon dioxide
PS(15:0cyclo/10:0(3-OH)) + Hydrogen ion > PE(15:0cyclo/10:0(3-OH)) + Carbon dioxide
PS(15:0/10:0(3-OH)) + Hydrogen ion > PE(15:0/10:0) + Carbon dioxide
PS(15:0/12:0(3-OH)) + Hydrogen ion > PE(15:0/12:0(3-OH)) + Carbon dioxide
PS(15:0cyclo/12:0(3-OH)) + Hydrogen ion > PE(15:0cyclo/12:0(3-OH)) + Carbon dioxide
PS(15:0/12:0(3-OH)) + Hydrogen ion > PE(15:0/12:0) + Carbon dioxide
PS(16:0/10:0(3-OH)) + Hydrogen ion > PE(16:0/10:0) + Carbon dioxide
PS(19:iso/16:0) + Hydrogen ion > PE(19:iso/16:0) + Carbon dioxide
PS(19:iso/16:1(9Z)) + Hydrogen ion > PE(19:iso/16:1(9Z)) + Carbon dioxide
PS(16:1(9Z)/14:0) + Hydrogen ion > PE(16:1(9Z)/14:0) + Carbon dioxide
PS(19:iso/18:1(9Z)) + Hydrogen ion > PE(19:iso/18:1(9Z)) + Carbon dioxide
PS(17:0cycw7c/17:0cycw7c) + Hydrogen ion > PE(17:0cycw7c/17:0cycw7c) + Carbon dioxide
PS(19:0cycv8c/14:0) + Hydrogen ion > PE(19:0cycv8c/14:0) + Carbon dioxide
PS(19:0cycv8c/16:0) + Hydrogen ion > PE(19:0cycv8c/16:0) + Carbon dioxide
PS(17:0cycw7c/19:0cycv8c) + Hydrogen ion > PE(17:0cycw7c/19:0cycv8c) + Carbon dioxide
PS(19:0cycv8c/16:1(9Z)) + Hydrogen ion > PE(19:0cycv8c/16:1(9Z)) + Carbon dioxide
PS(17:0cycw7c/16:1(9Z)) + Hydrogen ion > PE(17:0cycw7c/16:1(9Z)) + Carbon dioxide
PS(19:0cycv8c/17:0cycw7c) + Hydrogen ion > PE(19:0cycv8c/17:0cycw7c) + Carbon dioxide
PS(19:0cycv8c/19:0cycv8c) + Hydrogen ion > PE(19:0cycv8c/19:0cycv8c) + Carbon dioxide
PS(17:0cycw7c/18:1(9Z)) + Hydrogen ion > PE(17:0cycw7c/18:1(9Z)) + Carbon dioxide
CDP-DG(16:0/16:0) + Glycerol 3-phosphate + CDP-DG(16:0/16:0) > Cytidine monophosphate + Hydrogen ion + PGP(16:0/16:0) + Cytidine monophosphate
Glycerol 3-phosphate + CDP-DG(16:0/16:1(9Z)) > Hydrogen ion + PGP(16:0/16:1(9Z)) + Cytidine monophosphate + Cytidine monophosphate
CDP-DG(16:0/18:1(11Z)) + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(16:0/18:1(11Z)) + Cytidine monophosphate
CDP-DG(16:1(9Z)/16:0) + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(16:1(9Z)/16:0) + Cytidine monophosphate
CDP-DG(18:1(11Z)/16:0) + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(18:1(11Z)/16:0) + Cytidine monophosphate
CDP-DG(18:1(11Z)/18:1(11Z)) + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(18:1(11Z)/18:1(11Z)) + Cytidine monophosphate
Glycerol 3-phosphate + CDP-1,2-Dioctadecanoylglycerol > Hydrogen ion + Cytidine monophosphate + PGP(18:0/18:0) + Cytidine monophosphate
CDP-DG(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) + Glycerol 3-phosphate + CDP-DG(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) > PGP(18:2(9Z,12Z)/18:2(9Z,12Z)) + Hydrogen ion + Cytidine monophosphate + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + Glycerol 3-phosphate > Hydrogen ion + Cytidine monophosphate + PGP(18:1(9Z)/18:1(9Z)) + Cytidine monophosphate
CDP-DG(18:1(9Z)/18:0) + Glycerol 3-phosphate + CDP-DG(18:1(9Z)/18:0) > Hydrogen ion + Cytidine monophosphate + PGP(18:1(9Z)/18:1(9Z)) + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + Glycerol 3-phosphate > PGP(16:0/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + L-Serine + L-Serine > PS(18:0/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + Glycerol 3-phosphate > PGP(16:0/18:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + Glycerol 3-phosphate > PGP(14:0/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(18:1(9Z)/19:0cycv8c) + Glycerol 3-phosphate >2 PGP(18:1(9Z)/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0cycv8c/15:0cyclo) + Glycerol 3-phosphate >2 PGP(19:0cycv8c/15:0cyclo) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0cycv8c/16:0) + Glycerol 3-phosphate >2 PGP(19:0cycv8c/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0cycv8c/16:1(9Z)) + Glycerol 3-phosphate >2 PGP(19:0cycv8c/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(14:0/17:0cycw7c) + Glycerol 3-phosphate >2 PGP(14:0/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0cycv8c/18:1(9Z)) + Glycerol 3-phosphate >2 PGP(19:0cycv8c/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(14:0/16:0) + Glycerol 3-phosphate >2 PGP(14:0/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0cycv8c/14:0) + Glycerol 3-phosphate >2 PGP(19:0cycv8c/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
PS(19:iso/19:iso) + Hydrogen ion > PE(19:iso/19:iso) + Carbon dioxide
Beta-D-Glucose + Adenosine triphosphate + b-D-Glucose > Hydrogen ion + Adenosine diphosphate + beta-D-Glucose 6-phosphate + ADP
D-Glucose + Adenosine triphosphate > Hydrogen ion + Adenosine diphosphate + beta-D-Glucose 6-phosphate + ADP
β-D-fructofuranose + Adenosine triphosphate + D-Fructose > Adenosine diphosphate + Hydrogen ion + D-tagatofuranose 6-phosphate + ADP
D-Fructose + Adenosine triphosphate + D-Fructose > D-tagatofuranose 6-phosphate + Adenosine diphosphate + Hydrogen ion + ADP
N-Acetyl-D-glucosamine + Adenosine triphosphate + N-Acetylglucosamine > N-Acetyl-D-Glucosamine 6-Phosphate + Adenosine diphosphate + Hydrogen ion + N-Acetyl-D-Glucosamine 6-Phosphate + ADP
Glucosamine-1P + Acetyl-CoA + Glucosamine-1P > N-Acetyl-glucosamine 1-phosphate + Coenzyme A + Hydrogen ion + N-Acetyl-glucosamine 1-phosphate
N-Acetyl-glucosamine 1-phosphate + Uridine triphosphate + Hydrogen ion + N-Acetyl-glucosamine 1-phosphate + Uridine triphosphate > Uridine diphosphate-N-acetylglucosamine + Pyrophosphate
UDP-N-acetyl-D-mannosamine + 2 NAD + Water + UDP-N-Acetyl-D-mannosamine > UDP-N-acetyl-α-D-mannosaminuronate +2 NADH +3 Hydrogen ion
UDP-N-acetyl-α-D-glucosamine-enolpyruvate + NADPH + Hydrogen ion + NADPH > NADP + UDP-N-acetyl-α-D-muramate
D-Erythrose 4-phosphate + NAD + Water > NADH + Hydrogen ion + 4-Phospho-D-erythronate
4-Phospho-D-erythronate + NAD > NADH + Hydrogen ion + 2-Oxo-3-hydroxy-4-phosphobutanoic acid
Alpha-D-glucose 1-phosphate + Adenosine triphosphate + Hydrogen ion > ADP-Glucose + Pyrophosphate
UDP-Glucose + 2 NAD + Water > UDP-Glucuronic acid +2 NADH +3 Hydrogen ion
Uridine 5''-diphospho-{beta}-4-deoxy-4-amino-L-arabinose + an N10-formyl-tetrahydrofolate + N10-Formyl-THF > UDP-4-Deoxy-4-formamido-beta-L-arabinose + Hydrogen ion + a tetrahydrofolate + Tetrahydrofolic acid
a malonyl-[acp] + Hydrogen ion + Acetyl-CoA > Carbon dioxide + Coenzyme A + acetoacetyl-[acp]
6 Adenosine triphosphate + 3 L-Serine + 3 2,3-Dihydroxybenzoic acid + 3 L-Serine >6 Adenosine monophosphate + enterobactin +6 Pyrophosphate +3 Hydrogen ion
Guanosine triphosphate + Water > Formic acid + Hydrogen ion + 7,8-dihydroneopterin 3'-triphosphate
7,8-dihydroneopterin 3'-triphosphate + Water > Pyrophosphate + Hydrogen ion + Dihydroneopterin monophosphate
6-Hydroxymethyl dihydropterin + Adenosine triphosphate > Adenosine monophosphate + Hydrogen ion + 6-Hydroxymethyl-dihydropterin pyrophosphate
4-amino-4-deoxychorismate + 4-Amino-4-deoxychorismate > Pyruvic acid + Hydrogen ion + p-Aminobenzoic acid
7,8-Dihydropteroic acid + Adenosine triphosphate + L-Glutamic acid + L-Glutamate > Adenosine diphosphate + Phosphate + Hydrogen ion + 7,8-dihydrofolate monoglutamate + ADP + Dihydrofolic acid
D-Ribose-5-phosphate + Adenosine triphosphate > Hydrogen ion + Adenosine monophosphate + Phosphoribosyl pyrophosphate
5-Phosphoribosylamine + Glycine + Adenosine triphosphate + 5-Phosphoribosylamine > N1-(5-phospho-β-D-ribosyl)glycinamide + Phosphate + Adenosine diphosphate + Hydrogen ion + ADP
5'-Phosphoribosyl-N-formylglycinamide + Water + L-Glutamine + Adenosine triphosphate + 5'-Phosphoribosyl-N-formylglycineamide > 2-(Formamido)-N1-(5-phospho-D-ribosyl)acetamidine + L-Glutamic acid + Phosphate + Adenosine diphosphate + Hydrogen ion + L-Glutamate + ADP
2-(Formamido)-N1-(5-phospho-D-ribosyl)acetamidine + Adenosine triphosphate > 5-Aminoimidazole ribonucleotide + Phosphate + Adenosine diphosphate + Hydrogen ion + ADP
5-Aminoimidazole ribonucleotide + Hydrogen carbonate + Adenosine triphosphate > N5-Carboxyaminoimidazole ribonucleotide + Adenosine diphosphate + Phosphate +2 Hydrogen ion + N5-Carboxyaminoimidazole ribonucleotide + ADP
5-Amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylate + L-Aspartic acid + Adenosine triphosphate + L-Aspartic acid > SAICAR + Phosphate + Adenosine diphosphate + Hydrogen ion + SAICAR + ADP
Inosinic acid + NAD + Water > NADH + Hydrogen ion + Xanthylic acid
Xanthylic acid + Adenosine triphosphate + L-Glutamine + Water > Adenosine monophosphate + Pyrophosphate + L-Glutamic acid +2 Hydrogen ion + Guanosine monophosphate + L-Glutamate
Adenosine diphosphate + Phosphate + 4 Hydrogen ion + ADP <> Water +3 Hydrogen ion + Adenosine triphosphate
Adenosine diphosphate + Phosphate + 4 Hydrogen ion + ADP <> Water +3 Hydrogen ion + Adenosine triphosphate
β-D-fructofuranose 1-phosphate + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + Fructose 1,6-bisphosphate + ADP + Fructose 1,6-bisphosphate
a glycerophosphodiester + Water > Hydrogen ion + Alcohol + Glycerol 3-phosphate
sn-glycero-3-phosphocholine + Water > Hydrogen ion + Benzyl alcohol + Glycerol 3-phosphate
sn-glycero-3-phosphoethanolamine + Water > Benzyl alcohol + Hydrogen ion + Glycerol 3-phosphate
Glycerophosphoglycerol + Water > Benzyl alcohol + Hydrogen ion + Glycerol 3-phosphate
glycerophosphoserine + Water > Hydrogen ion + Benzyl alcohol + Glycerol 3-phosphate
Glycerol + Adenosine triphosphate > Hydrogen ion + Adenosine diphosphate + Glycerol 3-phosphate + ADP
UDP-N-acetyl-α-D-muramate + L-Alanine + Adenosine triphosphate + L-Alanine > Adenosine diphosphate + Phosphate + Hydrogen ion + UDP-N-Acetylmuramoyl-L-alanine + ADP
UDP-N-acetylmuramoyl-L-alanyl-D-glutamate + Meso-2,6-Diaminoheptanedioate + Adenosine triphosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamate > Adenosine diphosphate + Phosphate + Hydrogen ion + UDP-N-Acetylmuramoyl-L-alanyl-D-gamma-glutamyl-meso-2,6-diaminopimelate + ADP
UDP-N-Acetylmuramoyl-L-alanyl-D-gamma-glutamyl-meso-2,6-diaminopimelate + D-Alanyl-D-alanine + Adenosine triphosphate > Adenosine diphosphate + Phosphate + Hydrogen ion + UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine + ADP
Undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine + Uridine diphosphate-N-acetylglucosamine + Undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine > Uridine 5'-diphosphate + Hydrogen ion + lipid II(A) + Uridine 5'-diphosphate
2 lipid II(A) > Undecaprenyl diphosphate + Hydrogen ion + a peptidoglycan dimer (meso-diaminopimelate containing)
alkylsulfonate + FMNH2 + Oxygen > Betaine aldehyde + Sulfite + Flavin Mononucleotide + Water +2 Hydrogen ion + Sulfite
Butanesulfonate + Oxygen + FMNH2 > Hydrogen ion + Water + Sulfite + Flavin Mononucleotide + Betaine aldehyde + Sulfite
Oxygen + FMNH2 + 3-(N-morpholino)propanesulfonate > Sulfite + Water + Hydrogen ion + Flavin Mononucleotide + Betaine aldehyde + Sulfite
ethanesulfonate + Oxygen + FMNH2 > Hydrogen ion + Water + Flavin Mononucleotide + Sulfite + Betaine aldehyde + Sulfite
isethionate + Oxygen + FMNH2 > Betaine aldehyde + Flavin Mononucleotide + Hydrogen ion + Water + Sulfite + Sulfite
Oxygen + methanesulfonate + FMNH2 + Methanesulfonate > Hydrogen ion + Water + Flavin Mononucleotide + Sulfite + Betaine aldehyde + Sulfite
Cyanide + Thiosulfate + Cyanide + Thiosulfate > Thiocyanate + Sulfite + Hydrogen ion + Thiocyanate + Sulfite
8 5-Aminolevulinic acid >4 Hydrogen ion +8 Water +4 Porphobilinogen
Uroporphyrinogen III + 4 Hydrogen ion >4 Carbon dioxide + Coproporphyrinogen III
Uroporphyrinogen I + 4 Hydrogen ion >4 Carbon dioxide + Coproporphyrinogen I
Coproporphyrinogen III + 2 Hydrogen ion + Oxygen >2 Water +2 Carbon dioxide + Protoporphyrinogen IX
Protoporphyrin IX + Iron >2 Hydrogen ion + ferroheme b
Uroporphyrinogen III + S-adenosyl-L-methionine > Hydrogen ion + S-Adenosylhomocysteine + Precorrin-1
Precorrin-2 + NAD > NADH + Hydrogen ion + Sirohydrochlorin
Sirohydrochlorin + Iron >2 Hydrogen ion + Siroheme
Propionyl-CoA + Water + Oxalacetic acid + Propionyl-CoA > Coenzyme A + Hydrogen ion + 2-Methylcitric acid + Methylcitric acid
Methylmalonyl-CoA + Hydrogen ion > Carbon dioxide + Propionyl-CoA + Propionyl-CoA
UDP-Glucose + Alpha-D-glucose 6-phosphate > Uridine 5'-diphosphate + Trehalose 6-phosphate + Hydrogen ion + Uridine 5'-diphosphate
Carbamoylphosphate + L-Aspartic acid + L-Aspartic acid > Phosphate + Hydrogen ion + N-carbamoyl-L-aspartate
N-carbamoyl-L-aspartate + Hydrogen ion > Water + 4,5-Dihydroorotic acid + 4,5-Dihydroorotic acid
Orotidylic acid + Hydrogen ion > Carbon dioxide + Uridine 5'-monophosphate
Uridine triphosphate + L-Glutamine + Water + Adenosine triphosphate + Uridine triphosphate > Adenosine diphosphate + Hydrogen ion + Phosphate + L-Glutamic acid + Cytidine triphosphate + ADP + L-Glutamate
Deoxyuridine triphosphate + Water > Phosphate + Hydrogen ion + dUMP
dCTP + Water + Hydrogen ion > Ammonium + Deoxyuridine triphosphate
L-Serine + L-Serine > Water + Hydrogen ion + 2-Aminoacrylic acid
L-Serine + L-Serine > Water + Hydrogen ion + 2-Aminoacrylic acid
NADPH + Hydrogen ion + 1-Deoxy-D-xylulose 5-phosphate + NADPH + 1-Deoxy-D-xylulose 5-phosphate > NADP + 2-C-methyl-D-erythritol 4-phosphate
2-C-methyl-D-erythritol 4-phosphate + Cytidine triphosphate + Hydrogen ion > Pyrophosphate + 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol
D-Ribulose 5-phosphate > 1-Deoxy-L-glycero-tetrulose 4-phosphate + Formic acid + Hydrogen ion
4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Adenosine triphosphate + 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol > Adenosine diphosphate + Hydrogen ion + 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + ADP + 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol
2-C-Methyl-D-erythritol-2,4-cyclodiphosphate + a reduced flavodoxin > Water + Hydrogen ion + an oxidized flavodoxin + 1-Hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate
1-Hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate + Hydrogen ion + NADPH + NADPH > Water + NADPH + Isopentenyl pyrophosphate + Isopentenyl pyrophosphate
1-Hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate + Hydrogen ion + NADPH + NADPH > NADP + Water + Dimethylallylpyrophosphate + Dimethylallylpyrophosphate
N-acetyl-α-D-glucosaminyl-diphospho-ditrans,octacis-undecaprenol + UDP-ManNAcA > Uridine 5'-diphosphate + Hydrogen ion + Undecaprenyl N-acetyl-glucosaminyl-N-acetyl-mannosaminuronate pyrophosphate + Uridine 5'-diphosphate + Undecaprenyl-diphospho-N-acetylglucosamine-N-acetylmannosaminuronate
Undecaprenyl N-acetyl-glucosaminyl-N-acetyl-mannosaminuronate pyrophosphate + TDP-Fuc4NAc + Undecaprenyl-diphospho-N-acetylglucosamine-N-acetylmannosaminuronate > Hydrogen ion + dTDP + Undecaprenyl N-acetyl-glucosaminyl-N-acetyl-mannosaminuronate-4-acetamido-4,6-dideoxy-D-galactose pyrophosphate + Undecaprenyl-diphospho N-acetylglucosamine-N-acetylmannosaminuronate-N-acetamido-4,6-dideoxy-D-galactose
Acetyl-CoA + dTDP-thomosamine > TDP-Fuc4NAc + Coenzyme A + Hydrogen ion
Thymidine 5'-triphosphate + Hydrogen ion + Glucose 1-phosphate > Pyrophosphate + dTDP-D-Glucose
Glucose 1-phosphate + Thymidine 5'-triphosphate + Hydrogen ion > Pyrophosphate + dTDP-D-Glucose
D-Glyceraldehyde 3-phosphate + Hydrogen ion + D-Glyceraldehyde 3-phosphate > Carbon dioxide + 1-Deoxy-D-xylulose 5-phosphate + 1-Deoxy-D-xylulose 5-phosphate
3-Octaprenyl-4-hydroxybenzoate + Hydrogen ion > Carbon dioxide + 2-Octaprenylphenol
2-Octaprenylphenol + Hydrogen ion + NADPH + Oxygen + NADPH > NADP + Water + 2-Octaprenyl-6-hydroxyphenol + 2-Octaprenyl-6-hydroxyphenol
2-Octaprenyl-6-hydroxyphenol + S-adenosyl-L-methionine + 2-Octaprenyl-6-hydroxyphenol > Hydrogen ion + S-Adenosylhomocysteine + 2-methoxy-6-(all-trans-octaprenyl)phenol
3-demethylubiquinol-8 + S-adenosyl-L-methionine > Hydrogen ion + S-Adenosylhomocysteine + Ubiquinol 8 + Ubiquinol-8
Hydrogen ion + NADPH + Oxygen + 2-methoxy-6-(all-trans-octaprenyl)phenol + NADPH > Water + NADP + 2-Octaprenyl-6-methoxy-1,4-benzoquinol
2-Octaprenyl-6-methoxy-1,4-benzoquinol + S-adenosyl-L-methionine > S-Adenosylhomocysteine + Hydrogen ion + 6-Methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol
2-Demethylmenaquinol 8 + S-adenosyl-L-methionine > Hydrogen ion + S-Adenosylhomocysteine + Menaquinol 8
3-(3-Hydroxyphenyl)propanoic acid + NADH + Hydrogen ion + Oxygen > 3-(2,3-Dihydroxyphenyl)propionic acid + NAD + Water
3-Hydroxycinnamic acid + Hydrogen ion + NADH + Oxygen > NAD + Water + 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid + 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid
trans-Octadec-2-enoyl-CoA + Water + Trans-Octadec-2-enoyl-CoA > Coenzyme A + Hydrogen ion + Elaidic acid
Cytosine + Hydrogen ion + Water > Ammonium + Uracil
a [protein]-(L-serine/L-threonine) + Adenosine triphosphate > a [protein]-(L-serine/L-threonine) phosphate + Adenosine diphosphate + Hydrogen ion + ADP
Adenosyl cobinamide + Adenosine triphosphate + Adenosyl cobinamide > Adenosine diphosphate + Hydrogen ion + adenosylcobinamide phosphate + ADP
adenosylcobinamide phosphate + Guanosine triphosphate + Hydrogen ion > Pyrophosphate + Adenosylcobinamide-GDP + Adenosylcobinamide-GDP
Dimethylbenzimidazole + nicotinate beta-D-ribonucleotide + Nicotinamide ribotide > Hydrogen ion + Nicotinic acid + N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole
N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole + Adenosylcobinamide-GDP + Adenosylcobinamide-GDP > Hydrogen ion + GMP + Adenosylcobalamin 5'-phosphate
Fructose 6-phosphate + NADH + Hydrogen ion + Fructose 6-phosphate <> NAD + Mannitol 1-phosphate
Acetyl-CoA + L-Glutamic acid + L-Glutamate <> N-Acetyl-L-alanine + Coenzyme A + Hydrogen ion + N-Acetylglutamic acid + N-Acetyl-L-alanine + N-Acetylglutamic acid
Pseudouridine + Adenosine triphosphate + Pseudouridine > Pseudouridine 5'-phosphate + Adenosine diphosphate + Hydrogen ion + ADP
Cyclic pyranopterin monophosphate + Water + thiocarboxylated small subunit of molybdopterin synthase >4 Hydrogen ion +2 thiocarboxylated small subunit of molybdopterin synthase + Molybdopterin + Molybdopterin
