Record Information
Version2.0
Creation Date2012-07-30 14:37:08 -0600
Update Date2015-09-17 16:24:34 -0600
Secondary Accession Numbers
  • ECMDB21225
Identification
Name:Hydrogen ion
Description:Hydrogen ion is recommended by IUPAC as a general term for all ions of hydrogen and its isotopes. Depending on the charge of the ion, two different classes can be distinguished: positively charged ions and negatively charged ions. Under aqueous conditions found in biochemistry, hydrogen ions exist as the hydrated form hydronium, H3O+, but these are often still referred to as hydrogen ions or even protons by biochemists. (WikiPedia)
Structure
Thumb
Synonyms:
  • H
  • H(+)
  • H+
  • Hydrogen ion
  • Hydron
  • Proton
Chemical Formula:H
Weight:Average: 1.0079
Monoisotopic: 1.007825032
InChI Key:GPRLSGONYQIRFK-UHFFFAOYSA-N
InChI:InChI=1S/p+1
CAS number:Not Available
IUPAC Name:hydron
Traditional IUPAC Name:hydron
SMILES:[H+]
Chemical Taxonomy
DescriptionThis compound belongs to the class of inorganic compounds known as other non-metal hydrides. These are inorganic compounds in which the heaviest atom bonded to a hydrogen atom is belongs to the class of 'other non-metals'.
KingdomInorganic compounds
Super ClassHomogeneous non-metal compounds
ClassOther non-metal organides
Sub ClassOther non-metal hydrides
Direct ParentOther non-metal hydrides
Alternative ParentsNot Available
Substituents
  • Other non-metal hydride
  • Acyclic compound
Molecular FrameworkAcyclic compounds
External Descriptors
Physical Properties
State:Not Available
Charge:0
Melting point:Not Available
Experimental Properties:
PropertyValueSource
Predicted Properties
PropertyValueSource
logP0ChemAxon
Physiological Charge0ChemAxon
Hydrogen Acceptor Count0ChemAxon
Hydrogen Donor Count0ChemAxon
Polar Surface Area0 ŲChemAxon
Rotatable Bond Count0ChemAxon
Polarizability0.52 ųChemAxon
Number of Rings0ChemAxon
Bioavailability1ChemAxon
Rule of FiveYesChemAxon
Ghose FilterYesChemAxon
Veber's RuleYesChemAxon
MDDR-like RuleYesChemAxon
Biological Properties
Cellular Locations:Cytoplasm
Reactions:
ADP + Phosphate + 4 Hydrogen ion + Heme + Nickel(2+) + Iron chelate + Taurine + Molybdate + Magnesium + Fe3+ + Potassium + Polyamine + vitamin B12 + Sulfate + glycerol-3-phosphate + Phosphonate + D-Maltose <> Adenosine triphosphate +3 Hydrogen ion + Water
ADP + Phosphate + 4 Hydrogen ion + Heme + Nickel(2+) + Iron chelate + Taurine + Molybdate + Magnesium + Fe3+ + Potassium + Polyamine + vitamin B12 + Sulfate + glycerol-3-phosphate + Phosphonate + D-Maltose <> Adenosine triphosphate +3 Hydrogen ion + Water
Adenosine triphosphate + Water + Isethionic acid > ADP + Hydrogen ion + Isethionic acid + Phosphate
Coenzyme A + 2 flavodoxin semi oxidized + Pyruvic acid <> Acetyl-CoA + Carbon dioxide +2 Flavodoxin reduced + Hydrogen ion
Cytidine triphosphate + 2 Flavodoxin reduced + 2 Hydrogen ion > dCTP +2 flavodoxin semi oxidized + Water
Adenosine triphosphate + 2 Flavodoxin reduced + 2 Hydrogen ion > dATP +2 flavodoxin semi oxidized + Water
2 Flavodoxin reduced + Guanosine triphosphate + 2 Hydrogen ion > dGTP +2 flavodoxin semi oxidized + Water
2 Flavodoxin reduced + 2 Hydrogen ion + Uridine triphosphate > Deoxyuridine triphosphate +2 flavodoxin semi oxidized + Water
2 flavodoxin semi oxidized + NADPH >2 Flavodoxin reduced + Hydrogen ion + NADP
Adenosine triphosphate + Water + Potassium > ADP + Hydrogen ion + Potassium + Phosphate
Adenosine triphosphate + Water + Molybdate > ADP + Hydrogen ion + Molybdate + Phosphate
Adenosine triphosphate + Water + Putrescine > ADP + Hydrogen ion + Phosphate + Putrescine
Hydrogen ion + Menaquinol 8 + Trimethylamine N-Oxide > Water + Menaquinone 8 + Trimethylamine
Adenosine triphosphate + Water + Butanesulfonate > ADP + Butanesulfonate + Hydrogen ion + Phosphate
2 Hydrogen ion + Hydrogen (gas) + Ubiquinone-8 > Ubiquinol-8 +2 Hydrogen ion
2 Hydrogen ion + Hydrogen (gas) + Ubiquinone-8 > Ubiquinol-8 +2 Hydrogen ion
2-Demethylmenaquinone 8 + 2 Hydrogen ion + Hydrogen (gas) > 2-Demethylmenaquinol 8 +2 Hydrogen ion
2-Demethylmenaquinone 8 + 2 Hydrogen ion + Hydrogen (gas) > 2-Demethylmenaquinol 8 +2 Hydrogen ion
2 Hydrogen ion + Hydrogen (gas) + Menaquinone 8 > Menaquinol 8 +2 Hydrogen ion
2 Hydrogen ion + Hydrogen (gas) + Menaquinone 8 > Menaquinol 8 +2 Hydrogen ion
2 Hydrogen ion + Oxygen + Ubiquinol-8 > Water + Ubiquinone-8 +2 Hydrogen ion
2 Hydrogen ion + Oxygen + Ubiquinol-8 > Water + Ubiquinone-8 +2 Hydrogen ion
2-Demethylmenaquinol 8 + Hydrogen ion + Trimethylamine N-Oxide > 2-Demethylmenaquinone 8 + Water + Trimethylamine
Menaquinol 8 + Hydrogen ion + Trimethylamine N-Oxide > Menaquinone 8 + Water + Trimethylamine
Adenosine triphosphate + Water + Spermidine > ADP + Hydrogen ion + Phosphate + Spermidine
2 Hydrogen ion + Nitrate + Ubiquinol-8 > Water + Nitrite + Ubiquinone-8 +2 Hydrogen ion
2 Hydrogen ion + Nitrate + Ubiquinol-8 > Water + Nitrite + Ubiquinone-8 +2 Hydrogen ion
2 Hydrogen ion + Menaquinol 8 + Nitrate > Water + Menaquinone 8 + Nitrite +2 Hydrogen ion
2 Hydrogen ion + Menaquinol 8 + Nitrate > Water + Menaquinone 8 + Nitrite +2 Hydrogen ion
2 Hydrogen ion + Menaquinone 8 + Formic acid > Menaquinol 8 + Carbon dioxide + Hydrogen ion
2 Hydrogen ion + Menaquinone 8 + Formic acid > Menaquinol 8 + Carbon dioxide + Hydrogen ion
Adenosine triphosphate + Water + D-Alanyl-D-alanine > ADP + D-Alanyl-D-alanine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + D-Galactose > ADP + D-Galactose + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Arginine > ADP + L-Arginine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Sulfate > ADP + Hydrogen ion + Phosphate + Sulfate
Adenosine triphosphate + Water + Thiosulfate > ADP + Hydrogen ion + Phosphate + Thiosulfate
glutaredoxin + Phosphoadenosine phosphosulfate > glutaredoxin +2 Hydrogen ion + Adenosine 3',5'-diphosphate + Sulfite
Phosphoadenosine phosphosulfate + Reduced Thioredoxin >2 Hydrogen ion + Adenosine 3',5'-diphosphate + Sulfite + Oxidized Thioredoxin
2-C-Methyl-D-erythritol-2,4-cyclodiphosphate + 2 Flavodoxin reduced + Hydrogen ion >2 flavodoxin semi oxidized + 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + Water
Undecaprenyl-diphospho-N-acetylmuramoyl-(N-acetylglucosamine)-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine + two linked disacharide pentapeptide murein units (uncrosslinked, middle of chain) > Hydrogen ion + Undecaprenyl diphosphate + three linked disacharide pentapeptide murein units (uncrosslinked, middle of chain)
2 Undecaprenyl-diphospho-N-acetylmuramoyl-(N-acetylglucosamine)-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine >2 Hydrogen ion +2 Undecaprenyl diphosphate + two linked disacharide pentapeptide murein units (uncrosslinked, middle of chain)
Adenosine triphosphate + Water + L-Leucine > ADP + Hydrogen ion + L-Leucine + Phosphate
Adenosine triphosphate + Water + Nickel > ADP + Hydrogen ion + Nickel + Phosphate
2-Ketobutyric acid + Hydrogen ion + Pyruvic acid > 2-Aceto-2-hydroxy-butyrate + Carbon dioxide
Hydrogen ion + 2 Pyruvic acid > (S)-2-Acetolactate + Carbon dioxide
Hydrogen ion + NADPH + Oxidized Thioredoxin > NADP + Reduced Thioredoxin
2 Hydrogen ion + Ubiquinone-8 + Formic acid > Ubiquinol-8 + Carbon dioxide + Hydrogen ion
2 Hydrogen ion + Ubiquinone-8 + Formic acid > Ubiquinol-8 + Carbon dioxide + Hydrogen ion
Formic acid + Hydrogen ion > Carbon dioxide + Hydrogen (gas)
Adenosine triphosphate + Water + Ribose > ADP + Hydrogen ion + Phosphate + Ribose
L-Aspartic acid + Carbamoylphosphate <> Ureidosuccinic acid + Hydrogen ion + Phosphate
2 Adenosine triphosphate + L-Glutamine + Water + Hydrogen carbonate >2 ADP + Carbamoylphosphate + L-Glutamate +2 Hydrogen ion + Phosphate
1-Deoxy-D-xylulose 5-phosphate + NAD + O-Phospho-4-hydroxy-L-threonine > Carbon dioxide + Hydrogen ion +2 Water + NADH + Pyridoxine 5'-phosphate + Phosphate
Adenosine triphosphate + D-Xylulose <> ADP + Hydrogen ion + Xylulose 5-phosphate
Adenosine triphosphate + L-Threo-2-pentulose <> ADP + Hydrogen ion + L-Xylulose 5-phosphate
Adenosine triphosphate + Water + Thiamine > ADP + Hydrogen ion + Phosphate + Thiamine
Dihydroneopterin triphosphate + Water > Dihydroneopterin monophosphate + Hydrogen ion + Pyrophosphate
Guanosine triphosphate + Water > Guanosine monophosphate + Hydrogen ion + Pyrophosphate
dGTP + Water > 2'-Deoxyguanosine 5'-monophosphate + Hydrogen ion + Pyrophosphate
Ubiquinone-8 + D-Glucose + Water > Ubiquinol-8 + Gluconic acid + Hydrogen ion
Carbon dioxide + Water <> Hydrogen ion + Hydrogen carbonate
Adenosine triphosphate + Water + Ferric coprogen > ADP + Ferric coprogen + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Aerobactin > ADP + Aerobactin + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Fe(III)hydroxamate > ADP + Fe(III)hydroxamate + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Ferrichrome > ADP + Ferrichrome + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Ferroxamine > ADP + Ferroxamine + Hydrogen ion + Phosphate
