Record Information
Version2.0
Creation Date2012-05-31 14:06:19 -0600
Update Date2015-10-15 16:13:34 -0600
Secondary Accession Numbers
  • ECMDB04142
Identification
Name:Pyrophosphate
Description:Pyrophosphates are the anions, the salts, and the esters of pyrophosphoric acid. The anion is abbreviated PPi and is formed by the hydrolysis of ATP into AMP in cells. This hydrolysis is called pyrophosphorolysis. The pyrophosphate anion has the structure P2O74-, and is an acid anhydride of phosphate. It is unstable in aqueous solution and rapidly hydrolyzes into inorganic phosphate
Structure
Thumb
Synonyms:
  • (4-)Diphosphate ion
  • (4-)Diphosphorate ion
  • (4-)Diphosphoric acid ion
  • (P2O74-)Diphosphate
  • (P2O74-)Diphosphoric acid
  • Diphosphate
  • Diphosphorate
  • Diphosphoric acid
  • PP
  • PPi
  • Pyrometaphosphate
  • Pyrometaphosphoric acid
  • Pyrophosphate
  • Pyrophosphate tetraanion
  • Pyrophosphate(4-) ion
  • Pyrophosphoric acid
  • Pyrophosphoric acid tetraanion
  • Pyrophosphoric acid(4-) ion
Chemical Formula:O7P2
Weight:Average: 173.9433
Monoisotopic: 173.911925378
InChI Key:XPPKVPWEQAFLFU-UHFFFAOYSA-J
InChI:InChI=1S/H4O7P2/c1-8(2,3)7-9(4,5)6/h(H2,1,2,3)(H2,4,5,6)/p-4
CAS number:14000-31-8
IUPAC Name:(phosphonooxy)phosphonate
Traditional IUPAC Name:phosphonooxyphosphonate
SMILES:[O-]P([O-])(=O)OP([O-])([O-])=O
Chemical Taxonomy
DescriptionThis compound belongs to the class of inorganic compounds known as non-metal pyrophosphates. These are inorganic non-metallic compoundscontaining a pyrophosphate as its largest oxoanion.
KingdomInorganic compounds
Super ClassHomogeneous non-metal compounds
ClassNon-metal oxoanionic compounds
Sub ClassNon-metal pyrophosphates
Direct ParentNon-metal pyrophosphates
Alternative Parents
Substituents
  • Non-metal pyrophosphate
  • Inorganic oxide
  • Acyclic compound
Molecular FrameworkAcyclic compounds
External Descriptors
Physical Properties
State:Solid
Charge:-3
Melting point:61 °C
Experimental Properties:
PropertyValueSource
Predicted Properties
PropertyValueSource
logP-1.4ChemAxon
pKa (Strongest Acidic)1.7ChemAxon
Physiological Charge-3ChemAxon
Hydrogen Acceptor Count6ChemAxon
Hydrogen Donor Count0ChemAxon
Polar Surface Area135.61 ŲChemAxon
Rotatable Bond Count2ChemAxon
Refractivity21.04 m³·mol⁻¹ChemAxon
Polarizability9.06 ųChemAxon
Number of Rings0ChemAxon
Bioavailability1ChemAxon
Rule of FiveYesChemAxon
Ghose FilterYesChemAxon
Veber's RuleYesChemAxon
MDDR-like RuleYesChemAxon
Biological Properties
Cellular Locations:Cytoplasm
Reactions:
Dihydroneopterin triphosphate + Water > Dihydroneopterin monophosphate + Hydrogen ion + Pyrophosphate
Guanosine triphosphate + Water > Guanosine monophosphate + Hydrogen ion + Pyrophosphate
dGTP + Water > 2'-Deoxyguanosine 5'-monophosphate + Hydrogen ion + Pyrophosphate
Guanine + Phosphoribosyl pyrophosphate > Guanosine monophosphate + Pyrophosphate
Hypoxanthine + Phosphoribosyl pyrophosphate <> Inosinic acid + Pyrophosphate
Guanosine triphosphate + Water <> Cyclic pyranopterin monophosphate + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Dodecanoate (N-C12:0) + Hydrogen ion > Adenosine monophosphate + Lauroyl-CoA + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Palmitic acid > Adenosine monophosphate + Hydrogen ion + Palmityl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Octadecanoate (N-C18:0) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + Stearoyl-CoA
Adenosine triphosphate + Coenzyme A + Hydrogen ion + tetradecanoate (n-C14:0) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + Tetradecanoyl-CoA
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Tetradecenoate (N-C14:1) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + (2E)-Tetradecenoyl-CoA
Adenosine triphosphate + L-Phenylalanine + tRNA(Phe) + tRNA(Phe) <> Adenosine monophosphate + L-Phenylalanyl-tRNA(Phe) + Pyrophosphate + L-Phenylalanyl-tRNA(Phe)
Cytidine triphosphate + Water > Cytidine monophosphate + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Decanoate (N-C10:0) + Hydrogen ion > Adenosine monophosphate + Decanoyl-CoA (N-C10:0CoA) + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Caprylic acid > Adenosine monophosphate + Hydrogen ion + Octanoyl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Hexadecenoate (n-C16:1) > Adenosine monophosphate + Hydrogen ion + (2E)-Hexadecenoyl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Hexanoate (N-C6:0) > Adenosine monophosphate + Hydrogen ion + Hexanoyl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Octadecenoate (N-C18:1) > Adenosine monophosphate + Hydrogen ion + Octadecenoyl-CoA (N-C18:1CoA) + Pyrophosphate
Thymidine 5'-triphosphate + Glucose 1-phosphate + Hydrogen ion <> dTDP-D-Glucose + Pyrophosphate
Water + Triphosphate > Hydrogen ion + Phosphate + Pyrophosphate
Adenosine triphosphate + Dehydroglycine + 1-Deoxy-D-xylulose 5-phosphate + Hydrogen ion + IscS with bound sulfur + NADPH > 4-Methyl-5-(2-phosphoethyl)-thiazole + Adenosine monophosphate + Carbon dioxide +2 Water + IscS sulfur acceptor protein + NADP + Pyrophosphate
Water + Pyrophosphate > Hydrogen ion +2 Phosphate
Adenosine triphosphate + Guanosine triphosphate + Water + Sulfate > Adenosine phosphosulfate + Guanosine diphosphate + Phosphate + Pyrophosphate
dATP + Water > Deoxyadenosine monophosphate + Hydrogen ion + Pyrophosphate
dCTP + Water > dCMP + Hydrogen ion + Pyrophosphate
Thymidine 5'-triphosphate + Water > 5-Thymidylic acid + Hydrogen ion + Pyrophosphate
acyl carrier protein + Adenosine triphosphate + Palmitic acid > Adenosine monophosphate + Palmitoyl-ACP (n-C16:0ACP) + Pyrophosphate
acyl carrier protein + Adenosine triphosphate + Caprylic acid > Adenosine monophosphate + Octanoyl-ACP (n-C8:0ACP) + Pyrophosphate
acyl carrier protein + Adenosine triphosphate + Decanoate (N-C10:0) > Adenosine monophosphate + Decanoyl-ACP (n-C10:0ACP) + Pyrophosphate
acyl carrier protein + Adenosine triphosphate + Dodecanoate (N-C12:0) > Adenosine monophosphate + Dodecanoyl-ACP (n-C12:0ACP) + Pyrophosphate
acyl carrier protein + Adenosine triphosphate + Hexadecenoate (n-C16:1) > Adenosine monophosphate + cis-hexadec-9-enoyl-[acyl-carrier protein] (n-C16:1) + Pyrophosphate
acyl carrier protein + Adenosine triphosphate + Octadecanoate (N-C18:0) > Adenosine monophosphate + Octadecanoyl-ACP (n-C18:0ACP) + Pyrophosphate
acyl carrier protein + Adenosine triphosphate + Octadecenoate (N-C18:1) > Adenosine monophosphate + cis-octadec-11-enoyl-[acyl-carrier protein] (n-C18:1) + Pyrophosphate
acyl carrier protein + Adenosine triphosphate + tetradecanoate (n-C14:0) > Adenosine monophosphate + Myristoyl-ACP (n-C14:0ACP) + Pyrophosphate
acyl carrier protein + Adenosine triphosphate + Tetradecenoate (N-C14:1) > Adenosine monophosphate + Pyrophosphate + cis-tetradec-7-enoyl-[acyl-carrier protein] (n-C14:1)
Adenosine triphosphate + Glycine + tRNA(Gly) + tRNA(Gly) <> Adenosine monophosphate + Glycyl-tRNA(Gly) + Pyrophosphate + Glycyl-tRNA(Gly)
Deoxyuridine triphosphate + Water <> dUMP + Hydrogen ion + Pyrophosphate
bis-molybdenum cofactor + Guanosine triphosphate + Hydrogen ion > bis-molybdopterin mono-guanine dinucleotide + Pyrophosphate
Guanosine triphosphate + Hydrogen ion + Molybdopterin > Molybdopterin guanine dinucleotide + Pyrophosphate
bis-molybdopterin mono-guanine dinucleotide + Guanosine triphosphate + Hydrogen ion > Bis-molybdopterin guanine dinucleotide + Pyrophosphate
tungsten bispterin cofactor + Guanosine triphosphate + Hydrogen ion > tungsten bispterin cofactor mono-guanine dinucleotide + Pyrophosphate
tungsten bispterin cofactor mono-guanine dinucleotide + Guanosine triphosphate + Hydrogen ion > tungsten bispterin cofactor guanine dinucleotide + Pyrophosphate
Adenosine triphosphate + L-Lysine + tRNA(Lys) > Adenosine monophosphate + L-Lysine-tRNA (Lys) + Pyrophosphate
Adenosine triphosphate + Hydrogen ion + Nicotinamide ribotide + NMN <> NAD + Pyrophosphate
Adenosine triphosphate + Hydrogen ion + Molybdopterin <> Adenylated molybdopterin + Pyrophosphate
Adenosine triphosphate + Flavin Mononucleotide + Hydrogen ion > FAD + Pyrophosphate
Adenosine triphosphate + L-Isoleucine + tRNA(Ile) + tRNA(Ile) <> Adenosine monophosphate + L-Isoleucyl-tRNA(Ile) + Pyrophosphate + L-Isoleucyl-tRNA(Ile)
2 Hydrogen ion + Phosphoribosyl pyrophosphate + Quinolinic acid <> Carbon dioxide + Nicotinamide ribotide + Pyrophosphate
beta-Alanine + Adenosine triphosphate + (R)-Pantoate <> Adenosine monophosphate + Hydrogen ion + Pantothenic acid + Pyrophosphate
Farnesyl pyrophosphate + 8 Isopentenyl pyrophosphate >8 Pyrophosphate + Undecaprenyl diphosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-didodecanoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-dihexadec-9-enoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-dihexadecanoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-dioctadec-11-enoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-Dioctadecanoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-ditetradec-7-enoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-ditetradecanoylglycerol + Pyrophosphate
Adenosine triphosphate + L-Proline + tRNA(Pro) + tRNA(Pro) <> Adenosine monophosphate + Pyrophosphate + L-Prolyl-tRNA(Pro) + L-Prolyl-tRNA(Pro)
Phosphoribosyl pyrophosphate + Xanthine <> Pyrophosphate + Xanthylic acid
Dimethylallylpyrophosphate + Isopentenyl pyrophosphate > Geranyl-PP + Pyrophosphate
Geranyl-PP + Isopentenyl pyrophosphate + Geranyl diphosphate <> Farnesyl pyrophosphate + Pyrophosphate
Farnesyl pyrophosphate + Water + Heme > Heme O + Pyrophosphate
Adenine + Phosphoribosyl pyrophosphate <> Adenosine monophosphate + Pyrophosphate
Adenosine triphosphate + L-Cysteine + tRNA(Cys) + tRNA(Cys) <> Adenosine monophosphate + L-Cysteinyl-tRNA(Cys) + Pyrophosphate + L-Cysteinyl-tRNA(Cys)
Adenosine triphosphate + Hydrogen ion + L-Serine <> Pyrophosphate + L-Seryl-AMP
2-Pyrocatechuic acid + Adenosine triphosphate + Hydrogen ion > (2,3-Dihydroxybenzoyl)adenylic acid + Pyrophosphate
Adenosine triphosphate + Hydrogen ion + Nicotinamide ribotide <> Nicotinic acid adenine dinucleotide + Pyrophosphate
Adenosine triphosphate + L-Leucine + tRNA(Leu) > Adenosine monophosphate + L-Leucyl-tRNA(Leu) + Pyrophosphate
L-Aspartic acid + Adenosine triphosphate + L-Glutamine + Water > Adenosine monophosphate + L-Asparagine + L-Glutamate + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + L-Glutamine + tRNA(Gln) > Adenosine monophosphate + L-Glutaminyl-tRNA(Gln) + Pyrophosphate
Adenosine triphosphate + Hydrogen ion + MoaD Protein with carboxylate > MoaD Protein with bound AMP + Pyrophosphate
Adenosine triphosphate + L-Serine + tRNA(SeCys) > Adenosine monophosphate + Pyrophosphate
Adenosine triphosphate + L-Serine + tRNA(Ser) + tRNA(Ser) <> Adenosine monophosphate + Pyrophosphate + L-Seryl-tRNA(Ser) + L-Seryl-tRNA(Ser)
Cytidine triphosphate + 3-Deoxy-D-manno-octulosonate <> CMP-3-Deoxy-D-manno-octulosonate + Pyrophosphate
L-Asparagine + Adenosine triphosphate + tRNA(Asn) + tRNA(Asn) <> Adenosine monophosphate + L-Asparaginyl-tRNA(Asn) + Pyrophosphate + L-Asparaginyl-tRNA(Asn)
Adenosine triphosphate + Water + Nicotinic acid + Phosphoribosyl pyrophosphate > ADP + Nicotinamide ribotide + Phosphate + Pyrophosphate
Glucose 1-phosphate + Hydrogen ion + Uridine triphosphate <> Pyrophosphate + UDP-Glucose
2-Aminobenzoic acid + Phosphoribosyl pyrophosphate > Pyrophosphate + N-(5-Phospho-D-ribosyl)anthranilate
Guanosine triphosphate + 3 Water <> 2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Formic acid +2 Hydrogen ion + Pyrophosphate + 2,5-diamino-6-hydroxy-4-(5-phospho-D-ribosylamino)pyrimidine
Adenosine triphosphate + Coenzyme A + Benzeneacetic acid <> Adenosine monophosphate + Phenylacetyl-CoA + Pyrophosphate
Adenosine triphosphate + tRNA(Tyr) + L-Tyrosine + tRNA(Tyr) <> Adenosine monophosphate + Pyrophosphate + L-Tyrosyl-tRNA(Tyr) + L-Tyrosyl-tRNA(Tyr)
Adenosine triphosphate + L-Threonine + tRNA(Thr) + tRNA(Thr) <> Adenosine monophosphate + Pyrophosphate + L-Threonyl-tRNA(Thr) + L-Threonyl-tRNA(Thr)
Adenosine triphosphate + Nicotinic acid adenine dinucleotide + Ammonium > Adenosine monophosphate + Hydrogen ion + NAD + Pyrophosphate
L-Aspartic acid + Adenosine triphosphate + tRNA(Asp) + tRNA(Asp) <> Adenosine monophosphate + L-Aspartyl-tRNA(Asp) + Pyrophosphate + L-Aspartyl-tRNA(Asp)
L-Arginine + Adenosine triphosphate + tRNA(Arg) + tRNA(Arg) <> Adenosine monophosphate + L-Arginyl-tRNA(Arg) + Pyrophosphate + L-Arginyl-tRNA(Arg)
Adenosyl cobinamide phosphate + Guanosine triphosphate + Hydrogen ion > Adenosylcobinamide-GDP + Pyrophosphate
Adenosine triphosphate + Phosphoribosyl pyrophosphate <> Pyrophosphate + Phosphoribosyl-ATP
Water + Phosphoribosyl-ATP <> Hydrogen ion + Pyrophosphate + Phosphoribosyl-AMP
Adenosine triphosphate + L-Methionine + tRNA(Met) > Adenosine monophosphate + L-Methionyl-tRNA (Met) + Pyrophosphate
Adenosine triphosphate + Coenzyme A + 2-Succinylbenzoate <> Adenosine monophosphate + Pyrophosphate + 2-Succinylbenzoyl-CoA
L-Glutamine + Water + Phosphoribosyl pyrophosphate <> L-Glutamate + Pyrophosphate + 5-Phosphoribosylamine
Adenosine triphosphate + L-Glutamate + tRNA (Glu) > Adenosine monophosphate + L-Glutamyl-tRNA(Glu) + Pyrophosphate
Phosphoribosyl pyrophosphate + Uracil <> Pyrophosphate + Uridine 5'-monophosphate
Adenosine triphosphate + Phosphate <> ADP + Pyrophosphate
Adenosine triphosphate + Pyrophosphate <> ADP + Triphosphate
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid > Adenosine monophosphate + L-Glutamate + Guanosine monophosphate +2 Hydrogen ion + Pyrophosphate
Adenosine triphosphate + L-Histidine + tRNA(His) + tRNA(His) <> Adenosine monophosphate + L-Histidyl-tRNA(His) + Pyrophosphate + L-Histidyl-tRNA(His)
L-Alanine + Adenosine triphosphate + tRNA(Ala) > L-Alanyl-tRNA(Ala) + Adenosine monophosphate + Pyrophosphate
2-C-Methyl-D-erythritol-4-phosphate + Cytidine triphosphate + Hydrogen ion <> 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Pyrophosphate
Water + Uridine triphosphate > Hydrogen ion + Pyrophosphate + Uridine 5'-monophosphate