Molybdopterin + Adenosine triphosphate + Hydrogen ion + Molybdopterin > Pyrophosphate + Adenylyl-molybdopterin + Adenylyl-molybdopterin
trans-Cinnamic acid + Hydrogen ion + Oxygen + NADH > cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD
NAD + cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol > NADH + Hydrogen ion + 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid + 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid
2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid + Oxygen + 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid > Hydrogen ion + 2-Hydroxy-6-ketononatrienedioate
2-Hydroxy-6-ketononatrienedioate + Water > Hydrogen ion + Fumaric acid + 2-Hydroxy-2,4-pentadienoate + 2-Hydroxy-2,4-pentadienoate
Acetaldehyde + Coenzyme A + NAD > Hydrogen ion + NADH + Acetyl-CoA
S-adenosyl-L-methionine + Hydrogen ion > Carbon dioxide + S-Adenosylmethioninamine
Putrescine + S-Adenosylmethioninamine > Spermidine + Hydrogen ion + 5'-S-methyl-5'-thioadenosine
L-Threonine + NAD + L-Threonine > Hydrogen ion + NADH + L-2-Amino-3-oxobutanoic acid
L-Tyrosine + NADPH + S-adenosyl-L-methionine + L-Tyrosine + NADPH > Hydrogen ion + NADP + L-Methionine + 5'-Deoxyadenosine + p-Cresol + 2-iminoacetate
7,8-dihydroneopterin 3'-triphosphate + Water > Acetaldehyde + Triphosphate +2 Hydrogen ion + 6-Carboxy-5,6,7,8-tetrahydropterin + Triphosphate
7-Deaza-7-carboxyguanine + Adenosine triphosphate + Ammonium > Water + Phosphate + Adenosine diphosphate + Hydrogen ion + 7-Cyano-7-carbaguanine + ADP
7-Cyano-7-carbaguanine + 3 Hydrogen ion + 2 NADPH + 2 NADPH >2 NADP + 7-Aminomethyl-7-carbaguanine
7-Cyano-7-carbaguanine + 3 Hydrogen ion + 2 NADPH + 2 NADPH > Queuine +2 NADP + Queuine
7-aminomethyl-7-deazaguanosine34 in tRNA + S-adenosyl-L-methionine > Hydrogen ion + L-Methionine + Adenine + epoxyqueuosine
Spermidine + Acetyl-CoA > N8-Acetylspermidine + Coenzyme A + Hydrogen ion
Curcumin + Hydrogen ion + NADPH + curcumin + NADPH > NADP + Dihydrocurcumin + Dihydrocurcumin
Dihydrocurcumin + Hydrogen ion + NADPH + Dihydrocurcumin + NADPH > Tetrahydrocurcumin + NADP
isochorismate + Oxoglutaric acid + Hydrogen ion + Isochorismate > Carbon dioxide + 2-Succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate
2-Succinylbenzoyl-CoA + Hydrogen ion > Water + 1,4-dihydroxy-2-naphthoyl-CoA + 1,4-Dihydroxy-2-naphthoyl-CoA
1,4-dihydroxy-2-naphthoyl-CoA + Water + 1,4-Dihydroxy-2-naphthoyl-CoA > Coenzyme A + Hydrogen ion + 1,4-dihydroxy-2-naphthoate
1,4-dihydroxy-2-naphthoate + Hydrogen ion + Farnesylfarnesylgeranyl-PP + 1,4-Dihydroxy-2-naphthoyl-CoA > Carbon dioxide + Pyrophosphate + 2-Demethylmenaquinol 8
Octaprenyl diphosphate + 1,4-dihydroxy-2-naphthoate + Hydrogen ion + Octaprenyl diphosphate + 1,4-Dihydroxy-2-naphthoyl-CoA > Carbon dioxide + Pyrophosphate + 2-Demethylmenaquinol 8
L-Arginine + Adenosine triphosphate + Water > L-Arginine + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
L-Glutamic acid + Adenosine triphosphate + Water + L-Glutamate > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Glutamic acid + ADP
L-Leucine + Adenosine triphosphate + Water > L-Leucine + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
L-Valine + Adenosine triphosphate + Water + L-Valine > L-Valine + Adenosine diphosphate + Pyrophosphate + Hydrogen ion + ADP
L-Isoleucine + Adenosine triphosphate + Water + L-Isoleucine > L-Isoleucine + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
L-Glutamine + Adenosine triphosphate + Water > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Glutamine + ADP
L-Aspartic acid + Adenosine triphosphate + Water + L-Aspartic acid > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Aspartic acid + ADP
L-Histidine + Adenosine triphosphate + Water + L-Histidine > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Histidine + ADP
L-Lysine + Adenosine triphosphate + Water + L-Lysine > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Lysine + ADP
L-Methionine + Adenosine triphosphate + Water > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Methionine + ADP
L-Proline + Adenosine triphosphate + Water + L-Proline > L-Proline + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
D-allopyranose + Adenosine triphosphate + Water > D-allopyranose + Adenosine diphosphate + Hydrogen ion + Phosphate + ADP
Lipid A-core + Adenosine triphosphate + Water > Adenosine diphosphate + Phosphate + Hydrogen ion + Lipid A-core + ADP
(2R,4S)-2-methyl-2,3,3,4-tetrahydroxytetrahydrofuran + Phosphoribosyl-ATP + Water + (2R,4S)-2-Methyl-2,3,3,4-tetrahydroxytetrahydrofuran + Phosphoribosyl-ATP > (2R,4S)-2-methyl-2,3,3,4-tetrahydroxytetrahydrofuran + Adenosine diphosphate + Hydrogen ion + Pyrophosphate + ADP
L-Methionine + Adenosine triphosphate + Water > Adenosine diphosphate + Pyrophosphate + Hydrogen ion + L-Methionine + ADP
Ferric enterobactin + Adenosine triphosphate + Water Ferric enterobactin + Adenosine diphosphate + Hydrogen ion + ADP
2 Ubiquinol-1 + Oxygen + 4 Hydrogen ion >2 Ubiquinone-1 +2 Water +4 Hydrogen ion
2 Ubiquinol-1 + Oxygen + 4 Hydrogen ion >2 Ubiquinone-1 +2 Water +4 Hydrogen ion
Oxygen + 2 Ubiquinol-1 + 4 Hydrogen ion >2 Water +4 Hydrogen ion +2 Ubiquinone-1
Oxygen + 2 Ubiquinol-1 + 4 Hydrogen ion >2 Water +4 Hydrogen ion +2 Ubiquinone-1
Oxygen + 8 Hydrogen ion + 2 Ubiquinol-1 >2 Water +8 Hydrogen ion +2 Ubiquinone-1
Oxygen + 8 Hydrogen ion + 2 Ubiquinol-1 >2 Water +8 Hydrogen ion +2 Ubiquinone-1
NADH + 5 Hydrogen ion + Ubiquinone-1 > Hydrogen ion + NAD + Ubiquinol-1
NADH + 5 Hydrogen ion + Ubiquinone-1 > Hydrogen ion + NAD + Ubiquinol-1
Adenosine triphosphate + Water + Sulfate + Sulfate > Adenosine diphosphate + Phosphate + Hydrogen ion + Sulfate + ADP
Alkyl Sulfate + Adenosine triphosphate + Water > Adenosine diphosphate + Phosphate + Hydrogen ion + Alkyl Sulfate + ADP
Adenosine triphosphate + Water + Butanesulfonate > Adenosine diphosphate + Phosphate + Hydrogen ion + Butanesulfonate + ADP
Adenosine triphosphate + Water + 3-(N-morpholino)propanesulfonate > Phosphate + Hydrogen ion + Adenosine diphosphate + 3-(N-morpholino)propanesulfonate + ADP
Adenosine triphosphate + Water + ethanesulfonate > Hydrogen ion + Phosphate + Adenosine diphosphate + ethanesulfonate + ADP
Adenosine triphosphate + Water + isethionate > Adenosine diphosphate + Hydrogen ion + Phosphate + isethionate + ADP
Adenosine triphosphate + Water + methanesulfonate + Methanesulfonate > Adenosine diphosphate + Phosphate + Hydrogen ion + methanesulfonate + ADP
Maltotetraose + Adenosine triphosphate + Water > Maltotetraose + Phosphate + Hydrogen ion + Adenosine diphosphate + ADP
Maltotriose + Adenosine triphosphate + Water > Adenosine diphosphate + Phosphate + Hydrogen ion + Maltotriose + ADP
D-Maltose + Adenosine triphosphate + Water > D-Maltose + Phosphate + Hydrogen ion + Adenosine diphosphate + ADP
Adenosine triphosphate + Water + DL-O-Phosphoserine > Hydrogen ion + Phosphate + Adenosine diphosphate + DL-O-Phosphoserine + ADP
Taurine + Adenosine triphosphate + Water > Taurine + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
Cysteine-S-sulfate + Adenosine triphosphate + Water > Cysteine-S-sulfate + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
Homocarnosine + Adenosine triphosphate + Water + Homocarnosine > Homocarnosine + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
Cobinamide + Adenosine triphosphate + Water + Cobinamide > Adenosine diphosphate + Phosphate + Hydrogen ion + Cobinamide + ADP
Cyanocobalamin + Adenosine triphosphate + Water + Cyanocobalamin > Adenosine diphosphate + Phosphate + Hydrogen ion + Cyanocobalamin + ADP
NADH + 4 Hydrogen ion + 2 Hydrogen ion + menaquinone-8 NAD + Hydrogen ion + Menaquinol 8 + Electron +4 Hydrogen ion
NADH + 4 Hydrogen ion + 2 Hydrogen ion + menaquinone-8 NAD + Hydrogen ion + Menaquinol 8 + Electron +4 Hydrogen ion
NADH + 4 Hydrogen ion + 2 Hydrogen ion + menaquinone-8 NAD + Hydrogen ion + Menaquinol 8 + Electron +4 Hydrogen ion
NADH + 4 Hydrogen ion + 2 Hydrogen ion + menaquinone-8 NAD + Hydrogen ion + Menaquinol 8 + Electron +4 Hydrogen ion
Trimethylamine N-Oxide + 3 Hydrogen ion + Menaquinol 8 + 2 Electron > Trimethylamine + Water +2 Hydrogen ion + menaquinone-8
Trimethylamine N-Oxide + 3 Hydrogen ion + Menaquinol 8 + 2 Electron > Trimethylamine + Water +2 Hydrogen ion + menaquinone-8
Hydrogen ion + Electron + 2 Hydrogen ion + menaquinone-8 > Menaquinol 8 + Hydrogen ion
Hydrogen ion + Electron + 2 Hydrogen ion + menaquinone-8 > Menaquinol 8 + Hydrogen ion
Hydrogen ion + Electron + 2 Hydrogen ion + menaquinone-8 > Menaquinol 8 + Hydrogen ion
Formic acid + menaquinone-8 + Electron + Hydrogen ion > Carbon dioxide + Hydrogen ion + Menaquinol 8
Formic acid + menaquinone-8 + Electron + Hydrogen ion > Carbon dioxide + Hydrogen ion + Menaquinol 8
Menaquinol 8 + Dimethyl sulfoxide + 2 Hydrogen ion + 2 Electron > menaquinone-8 + Dimethyl sulfide + Water +2 Hydrogen ion
Menaquinol 8 + Dimethyl sulfoxide + 2 Hydrogen ion + 2 Electron > menaquinone-8 + Dimethyl sulfide + Water +2 Hydrogen ion
1-(2-Carboxyphenylamino)-1'-deoxyribulose-5'-phosphate + Hydrogen ion > Carbon dioxide + Water + (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate + (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate
DG(17:0cycw7c/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/18:1(9Z)) + Pyrophosphate
2 DG(10:0/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion 2 CDP-DG(10:0(3-OH)/10:0) + Pyrophosphate
2 DG(10:0(3-OH)/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/12:0(3-OH)) + Pyrophosphate
2 DG(10:0(3-OH)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/12:0) + Pyrophosphate
2 DG(10:0(3-OH)/15:0cyclo/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/15:0cyclo) + Pyrophosphate
2 DG(10:0(3-OH)/16:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/16:0) + Pyrophosphate
2 DG(10:0(3-OH)/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/16:1(9Z)) + Pyrophosphate
2 DG(10:0(3-OH)/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/17:0cycw7c) + Pyrophosphate
1,2-Diacyl-sn-glycerol (ditetradecanoyl, n-C14:0) + Cytidine triphosphate + Hydrogen ion > CDP-1,2-ditetradecanoylglycerol + Pyrophosphate
2 DG(10:0(3-OH)/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/19:0cycv8c) + Pyrophosphate
2 DG(10:0(3-OH)/19:iso/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(10:0(3-OH)/19:iso) + Pyrophosphate
2 DG(10:0/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0/10:0(3-OH)) + Pyrophosphate
2 DG(10:0/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0/12:0(3-OH)) + Pyrophosphate
DG(10:0/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(10:0/17:0cycw7c) + Pyrophosphate
2 1,2-Diacyl-sn-glycerol (ditetradecanoyl, n-C14:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-1,2-ditetradecanoylglycerol + Pyrophosphate
2 DG(12:0(3-OH)/10:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/10:0(3-OH)) + Pyrophosphate
2 DG(12:0(3-OH)/10:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/10:0) + Pyrophosphate
DG(12:0(3-OH)/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0(3-OH)/12:0(3-OH)) + Pyrophosphate
2 DG(12:0/12:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-1,2-didodecanoylglycerol + Pyrophosphate
DG(12:0(3-OH)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0(3-OH)/12:0) + Pyrophosphate
2 DG(12:0(3-OH)/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/14:0(3-OH)) + Pyrophosphate
2 DG(12:0(3-OH)/14:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/14:0) + Pyrophosphate
2 DG(12:0(3-OH)/15:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/15:0) + Pyrophosphate
2 DG(12:0(3-OH)/15:0cyclo/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/15:0cyclo) + Pyrophosphate
2 DG(12:0(3-OH)/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/17:0cycw7c) + Pyrophosphate
DG(12:0(3-OH)/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0(3-OH)/17:0cycw7c) + Pyrophosphate
2 DG(12:0(3-OH)/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/18:1(9Z)) + Pyrophosphate
2 DG(12:0(3-OH)/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/19:0cycv8c) + Pyrophosphate
2 DG(12:0(3-OH)/19:iso/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/19:iso) + Pyrophosphate
2 DG(12:0/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0/10:0(3-OH)) + Pyrophosphate
DG(12:0/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0/12:0(3-OH)) + Pyrophosphate
2 DG(12:0/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0/14:0(3-OH)) + Pyrophosphate
DG(12:0/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0/17:0cycw7c) + Pyrophosphate
2 DG(12:0/19:iso/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0/19:iso) + Pyrophosphate
2 DG(14:0(3-OH)/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(14:0(3-OH)/12:0(3-OH)) + Pyrophosphate
2 DG(14:0(3-OH)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(14:0(3-OH)/12:0) + Pyrophosphate
DG(14:0(3-OH)/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(14:0(3-OH)/14:0(3-OH)) + Pyrophosphate
DG(14:0(3-OH)/14:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(14:0(3-OH)/14:0) + Pyrophosphate
DG(14:0(3-OH)/16:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(14:0(3-OH)/16:0) + Pyrophosphate
2 DG(14:0(3-OH)/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(14:0(3-OH)/16:1(9Z)) + Pyrophosphate
2 DG(14:0(3-OH)/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(14:0(3-OH)/17:0cycw7c) + Pyrophosphate
2 DG(14:0/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(14:0/12:0(3-OH)) + Pyrophosphate
DG(14:0/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(14:0/14:0(3-OH)) + Pyrophosphate
2 DG(15:0/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(15:0/10:0(3-OH)) + Pyrophosphate
2 DG(15:0/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(15:0/12:0(3-OH)) + Pyrophosphate
DG(15:0/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion > Pyrophosphate + CDP-DG(15:0/14:0(3-OH))
2 DG(15:0cyclo/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(15:0cyclo/10:0(3-OH)) + Pyrophosphate
2 DG(16:0/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(16:0/10:0(3-OH)) + Pyrophosphate
2 DG(16:0/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(16:0/14:0(3-OH)) + Pyrophosphate
2 DG(16:1(9Z)/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(16:1(9Z)/14:0(3-OH)) + Pyrophosphate
2 DG(16:1(9Z)/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(16:1(9Z)/17:0cycw7c) + Pyrophosphate
DG(16:1(9Z)/0:0/19:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:1(9Z)/19:0) + Pyrophosphate
DG(17:0/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0/16:1(9Z)) + Pyrophosphate
2 DG(17:0cycw7c/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(17:0cycw7c/10:0(3-OH)) + Pyrophosphate
DG(17:0cycw7c/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/10:0) + Pyrophosphate
2 DG(17:0cycw7c/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(17:0cycw7c/12:0(3-OH)) + Pyrophosphate
CDP-1,2-ditetradecanoylglycerol + L-Serine + L-Serine > PS(14:0/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/17:0cycw7c) + L-Serine + L-Serine > PS(10:0/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0(3-OH)/12:0(3-OH)) + L-Serine + L-Serine > PS(12:0(3-OH)/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0(3-OH)/12:0) + L-Serine + L-Serine > PS(12:0(3-OH)/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0(3-OH)/17:0cycw7c) + L-Serine + L-Serine > PS(12:0(3-OH)/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/12:0(3-OH)) + L-Serine + L-Serine > PS(12:0/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/17:0cycw7c) + L-Serine + L-Serine > PS(12:0/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0(3-OH)/14:0(3-OH)) + L-Serine + L-Serine > PS(14:0(3-OH)/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0(3-OH)/14:0) + L-Serine + L-Serine > PS(14:0(3-OH)/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0(3-OH)/16:0) + L-Serine + L-Serine > PS(14:0(3-OH)/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0(3-OH)/16:1(9Z)) + L-Serine + L-Serine > PS(14:0(3-OH)/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/14:0(3-OH)) + L-Serine + L-Serine > PS(14:0/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(15:0/14:0(3-OH)) + L-Serine + L-Serine > PS(15:0/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:0/12:0) + L-Serine + L-Serine > PS(16:0/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:1(9Z)/14:0(3-OH)) + L-Serine + L-Serine > PS(16:1(9Z)/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:1(9Z)/19:0) + L-Serine + L-Serine > PS(16:1(9Z)/19:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(17:0/16:1(9Z)) + L-Serine + L-Serine > PS(17:0/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(17:0cycw7c/10:0(3-OH)) + L-Serine + L-Serine > PS(17:0cycw7c/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
PS(10:0/17:0cycw7c) + Hydrogen ion > PE(10:0/17:0cycw7c) + Carbon dioxide
PS(12:0(3-OH)/12:0(3-OH)) + Hydrogen ion > PE(12:0(3-OH)/12:0(3-OH)) + Carbon dioxide
PS(12:0(3-OH)/12:0) + Hydrogen ion > PE(12:0(3-OH)/12:0) + Carbon dioxide
PS(12:0(3-OH)/17:0cycw7c) + Hydrogen ion > PE(12:0(3-OH)/17:0cycw7c) + Carbon dioxide
PS(12:0/12:0(3-OH)) + Hydrogen ion > PE(12:0/12:0(3-OH)) + Carbon dioxide
PS(12:0/17:0cycw7c) + Hydrogen ion > PE(12:0/17:0cycw7c) + Carbon dioxide
PS(14:0(3-OH)/14:0(3-OH)) + Hydrogen ion > PE(14:0(3-OH)/14:0(3-OH)) + Carbon dioxide
PS(14:0(3-OH)/14:0) + Hydrogen ion > PE(14:0(3-OH)/14:0) + Carbon dioxide
PS(14:0(3-OH)/16:0) + Hydrogen ion PE(14:0(3-OH)/16:0) + Carbon dioxide
PS(14:0(3-OH)/16:1(9Z)) + Hydrogen ion > PE(14:0(3-OH)/16:1(9Z)) + Carbon dioxide
PS(14:0/14:0(3-OH)) + Hydrogen ion > PE(14:0/14:0(3-OH)) + Carbon dioxide
PS(15:0/14:0(3-OH)) + Hydrogen ion > PE(15:0/14:0(3-OH)) + Carbon dioxide