Acetyl-CoA + Adenosine triphosphate + Hydrogen carbonate <> ADP + Hydrogen ion + Malonyl-CoA + Phosphate
Hydrogen ion + L-Lysine <> Cadaverine + Carbon dioxide
Adenosine triphosphate + Water + L-Methionine > ADP + Hydrogen ion + L-Methionine + Phosphate
Adenosine triphosphate + Water + D-Methionine > ADP + Hydrogen ion + D-Methionine + Phosphate
2,5-Diketo-D-gluconate + Hydrogen ion + NADPH >2 -Dehydro-L-gulonate + NADP
Acetaldehyde + Coenzyme A + NAD <> Acetyl-CoA + Hydrogen ion + NADH
Adenosine triphosphate + Water + Taurine > ADP + Hydrogen ion + Phosphate + Taurine
2 D-Alanine + Adenosine triphosphate <> ADP + D-Alanyl-D-alanine + Hydrogen ion + Phosphate
2-Dehydropantoate + Hydrogen ion + NADPH <> NADP + (R)-Pantoate
4 Hydrogen ion + Oxygen + Ubiquinol-8 > Water + Ubiquinone-8 +4 Hydrogen ion
4 Hydrogen ion + Oxygen + Ubiquinol-8 > Water + Ubiquinone-8 +4 Hydrogen ion
2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate + Water > 4-Amino-2-methyl-5-phosphomethylpyrimidine + Hydrogen ion + Phosphate
Tartronate semialdehyde + Hydrogen ion + NADH <> Glyceric acid + NAD
Adenosine triphosphate + Carbon dioxide + Ammonium <> ADP + Carbamoylphosphate +2 Hydrogen ion
Adenosine triphosphate + Water + Ferric enterobactin > ADP + Ferric enterobactin + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + ferric 2,3-dihydroxybenzoylserine > ADP + ferric 2,3-dihydroxybenzoylserine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water > ADP + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Glutamate > ADP + L-Glutamate + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Aspartic acid > ADP + L-Aspartic acid + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Tungstate > ADP + Hydrogen ion + Phosphate + Tungstate
Cyclic pyranopterin monophosphate + Copper + 2 MoaD Protein with thiocarboxylate >5 Hydrogen ion +2 MoaD Protein with carboxylate + Molybdopterin
Adenosine triphosphate + Water + L-Glutamine > ADP + L-Glutamine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glutathione > ADP + Glutathione + Hydrogen ion + Phosphate
Water + Undecaprenyl diphosphate > Hydrogen ion + Phosphate + Undecaprenyl phosphate
Adenosine triphosphate + Glutathione + Water > ADP + Hydrogen ion + Phosphate + Glutathione
Adenosine triphosphate + L-Cysteine + Water > ADP + Hydrogen ion + Phosphate + L-Cysteine
2-Demethylmenaquinol 8 + Hydrogen ion + Trimethylamine N-Oxide > 2-Demethylmenaquinone 8 + Water + Trimethylamine
Adenosine triphosphate + Water + Ethanesulfonate > ADP + Ethanesulfonate + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Methanesulfonate > ADP + Hydrogen ion + Methanesulfonate + Phosphate
Adenosine triphosphate + Water + Sulfoacetate > ADP + Hydrogen ion + Phosphate + Sulfoacetate
Flavin Mononucleotide + Hydrogen ion + NADH > FMNH + NAD
2 Hydrogen ion + Menaquinol 8 + Oxygen > Water + Menaquinone 8 +2 Hydrogen ion
2 Hydrogen ion + Menaquinol 8 + Oxygen > Water + Menaquinone 8 +2 Hydrogen ion
Hydrogen ion + Malonic semialdehyde + NADPH > 3-Hydroxypropanoate + NADP
Hydrogen ion + NADH + Oxygen + Uracil > NAD + Ureidoacrylate peracid
Glyoxylic acid + Hydrogen ion + NADPH + Glycolate <> Glycolic acid + NADP
Hydrogen ion + Hydroxypyruvic acid + NADH > Glyceric acid + NAD
Hydrogen ion + Hydroxypyruvic acid + NADPH > Glyceric acid + NADP
Dodecanoyl-ACP (n-C12:0ACP) + Hydrogen ion + Phosphate > acyl carrier protein + Dodecanoly-phosphate (n-C12:0)
Hydrogen ion + cis-hexadec-9-enoyl-[acyl-carrier protein] (n-C16:1) + Phosphate > acyl carrier protein + Hexadecanoyl-phosphate (n-C16:1)
Hydrogen ion + cis-octadec-11-enoyl-[acyl-carrier protein] (n-C18:1) + Phosphate > acyl carrier protein + Octadecanoyl-phosphate (n-C18:1)
Hydrogen ion + Phosphate + cis-tetradec-7-enoyl-[acyl-carrier protein] (n-C14:1) > acyl carrier protein + Tetradecanoyl-phosphate (n-C14:1)
Hydrogen ion + Myristoyl-ACP (n-C14:0ACP) + Phosphate > acyl carrier protein + Tetradecanoyl-phosphate (n-C14:0)
Hydrogen ion + Octadecanoyl-ACP (n-C18:0ACP) + Phosphate > acyl carrier protein + Octadecanoyl-phosphate (n-C18:0)
Hydrogen ion + Palmitoyl-ACP (n-C16:0ACP) + Phosphate > acyl carrier protein + Hexadecanoyl-phosphate (n-C16:0)
Butyryl-ACP (n-C4:0ACP) + Hydrogen ion + Malonyl-[acyl-carrier protein] >3 -Oxohexanoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
Decanoyl-ACP (n-C10:0ACP) + Hydrogen ion + Malonyl-[acyl-carrier protein] >3 -Oxododecanoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
Hydrogen ion + Malonyl-[acyl-carrier protein] + Palmitoyl-ACP (n-C16:0ACP) >3 -Oxooctadecanoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
Adenosine triphosphate + Water + L-Alanine-D-glutamate-meso-2,6-diaminoheptanedioate-D-alanine > L-Alanine-D-glutamate-meso-2,6-diaminoheptanedioate-D-alanine + ADP + Hydrogen ion + Phosphate
Chorismate + L-Glutamine <> 2-Aminobenzoic acid + L-Glutamate + Hydrogen ion + Pyruvic acid
Water + Undecaprenyl diphosphate > Hydrogen ion + Phosphate + Undecaprenyl phosphate
Adenosine triphosphate + Water + L-alanine-D-glutamate-meso-2,6-diaminoheptanedioate > L-alanine-D-glutamate-meso-2,6-diaminoheptanedioate + ADP + Hydrogen ion + Phosphate
Hydrogen ion + NADPH + Oxygen + Phenylacetyl-CoA > Water + NADP + Ring 1,2-epoxyphenylacetyl-CoA
Ethanol + NAD <> Acetaldehyde + Hydrogen ion + NADH
NADH + NADP + 2 Hydrogen ion >2 Hydrogen ion + NAD + NADPH
NADH + NADP + 2 Hydrogen ion >2 Hydrogen ion + NAD + NADPH
Dihydrofolic acid + Hydrogen ion + NADPH <> NADP + Tetrahydrofolic acid
Adenosine triphosphate + Pyridoxal <> ADP + Hydrogen ion + Pyridoxal 5'-phosphate
[2Fe-1S] desulfurated iron-sulfur cluster + Adenosine triphosphate + Water + SufBCD scaffold complex + SufSE with bound sulfur > ADP +5 Hydrogen ion + Phosphate + SufBCD with bound [2Fe-2S] cluster + SufSE sulfur acceptor complex
FADH2 + 2 Hydrogen ion + SufBCD with two bound [2Fe-2S] clusters > FAD + SufBCD with bound [4Fe-4S] cluster
4 Hydrogen ion + SufBCD with bound [2Fe-2S] cluster > [2Fe-2S] iron-sulfur cluster + SufBCD scaffold complex
4 Hydrogen ion + SufBCD with bound [4Fe-4S] cluster > [4Fe-4S] iron-sulfur cluster + SufBCD scaffold complex
3-Dehydro-shikimate + Hydrogen ion + NADPH <> NADP + Shikimic acid
Adenosine triphosphate + Coenzyme A + Dodecanoate (N-C12:0) + Hydrogen ion > Adenosine monophosphate + Lauroyl-CoA + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Dodecanoate (N-C12:0) + Hydrogen ion > Adenosine monophosphate + Lauroyl-CoA + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Palmitic acid > Adenosine monophosphate + Hydrogen ion + Palmityl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Palmitic acid > Adenosine monophosphate + Hydrogen ion + Palmityl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Octadecanoate (N-C18:0) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + Stearoyl-CoA
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Octadecanoate (N-C18:0) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + Stearoyl-CoA
Adenosine triphosphate + Coenzyme A + Hydrogen ion + tetradecanoate (n-C14:0) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + Tetradecanoyl-CoA
Adenosine triphosphate + Coenzyme A + Hydrogen ion + tetradecanoate (n-C14:0) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + Tetradecanoyl-CoA
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Tetradecenoate (N-C14:1) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + (2E)-Tetradecenoyl-CoA
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Tetradecenoate (N-C14:1) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + (2E)-Tetradecenoyl-CoA
Adenosine triphosphate + Water + Adenosylcobalamin > Adenosylcobalamin + ADP + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Cob(I)alamin > ADP + Cob(I)alamin + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Cobinamide > ADP + Cobinamide + Hydrogen ion + Phosphate
Cytidine triphosphate + Water > Cytidine monophosphate + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Decanoate (N-C10:0) + Hydrogen ion > Adenosine monophosphate + Decanoyl-CoA (N-C10:0CoA) + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Decanoate (N-C10:0) + Hydrogen ion > Adenosine monophosphate + Decanoyl-CoA (N-C10:0CoA) + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Caprylic acid > Adenosine monophosphate + Hydrogen ion + Octanoyl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Caprylic acid > Adenosine monophosphate + Hydrogen ion + Octanoyl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Hexadecenoate (n-C16:1) > Adenosine monophosphate + Hydrogen ion + (2E)-Hexadecenoyl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Hexadecenoate (n-C16:1) > Adenosine monophosphate + Hydrogen ion + (2E)-Hexadecenoyl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Hexanoate (N-C6:0) > Adenosine monophosphate + Hydrogen ion + Hexanoyl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Hexanoate (N-C6:0) > Adenosine monophosphate + Hydrogen ion + Hexanoyl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Octadecenoate (N-C18:1) > Adenosine monophosphate + Hydrogen ion + Octadecenoyl-CoA (N-C18:1CoA) + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Octadecenoate (N-C18:1) > Adenosine monophosphate + Hydrogen ion + Octadecenoyl-CoA (N-C18:1CoA) + Pyrophosphate