Adenosine triphosphate + Water <> Adenosine monophosphate + Hydrogen ion + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C12:0) + Adenosine triphosphate + Dodecanoate (N-C12:0) > Adenosine monophosphate + PE(14:0/14:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:0) + Adenosine triphosphate + tetradecanoate (n-C14:0) > Adenosine monophosphate + PE(14:0/14:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:1) + Adenosine triphosphate + Tetradecenoate (N-C14:1) > Adenosine monophosphate + PE(14:0/14:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:0) + Adenosine triphosphate + Palmitic acid > Adenosine monophosphate + PE(14:0/14:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:1) + Adenosine triphosphate + Hexadecenoate (n-C16:1) > Adenosine monophosphate + PE(14:0/14:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:0) + Adenosine triphosphate + Octadecanoate (N-C18:0) > Adenosine monophosphate + PE(14:0/14:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:1) + Adenosine triphosphate + Octadecenoate (N-C18:1) > Adenosine monophosphate + PE(14:0/14:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoglycerol (n-C12:0) + Adenosine triphosphate + Dodecanoate (N-C12:0) > Adenosine monophosphate + PG(12:0/12:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoglycerol (N-C14:0) + Adenosine triphosphate + tetradecanoate (n-C14:0) > Adenosine monophosphate + PG(14:0/14:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoglycerol (N-C14:1) + Adenosine triphosphate + Tetradecenoate (N-C14:1) > Adenosine monophosphate + PG(14:1(7Z)/14:1(7Z)) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoglycerol (N-C16:0) + Adenosine triphosphate + Palmitic acid > Adenosine monophosphate + PG(16:0/16:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoglycerol (N-C16:1) + Adenosine triphosphate + Hexadecenoate (n-C16:1) > Adenosine monophosphate + PG(16:1(9Z)/16:1(9Z)) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoglycerol (N-C18:0) + Adenosine triphosphate + Octadecanoate (N-C18:0) > Adenosine monophosphate + PG(18:0/18:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoglycerol (N-C18:1) + Adenosine triphosphate + Octadecenoate (N-C18:1) > Adenosine monophosphate + PG(18:1(11Z)/18:1(11Z)) + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + Molybdopterin > Molybdopterin cytosine dinucleotide + Pyrophosphate
Adenosine triphosphate + Water + L-Methionine <> S-Adenosylmethionine + Phosphate + Pyrophosphate
Water + Inosine triphosphate > Hydrogen ion + Inosinic acid + Pyrophosphate
Water + Xanthosine 5-triphosphate > Hydrogen ion + Pyrophosphate + Xanthylic acid
2'-Deoxyinosine triphosphate + Water > DIMP + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + D-Glycero-D-manno-heptose 1-phosphate + Hydrogen ion > ADP-D-Glycero-D-manno-heptose + Pyrophosphate
L-Aspartic acid + Adenosine triphosphate + Citrulline <> Adenosine monophosphate + Argininosuccinic acid + Hydrogen ion + Pyrophosphate
p-Aminobenzoic acid + 6-Hydroxymethyl-dihydropterin pyrophosphate > 7,8-Dihydropteroic acid + Pyrophosphate
Farnesyl pyrophosphate + 5 Isopentenyl pyrophosphate <> Octaprenyl diphosphate +5 Pyrophosphate
Adenosine triphosphate + tRNA(Trp) + L-Tryptophan + tRNA(Trp) <> Adenosine monophosphate + Pyrophosphate + L-Tryptophanyl-tRNA(Trp)
Adenosine triphosphate + Glucose 1-phosphate + Hydrogen ion <> ADP-Glucose + Pyrophosphate
Adenosine triphosphate + Hydrogen ion + Pantetheine 4'-phosphate <> Dephospho-CoA + Pyrophosphate
D-4'-Phosphopantothenate + Cytidine triphosphate + L-Cysteine > 4-Phosphopantothenoylcysteine + Cytidine monophosphate + Hydrogen ion + Pyrophosphate
Orotidylic acid + Pyrophosphate <> Orotic acid + Phosphoribosyl pyrophosphate
Water + Guanosine 3',5'-bis(diphosphate) <> Guanosine diphosphate + Pyrophosphate
Guanosine 3'-diphosphate 5'-triphosphate + Water > Guanosine triphosphate + Pyrophosphate
N-Acetyl-glucosamine 1-phosphate + Hydrogen ion + Uridine triphosphate > Pyrophosphate + Uridine diphosphate-N-acetylglucosamine
L-Aspartic acid + Adenosine triphosphate + Ammonium > Adenosine monophosphate + L-Asparagine + Hydrogen ion + Pyrophosphate
Adenosine triphosphate <> Cyclic AMP + Pyrophosphate
1,4-Dihydroxy-2-naphthoic acid + Hydrogen ion + Octaprenyl diphosphate > 2-Demethylmenaquinol 8 + Carbon dioxide + Pyrophosphate
2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate + 4-Methyl-5-(2-phosphoethyl)-thiazole + Hydrogen ion <> Pyrophosphate + Thiamine monophosphate
4-Hydroxybenzoic acid + Octaprenyl diphosphate > 3-Octaprenyl-4-hydroxybenzoate + Pyrophosphate
Acetic acid + Adenosine triphosphate + Coenzyme A <> Acetyl-CoA + Adenosine monophosphate + Pyrophosphate
2 Adenosine triphosphate + Hydrogen ion > Diadenosine tetraphosphate + Pyrophosphate
Adenosine triphosphate + tRNA(Val) + L-Valine + tRNA(Val) <> Adenosine monophosphate + Pyrophosphate + L-Valyl-tRNA(Val) + L-Valyl-tRNA(Val)
Adenosine triphosphate + Lipoic acid > Lipoyl-AMP + Pyrophosphate
Adenosine triphosphate + Hydrogen ion + Caprylic acid > Adenosine monophosphate + octanoate (protein bound) + Pyrophosphate
Adenosine triphosphate + Water <> Adenosine monophosphate + Pyrophosphate
Adenosine triphosphate <> Cyclic AMP + Pyrophosphate
Adenosine triphosphate + Nicotinamide ribotide <> Pyrophosphate + NAD
Adenosine triphosphate + Flavin Mononucleotide <> Pyrophosphate + FAD
Phosphate + Pyrophosphate + S-Adenosylmethionine <> Adenosine triphosphate + L-Methionine + Water
Adenosine triphosphate + Nicotinic acid adenine dinucleotide + Ammonia <> Adenosine monophosphate + Pyrophosphate + NAD
Adenosine monophosphate + Pyrophosphate <> Adenine + Phosphoribosyl pyrophosphate
Adenosine triphosphate + Acetic acid + Coenzyme A <> Adenosine monophosphate + Pyrophosphate + Acetyl-CoA
Uridine triphosphate + Glucose 1-phosphate <> Pyrophosphate + UDP-Glucose
Adenosine triphosphate + Acetic acid <> Pyrophosphate + Acetyl adenylate
Guanosine 3',5'-bis(diphosphate) + Water <> Guanosine diphosphate + Pyrophosphate
dATP + DNA <> Pyrophosphate + DNA
dGTP + DNA <> Pyrophosphate + DNA
dCTP + DNA <> Pyrophosphate + DNA
Thymidine 5'-triphosphate + DNA <> Pyrophosphate + DNA
Uridine triphosphate + Glucosamine-1P <> Pyrophosphate + Uridine diphosphate-N-acetylglucosamine
Guanosine triphosphate + 3 Water <> Formic acid + 2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Pyrophosphate
Guanosine triphosphate + Water <> Guanosine monophosphate + Pyrophosphate
Guanosine triphosphate <> Cyclic GMP + Pyrophosphate
Adenosine triphosphate + RNA + RNA <> Pyrophosphate + RNA
Guanosine triphosphate + RNA <> Pyrophosphate + RNA
Cytidine triphosphate + RNA <> Pyrophosphate + RNA
Uridine triphosphate + RNA <> Pyrophosphate + RNA
Adenosine triphosphate + L-Aspartic acid + Ammonia <> Adenosine monophosphate + Pyrophosphate + L-Asparagine
Cytidine triphosphate + Water <> Cytidine monophosphate + Pyrophosphate
Adenosine triphosphate + Sulfate <> Pyrophosphate + Adenosine phosphosulfate
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water <> Adenosine monophosphate + Pyrophosphate + L-Asparagine + L-Glutamate
Uridine triphosphate + Water <> Uridine 5'-monophosphate + Pyrophosphate
Inosine triphosphate + Water <> Inosinic acid + Pyrophosphate
Guanosine triphosphate + D-Mannose 1-phosphate <> Pyrophosphate + Guanosine diphosphate mannose
Adenosine triphosphate + Glucose 1-phosphate <> Pyrophosphate + ADP-Glucose
Uridine 5'-monophosphate + Pyrophosphate <> Uracil + Phosphoribosyl pyrophosphate
Phosphoribosyl-ATP + Pyrophosphate <> Adenosine triphosphate + Phosphoribosyl pyrophosphate
5-Phosphoribosylamine + Pyrophosphate + L-Glutamate <> L-Glutamine + Phosphoribosyl pyrophosphate + Water
N-(5-Phospho-D-ribosyl)anthranilate + Pyrophosphate <> 2-Aminobenzoic acid + Phosphoribosyl pyrophosphate
Adenosine triphosphate + Biotin <> Pyrophosphate + Biotinyl-5'-AMP
Dimethylallylpyrophosphate + tRNA <> Pyrophosphate + tRNA containing 6-isopentenyladenosine
Inosinic acid + Pyrophosphate <> Hypoxanthine + Phosphoribosyl pyrophosphate
Guanosine monophosphate + Pyrophosphate <> Guanine + Phosphoribosyl pyrophosphate
Adenosine triphosphate + Xanthylic acid + Ammonia <> Adenosine monophosphate + Pyrophosphate + Guanosine monophosphate
Adenosine triphosphate + Xanthylic acid + L-Glutamine + Water <> Adenosine monophosphate + Pyrophosphate + Guanosine monophosphate + L-Glutamate
Adenosine triphosphate + Palmitic acid + Coenzyme A <> Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
Adenosine triphosphate + Propionic acid <> Pyrophosphate + Propinol adenylate
Adenosine triphosphate + Long-chain fatty acid + Acyl-carrier protein <> Adenosine monophosphate + Pyrophosphate + Acyl-[acyl-carrier protein]
Dimethylallylpyrophosphate + Isopentenyl pyrophosphate <> Pyrophosphate + Geranyl-PP
Nicotinamide ribotide + Pyrophosphate + Adenosine triphosphate + Water <> Nicotinic acid + Phosphoribosyl pyrophosphate + ADP + Phosphate
Cytidine triphosphate + PA(16:0/16:0) <> Pyrophosphate + CDP-diacylglycerol
dGTP + Water <> 2'-Deoxyguanosine 5'-monophosphate + Pyrophosphate
Orotidylic acid + Pyrophosphate <> Orotic acid + Phosphoribosyl pyrophosphate
Adenosine triphosphate + Citrulline + L-Aspartic acid <> Adenosine monophosphate + Pyrophosphate + Argininosuccinic acid
Geranyl-PP + Isopentenyl pyrophosphate <> Pyrophosphate + Farnesyl pyrophosphate
Deoxyuridine triphosphate + Water <> dUMP + Pyrophosphate
Xanthylic acid + Pyrophosphate <> Xanthine + Phosphoribosyl pyrophosphate
Thymidine 5'-triphosphate + Glucose 1-phosphate <> Pyrophosphate + dTDP-D-Glucose
Adenosine triphosphate + (R)-Pantoate + beta-Alanine <> Adenosine monophosphate + Pyrophosphate + Pantothenic acid
Adenosine triphosphate + Benzeneacetic acid + Coenzyme A <> Adenosine monophosphate + Pyrophosphate + Phenylacetyl-CoA
Xanthosine 5-triphosphate + Water <> Xanthylic acid + Pyrophosphate
Adenosine triphosphate + L-Tyrosine + tRNA(Tyr) <> Adenosine monophosphate + Pyrophosphate + L-Tyrosyl-tRNA(Tyr)
Adenosine triphosphate + Nicotinamide ribotide <> Pyrophosphate + Nicotinic acid adenine dinucleotide
Adenosine triphosphate + Pantetheine 4'-phosphate <> Pyrophosphate + Dephospho-CoA
Adenosine triphosphate + L-Alanine + tRNA(Ala) + tRNA(Ala) <> Adenosine monophosphate + Pyrophosphate + L-Alanyl-tRNA + L-Alanyl-tRNA
2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + p-Aminobenzoic acid + (2-amino-4-hydroxy-7,8-dihydropteridin-6-yl)methyl diphosphate <> Pyrophosphate + 7,8-Dihydropteroic acid
2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate + 4-Methyl-5-(2-phosphoethyl)-thiazole <> Pyrophosphate + Thiamine monophosphate
Nicotinamide ribotide + Pyrophosphate + Carbon dioxide <> Quinolinic acid + Phosphoribosyl pyrophosphate
Cytidine triphosphate + 3-Deoxy-D-manno-octulosonate <> Pyrophosphate + CMP-3-Deoxy-D-manno-octulosonate
2'-Deoxyinosine triphosphate + Water <> DIMP + Pyrophosphate
Adenosine triphosphate + L-Arginine + tRNA(Arg) <> Adenosine monophosphate + Pyrophosphate + L-Arginyl-tRNA(Arg)
Adenosine triphosphate + L-Asparagine + tRNA(Asn) <> Adenosine monophosphate + Pyrophosphate + L-Asparaginyl-tRNA(Asn)
Adenosine triphosphate + L-Cysteine + tRNA(Cys) <> Adenosine monophosphate + Pyrophosphate + L-Cysteinyl-tRNA(Cys)
Adenosine triphosphate + L-Glutamine + tRNA(Gln) + tRNA(Gln) <> Adenosine monophosphate + Pyrophosphate + Glutaminyl-tRNA + Glutaminyl-tRNA
Adenosine triphosphate + Glycine + tRNA(Gly) <> Adenosine monophosphate + Pyrophosphate + Glycyl-tRNA(Gly)
Adenosine triphosphate + L-Histidine + tRNA(His) <> Adenosine monophosphate + Pyrophosphate + L-Histidyl-tRNA(His)
Adenosine triphosphate + L-Isoleucine + tRNA(Ile) <> Adenosine monophosphate + Pyrophosphate + L-Isoleucyl-tRNA(Ile)
Adenosine triphosphate + L-Leucine + tRNA(Leu) + tRNA(Leu) <> Adenosine monophosphate + Pyrophosphate + L-Leucyl-tRNA + L-Leucyl-tRNA
Adenosine triphosphate + L-Lysine + tRNA(Lys) + tRNA(Lys) <> Adenosine monophosphate + Pyrophosphate + L-Lysyl-tRNA + L-Lysyl-tRNA
Adenosine triphosphate + L-Methionine + tRNA(Met) + tRNA(Met) <> Adenosine monophosphate + Pyrophosphate + L-Methionyl-tRNA + L-Methionyl-tRNA
Adenosine triphosphate + L-Phenylalanine + tRNA(Phe) <> Adenosine monophosphate + Pyrophosphate + L-Phenylalanyl-tRNA(Phe)
Adenosine triphosphate + L-Proline + tRNA(Pro) <> Adenosine monophosphate + Pyrophosphate + L-Prolyl-tRNA(Pro)
Adenosine triphosphate + L-Serine + tRNA(Ser) <> Adenosine monophosphate + Pyrophosphate + L-Seryl-tRNA(Ser)
Adenosine triphosphate + L-Threonine + tRNA(Thr) <> Adenosine monophosphate + Pyrophosphate + L-Threonyl-tRNA(Thr)
Adenosine triphosphate + L-Tryptophan + tRNA(Trp) <> Adenosine monophosphate + Pyrophosphate + L-Tryptophanyl-tRNA(Trp)
Adenosine triphosphate + L-Valine + tRNA(Val) <> Adenosine monophosphate + Pyrophosphate + L-Valyl-tRNA(Val)
Adenosine triphosphate + 2-Succinylbenzoate + Coenzyme A <> Adenosine monophosphate + Pyrophosphate + 2-Succinylbenzoyl-CoA
Phosphoribosyl-ATP + Water <> Phosphoribosyl-AMP + Pyrophosphate
Adenosine triphosphate + D-4'-Phosphopantothenate + L-Cysteine <> Adenosine monophosphate + Pyrophosphate + 4-Phosphopantothenoylcysteine
Cytidine triphosphate + D-4'-Phosphopantothenate + L-Cysteine <> Cytidine monophosphate + Pyrophosphate + 4-Phosphopantothenoylcysteine
AICAR + Pyrophosphate <> 5-Amino-4-imidazolecarboxyamide + Phosphoribosyl pyrophosphate
Adenosine triphosphate + Selenomethionine + Water <> Phosphate + Pyrophosphate + Se-Adenosylselenomethionine
Adenosine triphosphate + Selenomethionine + tRNA(Met) <> Adenosine monophosphate + Pyrophosphate + Selenomethionyl-tRNA(Met)
Adenosine triphosphate + Selenate <> Pyrophosphate + Adenylylselenate
all-trans-Polyprenyl diphosphate + 4-Hydroxybenzoic acid + Geranyl-PP <> 4-Hydroxy-3-polyprenylbenzoate + Pyrophosphate + 4-Hydroxy-3-polyprenylbenzoate
Adenosyl cobinamide phosphate + Guanosine triphosphate <> Adenosylcobinamide-GDP + Pyrophosphate
tRNA(Asp) + L-Aspartic acid + Adenosine triphosphate <> L-Aspartyl-tRNA(Asp) + Pyrophosphate + Adenosine monophosphate