PS(16:0/12:0) + Hydrogen ion > PE(16:0/12:0) + Carbon dioxide
PS(16:1(9Z)/10:0) + Hydrogen ion > PE(16:1(9Z)/10:0) + Carbon dioxide
PS(16:1(9Z)/12:0) + Hydrogen ion > PE(16:1(9Z)/12:0) + Carbon dioxide
PS(16:1(9Z)/14:0(3-OH)) + Hydrogen ion > PE(16:1(9Z)/14:0(3-OH)) + Carbon dioxide
PS(14:0/17:0cycw7c) + Hydrogen ion PE(14:0(3-OH)/17:0cycw7c) + Carbon dioxide
PS(16:1(9Z)/19:0) + Hydrogen ion > PE(16:1(9Z)/19:0) + Carbon dioxide
PS(17:0/16:1(9Z)) + Hydrogen ion > PE(17:0/16:1(9Z)) + Carbon dioxide
PS(17:0cycw7c/10:0(3-OH)) + Hydrogen ion > PE(17:0cycw7c/10:0(3-OH)) + Carbon dioxide
PS(12:0/12:0) + Hydrogen ion > PE(12:0/12:0) + Carbon dioxide
2 CDP-DG(18:1(9Z)/19:0cycv8c) + Glycerol 3-phosphate >2 PGP(18:1(9Z)/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/10:0) + Glycerol 3-phosphate >2 PGP(10:0(3-OH)/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(10:0(3-OH)/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/12:0) + Glycerol 3-phosphate >2 PGP(10:0(3-OH)/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/15:0cyclo) + Glycerol 3-phosphate >2 PGP(10:0(3-OH)/15:0cyclo) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/16:0) + Glycerol 3-phosphate >2 PGP(10:0(3-OH)/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/16:1(9Z)) + Glycerol 3-phosphate > PGP(10:0(3-OH)/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/17:0cycw7c) + Glycerol 3-phosphate >2 PGP(10:0(3-OH)/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/19:0cycv8c) + Glycerol 3-phosphate >2 PGP(10:0(3-OH)/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/19:iso) + Glycerol 3-phosphate >2 PGP(10:0(3-OH)/19:iso) + Cytidine triphosphate + Hydrogen ion
2 CDP-DG(10:0/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(10:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(10:0/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-1,2-ditetradecanoylglycerol + Glycerol 3-phosphate >2 PGP(14:0/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/10:0) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-1,2-didodecanoylglycerol + Glycerol 3-phosphate >2 PGP(12:0/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/14:0(3-OH)) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/14:0) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/15:0) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/15:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/15:0cyclo) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/15:0cyclo) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/17:0cycw7c) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/18:1(9Z)) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/19:0cycv8c) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/19:iso) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(12:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0/14:0(3-OH)) + Glycerol 3-phosphate >2 PGP(12:0/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0/19:iso) + Glycerol 3-phosphate >2 PGP(12:0/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(14:0(3-OH)/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(14:0(3-OH)/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(14:0(3-OH)/12:0) + Glycerol 3-phosphate >2 PGP(14:0(3-OH)/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(14:0(3-OH)/16:1(9Z)) + Glycerol 3-phosphate >2 PGP(14:0(3-OH)/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(14:0(3-OH)/17:0cycw7c) + Glycerol 3-phosphate >2 PGP(14:0(3-OH)/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(14:0/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(14:0/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(15:0/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(15:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(15:0/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(15:0/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(15:0cyclo/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(15:0cyclo/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(16:0/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(16:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(16:0/14:0(3-OH)) + Glycerol 3-phosphate >2 PGP(16:0/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(16:1(9Z)/14:0(3-OH)) + Glycerol 3-phosphate >2 PGP(16:1(9Z)/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(16:1(9Z)/17:0cycw7c) + Glycerol 3-phosphate >2 PGP(16:1(9Z)/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(17:0cycw7c/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(17:0cycw7c/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(17:0cycw7c/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(17:0cycw7c/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
Guanosine triphosphate + 3 Water > Formic acid + Pyrophosphate +2 Hydrogen ion + 2,5-Diamino-6-(5'-phosphoribosylamino)-4-pyrimidineone
1-Amino-2-propanol + NAD + 4,5-Dihydro-4-hydroxy-5-S-glutathionyl-benzo[a]pyrene < NADH + Hydrogen ion + Aminoacetone
Ferric enterobactin + 3 Water >3 2,3-Dihydroxybenzoylserine + Fe3+ +3 Hydrogen ion
DG(17:0cycw7c/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/12:0) + Pyrophosphate
2 DG(17:0cycw7c/19:iso/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(17:0cycw7c/19:iso) + Pyrophosphate
DG(18:1(11Z)/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(11Z)/10:0) + Pyrophosphate
DG(18:1(11Z)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(11Z)/12:0) + Pyrophosphate
DG(18:1(11Z)/17:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(11Z)/17:0) + Pyrophosphate
2 DG(18:1(11Z)/19:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(18:1(11Z)/19:0) + Pyrophosphate
2 CDP-DG(18:1(11Z)/19:0) + Cytidine triphosphate + Hydrogen ion >2 PGP(18:1(11Z)/19:0) + Pyrophosphate
2 DG(18:1(9Z)/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(18:1(9Z)/12:0(3-OH)) + Pyrophosphate
2 DG(19:0/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0/16:1(9Z)) + Pyrophosphate
2 DG(19:0/18:1(11Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0/18:1(11Z)) + Pyrophosphate
2 DG(19:0cycv8c/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0cycv8c/10:0(3-OH)) + Pyrophosphate
2 DG(19:0cycv8c/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0cycv8c/12:0(3-OH)) + Pyrophosphate
DG(19:0cycw8c/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:0cycw8c/10:0) + Pyrophosphate
2 DG(19:1(9Z)/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:1(9Z)/16:1(9Z)) + Pyrophosphate
2 DG(19:iso/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/10:0(3-OH)) + Pyrophosphate
2 DG(19:iso/10:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/10:0) + Pyrophosphate
2 DG(19:iso/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/12:0(3-OH)) + Pyrophosphate
2 DG(19:iso/12:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/12:0) + Pyrophosphate
2 DG(19:iso/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/14:0(3-OH)) + Pyrophosphate
2 DG(19:iso/14:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/14:0) + Pyrophosphate
2 DG(19:iso/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/17:0cycw7c) + Pyrophosphate
2 DG(19:iso/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/19:0cycv8c) + Pyrophosphate
2 DG(19:iso/19:iso/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/19:iso) + Pyrophosphate
CDP-DG(17:0cycw7c/12:0) + L-Serine + L-Serine > PS(17:0cycw7c/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:1(11Z)/10:0) + L-Serine + L-Serine > PS(18:1(11Z)/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:1(11Z)/12:0) + L-Serine + L-Serine > PS(18:1(11Z)/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:1(11Z)/17:0) + L-Serine + L-Serine > PS(18:1(11Z)/17:0) + Cytidine triphosphate + Hydrogen ion
CDP-DG(18:1(11Z)/19:0) + L-Serine + L-Serine > PS(18:1(11Z)/19:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:0cycw8c/10:0) + L-Serine + L-Serine > PS(19:0cycw8c/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
PS(17:0cycw7c/12:0) + Hydrogen ion > PE(17:0cycw7c/12:0) + Carbon dioxide
PS(18:0/10:0) + Hydrogen ion > PE(18:0/10:0) + Carbon dioxide
PS(18:0/12:0) + Hydrogen ion > PE(18:0/12:0) + Carbon dioxide
PS(18:1(11Z)/10:0) + Hydrogen ion > PE(18:1(11Z)/10:0) + Carbon dioxide
PS(18:1(11Z)/12:0) + Hydrogen ion > PE(18:1(11Z)/12:0) + Carbon dioxide
PS(18:1(11Z)/17:0) + Hydrogen ion > PE(18:1(11Z)/17:0) + Carbon dioxide
PS(18:1(11Z)/19:0) + Hydrogen ion > PE(18:1(11Z)/19:0) + Carbon dioxide
PS(19:0cycw8c/10:0) + Hydrogen ion > PE(19:0cycw8c/10:0) + Carbon dioxide
PS(19:0/19:0) + Hydrogen ion > PE(19:0/19:0) + Carbon dioxide
2 CDP-DG(17:0cycw7c/19:iso) + Glycerol 3-phosphate >2 PGP(17:0cycw7c/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(18:1(9Z)/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(18:1(9Z)/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0/16:1(9Z)) + Glycerol 3-phosphate >2 PGP(19:0/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0/18:1(11Z)) + Glycerol 3-phosphate >2 PGP(19:0/18:1(11Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0cycv8c/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(19:0cycv8c/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0cycv8c/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(19:0cycv8c/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:1(9Z)/16:1(9Z)) + Glycerol 3-phosphate >2 PGP(19:1(9Z)/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:iso/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(19:iso/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:iso/10:0) + Glycerol 3-phosphate >2 PGP(19:iso/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:iso/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(19:iso/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:iso/12:0) + Glycerol 3-phosphate >2 PGP(19:iso/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:iso/14:0(3-OH)) + Glycerol 3-phosphate >2 PGP(19:iso/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:iso/14:0) + Glycerol 3-phosphate >2 PGP(19:iso/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:iso/17:0cycw7c) + Glycerol 3-phosphate >2 PGP(19:iso/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:iso/19:0cycv8c) + Glycerol 3-phosphate >2 PGP(19:iso/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:iso/19:iso) + Glycerol 3-phosphate >2 PGP(19:iso/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
Guanosine triphosphate + Water > 2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Hydrogen ion + Formic acid + Pyrophosphate
2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Water + Hydrogen ion > 5-Amino-6-(5'-phosphoribosylamino)uracil + Ammonium
2,5-Diamino-6-(5'-phosphoribosylamino)-4-pyrimidineone + Water + Hydrogen ion > Ammonium + 5-Amino-6-(5'-phosphoribosylamino)uracil
5-Amino-6-(5'-phosphoribosylamino)uracil + Hydrogen ion + NADPH + NADPH > NADP + 5-Amino-6-(5'-phosphoribitylamino)uracil + 5-Amino-6-(5'-phosphoribitylamino)uracil
5-Amino-6-ribitylamino uracil + 1-Deoxy-L-glycero-tetrulose 4-phosphate > Water + Phosphate + Hydrogen ion + 6,7-Dimethyl-8-(1-D-ribityl)lumazine + 6,7-Dimethyl-8-(1-D-ribityl)lumazine
D-Ribulose 5-phosphate > Formic acid + Hydrogen ion + 1-Deoxy-L-glycero-tetrulose 4-phosphate
6,7-Dimethyl-8-(1-D-ribityl)lumazine + Hydrogen ion + 6,7-Dimethyl-8-(1-D-ribityl)lumazine > Riboflavin + 5-Amino-6-ribitylamino uracil + Riboflavin
Riboflavin + Adenosine triphosphate + Riboflavin > Adenosine diphosphate + Hydrogen ion + Flavin Mononucleotide + ADP
Flavin Mononucleotide + Hydrogen ion + Adenosine triphosphate > Pyrophosphate + FAD
2,5-Diketo-D-gluconate + NADPH + Hydrogen ion + NADPH > NADP + 5-Keto-D-gluconate + 5-Keto-D-gluconate
2-Keto-L-gluconate + Hydrogen ion + NADPH + 2-Dehydro-D-gluconate + NADPH > NADP + L-Idonate
2,5-Diketo-D-gluconate + Hydrogen ion + NADPH + NADPH > NADP + 2-Keto-L-gluconate + 2-Dehydro-D-gluconate
L-Idonate + NADP > Hydrogen ion + NADPH + 5-Keto-D-gluconate + NADPH + 5-Keto-D-gluconate
2-Keto-L-gluconate + NADPH + Hydrogen ion + 2-Dehydro-D-gluconate + NADPH > Gluconic acid + NADP
2 DG(16:0/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(16:0/17:0cycw7c) + Pyrophosphate
DG(18:1(9Z)/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(9Z)/17:0cycw7c) + Pyrophosphate
DG(14:0/15:0cyclo/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(14:0/15:0cyclo) + Pyrophosphate
DG(14:0/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion + DG(14:0/16:1(9Z)/0:0) > CDP-DG(14:0/16:1(9Z)) + Pyrophosphate
DG(14:0/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(14:0/19:0cycv8c) + Pyrophosphate
DG(14:0/19:0cycw8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(14:0/19:0cycw8c) + Pyrophosphate
DG(15:0cyclo/14:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(15:0cyclo/14:0) + Pyrophosphate
DG(15:0cyclo/15:0cyclo/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(15:0cyclo/15:0cyclo) + Pyrophosphate
2 DG(15:0cyclo/16:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(15:0cyclo/16:0) + Pyrophosphate
DG(15:0cyclo/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(15:0cyclo/17:0cycw7c) + Pyrophosphate
DG(15:0cyclo/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(15:0cyclo/19:0cycv8c) + Pyrophosphate
2 DG(16:0/14:0/0:0) + Cytidine triphosphate + Hydrogen ion + 2 DG(16:0/14:0/0:0) >2 CDP-DG(16:0/14:0) + Pyrophosphate
DG(16:0/15:0cyclo/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:0/15:0cyclo) + Pyrophosphate
2 DG(16:0/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion + 2 DG(16:0/16:1(9Z)/0:0) >2 CDP-DG(16:0/16:1(9Z)) + Pyrophosphate
2 DG(16:0/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion + 2 DG(16:0/18:1(9Z)/0:0) >2 CDP-DG(16:0/18:1(9Z)) + Pyrophosphate +2 CDP-DG(16:0/18:1(9Z))
DG(16:0/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:0/19:0cycv8c) + Pyrophosphate
DG(16:0/19:0cycw8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:0/19:0cycw8c) + Pyrophosphate
2 DG(16:1(9Z)/14:0/0:0) + Cytidine triphosphate + Hydrogen ion + 2 DG(16:1(9Z)/14:0/0:0) >2 CDP-DG(16:1(9Z)/14:0) + Pyrophosphate
2 DG(16:1(9Z)/16:0/0:0) + Cytidine triphosphate + Hydrogen ion + 2 DG(16:1(9Z)/16:0/0:0) >2 CDP-DG(16:1(9Z)/16:0) + Pyrophosphate
2 1,2-Diacyl-sn-glycerol (dihexadec-9-enoyl, n-C16:1) + Cytidine triphosphate + Hydrogen ion >2 CDP-1,2-dihexadec-9-enoylglycerol + Pyrophosphate
DG(16:1(9Z)/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:1(9Z)/19:0cycv8c) + Pyrophosphate
DG(16:1(9Z)/19:0cycw8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:1(9Z)/19:0cycw8c) + Pyrophosphate
DG(17:0cycw7c/14:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/14:0) + Pyrophosphate
DG(17:0cycw7c/15:0cyclo/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/15:0cyclo) + Pyrophosphate
DG(17:0cycw7c/16:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/16:0) + Pyrophosphate
DG(18:1(11Z)/0:0/18:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(11Z)/18:0) + Pyrophosphate
DG(18:1(11Z)/0:0/18:1(9Z)) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(11Z)/18:1(9Z)) + Pyrophosphate
DG(18:1(9Z)/15:0cyclo/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(9Z)/15:0cyclo) + Pyrophosphate
PS(18:1(9Z)/17:0cycw7c) + Hydrogen ion > PE(18:1(9Z)/17:0cycw7c) + Carbon dioxide
2 CDP-DG(16:0/16:0) + Glycerol 3-phosphate + 2 CDP-DG(16:0/16:0) >2 PGP(16:0/16:0) + Cytidine monophosphate + Hydrogen ion
2 CDP-DG(18:1(9Z)/18:1(9Z)) + Glycerol 3-phosphate >2 PGP(18:1(9Z)/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion
5-Keto-D-gluconate + Hydrogen ion + NADPH + 5-Keto-D-gluconate + NADPH > NADP + Gluconic acid
Gluconic acid + Adenosine triphosphate > ADP + Hydrogen ion + gluconate 6-phosphate
DG(18:1(9Z)/19:0cycw8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(9Z)/19:0cycw8c) + Pyrophosphate + Pyrophosphate
2 DG(15:0cyclo/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(15:0cyclo/16:0) + Pyrophosphate + Pyrophosphate
2 DG(15:0cyclo/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(18:1(9Z)/18:1(9Z)) + Pyrophosphate + Pyrophosphate
DG(16:1(9Z)/19:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:1(9Z)/19:0) + Pyrophosphate + Pyrophosphate
PS(17:0cycw7c/14:0) + Hydrogen ion > PE(17:0cycw7c/14:0) + Carbon dioxide
PS(16:0/17:0cycw7c) + Hydrogen ion > PE(15:0/17:0cycw7c) + Carbon dioxide
PS(16:0/18:1(11Z)) + Hydrogen ion > PE(16:0/18:1(11Z)) + Carbon dioxide
PS(16:0/19:0cycw8c) + Hydrogen ion > PE(16:0/19:0cycw8c) + Carbon dioxide
PS(19:iso/19:0cycv8c) + Hydrogen ion > PE(19:iso/19:0cycv8c) + Carbon dioxide
PS(19:iso/17:0cycw7c) + Hydrogen ion > PE(19:iso/17:0cycw7c) + Carbon dioxide
PS(10:0(3-OH)/17:0cycw7c) + Hydrogen ion > PE(10:0(3-OH)/17:0cycw7c) + Carbon dioxide
PS(14:0(3-OH)/18:1(9Z)) + Hydrogen ion > PE(14:0(3-OH)/18:1(9Z)) + Carbon dioxide
PS(18:1(9Z)/14:0(3-OH)) + Hydrogen ion > PE(18:1(9Z)/14:0(3-OH)) + Carbon dioxide
PS(14:0/15:0cyclo) + Hydrogen ion > PE(14:0/15:0cyclo) + Carbon dioxide
PS(15:0cyclo/14:0) + Hydrogen ion > PE(15:0cyclo/14:0) + Carbon dioxide
PS(14:0/19:0cycv8c) + Hydrogen ion > PE(14:0/19:0cycv8c) + Carbon dioxide
PS(14:0/19:0cycw8c) + Hydrogen ion > PE(14:0/19:0cycw8c) + Carbon dioxide
PS(15:0cyclo/15:0cyclo) + Hydrogen ion > PE(15:0cyclo/15:0cyclo) + Carbon dioxide
PS(15:0cyclo/16:0) + Hydrogen ion > PE(15:0cyclo/16:0) + Carbon dioxide
PS(15:0cyclo/17:0cycw7c) + Hydrogen ion > PE(15:0cyclo/17:0cycw7c) + Carbon dioxide
PS(17:0cycw7c/15:0cyclo) + Hydrogen ion > PE(17:0cycw7c/15:0cyclo) + Carbon dioxide
PS(15:0cyclo/19:0cycv8c) + Hydrogen ion > PE(15:0cyclo/19:0cycv8c) + Carbon dioxide
PS(19:0cycv8c/15:0cyclo) + Hydrogen ion > PE(19:0cycv8c/15:0cyclo) + Carbon dioxide
PS(16:0/14:0(3-OH)) + Hydrogen ion > PE(16:0/14:0(3-OH)) + Carbon dioxide
PS(16:0/19:0) + Hydrogen ion > PE(16:0/19:0) + Carbon dioxide
PS(16:0/19:0cycv8c) + Hydrogen ion > PE(16:0/19:0cycv8c) + Carbon dioxide