ADP + Hydrogen ion + Phosphoenolpyruvic acid <> Adenosine triphosphate + Pyruvic acid
Adenosine triphosphate + Water + Zinc > ADP + Hydrogen ion + Phosphate + Zinc
Adenosine triphosphate + Water + L-Arabinose > ADP + L-Arabinose + Hydrogen ion + Phosphate
L-Glutamine + Phosphoribulosylformimino-AICAR-P > Phosphoribosyl formamidocarboxamide + D-Erythro-imidazole-glycerol-phosphate + L-Glutamate + Hydrogen ion
(O16 antigen)x2 undecaprenyl diphosphate + O16 antigen undecaprenyl diphosphate > Hydrogen ion + (O16 antigen)x3 undecaprenyl diphosphate + Undecaprenyl diphosphate
(O16 antigen)x3 undecaprenyl diphosphate + O16 antigen undecaprenyl diphosphate > Hydrogen ion + (O16 antigen)x4 undecaprenyl diphosphate + Undecaprenyl diphosphate
2 O16 antigen undecaprenyl diphosphate > Hydrogen ion + (O16 antigen)x2 undecaprenyl diphosphate + Undecaprenyl diphosphate
Thymidine 5'-triphosphate + Glucose 1-phosphate + Hydrogen ion <> dTDP-D-Glucose + Pyrophosphate
Adenosine triphosphate + D-Galactose + Alpha-D-Galactose <> ADP + Galactose 1-phosphate + Hydrogen ion
4-Amino-5-hydroxymethyl-2-methylpyrimidine + Adenosine triphosphate <> 4-Amino-2-methyl-5-phosphomethylpyrimidine + ADP + Hydrogen ion + 4-amino-5-phosphonooxymethyl-2-methylpyrimidine
Adenosine triphosphate + Water + Choline > ADP + Choline + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Betaine > ADP + Betaine + Hydrogen ion + Phosphate
D-Lactic acid + NAD <> Hydrogen ion + NADH + Pyruvic acid
Dihydrouracil + NAD <> Hydrogen ion + NADH + Uracil
Adenosine triphosphate + Water + D-Glucose > ADP + D-Glucose + Hydrogen ion + Phosphate
S-Formylglutathione + Water <> Formic acid + Glutathione + Hydrogen ion
Adenosine triphosphate + Water + Heme > ADP + Hydrogen ion + Phosphate + Heme
2-Demethylmenaquinone 8 + 4 Hydrogen ion + NADH > 2-Demethylmenaquinol 8 + NAD +3 Hydrogen ion
2-Demethylmenaquinone 8 + 4 Hydrogen ion + NADH > 2-Demethylmenaquinol 8 + NAD +3 Hydrogen ion
4 Hydrogen ion + NADH + Ubiquinone-8 > NAD + Ubiquinol-8 +3 Hydrogen ion
4 Hydrogen ion + NADH + Ubiquinone-8 > NAD + Ubiquinol-8 +3 Hydrogen ion
4 Hydrogen ion + Menaquinone 8 + NADH > Menaquinol 8 + NAD +3 Hydrogen ion
4 Hydrogen ion + Menaquinone 8 + NADH > Menaquinol 8 + NAD +3 Hydrogen ion
Adenosine triphosphate + Water + L-Histidine > ADP + Hydrogen ion + L-Histidine + Phosphate
Adenosine triphosphate + Water + L-Lysine > ADP + Hydrogen ion + L-Lysine + Phosphate
Adenosine triphosphate + Water + Ornithine > ADP + Hydrogen ion + Ornithine + Phosphate
Acetyl-ACP + Hydrogen ion + Malonyl-[acyl-carrier protein] > acyl carrier protein + Acetoacetyl-ACP + Carbon dioxide
Dodecanoyl-ACP (n-C12:0ACP) + Hydrogen ion + Malonyl-[acyl-carrier protein] >3 -Oxotetradecanoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
Hydrogen ion + Hexanoyl-ACP (n-C6:0ACP) + Malonyl-[acyl-carrier protein] >3 -Oxooctanoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
Hydrogen ion + Malonyl-[acyl-carrier protein] + Myristoyl-ACP (n-C14:0ACP) >3 -Oxohexadecanoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
Hydrogen ion + Malonyl-[acyl-carrier protein] + Octanoyl-ACP (n-C8:0ACP) >3 -Oxodecanoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
O-Acetylserine + Hydrogen sulfide <> Acetic acid + L-Cysteine + Hydrogen ion
Water + Triphosphate > Hydrogen ion + Phosphate + Pyrophosphate
4 Hydrogen ion + IscU with bound [2Fe-2S] cluster > [2Fe-2S] iron-sulfur cluster + IscU scaffold protein
4 Hydrogen ion + IscU with bound [4Fe-4S] cluster > [4Fe-4S] iron-sulfur cluster + IscU scaffold protein
[2Fe-1S] desulfurated iron-sulfur cluster + IscS with bound sulfur + IscU scaffold protein >4 Hydrogen ion + IscS sulfur acceptor protein + IscU with bound [2Fe-2S] cluster
Adenosine triphosphate + Dehydroglycine + 1-Deoxy-D-xylulose 5-phosphate + Hydrogen ion + IscS with bound sulfur + NADPH > 4-Methyl-5-(2-phosphoethyl)-thiazole + Adenosine monophosphate + Carbon dioxide +2 Water + IscS sulfur acceptor protein + NADP + Pyrophosphate
trans-Cinnamic acid + Hydrogen ion + NADH + Oxygen > cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD
Hydrogen ion + NADH + Oxygen + Hydrocinnamic acid > Cis-3-(3-carboxyethyl)-3,5-cyclohexadiene-1,2-diol + NAD
Water + NADP + Succinic acid semialdehyde >2 Hydrogen ion + NADPH + Succinic acid
Adenosine triphosphate + Water + Carnitine > ADP + Carnitine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Proline > ADP + Hydrogen ion + Phosphate + L-Proline
Adenosine triphosphate + Water + Carnitine > ADP + Carnitine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Crotonobetaine > ADP + Crotonobetaine + Hydrogen ion + Phosphate
Hydrogen ion + NADH + 2 Nitric oxide > Water + Nitrous oxide + NAD
Water + Pyrophosphate > Hydrogen ion +2 Phosphate
FAD + Hydrogen ion + NADPH > FADH2 + NADP
5 Hydrogen ion + 3 NADPH + Sulfite <>3 Water + Hydrogen sulfide +3 NADP
dATP + Water > Deoxyadenosine monophosphate + Hydrogen ion + Pyrophosphate
dCTP + Water > dCMP + Hydrogen ion + Pyrophosphate
Thymidine 5'-triphosphate + Water > 5-Thymidylic acid + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Guanosine diphosphate > Adenosine monophosphate + Hydrogen ion + Guanosine 3',5'-bis(diphosphate)
Water + Hypoxanthine + NAD > Hydrogen ion + NADH + Xanthine
Water + NAD + Xanthine <> Hydrogen ion + NADH + Uric acid
D-Erythrose 4-phosphate + Water + NAD <> 4-Phospho-D-erythronate +2 Hydrogen ion + NADH
Hydrogen ion + Ornithine + L-Ornithine <> Carbon dioxide + Putrescine + Ethylenediamine
Hydrogen ion + Pyruvaldehyde + NADPH > Acetol + NADP
Adenosine triphosphate + Water + (enterobacterial common antigen)x4 core oligosaccharide lipid A > ADP + Hydrogen ion + Phosphate + (enterobacterial common antigen)x4 core oligosaccharide lipid A
Adenosine triphosphate + Water + (O16 antigen)x4 core oligosaccharide lipid A > ADP + Hydrogen ion + Phosphate + (O16 antigen)x4 core oligosaccharide lipid A
Adenosine triphosphate + Water + cold adapted KDO(2)-lipid (A) > ADP + Hydrogen ion + Phosphate + cold adapted KDO(2)-lipid (A)
Adenosine triphosphate + Water + core oligosaccharide lipid A > ADP + Hydrogen ion + Phosphate + core oligosaccharide lipid A
Adenosine triphosphate + Water + core oligosaccharide lipid A diphosphate > ADP + Hydrogen ion + Phosphate + core oligosaccharide lipid A diphosphate
Adenosine triphosphate + Water + KDO2-Lipid A > ADP + Hydrogen ion + Phosphate + KDO2-Lipid A
Adenosine triphosphate + Water + 4-Amino-4-deoxy-L-arabinose modified core oligosaccharide lipid A > ADP + Hydrogen ion + Phosphate + 4-Amino-4-deoxy-L-arabinose modified core oligosaccharide lipid A
Adenosine triphosphate + Water + KDO(2)-lipid IV(A) > ADP + Hydrogen ion + Phosphate + KDO(2)-lipid IV(A)
Adenosine triphosphate + Water + Phosphoethanolamine KDO(2)-lipid (A) > ADP + Hydrogen ion + Phosphate + Phosphoethanolamine KDO(2)-lipid (A)
alpha-Ketoglutarate + L-Glutamine + Hydrogen ion + NADPH >2 L-Glutamate + NADP
5 Hydrogen ion + 3 NADH + Nitrite >2 Water +3 NAD + Ammonium
Adenosine triphosphate + Shikimic acid <> ADP + Hydrogen ion + Shikimate 3-phosphate
Adenosine diphosphate ribose + Water <> Adenosine monophosphate +2 Hydrogen ion + D-Ribose-5-phosphate
Adenosine triphosphate + Water + Glycerophosphocholine > ADP + Glycerophosphocholine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glycerylphosphorylethanolamine > ADP + Glycerylphosphorylethanolamine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glycerol 3-phosphate > ADP + Glycerol 3-phosphate + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glycerol 2-phosphate > ADP + Glycerol 2-phosphate + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glycerophosphoglycerol > ADP + Glycerophosphoglycerol + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glycerophosphoserine > ADP + Glycerophosphoserine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Sn-Glycero-3-phospho-1-inositol > ADP + Sn-Glycero-3-phospho-1-inositol + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Alanine > ADP + L-Alanine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Threonine > ADP + Hydrogen ion + Phosphate + L-Threonine
Adenosine triphosphate + Water + L-Isoleucine > ADP + Hydrogen ion + L-Isoleucine + Phosphate
Adenosine triphosphate + Water + L-Valine > ADP + Hydrogen ion + Phosphate + L-Valine