tRNA(Glu) + L-Glutamate + Adenosine triphosphate + tRNA(Glu) <> L-Glutamyl-tRNA(Glu) + Pyrophosphate + Adenosine monophosphate + L-Glutamyl-tRNA(Glu)
Octaprenyl diphosphate + 4-Hydroxybenzoic acid <> 3-Octaprenyl-4-hydroxybenzoate + Pyrophosphate
1,4-Dihydroxy-2-naphthoic acid + Octaprenyl diphosphate <> 2-Demethylmenaquinone 8 + Pyrophosphate + Carbon dioxide
2-C-Methyl-D-erythritol-4-phosphate + Cytidine triphosphate <> 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Pyrophosphate
Adenosine triphosphate + D-Glycero-D-manno-heptose 1-phosphate <> Pyrophosphate + ADP-D-Glycero-D-manno-heptose
Farnesyl pyrophosphate + 8 Isopentenyl pyrophosphate <> di-trans,poly-cis-Undecaprenyl diphosphate +8 Pyrophosphate + Undecaprenyl diphosphate
1,4-Dihydroxy-2-naphthoic acid + Phytyl diphosphate <> 2-Phytyl-1,4-naphthoquinone + Carbon dioxide + Pyrophosphate
Heme + Water + Farnesyl pyrophosphate <> Heme O + Pyrophosphate
C15810 + Adenosine triphosphate <> C15813 + Pyrophosphate
Adenosine triphosphate + Lipoic acid <> Pyrophosphate + Lipoyl-AMP
2 Guanosine triphosphate <> 3',5'-Cyclic diGMP +2 Pyrophosphate + Cyclic di-3',5'-guanylate
Adenosine triphosphate + L-Serine + tRNA(Sec) <> Adenosine monophosphate + Pyrophosphate + L-Seryl-tRNA(Sec)
6-Mercaptopurine + Phosphoribosyl pyrophosphate <> 6-Thioinosine-5'-monophosphate + Pyrophosphate
6-Methylmercaptopurine + Phosphoribosyl pyrophosphate <> 6-Methylthiopurine 5'-monophosphate ribonucleotide + Pyrophosphate
6-Thioxanthine 5'-monophosphate + Adenosine triphosphate + L-Glutamine + Water <> 6-Thioguanosine monophosphate + Adenosine monophosphate + Pyrophosphate + L-Glutamate
Thioguanine + Phosphoribosyl pyrophosphate <> 6-Thioguanosine monophosphate + Pyrophosphate
Farnesyl pyrophosphate + 5 Isopentenyl pyrophosphate <> Octaprenyl diphosphate +5 Pyrophosphate
tRNA precursor + 2 Cytidine triphosphate + Adenosine triphosphate <> tRNA with a 3' CCA end +3 Pyrophosphate
tRNA precursor + Cytidine triphosphate <> tRNA with a 3' cytidine + Pyrophosphate
tRNA with a 3' cytidine + Cytidine triphosphate <> tRNA with a 3' CC end + Pyrophosphate
tRNA with a 3' CC end + Adenosine triphosphate <> tRNA with a 3' CCA end + Pyrophosphate
Guanosine triphosphate + Water <> Cyclic pyranopterin monophosphate + Pyrophosphate
[tRNA(Ile2)]-cytidine34 + L-Lysine + Adenosine triphosphate <> [tRNA(Ile2)]-lysidine34 + Adenosine monophosphate + Pyrophosphate + Water
Adenosine triphosphate + Molybdopterin <> Pyrophosphate + Adenylated molybdopterin
Adenosine triphosphate + L-Serine <> Pyrophosphate + L-Seryl-AMP
a tRNA uridine<sup>34</sup> + a [TusE sulfur carrier protein]-<i>S</i>-sulfanylcysteine + Adenosine triphosphate > a tRNA 2-thiouridine<sup>34</sup> + a [TusE sulfur carrier protein]-L-cysteine + Adenosine monophosphate + Pyrophosphate
&alpha;-D-ribose-1-methylphosphonate-5-triphosphate + Water > Hydrogen ion + &alpha;-D-ribose-1-methylphosphonate-5-phosphate + Pyrophosphate
Hydrogen ion + Nicotinamide ribotide + Adenosine triphosphate <> NAD + Pyrophosphate
Hydrogen ion + D-Mannose 1-phosphate + Guanosine triphosphate > Guanosine diphosphate mannose + Pyrophosphate
Hydrogen ion + 2-C-Methyl-D-erythritol-4-phosphate + Cytidine triphosphate > 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Pyrophosphate
a nucleoside triphosphate + Water > a nucleoside monophosphate + Pyrophosphate + Hydrogen ion
all-<i>trans</i>-octaprenyl diphosphate + 4-Hydroxybenzoic acid > Pyrophosphate + 3-Octaprenyl-4-hydroxybenzoate
Coenzyme A + Acetic acid + Adenosine triphosphate > Acetyl-CoA + Pyrophosphate + Adenosine monophosphate
a 2,3,4-saturated fatty acid + Coenzyme A + Adenosine triphosphate > a 2,3,4-saturated fatty acyl CoA + Pyrophosphate + Adenosine monophosphate
Pyrophosphate + Adenosine monophosphate < Phosphoribosyl pyrophosphate + Adenine
Adenosine triphosphate > Cyclic AMP + Pyrophosphate
L-Aspartic acid + Citrulline + Adenosine triphosphate > Hydrogen ion + L-arginino-succinate + Pyrophosphate + Adenosine monophosphate
Ammonia + L-Aspartic acid + Adenosine triphosphate > L-Asparagine + Pyrophosphate + Adenosine monophosphate
L-Glutamine + L-Aspartic acid + Adenosine triphosphate + Water > Hydrogen ion + L-Glutamate + L-Asparagine + Pyrophosphate + Adenosine monophosphate
Phosphoribosyl-ATP + Pyrophosphate <> Adenosine triphosphate + Phosphoribosyl pyrophosphate
Cytidine triphosphate + PA(16:0/16:0) + Hydrogen ion > Pyrophosphate + a CDP-diacylglycerol
Hydrogen ion + Adenosyl cobinamide phosphate + Guanosine triphosphate > Adenosylcobinamide-GDP + Pyrophosphate
3-Deoxy-D-manno-octulosonate + Cytidine triphosphate > CMP-3-Deoxy-D-manno-octulosonate + Pyrophosphate
dCTP + Water > Hydrogen ion + dCMP + Pyrophosphate
Hydrogen ion + Adenosine triphosphate + 2-Pyrocatechuic acid > Pyrophosphate + (2,3-Dihydroxybenzoyl)adenylic acid
all-<i>trans</i>-octaprenyl diphosphate + 1,4-Dihydroxy-2-naphthoic acid + Hydrogen ion > 2-Demethylmenaquinol 8 + Pyrophosphate + Carbon dioxide
Hydrogen ion + Glucose 1-phosphate + Thymidine 5'-triphosphate <> dTDP-D-Glucose + Pyrophosphate
Deoxyuridine triphosphate + Water > Hydrogen ion + dUMP + Pyrophosphate
Adenosine triphosphate + L-Serine + 2-Pyrocatechuic acid > Hydrogen ion + Pyrophosphate + Adenosine monophosphate + Enterochelin
Flavin Mononucleotide + Adenosine triphosphate + Hydrogen ion > FAD + Pyrophosphate
Geranyl-PP + Isopentenyl pyrophosphate > Farnesyl pyrophosphate + Pyrophosphate
Hydrogen ion + Glucose 1-phosphate + Adenosine triphosphate > ADP-Glucose + Pyrophosphate
Hydrogen ion + Glucose 1-phosphate + Uridine triphosphate > UDP-Glucose + Pyrophosphate
Water + L-Glutamine + Xanthylic acid + Adenosine triphosphate > Hydrogen ion + L-Glutamate + Guanosine monophosphate + Pyrophosphate + Adenosine monophosphate
Adenosine triphosphate + Xanthylic acid + Ammonia > Hydrogen ion + Adenosine monophosphate + Pyrophosphate + Guanosine monophosphate
Dimethylallylpyrophosphate + Isopentenyl pyrophosphate > Geranyl-PP + Pyrophosphate
Water + Guanosine triphosphate > Hydrogen ion + Pyrophosphate + 2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Formic acid
Guanosine monophosphate + Pyrophosphate <> Guanine + Phosphoribosyl pyrophosphate
Guanosine triphosphate <> Cyclic GMP + Pyrophosphate
Dihydroneopterin triphosphate + Water > Hydrogen ion + Dihydroneopterin monophosphate + Pyrophosphate
p-Aminobenzoic acid + 6-Hydroxymethyl-dihydropterin pyrophosphate > 7,8-Dihydropteroic acid + Pyrophosphate
Heme + Farnesyl pyrophosphate + Water <> Heme O + Pyrophosphate
Phosphoribosyl-ATP + Water > Hydrogen ion + Phosphoribosyl-AMP + Pyrophosphate
Pyrophosphate + Inosinic acid < Phosphoribosyl pyrophosphate + Hypoxanthine
Water + Pyrophosphate > Hydrogen ion + Phosphate
Coenzyme A + Carnitine + Adenosine triphosphate > L-Carnitinyl-CoA + Adenosine monophosphate + Pyrophosphate
Adenosine triphosphate + Nicotinic acid adenine dinucleotide + L-Glutamine + Water > Hydrogen ion + Adenosine monophosphate + Pyrophosphate + NAD + L-Glutamate
Adenosine triphosphate + Nicotinic acid adenine dinucleotide + Ammonia > Adenosine monophosphate + Pyrophosphate + NAD
Hydrogen ion + <i>N</i>-acetyl-&alpha;-D-glucosamine 1-phosphate + Uridine triphosphate > Uridine diphosphate-N-acetylglucosamine + Pyrophosphate
Hydrogen ion + Adenosine triphosphate + Nicotinamide ribotide > Pyrophosphate + Nicotinic acid adenine dinucleotide
Nicotinamide ribotide + Pyrophosphate < Hydrogen ion + Nicotinic acid + Phosphoribosyl pyrophosphate
Adenosine triphosphate + 2-Succinylbenzoate + Coenzyme A > Adenosine monophosphate + Pyrophosphate + 2-Succinylbenzoyl-CoA
Orotidylic acid + Pyrophosphate <> Phosphoribosyl pyrophosphate + Orotic acid
D-4'-Phosphopantothenate + L-Cysteine + Cytidine triphosphate > Hydrogen ion + Pyrophosphate + Cytidine monophosphate + 4-Phosphopantothenoylcysteine
Hydrogen ion + Pantetheine 4'-phosphate + Adenosine triphosphate <> Dephospho-CoA + Pyrophosphate
beta-Alanine + (R)-Pantoate + Adenosine triphosphate > Hydrogen ion + Pantothenic acid + Pyrophosphate + Adenosine monophosphate
Coenzyme A + phenylacetate + Adenosine triphosphate > Phenylacetyl-CoA + Pyrophosphate + Adenosine monophosphate
Guanosine 3',5'-bis(diphosphate) + Water > Hydrogen ion + Pyrophosphate + Guanosine diphosphate
Coenzyme A + Propionic acid + Adenosine triphosphate > Propionyl-CoA + Pyrophosphate + Adenosine monophosphate
5-Phosphoribosylamine + Pyrophosphate + L-Glutamate < Phosphoribosyl pyrophosphate + L-Glutamine + Water
N-(5-Phospho-D-ribosyl)anthranilate + Pyrophosphate < 2-Aminobenzoic acid + Phosphoribosyl pyrophosphate
Nicotinamide ribotide + Pyrophosphate + Carbon dioxide < Phosphoribosyl pyrophosphate + Quinolinic acid + Hydrogen ion
8-oxo-dGTP + Water > Hydrogen ion + 8-oxo-dGMP + Pyrophosphate
2-[(2<i>R</i>,5<i>Z</i>)-(2-carboxy-4-methylthiazol-5(2<i>H</i>)-ylidene]ethyl phosphate + 2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate + Hydrogen ion > Thiamine monophosphate + Carbon dioxide + Pyrophosphate
Guanosine triphosphate > Cyclic pyranopterin monophosphate + Pyrophosphate
Hydrogen ion + Molybdopterin + Adenosine triphosphate > Adenylated molybdopterin + Pyrophosphate
Hydrogen ion + Lipoic acid + Adenosine triphosphate > Lipoyl-AMP + Pyrophosphate
Farnesyl pyrophosphate + Isopentenyl pyrophosphate > all-<i>trans</i>-octaprenyl diphosphate + Pyrophosphate
Farnesyl pyrophosphate + Isopentenyl pyrophosphate > Undecaprenyl diphosphate + Pyrophosphate
2'-Deoxyinosine triphosphate + Water > Hydrogen ion + DIMP + Pyrophosphate
Xanthosine 5-triphosphate + Water > Hydrogen ion + Xanthylic acid + Pyrophosphate
Hydrogen ion + molybdenum cofactor + Guanosine triphosphate <> Molybdopterin guanine dinucleotide + Pyrophosphate
Cytidine triphosphate + Water > Hydrogen ion + Cytidine monophosphate + Pyrophosphate
dATP + Water > Hydrogen ion + Deoxyadenosine monophosphate + Pyrophosphate
dGTP + Water > Hydrogen ion + 2'-Deoxyguanosine 5'-monophosphate + Pyrophosphate
Hydrogen ion + D-<i>glycero</i>-&beta;-D-<i>manno</i>-heptose 1-phosphate + Adenosine triphosphate > ADP-D-Glycero-D-manno-heptose + Pyrophosphate
Thymidine 5'-triphosphate + Water > Hydrogen ion + 5-Thymidylic acid + Pyrophosphate
Hydrogen ion + Adenosine triphosphate + Adenosine triphosphate Diadenosine tetraphosphate + Pyrophosphate
Hydrogen ion + Adenosine triphosphate + ADP > Diadenosine triphosphate + Pyrophosphate
Guanosine triphosphate > cyclic di-3',5'-guanylate + Pyrophosphate
Cytidine triphosphate + a 2,3,4-saturated L-phosphatidate + Hydrogen ion > Pyrophosphate + a CDP-2,3,4-saturated-diacylglycerol
Hydrogen ion + molybdenum cofactor + Cytidine triphosphate > Molybdopterin cytosine dinucleotide + Pyrophosphate
Inosine triphosphate + Water > Hydrogen ion + Inosinic acid + Pyrophosphate
Guanosine 3'-diphosphate 5'-triphosphate + Water > Hydrogen ion + Guanosine triphosphate + Pyrophosphate
2-Hydroxydeoxyadenosine 5'-triphosphate + Water > 2-hydroxydeoxyadenosine 5'-monophosphate + Pyrophosphate
Adenosine triphosphate + L-Methionine + Water > Phosphate + Pyrophosphate + S-Adenosylmethionine
Hydrogen ion + Sulfate + Adenosine triphosphate > Adenosine phosphosulfate + Pyrophosphate
Hydrogen ion + 4-Methyl-5-(2-phosphoethyl)-thiazole + 2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate > Thiamine monophosphate + Pyrophosphate
Pyrophosphate + Uridine 5'-monophosphate < Phosphoribosyl pyrophosphate + Uracil
Xanthylic acid + Pyrophosphate < Xanthine + Phosphoribosyl pyrophosphate
Adenosine triphosphate + an acid + [acyl-carrier-protein] > Adenosine monophosphate + Pyrophosphate + acyl-[acyl-carrier-protein]
Adenosine triphosphate + Acetic acid + CoA > Adenosine monophosphate + Pyrophosphate + Acetyl-CoA
2 Guanosine triphosphate >2 Pyrophosphate + Cyclic di-3',5'-guanylate
Adenosine monophosphate + Pyrophosphate > Adenine + Phosphoribosyl pyrophosphate
Adenosine triphosphate + L-Aspartic acid + Ammonia > Adenosine monophosphate + Pyrophosphate + L-Asparagine
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water > Adenosine monophosphate + Pyrophosphate + L-Asparagine + L-Glutamate
Adenosine triphosphate + Citrulline + L-Aspartic acid > Adenosine monophosphate + Pyrophosphate + 2-(N(omega)-L-arginino)succinate
Adenosine triphosphate + Biotin + apo-[acetyl-CoA:carbon-dioxide ligase (ADP-forming)] > Adenosine monophosphate + Pyrophosphate + [acetyl-CoA:carbon-dioxide ligase (ADP-forming)]
A tRNA precursor + 2 Cytidine triphosphate + Adenosine triphosphate > a tRNA with a 3' CCA end +3 Pyrophosphate
Cytidine triphosphate + phosphatidate > Pyrophosphate + CDP-diacylglycerol
Adenosine triphosphate + Acetic acid + [citrate (pro-3S)-lyase](thiol form) > Adenosine monophosphate + Pyrophosphate + [citrate (pro-3S)-lyase](acetyl form)
2'-(5-Triphosphoribosyl)-3'-dephospho-CoA + citrate lyase apo-[acyl-carrier-protein] > citrate lyase holo-[acyl-carrier-protein] + Pyrophosphate
Cytidine triphosphate + (R)-4'-phosphopantothenate + L-Cysteine > Cytidine monophosphate + Pyrophosphate + 4-Phosphopantothenoylcysteine
Adenosine triphosphate + pantotheine 4'-phosphate > Pyrophosphate + 3'-dephospho-CoA
Guanosine triphosphate + adenosylcobinamide phosphate > Pyrophosphate + Adenosylcobinamide-GDP
Adenosine triphosphate > Cyclic AMP + Pyrophosphate
Adenosine triphosphate + Sulfate > Pyrophosphate + Adenosine phosphosulfate
Adenosine triphosphate + Sulfate > Pyrophosphate + Adenosine phosphosulfate
2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + p-Aminobenzoic acid > Pyrophosphate + 7,8-Dihydropteroic acid
2 Guanosine triphosphate >2 Pyrophosphate + Cyclic di-3',5'-guanylate
Deoxynucleoside triphosphate + DNA(n) > Pyrophosphate + DNA(n+1)
Deoxynucleoside triphosphate + DNA(n) > Pyrophosphate + DNA(n+1)
Deoxynucleoside triphosphate + DNA(n) > Pyrophosphate + DNA(n+1)
Deoxynucleoside triphosphate + DNA(n) > Pyrophosphate + DNA(n+1)
Deoxynucleoside triphosphate + DNA(n) > Pyrophosphate + DNA(n+1)
Deoxynucleoside triphosphate + DNA(n) > Pyrophosphate + DNA(n+1)