PS(16:1(9Z)/17:0cycw7c) + Hydrogen ion > PE(16:1(9Z)/17:0cycw7c) + Carbon dioxide
PS(16:1(9Z)/18:1(11Z)) + Hydrogen ion > PE(16:1(9Z)/18:1(11Z)) + Carbon dioxide
PS(18:1(11Z)/16:1(9Z)) + Hydrogen ion > PE(18:1(11Z)/16:1(9Z)) + Carbon dioxide
PS(16:1(9Z)/19:0cycv8c) + Hydrogen ion > PE(16:1(9Z)/19:0cycv8c) + Carbon dioxide
PS(16:1(9Z)/19:0cycw8c) + Hydrogen ion > PE(16:1(9Z)/19:0cycw8c) + Carbon dioxide
PS(17:0cycw7c/12:0(3-OH)) + Hydrogen ion > PE(17:0cycw7c/12:0(3-OH)) + Carbon dioxide
PS(17:0cycw7c/16:0) + Hydrogen ion > PE(17:0cycw7c/16:0) + Carbon dioxide
PS(18:1(11Z)/16:0) + Hydrogen ion > PE(18:1(11Z)/16:0) + Carbon dioxide
PS(18:1(11Z)/18:1(11Z)) + Hydrogen ion > PE(18:1(11Z)/18:1(11Z)) + Carbon dioxide
PS(18:1(9Z)/15:0cyclo) + Hydrogen ion > PE(18:1(9Z)/15:0cyclo) + Carbon dioxide
PS(18:1(9Z)/19:0cycv8c) + Hydrogen ion > PE(18:1(9Z)/19:0cycv8c) + Carbon dioxide
PS(18:1(9Z)/19:0cycw8c) + Hydrogen ion > PE(18:1(9Z)/19:0cycw8c) + Carbon dioxide
PS(19:0cycv8c/18:1(9Z)) + Hydrogen ion > PE(19:0cycv8c/18:1(9Z)) + Carbon dioxide
PS(19:0/14:0) + Hydrogen ion > PE(19:0/14:0) + Carbon dioxide
PS(19:0/16:1(9Z)) + Hydrogen ion > PE(19:0/16:1(9Z)) + Carbon dioxide
PS(19:0/18:1(11Z)) + Hydrogen ion > PE(19:0/18:1(11Z)) + Carbon dioxide
PS(19:0cycv8c/10:0(3-OH)) + Hydrogen ion > PE(19:0cycv8c/10:0(3-OH)) + Carbon dioxide
PS(19:0cycv8c/12:0(3-OH)) + Hydrogen ion > PE(19:0cycv8c/12:0(3-OH)) + Carbon dioxide
PS(19:iso/10:0(3-OH)) + Hydrogen ion > PE(19:iso/10:0(3-OH)) + Carbon dioxide
PS(19:iso/12:0(3-OH)) + Hydrogen ion > PE(19:iso/12:0(3-OH)) + Carbon dioxide
PS(19:iso/14:0(3-OH)) + Hydrogen ion > PE(19:iso/14:0(3-OH)) + Carbon dioxide
PS(19:iso/14:0) + Hydrogen ion > PE(19:iso/14:0) + Carbon dioxide
Homocysteine + S-Methylmethionine <>2 L-Methionine + Hydrogen ion
Sorbitol-6-phosphate + NAD <> Fructose 6-phosphate + NADH + Hydrogen ion
Quinate + NADP <> 3-Dehydroquinate + NADPH + Hydrogen ion
2 DG(18:1(11Z)/0:0/18:1(9Z)) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(18:1(11Z)/18:1(9Z)) + Pyrophosphate
2 DG(18:1(9Z)/0:0/18:1(11Z)) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(18:1(9Z)/18:1(11Z)) + Pyrophosphate
2 CDP-DG(18:1(11Z)/18:1(11Z)) + Glycerol 3-phosphate >2 PGP(18:1(11Z)/18:1(11Z)) + Cytidine monophosphate + Hydrogen ion
2 CDP-DG(18:1(11Z)/18:1(9Z)) + Glycerol 3-phosphate >2 PGP(18:1(11Z)/18:1(11Z)) + Cytidine monophosphate + Hydrogen ion
2 CDP-DG(18:1(9Z)/18:1(11Z)) + Glycerol 3-phosphate >2 PGP(18:1(11Z)/18:1(11Z)) + Cytidine monophosphate + Hydrogen ion
Precorrin 2 + NAD <> Sirohydrochlorin + NADH +2 Hydrogen ion
Trimethylamine N-Oxide + NADH + 2 Hydrogen ion > Trimethylamine + NAD + Water
3-(2,3-Dihydroxyphenyl)propionic acid + Oxygen > (2E,4Z)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate + Hydrogen ion
(2E,4Z)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate + Water > (2Z)-2-hydroxypenta-2,4-dienoate + Succinic acid + Hydrogen ion
2-Aminomalonate semialdehyde + NADPH + Hydrogen ion <> NADP + L-Serine
2-Pyrocatechuic acid + Oxygen > Hydrogen ion + 2-Carboxymuconate
Hydrogen (gas) + 2 Hydrogen ion + 2-Demethylmenaquinone 8 >
2-Deoxygluconate + NAD > 3-Dehydro-2-deoxy-D-gluconate + NADH + Hydrogen ion
Tartaric acid + NAD <> NADH + Hydrogen ion + 2-Hydroxy-3-oxosuccinate
Uracil + FMNH2 + Oxygen > Ureidoacrylate peracid + Flavin Mononucleotide + Hydrogen ion + Peroxyaminoacrylate
Ureidoacrylate peracid + Water > Peroxyaminoacrylate + Carbamic acid + Hydrogen ion + 3-Aminoacrylate
2-Aminoacrylic acid + Water + Hydrogen ion > Malonic semialdehyde + Ammonium
Malonic semialdehyde + NADPH + Hydrogen ion > 3-Hydroxypropanoate + NADP
Xanthosine 5-triphosphate + Water > XDP + Phosphate + Hydrogen ion
trans-Delta2, cis-delta4-decadienoyl-CoA + NADPH + Hydrogen ion > (2E)-Decenoyl-CoA + NADP
Riboflavin + NADPH + 2 Hydrogen ion > Riboflavin reduced + NADP
Adenosine triphosphate + Water > ADP + Phosphate + Hydrogen ion
(2-Naphthyl)methanol + NAD > 2-Naphthaldehyde + Hydrogen ion + NADH
3-Oxo-5,6-dehydrosuberyl-CoA semialdehyde + Water + NADP > Hydrogen ion + NADPH + 3-Oxo-5,6-dehydrosuberyl-CoA
2',3'-Cyclic UMP + Water > Hydrogen ion + 3'-UMP
Cytidine + Hydrogen ion + Water > Uridine + Ammonium
3,5-Tetradecadienoyl-CoA + Water > Hydrogen ion + Coenzyme A + 3,5-tetradecadienoate
Hydrogen ion + NADH + Oxygen + 3-(3-Hydroxyphenyl)propanoic acid > 3-(2,3-Dihydroxyphenyl)propionic acid + Water + NAD
Phenylacetaldehyde + NAD + Water > NADH + Hydrogen ion + Benzeneacetic acid
Phenylacetyl-CoA + Hydrogen ion + NADPH + Oxygen > Water + NADP + 2-(1,2-Epoxy-1,2-dihydrophenyl)acetyl-CoA
3-Hydroxyadipyl-CoA + NAD > NADH + Hydrogen ion + 3-Oxoadipyl-CoA
10-formyl-tetrahydrofolate mono-L-glutamate + N1-(5-phospho-β-D-ribosyl)glycinamide > Hydrogen ion + tetrahydropteroyl mono-L-glutamate + 5'-Phosphoribosyl-N-formylglycineamide
5-Aminoimidazole ribonucleotide + S-adenosyl-L-methionine >3 Hydrogen ion + CO + Formic acid + L-Methionine + 5'-Deoxyadenosine + 4-amino-2-methyl-5-phosphomethylpyrimidine
2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate + 2-((2R,5Z)-2-Carboxy-4-methylthiazol-5(2H)-ylidene)ethyl phosphate + Hydrogen ion > Carbon dioxide + Pyrophosphate + Thiamine monophosphate
3-Aminopropylphosphonate + Adenosine triphosphate + Water > ADP + Phosphate + Hydrogen ion
Bis-molybdopterin guanine dinucleotide + Guanosine triphosphate + Hydrogen ion + Molybdopterin guanine dinucleotide > Guanylyl molybdenum cofactor + Pyrophosphate
2,3-dihydroxy-2,3-dihydrobenzoate + NAD > 2,3-Dihydroxybenzoic acid + NADH + Hydrogen ion
2,3-Dihydroxybenzoic acid + Adenosine triphosphate + Hydrogen ion > (2,3-Dihydroxybenzoyl)adenylic acid + Pyrophosphate
(2,3-Dihydroxybenzoyl)adenylic acid + a holo-[EntB isochorismatase/aryl-carrier protein] > a 2,3-dihydroxybenzoyl-[EntB isochorismatase/aryl-carrier protein] + Adenosine monophosphate + Hydrogen ion
a 2,3-dihydroxybenzoyl-[EntB isochorismatase/aryl-carrier protein] + a seryl-[EntF peptidyl-carrier protein] > a holo-[EntB isochorismatase/aryl-carrier protein] + a DHB-seryl-[EntF peptidyl-carrier protein] + Hydrogen ion
1-[(5-Amino-5-carboxypentyl)amino]-1-deoxyfructose + Adenosine triphosphate > Fructoselysine-6-phosphate + ADP + Hydrogen ion
2 Superoxide anion + 2 Hydrogen ion > Hydrogen peroxide + Oxygen
Putrescine + L-Glutamate + Adenosine triphosphate > gamma-Glutamyl-L-putrescine + ADP + Hydrogen ion + Phosphate
Pyruvaldehyde + NADPH + Hydrogen ion <> Hydroxyacetone + NADP
NAD + Adenosine triphosphate > NADP + ADP + Hydrogen ion
oxidized thioredoxin + NADPH + Hydrogen ion > reduced thioredoxin + NADP
a [pyruvate dehydrogenase E2 protein] N6-dihydrolipoyl-L-lysine + NAD > a [pyruvate dehydrogenase E2 protein] N6-lipoyl-L-lysine + NADH + Hydrogen ion
Pyruvaldehyde + Water > D-Lactic acid + Hydrogen ion
Adenosine triphosphate + Water > ADP + Phosphate + Hydrogen ion
L-Cysteine + Adenosine triphosphate + Water > ADP + Phosphate + Hydrogen ion
Fumaric acid + 2 Hydrogen ion + "a menaquinol" > Succinic acid + "a menaquinone"
Hydrogen ion + NADH + NADP > NADPH + NAD
Adenosine triphosphate + Biotin + Biotin-Carboxyl Carrying Protein > Hydrogen ion + Adenosine monophosphate + Pyrophosphate + Biotinylated [BCCP monomer]
L-Lysine + Hydrogen ion > Cadaverine + Carbon dioxide
gamma-Glutamyl-L-putrescine + Oxygen + Hydrogen ion > gamma-Glutamyl-gamma-butyraldehyde + Hydrogen peroxide + Ammonium
gamma-Glutamyl-gamma-butyraldehyde + NADP + Water > gamma-glutamyl-gamma-aminobutyrate + NADPH +2 Hydrogen ion
Succinic acid semialdehyde + NAD + Water > Succinic acid + NADH +2 Hydrogen ion
a biotinylated [BCCP dimer] + Adenosine triphosphate + Hydrogen carbonate > carboxylated-biotinylated [BCCP dimer] + Hydrogen ion + ADP + Phosphate
D-Ribulose + Adenosine triphosphate > D-Ribulose-1-phosphate + Adenosine monophosphate + Hydrogen ion
Glycolaldehyde + NAD + Water > Glycolic acid + NADH +2 Hydrogen ion
N-Acetyl-glucosamine 1-phosphate + Uridine triphosphate + Hydrogen ion > Uridine diphosphate-N-acetylglucosamine + Pyrophosphate
D-Erythrose 4-phosphate + NAD + Water > 4-Phospho-D-erythronate + NADH +2 Hydrogen ion
Dihydromethysticin + NADPH + Hydrogen ion > Tetrahydromonapterin + NADP
5-Aminoimidazole ribonucleotide + Hydrogen carbonate + Adenosine triphosphate > 5-Phosphoribosyl-5-carboxyaminoimidazole + ADP + Phosphate + Hydrogen ion
UDP-N-acetyl-α-D-muramate + Adenosine triphosphate + L-Alanine > UDP-N-Acetylmuramyl-L-Ala + ADP + Phosphate + Hydrogen ion
UDP-N-Acetylmuramoyl-L-alanyl-D-gamma-glutamyl-meso-2,6-diaminopimelate + D-Alanyl-D-alanine + Adenosine triphosphate > N-Acetylmuramoyl-L-alanyl-D-glutamyl-L-lysyl-D-alanyl-D-alanine-diphosphoundecaprenyl-N-acetylglucosamine + ADP + Phosphate + Hydrogen ion
N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimelyl-D-alanyl-D-alanine-diphosphoundecaprenol + Uridine diphosphate-N-acetylglucosamine > Undecaprenyl-diphospho-N-acetylmuramoyl-(N-acetylglucosamine)-L-alanyl-D-glutaminyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine + Uridine 5'-diphosphate + Hydrogen ion
2 Undecaprenyl-diphospho-N-acetylmuramoyl-(N-acetylglucosamine)-L-alanyl-D-glutaminyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine > a peptidoglycan dimer (meso-diaminopimelate containing) + Undecaprenyl diphosphate + Hydrogen ion
Hydrogen cyanide + Thiosulfate > Thiocyanate + Sulfite +2 Hydrogen ion
R-Methylmalonyl-CoA + Hydrogen ion > Propionyl-CoA + Carbon dioxide
Undecaprenyl-N-acetyl-alpha-D-glucosaminyl-pyrophosphate + UDP-ManNAcA > Uridine 5'-diphosphate + Undecaprenyl-diphospho-N-acetylglucosamine-N-acetylmannosaminuronate + Hydrogen ion
Undecaprenyl-diphospho-N-acetylglucosamine-N-acetylmannosaminuronate + dTDP-4-Acetamido-4,6-dideoxy-D-galactose > Undecaprenyl-diphospho N-acetylglucosamine-N-acetylmannosaminuronate-N-acetamido-4,6-dideoxy-D-galactose + dTDP + Hydrogen ion
Acetyl-CoA + dTDP-D-Fucosamine > Coenzyme A + Hydrogen ion + dTDP-4-Acetamido-4,6-dideoxy-D-galactose
Glucose 1-phosphate + Thymidine 5'-triphosphate + Hydrogen ion > Pyrophosphate + TDP-Glucose
D-Glyceraldehyde 3-phosphate + Pyruvic acid + Hydrogen ion > 1-Deoxy-D-xylulose 5-phosphate + Carbon dioxide
2-octaprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinone + S-adenosyl-L-methionine > S-Adenosylhomocysteine + Ubiquinol-8 + Hydrogen ion
2-Octaprenyl-6-methoxy-1,4-benzoquinol + S-adenosyl-L-methionine > 2-Octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol + S-Adenosylhomocysteine + Hydrogen ion
trans-Cinnamic acid + Hydrogen ion + Oxygen + NADH > Cis-3-(3-carboxyethyl)-3,5-cyclohexadiene-1,2-diol + NAD
Cis-3-(3-carboxyethyl)-3,5-cyclohexadiene-1,2-diol + NAD > 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid + NADH + Hydrogen ion
S-adenosyl-L-methionine + Hydrogen ion > Decarboxy-SAM + Carbon dioxide
Cadaverine + Decarboxy-SAM > Aminopropylcadaverine + 5'-Methylthioadenosine + Hydrogen ion
Decarboxy-SAM + Putrescine > 5'-Methylthioadenosine + Spermidine + Hydrogen ion
L-Tyrosine + S-adenosyl-L-methionine + NADPH > Dehydroglycine + 4-Methylcatechol + 5'-Deoxyadenosine + L-Methionine + NADP + Hydrogen ion
anhydro-n-acetylmuramic acid + Adenosine triphosphate + Water > N-Acetylmuramate 6-phosphate + ADP + Hydrogen ion
Hydroxyacetone + NADH + Hydrogen ion <> Propylene glycol + NAD
Pyruvaldehyde + NADPH + Hydrogen ion > Lactaldehyde + NADP
Deoxycytidine + Water + Hydrogen ion > Ammonium + Deoxyuridine
N-Acetylmannosamine + Adenosine triphosphate > ADP + Hydrogen ion + N-Acetyl-D-mannosamine 6-phosphate
Adenylyl-molybdopterin + Hydrogen ion + Molybdate > Adenosine monophosphate + Water + molybdenum cofactor
(S)-Ureidoglycolic acid + NAD > Hydrogen ion + NADH + Oxalureate
Carbamoylphosphate + ADP + 2 Hydrogen ion > Ammonium + Adenosine triphosphate + Carbon dioxide
molybdenum cofactor + Cytidine triphosphate + Hydrogen ion > Pyrophosphate + Cytidylyl molybdenum cofactor
Alpha-D-glucose 1-phosphate + Thymidine 5'-triphosphate + Hydrogen ion > Pyrophosphate + dTDP-D-Glucose
dTDP-4-dehydro-beta-L-rhamnose + NADPH + Hydrogen ion > NADP + Deoxythymidine diphosphate-L-rhamnose
L-Galactonate + NAD > NADH + Hydrogen ion + D-Tagaturonate
Deoxyuridine + Adenosine triphosphate > ADP + Hydrogen ion + dUMP
Thymidine + Adenosine triphosphate > ADP + Hydrogen ion + 5-Thymidylic acid
alpha-D-Ribose 1-methylphosphonate 5-triphosphate + Water > Hydrogen ion + Pyrophosphate + alpha-D-Ribose 1-methylphosphonate 5-phosphate
alpha-D-Ribose 1,2-cyclic phosphate 5-phosphate + Water > Hydrogen ion + Ribose 1,5-bisphosphate
a biotinylated [BCCP dimer] + Hydrogen ion + Phosphate + ADP + Malonyl-CoA < Water + Acetyl-CoA + Adenosine triphosphate + carboxylated-biotinylated [BCCP dimer]
Adenosine + Water + Hydrogen ion > Ammonium + Inosine
Deoxyinosine + Ammonium < Water + Hydrogen ion + Deoxyadenosine
Inosine + Adenosine triphosphate > ADP + Hydrogen ion + Inosinic acid
Guanosine + Adenosine triphosphate > ADP + Hydrogen ion + Guanosine monophosphate
Dephospho-CoA + Adenosine triphosphate + Hydrogen ion > Adenine + 2'-(5-Triphosphoribosyl)-3'-dephospho-CoA
2'-(5-Triphosphoribosyl)-3'-dephospho-CoA + [an apo citrate-lyase acyl-carrier protein] > Pyrophosphate + Hydrogen ion + [a holo citrate lyase acyl-carrier protein]
Pyruvic acid + a [pyruvate dehydrogenase E2 protein] N6-lipoyl-L-lysine + Hydrogen ion > a [pyruvate dehydrogenase E2 protein] N6-S-acetyldihydrolipoyl-L-lysine + Carbon dioxide
Zinc + Adenosine triphosphate + Water > ADP + Phosphate + Hydrogen ion
Thiosulfate + Adenosine triphosphate + Water > ADP + Phosphate + Hydrogen ion
"a menaquinone" + 4 Hydrogen ion + NADH > "a menaquinol" + NAD
a [2-oxoglutarate dehydrogenase E2 protein] N6-dihydrolipoyl-L-lysine + NAD > a [2-oxoglutarate dehydrogenase E2 protein] N6-lipoyl-L-lysine + NADH + Hydrogen ion
D-Lactic acid + 2 Hydrogen ion + an ubiquinol  > Pyruvic acid + ubiquinone
D-Glycero-D-manno-heptose 7-phosphate + Adenosine triphosphate > D-Glycero-D-manno-heptose 1,7-bisphosphate + ADP + Hydrogen ion
D-glycero-beta-D-manno-heptose 1-phosphate + Adenosine triphosphate + Hydrogen ion > ADP-D-Glycero-D-manno-heptose + Pyrophosphate
Ribose + Adenosine triphosphate > D-Ribose-5-phosphate + ADP + Hydrogen ion
L-Ribulose + Adenosine triphosphate > L-ribulose 5-phosphate + ADP + Hydrogen ion
L-Threo-2-pentulose + Adenosine triphosphate > Xylulose 5-phosphate + ADP + Hydrogen ion
a [2-oxoglutarate dehydrogenase E2 protein] N6-lipoyl-L-lysine + Oxoglutaric acid + Hydrogen ion > a [2-oxoglutarate dehydrogenase E2 protein] N6-S-succinyldihydrolipoyl-L-lysine + Carbon dioxide
a [phospholipid] olefinic fatty acid + S-adenosyl-L-methionine > a [phospholipid] cyclopropane fatty acid + S-Adenosylhomocysteine + Hydrogen ion
beta-D-Ribopyranose + Adenosine triphosphate + Water > ADP + Phosphate + Hydrogen ion
Carbon dioxide + Water > Hydrogen ion + Hydrogen carbonate
Hydrogen carbonate + Cyanate + Hydrogen ion > Carbon dioxide + Carbamic acid
an acetyl-[acp] + a [lipoyl-carrier protein]-L-lysine > a [lipoyl-carrier protein] N6-octanoyl-L-lysine + Hydrogen ion + a holo-[acyl-carrier protein]
D-Sedoheptulose 7-phosphate + Adenosine triphosphate > Sedoheptulose 1,7-bisphosphate + ADP + Hydrogen ion
L-Threo-2-pentulose + Adenosine triphosphate > L-Xylulose 5-phosphate + ADP + Hydrogen ion
Glyceric acid + Adenosine triphosphate > 2-Phospho-D-glyceric acid + ADP + Hydrogen ion
L-Cysteine > Hydrogen sulfide + Hydrogen ion + 2-aminoprop-2-enoate
Ethylene glycol + NAD <> Glycolaldehyde + NADH + Hydrogen ion
Beta-D-Glucopyranuronic acid + Adenosine triphosphate > Glucose 6-phosphate + ADP + Hydrogen ion
Oxygen + 4 Hydrogen ion + Electron >2 Water
UDP-Glucose + Mannose 6-phosphate > alpha,alpha-Trehalose 6-phosphate + Uridine 5'-diphosphate + Hydrogen ion
α-D-glucose 1-phosphate + Thymidine 5'-triphosphate + Hydrogen ion > dTDP-D-Glucose + Pyrophosphate
molybdenum cofactor + Cytidine triphosphate + Hydrogen ion > Molybdopterin cytosine dinucleotide + Pyrophosphate
dTDP-4-dehydro-beta-L-rhamnose + NADPH + Hydrogen ion > dTDP-6-deoxy-L-mannose + NADP
dTDP-4-dehydro-beta-L-rhamnose + NADH + Hydrogen ion > NADP + TDP-Rhamnose
2 Pyruvic acid + 2 Water > Carbon dioxide + Acetic acid + Hydrogen ion + Electron
Hypoxanthine + Water + NAD > Hydrogen ion + NADH + Xanthine
Xanthine + Water + NAD > NADH + Hydrogen ion + Uric acid
D-Serine > Water + Hydrogen ion + 2-Aminoacrylic acid
S-Lactoylglutathione + Water > Glutathione + Hydrogen ion + L-Lactic acid
4 Hydrogen ion + NADH + "a menaquinone" > NAD + "a menaquinol"
Nitrate + 2 Hydrogen ion + "a menaquinol" > Nitrite + Water + "a menaquinone"

SMPDB Pathways:
1,6-anhydro-<i>N</i>-acetylmuramic acid recyclingPW002064 Pw002064Pw002064 greyscalePw002064 simple
2,3-dihydroxybenzoate biosynthesisPW000751 Pw000751Pw000751 greyscalePw000751 simple
2-O-alpha-mannosyl-D-glycerate degradationPW002096 Pw002096Pw002096 greyscalePw002096 simple
2-Oxopent-4-enoate metabolismPW001890 Pw001890Pw001890 greyscalePw001890 simple
2-Oxopent-4-enoate metabolism 2PW002035 Pw002035Pw002035 greyscalePw002035 simple
2-oxoglutarate decarboxylation to succinyl-CoAPW002108 Pw002108Pw002108 greyscalePw002108 simple
4-aminobutanoate degradation IPW002068 Pw002068Pw002068 greyscalePw002068 simple
ADP-L-glycero-Beta-D-manno-heptose biosynthesisPW002095 Pw002095Pw002095 greyscalePw002095 simple
Amino sugar and nucleotide sugar metabolism IPW000886 Pw000886Pw000886 greyscalePw000886 simple
Amino sugar and nucleotide sugar metabolism IIPW000887 Pw000887Pw000887 greyscalePw000887 simple
Amino sugar and nucleotide sugar metabolism IIIPW000895 Pw000895Pw000895 greyscalePw000895 simple
Ascorbate metabolismPW000793 Pw000793Pw000793 greyscalePw000793 simple
Asparagine biosynthesisPW000813 Pw000813Pw000813 greyscalePw000813 simple
Biosynthesis of siderophore group nonribosomal peptidesPW000760 Pw000760Pw000760 greyscalePw000760 simple