apoprotein [acyl carrier protein] + Coenzyme A > acyl carrier protein + Hydrogen ion + Adenosine 3',5'-diphosphate
L-Glutamate + Hydrogen ion <> gamma-Aminobutyric acid + Carbon dioxide
Adenosine triphosphate + Water + Cysteinylglycine > ADP + Cysteinylglycine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Prolinylglycine > ADP + Hydrogen ion + Phosphate + L-Prolinylglycine
Glyoxylic acid + Hydrogen ion + NADH > Glycolic acid + NAD
Adenosine triphosphate + Water + D-Xylose > ADP + Hydrogen ion + Phosphate + D-Xylose
Deoxyuridine triphosphate + Water <> dUMP + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Water + Phosphate > ADP + Hydrogen ion +2 Phosphate
(enterobacterial common antigen)x2 undecaprenyl-diphosphate + Undecaprenyl-diphospho N-acetylglucosamine-N-acetylmannosaminuronate-N-acetamido-4,6-dideoxy-D-galactose > (enterobacterial common antigen)x3 undecaprenyl-diphosphate + Hydrogen ion + Undecaprenyl diphosphate
(enterobacterial common antigen)x3 undecaprenyl-diphosphate + Undecaprenyl-diphospho N-acetylglucosamine-N-acetylmannosaminuronate-N-acetamido-4,6-dideoxy-D-galactose > (enterobacterial common antigen)x4 undecaprenyl-diphosphate + Hydrogen ion + Undecaprenyl diphosphate
2 Undecaprenyl-diphospho N-acetylglucosamine-N-acetylmannosaminuronate-N-acetamido-4,6-dideoxy-D-galactose > (enterobacterial common antigen)x2 undecaprenyl-diphosphate + Hydrogen ion + Undecaprenyl diphosphate
2 S-Adenosylmethionine + Uroporphyrinogen III >2 S-Adenosylhomocysteine + Precorrin 2 + Hydrogen ion
Adenosine triphosphate + FADH2 + 2 Iron + Water + SufBCD scaffold complex + 2 SufSE with bound sulfur > ADP + FAD +7 Hydrogen ion + Phosphate + SufBCD with bound [2Fe-2S] cluster +2 SufSE sulfur acceptor complex
Adenosine triphosphate + FADH2 + 2 Iron + Water + SufBCD with bound [2Fe-2S] cluster + 2 SufSE with bound sulfur > ADP + FAD +7 Hydrogen ion + Phosphate + SufBCD with two bound [2Fe-2S] clusters +2 SufSE sulfur acceptor complex
FADH2 + 2 Iron + 2 IscS with bound sulfur + IscU scaffold protein > FAD +6 Hydrogen ion +2 IscS sulfur acceptor protein + IscU with bound [2Fe-2S] cluster
FADH2 + 2 Iron + 2 IscS with bound sulfur + IscU with bound [2Fe-2S] cluster > FAD +6 Hydrogen ion +2 IscS sulfur acceptor protein + IscU with two bound [2Fe-2S] clusters
3-Octaprenyl-4-hydroxybenzoate + Hydrogen ion > 2-Octaprenylphenol + Carbon dioxide
Hydrogen ion + NADPH + Riboflavin > NADP + Reduced riboflavin
Flavin Mononucleotide + Hydrogen ion + NADPH <> FMNH + NADP
Acetoacetyl-CoA + Hydrogen ion + NADH <> 3-Hydroxybutyryl-CoA + NAD
3-Oxotetradecanoyl-CoA + Hydrogen ion + NADH <> (S)-3-Hydroxytetradecanoyl-CoA + NAD
3-Oxododecanoyl-CoA + Hydrogen ion + NADH <> (S)-3-Hydroxydodecanoyl-CoA + NAD
3-Oxodecanoyl-CoA + Hydrogen ion + NADH <> (S)-Hydroxydecanoyl-CoA + NAD
3-Oxooctanoyl-CoA + Hydrogen ion + NADH <> (S)-Hydroxyoctanoyl-CoA + NAD
3-Oxohexanoyl-CoA + Hydrogen ion + NADH <> (S)-Hydroxyhexanoyl-CoA + NAD
3-Oxohexadecanoyl-CoA + Hydrogen ion + NADH <> (S)-3-Hydroxyhexadecanoyl-CoA + NAD
3-Oxooctadecanoyl-CoA + Hydrogen ion + NADH <> (S)-3-Hydroxyoctadecanoyl-CoA + NAD
bis-molybdenum cofactor + Guanosine triphosphate + Hydrogen ion > bis-molybdopterin mono-guanine dinucleotide + Pyrophosphate
Guanosine triphosphate + Hydrogen ion + Molybdopterin > Molybdopterin guanine dinucleotide + Pyrophosphate
bis-molybdopterin mono-guanine dinucleotide + Guanosine triphosphate + Hydrogen ion > Bis-molybdopterin guanine dinucleotide + Pyrophosphate
tungsten bispterin cofactor + Guanosine triphosphate + Hydrogen ion > tungsten bispterin cofactor mono-guanine dinucleotide + Pyrophosphate
tungsten bispterin cofactor mono-guanine dinucleotide + Guanosine triphosphate + Hydrogen ion > tungsten bispterin cofactor guanine dinucleotide + Pyrophosphate
Adenosine triphosphate + L-Glutamate + Ammonium > ADP + L-Glutamine + Hydrogen ion + Phosphate
2 Hydrogen ion + 2 Superoxide anion > Hydrogen peroxide + Oxygen
Adenosine triphosphate + Fructose 6-phosphate > ADP + Fructose 1,6-bisphosphate + Hydrogen ion
L-Homoserine + NADP <> L-Aspartate-semialdehyde + Hydrogen ion + NADPH
Water + NAD <> Adenosine monophosphate +2 Hydrogen ion + Nicotinamide ribotide + NMN
Acetyl-CoA + Glyoxylic acid + Water <> Coenzyme A + Hydrogen ion + L-Malic acid
5-Methyltetrahydrofolic acid + L-Homocysteine <> Hydrogen ion + L-Methionine + Tetrahydrofolic acid
Adenosine triphosphate + Water + D-Maltose > ADP + Hydrogen ion + D-Maltose + Phosphate
Adenosine triphosphate + Water + Maltotriose > ADP + Hydrogen ion + Maltotriose + Phosphate
Adenosine triphosphate + Water + Maltotetraose > ADP + Hydrogen ion + Maltotetraose + Phosphate
Adenosine triphosphate + Water + 1,4-alpha-D-glucan > 1,4-alpha-D-glucan + ADP + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Maltohexaose > ADP + Hydrogen ion + Maltohexaose + Phosphate
Adenosine triphosphate + Water + Maltopentaose > ADP + Hydrogen ion + Maltopentaose + Phosphate
3 Ubiquinol-8 + 2 Hydrogen ion + Nitrite >3 Ubiquinone-8 +2 Water + Ammonium
3 Menaquinol 8 + 2 Hydrogen ion + Nitrite >3 Menaquinone 8 +2 Water + Ammonium
Adenosine triphosphate + Water + D-Allose > ADP + D-Allose + Hydrogen ion + Phosphate
Water + Inosine triphosphate > Hydrogen ion + IDP + Phosphate
3-Dehydro-L-gulonate 6-phosphate + Hydrogen ion <> Carbon dioxide + L-Xylulose 5-phosphate
Carbamoylphosphate + Ornithine + L-Ornithine <> Citrulline + Hydrogen ion + Phosphate
Adenosine triphosphate + Gluconic acid <> 6-Phosphogluconic acid + ADP + Hydrogen ion
Adenosine triphosphate + Water + Fe(III)dicitrate > ADP +2 Citric acid + Fe3+ + Hydrogen ion + Phosphate
Adenosine triphosphate + Hydrogen ion + Nicotinamide ribotide + NMN <> NAD + Pyrophosphate
Adenosine triphosphate + L-Homoserine <> ADP + Hydrogen ion + O-Phosphohomoserine
Adenosine triphosphate + Hydrogen ion + Molybdopterin <> Adenylated molybdopterin + Pyrophosphate
Adenosine triphosphate + Riboflavin <> ADP + Flavin Mononucleotide + Hydrogen ion
Adenosine triphosphate + Flavin Mononucleotide + Hydrogen ion > FAD + Pyrophosphate
Hydrogen ion + 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH > Water + Isopentenyl pyrophosphate + NAD
Hydrogen ion + 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH > Dimethylallylpyrophosphate + Water + NAD
2,3-Dihydrodipicolinic acid + Hydrogen ion + NADPH > NADP + Tetrahydrodipicolinate
Diadenosine tetraphosphate + Water <>2 ADP +2 Hydrogen ion
Diadenosine pentaphosphate + Water > ADP + Adenosine triphosphate +2 Hydrogen ion
P1,P4-Bis(5'-guanosyl) tetraphosphate + Water >2 Guanosine diphosphate +2 Hydrogen ion
Adenosine triphosphate + L-Ribulose > ADP + Hydrogen ion + L-Ribulose 5-phosphate
3-Isopropylmalate + NAD > 2-Isopropyl-3-oxosuccinate + Hydrogen ion + NADH
alpha-Ketoisovaleric acid + Acetyl-CoA + Water + a-Ketoisovaleric acid <> 2-Isopropylmalic acid + Coenzyme A + Hydrogen ion
Diaminopimelic acid + Adenosine triphosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamate > ADP + Hydrogen ion + Phosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate
D-Alanyl-D-alanine + Adenosine triphosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate > ADP + Hydrogen ion + Phosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-6-carboxy-L-lysyl-D-alanyl-D-alanine
Adenosine triphosphate + D-Glutamic acid + UDP-N-Acetylmuramoyl-L-alanine <> ADP + Hydrogen ion + Phosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamate
Uridine diphosphate-N-acetylglucosamine + Undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine > Hydrogen ion + Undecaprenyl-diphospho-N-acetylmuramoyl-(N-acetylglucosamine)-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine + Uridine 5'-diphosphate
L-Alanine + Adenosine triphosphate + UDP-N-Acetylmuraminate <> ADP + Hydrogen ion + Phosphate + UDP-N-Acetylmuramoyl-L-alanine
Adenosine triphosphate + Dephospho-CoA <> ADP + Coenzyme A + Hydrogen ion
Guanosine monophosphate + 2 Hydrogen ion + NADPH > Inosinic acid + NADP + Ammonium
2 Hydrogen ion + Phosphoribosyl pyrophosphate + Quinolinic acid <> Carbon dioxide + Nicotinamide ribotide + Pyrophosphate
S-Adenosylmethionine + Hydrogen ion <> S-Adenosylmethioninamine + Carbon dioxide
S-Adenosylmethioninamine + Putrescine + Ethylenediamine <> 5'-Methylthioadenosine + Hydrogen ion + Spermidine
Cadaverine + S-Adenosylmethioninamine > 5'-Methylthioadenosine + Hydrogen ion + Aminopropylcadaverine
4 Copper + 4 Hydrogen ion + Oxygen >4 Copper +2 Water
4 Iron + 4 Hydrogen ion + Oxygen >4 Fe3+ +2 Water
L-Aspartic acid + Hydrogen ion <> beta-Alanine + Carbon dioxide
beta-Alanine + Adenosine triphosphate + (R)-Pantoate <> Adenosine monophosphate + Hydrogen ion + Pantothenic acid + Pyrophosphate
6-Hydroxymethyl dihydropterin + Adenosine triphosphate > 6-Hydroxymethyl-dihydropterin pyrophosphate + Adenosine monophosphate + Hydrogen ion