Deoxynucleoside triphosphate + DNA(n) > Pyrophosphate + DNA(n+1)
Deoxyuridine triphosphate + Water > dUMP + Pyrophosphate
Adenosine triphosphate + 2-Pyrocatechuic acid > Pyrophosphate + (2,3-Dihydroxybenzoyl)adenylic acid
Adenosine triphosphate + L-Serine > Pyrophosphate + L-Seryl-AMP
Adenosine triphosphate + a short-chain carboxylic acid + CoA > Adenosine monophosphate + Pyrophosphate + an acyl-CoA
Adenosine triphosphate + [protein] > Pyrophosphate + [protein]-AMP
Uridine triphosphate + Alpha-D-glucose 1-phosphate > Pyrophosphate + UDP-Glucose
Uridine triphosphate + Alpha-D-glucose 1-phosphate > Pyrophosphate + UDP-Glucose
Adenosine triphosphate + Alpha-D-glucose 1-phosphate > Pyrophosphate + ADP-Glucose
Uridine triphosphate + N-acetyl-alpha-D-glucosamine 1-phosphate > Pyrophosphate + Uridine diphosphate-N-acetylglucosamine
Uridine triphosphate + [protein-PII] > Pyrophosphate + uridylyl-[protein-PII]
Adenosine triphosphate + [L-glutamate:ammonia ligase (ADP-forming)] > Pyrophosphate + adenylyl-[L-glutamate:ammonia ligase (ADP-forming)]
Adenosine triphosphate + Xanthylic acid + L-Glutamine + Water > Adenosine monophosphate + Pyrophosphate + Guanosine monophosphate + L-Glutamate
Phosphoribosyl-ATP + Pyrophosphate > Adenosine triphosphate + Phosphoribosyl pyrophosphate
Phosphoribosyl-ATP + Water > 1-(5-phosphoribosyl)-AMP + Pyrophosphate
Adenosine triphosphate + D-glycero-beta-D-manno-heptose 1-phosphate > Pyrophosphate + ADP-D-glycero-beta-D-manno-heptose
Deoxynucleoside triphosphate + DNA(n) > Pyrophosphate + DNA(n+1)
Deoxynucleoside triphosphate + DNA(n) > Pyrophosphate + DNA(n+1)
Deoxynucleoside triphosphate + DNA(n) > Pyrophosphate + DNA(n+1)
Deoxynucleoside triphosphate + DNA(n) > Pyrophosphate + DNA(n+1)
Deoxynucleoside triphosphate + DNA(n) > Pyrophosphate + DNA(n+1)
Inosinic acid + Pyrophosphate > Hypoxanthine + Phosphoribosyl pyrophosphate
Pyrophosphate + Water >2 Inorganic phosphate
Geranyl-PP + Isopentenyl pyrophosphate > Pyrophosphate + Farnesyl pyrophosphate
Farnesyl pyrophosphate + 5 Isopentenyl pyrophosphate >5 Pyrophosphate + Octaprenyl diphosphate
Cytidine triphosphate + 2-C-methyl-D-erythritol 4-phosphate > Pyrophosphate + 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol
Cytidine triphosphate + 3-Deoxy-D-manno-octulosonate > Pyrophosphate + CMP-3-Deoxy-D-manno-octulosonate
Adenosine triphosphate + a long-chain fatty acid + CoA > Adenosine monophosphate + Pyrophosphate + an acyl-CoA
Adenosine triphosphate + lipoate > Pyrophosphate + Lipoyl-AMP
Guanosine triphosphate + Alpha-D-mannose 1-phosphate > Pyrophosphate + Guanosine diphosphate mannose
Adenosine triphosphate + Water > Adenosine monophosphate + Pyrophosphate
An all-trans-polyprenyl diphosphate + 1,4-Dihydroxy-2-naphthoic acid > a demethylmenaquinol + Pyrophosphate + Carbon dioxide
Adenosine triphosphate + 2-Succinylbenzoate + CoA > Adenosine monophosphate + Pyrophosphate + 2-Succinylbenzoyl-CoA
Adenosine triphosphate + L-Methionine + Water > Inorganic phosphate + Pyrophosphate + S-adenosyl-L-methionine
Dimethylallylpyrophosphate + tRNA > Pyrophosphate + tRNA containing 6-dimethylallyladenosine
Guanosine triphosphate + Molybdopterin > Pyrophosphate + Guanylyl molybdenum cofactor
Cytidine triphosphate + Molybdopterin > Pyrophosphate + Cytidylyl molybdenum cofactor
Adenosine triphosphate + [molybdopterin-synthase sulfur-carrier protein]-Gly-Gly > Pyrophosphate + [molybdopterin-synthase sulfur-carrier protein]-Gly-Gly-AMP
Adenosine triphosphate + molybdopterin forma > Pyrophosphate + Adenylyl-molybdopterin
8-oxo-dGTP + Water > 8-oxo-dGMP + Pyrophosphate
Nicotinamide ribotide + Pyrophosphate + Carbon dioxide > Quinolinic acid + Phosphoribosyl pyrophosphate
Adenosine triphosphate + Nicotinamide ribotide > Pyrophosphate + Nicotinic acid adenine dinucleotide
Adenosine triphosphate + Nicotinic acid adenine dinucleotide + Ammonia > Adenosine monophosphate + Pyrophosphate + NAD
Adenosine triphosphate + NMN > Pyrophosphate + NAD
Cytidine triphosphate + Water > Cytidine monophosphate + Pyrophosphate
Nucleoside triphosphate + Water > nucleoside monophosphate + Pyrophosphate
Adenosine triphosphate + Benzeneacetic acid + CoA > Adenosine monophosphate + Pyrophosphate + Phenylacetyl-CoA
Adenosine triphosphate + (R)-Pantoate + beta-Alanine > Adenosine monophosphate + Pyrophosphate + (R)-pantothenate
Adenosine triphosphate + RNA(n) > Pyrophosphate + RNA(n+1)
Nicotinamide ribotide + Pyrophosphate > Nicotinic acid + Phosphoribosyl pyrophosphate
Adenosine triphosphate + Propionic acid + CoA > Adenosine monophosphate + Pyrophosphate + Propionyl-CoA
[Pyruvate, water dikinase] phosphate + Inorganic phosphate > [pyruvate, water dikinase] + Pyrophosphate
5-Phosphoribosylamine + Pyrophosphate + L-Glutamate > L-Glutamine + Phosphoribosyl pyrophosphate + Water
Formic acid + Adenosine triphosphate + 5'-Phospho-ribosylglycinamide > 5'-Phosphoribosyl-N-formylglycineamide + ADP + Pyrophosphate
Orotidylic acid + Pyrophosphate > Orotic acid + Phosphoribosyl pyrophosphate
A nucleoside triphosphate + Water > a nucleotide + Pyrophosphate
Guanosine triphosphate + 3 Water > Formic acid + 2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Pyrophosphate
Adenosine triphosphate + Flavin Mononucleotide > Pyrophosphate + FAD
Thymidine 5'-triphosphate + Alpha-D-glucose 1-phosphate > Pyrophosphate + dTDP-glucose
Thymidine 5'-triphosphate + Alpha-D-glucose 1-phosphate > Pyrophosphate + dTDP-glucose
Nucleoside triphosphate + RNA(n) > Pyrophosphate + RNA(n+1)
Nucleoside triphosphate + RNA(n) > Pyrophosphate + RNA(n+1)
Nucleoside triphosphate + RNA(n) > Pyrophosphate + RNA(n+1)
Nucleoside triphosphate + RNA(n) > Pyrophosphate + RNA(n+1)
Adenosine triphosphate + RNA 3'-terminal-phosphate > Adenosine monophosphate + Pyrophosphate + RNA terminal-2',3'-cyclic-phosphate
Guanosine 3',5'-bis(diphosphate) + Water > Guanosine diphosphate + Pyrophosphate
Adenosine triphosphate + L-Alanine + tRNA(Ala) > Adenosine monophosphate + Pyrophosphate + L-alanyl-tRNA(Ala)
Adenosine triphosphate + L-Cysteine + tRNA(Cys) > Adenosine monophosphate + Pyrophosphate + L-cysteinyl-tRNA(Cys)
Adenosine triphosphate + L-Aspartic acid + tRNA(Asp) > Adenosine monophosphate + Pyrophosphate + L-aspartyl-tRNA(Asp)
Adenosine triphosphate + L-Glutamate + tRNA(Glu) > Adenosine monophosphate + Pyrophosphate + L-glutamyl-tRNA(Glu)
Adenosine triphosphate + L-Phenylalanine + tRNA(Phe) > Adenosine monophosphate + Pyrophosphate + L-phenylalanyl-tRNA(Phe)
Adenosine triphosphate + L-Phenylalanine + tRNA(Phe) > Adenosine monophosphate + Pyrophosphate + L-phenylalanyl-tRNA(Phe)
Adenosine triphosphate + Glycine + tRNA(Gly) > Adenosine monophosphate + Pyrophosphate + glycyl-tRNA(Gly)
Adenosine triphosphate + Glycine + tRNA(Gly) > Adenosine monophosphate + Pyrophosphate + glycyl-tRNA(Gly)
Adenosine triphosphate + L-Histidine + tRNA(His) > Adenosine monophosphate + Pyrophosphate + L-histidyl-tRNA(His)
Adenosine triphosphate + L-Isoleucine + tRNA(Ile) > Adenosine monophosphate + Pyrophosphate + L-isoleucyl-tRNA(Ile)
Adenosine triphosphate + L-Lysine + tRNA(Lys) > Adenosine monophosphate + Pyrophosphate + L-lysyl-tRNA(Lys)
Adenosine triphosphate + L-Lysine + tRNA(Lys) > Adenosine monophosphate + Pyrophosphate + L-lysyl-tRNA(Lys)
Adenosine triphosphate + L-Leucine + tRNA(Leu) > Adenosine monophosphate + Pyrophosphate + L-leucyl-tRNA(Leu)
Adenosine triphosphate + L-Methionine + tRNA(Met) > Adenosine monophosphate + Pyrophosphate + L-methionyl-tRNA(Met)
Adenosine triphosphate + L-Asparagine + tRNA(Asn) > Adenosine monophosphate + Pyrophosphate + L-asparaginyl-tRNA(Asn)
Adenosine triphosphate + L-Proline + tRNA(Pro) > Adenosine monophosphate + Pyrophosphate + L-prolyl-tRNA(Pro)
Adenosine triphosphate + L-Glutamine + tRNA(Gln) > Adenosine monophosphate + Pyrophosphate + L-glutaminyl-tRNA(Gln)
Adenosine triphosphate + L-Arginine + tRNA(Arg) > Adenosine monophosphate + Pyrophosphate + L-arginyl-tRNA(Arg)
Adenosine triphosphate + L-Serine + tRNA(Ser) > Adenosine monophosphate + Pyrophosphate + L-seryl-tRNA(Ser)
Adenosine triphosphate + L-Serine + tRNA(Sec) > Adenosine monophosphate + Pyrophosphate + L-seryl-tRNA(Sec)
Adenosine triphosphate + L-Threonine + tRNA(Thr) > Adenosine monophosphate + Pyrophosphate + L-threonyl-tRNA(Thr)
Adenosine triphosphate + L-Valine + tRNA(Val) > Adenosine monophosphate + Pyrophosphate + L-valyl-tRNA(Val)
Adenosine triphosphate + L-Tryptophan + tRNA(Trp) > Adenosine monophosphate + Pyrophosphate + L-tryptophyl-tRNA(Trp)
Adenosine triphosphate + L-Tyrosine + tRNA(Tyr) > Adenosine monophosphate + Pyrophosphate + L-tyrosyl-tRNA(Tyr)
2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate + 4-Methyl-5-(2-phosphoethyl)-thiazole > Pyrophosphate + Thiamine monophosphate
Adenosine triphosphate + [ThiS] > Pyrophosphate + adenylyl-[ThiS]
(tRNA(Ile2))-cytidine(34) + L-Lysine + Adenosine triphosphate > (tRNA(Ile2))-lysidine(34) + Adenosine monophosphate + Pyrophosphate + Water
N-(5-Phospho-D-ribosyl)anthranilate + Pyrophosphate > 2-Aminobenzoic acid + Phosphoribosyl pyrophosphate
Farnesyl pyrophosphate + 8 Isopentenyl pyrophosphate >8 Pyrophosphate + di-trans,octa-cis-undecaprenyl diphosphate
Uridine 5'-monophosphate + Pyrophosphate > Uracil + Phosphoribosyl pyrophosphate
Xanthylic acid + Pyrophosphate > Phosphoribosyl pyrophosphate + Xanthine
2 Guanosine triphosphate >2 Pyrophosphate + Cyclic di-3',5'-guanylate
2 Guanosine triphosphate >2 Pyrophosphate + Cyclic di-3',5'-guanylate
2 Guanosine triphosphate >2 Pyrophosphate + Cyclic di-3',5'-guanylate
2 Guanosine triphosphate >2 Pyrophosphate + Cyclic di-3',5'-guanylate
2 Guanosine triphosphate >2 Pyrophosphate + Cyclic di-3',5'-guanylate
2 Guanosine triphosphate >2 Pyrophosphate + Cyclic di-3',5'-guanylate
2 Guanosine triphosphate >2 Pyrophosphate + Cyclic di-3',5'-guanylate
2 Guanosine triphosphate >2 Pyrophosphate + Cyclic di-3',5'-guanylate
Nucleoside triphosphate + RNA <> Pyrophosphate
Deoxynucleoside triphosphate + DNA <> Pyrophosphate
8-oxo-dGTP + Water <> 8-oxo-dGMP + Pyrophosphate
Adenosine triphosphate + 2-Pyrocatechuic acid <> Pyrophosphate + (2,3-Dihydroxybenzoyl)adenylic acid
Cytidine triphosphate + Water + dCTP <> Cytidine monophosphate + Pyrophosphate + dCMP
Xanthosine 5-triphosphate + Water + 2'-Deoxyinosine triphosphate <> Xanthylic acid + Pyrophosphate + DIMP
tRNA precursor + 2 Cytidine triphosphate + Adenosine triphosphate + tRNA with a 3' cytidine + tRNA with a 3' CC end <> tRNA with a 3' CCA end +3 Pyrophosphate
Adenosine triphosphate + Biotin + Apo-[acetyl-CoA:carbon-dioxide ligase (ADP-forming)] <> Adenosine monophosphate + Pyrophosphate + [Acetyl-CoA:carbon-dioxide ligase (ADP-forming)]
Uridine triphosphate + [Protein-PII] <> Pyrophosphate + Uridylyl-[protein-PII]
2'-(5-Triphosphoribosyl)-3'-dephospho-CoA <> Pyrophosphate
Adenosine triphosphate + Acetic acid + Citrate (pro-3S)-lyase (thiol form) <> Adenosine monophosphate + Pyrophosphate + Citrate (pro-3S)-lyase (acetyl form)
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water + Ammonia <> Adenosine monophosphate + Pyrophosphate + L-Asparagine + L-Glutamate
Adenosine triphosphate + Long-chain fatty acid + Coenzyme A <> Adenosine monophosphate + Pyrophosphate + Acyl-CoA
Adenosine triphosphate + Xanthylic acid + L-Glutamine + Water + Ammonia <> Adenosine monophosphate + Pyrophosphate + Guanosine monophosphate + L-Glutamate
Adenosine triphosphate <> Pyrophosphate
Triphosphate + Water <> Pyrophosphate + Phosphate
L-Threonine + Adenosine triphosphate + Hydrogen carbonate <> L-Threonylcarbamoyladenylate + Pyrophosphate + Water
Adenosine triphosphate + RNA 3'-terminal-phosphate <> Adenosine monophosphate + Pyrophosphate + RNA terminal-2',3'-cyclic-phosphate
Adenosine triphosphate + RNA <> Adenosine monophosphate + Pyrophosphate
Geranyl-PP + 1,4-Dihydroxy-2-naphthoic acid <> Demethylmenaquinol + Pyrophosphate + Carbon dioxide
alpha-D-Ribose 1-methylphosphonate 5-triphosphate + Water <> alpha-D-Ribose 1-methylphosphonate 5-phosphate + Pyrophosphate
Pyrophosphate + Water <> Phosphate
Adenosine triphosphate + lipoate + Lipoyl-AMP + Apoprotein <> Pyrophosphate + Protein N6-(lipoyl)lysine + Adenosine monophosphate
Adenosine triphosphate + Propionic acid + Coenzyme A <> Adenosine monophosphate + Pyrophosphate + Propionyl-CoA
4-amino-2-methyl-5-diphosphomethylpyrimidine + 2-((2R,5Z)-2-Carboxy-4-methylthiazol-5(2H)-ylidene)ethyl phosphate + 2 Hydrogen ion + 2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate > Thiamine monophosphate + Carbon dioxide + diphosphate + Thiamine monophosphate + Pyrophosphate
Biotin + Adenosine triphosphate > diphosphate + Biotinyl-5'-AMP + Pyrophosphate
DG(18:1(9Z)/19:0cycw8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(9Z)/19:0cycw8c) + Pyrophosphate + Pyrophosphate
2 DG(15:0cyclo/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(15:0cyclo/16:0) + Pyrophosphate + Pyrophosphate
2 DG(15:0cyclo/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(18:1(9Z)/18:1(9Z)) + Pyrophosphate + Pyrophosphate
DG(16:1(9Z)/19:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:1(9Z)/19:0) + Pyrophosphate + Pyrophosphate
Bis-molybdopterin guanine dinucleotide + Guanosine triphosphate + Hydrogen ion + Molybdopterin guanine dinucleotide > Guanylyl molybdenum cofactor + Pyrophosphate
L-Carnitine + Coenzyme A + Adenosine triphosphate > D-Carnitinyl-CoA + Adenosine monophosphate + Pyrophosphate
2,3-Dihydroxybenzoic acid + Adenosine triphosphate + Hydrogen ion > (2,3-Dihydroxybenzoyl)adenylic acid + Pyrophosphate
N-Acetyl-glucosamine 1-phosphate + Uridine triphosphate + Hydrogen ion > Uridine diphosphate-N-acetylglucosamine + Pyrophosphate
D-glycero-beta-D-manno-heptose 1-phosphate + Adenosine triphosphate + Hydrogen ion > ADP-D-Glycero-D-manno-heptose + Pyrophosphate
α-D-glucose 1-phosphate + Thymidine 5'-triphosphate + Hydrogen ion > dTDP-D-Glucose + Pyrophosphate
molybdenum cofactor + Cytidine triphosphate + Hydrogen ion > Molybdopterin cytosine dinucleotide + Pyrophosphate
Xanthine + Phosphoribosyl pyrophosphate > Xanthylic acid + Pyrophosphate
More...