Biotin metabolismPW000762 Pw000762Pw000762 greyscalePw000762 simple
Chorismate biosynthesisPW000816 Pw000816Pw000816 greyscalePw000816 simple
Citrate lyase activationPW002075 Pw002075Pw002075 greyscalePw002075 simple
Collection of Reactions without pathwaysPW001891 Pw001891Pw001891 greyscalePw001891 simple
Conversion of Succinate to PropanoatePW002058 Pw002058Pw002058 greyscalePw002058 simple
Cyclopropane Fatty Acid (CFA) BiosynthesisPW002109 Pw002109Pw002109 greyscalePw002109 simple
D-Glutamine and D-glutamate metabolismPW000769 Pw000769Pw000769 greyscalePw000769 simple
D-allulose degradationPW000825 Pw000825Pw000825 greyscalePw000825 simple
D-arabinose degradation IPW002038 Pw002038Pw002038 greyscalePw002038 simple
D-serine degradationPW002101 Pw002101Pw002101 greyscalePw002101 simple
D-sorbitol degradation IIPW002022 Pw002022Pw002022 greyscalePw002022 simple
Enterobactin BiosynthesisPW002048 Pw002048Pw002048 greyscalePw002048 simple
Ethylene Glycol DegradationPW002093 Pw002093Pw002093 greyscalePw002093 simple
Fatty acid biosynthesisPW000900 Pw000900Pw000900 greyscalePw000900 simple
Fatty acid metabolismPW000796 Pw000796Pw000796 greyscalePw000796 simple
Flavin biosynthesisPW001971 Pw001971Pw001971 greyscalePw001971 simple
Folate biosynthesisPW000908 Pw000908Pw000908 greyscalePw000908 simple
Fructoselysine and Psicoselysine DegradationPW002049 Pw002049Pw002049 greyscalePw002049 simple
GLYCINE BIOSYNTHESISPW000808 Pw000808Pw000808 greyscalePw000808 simple
GTP degradationPW001888 Pw001888Pw001888 greyscalePw001888 simple
Galactitol and galactonate degradationPW000820 Pw000820Pw000820 greyscalePw000820 simple
Galactose metabolismPW000821 Pw000821Pw000821 greyscalePw000821 simple
Gluconeogenesis from L-malic acidPW000819 Pw000819Pw000819 greyscalePw000819 simple
Glutathione metabolismPW000833 Pw000833Pw000833 greyscalePw000833 simple
Hydrogen Sulfide Biosynthesis IPW002066 Pw002066Pw002066 greyscalePw002066 simple
L-arabinose Degradation IPW002103 Pw002103Pw002103 greyscalePw002103 simple
L-cysteine degradationPW002110 Pw002110Pw002110 greyscalePw002110 simple
L-glutamate metabolismPW000789 Pw000789Pw000789 greyscalePw000789 simple
L-glutamate metabolism IIPW001886 Pw001886Pw001886 greyscalePw001886 simple
L-lactaldehyde degradation (aerobic)PW002073 Pw002073Pw002073 greyscalePw002073 simple
L-lyxose DegradationPW002100 Pw002100Pw002100 greyscalePw002100 simple
L-threonine degradation to methylglyoxalPW002106 Pw002106Pw002106 greyscalePw002106 simple
Leucine BiosynthesisPW000811 Pw000811Pw000811 greyscalePw000811 simple
Lipoate Biosynthesis and Incorporation IPW002107 Pw002107Pw002107 greyscalePw002107 simple
Lipoic acid metabolismPW000770 Pw000770Pw000770 greyscalePw000770 simple
Lipopolysaccharide biosynthesisPW000831 Pw000831Pw000831 greyscalePw000831 simple
Lysine Degradation IPW000772 Pw000772Pw000772 greyscalePw000772 simple
Lysine biosynthesisPW000771 Pw000771Pw000771 greyscalePw000771 simple
Mannose MetabolismPW000822 Pw000822Pw000822 greyscalePw000822 simple
Menaquinol biosythesisPW001897 Pw001897Pw001897 greyscalePw001897 simple
N-acetylneuraminate and N-acetylmannosamine and N-acetylglucosamine degradationPW002030 Pw002030Pw002030 greyscalePw002030 simple
N-oxide electron transferPW001889 Pw001889Pw001889 greyscalePw001889 simple
NAD biosynthesisPW000829 Pw000829Pw000829 greyscalePw000829 simple
NAD phosphorylation and dephosphorylationPW002081 Pw002081Pw002081 greyscalePw002081 simple
NAD salvagePW000830 Pw000830Pw000830 greyscalePw000830 simple
Nitrogen metabolismPW000755 Pw000755Pw000755 greyscalePw000755 simple
O-antigen building blocks biosynthesisPW002089 Pw002089Pw002089 greyscalePw002089 simple
Oleic acid OxidationPW002025 Pw002025Pw002025 greyscalePw002025 simple
One Carbon Pool by Folate IPW001735 Pw001735Pw001735 greyscalePw001735 simple
One carbon pool by folatePW000773 Pw000773Pw000773 greyscalePw000773 simple
Oxidative phosphorylationPW000919 Pw000919Pw000919 greyscalePw000919 simple
PRPP BiosynthesisPW000909 Pw000909Pw000909 greyscalePw000909 simple
Pantothenate and CoA biosynthesisPW000828 Pw000828Pw000828 greyscalePw000828 simple
Pentose PhosphatePW000893 Pw000893Pw000893 greyscalePw000893 simple
Phenylalanine metabolismPW000921 Pw000921Pw000921 greyscalePw000921 simple
Phenylethylamine metabolismPW002027 Pw002027Pw002027 greyscalePw002027 simple
Porphyrin metabolismPW000936 Pw000936Pw000936 greyscalePw000936 simple
Propanoate metabolismPW000940 Pw000940Pw000940 greyscalePw000940 simple
Purine degradationPW001887 Pw001887Pw001887 greyscalePw001887 simple
Putrescine Degradation IIPW002054 Pw002054Pw002054 greyscalePw002054 simple
Pyrimidine metabolismPW000942 Pw000942Pw000942 greyscalePw000942 simple
Pyrimidine ribonucleosides degradtionPW002024 Pw002024Pw002024 greyscalePw002024 simple
Quorum SensingPW000836 Pw000836Pw000836 greyscalePw000836 simple
Ribose DegradationPW002102 Pw002102Pw002102 greyscalePw002102 simple
S-adenosyl-L-methionine biosynthesisPW000837 Pw000837Pw000837 greyscalePw000837 simple
S-adenosyl-L-methionine cyclePW002080 Pw002080Pw002080 greyscalePw002080 simple
Secondary Metabolite: Leucine biosynthesisPW000980 Pw000980Pw000980 greyscalePw000980 simple
Secondary Metabolites: Glyoxylate cyclePW000967 Pw000967Pw000967 greyscalePw000967 simple
Secondary Metabolites: Histidine biosynthesisPW000984 Pw000984Pw000984 greyscalePw000984 simple
Secondary Metabolites: Shikimate PathwayPW000985 Pw000985Pw000985 greyscalePw000985 simple
Secondary Metabolites: Ubiquinol biosynthesisPW000981 Pw000981Pw000981 greyscalePw000981 simple
Secondary Metabolites: Ubiquinol biosynthesis 2PW002036 Pw002036Pw002036 greyscalePw002036 simple
Secondary Metabolites: Valine and I-leucine biosynthesis from pyruvatePW000978 Pw000978Pw000978 greyscalePw000978 simple
Secondary Metabolites: cysteine biosynthesis from serinePW000977 Pw000977Pw000977 greyscalePw000977 simple
Secondary Metabolites: enterobacterial common antigen biosynthesisPW000959 Pw000959Pw000959 greyscalePw000959 simple
Secondary Metabolites: enterobacterial common antigen biosynthesis 2PW002045 Pw002045Pw002045 greyscalePw002045 simple
Secondary Metabolites: enterobacterial common antigen biosynthesis 3PW002046 Pw002046Pw002046 greyscalePw002046 simple
Secondary Metabolites: threonine biosynthesis from aspartatePW000976 Pw000976Pw000976 greyscalePw000976 simple
Secondary metabolites: Trehalose Biosynthesis and MetabolismPW000968 Pw000968Pw000968 greyscalePw000968 simple
Secondary metabolites: isoprenoid biosynthesis (nonmevalonate pathway)PW000975 Pw000975Pw000975 greyscalePw000975 simple
Secondary metabolites: methylerythritol phosphate and polyisoprenoid biosynthesisPW000958 Pw000958Pw000958 greyscalePw000958 simple
Sedoheptulose Bisphosphate BypassPW002098 Pw002098Pw002098 greyscalePw002098 simple
Selenium metabolismPW001894 Pw001894Pw001894 greyscalePw001894 simple
Spermidine Biosynthesis IPW002040 Pw002040Pw002040 greyscalePw002040 simple
Spermidine biosynthesis and metabolismPW002085 Pw002085Pw002085 greyscalePw002085 simple
Starch and sucrose metabolismPW000941 Pw000941Pw000941 greyscalePw000941 simple
Sulfur metabolismPW000922 Pw000922Pw000922 greyscalePw000922 simple
Superoxide Radicals DegradationPW002053 Pw002053Pw002053 greyscalePw002053 simple
TCA cyclePW000779 Pw000779Pw000779 greyscalePw000779 simple
TCA cycle (ubiquinol-0)PW002023 Pw002023Pw002023 greyscalePw002023 simple
TCA cycle (ubiquinol-10)PW001010 Pw001010Pw001010 greyscalePw001010 simple
TCA cycle (ubiquinol-2)PW001002 Pw001002Pw001002 greyscalePw001002 simple
TCA cycle (ubiquinol-3)PW001003 Pw001003Pw001003 greyscalePw001003 simple
TCA cycle (ubiquinol-4)PW001004 Pw001004Pw001004 greyscalePw001004 simple
TCA cycle (ubiquinol-5)PW001005 Pw001005Pw001005 greyscalePw001005 simple
TCA cycle (ubiquinol-6)PW001006 Pw001006Pw001006 greyscalePw001006 simple
TCA cycle (ubiquinol-7)PW001007 Pw001007Pw001007 greyscalePw001007 simple
TCA cycle (ubiquinol-8)PW001008 Pw001008Pw001008 greyscalePw001008 simple
TCA cycle (ubiquinol-9)PW001009 Pw001009Pw001009 greyscalePw001009 simple
Taurine MetabolismPW000774 Pw000774Pw000774 greyscalePw000774 simple
Taurine Metabolism IPW001028 Pw001028Pw001028 greyscalePw001028 simple
Tetrahydromonapterin BiosynthesisPW002043 Pw002043Pw002043 greyscalePw002043 simple
Thiamin diphosphate biosynthesisPW002028 Pw002028Pw002028 greyscalePw002028 simple
Thiazole Biosynthesis IPW002041 Pw002041Pw002041 greyscalePw002041 simple
Thiosulfate Disproportionation IIIPW002060 Pw002060Pw002060 greyscalePw002060 simple
Trehalose Degradation I (low osmolarity)PW002097 Pw002097Pw002097 greyscalePw002097 simple
Tryptophan metabolismPW000815 Pw000815Pw000815 greyscalePw000815 simple
Uracil degradation IIIPW002026 Pw002026Pw002026 greyscalePw002026 simple
Valine BiosynthesisPW000812 Pw000812Pw000812 greyscalePw000812 simple
Vitamin B1/ThiaminePW000892 Pw000892Pw000892 greyscalePw000892 simple
Vitamin B6 1430936196PW000891 Pw000891Pw000891 greyscalePw000891 simple
Xylose Degradation IPW002105 Pw002105Pw002105 greyscalePw002105 simple
adenine and adenosine salvage IPW002069 Pw002069Pw002069 greyscalePw002069 simple
adenine and adenosine salvage IIPW002071 Pw002071Pw002071 greyscalePw002071 simple
adenine and adenosine salvage IIIPW002072 Pw002072Pw002072 greyscalePw002072 simple
adenosine nucleotides degradationPW002091 Pw002091Pw002091 greyscalePw002091 simple
adenosylcobalamin salvage from cobinamidePW001884 Pw001884Pw001884 greyscalePw001884 simple
allantoin degradation (anaerobic)PW002050 Pw002050Pw002050 greyscalePw002050 simple
aminopropylcadaverine biosynthesisPW002039 Pw002039Pw002039 greyscalePw002039 simple
arginine metabolismPW000790 Pw000790Pw000790 greyscalePw000790 simple
beta-Alanine metabolismPW000896 Pw000896Pw000896 greyscalePw000896 simple
biotin-carboxyl carrier protein assemblyPW002067 Pw002067Pw002067 greyscalePw002067 simple
colanic acid building blocks biosynthesisPW000951 Pw000951Pw000951 greyscalePw000951 simple
curcumin degradationPW001896 Pw001896Pw001896 greyscalePw001896 simple
cyanate degradationPW002099 Pw002099Pw002099 greyscalePw002099 simple
cysteine biosynthesisPW000800 Pw000800Pw000800 greyscalePw000800 simple
dimethyl sulfoxide electron transferPW001892 Pw001892Pw001892 greyscalePw001892 simple
fatty acid elongation -- saturatedPW000798 Pw000798Pw000798 greyscalePw000798 simple
fatty acid oxidationPW000758 Pw000758Pw000758 greyscalePw000758 simple
fatty acid oxidation (Butanoate)PW001017 Pw001017Pw001017 greyscalePw001017 simple
fatty acid oxidation (Decanoate)PW001018 Pw001018Pw001018 greyscalePw001018 simple
fatty acid oxidation (hexanoate)PW001019 Pw001019Pw001019 greyscalePw001019 simple
fatty acid oxidation (laurate)PW001020 Pw001020Pw001020 greyscalePw001020 simple
fatty acid oxidation (myristate)PW001021 Pw001021Pw001021 greyscalePw001021 simple
fatty acid oxidation (octanoate)PW001022 Pw001022Pw001022 greyscalePw001022 simple
fatty acid oxidation (palmitate)PW001023 Pw001023Pw001023 greyscalePw001023 simple
fatty acid oxidation (steareate)PW001024 Pw001024Pw001024 greyscalePw001024 simple
fructose metabolismPW000913 Pw000913Pw000913 greyscalePw000913 simple
fucose and rhamnose degradationPW000826 Pw000826Pw000826 greyscalePw000826 simple
galactose degradation/Leloir PathwayPW000884 Pw000884Pw000884 greyscalePw000884 simple
glutathione metabolism IIPW001927 Pw001927Pw001927 greyscalePw001927 simple
glutathione metabolism IIIPW002018 Pw002018Pw002018 greyscalePw002018 simple
glycerol metabolismPW000914 Pw000914Pw000914 greyscalePw000914 simple
glycerol metabolism IIPW000915 Pw000915Pw000915 greyscalePw000915 simple
glycerol metabolism III (sn-glycero-3-phosphoethanolamine)PW000916 Pw000916Pw000916 greyscalePw000916 simple
glycerol metabolism IV (glycerophosphoglycerol)PW000917 Pw000917Pw000917 greyscalePw000917 simple
glycerol metabolism V (glycerophosphoserine)PW000918 Pw000918Pw000918 greyscalePw000918 simple
glycolate and glyoxylate degradationPW000827 Pw000827Pw000827 greyscalePw000827 simple
glycolate and glyoxylate degradation IIPW002021 Pw002021Pw002021 greyscalePw002021 simple
glycolysis and pyruvate dehydrogenasePW000785 Pw000785Pw000785 greyscalePw000785 simple
guanine and guanosine salvagePW002074 Pw002074Pw002074 greyscalePw002074 simple
guanylyl molybdenum cofactor biosynthesisPW002032 Pw002032Pw002032 greyscalePw002032 simple
hexuronide and hexuronate degradationPW000834 Pw000834Pw000834 greyscalePw000834 simple
histidine biosynthesisPW000810 Pw000810Pw000810 greyscalePw000810 simple
inner membrane transportPW000786 Pw000786Pw000786 greyscalePw000786 simple
isoleucine biosynthesisPW000818 Pw000818Pw000818 greyscalePw000818 simple
ketogluconate metabolismPW002003 Pw002003Pw002003 greyscalePw002003 simple
lipopolysaccharide biosynthesis IIPW001905 Pw001905Pw001905 greyscalePw001905 simple
lipopolysaccharide biosynthesis IIIPW002059 Pw002059Pw002059 greyscalePw002059 simple
methionine biosynthesisPW000814 Pw000814Pw000814 greyscalePw000814 simple
methylglyoxal degradation IIPW002084 Pw002084Pw002084 greyscalePw002084 simple
methylglyoxal degradation IIIPW002079 Pw002079Pw002079 greyscalePw002079 simple
methylglyoxal degradation IVPW002078 Pw002078Pw002078 greyscalePw002078 simple
methylphosphonate degradation IPW002065 Pw002065Pw002065 greyscalePw002065 simple
nitrate reduction VIIIPW002092 Pw002092Pw002092 greyscalePw002092 simple
ornithine metabolismPW000791 Pw000791Pw000791 greyscalePw000791 simple
palmitate biosynthesisPW000797 Pw000797Pw000797 greyscalePw000797 simple
palmitate biosynthesis 2PW002044 Pw002044Pw002044 greyscalePw002044 simple
peptidoglycan biosynthesis IPW000906 Pw000906Pw000906 greyscalePw000906 simple
peptidoglycan biosynthesis I 2PW002062 Pw002062Pw002062 greyscalePw002062 simple
phenylalanine biosynthesisPW000807 Pw000807Pw000807 greyscalePw000807 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/15:0cyclo/18:1(9Z))PW001064 Pw001064Pw001064 greyscalePw001064 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/15:0cyclo/19:0cycv8c)PW001065 Pw001065Pw001065 greyscalePw001065 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/18:1(9Z)/15:0cyclo)PW001082 Pw001082Pw001082 greyscalePw001082 simple
phospholipid biosynthesis (CDP-DG(16:0/15:0))PW001745 Pw001745Pw001745 greyscalePw001745 simple
phospholipid biosynthesis (CDP-DG(16:1(9Z)/15:0))PW001757 Pw001757Pw001757 greyscalePw001757 simple
phospholipid biosynthesis (CDP-DG(18:0/10:0))PW001761 Pw001761Pw001761 greyscalePw001761 simple
phospholipid biosynthesis (CDP-DG(18:0/12:0))PW001762 Pw001762Pw001762 greyscalePw001762 simple
phospholipid biosynthesis (CDP-DG(18:0/15:0)PW001766 Pw001766Pw001766 greyscalePw001766 simple
phospholipid biosynthesis (CDP-DG(18:0/19:1(9Z)))PW001776 Pw001776Pw001776 greyscalePw001776 simple
phospholipid biosynthesis (CDP-DG(18:1(9Z)/15:0))PW001782 Pw001782Pw001782 greyscalePw001782 simple
phospholipid biosynthesis (CDP-DG(18:1(9Z)/19:1(9Z)))PW001785 Pw001785Pw001785 greyscalePw001785 simple
phospholipid biosynthesis (CDP-DG(19:1(9Z)/14:0))PW001788 Pw001788Pw001788 greyscalePw001788 simple
phospholipid biosynthesis (CDP-DG(19:1(9Z)/16:0))PW001790 Pw001790Pw001790 greyscalePw001790 simple
phospholipid biosynthesis (CDP-DG(19:1(9Z)/18:0))PW001791 Pw001791Pw001791 greyscalePw001791 simple
phospholipid biosynthesis (CDP-DG(19:1(9Z)/19:1(9Z)))PW001792 Pw001792Pw001792 greyscalePw001792 simple
phospholipid biosynthesis (CL(10:0(3-OH)/10:0/10:0(3-OH)/10:0))PW001899 Pw001899Pw001899 greyscalePw001899 simple
phospholipid biosynthesis (CL(10:0(3-OH)/12:0(3-OH)/10:0(3-OH)/12:0(3-OH)))PW001900 Pw001900Pw001900 greyscalePw001900 simple
phospholipid biosynthesis (CL(10:0(3-OH)/12:0/10:0(3-OH)/12:0))PW001901 Pw001901Pw001901 greyscalePw001901 simple
phospholipid biosynthesis (CL(10:0(3-OH)/15:0cyclo/10:0(3-OH)/15:0cyclo))PW001902 Pw001902Pw001902 greyscalePw001902 simple
phospholipid biosynthesis (CL(10:0(3-OH)/16:0/10:0(3-OH)/16:0))PW001904 Pw001904Pw001904 greyscalePw001904 simple
phospholipid biosynthesis (CL(10:0(3-OH)/16:1(9Z)/10:0(3-OH)/16:1(9Z)))PW001903 Pw001903Pw001903 greyscalePw001903 simple
phospholipid biosynthesis (CL(10:0(3-OH)/17:0cycw7c/10:0(3-OH)/17:0cycw7c))PW001906 Pw001906Pw001906 greyscalePw001906 simple
phospholipid biosynthesis (CL(10:0(3-OH)/17:0cycw7c/14:0/14:0))PW001907 Pw001907Pw001907 greyscalePw001907 simple
phospholipid biosynthesis (CL(10:0(3-OH)/19:0cycv8c/10:0(3-OH)/19:0cycv8c))PW001908 Pw001908Pw001908 greyscalePw001908 simple
phospholipid biosynthesis (CL(10:0(3-OH)/19:iso/10:0(3-OH)/19:iso))PW001909 Pw001909Pw001909 greyscalePw001909 simple
phospholipid biosynthesis (CL(10:0/10:0(3-OH)/10:0/10:0(3-OH)))PW001910 Pw001910Pw001910 greyscalePw001910 simple
phospholipid biosynthesis (CL(10:0/12:0(3-OH)/10:0/12:0(3-OH)))PW001911 Pw001911Pw001911 greyscalePw001911 simple
phospholipid biosynthesis (CL(10:0/17:0cycw7c/14:0/14:0))PW001912 Pw001912Pw001912 greyscalePw001912 simple
phospholipid biosynthesis (CL(12:0(3-OH)/10:0(3-OH)/12:0(3-OH)/10:0(3-OH)))PW001913 Pw001913Pw001913 greyscalePw001913 simple
phospholipid biosynthesis (CL(12:0(3-OH)/10:0/12:0(3-OH)/10:0))PW001914 Pw001914Pw001914 greyscalePw001914 simple
phospholipid biosynthesis (CL(12:0(3-OH)/12:0(3-OH)/12:0/12:0))PW001915 Pw001915Pw001915 greyscalePw001915 simple
phospholipid biosynthesis (CL(12:0(3-OH)/12:0/12:0/12:0))PW001917 Pw001917Pw001917 greyscalePw001917 simple
phospholipid biosynthesis (CL(12:0(3-OH)/14:0(3-OH)/12:0(3-OH)/14:0(3-OH)))PW001918 Pw001918Pw001918 greyscalePw001918 simple
phospholipid biosynthesis (CL(12:0(3-OH)/14:0/12:0(3-OH)/14:0))PW001919 Pw001919Pw001919 greyscalePw001919 simple
phospholipid biosynthesis (CL(12:0(3-OH)/15:0/12:0(3-OH)/15:0))PW001920 Pw001920Pw001920 greyscalePw001920 simple