1-Deoxy-D-xylulose 5-phosphate + Hydrogen ion + NADPH <> 2-C-Methyl-D-erythritol-4-phosphate + NADP
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-didodecanoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-dihexadec-9-enoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-dihexadecanoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-dioctadec-11-enoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-Dioctadecanoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-ditetradec-7-enoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-ditetradecanoylglycerol + Pyrophosphate
(R)-3-Hydroxytetradecanoyl-[acyl-carrier protein] + UDP-3-O-(3-Hydroxytetradecanoyl)-D-glucosamine > acyl carrier protein + Hydrogen ion + UDP-2,3-Bis(3-hydroxytetradecanoyl)glucosamine
2,3-Bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl 1-phosphate + UDP-2,3-Bis(3-hydroxytetradecanoyl)glucosamine <> Hydrogen ion + 2,3,2',3'-Tetrakis(3-hydroxytetradecanoyl)-D-glucosaminyl-1,6-beta-D-glucosamine 1-phosphate + Uridine 5'-diphosphate
Water + S-Lactoylglutathione > Glutathione + Hydrogen ion + D-Lactic acid
L-Glutamic acid 5-phosphate + Hydrogen ion + NADPH > L-Glutamic-gamma-semialdehyde + NADP + Phosphate
L-Homocysteine + S-Methylmethionine > Hydrogen ion +2 L-Methionine
S-Adenosylmethionine + L-Homocysteine + S-Methylmethionine <> S-Adenosylhomocysteine + Hydrogen ion + L-Methionine
Choline + NAD > Betaine aldehyde + Hydrogen ion + NADH
Betaine aldehyde + Water + NADP > Betaine +2 Hydrogen ion + NADPH
Betaine aldehyde + Water + NAD <> Betaine +2 Hydrogen ion + NADH
Water + Oxalacetic acid + Propionyl-CoA <> Methylcitric acid + Coenzyme A + Hydrogen ion + (2S,3S)-2-hydroxybutane-1,2,3-tricarboxylate
Cytosine + Hydrogen ion + Water > Ammonium + Uracil
Cyanate + 3 Hydrogen ion + Hydrogen carbonate >2 Carbon dioxide + Ammonium
3-(3-Hydroxyphenyl)propanoic acid + Hydrogen ion + NADH + Oxygen > 3-(2,3-Dihydroxyphenyl)propionic acid + Water + NAD
3-Hydroxycinnamic acid + Hydrogen ion + NADH + Oxygen > Trans-2,3-Dihydroxycinnamate + Water + NAD
3-(2,3-Dihydroxyphenyl)propionic acid + Oxygen > Hydrogen ion + 2-Hydroxy-6-ketononadienedicarboxylate
Trans-2,3-Dihydroxycinnamate + Oxygen > Hydrogen ion + 2-Hydroxy-6-ketononatrienedioate
Water + 2-Hydroxy-6-ketononadienedicarboxylate > Hydrogen ion + 2-Hydroxy-2,4-pentadienoate + Succinic acid
Water + 2-Hydroxy-6-ketononatrienedioate > Fumaric acid + Hydrogen ion + 2-Hydroxy-2,4-pentadienoate
D-Glyceraldehyde + Hydrogen ion + NADH <> Glycerol + NAD
S-(Hydroxymethyl)glutathione + NAD <> S-Formylglutathione + Hydrogen ion + NADH
alpha-Ketoglutarate + Oxygen + Taurine <> Aminoacetaldehyde + Carbon dioxide + Hydrogen ion + Sulfite + Succinic acid
2 5-Aminolevulinic acid <> Hydrogen ion +2 Water + Porphobilinogen
L-D-1-Pyrroline-5-carboxylic acid + 2 Hydrogen ion + NADPH > NADP + L-Proline
Adenosine triphosphate + D-Fructose > ADP + Fructose 6-phosphate + Hydrogen ion
Decanoyl-ACP (n-C10:0ACP) + Water > acyl carrier protein + Decanoate (N-C10:0) + Hydrogen ion
Dodecanoyl-ACP (n-C12:0ACP) + Water > acyl carrier protein + Dodecanoate (N-C12:0) + Hydrogen ion
Water + cis-hexadec-9-enoyl-[acyl-carrier protein] (n-C16:1) > acyl carrier protein + Hydrogen ion + Hexadecenoate (n-C16:1)
Water + cis-tetradec-7-enoyl-[acyl-carrier protein] (n-C14:1) > acyl carrier protein + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + Myristoyl-ACP (n-C14:0ACP) > acyl carrier protein + Hydrogen ion + tetradecanoate (n-C14:0)
Water + Octanoyl-ACP (n-C8:0ACP) > acyl carrier protein + Hydrogen ion + Caprylic acid
Water + Palmitoyl-ACP (n-C16:0ACP) > acyl carrier protein + Hydrogen ion + Palmitic acid
2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Hydrogen ion + Water > 5-Amino-6-(5'-phosphoribosylamino)uracil + Ammonium
5-Amino-6-(5'-phosphoribosylamino)uracil + Hydrogen ion + NADPH > 5-Amino-6-(5'-phosphoribitylamino)uracil + NADP
D-Glyceraldehyde 3-phosphate + Hydrogen ion + Pyruvic acid <> Carbon dioxide + 1-Deoxy-D-xylulose 5-phosphate
Adenosine triphosphate + 7-Deaza-7-carboxyguanine + Ammonium > ADP + Hydrogen ion + Water + Phosphate + 7-Cyano-7-carbaguanine
Water + Octanoyl-CoA > Coenzyme A + Hydrogen ion + Caprylic acid
Water + Palmityl-CoA > Coenzyme A + Hydrogen ion + Palmitic acid
Water + Tetradecanoyl-CoA > Coenzyme A + Hydrogen ion + tetradecanoate (n-C14:0)
Water + Hexanoyl-CoA > Coenzyme A + Hydrogen ion + Hexanoate (N-C6:0)
Water + (2E)-Hexadecenoyl-CoA > Coenzyme A + Hydrogen ion + Hexadecenoate (n-C16:1)
Water + (2E)-Tetradecenoyl-CoA > Coenzyme A + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + Octadecenoyl-CoA (N-C18:1CoA) > Coenzyme A + Hydrogen ion + Octadecenoate (N-C18:1)
Water + Stearoyl-CoA > Coenzyme A + Hydrogen ion + Octadecanoate (N-C18:0)
Lauroyl-CoA + Water > Coenzyme A + Dodecanoate (N-C12:0) + Hydrogen ion
Decanoyl-CoA (N-C10:0CoA) + Water > Coenzyme A + Decanoate (N-C10:0) + Hydrogen ion
Adenosine + Adenosine triphosphate > ADP + Adenosine monophosphate + Hydrogen ion
Iron + Protoporphyrin IX >2 Hydrogen ion + Heme
Adenosine triphosphate + Guanosine > ADP + Guanosine monophosphate + Hydrogen ion
Adenosine triphosphate + Inosine <> ADP + Hydrogen ion + Inosinic acid
Water + Uridine diphosphate-N-acetylglucosamine > N-Acetyl-glucosamine 1-phosphate +2 Hydrogen ion + Uridine 5'-monophosphate
Water + Uridine diphosphategalactose > Galactose 1-phosphate +2 Hydrogen ion + Uridine 5'-monophosphate
Water + Uridine diphosphate-N-acetylgalactosamine > N-Acetyl-D-galactosamine 1-phosphate +2 Hydrogen ion + Uridine 5'-monophosphate
Water + Uridine diphosphate glucuronic acid > D-Glucuronate 1-phosphate +2 Hydrogen ion + Uridine 5'-monophosphate
Water + UDP-Glucose > Glucose 1-phosphate +2 Hydrogen ion + Uridine 5'-monophosphate
Adenosine triphosphate + Copper + Water > ADP + Hydrogen ion + Phosphate + Copper
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C12:0) + Water > Dodecanoate (N-C12:0) + Glycerylphosphorylethanolamine + Hydrogen ion
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:0) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + tetradecanoate (n-C14:0)
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:1) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Tetradecenoate (N-C14:1)
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:0) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Palmitic acid
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:1) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Hexadecenoate (n-C16:1)
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:0) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Octadecanoate (N-C18:0)
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:1) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Octadecenoate (N-C18:1)
1-Acyl-sn-glycero-3-phosphoglycerol (N-C12:0) + Water > Dodecanoate (N-C12:0) + Glycerophosphoglycerol + Hydrogen ion
1-Acyl-sn-glycero-3-phosphoglycerol (N-C14:0) + Water > Glycerophosphoglycerol + Hydrogen ion + tetradecanoate (n-C14:0)
1-Acyl-sn-glycero-3-phosphoglycerol (N-C14:1) + Water > Glycerophosphoglycerol + Hydrogen ion + Tetradecenoate (N-C14:1)
1-Acyl-sn-glycero-3-phosphoglycerol (N-C16:0) + Water > Glycerophosphoglycerol + Hydrogen ion + Palmitic acid
1-Acyl-sn-glycero-3-phosphoglycerol (N-C16:1) + Water > Glycerophosphoglycerol + Hydrogen ion + Hexadecenoate (n-C16:1)
1-Acyl-sn-glycero-3-phosphoglycerol (N-C18:0) + Water > Glycerophosphoglycerol + Hydrogen ion + Octadecanoate (N-C18:0)
1-Acyl-sn-glycero-3-phosphoglycerol (N-C18:1) + Water > Glycerophosphoglycerol + Hydrogen ion + Octadecenoate (N-C18:1)
1-Dodecanoyl-sn-glycerol 3-phosphate + Water > Dodecanoate (N-C12:0) + Glycerol 3-phosphate + Hydrogen ion
1-Hexadec-9-enoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate + Hydrogen ion + Hexadecenoate (n-C16:1)
1-hexadecanoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate + Hydrogen ion + Palmitic acid
1-Octadec-11-enoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate + Hydrogen ion + Octadecenoate (N-C18:1)
1-Octadecanoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate + Hydrogen ion + Octadecanoate (N-C18:0)
1-Tetradec-7-enoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate + Hydrogen ion + Tetradecenoate (N-C14:1)
1-Tetradecanoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate + Hydrogen ion + tetradecanoate (n-C14:0)
2 Hydrogen ion + Water + (S)-Ureidoglycolic acid > Carbon dioxide + Glyoxylic acid +2 Ammonium
2 Glyoxylic acid + Hydrogen ion <> Tartronate semialdehyde + Carbon dioxide
Allantoin + Water > Allantoic acid + Hydrogen ion
Adenosine triphosphate + Glyceric acid > 3-Phosphoglycerate + ADP + Hydrogen ion
Allantoic acid + 2 Hydrogen ion + 2 Water > Carbon dioxide +2 Ammonium + (S)-Ureidoglycolic acid