SMPDB Pathways:
1,6-anhydro-<i>N</i>-acetylmuramic acid recyclingPW002064 ThumbThumb?image type=greyscaleThumb?image type=simple
ADP-L-glycero-Beta-D-manno-heptose biosynthesisPW002095 ThumbThumb?image type=greyscaleThumb?image type=simple
Amino sugar and nucleotide sugar metabolism IPW000886 ThumbThumb?image type=greyscaleThumb?image type=simple
Amino sugar and nucleotide sugar metabolism IIPW000887 ThumbThumb?image type=greyscaleThumb?image type=simple
Amino sugar and nucleotide sugar metabolism IIIPW000895 ThumbThumb?image type=greyscaleThumb?image type=simple
Asparagine biosynthesisPW000813 ThumbThumb?image type=greyscaleThumb?image type=simple
Aspartate metabolismPW000787 ThumbThumb?image type=greyscaleThumb?image type=simple
Biosynthesis of siderophore group nonribosomal peptidesPW000760 ThumbThumb?image type=greyscaleThumb?image type=simple
Biotin metabolismPW000762 ThumbThumb?image type=greyscaleThumb?image type=simple
Enterobactin BiosynthesisPW002048 ThumbThumb?image type=greyscaleThumb?image type=simple
Fatty acid biosynthesisPW000900 ThumbThumb?image type=greyscaleThumb?image type=simple
Fatty acid metabolismPW000796 ThumbThumb?image type=greyscaleThumb?image type=simple
Flavin biosynthesisPW001971 ThumbThumb?image type=greyscaleThumb?image type=simple
Folate biosynthesisPW000908 ThumbThumb?image type=greyscaleThumb?image type=simple
GTP degradationPW001888 ThumbThumb?image type=greyscaleThumb?image type=simple
Galactose metabolismPW000821 ThumbThumb?image type=greyscaleThumb?image type=simple
L-carnitine degradation IPW002037 ThumbThumb?image type=greyscaleThumb?image type=simple
Lipoic acid metabolismPW000770 ThumbThumb?image type=greyscaleThumb?image type=simple
Lipopolysaccharide biosynthesisPW000831 ThumbThumb?image type=greyscaleThumb?image type=simple
Mannose MetabolismPW000822 ThumbThumb?image type=greyscaleThumb?image type=simple
Menaquinol biosythesisPW001897 ThumbThumb?image type=greyscaleThumb?image type=simple
NAD biosynthesisPW000829 ThumbThumb?image type=greyscaleThumb?image type=simple
NAD salvagePW000830 ThumbThumb?image type=greyscaleThumb?image type=simple
Nitrogen metabolismPW000755 ThumbThumb?image type=greyscaleThumb?image type=simple
O-antigen building blocks biosynthesisPW002089 ThumbThumb?image type=greyscaleThumb?image type=simple
Oxidative phosphorylationPW000919 ThumbThumb?image type=greyscaleThumb?image type=simple
Pantothenate and CoA biosynthesisPW000828 ThumbThumb?image type=greyscaleThumb?image type=simple
Phenylalanine metabolismPW000921 ThumbThumb?image type=greyscaleThumb?image type=simple
Porphyrin metabolismPW000936 ThumbThumb?image type=greyscaleThumb?image type=simple
Propanoate metabolismPW000940 ThumbThumb?image type=greyscaleThumb?image type=simple
Pyrimidine metabolismPW000942 ThumbThumb?image type=greyscaleThumb?image type=simple
Quorum SensingPW000836 ThumbThumb?image type=greyscaleThumb?image type=simple
S-adenosyl-L-methionine biosynthesisPW000837 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolites: Histidine biosynthesisPW000984 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolites: Ubiquinol biosynthesisPW000981 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolites: enterobacterial common antigen biosynthesisPW000959 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary metabolites: Trehalose Biosynthesis and MetabolismPW000968 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary metabolites: isoprenoid biosynthesis (nonmevalonate pathway)PW000975 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary metabolites: methylerythritol phosphate and polyisoprenoid biosynthesisPW000958 ThumbThumb?image type=greyscaleThumb?image type=simple
Starch and sucrose metabolismPW000941 ThumbThumb?image type=greyscaleThumb?image type=simple
Sulfur metabolismPW000922 ThumbThumb?image type=greyscaleThumb?image type=simple
Tryptophan metabolismPW000815 ThumbThumb?image type=greyscaleThumb?image type=simple
Vitamin B1/ThiaminePW000892 ThumbThumb?image type=greyscaleThumb?image type=simple
adenosylcobalamin salvage from cobinamidePW001884 ThumbThumb?image type=greyscaleThumb?image type=simple
arginine metabolismPW000790 ThumbThumb?image type=greyscaleThumb?image type=simple
beta-Alanine metabolismPW000896 ThumbThumb?image type=greyscaleThumb?image type=simple
colanic acid building blocks biosynthesisPW000951 ThumbThumb?image type=greyscaleThumb?image type=simple
cysteine biosynthesisPW000800 ThumbThumb?image type=greyscaleThumb?image type=simple
fatty acid oxidationPW000758 ThumbThumb?image type=greyscaleThumb?image type=simple
galactose degradation/Leloir PathwayPW000884 ThumbThumb?image type=greyscaleThumb?image type=simple
guanylyl molybdenum cofactor biosynthesisPW002032 ThumbThumb?image type=greyscaleThumb?image type=simple
histidine biosynthesisPW000810 ThumbThumb?image type=greyscaleThumb?image type=simple
lipopolysaccharide biosynthesis IIPW001905 ThumbThumb?image type=greyscaleThumb?image type=simple
peptidoglycan biosynthesis IPW000906 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/15:0cyclo/18:1(9Z))PW001064 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/15:0cyclo/19:0cycv8c)PW001065 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/18:1(9Z)/15:0cyclo)PW001082 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CDP-DG(16:0/15:0))PW001745 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CDP-DG(16:1(9Z)/15:0))PW001757 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CDP-DG(18:0/10:0))PW001761 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CDP-DG(18:0/12:0))PW001762 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CDP-DG(18:0/15:0)PW001766 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CDP-DG(18:0/19:1(9Z)))PW001776 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CDP-DG(18:1(9Z)/15:0))PW001782 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CDP-DG(18:1(9Z)/19:1(9Z)))PW001785 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CDP-DG(19:1(9Z)/14:0))PW001788 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CDP-DG(19:1(9Z)/16:0))PW001790 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CDP-DG(19:1(9Z)/18:0))PW001791 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CDP-DG(19:1(9Z)/19:1(9Z)))PW001792 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/10:0/10:0(3-OH)/10:0))PW001899 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/12:0(3-OH)/10:0(3-OH)/12:0(3-OH)))PW001900 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/12:0/10:0(3-OH)/12:0))PW001901 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/15:0cyclo/10:0(3-OH)/15:0cyclo))PW001902 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/16:0/10:0(3-OH)/16:0))PW001904 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/16:1(9Z)/10:0(3-OH)/16:1(9Z)))PW001903 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/17:0cycw7c/10:0(3-OH)/17:0cycw7c))PW001906 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/17:0cycw7c/14:0/14:0))PW001907 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/19:0cycv8c/10:0(3-OH)/19:0cycv8c))PW001908 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/19:iso/10:0(3-OH)/19:iso))PW001909 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0/10:0(3-OH)/10:0/10:0(3-OH)))PW001910 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0/12:0(3-OH)/10:0/12:0(3-OH)))PW001911 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0/17:0cycw7c/14:0/14:0))PW001912 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/10:0(3-OH)/12:0(3-OH)/10:0(3-OH)))PW001913 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/10:0/12:0(3-OH)/10:0))PW001914 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/12:0(3-OH)/12:0/12:0))PW001915 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/12:0/12:0/12:0))PW001917 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/14:0(3-OH)/12:0(3-OH)/14:0(3-OH)))PW001918 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/14:0/12:0(3-OH)/14:0))PW001919 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/15:0/12:0(3-OH)/15:0))PW001920 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/15:0cyclo/12:0(3-OH)/15:0cyclo))PW001921 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/17:0cycw7c/12:0(3-OH)/17:0cycw7c))PW001922 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/17:0cycw7c/12:0/12:0))PW001923 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/18:1(9Z)/12:0(3-OH)/18:1(9Z)))PW001924 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/19:0cycv8c/12:0(3-OH)/19:0cycv8c))PW001925 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/19:iso/12:0(3-OH)/19:iso))PW001926 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0/10:0(3-OH)/12:0/10:0(3-OH)))PW001928 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0/12:0(3-OH)/12:0/12:0))PW001929 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0/12:0/12:0/12:0))PW001930 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0/14:0(3-OH)/12:0/14:0(3-OH)))PW001931 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0/17:0cycw7c/12:0/12:0))PW001932 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0/19:iso/12:0/19:iso))PW001933 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0(3-OH)/12:0(3-OH)/14:0(3-OH)/12:0(3-OH)))PW001934 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0(3-OH)/12:0/14:0(3-OH)/12:0))PW001935 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0(3-OH)/14:0(3-OH)/14:0/14:0))PW001936 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0(3-OH)/14:0/14:0/14:0))PW001937 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0(3-OH)/16:0/16:0/16:0))PW001938 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0(3-OH)/16:1(9Z)/14:0(3-OH)/16:1(9Z)))PW001939 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0(3-OH)/16:1(9Z)/14:0/14:0))PW001940 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0(3-OH)/17:0cycw7c/14:0(3-OH)/17:0cycw7c))PW001941 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0(3-OH)/17:0cycw7c/14:0/14:0))PW001942 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0/12:0(3-OH)/14:0/12:0(3-OH)))PW001943 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0/14:0(3-OH)/14:0/14:0))PW001944 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0/15:0cyclo/17:0cycw7c/14:0)PW001030 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(15:0/10:0(3-OH)/15:0/10:0(3-OH)))PW001945 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(15:0/12:0(3-OH)/15:0/12:0(3-OH)))PW001946 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(15:0/14:0(3-OH)/14:0/14:0))PW001947 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(15:0cyclo/10:0(3-OH)/15:0cyclo/10:0(3-OH)))PW001948 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(15:0cyclo/15:0cyclo/18:1(9Z)/16:0))PW001713 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(15:0cyclo/15:0cyclo/19:0cycv8c/19:0cycv8c))PW001789 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(15:0cyclo/16:0/19:0cycv8c/15:0cyclo))PW001114 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:0/10:0(3-OH)/16:0/10:0(3-OH)))PW001949 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:0/12:0/12:0/12:0)) 2PW001952 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:0/14:0(3-OH)/16:0/14:0(3-OH)))PW001951 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:0/16:0/16:0/16:0))PW002010 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/10:0/14:0/14:0))PW001954 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/12:0/12:0/12:0))PW001955 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/14:0(3-OH)/14:0/14:0))PW001957 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/14:0(3-OH)/16:1(9Z)/14:0(3-OH)))PW001958 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/17:0cycw7c/14:0/17:0cycw7c))PW001959 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/18:1(9Z)/16:1(9Z)/14:0))PW001759 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/19:0/14:0/14:0))PW001960 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/19:0/16:0/16:0))PW001961 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/19:0/16:1(9Z)/19:0))PW001962 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0/16:1(9Z)/14:0/14:0))PW001963 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0/16:1(9Z)/16:0/16:0))PW001964 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/10:0(3-OH)/10:0/10:0))PW001965 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/10:0(3-OH)/14:0/14:0))PW001966 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/10:0(3-OH)/17:0cycw7c/10:0(3-OH)))PW001967 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/10:0/14:0/14:0))PW001968 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/12:0(3-OH)/12:0/12:0))PW001969 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/12:0(3-OH)/17:0cycw7c/12:0(3-OH)))PW001970 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/12:0/12:0/12:0))PW001972 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/14:0/17:0cycw7c))PW001692 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/16:1(9Z)/14:0))PW001694 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/17:0cycw7c/14:0))PW001695 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/17:0cycw7c/16:1(9Z)))PW001696 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/17:0cycw7c/17:0cycw7c))PW001697 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/17:0cycw7c/18:1(9Z)))PW001698 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/17:0cycw7c/19:0cycv8c))PW001699 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/18:1(9Z)/17:0cycw7c))PW001700 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/19:0cycv8c/17:0cycw7c))PW001701 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/15:0cyclo))PW001702 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/16:0))PW001703 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/16:1(9Z)))PW001704 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/17:0cycw7c))PW001705 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/18:1(9Z)))PW001706 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/19:0cycv8c))PW001707 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/17:0cycw7c/14:0))PW001708 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/17:0cycw7c/17:0cycw7c))PW001709 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/14:0/14:0))PW001710 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/14:0/17:0cycw7c))PW001711 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/14:0/18:1(9Z)))PW001712 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/17:0cycw7c/14:0))PW001464 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/17:0cycw7c/17:0cycw7c))PW001465 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/17:0cycw7c/18:1(9Z)))PW001466 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/17:0cycw7c/19:0cycv8c))PW001467 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/18:1(9Z)/14:0))PW001473 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/19:0cycv8c/17:0cycw7c))PW001474 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/14:0/14:0))PW001475 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/14:0/17:0cycw7c))PW001476 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/14:0/19:0cycv8c))PW001482 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/17:0cycw7c/14:0))PW001483 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/17:0cycw7c/19:0cycv8c))PW001484 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/19:0cycv8c/14:0))PW001485 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/19:iso/17:0cycw7c/19:iso))PW001973 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:0/10:0/10:0/10:0))PW001974 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:0/12:0/12:0/12:0))PW001975 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(11Z)/10:0/10:0/10:0))PW001976 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(11Z)/12:0/12:0/12:0))PW001977 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(11Z)/17:0/14:0/14:0))PW001978 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(11Z)/19:0/14:0/14:0))PW001979 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(11Z)/19:0/18:1(11Z)/19:0))PW001980 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(11Z)/19:0/19:0/19:0))PW001981 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/12:0(3-OH)/18:1(9Z)/12:0(3-OH)))PW001982 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/14:0/14:0))PW001493 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/14:0/17:0cycw7c))PW001492 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/14:0/18:1(9Z)))PW001494 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/14:0/19:0cycv8c))PW001495 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/17:0cycw7c/14:0))PW001498 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/17:0cycw7c/17:0cycw7c))PW001499 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/18:1(9Z)/14:0))PW001500 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/19:0cycv8c/14:0))PW001502 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/19:0cycv8c/19:0cycv8c) 2)PW001781 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/19:0cycv8c/19:0cycv8c))PW001506 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/14:0/15:0cyclo) 5)PW001717 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/14:0/15:0cyclo))PW001507 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/14:0/18:1(9Z)))PW001514 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/15:0cyclo/14:0))PW001515 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/15:0cyclo/17:0cycw7c))PW001516 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/15:0cyclo/19:0cycv8c))PW001517 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/16:0/18:1(9Z)))PW001518 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/16:1(9Z)/18:1(9Z)))PW001519 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/17:0cycw7c/15:0cyclo))PW001527 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/17:0cycw7c/17:0cycw7c))PW001528 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/17:0cycw7c/18:1(9Z)))PW001529 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/14:0))PW001530 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/15:0cyclo))PW001531 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/16:0))PW001532 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/16:1(9Z)))PW001533 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/17:0cycw7c))PW001534 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/18:1(9Z)))PW001540 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/19:0cycv8c))PW001541 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/19:0cycv8c/15:0cyclo))PW001577 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/19:0cycv8c/18:1(9Z)))PW001578 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/19:0cycv8c/19:0cycv8c))PW001579 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/14:0/14:0))PW001580 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/14:0/16:0))PW001581 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/14:0/18:1(9Z)))PW001582 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/16:0/14:0))PW002011 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/16:0/17:0cycw7c))PW002012 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/16:0/19:0cycv8c) 2)PW001783 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/16:0/19:0cycv8c))PW001583 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/16:1(9Z)/18:1(9Z)))PW002013 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/17:0cycw7c/16:0))PW001584 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/17:0cycw7c/17:0cycw7c))PW001585 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/17:0cycw7c/18:1(9Z)))PW001586 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/14:0))PW001587 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/16:0))PW001588 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/16:1(9Z)))PW001594 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/17:0cycw7c))PW001595 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/18:1(9Z)))PW001596 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/19:0cycv8c))PW001597 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/19:0cycv8c/16:0))PW001598 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/19:0cycv8c/18:1(9Z)))PW001599 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/19:0cycv8c/19:0cycv8c))PW001600 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/14:0/14:0))PW001601 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/14:0/16:1(9Z)))PW001607 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/14:0/18:1(9Z)))PW001608 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/16:1(9Z)/14:0))PW001609 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/16:1(9Z)/17:0cycw7c))PW001610 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/16:1(9Z)/19:0cycv8c))PW001612 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/17:0cycw7c/16:1(9Z)))PW001613 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/17:0cycw7c/17:0cycw7c))PW001618 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/17:0cycw7c/18:1(9Z)))PW001619 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/18:1(9Z)/14:0))PW001620 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/18:1(9Z)/16:1(9Z)))PW001621 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/18:1(9Z)/17:0cycw7c))PW002014 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/18:1(9Z)/18:1(9Z)))PW001622 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/18:1(9Z)/19:0cycv8c))PW001623 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/19:0cycv8c/16:1(9Z)))PW001629 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/19:0cycv8c/18:1(9Z)) 2)PW001784 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/19:0cycv8c/18:1(9Z)))PW001630 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/19:0cycv8c/19:0cycv8c))PW001632 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/14:0/14:0))PW001633 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/14:0/17:0cycw7c))PW001634 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/14:0/18:1(9Z)))PW001635 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/17:0cycw7c/14:0))PW001638 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/17:0cycw7c/17:0cycw7c))PW001640 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/17:0cycw7c/18:1(9Z)))PW001644 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/17:0cycw7c/19:0cycv8c))PW001645 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/18:1(9Z)/14:0))PW001646 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/18:1(9Z)/17:0cycw7c))PW001647 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/19:0cycv8c/17:0cycw7c))PW001648 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/14:0))PW001649 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/15:0cyclo))PW001664 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/16:0))PW001665 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/16:1(9Z)))PW001666 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/17:0cycw7c))PW001667 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/18:1(9Z)))PW001668 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/19:0cycv8c))PW001669 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/14:0))PW001670 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/15:0cyclo))PW001671 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/16:0))PW001672 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/16:1(9Z)))PW001673 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/17:0cycw7c))PW001679 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/18:1(9Z)))PW001680 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/19:0cycv8c))PW001685 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/18:1(9Z)/14:0))PW001686 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/18:1(9Z)/17:0cycw7c))PW001687 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/18:1(9Z)/19:0cycv8c))PW001026 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/18:1(9Z)/19:0cycv8c)) 1440195714PW001034 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/18:1(9Z)/19:0cycv8c)) 2PW001186 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/14:0))PW001688 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/15:0cyclo))PW001185 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/16:0))PW001194 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/16:0)) 1442332377PW001956 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/16:1(9Z))PW001212 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/17:0cycw7c))PW001210 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/14:0/14:0))PW001211 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/14:0/18:1(9Z)))PW001233 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/14:0/19:0cycv8c))PW001234 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/17:0cycw7c/17:0cycw7c))PW001240 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/17:0cycw7c/18:1(9Z)))PW001241 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/18:1(9Z)/14:0))PW001244 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/18:1(9Z)/17:0cycw7c))PW001248 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/19:0cycv8c/14:0))PW001249 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1/18:1/18:1/18:1))PW001027 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0/16:1(9Z)/14:0/14:0))PW001983 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0/16:1(9Z)/16:0/16:0))PW001984 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0/16:1(9Z)/19:0/16:1(9Z)))PW001985 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0/18:1(11Z)/14:0/14:0))PW001986 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0/18:1(11Z)/19:0/18:1(11Z)))PW001987 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0/18:1(11Z)/19:0/19:0))PW001988 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/10:0(3-OH)/10:0/10:0))PW001989 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/10:0(3-OH)/19:0cycv8c/10:0(3-OH)))PW001991 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/12:0(3-OH)/12:0/12:0))PW001992 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/12:0(3-OH)/19:0cycv8c/12:0(3-OH)))PW001993 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/14:0/14:0/17:0cycw7c))PW001251 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/14:0/14:0/19:0cycv8c))PW001253 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/14:0/17:0cycw7c/14:0))PW001262 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/14:0/17:0cycw7c/17:0cycw7c))PW001263 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/14:0/19:0cycv8c/14:0))PW001275 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/14:0/15:0cyclo))PW001276 