phospholipid biosynthesis (CL(12:0(3-OH)/15:0cyclo/12:0(3-OH)/15:0cyclo))PW001921 Pw001921Pw001921 greyscalePw001921 simple
phospholipid biosynthesis (CL(12:0(3-OH)/17:0cycw7c/12:0(3-OH)/17:0cycw7c))PW001922 Pw001922Pw001922 greyscalePw001922 simple
phospholipid biosynthesis (CL(12:0(3-OH)/17:0cycw7c/12:0/12:0))PW001923 Pw001923Pw001923 greyscalePw001923 simple
phospholipid biosynthesis (CL(12:0(3-OH)/18:1(9Z)/12:0(3-OH)/18:1(9Z)))PW001924 Pw001924Pw001924 greyscalePw001924 simple
phospholipid biosynthesis (CL(12:0(3-OH)/19:0cycv8c/12:0(3-OH)/19:0cycv8c))PW001925 Pw001925Pw001925 greyscalePw001925 simple
phospholipid biosynthesis (CL(12:0(3-OH)/19:iso/12:0(3-OH)/19:iso))PW001926 Pw001926Pw001926 greyscalePw001926 simple
phospholipid biosynthesis (CL(12:0/10:0(3-OH)/12:0/10:0(3-OH)))PW001928 Pw001928Pw001928 greyscalePw001928 simple
phospholipid biosynthesis (CL(12:0/12:0(3-OH)/12:0/12:0))PW001929 Pw001929Pw001929 greyscalePw001929 simple
phospholipid biosynthesis (CL(12:0/12:0/12:0/12:0))PW001930 Pw001930Pw001930 greyscalePw001930 simple
phospholipid biosynthesis (CL(12:0/14:0(3-OH)/12:0/14:0(3-OH)))PW001931 Pw001931Pw001931 greyscalePw001931 simple
phospholipid biosynthesis (CL(12:0/17:0cycw7c/12:0/12:0))PW001932 Pw001932Pw001932 greyscalePw001932 simple
phospholipid biosynthesis (CL(12:0/19:iso/12:0/19:iso))PW001933 Pw001933Pw001933 greyscalePw001933 simple
phospholipid biosynthesis (CL(14:0(3-OH)/12:0(3-OH)/14:0(3-OH)/12:0(3-OH)))PW001934 Pw001934Pw001934 greyscalePw001934 simple
phospholipid biosynthesis (CL(14:0(3-OH)/12:0/14:0(3-OH)/12:0))PW001935 Pw001935Pw001935 greyscalePw001935 simple
phospholipid biosynthesis (CL(14:0(3-OH)/14:0(3-OH)/14:0/14:0))PW001936 Pw001936Pw001936 greyscalePw001936 simple
phospholipid biosynthesis (CL(14:0(3-OH)/14:0/14:0/14:0))PW001937 Pw001937Pw001937 greyscalePw001937 simple
phospholipid biosynthesis (CL(14:0(3-OH)/16:0/16:0/16:0))PW001938 Pw001938Pw001938 greyscalePw001938 simple
phospholipid biosynthesis (CL(14:0(3-OH)/16:1(9Z)/14:0(3-OH)/16:1(9Z)))PW001939 Pw001939Pw001939 greyscalePw001939 simple
phospholipid biosynthesis (CL(14:0(3-OH)/16:1(9Z)/14:0/14:0))PW001940 Pw001940Pw001940 greyscalePw001940 simple
phospholipid biosynthesis (CL(14:0(3-OH)/17:0cycw7c/14:0(3-OH)/17:0cycw7c))PW001941 Pw001941Pw001941 greyscalePw001941 simple
phospholipid biosynthesis (CL(14:0(3-OH)/17:0cycw7c/14:0/14:0))PW001942 Pw001942Pw001942 greyscalePw001942 simple
phospholipid biosynthesis (CL(14:0/12:0(3-OH)/14:0/12:0(3-OH)))PW001943 Pw001943Pw001943 greyscalePw001943 simple
phospholipid biosynthesis (CL(14:0/14:0(3-OH)/14:0/14:0))PW001944 Pw001944Pw001944 greyscalePw001944 simple
phospholipid biosynthesis (CL(14:0/15:0cyclo/17:0cycw7c/14:0)PW001030 Pw001030Pw001030 greyscalePw001030 simple
phospholipid biosynthesis (CL(15:0/10:0(3-OH)/15:0/10:0(3-OH)))PW001945 Pw001945Pw001945 greyscalePw001945 simple
phospholipid biosynthesis (CL(15:0/12:0(3-OH)/15:0/12:0(3-OH)))PW001946 Pw001946Pw001946 greyscalePw001946 simple
phospholipid biosynthesis (CL(15:0/14:0(3-OH)/14:0/14:0))PW001947 Pw001947Pw001947 greyscalePw001947 simple
phospholipid biosynthesis (CL(15:0cyclo/10:0(3-OH)/15:0cyclo/10:0(3-OH)))PW001948 Pw001948Pw001948 greyscalePw001948 simple
phospholipid biosynthesis (CL(15:0cyclo/15:0cyclo/15:0cyclo/15:0cyclo))PW002015 Pw002015Pw002015 greyscalePw002015 simple
phospholipid biosynthesis (CL(15:0cyclo/15:0cyclo/18:1(9Z)/16:0))PW001713 Pw001713Pw001713 greyscalePw001713 simple
phospholipid biosynthesis (CL(15:0cyclo/15:0cyclo/18:1(9Z)/16:0)) 1442599180PW002016 Pw002016Pw002016 greyscalePw002016 simple
phospholipid biosynthesis (CL(15:0cyclo/15:0cyclo/19:0cycv8c/19:0cycv8c))PW001789 Pw001789Pw001789 greyscalePw001789 simple
phospholipid biosynthesis (CL(15:0cyclo/16:0/19:0cycv8c/15:0cyclo))PW001114 Pw001114Pw001114 greyscalePw001114 simple
phospholipid biosynthesis (CL(16:0/10:0(3-OH)/16:0/10:0(3-OH)))PW001949 Pw001949Pw001949 greyscalePw001949 simple
phospholipid biosynthesis (CL(16:0/12:0/12:0/12:0)) 2PW001952 Pw001952Pw001952 greyscalePw001952 simple
phospholipid biosynthesis (CL(16:0/14:0(3-OH)/16:0/14:0(3-OH)))PW001951 Pw001951Pw001951 greyscalePw001951 simple
phospholipid biosynthesis (CL(16:0/16:0/16:0/16:0))PW002010 Pw002010Pw002010 greyscalePw002010 simple
phospholipid biosynthesis (CL(16:1(9Z)/10:0/14:0/14:0))PW001954 Pw001954Pw001954 greyscalePw001954 simple
phospholipid biosynthesis (CL(16:1(9Z)/12:0/12:0/12:0))PW001955 Pw001955Pw001955 greyscalePw001955 simple
phospholipid biosynthesis (CL(16:1(9Z)/14:0(3-OH)/14:0/14:0))PW001957 Pw001957Pw001957 greyscalePw001957 simple
phospholipid biosynthesis (CL(16:1(9Z)/14:0(3-OH)/16:1(9Z)/14:0(3-OH)))PW001958 Pw001958Pw001958 greyscalePw001958 simple
phospholipid biosynthesis (CL(16:1(9Z)/17:0cycw7c/14:0/17:0cycw7c))PW001959 Pw001959Pw001959 greyscalePw001959 simple
phospholipid biosynthesis (CL(16:1(9Z)/18:1(9Z)/16:1(9Z)/14:0))PW001759 Pw001759Pw001759 greyscalePw001759 simple
phospholipid biosynthesis (CL(16:1(9Z)/19:0/14:0/14:0))PW001960 Pw001960Pw001960 greyscalePw001960 simple
phospholipid biosynthesis (CL(16:1(9Z)/19:0/16:0/16:0))PW001961 Pw001961Pw001961 greyscalePw001961 simple
phospholipid biosynthesis (CL(16:1(9Z)/19:0/16:1(9Z)/19:0))PW001962 Pw001962Pw001962 greyscalePw001962 simple
phospholipid biosynthesis (CL(16:1(9Z)/19:0cycv8c/16:1(9Z)/19:0cycv8c))PW002017 Pw002017Pw002017 greyscalePw002017 simple
phospholipid biosynthesis (CL(17:0/16:1(9Z)/14:0/14:0))PW001963 Pw001963Pw001963 greyscalePw001963 simple
phospholipid biosynthesis (CL(17:0/16:1(9Z)/16:0/16:0))PW001964 Pw001964Pw001964 greyscalePw001964 simple
phospholipid biosynthesis (CL(17:0cycw7c/10:0(3-OH)/10:0/10:0))PW001965 Pw001965Pw001965 greyscalePw001965 simple
phospholipid biosynthesis (CL(17:0cycw7c/10:0(3-OH)/14:0/14:0))PW001966 Pw001966Pw001966 greyscalePw001966 simple
phospholipid biosynthesis (CL(17:0cycw7c/10:0(3-OH)/17:0cycw7c/10:0(3-OH)))PW001967 Pw001967Pw001967 greyscalePw001967 simple
phospholipid biosynthesis (CL(17:0cycw7c/10:0/14:0/14:0))PW001968 Pw001968Pw001968 greyscalePw001968 simple
phospholipid biosynthesis (CL(17:0cycw7c/12:0(3-OH)/12:0/12:0))PW001969 Pw001969Pw001969 greyscalePw001969 simple
phospholipid biosynthesis (CL(17:0cycw7c/12:0(3-OH)/17:0cycw7c/12:0(3-OH)))PW001970 Pw001970Pw001970 greyscalePw001970 simple
phospholipid biosynthesis (CL(17:0cycw7c/12:0/12:0/12:0))PW001972 Pw001972Pw001972 greyscalePw001972 simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/14:0/17:0cycw7c))PW001692 Pw001692Pw001692 greyscalePw001692 simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/16:1(9Z)/14:0))PW001694 Pw001694Pw001694 greyscalePw001694 simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/17:0cycw7c/14:0))PW001695 Pw001695Pw001695 greyscalePw001695 simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/17:0cycw7c/16:1(9Z)))PW001696 Pw001696Pw001696 greyscalePw001696 simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/17:0cycw7c/17:0cycw7c))PW001697 Pw001697Pw001697 greyscalePw001697 simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/17:0cycw7c/18:1(9Z)))PW001698 Pw001698Pw001698 greyscalePw001698 simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/17:0cycw7c/19:0cycv8c))PW001699 Pw001699Pw001699 greyscalePw001699 simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/18:1(9Z)/17:0cycw7c))PW001700 Pw001700Pw001700 greyscalePw001700 simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/19:0cycv8c/17:0cycw7c))PW001701 Pw001701Pw001701 greyscalePw001701 simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/15:0cyclo))PW001702 Pw001702Pw001702 greyscalePw001702 simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/16:0))PW001703 Pw001703Pw001703 greyscalePw001703 simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/16:1(9Z)))PW001704 Pw001704Pw001704 greyscalePw001704 simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/17:0cycw7c))PW001705 Pw001705Pw001705 greyscalePw001705 simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/18:1(9Z)))PW001706 Pw001706Pw001706 greyscalePw001706 simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/19:0cycv8c))PW001707 Pw001707Pw001707 greyscalePw001707 simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/17:0cycw7c/14:0))PW001708 Pw001708Pw001708 greyscalePw001708 simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/17:0cycw7c/17:0cycw7c))PW001709 Pw001709Pw001709 greyscalePw001709 simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/14:0/14:0))PW001710 Pw001710Pw001710 greyscalePw001710 simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/14:0/17:0cycw7c))PW001711 Pw001711Pw001711 greyscalePw001711 simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/14:0/18:1(9Z)))PW001712 Pw001712Pw001712 greyscalePw001712 simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/17:0cycw7c/14:0))PW001464 Pw001464Pw001464 greyscalePw001464 simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/17:0cycw7c/17:0cycw7c))PW001465 Pw001465Pw001465 greyscalePw001465 simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/17:0cycw7c/18:1(9Z)))PW001466 Pw001466Pw001466 greyscalePw001466 simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/17:0cycw7c/19:0cycv8c))PW001467 Pw001467Pw001467 greyscalePw001467 simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/18:1(9Z)/14:0))PW001473 Pw001473Pw001473 greyscalePw001473 simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/19:0cycv8c/17:0cycw7c))PW001474 Pw001474Pw001474 greyscalePw001474 simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/14:0/14:0))PW001475 Pw001475Pw001475 greyscalePw001475 simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/14:0/17:0cycw7c))PW001476 Pw001476Pw001476 greyscalePw001476 simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/14:0/19:0cycv8c))PW001482 Pw001482Pw001482 greyscalePw001482 simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/17:0cycw7c/14:0))PW001483 Pw001483Pw001483 greyscalePw001483 simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/17:0cycw7c/19:0cycv8c))PW001484 Pw001484Pw001484 greyscalePw001484 simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/19:0cycv8c/14:0))PW001485 Pw001485Pw001485 greyscalePw001485 simple
phospholipid biosynthesis (CL(17:0cycw7c/19:iso/17:0cycw7c/19:iso))PW001973 Pw001973Pw001973 greyscalePw001973 simple
phospholipid biosynthesis (CL(18:0/10:0/10:0/10:0))PW001974 Pw001974Pw001974 greyscalePw001974 simple
phospholipid biosynthesis (CL(18:0/12:0/12:0/12:0))PW001975 Pw001975Pw001975 greyscalePw001975 simple
phospholipid biosynthesis (CL(18:1(11Z)/10:0/10:0/10:0))PW001976 Pw001976Pw001976 greyscalePw001976 simple
phospholipid biosynthesis (CL(18:1(11Z)/12:0/12:0/12:0))PW001977 Pw001977Pw001977 greyscalePw001977 simple
phospholipid biosynthesis (CL(18:1(11Z)/17:0/14:0/14:0))PW001978 Pw001978Pw001978 greyscalePw001978 simple
phospholipid biosynthesis (CL(18:1(11Z)/19:0/14:0/14:0))PW001979 Pw001979Pw001979 greyscalePw001979 simple
phospholipid biosynthesis (CL(18:1(11Z)/19:0/18:1(11Z)/19:0))PW001980 Pw001980Pw001980 greyscalePw001980 simple
phospholipid biosynthesis (CL(18:1(11Z)/19:0/19:0/19:0))PW001981 Pw001981Pw001981 greyscalePw001981 simple
phospholipid biosynthesis (CL(18:1(9Z)/12:0(3-OH)/18:1(9Z)/12:0(3-OH)))PW001982 Pw001982Pw001982 greyscalePw001982 simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/14:0/14:0))PW001493 Pw001493Pw001493 greyscalePw001493 simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/14:0/17:0cycw7c))PW001492 Pw001492Pw001492 greyscalePw001492 simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/14:0/18:1(9Z)))PW001494 Pw001494Pw001494 greyscalePw001494 simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/14:0/19:0cycv8c))PW001495 Pw001495Pw001495 greyscalePw001495 simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/17:0cycw7c/14:0))PW001498 Pw001498Pw001498 greyscalePw001498 simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/17:0cycw7c/17:0cycw7c))PW001499 Pw001499Pw001499 greyscalePw001499 simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/18:1(9Z)/14:0))PW001500 Pw001500Pw001500 greyscalePw001500 simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/19:0cycv8c/14:0))PW001502 Pw001502Pw001502 greyscalePw001502 simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/19:0cycv8c/19:0cycv8c) 2)PW001781 Pw001781Pw001781 greyscalePw001781 simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/19:0cycv8c/19:0cycv8c))PW001506 Pw001506Pw001506 greyscalePw001506 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/14:0/15:0cyclo) 5)PW001717 Pw001717Pw001717 greyscalePw001717 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/14:0/15:0cyclo))PW001507 Pw001507Pw001507 greyscalePw001507 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/14:0/18:1(9Z)))PW001514 Pw001514Pw001514 greyscalePw001514 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/15:0cyclo/14:0))PW001515 Pw001515Pw001515 greyscalePw001515 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/15:0cyclo/17:0cycw7c))PW001516 Pw001516Pw001516 greyscalePw001516 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/15:0cyclo/19:0cycv8c))PW001517 Pw001517Pw001517 greyscalePw001517 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/16:0/18:1(9Z)))PW001518 Pw001518Pw001518 greyscalePw001518 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/16:1(9Z)/18:1(9Z)))PW001519 Pw001519Pw001519 greyscalePw001519 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/17:0cycw7c/15:0cyclo))PW001527 Pw001527Pw001527 greyscalePw001527 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/17:0cycw7c/17:0cycw7c))PW001528 Pw001528Pw001528 greyscalePw001528 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/17:0cycw7c/18:1(9Z)))PW001529 Pw001529Pw001529 greyscalePw001529 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/14:0))PW001530 Pw001530Pw001530 greyscalePw001530 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/15:0cyclo))PW001531 Pw001531Pw001531 greyscalePw001531 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/16:0))PW001532 Pw001532Pw001532 greyscalePw001532 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/16:1(9Z)))PW001533 Pw001533Pw001533 greyscalePw001533 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/17:0cycw7c))PW001534 Pw001534Pw001534 greyscalePw001534 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/18:1(9Z)))PW001540 Pw001540Pw001540 greyscalePw001540 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/19:0cycv8c))PW001541 Pw001541Pw001541 greyscalePw001541 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/19:0cycv8c/15:0cyclo))PW001577 Pw001577Pw001577 greyscalePw001577 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/19:0cycv8c/18:1(9Z)))PW001578 Pw001578Pw001578 greyscalePw001578 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/19:0cycv8c/19:0cycv8c))PW001579 Pw001579Pw001579 greyscalePw001579 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/14:0/14:0))PW001580 Pw001580Pw001580 greyscalePw001580 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/14:0/16:0))PW001581 Pw001581Pw001581 greyscalePw001581 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/14:0/18:1(9Z)))PW001582 Pw001582Pw001582 greyscalePw001582 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/16:0/14:0))PW002011 Pw002011Pw002011 greyscalePw002011 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/16:0/17:0cycw7c))PW002012 Pw002012Pw002012 greyscalePw002012 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/16:0/19:0cycv8c) 2)PW001783 Pw001783Pw001783 greyscalePw001783 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/16:0/19:0cycv8c))PW001583 Pw001583Pw001583 greyscalePw001583 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/16:1(9Z)/18:1(9Z)))PW002013 Pw002013Pw002013 greyscalePw002013 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/17:0cycw7c/16:0))PW001584 Pw001584Pw001584 greyscalePw001584 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/17:0cycw7c/17:0cycw7c))PW001585 Pw001585Pw001585 greyscalePw001585 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/17:0cycw7c/18:1(9Z)))PW001586 Pw001586Pw001586 greyscalePw001586 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/14:0))PW001587 Pw001587Pw001587 greyscalePw001587 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/16:0))PW001588 Pw001588Pw001588 greyscalePw001588 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/16:1(9Z)))PW001594 Pw001594Pw001594 greyscalePw001594 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/17:0cycw7c))PW001595 Pw001595Pw001595 greyscalePw001595 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/18:1(9Z)))PW001596 Pw001596Pw001596 greyscalePw001596 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/19:0cycv8c))PW001597 Pw001597Pw001597 greyscalePw001597 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/19:0cycv8c/16:0))PW001598 Pw001598Pw001598 greyscalePw001598 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/19:0cycv8c/18:1(9Z)))PW001599 Pw001599Pw001599 greyscalePw001599 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/19:0cycv8c/19:0cycv8c))PW001600 Pw001600Pw001600 greyscalePw001600 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/14:0/14:0))PW001601 Pw001601Pw001601 greyscalePw001601 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/14:0/16:1(9Z)))PW001607 Pw001607Pw001607 greyscalePw001607 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/14:0/18:1(9Z)))PW001608 Pw001608Pw001608 greyscalePw001608 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/16:1(9Z)/14:0))PW001609 Pw001609Pw001609 greyscalePw001609 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/16:1(9Z)/17:0cycw7c))PW001610 Pw001610Pw001610 greyscalePw001610 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/16:1(9Z)/19:0cycv8c))PW001612 Pw001612Pw001612 greyscalePw001612 