NAD + (S)-Ureidoglycolic acid <> Hydrogen ion + NADH + Oxalureate
5-Aminoimidazole ribonucleotide + Adenosine triphosphate + Hydrogen carbonate > 5-Phosphoribosyl-5-carboxyaminoimidazole + ADP + Hydrogen ion + Phosphate
Water + UDP-2,3-Bis(3-hydroxytetradecanoyl)glucosamine <>2 Hydrogen ion + 2,3-Bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl 1-phosphate + Uridine 5'-monophosphate
Water + 5,10-Methenyltetrahydrofolate <> N10-Formyl-THF + Hydrogen ion
5,10-Methylene-THF + NADP <> 5,10-Methenyltetrahydrofolate + NADPH + Hydrogen ion
6,7-Dihydropteridine + 3 Hydrogen ion + NADH <> NAD + Tetrahydropteridine
6,7-Dihydropteridine + 3 Hydrogen ion + NADPH <> NADP + Tetrahydropteridine
3 (2,3-Dihydroxybenzoyl)adenylic acid + 3 L-Seryl-AMP >6 Adenosine monophosphate + Enterochelin +9 Hydrogen ion
Enterochelin + 3 Water >3 2,3-Dihydroxybenzoylserine +3 Hydrogen ion
Ferric enterobactin + 3 Water >3 2,3-Dihydroxybenzoylserine + Fe3+ +3 Hydrogen ion
Adenosine triphosphate + Hydrogen ion + L-Serine <> Pyrophosphate + L-Seryl-AMP
2-Pyrocatechuic acid + Adenosine triphosphate + Hydrogen ion > (2,3-Dihydroxybenzoyl)adenylic acid + Pyrophosphate
(2S,3S)-2,3-Dihydro-2,3-dihydroxybenzoate + NAD + 2,3-Dihydro-2,3-dihydroxybenzoic acid <> 2-Pyrocatechuic acid + Hydrogen ion + NADH
core oligosaccharide lipid A + Hydrogen ion + Palmitic acid > Water + hepta-acylated core oligosaccharide lipid A (E. coli)
Hydrogen ion + Palmitic acid + KDO2-Lipid A > Water + Hepta-acylated KDO2-lipid A
[4Fe-4S] iron-sulfur cluster + 2 S-Adenosylmethionine + Hydrogen ion + NAD + octanoate (protein bound) > [2Fe-2S] iron-sulfur cluster +2 5'-Deoxyadenosine +2 Iron + lipoate (protein bound) +2 L-Methionine + NADH
Hydrogen ion + Octanoyl-ACP (n-C8:0ACP) > acyl carrier protein + octanoate (protein bound)
Adenosine triphosphate + Hydrogen ion + Nicotinamide ribotide <> Nicotinic acid adenine dinucleotide + Pyrophosphate
L-Aspartic acid + Adenosine triphosphate + L-Glutamine + Water > Adenosine monophosphate + L-Asparagine + L-Glutamate + Hydrogen ion + Pyrophosphate
Acetyl-CoA + Water + Oxalacetic acid <> Citric acid + Coenzyme A + Hydrogen ion
1,4-Dihydroxy-2-naphthoyl-CoA + Water > Coenzyme A + 1,4-Dihydroxy-2-naphthoic acid + Hydrogen ion
6-Phosphonoglucono-D-lactone + Water <> 6-Phosphogluconic acid + Hydrogen ion
[2Fe-2S] iron-sulfur cluster + S-Adenosylmethionine + Dethiobiotin > [2Fe-1S] desulfurated iron-sulfur cluster + Biotin + 5'-Deoxyadenosine + Hydrogen ion + L-Methionine
Adenosine triphosphate + Carbon dioxide + 7,8-Diaminononanoate <> ADP + Dethiobiotin +3 Hydrogen ion + Phosphate
Adenosine triphosphate + Hydrogen ion + MoaD Protein with carboxylate > MoaD Protein with bound AMP + Pyrophosphate
2 Hydrogen ion + Molybdate + Adenylated molybdopterin > Adenosine monophosphate + Copper + Water + Molybdopterin
2 Hydrogen ion + Adenylated molybdopterin + Tungstate > Adenosine monophosphate + Copper + Water + tungsten binding cofactor
Adenosine triphosphate + core oligosaccharide lipid A + Water > ADP + Hydrogen ion + Phosphate + core oligosaccharide lipid A
Adenosine triphosphate + Water + cold adapted KDO(2)-lipid (A) > ADP + Hydrogen ion + Phosphate + cold adapted KDO(2)-lipid (A)
Adenosine triphosphate + Water + PA(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PA(16:0/16:0)
Adenosine triphosphate + Water + PA(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PA(16:0/16:0)
Adenosine triphosphate + Water + PA(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PA(16:0/16:0)
Adenosine triphosphate + Water + PA(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PA(16:0/16:0)
Adenosine triphosphate + Water + PA(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PA(16:0/16:0)
Adenosine triphosphate + Water + PA(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PA(16:0/16:0)
Adenosine triphosphate + Water + PA(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PA(16:0/16:0)
Adenosine triphosphate + Water + PE(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PE(14:0/14:0)
Adenosine triphosphate + Water + PE(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PE(14:0/14:0)
Adenosine triphosphate + Water + PE(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PE(14:0/14:0)
Adenosine triphosphate + Water + PE(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PE(14:0/14:0)
Adenosine triphosphate + Water + PE(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PE(14:0/14:0)
Adenosine triphosphate + Water + PE(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PE(14:0/14:0)
Adenosine triphosphate + Water + PE(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PE(14:0/14:0)
Adenosine triphosphate + Water + PG(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PG(16:0/16:0)
Adenosine triphosphate + Water + PG(16:1(9Z)/16:1(9Z)) > ADP + Hydrogen ion + Phosphate + PG(16:1(9Z)/16:1(9Z))
Adenosine triphosphate + Water + PG(18:1(11Z)/18:1(11Z)) > ADP + Hydrogen ion + Phosphate + PG(18:1(11Z)/18:1(11Z))
Adenosine triphosphate + Water + PG(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PG(14:0/14:0)
Adenosine triphosphate + Water + KDO2-Lipid A > ADP + Hydrogen ion + Phosphate + KDO2-Lipid A
Adenosine triphosphate + Water + KDO(2)-lipid IV(A) > ADP + Hydrogen ion + Phosphate + KDO(2)-lipid IV(A)
Adenosine triphosphate + Water + PG(12:0/12:0) > ADP + Hydrogen ion + Phosphate + PG(12:0/12:0)
Adenosine triphosphate + Water + PG(14:1(7Z)/14:1(7Z)) > ADP + Hydrogen ion + Phosphate + PG(14:1(7Z)/14:1(7Z))
Adenosine triphosphate + Water + PG(18:0/18:0) > ADP + Hydrogen ion + Phosphate + PG(18:0/18:0)
Adenosine triphosphate + Water + PGP(12:0/12:0) > ADP + Hydrogen ion + Phosphate + PGP(12:0/12:0)
Adenosine triphosphate + Water + PGP(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PGP(14:0/14:0)
Adenosine triphosphate + Water + PGP(14:1(7Z)/14:1(7Z)) > ADP + Hydrogen ion + Phosphate + PGP(14:1(7Z)/14:1(7Z))
Adenosine triphosphate + Water + PGP(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PGP(16:0/16:0)
Adenosine triphosphate + Water + PGP(16:1(9Z)/16:1(9Z)) > ADP + Hydrogen ion + Phosphate + PGP(16:1(9Z)/16:1(9Z))
Adenosine triphosphate + Water + PGP(18:0/18:0) > ADP + Hydrogen ion + Phosphate + PGP(18:0/18:0)
Adenosine triphosphate + Water + PGP(18:1(11Z)/18:1(11Z)) > ADP + Hydrogen ion + Phosphate + PGP(18:1(11Z)/18:1(11Z))
Adenosine triphosphate + 2,3,2',3'-Tetrakis(3-hydroxytetradecanoyl)-D-glucosaminyl-1,6-beta-D-glucosamine 1-phosphate > ADP + Hydrogen ion + 2,3,2'3'-Tetrakis(beta-hydroxymyristoyl)-D-glucosaminyl-1,6-beta-D-glucosamine 1,4'-bisphosphate
FMNH + Oxygen + Sulfoacetate > Flavin Mononucleotide + Glyoxylic acid + Hydrogen ion + Water + Sulfite
FMNH + Isethionic acid + Oxygen > Flavin Mononucleotide + Glycolaldehyde + Hydrogen ion + Water + Sulfite
FMNH + Methanesulfonate + Oxygen > Formaldehyde + Flavin Mononucleotide + Hydrogen ion + Water + Sulfite
Butanesulfonate + FMNH + Oxygen > Butanal + Flavin Mononucleotide + Hydrogen ion + Water + Sulfite
Ethanesulfonate + FMNH + Oxygen > Acetaldehyde + Flavin Mononucleotide + Hydrogen ion + Water + Sulfite
Water + Hexadecanoyl-phosphate (n-C16:0) >2 Hydrogen ion + Palmitic acid + Phosphate
Water + Hexadecanoyl-phosphate (n-C16:1) >2 Hydrogen ion + Hexadecenoate (n-C16:1) + Phosphate
Water + Octadecanoyl-phosphate (n-C18:0) >2 Hydrogen ion + Octadecanoate (N-C18:0) + Phosphate
Water + Octadecanoyl-phosphate (n-C18:1) >2 Hydrogen ion + Octadecenoate (N-C18:1) + Phosphate
Water + Tetradecanoyl-phosphate (n-C14:0) >2 Hydrogen ion + Phosphate + tetradecanoate (n-C14:0)
Water + Tetradecanoyl-phosphate (n-C14:1) >2 Hydrogen ion + Phosphate + Tetradecenoate (N-C14:1)
Dodecanoly-phosphate (n-C12:0) + Water > Dodecanoate (N-C12:0) +2 Hydrogen ion + Phosphate
Guanosine triphosphate + Water > Guanosine diphosphate + Hydrogen ion + Phosphate
3-Aminoacrylate + Hydrogen ion + Water > Malonic semialdehyde + Ammonium
Water + Ureidoacrylate peracid > Carbamic acid + Hydrogen ion + Peroxyaminoacrylate
FAD + L-Proline > L-D-1-Pyrroline-5-carboxylic acid + FADH2 + Hydrogen ion
L-D-1-Pyrroline-5-carboxylic acid + 2 Water + NAD > L-Glutamate + Hydrogen ion + NADH
4,5-Dihydroorotic acid + Water <> Ureidosuccinic acid + Hydrogen ion
Acetyl-CoA + Hydrogen ion + Malonyl-[acyl-carrier protein] > Acetoacetyl-ACP + Carbon dioxide + Coenzyme A
Hydrogen ion + Malonyl-[acyl-carrier protein] + malonyl-CoA methyl ester > Carbon dioxide + Coenzyme A +3 -Oxo-glutaryl-[acyl-carrier protein] methyl ester
3 -oxo-cis-dodec-5-enoyl-[acyl-carrier protein] + Hydrogen ion + NADPH > (R)-3-hydroxy-cis-dodec-5-enoyl-[acyl-carrier protein] + NADP
3 -oxo-cis-myristol-7-eoyl-[acyl-carrier protein] + Hydrogen ion + NADPH > (R)-3-hydroxy-cis-myristol-7-eoyl-[acyl-carrier protein] + NADP
3 -oxo-cis-palm-9-eoyl-[acyl-carrier protein] + Hydrogen ion + NADPH > (R)-3-hydroxy-cis-palm-9-eoyl-[acyl-carrier protein] + NADP