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/14:0/19:0cycv8c))PW001291 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/15:0cyclo/14:0))PW001292 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/15:0cyclo/17:0cycw7c))PW001298 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/16:0/19:0cycv8c))PW001299 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/16:1(9Z)/19:0cycv8c))PW001300 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/17:0cycw7c/15:0cyclo))PW001301 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/17:0cycw7c/17:0cycw7c))PW001302 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/18:1(9Z)/19:0cycv8c))PW001304 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/14:0))PW001309 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/15:0cyclo))PW001310 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/16:0))PW001316 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/16:1(9Z)))PW001317 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/18:1(9Z)))PW001318 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/19:0cycv8c))PW001319 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/14:0/14:0))PW001320 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/14:0/16:0))PW001321 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/14:0/19:0cycv8c))PW001322 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/16:0/14:0))PW001323 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/16:0/17:0cycw7c))PW001324 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/16:1(9Z)/19:0cycv8c))PW001326 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/17:0cycw7c/16:0))PW001331 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/17:0cycw7c/17:0cycw7c))PW001332 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/17:0cycw7c/19:0cycv8c))PW001333 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/18:1(9Z)/19:0cycv8c))PW001334 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/19:0cycv8c/14:0))PW001340 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/19:0cycv8c/16:1(9Z)))PW001341 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/19:0cycv8c/17:0cycw7c))PW001372 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/19:0cycv8c/18:1(9Z)))PW001373 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/14:0/14:0))PW001374 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/14:0/16:1(9Z)))PW001375 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/14:0/19:0cycv8c))PW001376 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/16:1(9Z)/14:0))PW001377 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/16:1(9Z)/17:0cycw7c))PW001383 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/17:0cycw7c/16:1(9Z)))PW001384 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/17:0cycw7c/17:0cycw7c))PW001385 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/17:0cycw7c/19:0cycv8c))PW001386 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/18:1(9Z)/19:0cycv8c))PW001387 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/19:0cycv8c/14:0))PW001388 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/19:0cycv8c/16:1(9Z)))PW001394 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/19:0cycv8c/17:0cycw7c))PW001395 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/19:0cycv8c/18:1(9Z)))PW001396 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/14:0/14:0))PW001397 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/14:0/17:0cycw7c))PW001403 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/14:0/19:0cycv8c))PW001404 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/17:0cycw7c/14:0))PW001405 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/17:0cycw7c/19:0cycv8c))PW001406 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/19:0cycv8c/14:0))PW001407 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/19:0cycv8c/17:0cycw7c))PW001408 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/14:0/14:0))PW001414 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/14:0/18:1(9Z)))PW001415 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/14:0/19:0cycv8c))PW001420 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/17:0cycw7c/17:0cycw7c))PW001422 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/17:0cycw7c/18:1(9Z)))PW001423 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/18:1(9Z)/14:0))PW001424 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/18:1(9Z)/17:0cycw7c))PW001426 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/19:0cycv8c/14:0))PW001428 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/14:0))PW001432 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/15:0cyclo))PW001433 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/16:0))PW001434 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/16:1(9Z)))PW001435 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/17:0cycw7c))PW001436 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/18:1(9Z)))PW001438 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/19:0cycv8c))PW001443 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/17:0cycw7c/14:0))PW001444 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/17:0cycw7c/16:0))PW001445 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/17:0cycw7c/16:1(9Z)))PW001446 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/17:0cycw7c/17:0cycw7c))PW001447 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/19:0cycv8c/14:0))PW001448 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycw8c/10:0/10:0/10:0))PW001994 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:1(9Z)/16:1(9Z)/19:1(9Z)/16:1(9Z)))PW001995 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/10:0(3-OH)/10:0/10:0))PW001996 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/10:0(3-OH)/19:iso/10:0(3-OH)))PW001997 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/10:0/19:iso/10:0))PW001998 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/12:0(3-OH)/12:0/12:0))PW001999 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/12:0(3-OH)/19:iso/12:0(3-OH)))PW002000 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/12:0/19:iso/12:0))PW002001 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/14:0(3-OH)/14:0/14:0))PW002002 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/14:0(3-OH)/19:iso/14:0(3-OH)))PW002004 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/14:0/14:0/14:0))PW002005 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/14:0/19:iso/14:0))PW002006 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/17:0cycw7c/19:0/19:0))PW002007 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/19:0cycv8c/19:0/19:0))PW002008 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/19:iso/19:iso/19:iso))PW002009 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(16:0/10:0(3-OH)))PW001741 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(16:0/12:0(3-OH)))PW001744 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(16:0/18:0))PW001748 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(16:0/19:iso))PW001751 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(16:1(9Z)/10:0(3-OH)))PW001753 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(16:1(9Z)/12:0(3-OH)))PW001755 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(16:1(9Z)/18:0))PW001758 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(16:1(9Z)/19:iso))PW001760 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(18:0/14:0))PW001765 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(18:0/16:0))PW001767 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(18:0/16:1(9Z)))PW001770 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(18:0/18:0))PW001772 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(18:0/18:1(9Z)))PW001774 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(18:1(9Z)/10:0(3-OH)))PW001779 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(18:1(9Z)/12:0(3-OH)))PW001780 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(19:iso/10:0))PW001786 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(19:iso/12:0))PW001787 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/10:0) IPW001743 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/10:0) IIPW001815 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/10:0) IIIPW001816 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/10:0) IVPW001817 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/12:0)PW001746 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/12:0) IIPW001818 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/12:0) IIIPW001819 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/12:0) IVPW001820 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/14:0)PW001747 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/14:0) IIPW001821 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/14:0) IIIPW001822 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/14:0) IVPW001823 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/15:0)PW001749 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/15:0) IIPW001826 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/15:0) IIIPW001825 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/16:0)PW001750 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/16:0) IIPW001827 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/16:1(9Z))PW001752 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/16:1(9Z)) IIPW001828 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/18:0)PW001754 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/18:0) IIIPW001833 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/18:1(9Z))PW001756 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/19:1(9Z))PW001763 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/19:1(9Z)) IIPW001829 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/19:1(9Z)) IIIPW001830 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/19:1(9Z)) IVPW001831 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/19:1(9Z)) VPW001832 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/10:0)PW001764 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/10:0) IIPW001834 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/10:0) IIIPW001835 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/10:0) IVPW001844 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/14:0)PW001768 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/14:0) IIPW001836 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/14:0) IIIPW001837 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/14:0) IVPW001840 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/15:0)PW001769 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/15:0) IIPW001838 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/15:0) IIIPW001839 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/16:0)PW001771 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/16:0) IIPW001841 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/16:1(9Z))PW001773 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/16:1(9Z)) IIPW001842 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/18:0)PW001775 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/18:1(9Z))PW001777 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/18:1(9Z)) IIPW001843 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/19:1(9Z))PW001778 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/19:1(9Z)) IIPW001848 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/19:1(9Z)) IIIPW001847 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/19:1(9Z)) IVPW001846 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/19:1(9Z)) VPW001845 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/10:0)PW001793 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/10:0) IIPW001852 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/10:0) IIIPW001851 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/10:0) IVPW001850 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/12:0)PW001794 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/12:0) IIPW001855 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/12:0) IIIPW001854 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/12:0) IVPW001853 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/15:0)PW001795 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/15:0) IIPW001857 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/18:0)PW001802 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/18:1(9Z))PW001803 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/19:1(9Z))PW001804 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/19:1(9Z)) IIPW001858 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(15:0/10:0)PW001805 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(15:0/10:0) IIPW001859 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(15:0/12:0)PW001806 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(15:0/12:0) IIPW001861 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(15:0/12:0) IIIPW001862 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(15:0/14:0)PW001807 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(15:0/15:0)PW001808 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(15:0/16:0)PW001809 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(15:0/16:1(9Z))PW001810 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(15:0/18:0)PW001811 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(15:0/18:1(9Z))PW001812 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(15:0/19:1(9Z))PW001813 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(16:0/10:0)PW001814 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/15:0cyclo/14:0/17:0cycw7c)PW001029 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:0/14:0/14:0)PW001031 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:0/14:0/16:0)PW001032 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:0/14:0/16:1(9Z))PW001871 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:0/14:0/18:1(9Z))PW001033 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:0/14:0/19:0cycv8c)PW001035 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:0/16:1(9Z)/14:0)PW001036 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:0/18:1(9Z)/14:0)PW001037 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:0/19:0cycv8c/14:0)PW001038 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:1(9Z)/14:0/16:1(9Z))PW001039 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:1(9Z)/14:0/18:1(9Z))PW001040 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:1(9Z)/14:0/19:0cycv8c)PW001041 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:1(9Z)/18:1(9Z)/14:0)PW001042 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:1(9Z)/19:0cycv8c/14:0)PW001043 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/14:0/14:0)PW001044 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/14:0/17:0cycw7c)PW001045 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/14:0/18:1(9Z))PW001046 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/14:0/19:0cycv8c)PW001047 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/17:0cycw7c/14:0)PW001048 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/19:0cycv8c/14:0)PW001049 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/19:0cycv8c/14:0/17:0cycw7c)PW001050 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/19:0cycv8c/14:0/19:0cycv8c)PW001051 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/19:0cycv8c/17:0cycw7c/14:0)PW001052 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/14:0/14:0/17:0cycw7c)PW001053 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/14:0/16:1(9Z)/16:1(9Z))PW001054 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/14:0/17:0cycw7c/14:0)PW001055 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/14:0/17:0cycw7c/17:0cycw7c)PW001056 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/14:0/18:1(9Z)/18:1(9Z))PW001057 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/14:0/19:0cycv8c/19:0cycv8c)PW001058 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/14:0/16:0)PW001059 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/14:0/16:1(9Z))PW001060 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/14:0/18:1(9Z))PW001061 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/14:0/19:0cycv8c)PW001062 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:0/14:0)PW001066 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:0/16:1(9Z))PW001063 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:0/17:0cycw7c)PW001067 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:0/18:1(9Z))PW001069 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:0/19:0cycv8c)PW001070 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:1(9Z)/14:0)PW001071 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:1(9Z)/16:0)PW001072 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:1(9Z)/16:1(9Z))PW001068 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:1(9Z)/17:0cycw7c)PW001073 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:1(9Z)/18:1(9Z))PW001074 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:1(9Z)/19:0cycv8c)PW001075 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/17:0cycw7c/16:0)PW001076 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/17:0cycw7c/16:1(9Z))PW001077 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/17:0cycw7c/17:0cycw7c)PW001078 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/17:0cycw7c/18:1(9Z))PW001079 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/17:0cycw7c/19:0cycv8c)PW001080 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/18:1(9Z)/14:0)PW001081 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/18:1(9Z)/16:1(9Z))PW001083 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/18:1(9Z)/17:0cycw7c)PW001084 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/18:1(9Z)/18:1(9Z))PW001085 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/18:1(9Z)/19:0cycv8c)PW001086 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/14:0)PW001087 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/15:0cyclo)PW001088 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/16:0)PW001089 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/16:1(9Z))PW001090 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/17:0cycw7c)PW001091 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/18:1(9Z))PW001092 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/19:0cycv8c)PW001093 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/14:0/15:0cyclo)PW001094 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/15:0cyclo/14:0)PW001095 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/15:0cyclo/16:1(9Z))PW001096 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/15:0cyclo/17:0cycw7c)PW001097 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/15:0cyclo/18:1(9Z))PW001098 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/15:0cyclo/19:0cycv8c)PW001099 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:0/16:0)PW001100 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:0/16:1(9Z))PW001102 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:0/17:0cycw7c)PW001103 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:0/18:1(9Z))PW001104 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:0/19:0cycv8c)PW001105 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:1(9Z)/15:0cyclo)PW001107 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:1(9Z)/16:0)PW001106 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:1(9Z)/16:1(9Z))PW001108 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/17:0cycw7c/15:0cyclo)PW001101 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/17:0cycw7c/16:0)PW001109 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/17:0cycw7c/17:0cycw7c)PW001110 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/18:1(9Z)/15:0cyclo)PW001111 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/18:1(9Z)/16:0)PW001112 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/18:1(9Z)/18:1(9Z))PW001113 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/19:0cycv8c/16:0)PW001115 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:0/19:0cycv8c/19:0cycv8c)PW001116 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/14:0/15:0cyclo)PW001117 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/14:0/16:1(9Z))PW001118 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/15:0cyclo/14:0)PW001119 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/15:0cyclo/16:1(9Z))PW001120 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/15:0cyclo/17:0cycw7c)PW001121 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/15:0cyclo/18:1(9Z))PW001122 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/15:0cyclo/19:0cycv8c)PW001123 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:0/16:0)PW001124 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:0/16:1(9Z))PW001125 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:1(9Z)/14:0)PW001126 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:1(9Z)/15:0cyclo)PW001127 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:1(9Z)/16:0)PW001128 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:1(9Z)/16:1(9Z))PW001129 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:1(9Z)/17:0cycw7c)PW001130 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:1(9Z)/18:1(9Z))PW001131 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:1(9Z)/19:0cycv8c)PW001132 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/17:0cycw7c/15:0cyclo)PW001133 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/17:0cycw7c/16:1(9Z))PW001134 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/17:0cycw7c/17:0cycw7c)PW001135 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/18:1(9Z)/15:0cyclo)PW001136 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/18:1(9Z)/16:1(9Z))PW001137 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/18:1(9Z)/18:1(9Z))PW001138 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/19:0cycv8c/15:0cyclo)PW001139 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/19:0cycv8c/16:1(9Z))PW001140 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/19:0cycv8c/19:0cycv8c)PW001141 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/14:0/14:0)PW001142 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/14:0/17:0cycw7c)PW001143 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/15:0cyclo/17:0cycw7c)PW001144 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/16:0/16:0)PW001145 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/16:0/17:0cycw7c)PW001146 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/16:1(9Z)/16:1(9Z))PW001147 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/16:1(9Z)/17:0cycw7c)PW001148 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/17:0cycw7c)/16:0)PW001151 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/17:0cycw7c/14:0)PW001149 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/17:0cycw7c/15:0cyclo)PW001150 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/17:0cycw7c/16:1(9Z))PW001152 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/17:0cycw7c/17:0cycw7c)PW001153 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/17:0cycw7c/18:1(9Z))PW001154 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/17:0cycw7c/19:0cycv8c)PW001155 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/18:1(9Z)/17:0cycw7c)PW001156 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/18:1(9Z)/18:1(9Z))PW001157 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/19:0cycv8c/17:0cycw7c)PW001158 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/14:0/15:0cyclo)PW001159 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/14:0/18:1(9Z))PW001160 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/15:0cyclo/14:0)PW001161 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/15:0cyclo/17:0cycw7c)PW001162 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/15:0cyclo/18:1(9Z))PW001163 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/15:0cyclo/19:0cycv8c)PW001164 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/16:0/16:0)PW001165 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/16:0/18:1(9Z))PW001166 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/16:1(9Z)/16:1(9Z))PW001167 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/16:1(9Z)/18:1(9Z))PW001168 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/17:0cycw7c/15:0cyclo)PW001169 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/17:0cycw7c/17:0cycw7c)PW001170 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/17:0cycw7c/18:1(9Z))PW001171 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/18:1(9Z)/14:0)PW001172 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/18:1(9Z)/15:0cyclo)PW001173 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/18:1(9Z)/16:0)PW001174 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/18:1(9Z)/16:1(9Z))PW001175 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/18:1(9Z)/17:0cycw7c)PW001176 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/18:1(9Z)/18:1(9Z))PW001177 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/18:1(9Z)/19:0cycv8c)PW001178 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/19:0cycv8c/15:0cyclo)PW001179 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/19:0cycv8c/18:1(9Z))PW001180 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/19:0cycv8c/19:0cycv8c)PW001181 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/14:0/15:0cyclo)PW001182 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/14:0/19:0cycv8c)PW001183 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/15:0cyclo/14:0)PW001184 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/15:0cyclo/17:0cycw7c)PW001187 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/15:0cyclo/19:0cycv8c)PW001188 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/16:0/16:0)PW001189 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/16:0/19:0cycv8c)PW001190 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/16:1(9Z)/16:1(9Z))PW001191 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/16:1(9Z)/19:0cycv8c)PW001192 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/17:0cycw7c/15:0cyclo)PW001193 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/17:0cycw7c/17:0cycw7c)PW001195 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/18:1(9Z)/18:1(9Z))PW001196 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/18:1(9Z)/19:0cycv8c)PW001197 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/19:0cycv8c/14:0)PW001198 