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/17:0cycw7c/16:1(9Z)))PW001613 Pw001613Pw001613 greyscalePw001613 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/17:0cycw7c/17:0cycw7c))PW001618 Pw001618Pw001618 greyscalePw001618 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/17:0cycw7c/18:1(9Z)))PW001619 Pw001619Pw001619 greyscalePw001619 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/18:1(9Z)/14:0))PW001620 Pw001620Pw001620 greyscalePw001620 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/18:1(9Z)/16:1(9Z)))PW001621 Pw001621Pw001621 greyscalePw001621 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/18:1(9Z)/17:0cycw7c))PW002014 Pw002014Pw002014 greyscalePw002014 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/18:1(9Z)/18:1(9Z)))PW001622 Pw001622Pw001622 greyscalePw001622 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/18:1(9Z)/19:0cycv8c))PW001623 Pw001623Pw001623 greyscalePw001623 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/19:0cycv8c/16:1(9Z)))PW001629 Pw001629Pw001629 greyscalePw001629 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/19:0cycv8c/18:1(9Z)) 2)PW001784 Pw001784Pw001784 greyscalePw001784 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/19:0cycv8c/18:1(9Z)))PW001630 Pw001630Pw001630 greyscalePw001630 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/19:0cycv8c/19:0cycv8c))PW001632 Pw001632Pw001632 greyscalePw001632 simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/14:0/14:0))PW001633 Pw001633Pw001633 greyscalePw001633 simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/14:0/17:0cycw7c))PW001634 Pw001634Pw001634 greyscalePw001634 simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/14:0/18:1(9Z)))PW001635 Pw001635Pw001635 greyscalePw001635 simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/17:0cycw7c/14:0))PW001638 Pw001638Pw001638 greyscalePw001638 simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/17:0cycw7c/17:0cycw7c))PW001640 Pw001640Pw001640 greyscalePw001640 simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/17:0cycw7c/18:1(9Z)))PW001644 Pw001644Pw001644 greyscalePw001644 simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/17:0cycw7c/19:0cycv8c))PW001645 Pw001645Pw001645 greyscalePw001645 simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/18:1(9Z)/14:0))PW001646 Pw001646Pw001646 greyscalePw001646 simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/18:1(9Z)/17:0cycw7c))PW001647 Pw001647Pw001647 greyscalePw001647 simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/19:0cycv8c/17:0cycw7c))PW001648 Pw001648Pw001648 greyscalePw001648 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/14:0))PW001649 Pw001649Pw001649 greyscalePw001649 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/15:0cyclo))PW001664 Pw001664Pw001664 greyscalePw001664 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/16:0))PW001665 Pw001665Pw001665 greyscalePw001665 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/16:1(9Z)))PW001666 Pw001666Pw001666 greyscalePw001666 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/17:0cycw7c))PW001667 Pw001667Pw001667 greyscalePw001667 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/18:1(9Z)))PW001668 Pw001668Pw001668 greyscalePw001668 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/19:0cycv8c))PW001669 Pw001669Pw001669 greyscalePw001669 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/14:0))PW001670 Pw001670Pw001670 greyscalePw001670 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/15:0cyclo))PW001671 Pw001671Pw001671 greyscalePw001671 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/16:0))PW001672 Pw001672Pw001672 greyscalePw001672 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/16:1(9Z)))PW001673 Pw001673Pw001673 greyscalePw001673 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/17:0cycw7c))PW001679 Pw001679Pw001679 greyscalePw001679 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/18:1(9Z)))PW001680 Pw001680Pw001680 greyscalePw001680 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/19:0cycv8c))PW001685 Pw001685Pw001685 greyscalePw001685 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/18:1(9Z)/14:0))PW001686 Pw001686Pw001686 greyscalePw001686 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/18:1(9Z)/17:0cycw7c))PW001687 Pw001687Pw001687 greyscalePw001687 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/18:1(9Z)/19:0cycv8c))PW001026 Pw001026Pw001026 greyscalePw001026 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/18:1(9Z)/19:0cycv8c)) 1440195714PW001034 Pw001034Pw001034 greyscalePw001034 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/18:1(9Z)/19:0cycv8c)) 2PW001186 Pw001186Pw001186 greyscalePw001186 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/14:0))PW001688 Pw001688Pw001688 greyscalePw001688 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/15:0cyclo))PW001185 Pw001185Pw001185 greyscalePw001185 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/16:0))PW001194 Pw001194Pw001194 greyscalePw001194 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/16:0)) 1442332377PW001956 Pw001956Pw001956 greyscalePw001956 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/16:1(9Z))PW001212 Pw001212Pw001212 greyscalePw001212 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/17:0cycw7c))PW001210 Pw001210Pw001210 greyscalePw001210 simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/14:0/14:0))PW001211 Pw001211Pw001211 greyscalePw001211 simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/14:0/18:1(9Z)))PW001233 Pw001233Pw001233 greyscalePw001233 simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/14:0/19:0cycv8c))PW001234 Pw001234Pw001234 greyscalePw001234 simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/17:0cycw7c/17:0cycw7c))PW001240 Pw001240Pw001240 greyscalePw001240 simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/17:0cycw7c/18:1(9Z)))PW001241 Pw001241Pw001241 greyscalePw001241 simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/18:1(9Z)/14:0))PW001244 Pw001244Pw001244 greyscalePw001244 simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/18:1(9Z)/17:0cycw7c))PW001248 Pw001248Pw001248 greyscalePw001248 simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/19:0cycv8c/14:0))PW001249 Pw001249Pw001249 greyscalePw001249 simple
phospholipid biosynthesis (CL(18:1/18:1/18:1/18:1))PW001027 Pw001027Pw001027 greyscalePw001027 simple
phospholipid biosynthesis (CL(19:0/16:1(9Z)/14:0/14:0))PW001983 Pw001983Pw001983 greyscalePw001983 simple
phospholipid biosynthesis (CL(19:0/16:1(9Z)/16:0/16:0))PW001984 Pw001984Pw001984 greyscalePw001984 simple
phospholipid biosynthesis (CL(19:0/16:1(9Z)/19:0/16:1(9Z)))PW001985 Pw001985Pw001985 greyscalePw001985 simple
phospholipid biosynthesis (CL(19:0/18:1(11Z)/14:0/14:0))PW001986 Pw001986Pw001986 greyscalePw001986 simple
phospholipid biosynthesis (CL(19:0/18:1(11Z)/19:0/18:1(11Z)))PW001987 Pw001987Pw001987 greyscalePw001987 simple
phospholipid biosynthesis (CL(19:0/18:1(11Z)/19:0/19:0))PW001988 Pw001988Pw001988 greyscalePw001988 simple
phospholipid biosynthesis (CL(19:0cycv8c/10:0(3-OH)/10:0/10:0))PW001989 Pw001989Pw001989 greyscalePw001989 simple
phospholipid biosynthesis (CL(19:0cycv8c/10:0(3-OH)/19:0cycv8c/10:0(3-OH)))PW001991 Pw001991Pw001991 greyscalePw001991 simple
phospholipid biosynthesis (CL(19:0cycv8c/12:0(3-OH)/12:0/12:0))PW001992 Pw001992Pw001992 greyscalePw001992 simple
phospholipid biosynthesis (CL(19:0cycv8c/12:0(3-OH)/19:0cycv8c/12:0(3-OH)))PW001993 Pw001993Pw001993 greyscalePw001993 simple
phospholipid biosynthesis (CL(19:0cycv8c/14:0/14:0/17:0cycw7c))PW001251 Pw001251Pw001251 greyscalePw001251 simple
phospholipid biosynthesis (CL(19:0cycv8c/14:0/14:0/19:0cycv8c))PW001253 Pw001253Pw001253 greyscalePw001253 simple
phospholipid biosynthesis (CL(19:0cycv8c/14:0/17:0cycw7c/14:0))PW001262 Pw001262Pw001262 greyscalePw001262 simple
phospholipid biosynthesis (CL(19:0cycv8c/14:0/17:0cycw7c/17:0cycw7c))PW001263 Pw001263Pw001263 greyscalePw001263 simple
phospholipid biosynthesis (CL(19:0cycv8c/14:0/19:0cycv8c/14:0))PW001275 Pw001275Pw001275 greyscalePw001275 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/14:0/15:0cyclo))PW001276 Pw001276Pw001276 greyscalePw001276 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/14:0/19:0cycv8c))PW001291 Pw001291Pw001291 greyscalePw001291 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/15:0cyclo/14:0))PW001292 Pw001292Pw001292 greyscalePw001292 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/15:0cyclo/17:0cycw7c))PW001298 Pw001298Pw001298 greyscalePw001298 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/16:0/19:0cycv8c))PW001299 Pw001299Pw001299 greyscalePw001299 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/16:1(9Z)/19:0cycv8c))PW001300 Pw001300Pw001300 greyscalePw001300 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/17:0cycw7c/15:0cyclo))PW001301 Pw001301Pw001301 greyscalePw001301 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/17:0cycw7c/17:0cycw7c))PW001302 Pw001302Pw001302 greyscalePw001302 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/18:1(9Z)/19:0cycv8c))PW001304 Pw001304Pw001304 greyscalePw001304 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/14:0))PW001309 Pw001309Pw001309 greyscalePw001309 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/15:0cyclo))PW001310 Pw001310Pw001310 greyscalePw001310 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/16:0))PW001316 Pw001316Pw001316 greyscalePw001316 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/16:1(9Z)))PW001317 Pw001317Pw001317 greyscalePw001317 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/18:1(9Z)))PW001318 Pw001318Pw001318 greyscalePw001318 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/19:0cycv8c))PW001319 Pw001319Pw001319 greyscalePw001319 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/14:0/14:0))PW001320 Pw001320Pw001320 greyscalePw001320 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/14:0/16:0))PW001321 Pw001321Pw001321 greyscalePw001321 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/14:0/19:0cycv8c))PW001322 Pw001322Pw001322 greyscalePw001322 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/16:0/14:0))PW001323 Pw001323Pw001323 greyscalePw001323 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/16:0/17:0cycw7c))PW001324 Pw001324Pw001324 greyscalePw001324 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/16:1(9Z)/19:0cycv8c))PW001326 Pw001326Pw001326 greyscalePw001326 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/17:0cycw7c/16:0))PW001331 Pw001331Pw001331 greyscalePw001331 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/17:0cycw7c/17:0cycw7c))PW001332 Pw001332Pw001332 greyscalePw001332 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/17:0cycw7c/19:0cycv8c))PW001333 Pw001333Pw001333 greyscalePw001333 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/18:1(9Z)/19:0cycv8c))PW001334 Pw001334Pw001334 greyscalePw001334 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/19:0cycv8c/14:0))PW001340 Pw001340Pw001340 greyscalePw001340 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/19:0cycv8c/16:1(9Z)))PW001341 Pw001341Pw001341 greyscalePw001341 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/19:0cycv8c/17:0cycw7c))PW001372 Pw001372Pw001372 greyscalePw001372 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/19:0cycv8c/18:1(9Z)))PW001373 Pw001373Pw001373 greyscalePw001373 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/14:0/14:0))PW001374 Pw001374Pw001374 greyscalePw001374 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/14:0/16:1(9Z)))PW001375 Pw001375Pw001375 greyscalePw001375 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/14:0/19:0cycv8c))PW001376 Pw001376Pw001376 greyscalePw001376 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/16:1(9Z)/14:0))PW001377 Pw001377Pw001377 greyscalePw001377 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/16:1(9Z)/17:0cycw7c))PW001383 Pw001383Pw001383 greyscalePw001383 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/17:0cycw7c/16:1(9Z)))PW001384 Pw001384Pw001384 greyscalePw001384 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/17:0cycw7c/17:0cycw7c))PW001385 Pw001385Pw001385 greyscalePw001385 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/17:0cycw7c/19:0cycv8c))PW001386 Pw001386Pw001386 greyscalePw001386 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/18:1(9Z)/19:0cycv8c))PW001387 Pw001387Pw001387 greyscalePw001387 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/19:0cycv8c/14:0))PW001388 Pw001388Pw001388 greyscalePw001388 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/19:0cycv8c/16:1(9Z)))PW001394 Pw001394Pw001394 greyscalePw001394 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/19:0cycv8c/17:0cycw7c))PW001395 Pw001395Pw001395 greyscalePw001395 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/19:0cycv8c/18:1(9Z)))PW001396 Pw001396Pw001396 greyscalePw001396 simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/14:0/14:0))PW001397 Pw001397Pw001397 greyscalePw001397 simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/14:0/17:0cycw7c))PW001403 Pw001403Pw001403 greyscalePw001403 simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/14:0/19:0cycv8c))PW001404 Pw001404Pw001404 greyscalePw001404 simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/17:0cycw7c/14:0))PW001405 Pw001405Pw001405 greyscalePw001405 simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/17:0cycw7c/19:0cycv8c))PW001406 Pw001406Pw001406 greyscalePw001406 simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/19:0cycv8c/14:0))PW001407 Pw001407Pw001407 greyscalePw001407 simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/19:0cycv8c/17:0cycw7c))PW001408 Pw001408Pw001408 greyscalePw001408 simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/14:0/14:0))PW001414 Pw001414Pw001414 greyscalePw001414 simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/14:0/18:1(9Z)))PW001415 Pw001415Pw001415 greyscalePw001415 simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/14:0/19:0cycv8c))PW001420 Pw001420Pw001420 greyscalePw001420 simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/17:0cycw7c/17:0cycw7c))PW001422 Pw001422Pw001422 greyscalePw001422 simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/17:0cycw7c/18:1(9Z)))PW001423 Pw001423Pw001423 greyscalePw001423 simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/18:1(9Z)/14:0))PW001424 Pw001424Pw001424 greyscalePw001424 simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/18:1(9Z)/17:0cycw7c))PW001426 Pw001426Pw001426 greyscalePw001426 simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/19:0cycv8c/14:0))PW001428 Pw001428Pw001428 greyscalePw001428 simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/14:0))PW001432 Pw001432Pw001432 greyscalePw001432 simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/15:0cyclo))PW001433 Pw001433Pw001433 greyscalePw001433 simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/16:0))PW001434 Pw001434Pw001434 greyscalePw001434 simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/16:1(9Z)))PW001435 Pw001435Pw001435 greyscalePw001435 simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/17:0cycw7c))PW001436 Pw001436Pw001436 greyscalePw001436 simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/18:1(9Z)))PW001438 Pw001438Pw001438 greyscalePw001438 simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/19:0cycv8c))PW001443 Pw001443Pw001443 greyscalePw001443 simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/17:0cycw7c/14:0))PW001444 Pw001444Pw001444 greyscalePw001444 simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/17:0cycw7c/16:0))PW001445 Pw001445Pw001445 greyscalePw001445 simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/17:0cycw7c/16:1(9Z)))PW001446 Pw001446Pw001446 greyscalePw001446 simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/17:0cycw7c/17:0cycw7c))PW001447 Pw001447Pw001447 greyscalePw001447 simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/19:0cycv8c/14:0))PW001448 Pw001448Pw001448 greyscalePw001448 simple
phospholipid biosynthesis (CL(19:0cycw8c/10:0/10:0/10:0))PW001994 Pw001994Pw001994 greyscalePw001994 simple
phospholipid biosynthesis (CL(19:1(9Z)/16:1(9Z)/19:1(9Z)/16:1(9Z)))PW001995 Pw001995Pw001995 greyscalePw001995 simple
phospholipid biosynthesis (CL(19:iso/10:0(3-OH)/10:0/10:0))PW001996 Pw001996Pw001996 greyscalePw001996 simple
phospholipid biosynthesis (CL(19:iso/10:0(3-OH)/19:iso/10:0(3-OH)))PW001997 Pw001997Pw001997 greyscalePw001997 simple
phospholipid biosynthesis (CL(19:iso/10:0/19:iso/10:0))PW001998 Pw001998Pw001998 greyscalePw001998 simple
phospholipid biosynthesis (CL(19:iso/12:0(3-OH)/12:0/12:0))PW001999 Pw001999Pw001999 greyscalePw001999 simple
phospholipid biosynthesis (CL(19:iso/12:0(3-OH)/19:iso/12:0(3-OH)))PW002000 Pw002000Pw002000 greyscalePw002000 simple
phospholipid biosynthesis (CL(19:iso/12:0/19:iso/12:0))PW002001 Pw002001Pw002001 greyscalePw002001 simple
phospholipid biosynthesis (CL(19:iso/14:0(3-OH)/14:0/14:0))PW002002 Pw002002Pw002002 greyscalePw002002 simple
phospholipid biosynthesis (CL(19:iso/14:0(3-OH)/19:iso/14:0(3-OH)))PW002004 Pw002004Pw002004 greyscalePw002004 simple
phospholipid biosynthesis (CL(19:iso/14:0/14:0/14:0))PW002005 Pw002005Pw002005 greyscalePw002005 simple
phospholipid biosynthesis (CL(19:iso/14:0/19:iso/14:0))PW002006 Pw002006Pw002006 greyscalePw002006 simple
phospholipid biosynthesis (CL(19:iso/17:0cycw7c/19:0/19:0))PW002007 Pw002007Pw002007 greyscalePw002007 simple
phospholipid biosynthesis (CL(19:iso/19:0cycv8c/19:0/19:0))PW002008 Pw002008Pw002008 greyscalePw002008 simple
phospholipid biosynthesis (CL(19:iso/19:iso/19:iso/19:iso))PW002009 Pw002009Pw002009 greyscalePw002009 simple