3 -oxo-cis-vacc-11-enoyl-[acyl-carrier protein] + Hydrogen ion + NADPH > (R)-3-hydroxy-cis-vacc-11-enoyl-[acyl-carrier protein] + NADP
3 -Oxodecanoyl-[acyl-carrier protein] + Hydrogen ion + NADPH <> (R)-3-Hydroxydecanoyl-[acyl-carrier protein] + NADP
3 -Oxododecanoyl-[acyl-carrier protein] + Hydrogen ion + NADPH <> (R)-3-Hydroxydodecanoyl-[acyl-carrier protein] + NADP
3 -Oxohexadecanoyl-[acyl-carrier protein] + Hydrogen ion + NADPH <> R-3-hydroxypalmitoyl-[acyl-carrier protein] + NADP
3 -Oxohexanoyl-[acyl-carrier protein] + Hydrogen ion + NADPH <> (R)-3-Hydroxyhexanoyl-[acyl-carrier protein] + NADP
3 -Oxooctadecanoyl-[acyl-carrier protein] + Hydrogen ion + NADPH <> (R)-3-Hydroxyoctadecanoyl-[acyl-carrier protein] + NADP
3 -Oxooctanoyl-[acyl-carrier protein] + Hydrogen ion + NADPH <> (R)-3-Hydroxyoctanoyl-[acyl-carrier protein] + NADP
3 -Oxotetradecanoyl-[acyl-carrier protein] + Hydrogen ion + NADPH <> (R)-3-Hydroxytetradecanoyl-[acyl-carrier protein] + NADP
Acetoacetyl-ACP + Hydrogen ion + NADPH <> (3R)-3-Hydroxyacyl-[acyl-carrier protein] + NADP
Hydrogen ion + NADPH + 3 -Oxo-glutaryl-[acyl-carrier protein] methyl ester >3 -Hydroxyglutaryl-[acyl-carrier protein] methyl ester + NADP
Hydrogen ion + NADPH + 3 -Oxo-pimeloyl-[acyl-carrier protein] methyl ester >3 -Hydroxypimeloyl-[acyl-carrier protein] methyl ester + NADP
Hydrogen ion + cis-hexadec-9-enoyl-[acyl-carrier protein] (n-C16:1) + Malonyl-[acyl-carrier protein] >3 -oxo-cis-vacc-11-enoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
4-Amino-4-deoxychorismate <> p-Aminobenzoic acid + Hydrogen ion + Pyruvic acid
Adenosine triphosphate + Thiamine <> ADP + Hydrogen ion + Thiamine monophosphate
2-Demethylmenaquinone 8 + Hydrogen ion + NADH > 2-Demethylmenaquinol 8 + NAD
Hydrogen ion + NADH + Ubiquinone-8 > NAD + Ubiquinol-8
Hydrogen ion + Menaquinone 8 + NADH > Menaquinol 8 + NAD
N-Acetyl-D-glucosamine + Adenosine triphosphate <> N-Acetyl-D-Glucosamine 6-Phosphate + ADP + Hydrogen ion
Water + Thiamine pyrophosphate > Hydrogen ion + Phosphate + Thiamine monophosphate
Adenosine triphosphate + D-Ribose-5-phosphate <> Adenosine monophosphate + Hydrogen ion + Phosphoribosyl pyrophosphate
4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Adenosine triphosphate <> 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + ADP + Hydrogen ion
L-Glutamyl-tRNA(Glu) + Hydrogen ion + NADPH > (S)-4-Amino-5-oxopentanoate + NADP + tRNA (Glu)
N10-Formyl-THF + Water <> Formic acid + Hydrogen ion + Tetrahydrofolic acid
Glucose 1-phosphate + Hydrogen ion + Uridine triphosphate <> Pyrophosphate + UDP-Glucose
Adenosine triphosphate + Deoxyuridine > ADP + dUMP + Hydrogen ion
Adenosine triphosphate + Thymidine <> ADP + 5-Thymidylic acid + Hydrogen ion
1-(2-Carboxyphenylamino)-1'-deoxy-D-ribulose 5'-phosphate + Hydrogen ion <> Indoleglycerol phosphate + Carbon dioxide + Water
Adenosine triphosphate + Cob(I)alamin + Hydrogen ion <> Adenosylcobalamin + Triphosphate
Adenosine triphosphate + Cobinamide + Hydrogen ion <> Adenosyl cobinamide + Triphosphate
Guanosine triphosphate + 3 Water <> 2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Formic acid +2 Hydrogen ion + Pyrophosphate + 2,5-diamino-6-hydroxy-4-(5-phospho-D-ribosylamino)pyrimidine
Hydrogen ion + Orotidylic acid <> Carbon dioxide + Uridine 5'-monophosphate
But-2-enoyl-[acyl-carrier protein] + Hydrogen ion + NADH > Butyryl-ACP (n-C4:0ACP) + NAD
But-2-enoyl-[acyl-carrier protein] + Hydrogen ion + NADPH > Butyryl-ACP (n-C4:0ACP) + NADP
Hydrogen ion + NADH + trans-3-cis-11-vacceoyl-[acyl-carrier protein] > NAD + cis-octadec-11-enoyl-[acyl-carrier protein] (n-C18:1)
Hydrogen ion + NADH + trans-3-cis-5-dodecenoyl-[acyl-carrier protein] > cis-dodec-5-enoyl-[acyl-carrier protein] (n-C12:1) + NAD
Hydrogen ion + NADH + trans-3-cis-7-myristoleoyl-[acyl-carrier protein] > NAD + cis-tetradec-7-enoyl-[acyl-carrier protein] (n-C14:1)
Hydrogen ion + NADH + trans-3-cis-9-palmitoleoyl-[acyl-carrier protein] > cis-hexadec-9-enoyl-[acyl-carrier protein] (n-C16:1) + NAD
Hydrogen ion + NADH + trans-Dec-2-enoyl-[acyl-carrier protein] > Decanoyl-ACP (n-C10:0ACP) + NAD
Hydrogen ion + NADH + trans-Dodec-2-enoyl-[acyl-carrier protein] > Dodecanoyl-ACP (n-C12:0ACP) + NAD
Hydrogen ion + NADH + trans-Hex-2-enoyl-[acyl-carrier protein] > Hexanoyl-ACP (n-C6:0ACP) + NAD
Hydrogen ion + NADH + trans-Hexadec-2-enoyl-[acyl-carrier protein] > NAD + Palmitoyl-ACP (n-C16:0ACP)
Hydrogen ion + NADH + trans-Oct-2-enoyl-[acyl-carrier protein] > NAD + Octanoyl-ACP (n-C8:0ACP)
Hydrogen ion + NADH + trans-octadec-2-enoyl-[acyl-carrier protein] > NAD + Octadecanoyl-ACP (n-C18:0ACP)
Hydrogen ion + NADH + trans-Tetradec-2-enoyl-[acyl-carrier protein] > Myristoyl-ACP (n-C14:0ACP) + NAD
Hydrogen ion + NADPH + trans-3-cis-11-vacceoyl-[acyl-carrier protein] > NADP + cis-octadec-11-enoyl-[acyl-carrier protein] (n-C18:1)
Hydrogen ion + NADPH + trans-3-cis-5-dodecenoyl-[acyl-carrier protein] > cis-dodec-5-enoyl-[acyl-carrier protein] (n-C12:1) + NADP
Hydrogen ion + NADPH + trans-3-cis-7-myristoleoyl-[acyl-carrier protein] > NADP + cis-tetradec-7-enoyl-[acyl-carrier protein] (n-C14:1)
Hydrogen ion + NADPH + trans-3-cis-9-palmitoleoyl-[acyl-carrier protein] > cis-hexadec-9-enoyl-[acyl-carrier protein] (n-C16:1) + NADP
Hydrogen ion + NADPH + trans-Dec-2-enoyl-[acyl-carrier protein] > Decanoyl-ACP (n-C10:0ACP) + NADP
Hydrogen ion + NADPH + trans-Dodec-2-enoyl-[acyl-carrier protein] > Dodecanoyl-ACP (n-C12:0ACP) + NADP
Hydrogen ion + NADPH + trans-Hex-2-enoyl-[acyl-carrier protein] > Hexanoyl-ACP (n-C6:0ACP) + NADP
Hydrogen ion + NADPH + trans-Hexadec-2-enoyl-[acyl-carrier protein] > NADP + Palmitoyl-ACP (n-C16:0ACP)
Hydrogen ion + NADPH + trans-Oct-2-enoyl-[acyl-carrier protein] > NADP + Octanoyl-ACP (n-C8:0ACP)
Hydrogen ion + NADPH + trans-octadec-2-enoyl-[acyl-carrier protein] > NADP + Octadecanoyl-ACP (n-C18:0ACP)
Hydrogen ion + NADPH + trans-Tetradec-2-enoyl-[acyl-carrier protein] > Myristoyl-ACP (n-C14:0ACP) + NADP
Enoylglutaryl-[acyl-carrier protein] methyl ester + Hydrogen ion + NADPH > Glutaryl-[acyl-carrier protein] methyl ester + NADP
Enoylpimeloyl-[acyl-carrier protein] methyl ester + Hydrogen ion + NADPH > NADP + Pimeloyl-[acyl-carrier protein] methyl ester
Adenosine triphosphate + L-Glutamate + Putrescine + Ethylenediamine <> ADP + gamma-Glutamyl-L-putrescine + Hydrogen ion + Phosphate
Acetaldehyde + Water + NAD > Acetic acid +2 Hydrogen ion + NADH
gamma-Glutamyl-gamma-butyraldehyde + Water + NADP <> 4-(Glutamylamino) butanoate +2 Hydrogen ion + NADPH
Hydrogen cyanide + Thiosulfate > Hydrogen ion + Sulfite + Thiocyanate
Water + NAD + Phenylacetaldehyde <>2 Hydrogen ion + NADH + Benzeneacetic acid
2-Oxepin-2(3H)-ylideneacetyl-CoA + 2 Water + NADP > 3-Oxo-5,6-dehydrosuberyl-CoA +2 Hydrogen ion + NADPH
(3S)-3-Hydroxyadipyl-CoA + NAD <> Hydrogen ion + NADH + 3-Oxoadipyl-CoA
Water + Lactaldehyde + NAD + (S)-Lactaldehyde <>2 Hydrogen ion + L-Lactic acid + NADH
Glycolaldehyde + Water + NAD > Glycolic acid +2 Hydrogen ion + NADH
4-Aminobutyraldehyde + Water + NAD <> gamma-Aminobutyric acid +2 Hydrogen ion + NADH
Cyclic AMP + Water > Adenosine monophosphate + Hydrogen ion
Cyclic GMP + Water > Guanosine monophosphate + Hydrogen ion
D-Altronate + NAD <> Hydrogen ion + NADH + 5-Keto-D-gluconate + D-Tagaturonate
Water + NAD + Succinic acid semialdehyde >2 Hydrogen ion + NADH + Succinic acid
NADP + L-Serine <> 2-Aminomalonate semialdehyde + Hydrogen ion + NADPH
NADP + D-Serine <> 2-Aminomalonate semialdehyde + Hydrogen ion + NADPH
L-Allothreonine + NADP <> L-2-Amino-3-oxobutanoic acid + Hydrogen ion + NADPH
Acetyl-CoA + Spermidine > N1-Acetylspermidine + Coenzyme A + Hydrogen ion
Acetyl-CoA + Spermidine > Coenzyme A + Hydrogen ion + N8-Acetylspermidine
7,8-Dihydroneopterin + Hydrogen ion + NADPH > NADP + Tetrahydromonapterin
Adenosine + Hydrogen ion + Water > Inosine + Ammonium
Deoxyadenosine + Hydrogen ion + Water > Deoxyinosine + Ammonium
1,6-Anhydro-N-acetylmuramate + Adenosine triphosphate + Water > N-Acetylmuramic acid 6-phosphate + ADP + Hydrogen ion
2 Hydrogen ion + 2 Superoxide anion > Hydrogen peroxide + Oxygen
2 S-Adenosylmethionine + PE(14:0/14:0) >2 S-Adenosylhomocysteine + Cyclopropane phosphatidylethanolamine (dihexadec-9,10-cyclo-anoyl, N-C16:0 cyclo) +2 Hydrogen ion
2 S-Adenosylmethionine + PE(14:0/14:0) >2 S-Adenosylhomocysteine + Cyclopropane phosphatidylethanolamine (dioctadec-11,12-cyclo-anoyl, N-C18:0 cyclo) +2 Hydrogen ion
2 S-Adenosylmethionine + PG(16:1(9Z)/16:1(9Z)) >2 S-Adenosylhomocysteine + Cyclopropane phosphatidylglycerol (dihexadec-9,10-cyclo-anoyl, N-C16:0 cyclo) +2 Hydrogen ion
2 S-Adenosylmethionine + PG(18:1(11Z)/18:1(11Z)) >2 S-Adenosylhomocysteine + Cyclopropane phosphatidylglycerol (dioctadec-11,12-cyclo-anoyl, N-C18:0 cyclo) +2 Hydrogen ion
NAD + Quinate <> 3-Dehydroquinate +2 Hydrogen ion + NADH