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/19:0cycv8c/15:0cyclo)PW001199 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/19:0cycv8c/16:0)PW001200 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/19:0cycv8c/16:1(9Z))PW001201 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/19:0cycv8c/18:1(9Z))PW001202 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/19:0cycv8c/19:0cycv8c)PW001203 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/14:0/14:0)PW001204 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/14:0/16:0)PW001205 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/14:0/16:1(9Z))PW001206 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/14:0/18:1(9Z))PW001207 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/14:0/19:0cycv8c)PW001208 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/16:0/14:0)PW001209 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/16:1(9Z)/14:0)PW001213 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/16:1(9Z)/16:1(9Z))PW001214 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/17:0cycw7c/17:0cycw7c)PW001215 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/18:1(9Z)/14:0)PW001216 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/18:1(9Z)/18:1(9Z))PW001217 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/19:0cycv8c/14:0)PW001218 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/14:0/19:0cycv8c/19:0cycv8c)PW001219 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/14:0/15:0cyclo)PW001220 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/15:0cyclo/14:0)PW001221 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/15:0cyclo/16:1(9Z))PW001222 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/15:0cyclo/17:0cycw7c)PW001223 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/15:0cyclo/18:1(9Z))PW001224 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/15:0cyclo/19:0cycv8c)PW001225 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/16:0/16:0)PW001226 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/16:0/16:1(9Z))PW001227 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/16:0/17:0cycw7c)PW001228 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/16:0/18:1(9Z))PW001229 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/16:0/19:0cycv8c)PW001230 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/16:1(9Z)/15:0cyclo)PW001231 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/16:1(9Z)/16:0)PW001232 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/16:1(9Z)/16:1(9Z))PW001235 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/17:0cycw7c/15:0cyclo)PW001236 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/17:0cycw7c/16:0)PW001237 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/17:0cycw7c/17:0cycw7c)PW001238 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/18:1(9Z)/15:0cyclo)PW001239 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/18:1(9Z)/16:0)PW001242 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/18:1(9Z)/18:1(9Z))PW001243 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/19:0cycv8c/15:0cyclo)PW001245 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/19:0cycv8c/16:0)PW001246 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/15:0cyclo/19:0cycv8c/19:0cycv8c)PW001247 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/14:0/14:0)PW001250 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/14:0/16:1(9Z))PW001252 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/14:0/17:0cycw7c)PW001254 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/14:0/18:1(9Z))PW001255 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/14:0/19:0cycv8c)PW001256 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/16:0/17:0cycw7c)PW001257 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/16:0/18:1(9Z))PW001258 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/16:0/19:0cycv8c)PW001259 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/16:1(9Z)/14:0)PW001260 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/16:1(9Z)/15:0cyclo)PW001261 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/16:1(9Z)/16:0)PW001264 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/16:1(9Z)/16:1(9Z))PW001265 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/16:1(9Z)/17:0cycw7c)PW001267 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/16:1(9Z)/18:1(9Z))PW001268 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/16:1(9Z)/19:0cycv8c)PW001269 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/17:0cycw7c/14:0)PW001270 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/17:0cycw7c/15:0cyclo)PW001271 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/17:0cycw7c/16:0)PW001272 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/17:0cycw7c/16:1(9Z))PW001273 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/17:0cycw7c/17:0cycw7c)PW001274 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/17:0cycw7c/18:1(9Z))PW001277 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/17:0cycw7c/19:0cycv8c)PW001278 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/18:1(9Z)/14:0)PW001266 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/18:1(9Z)/15:0cyclo)PW001279 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/18:1(9Z)/16:0)PW001280 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/18:1(9Z)/16:1(9Z))PW001281 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/18:1(9Z)/17:0cycw7c)PW001282 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/18:1(9Z)/18:1(9Z))PW001283 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/18:1(9Z)/19:0cycv8c)PW001284 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/19:0cycv8c/14:0)PW001285 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/19:0cycv8c/15:0cyclo)PW001286 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/19:0cycv8c/16:0)PW001287 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/19:0cycv8c/16:1(9Z))PW001288 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/19:0cycv8c/17:0cycw7c)PW001289 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:0/19:0cycv8c/18:1(9Z))PW001290 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/14:0/14:0)PW001293 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/14:0/16:0)PW001294 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/14:0/16:1(9Z))PW001295 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:0/14:0)PW001296 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:0/16:1(9Z))PW001297 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:0/17:0cycw7c)PW001303 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:0/18:1(9Z))PW001305 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:0/19:0cycv8c)PW001306 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:1(9Z)/14:0)PW001307 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:1(9Z)/16:0)PW001308 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:1(9Z)/16:1(9Z))PW001311 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:1(9Z)/17:0cycw7c)PW001312 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:1(9Z)/18:1(9Z))PW001313 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/17:0cycw7c/16:0)PW001315 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/17:0cycw7c/16:1(9Z))PW001325 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/17:0cycw7c/17:0cycw7c)PW001327 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/18:1(9Z)/16:0)PW001328 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/18:1(9Z)/16:1(9Z))PW001329 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/18:1(9Z)/18:1(9Z))PW001330 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/19:0cycv8c/16:0)PW001335 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/19:0cycv8c/16:1(9Z))PW001336 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/19:0cycv8c/19:0cycv8c)PW001337 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/14:0/16:0)PW001338 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/14:0/17:0cycw7c)PW001339 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/16:0/14:0)PW001342 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/16:0/17:0cycw7c)PW001343 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/16:1(9Z)/16:1(9Z))PW001344 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/16:1(9Z)/17:0cycw7c)PW001345 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/17:0cycw7c/14:0)PW001346 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/17:0cycw7c/16:1(9Z))PW001347 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/17:0cycw7c/17:0cycw7c)PW001351 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/17:0cycw7c/18:1(9Z))PW001348 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/17:0cycw7c/19:0cycv8c)PW001349 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/18:1(9Z)/17:0cycw7c)PW001350 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/18:1(9Z)/18:1(9Z))PW001352 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/19:0cycv8c/17:0cycw7c)PW001353 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/19:0cycv8c/19:0cycv8c)PW001354 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/14:0/14:0)PW001355 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/14:0/16:0)PW001356 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/14:0/18:1(9Z))PW001357 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/16:0/14:0)PW001358 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/16:0/17:0cycw7c)PW001359 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/16:0/18:1(9Z))PW001360 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/16:0/19:0cycv8c)PW001361 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/16:1(9Z)/16:1(9Z))PW001362 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/16:1(9Z)/18:1(9Z))PW001363 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/17:0cycw7c/16:0)PW001364 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/17:0cycw7c/17:0cycw7c)PW001365 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/17:0cycw7c/18:1(9Z))PW001366 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/18:1(9Z)/14:0)PW001367 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/18:1(9Z)/16:0)PW001368 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/18:1(9Z)/16:1(9Z))PW001369 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/18:1(9Z)/17:0cycw7c)PW001370 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/18:1(9Z)/18:1(9Z))PW001371 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/18:1(9Z)/19:0cycv8c)PW001378 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/19:0cycv8c/16:0)PW001379 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/19:0cycv8c/18:1(9Z))PW001380 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/19:0cycv8c/19:0cycv8c)PW001381 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/14:0/14:0)PW001382 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/14:0/16:0)PW001389 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/14:0/19:0cycv8c)PW001390 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/16:0/14:0)PW001391 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/16:0/17:0cycw7c)PW001392 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/16:1(9Z)/16:1(9Z))PW001393 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/16:1(9Z)/19:0cycv8c)PW001398 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/17:0cycw7c/16:0)PW001399 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/17:0cycw7c/17:0cycw7c)PW001400 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/17:0cycw7c/19:0cycv8c)PW001401 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/18:1(9Z)/18:1(9Z))PW001402 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/18:1(9Z)/19:0cycv8c)PW001409 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/19:0cycv8c/14:0)PW001410 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/19:0cycv8c/16:1(9Z))PW001411 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/19:0cycv8c/17:0cycw7c)PW001412 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/19:0cycv8c/18:1(9Z))PW001413 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/14:0/16:1(9Z))PW001416 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/14:0/18:1(9Z))PW001417 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/14:0/19:0cycv8c)PW001418 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/16:1(9Z)/14:0)PW001419 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/17:0cycw7c/17:0cycw7c)PW001421 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/18:1(9Z)/14:0)PW001425 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/18:1(9Z)/18:1(9Z))PW001427 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/19:0cycv8c/14:0)PW001429 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/19:0cycv8c/19:0cycv8c)PW001430 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/14:0/15:0cyclo)PW001431 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/14:0/16:1(9Z))PW001437 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/15:0cyclo/14:0) )PW001724 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/15:0cyclo/17:0cycw7c)PW001440 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/15:0cyclo/18:1(9Z))PW001441 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/15:0cyclo/19:0cycv8c)PW001442 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/16:0/16:1(9Z))PW001449 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/16:1(9Z)/14:0)PW001450 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/16:1(9Z)/15:0cyclo)PW001451 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/16:1(9Z)/16:0)PW001452 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/16:1(9Z)/16:1(9Z))PW001453 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/16:1(9Z)/18:1(9Z))PW001455 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/16:1(9Z)/19:0cycv8c)PW001456 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/17:0cycw7c/15:0cyclo)PW001457 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/17:0cycw7c/16:1(9Z))PW001458 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/17:0cycw7c/17:0cycw7c)PW001459 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/18:1(9Z)/15:0cyclo)PW001460 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/18:1(9Z)/16:1(9Z))PW001461 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/18:1(9Z)/18:1(9Z))PW001462 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/19:0cycv8c/15:0cyclo)PW001463 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/19:0cycv8c/16:1(9Z))PW001468 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/19:0cycv8c/19:0cycv8c)PW001469 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/14:0/14:0)PW001470 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/14:0/16:0)PW001471 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/14:0/16:1(9Z))PW001472 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:0/14:0)PW001477 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:0/17:0cycw7c)PW001478 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:0/18:1(9Z))PW001479 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:0/19:0cycv8c)PW001480 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:1(9Z)/14:0)PW001481 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:1(9Z)/16:0)PW001486 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:1(9Z)/16:1(9Z))PW001487 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:1(9Z)/17:0cycw7c)PW001488 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:1(9Z)/18:1(9Z))PW001489 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:1(9Z)/19:0cycv8c)PW001490 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/17:0cycw7c/16:0)PW001491 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/17:0cycw7c/16:1(9Z))PW001496 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/17:0cycw7c/17:0cycw7c)PW001497 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/18:1(9Z)/16:0)PW001501 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/18:1(9Z)/16:1(9Z))PW001503 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/18:1(9Z)/18:1(9Z))PW001504 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/19:0cycv8c/16:0)PW001505 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/19:0cycv8c/16:1(9Z))PW001508 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/19:0cycv8c/19:0cycv8c)PW001509 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/14:0/14:0)PW001510 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/14:0/15:0cyclo)PW001511 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/14:0/16:0)PW001512 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/14:0/16:1(9Z))PW001513 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/14:0/17:0cycw7c)PW001520 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/14:0/18:1(9Z))PW001521 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/14:0/19:0cycv8c)PW001522 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/16:1(9Z)/14:0)PW001523 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/16:1(9Z)/17:0cycw7c)PW001524 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/16:1(9Z)/18:1(9Z))PW001525 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/16:1(9Z)/19:0cycv8c)PW001526 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/17:0cycw7c/14:0)PW001535 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/17:0cycw7c/15:0cyclo)PW001536 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/17:0cycw7c/16:0)PW001537 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/17:0cycw7c/16:1(9Z))PW001538 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/17:0cycw7c/17:0cycw7c)PW001539 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/17:0cycw7c/18:1(9Z))PW001542 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/17:0cycw7c/19:0cycv8c)PW001543 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/18:1(9Z)/14:0)PW001544 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/18:1(9Z)/15:0cyclo)PW001545 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/18:1(9Z)/16:0)PW001546 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/18:1(9Z)/16:1(9Z))PW001547 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/18:1(9Z)/17:0cycw7c)PW001548 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/18:1(9Z)/18:1(9Z))PW001549 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/18:1(9Z)/19:0cycv8c)PW001550 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/19:0cycv8c/14:0)PW001551 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/19:0cycv8c/15:0cyclo)PW001552 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/19:0cycv8c/16:0)PW001553 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/19:0cycv8c/16:1(9Z))PW001554 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/19:0cycv8c/17:0cycw7c)PW001555 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/19:0cycv8c/18:1(9Z))PW001556 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/19:0cycv8c/19:0cycv8c)PW001557 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/14:0/16:1(9Z))PW001558 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/14:0/17:0cycw7c)PW001559 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/16:1(9Z)/14:0)PW001560 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/16:1(9Z)/17:0cycw7c)PW001561 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/17:0cycw7c/14:0)PW001562 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/17:0cycw7c/16:1(9Z))PW001563 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/17:0cycw7c/17:0cycw7c)PW001564 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/17:0cycw7c/18:1(9Z))PW001565 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/17:0cycw7c/19:0cycv8c)PW001566 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/18:1(9Z)/17:0cycw7c)PW001567 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/18:1(9Z)/18:1(9Z))PW001568 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/19:0cycv8c/17:0cycw7c)PW001569 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/19:0cycv8c/19:0cycv8c)PW001570 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/14:0/14:0)PW001571 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/14:0/16:1(9Z))PW001572 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/14:0/18:1(9Z))PW001573 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/16:1(9Z)/14:0)PW001574 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/16:1(9Z)/17:0cycw7c)PW001575 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/16:1(9Z)/18:1(9Z))PW001576 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/16:1(9Z)/19:0cycv8c)PW001589 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/17:0cycw7c/16:1(9Z))PW001590 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/17:0cycw7c/17:0cycw7c)PW001591 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/17:0cycw7c/18:1(9Z))PW001592 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/18:1(9Z)/14:0)PW001593 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/18:1(9Z)/16:1(9Z))PW001602 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/18:1(9Z)/17:0cycw7c)PW001603 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/18:1(9Z)/18:1(9Z))PW001604 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/18:1(9Z)/19:0cycv8c)PW001605 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/19:0cycv8c/16:1(9Z))PW001606 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/19:0cycv8c/18:1(9Z))PW001611 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/19:0cycv8c/19:0cycv8c)PW001614 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/14:0/14:0)PW001615 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/14:0/16:1(9Z))PW001616 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/14:0/19:0cycv8c)PW001617 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/16:1(9Z)/14:0)PW001624 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/16:1(9Z)/17:0cycw7c)PW001625 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/16:1(9Z)/19:0cycv8c)PW001626 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/17:0cycw7c/16:1(9Z))PW001627 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/17:0cycw7c/17:0cycw7c)PW001628 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/17:0cycw7c/19:0cycv8c)PW001631 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/18:1(9Z)/18:1(9Z))PW001636 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/18:1(9Z)/19:0cycv8c)PW001637 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/19:0cycv8c/14:0)PW001639 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/19:0cycv8c/16:1(9Z))PW001641 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/19:0cycv8c/17:0cycw7c)PW001642 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/19:0cycv8c/18:1(9Z))PW001643 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/14:0/14:0)PW001650 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/14:0/17:0cycw7c)PW001651 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/16:0/17:0cycw7c)PW001652 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/16:1(9Z)/17:0cycw7c)PW001653 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/17:0cycw7c/14:0)PW001654 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/17:0cycw7c/15:0cyclo)PW001655 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/17:0cycw7c/16:0)PW001656 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/17:0cycw7c/16:1(9Z))PW001657 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/17:0cycw7c/17:0cycw7c)PW001658 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/17:0cycw7c/18:1(9Z))PW001659 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/17:0cycw7c/19:0cycv8c)PW001660 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/18:1(9Z)/17:0cycw7c)PW001661 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/19:0cycv8c/17:0cycw7c)PW001662 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/14:0/16:0)PW001663 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/14:0/17:0cycw7c)PW001674 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/16:0/14:0)PW001675 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/16:0/17:0cycw7c)PW001676 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/16:1(9Z)/17:0cycw7c)PW001677 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/17:0cycw7c/14:0)PW001678 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/17:0cycw7c/16:0)PW001681 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/17:0cycw7c/16:1(9Z))PW001682 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/17:0cycw7c/17:0cycw7c)PW001683 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/17:0cycw7c/18:1(9Z))PW001684 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/17:0cycw7c/19:0cycv8c)PW001689 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/18:1(9Z)/17:0cycw7c)PW001690 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/19:0cycv8c/17:0cycw7c)PW001691 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(17:0cycw7c/16:1(9Z)/14:0/16:1(9Z))PW001693 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis I (18:0, 18:0)PW001001 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis I (CL(18:2(9Z,12Z)/18:2(9Z,12Z)/18:2(9Z,12Z)/18:2(9Z,12Z)) )PW001025 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesisCL(16:0/16:1(9Z)/16:1(9Z)/19:0cycv8c)PW001314 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesisCL(16:1(9Z)/15:0cyclo/16:1(9Z)/17:0cycw7c)PW001454 ThumbThumb?image type=greyscaleThumb?image type=simple
purine nucleotides de novo biosynthesisPW000910 ThumbThumb?image type=greyscaleThumb?image type=simple
purine nucleotides de novo biosynthesis 1435709748PW000960 ThumbThumb?image type=greyscaleThumb?image type=simple
purine ribonucleosides degradationPW002076 ThumbThumb?image type=greyscaleThumb?image type=simple
sulfur metabolism (butanesulfonate)PW000923 ThumbThumb?image type=greyscaleThumb?image type=simple
sulfur metabolism (ethanesulfonate)PW000925 ThumbThumb?image type=greyscaleThumb?image type=simple
sulfur metabolism (isethionate)PW000926 ThumbThumb?image type=greyscaleThumb?image type=simple
sulfur metabolism (methanesulfonate)PW000927 ThumbThumb?image type=greyscaleThumb?image type=simple
sulfur metabolism (propanesulfonate)PW000924 ThumbThumb?image type=greyscaleThumb?image type=simple
tRNA Charging 2PW000803 ThumbThumb?image type=greyscaleThumb?image type=simple
tRNA chargingPW000799 ThumbThumb?image type=greyscaleThumb?image type=simple
tryptophan metabolism IIPW001916 ThumbThumb?image type=greyscaleThumb?image type=simple
KEGG Pathways:
EcoCyc Pathways:
Concentrations
ConcentrationStrainMediaGrowth StatusGrowth SystemTemperatureDetails
500± 0 uMK12MOPS-buffered minimal mediaMid-Log PhaseShake flask37 oCPMID: 6291941
Find out more about how we convert literature concentrations.