phospholipid biosynthesis (PE(16:0/10:0(3-OH)))PW001741 Pw001741Pw001741 greyscalePw001741 simple
phospholipid biosynthesis (PE(16:0/12:0(3-OH)))PW001744 Pw001744Pw001744 greyscalePw001744 simple
phospholipid biosynthesis (PE(16:0/18:0))PW001748 Pw001748Pw001748 greyscalePw001748 simple
phospholipid biosynthesis (PE(16:0/19:iso))PW001751 Pw001751Pw001751 greyscalePw001751 simple
phospholipid biosynthesis (PE(16:1(9Z)/10:0(3-OH)))PW001753 Pw001753Pw001753 greyscalePw001753 simple
phospholipid biosynthesis (PE(16:1(9Z)/12:0(3-OH)))PW001755 Pw001755Pw001755 greyscalePw001755 simple
phospholipid biosynthesis (PE(16:1(9Z)/18:0))PW001758 Pw001758Pw001758 greyscalePw001758 simple
phospholipid biosynthesis (PE(16:1(9Z)/19:iso))PW001760 Pw001760Pw001760 greyscalePw001760 simple
phospholipid biosynthesis (PE(18:0/14:0))PW001765 Pw001765Pw001765 greyscalePw001765 simple
phospholipid biosynthesis (PE(18:0/16:0))PW001767 Pw001767Pw001767 greyscalePw001767 simple
phospholipid biosynthesis (PE(18:0/16:1(9Z)))PW001770 Pw001770Pw001770 greyscalePw001770 simple
phospholipid biosynthesis (PE(18:0/18:0))PW001772 Pw001772Pw001772 greyscalePw001772 simple
phospholipid biosynthesis (PE(18:0/18:1(9Z)))PW001774 Pw001774Pw001774 greyscalePw001774 simple
phospholipid biosynthesis (PE(18:1(9Z)/10:0(3-OH)))PW001779 Pw001779Pw001779 greyscalePw001779 simple
phospholipid biosynthesis (PE(18:1(9Z)/12:0(3-OH)))PW001780 Pw001780Pw001780 greyscalePw001780 simple
phospholipid biosynthesis (PE(19:iso/10:0))PW001786 Pw001786Pw001786 greyscalePw001786 simple
phospholipid biosynthesis (PE(19:iso/12:0))PW001787 Pw001787Pw001787 greyscalePw001787 simple
phospholipid biosynthesis CDP-DG(10:0/10:0) IPW001743 Pw001743Pw001743 greyscalePw001743 simple
phospholipid biosynthesis CDP-DG(10:0/10:0) IIPW001815 Pw001815Pw001815 greyscalePw001815 simple
phospholipid biosynthesis CDP-DG(10:0/10:0) IIIPW001816 Pw001816Pw001816 greyscalePw001816 simple
phospholipid biosynthesis CDP-DG(10:0/10:0) IVPW001817 Pw001817Pw001817 greyscalePw001817 simple
phospholipid biosynthesis CDP-DG(10:0/12:0)PW001746 Pw001746Pw001746 greyscalePw001746 simple
phospholipid biosynthesis CDP-DG(10:0/12:0) IIPW001818 Pw001818Pw001818 greyscalePw001818 simple
phospholipid biosynthesis CDP-DG(10:0/12:0) IIIPW001819 Pw001819Pw001819 greyscalePw001819 simple
phospholipid biosynthesis CDP-DG(10:0/12:0) IVPW001820 Pw001820Pw001820 greyscalePw001820 simple
phospholipid biosynthesis CDP-DG(10:0/14:0)PW001747 Pw001747Pw001747 greyscalePw001747 simple
phospholipid biosynthesis CDP-DG(10:0/14:0) IIPW001821 Pw001821Pw001821 greyscalePw001821 simple
phospholipid biosynthesis CDP-DG(10:0/14:0) IIIPW001822 Pw001822Pw001822 greyscalePw001822 simple
phospholipid biosynthesis CDP-DG(10:0/14:0) IVPW001823 Pw001823Pw001823 greyscalePw001823 simple
phospholipid biosynthesis CDP-DG(10:0/15:0)PW001749 Pw001749Pw001749 greyscalePw001749 simple
phospholipid biosynthesis CDP-DG(10:0/15:0) IIPW001826 Pw001826Pw001826 greyscalePw001826 simple
phospholipid biosynthesis CDP-DG(10:0/15:0) IIIPW001825 Pw001825Pw001825 greyscalePw001825 simple
phospholipid biosynthesis CDP-DG(10:0/16:0)PW001750 Pw001750Pw001750 greyscalePw001750 simple
phospholipid biosynthesis CDP-DG(10:0/16:0) IIPW001827 Pw001827Pw001827 greyscalePw001827 simple
phospholipid biosynthesis CDP-DG(10:0/16:1(9Z))PW001752 Pw001752Pw001752 greyscalePw001752 simple
phospholipid biosynthesis CDP-DG(10:0/16:1(9Z)) IIPW001828 Pw001828Pw001828 greyscalePw001828 simple
phospholipid biosynthesis CDP-DG(10:0/18:0)PW001754 Pw001754Pw001754 greyscalePw001754 simple
phospholipid biosynthesis CDP-DG(10:0/18:0) IIIPW001833 Pw001833Pw001833 greyscalePw001833 simple
phospholipid biosynthesis CDP-DG(10:0/18:1(9Z))PW001756 Pw001756Pw001756 greyscalePw001756 simple
phospholipid biosynthesis CDP-DG(10:0/19:1(9Z))PW001763 Pw001763Pw001763 greyscalePw001763 simple
phospholipid biosynthesis CDP-DG(10:0/19:1(9Z)) IIPW001829 Pw001829Pw001829 greyscalePw001829 simple
phospholipid biosynthesis CDP-DG(10:0/19:1(9Z)) IIIPW001830 Pw001830Pw001830 greyscalePw001830 simple
phospholipid biosynthesis CDP-DG(10:0/19:1(9Z)) IVPW001831 Pw001831Pw001831 greyscalePw001831 simple
phospholipid biosynthesis CDP-DG(10:0/19:1(9Z)) VPW001832 Pw001832Pw001832 greyscalePw001832 simple
phospholipid biosynthesis CDP-DG(12:0/10:0)PW001764 Pw001764Pw001764 greyscalePw001764 simple
phospholipid biosynthesis CDP-DG(12:0/10:0) IIPW001834 Pw001834Pw001834 greyscalePw001834 simple
phospholipid biosynthesis CDP-DG(12:0/10:0) IIIPW001835 Pw001835Pw001835 greyscalePw001835 simple
phospholipid biosynthesis CDP-DG(12:0/10:0) IVPW001844 Pw001844Pw001844 greyscalePw001844 simple
phospholipid biosynthesis CDP-DG(12:0/14:0)PW001768 Pw001768Pw001768 greyscalePw001768 simple
phospholipid biosynthesis CDP-DG(12:0/14:0) IIPW001836 Pw001836Pw001836 greyscalePw001836 simple
phospholipid biosynthesis CDP-DG(12:0/14:0) IIIPW001837 Pw001837Pw001837 greyscalePw001837 simple
phospholipid biosynthesis CDP-DG(12:0/14:0) IVPW001840 Pw001840Pw001840 greyscalePw001840 simple
phospholipid biosynthesis CDP-DG(12:0/15:0)PW001769 Pw001769Pw001769 greyscalePw001769 simple
phospholipid biosynthesis CDP-DG(12:0/15:0) IIPW001838 Pw001838Pw001838 greyscalePw001838 simple
phospholipid biosynthesis CDP-DG(12:0/15:0) IIIPW001839 Pw001839Pw001839 greyscalePw001839 simple
phospholipid biosynthesis CDP-DG(12:0/16:0)PW001771 Pw001771Pw001771 greyscalePw001771 simple
phospholipid biosynthesis CDP-DG(12:0/16:0) IIPW001841 Pw001841Pw001841 greyscalePw001841 simple
phospholipid biosynthesis CDP-DG(12:0/16:1(9Z))PW001773 Pw001773Pw001773 greyscalePw001773 simple
phospholipid biosynthesis CDP-DG(12:0/16:1(9Z)) IIPW001842 Pw001842Pw001842 greyscalePw001842 simple
phospholipid biosynthesis CDP-DG(12:0/18:0)PW001775 Pw001775Pw001775 greyscalePw001775 simple
phospholipid biosynthesis CDP-DG(12:0/18:1(9Z))PW001777 Pw001777Pw001777 greyscalePw001777 simple
phospholipid biosynthesis CDP-DG(12:0/18:1(9Z)) IIPW001843 Pw001843Pw001843 greyscalePw001843 simple
phospholipid biosynthesis CDP-DG(12:0/19:1(9Z))PW001778 Pw001778Pw001778 greyscalePw001778 simple
phospholipid biosynthesis CDP-DG(12:0/19:1(9Z)) IIPW001848 Pw001848Pw001848 greyscalePw001848 simple
phospholipid biosynthesis CDP-DG(12:0/19:1(9Z)) IIIPW001847 Pw001847Pw001847 greyscalePw001847 simple
phospholipid biosynthesis CDP-DG(12:0/19:1(9Z)) IVPW001846 Pw001846Pw001846 greyscalePw001846 simple
phospholipid biosynthesis CDP-DG(12:0/19:1(9Z)) VPW001845 Pw001845Pw001845 greyscalePw001845 simple
phospholipid biosynthesis CDP-DG(14:0/10:0)PW001793 Pw001793Pw001793 greyscalePw001793 simple
phospholipid biosynthesis CDP-DG(14:0/10:0) IIPW001852 Pw001852Pw001852 greyscalePw001852 simple
phospholipid biosynthesis CDP-DG(14:0/10:0) IIIPW001851 Pw001851Pw001851 greyscalePw001851 simple
phospholipid biosynthesis CDP-DG(14:0/10:0) IVPW001850 Pw001850Pw001850 greyscalePw001850 simple
phospholipid biosynthesis CDP-DG(14:0/12:0)PW001794 Pw001794Pw001794 greyscalePw001794 simple
phospholipid biosynthesis CDP-DG(14:0/12:0) IIPW001855 Pw001855Pw001855 greyscalePw001855 simple
phospholipid biosynthesis CDP-DG(14:0/12:0) IIIPW001854 Pw001854Pw001854 greyscalePw001854 simple
phospholipid biosynthesis CDP-DG(14:0/12:0) IVPW001853 Pw001853Pw001853 greyscalePw001853 simple
phospholipid biosynthesis CDP-DG(14:0/15:0)PW001795 Pw001795Pw001795 greyscalePw001795 simple
phospholipid biosynthesis CDP-DG(14:0/15:0) IIPW001857 Pw001857Pw001857 greyscalePw001857 simple
phospholipid biosynthesis CDP-DG(14:0/18:0)PW001802 Pw001802Pw001802 greyscalePw001802 simple
phospholipid biosynthesis CDP-DG(14:0/18:1(9Z))PW001803 Pw001803Pw001803 greyscalePw001803 simple
phospholipid biosynthesis CDP-DG(14:0/19:1(9Z))PW001804 Pw001804Pw001804 greyscalePw001804 simple
phospholipid biosynthesis CDP-DG(14:0/19:1(9Z)) IIPW001858 Pw001858Pw001858 greyscalePw001858 simple
phospholipid biosynthesis CDP-DG(15:0/10:0)PW001805 Pw001805Pw001805 greyscalePw001805 simple
phospholipid biosynthesis CDP-DG(15:0/10:0) IIPW001859 Pw001859Pw001859 greyscalePw001859 simple
phospholipid biosynthesis CDP-DG(15:0/12:0)PW001806 Pw001806Pw001806 greyscalePw001806 simple
phospholipid biosynthesis CDP-DG(15:0/12:0) IIPW001861 Pw001861Pw001861 greyscalePw001861 simple
phospholipid biosynthesis CDP-DG(15:0/12:0) IIIPW001862 Pw001862Pw001862 greyscalePw001862 simple
phospholipid biosynthesis CDP-DG(15:0/14:0)PW001807 Pw001807Pw001807 greyscalePw001807 simple
phospholipid biosynthesis CDP-DG(15:0/15:0)PW001808 Pw001808Pw001808 greyscalePw001808 simple
phospholipid biosynthesis CDP-DG(15:0/16:0)PW001809 Pw001809Pw001809 greyscalePw001809 simple
phospholipid biosynthesis CDP-DG(15:0/16:1(9Z))PW001810 Pw001810Pw001810 greyscalePw001810 simple
phospholipid biosynthesis CDP-DG(15:0/18:0)PW001811 Pw001811Pw001811 greyscalePw001811 simple
phospholipid biosynthesis CDP-DG(15:0/18:1(9Z))PW001812 Pw001812Pw001812 greyscalePw001812 simple
phospholipid biosynthesis CDP-DG(15:0/19:1(9Z))PW001813 Pw001813Pw001813 greyscalePw001813 simple
phospholipid biosynthesis CDP-DG(16:0/10:0)PW001814 Pw001814Pw001814 greyscalePw001814 simple
phospholipid biosynthesis CL(14:0/15:0cyclo/14:0/17:0cycw7c)PW001029 Pw001029Pw001029 greyscalePw001029 simple
phospholipid biosynthesis CL(14:0/16:0/14:0/14:0)PW001031 Pw001031Pw001031 greyscalePw001031 simple
phospholipid biosynthesis CL(14:0/16:0/14:0/16:0)PW001032 Pw001032Pw001032 greyscalePw001032 simple
phospholipid biosynthesis CL(14:0/16:0/14:0/16:1(9Z))PW001871 Pw001871Pw001871 greyscalePw001871 simple
phospholipid biosynthesis CL(14:0/16:0/14:0/18:1(9Z))PW001033 Pw001033Pw001033 greyscalePw001033 simple
phospholipid biosynthesis CL(14:0/16:0/14:0/19:0cycv8c)PW001035 Pw001035Pw001035 greyscalePw001035 simple
phospholipid biosynthesis CL(14:0/16:0/16:1(9Z)/14:0)PW001036 Pw001036Pw001036 greyscalePw001036 simple
phospholipid biosynthesis CL(14:0/16:0/18:1(9Z)/14:0)PW001037 Pw001037Pw001037 greyscalePw001037 simple
phospholipid biosynthesis CL(14:0/16:0/19:0cycv8c/14:0)PW001038 Pw001038Pw001038 greyscalePw001038 simple
phospholipid biosynthesis CL(14:0/16:1(9Z)/14:0/16:1(9Z))PW001039 Pw001039Pw001039 greyscalePw001039 simple
phospholipid biosynthesis CL(14:0/16:1(9Z)/14:0/18:1(9Z))PW001040 Pw001040Pw001040 greyscalePw001040 simple
phospholipid biosynthesis CL(14:0/16:1(9Z)/14:0/19:0cycv8c)PW001041 Pw001041Pw001041 greyscalePw001041 simple
phospholipid biosynthesis CL(14:0/16:1(9Z)/18:1(9Z)/14:0)PW001042 Pw001042Pw001042 greyscalePw001042 simple
phospholipid biosynthesis CL(14:0/16:1(9Z)/19:0cycv8c/14:0)PW001043 Pw001043Pw001043 greyscalePw001043 simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/14:0/14:0)PW001044 Pw001044Pw001044 greyscalePw001044 simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/14:0/17:0cycw7c)PW001045 Pw001045Pw001045 greyscalePw001045 simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/14:0/18:1(9Z))PW001046 Pw001046Pw001046 greyscalePw001046 simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/14:0/19:0cycv8c)PW001047 Pw001047Pw001047 greyscalePw001047 simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/17:0cycw7c/14:0)PW001048 Pw001048Pw001048 greyscalePw001048 simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/19:0cycv8c/14:0)PW001049 Pw001049Pw001049 greyscalePw001049 simple
phospholipid biosynthesis CL(14:0/19:0cycv8c/14:0/17:0cycw7c)PW001050 Pw001050Pw001050 greyscalePw001050 simple
phospholipid biosynthesis CL(14:0/19:0cycv8c/14:0/19:0cycv8c)PW001051 Pw001051Pw001051 greyscalePw001051 simple
phospholipid biosynthesis CL(14:0/19:0cycv8c/17:0cycw7c/14:0)PW001052 Pw001052Pw001052 greyscalePw001052 simple
phospholipid biosynthesis CL(15:0cyclo/14:0/14:0/17:0cycw7c)PW001053 Pw001053Pw001053 greyscalePw001053 simple
phospholipid biosynthesis CL(15:0cyclo/14:0/16:1(9Z)/16:1(9Z))PW001054 Pw001054Pw001054 greyscalePw001054 simple
phospholipid biosynthesis CL(15:0cyclo/14:0/17:0cycw7c/14:0)PW001055 Pw001055Pw001055 greyscalePw001055 simple
phospholipid biosynthesis CL(15:0cyclo/14:0/17:0cycw7c/17:0cycw7c)PW001056 Pw001056Pw001056 greyscalePw001056 simple
phospholipid biosynthesis CL(15:0cyclo/14:0/18:1(9Z)/18:1(9Z))PW001057 Pw001057Pw001057 greyscalePw001057 simple
phospholipid biosynthesis CL(15:0cyclo/14:0/19:0cycv8c/19:0cycv8c)PW001058 Pw001058Pw001058 greyscalePw001058 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/14:0/16:0)PW001059 Pw001059Pw001059 greyscalePw001059 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/14:0/16:1(9Z))PW001060 Pw001060Pw001060 greyscalePw001060 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/14:0/18:1(9Z))PW001061 Pw001061Pw001061 greyscalePw001061 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/14:0/19:0cycv8c)PW001062 Pw001062Pw001062 greyscalePw001062 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:0/14:0)PW001066 Pw001066Pw001066 greyscalePw001066 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:0/16:1(9Z))PW001063 Pw001063Pw001063 greyscalePw001063 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:0/17:0cycw7c)PW001067 Pw001067Pw001067 greyscalePw001067 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:0/18:1(9Z))PW001069 Pw001069Pw001069 greyscalePw001069 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:0/19:0cycv8c)PW001070 Pw001070Pw001070 greyscalePw001070 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:1(9Z)/14:0)PW001071 Pw001071Pw001071 greyscalePw001071 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:1(9Z)/16:0)PW001072 Pw001072Pw001072 greyscalePw001072 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:1(9Z)/16:1(9Z))PW001068 Pw001068Pw001068 greyscalePw001068 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:1(9Z)/17:0cycw7c)PW001073 Pw001073Pw001073 greyscalePw001073 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:1(9Z)/18:1(9Z))PW001074 Pw001074Pw001074 greyscalePw001074 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:1(9Z)/19:0cycv8c)PW001075 Pw001075Pw001075 greyscalePw001075 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/17:0cycw7c/16:0)PW001076 Pw001076Pw001076 greyscalePw001076 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/17:0cycw7c/16:1(9Z))PW001077 Pw001077Pw001077 greyscalePw001077 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/17:0cycw7c/17:0cycw7c)PW001078 Pw001078Pw001078 greyscalePw001078 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/17:0cycw7c/18:1(9Z))PW001079 Pw001079Pw001079 greyscalePw001079 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/17:0cycw7c/19:0cycv8c)PW001080 Pw001080Pw001080 greyscalePw001080 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/18:1(9Z)/14:0)PW001081 Pw001081Pw001081 greyscalePw001081 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/18:1(9Z)/16:1(9Z))PW001083 Pw001083Pw001083 greyscalePw001083 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/18:1(9Z)/17:0cycw7c)PW001084 Pw001084Pw001084 greyscalePw001084 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/18:1(9Z)/18:1(9Z))PW001085 Pw001085Pw001085 greyscalePw001085 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/18:1(9Z)/19:0cycv8c)PW001086 Pw001086Pw001086 greyscalePw001086 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/14:0)PW001087 Pw001087Pw001087 greyscalePw001087 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/15:0cyclo)PW001088 Pw001088Pw001088 greyscalePw001088 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/16:0)PW001089 Pw001089Pw001089 greyscalePw001089 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/16:1(9Z))PW001090 Pw001090Pw001090 greyscalePw001090 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/17:0cycw7c)PW001091 Pw001091Pw001091 greyscalePw001091 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/18:1(9Z))PW001092 Pw001092Pw001092 greyscalePw001092 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/19:0cycv8c)PW001093 Pw001093Pw001093 greyscalePw001093 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/14:0/15:0cyclo)PW001094 Pw001094Pw001094 greyscalePw001094 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/15:0cyclo/14:0)PW001095 Pw001095Pw001095 greyscalePw001095 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/15:0cyclo/16:1(9Z))PW001096 Pw001096Pw001096 greyscalePw001096 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/15:0cyclo/17:0cycw7c)PW001097 Pw001097Pw001097 greyscalePw001097 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/15:0cyclo/18:1(9Z))PW001098 Pw001098Pw001098 greyscalePw001098 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/15:0cyclo/19:0cycv8c)PW001099 Pw001099Pw001099 greyscalePw001099 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:0/16:0)PW001100 Pw001100Pw001100 greyscalePw001100 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:0/16:1(9Z))PW001102 Pw001102Pw001102 greyscalePw001102 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:0/17:0cycw7c)PW001103 Pw001103Pw001103 greyscalePw001103 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:0/18:1(9Z))PW001104 Pw001104Pw001104 greyscalePw001104 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:0/19:0cycv8c)PW001105 Pw001105Pw001105 greyscalePw001105 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:1(9Z)/15:0cyclo)PW001107 Pw001107Pw001107 greyscalePw001107 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:1(9Z)/16:0)PW001106 Pw001106Pw001106 greyscalePw001106 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:1(9Z)/16:1(9Z))PW001108 Pw001108Pw001108 greyscalePw001108 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/17:0cycw7c/15:0cyclo)PW001101 Pw001101Pw001101 greyscalePw001101 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/17:0cycw7c/16:0)PW001109 Pw001109Pw001109 greyscalePw001109 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/17:0cycw7c/17:0cycw7c)