Spectra
Spectra:
Spectrum TypeDescriptionSplash Key
GC-MSGC-MS Spectrum - GC-EI-TOF (Non-derivatized)splash10-0002-0972000000-a80f120dd426991d6effView in MoNA
GC-MSGC-MS Spectrum - GC-EI-TOF (Non-derivatized)splash10-0udi-0741900000-9c5b3c334561dd282116View in MoNA
GC-MSGC-MS Spectrum - GC-EI-TOF (Non-derivatized)splash10-03di-0920000000-a5ad76aa129d898d71f8View in MoNA
GC-MSGC-MS Spectrum - GC-EI-TOF (Non-derivatized)splash10-03di-0910000000-531d3e19493dc29d6e5cView in MoNA
GC-MSGC-MS Spectrum - GC-MS (4 TMS)splash10-0udi-0320900000-0abbcb28a43d7e24fe81View in MoNA
GC-MSGC-MS Spectrum - GC-MS (Non-derivatized)splash10-0udi-0320900000-0abbcb28a43d7e24fe81View in MoNA
Predicted GC-MSPredicted GC-MS Spectrum - GC-MS (Non-derivatized) - 70eV, Positivesplash10-0002-9200000000-47d5c2340766aaf36e95View in MoNA
LC-MS/MSLC-MS/MS Spectrum - Quattro_QQQ 10V, Positive (Annotated)splash10-004j-5900000000-6633d5123eb37c266247View in MoNA
LC-MS/MSLC-MS/MS Spectrum - Quattro_QQQ 25V, Positive (Annotated)splash10-0002-9000000000-1274b83242b279e9dac7View in MoNA
LC-MS/MSLC-MS/MS Spectrum - Quattro_QQQ 40V, Positive (Annotated)splash10-001i-9000000000-69bc4c795fec87fef4b8View in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 10V, Positivesplash10-004j-4900000000-fab623ebd43ab1452b9fView in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 20V, Positivesplash10-0002-9400000000-b2565f0d436385569cffView in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 40V, Positivesplash10-000t-9300000000-ac978f84efc222da7b43View in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 10V, Negativesplash10-004i-0900000000-21c64963e1ff18b360e1View in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 20V, Negativesplash10-004i-9700000000-54e41043f009fe6db86cView in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 40V, Negativesplash10-004i-9000000000-2a5f69c16aa671275a62View in MoNA
References
References:
  • Kanehisa, M., Goto, S., Sato, Y., Furumichi, M., Tanabe, M. (2012). "KEGG for integration and interpretation of large-scale molecular data sets." Nucleic Acids Res 40:D109-D114. Pubmed: 22080510
  • Keseler, I. M., Collado-Vides, J., Santos-Zavaleta, A., Peralta-Gil, M., Gama-Castro, S., Muniz-Rascado, L., Bonavides-Martinez, C., Paley, S., Krummenacker, M., Altman, T., Kaipa, P., Spaulding, A., Pacheco, J., Latendresse, M., Fulcher, C., Sarker, M., Shearer, A. G., Mackie, A., Paulsen, I., Gunsalus, R. P., Karp, P. D. (2011). "EcoCyc: a comprehensive database of Escherichia coli biology." Nucleic Acids Res 39:D583-D590. Pubmed: 21097882
  • Kukko, E., Heinonen, J. (1982). "The intracellular concentration of pyrophosphate in the batch culture of Escherichia coli." Eur J Biochem 127:347-349. Pubmed: 6291941
  • van der Werf, M. J., Overkamp, K. M., Muilwijk, B., Coulier, L., Hankemeier, T. (2007). "Microbial metabolomics: toward a platform with full metabolome coverage." Anal Biochem 370:17-25. Pubmed: 17765195
  • Winder, C. L., Dunn, W. B., Schuler, S., Broadhurst, D., Jarvis, R., Stephens, G. M., Goodacre, R. (2008). "Global metabolic profiling of Escherichia coli cultures: an evaluation of methods for quenching and extraction of intracellular metabolites." Anal Chem 80:2939-2948. Pubmed: 18331064
Synthesis Reference:Dittmer, Donald C.; Silverstein, V. Opshelor. Production of pyrophosphate from S-n-butyl phosphorothioate. Journal of Organic Chemistry (1961), 26 4706-7.
Material Safety Data Sheet (MSDS)Download (PDF)
External Links:
ResourceLink
CHEBI ID29888
HMDB IDHMDB00250
Pubchem Compound ID1023
Kegg IDC00013
ChemSpider ID559142
WikipediaPyrophosphate
BioCyc IDPPI
EcoCyc IDPPI
Ligand ExpoPPV

Enzymes

General function:
Involved in nucleic acid binding
Specific function:
In addition to polymerase activity, this DNA polymerase exhibits 3' to 5' and 5' to 3' exonuclease activity. It is able to utilize nicked circular duplex DNA as a template and can unwind the parental DNA strand from its template
Gene Name:
polA
Uniprot ID:
P00582
Molecular weight:
103117
Reactions
Deoxynucleoside triphosphate + DNA(n) = diphosphate + DNA(n+1).
General function:
Involved in anthranilate phosphoribosyltransferase activity
Specific function:
Chorismate + L-glutamine = anthranilate + pyruvate + L-glutamate
Gene Name:
trpD
Uniprot ID:
P00904
Molecular weight:
56869
Reactions
Chorismate + L-glutamine = anthranilate + pyruvate + L-glutamate.
N-(5-phospho-D-ribosyl)-anthranilate + diphosphate = anthranilate + 5-phospho-alpha-D-ribose 1-diphosphate.
General function:
Involved in adenylate cyclase activity
Specific function:
ATP = 3',5'-cyclic AMP + diphosphate
Gene Name:
cyaA
Uniprot ID:
P00936
Molecular weight:
97585
Reactions
ATP = 3',5'-cyclic AMP + diphosphate.
General function:
Involved in nucleotide binding
Specific function:
ATP + L-tryptophan + tRNA(Trp) = AMP + diphosphate + L-tryptophyl-tRNA(Trp)
Gene Name:
trpS
Uniprot ID:
P00954
Molecular weight:
37438
Reactions
ATP + L-tryptophan + tRNA(Trp) = AMP + diphosphate + L-tryptophyl-tRNA(Trp).
General function:
Involved in nucleotide binding
Specific function:
Catalyzes the attachment of isoleucine to tRNA(Ile). As IleRS can inadvertently accommodate and process structurally similar amino acids such as valine, to avoid such errors it has two additional distinct tRNA(Ile)-dependent editing activities. One activity is designated as 'pretransfer' editing and involves the hydrolysis of activated Val-AMP. The other activity is designated 'posttransfer' editing and involves deacylation of mischarged Val-tRNA(Ile)
Gene Name:
ileS
Uniprot ID:
P00956
Molecular weight:
104296
Reactions
ATP + L-isoleucine + tRNA(Ile) = AMP + diphosphate + L-isoleucyl-tRNA(Ile).
General function:
Involved in nucleotide binding
Specific function:
Edits incorrectly charged Ser-tRNA(Ala) and Gly- tRNA(Ala) but not incorrectly charged Ser-tRNA(Thr)
Gene Name:
alaS
Uniprot ID:
P00957
Molecular weight:
96032
Reactions
ATP + L-alanine + tRNA(Ala) = AMP + diphosphate + L-alanyl-tRNA(Ala).
General function:
Involved in nucleotide binding
Specific function:
Is required not only for elongation of protein synthesis but also for the initiation of all mRNA translation through initiator tRNA(fMet) aminoacylation
Gene Name:
metG
Uniprot ID:
P00959
Molecular weight:
76254
Reactions
ATP + L-methionine + tRNA(Met) = AMP + diphosphate + L-methionyl-tRNA(Met).
General function:
Involved in nucleotide binding
Specific function:
ATP + glycine + tRNA(Gly) = AMP + diphosphate + glycyl-tRNA(Gly)
Gene Name:
glyQ
Uniprot ID:
P00960
Molecular weight:
34774
Reactions
ATP + glycine + tRNA(Gly) = AMP + diphosphate + glycyl-tRNA(Gly).
General function:
Involved in arginine-tRNA ligase activity
Specific function:
ATP + glycine + tRNA(Gly) = AMP + diphosphate + glycyl-tRNA(Gly)
Gene Name:
glyS
Uniprot ID:
P00961
Molecular weight:
76812
Reactions
ATP + glycine + tRNA(Gly) = AMP + diphosphate + glycyl-tRNA(Gly).
General function:
Involved in nucleotide binding
Specific function:
ATP + L-glutamine + tRNA(Gln) = AMP + diphosphate + L-glutaminyl-tRNA(Gln)
Gene Name:
glnS
Uniprot ID:
P00962
Molecular weight:
63477
Reactions
ATP + L-glutamine + tRNA(Gln) = AMP + diphosphate + L-glutaminyl-tRNA(Gln).
General function:
Involved in nucleotide binding
Specific function:
ATP + L-aspartate + NH(3) = AMP + diphosphate + L-asparagine
Gene Name:
asnA
Uniprot ID:
P00963
Molecular weight:
36650
Reactions
ATP + L-aspartate + NH(3) = AMP + diphosphate + L-asparagine.
General function:
Involved in DNA binding
Specific function:
DNA polymerase III is a complex, multichain enzyme responsible for most of the replicative synthesis in bacteria. The epsilon subunit contain the editing function and is a proofreading 3'-5' exonuclease
Gene Name:
dnaQ
Uniprot ID:
P03007
Molecular weight:
27099
Reactions
Deoxynucleoside triphosphate + DNA(n) = diphosphate + DNA(n+1).
General function:
Involved in GMP synthase (glutamine-hydrolyzing) activity
Specific function:
Catalyzes the synthesis of GMP from XMP
Gene Name:
guaA
Uniprot ID:
P04079
Molecular weight:
58679
Reactions
ATP + xanthosine 5'-phosphate + L-glutamine + H(2)O = AMP + diphosphate + GMP + L-glutamate.
General function:
Involved in nucleotide binding
Specific function:
Catalyzes the attachment of glutamate to tRNA(Glu) in a two-step reaction:glutamate is first activated by ATP to form Glu-AMP and then transferred to the acceptor end of tRNA(Glu)
Gene Name:
gltX
Uniprot ID:
P04805
Molecular weight:
53815
Reactions
ATP + L-glutamate + tRNA(Glu) = AMP + diphosphate + L-glutamyl-tRNA(Glu).
General function:
Involved in lipopolysaccharide biosynthetic process
Specific function:
Activates KDO (a required 8-carbon sugar) for incorporation into bacterial lipopolysaccharide in Gram-negative bacteria
Gene Name:
kdsB
Uniprot ID:
P04951
Molecular weight:
27614
Reactions
CTP + 3-deoxy-D-manno-octulosonate = diphosphate + CMP-3-deoxy-D-manno-octulosonate.
General function:
Involved in biotin-[acetyl-CoA-carboxylase] ligase activity
Specific function:
BirA acts both as a biotin-operon repressor and as the enzyme that synthesizes the corepressor, acetyl-CoA:carbon-dioxide ligase. This protein also activates biotin to form biotinyl-5'- adenylate and transfers the biotin moiety to biotin-accepting proteins
Gene Name:
birA
Uniprot ID:
P06709
Molecular weight:
35312
Reactions
ATP + biotin + apo-[acetyl-CoA:carbon-dioxide ligase (ADP-forming)] = AMP + diphosphate + [acetyl-CoA:carbon-dioxide ligase (ADP-forming)].
General function:
Involved in nucleotide binding
Specific function:
The gamma chain seems to interact with the delta subunit to transfer the beta subunit on the DNA
Gene Name:
dnaX
Uniprot ID:
P06710
Molecular weight:
71137
Reactions
Deoxynucleoside triphosphate + DNA(n) = diphosphate + DNA(n+1).
General function:
Involved in RNA binding
Specific function:
Catalyzes the addition and repair of the essential 3'- terminal CCA sequence in tRNAs without using a nucleic acid template. Adds these three nucleotides in the order of C, C, and A to the tRNA nucleotide-73, using CTP and ATP as substrates and producing inorganic pyrophosphate. Also shows highest phosphatase activity in the presence of Ni(2+) and hydrolyzes pyrophosphate, canonical 5'-nucleoside tri- and diphosphates, NADP, and 2'-AMP with the production of Pi. Displays a metal-independent phosphodiesterase activity toward 2',3'-cAMP, 2',3'-cGMP, and 2',3'-cCMP. Without metal or in the presence of Mg(2+), this protein hydrolyzes 2',3'-cyclic substrates with the formation of 2'-nucleotides, whereas in the presence of Ni(2+), it also produces some 3'-nucleotides. These phosphohydrolase activities are probably involved in the repair of the tRNA 3'-CCA terminus degraded by intracellular RNases
Gene Name:
cca
Uniprot ID:
P06961
Molecular weight:
46467
Reactions
A tRNA precursor + 2 CTP + ATP = a tRNA with a 3' CCA end + 3 diphosphate.
General function:
Involved in hydrolase activity
Specific function:
This enzyme is involved in nucleotide metabolism:it produces dUMP, the immediate precursor of thymidine nucleotides and it decreases the intracellular concentration of dUTP so that uracil cannot be incorporated into DNA
Gene Name:
dut
Uniprot ID:
P06968
Molecular weight:
16155
Reactions
dUTP + H(2)O = dUMP + diphosphate.
General function:
Involved in phosphoribosyl-AMP cyclohydrolase activity
Specific function:
1-(5-phosphoribosyl)-ATP + H(2)O = 1-(5- phosphoribosyl)-AMP + diphosphate
Gene Name:
hisI
Uniprot ID:
P06989
Molecular weight:
22756
Reactions
1-(5-phosphoribosyl)-ATP + H(2)O = 1-(5-phosphoribosyl)-AMP + diphosphate.
1-(5-phosphoribosyl)-AMP + H(2)O = 1-(5-phosphoribosyl)-5-((5-phosphoribosylamino)methylideneamino)imidazole-4-carboxamide.
General function:
Involved in nucleotide binding
Specific function:
Catalyzes the attachment of valine to tRNA(Val). As ValRS can inadvertently accommodate and process structurally similar amino acids such as threonine, to avoid such errors, it has a "posttransfer" editing activity that hydrolyzes mischarged Thr-tRNA(Val) in a tRNA-dependent manner
Gene Name:
valS
Uniprot ID:
P07118
Molecular weight:
108192
Reactions
ATP + L-valine + tRNA(Val) = AMP + diphosphate + L-valyl-tRNA(Val).
General function:
Involved in RNA binding
Specific function:
ATP + L-phenylalanine + t