Adenosine triphosphate + Water + Pyruvic acid <> Adenosine monophosphate +2 Hydrogen ion + Phosphoenolpyruvic acid + Phosphate
Adenosine triphosphate + Nicotinic acid adenine dinucleotide + Ammonium > Adenosine monophosphate + Hydrogen ion + NAD + Pyrophosphate
2 Hydrogen ion + 2 Water + N2-Succinyl-L-arginine > Carbon dioxide +2 Ammonium + N2-Succinyl-L-ornithine
Water + NAD + N2-Succinyl-L-glutamic acid 5-semialdehyde <>2 Hydrogen ion + NADH + N-Succinyl-L-glutamate
L-Arginine + Succinyl-CoA <> Coenzyme A + Hydrogen ion + N2-Succinyl-L-arginine
L-Glutamate + Water + NADP <> alpha-Ketoglutarate + Hydrogen ion + NADPH + Ammonium
D-Glyceraldehyde 3-phosphate + NAD + Phosphate <> Glyceric acid 1,3-biphosphate + Hydrogen ion + NADH + 3-phospho-D-glyceroyl phosphate
Adenosine triphosphate + Formic acid + Glycineamideribotide > ADP + 5'-Phosphoribosyl-N-formylglycineamide + Hydrogen ion + Phosphate
Hydrogen ion + Oxalacetic acid > Carbon dioxide + Pyruvic acid
Glucose 6-phosphate + NADP <> 6-Phosphonoglucono-D-lactone + Hydrogen ion + NADPH
Glucose 6-phosphate + UDP-Glucose > Hydrogen ion + Trehalose 6-phosphate + Uridine 5'-diphosphate
CDP-1,2-didodecanoylglycerol + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(12:0/12:0)
CDP-1,2-dihexadec-9-enoylglycerol + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(16:1(9Z)/16:1(9Z))
CDP-1,2-dihexadecanoylglycerol + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(16:0/16:0)
CDP-1,2-dioctadec-11-enoylglycerol + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(18:1(11Z)/18:1(11Z))
CDP-1,2-Dioctadecanoylglycerol + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(18:0/18:0)
CDP-1,2-ditetradec-7-enoylglycerol + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(14:1(7Z)/14:1(7Z))
CDP-1,2-ditetradecanoylglycerol + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(14:0/14:0)
Dimethylbenzimidazole + Nicotinamide ribotide <> N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole + Hydrogen ion + Nicotinic acid
Adenosylcobinamide-GDP + N1-(alpha-D-ribosyl)-5,6-dimethyl-benzimidazole > Adenosylcobalamin + Guanosine monophosphate + Hydrogen ion
Adenosyl cobinamide + Adenosine triphosphate > Adenosyl cobinamide phosphate + ADP + Hydrogen ion
Adenosyl cobinamide phosphate + Guanosine triphosphate + Hydrogen ion > Adenosylcobinamide-GDP + Pyrophosphate
Water + L-Histidinol + 2 NAD >3 Hydrogen ion + L-Histidine +2 NADH
Water + Phosphoribosyl-ATP <> Hydrogen ion + Pyrophosphate + Phosphoribosyl-AMP
Water + 2 NAD + UDP-Glucose <>3 Hydrogen ion +2 NADH + Uridine diphosphate glucuronic acid + UDP-Glucuronic acid
6-Phosphogluconic acid + NADP <> Carbon dioxide + NADPH + D-Ribulose 5-phosphate + Hydrogen ion
O-Acetyl-rhamanosyl-N-acetylglucosamyl-undecaprenyl diphosphate + UDP-Glucose > Glucosyl-O-acetyl-rhamanosyl-N-acetylglucosamyl-undecaprenyl diphosphate + Hydrogen ion + Uridine 5'-diphosphate
Glucosyl-O-acetyl-rhamanosyl-N-acetylglucosamyl-undecaprenyl diphosphate + UDP-D-Galacto-1,4-furanose > Galactofuranosyl-glucosyl-O-acetyl-rhamanosyl-N-acetylglucosamyl-undecaprenyl diphosphate + Hydrogen ion + Uridine 5'-diphosphate
dTDP-4-Dehydro-6-deoxy-L-mannose + Hydrogen ion + NADPH <> Deoxythymidine diphosphate-L-rhamnose + NADP
Guanosine diphosphate + Hydrogen ion + D-Mannose 1-phosphate > Guanosine diphosphate mannose + Phosphate
Guanosine diphosphate mannose + Water > Guanosine diphosphate + Hydrogen ion + D-Mannose
GDP-4-Oxo-L-fucose + Hydrogen ion + NADPH > GDP-L-Fucose + NADP
dCTP + Hydrogen ion + Water > Deoxyuridine triphosphate + Ammonium
Cytidine + Guanosine triphosphate > Cytidine monophosphate + Guanosine diphosphate + Hydrogen ion
Guanosine triphosphate + Uridine > Guanosine diphosphate + Hydrogen ion + Uridine 5'-monophosphate
Galactitol 1-phosphate + NAD <> Hydrogen ion + NADH + D-Tagatose 6-phosphate
5-(2-Hydroxyethyl)-4-methylthiazole + Adenosine triphosphate + 4-methyl-5-(2-hydroxyethyl)thiazole <> 4-Methyl-5-(2-phosphoethyl)-thiazole + ADP + Hydrogen ion
Deoxycytidine + Hydrogen ion + Water > Deoxyuridine + Ammonium
Cytidine + Hydrogen ion + Water > Ammonium + Uridine
Guanosine triphosphate + Water > Dihydroneopterin triphosphate + Formic acid + Hydrogen ion
Adenosine triphosphate + Fructose 1-phosphate > ADP + Fructose 1,6-bisphosphate + Hydrogen ion
2-Octaprenyl-6-hydroxyphenol + S-Adenosylmethionine > 2-Octaprenyl-6-methoxyphenol + S-Adenosylhomocysteine + Hydrogen ion
2-Octaprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinol + S-Adenosylmethionine > S-Adenosylhomocysteine + Hydrogen ion + Ubiquinol-8
Glycerophosphocholine + Water > Choline + Glycerol 3-phosphate + Hydrogen ion
Glycerylphosphorylethanolamine + Water > Ethanolamine + Glycerol 3-phosphate + Hydrogen ion
Glycerophosphoglycerol + Water > Glycerol + Glycerol 3-phosphate + Hydrogen ion
Glycerophosphoserine + Water > Glycerol 3-phosphate + Hydrogen ion + L-Serine
Sn-Glycero-3-phospho-1-inositol + Water > Glycerol 3-phosphate + Hydrogen ion + Inositol
N10-Formyl-THF + Uridine 5''-diphospho-{beta}-4-deoxy-4-amino-L-arabinose <> Hydrogen ion + Tetrahydrofolic acid + Uridine 5''-diphospho-{beta}-4-deoxy-4-formamido-L-arabinose
Hydrogen ion + 2-Succinylbenzoyl-CoA > 1,4-Dihydroxy-2-naphthoyl-CoA + Water
alpha-Ketoglutarate + Hydrogen ion + Isochorismate <> 2-Succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate + Carbon dioxide
Adenosine triphosphate + 7,8-Dihydropteroic acid + L-Glutamate <> ADP + Dihydrofolic acid + Hydrogen ion + Phosphate
4-Phospho-D-erythronate + NAD <> Hydrogen ion + NADH + 2-Oxo-3-hydroxy-4-phosphobutanoic acid
cis-dec-3-enoyl-[acyl-carrier protein] (n-C10:1) + Hydrogen ion + Malonyl-[acyl-carrier protein] >3 -oxo-cis-dodec-5-enoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
cis-dodec-5-enoyl-[acyl-carrier protein] (n-C12:1) + Hydrogen ion + Malonyl-[acyl-carrier protein] >3 -oxo-cis-myristol-7-eoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
Hydrogen ion + Malonyl-[acyl-carrier protein] + cis-tetradec-7-enoyl-[acyl-carrier protein] (n-C14:1) >3 -oxo-cis-palm-9-eoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
Hydrogen ion + Malonyl-[acyl-carrier protein] > Acetyl-ACP + Carbon dioxide
Glutaryl-[acyl-carrier protein] methyl ester + Hydrogen ion + Malonyl-[acyl-carrier protein] > acyl carrier protein + Carbon dioxide +3 -Oxo-pimeloyl-[acyl-carrier protein] methyl ester
Hydrogen ion + Oxalyl-CoA <> Carbon dioxide + Formyl-CoA
Adenosine triphosphate + D-Glucose > ADP + Glucose 6-phosphate + Hydrogen ion
Adenosine triphosphate + Pyridoxine > ADP + Hydrogen ion + Pyridoxine 5'-phosphate
Adenosine triphosphate + Pyridoxamine > ADP + Hydrogen ion + Pyridoxamine 5'-phosphate
Coproporphyrin III + 2 Hydrogen ion + Oxygen <>2 Carbon dioxide +2 Water + Protoporphyrinogen IX
Guanosine diphosphate mannose + Water > Guanosine monophosphate +2 Hydrogen ion + D-Mannose 1-phosphate
5-Amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylate + L-Aspartic acid + Adenosine triphosphate <> SAICAR + ADP + Hydrogen ion + Phosphate
L-Aspartate-semialdehyde + Pyruvic acid > 2,3-Dihydrodipicolinic acid + Hydrogen ion +2 Water
Adenosine triphosphate + Phosphoribosylformylglycineamidine <> ADP + 5-Aminoimidazole ribonucleotide +2 Hydrogen ion + Phosphate
N10-Formyl-THF + Glycineamideribotide <> 5'-Phosphoribosyl-N-formylglycineamide + Hydrogen ion + Tetrahydrofolic acid
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid > Adenosine monophosphate + L-Glutamate + Guanosine monophosphate +2 Hydrogen ion + Pyrophosphate
Water + Inosinic acid + NAD <> Hydrogen ion + NADH + Xanthylic acid
Hydrogen cyanide + 3-Mercaptopyruvic acid + Cyanide <> Hydrogen ion + Pyruvic acid + Thiocyanate
FADH2 + 2 Hydrogen ion + IscU with two bound [2Fe-2S] clusters > FAD + IscU with bound [4Fe-4S] cluster
cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD > Trans-2,3-Dihydroxycinnamate + Hydrogen ion + NADH
Cis-3-(3-carboxyethyl)-3,5-cyclohexadiene-1,2-diol + NAD > 3-(2,3-Dihydroxyphenyl)propionic acid + Hydrogen ion + NADH
Water + 5,10-Methenyltetrahydrofolate > N5-Formyl-H4F + Hydrogen ion
NADH + 2 Nitric oxide + 2 Oxygen > Hydrogen ion + NAD +2 Nitrate
NADPH + 2 Nitric oxide + 2 Oxygen > Hydrogen ion + NADP +2 Nitrate
Adenosine triphosphate + 5'-Phosphoribosyl-N-formylglycineamide + L-Glutamine + Water <> ADP + Phosphoribosylformylglycineamidine + L-Glutamate + Hydrogen ion + Phosphate
L-Aspartic acid + Fumaric acid > Hydrogen ion + Iminoaspartic acid + Succinic acid
L-Aspartic acid + Oxygen <> Hydrogen ion + Hydrogen peroxide + Iminoaspartic acid
L-Aspartic acid + Ubiquinone-8 > Hydrogen ion + Iminoaspartic acid + Ubiquinol-8
L-Aspartic acid + Menaquinone 8 > Hydrogen ion + Iminoaspartic acid + Menaquinol 8
CDP-1,2-didodecanoylglycerol + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/16:0)
CDP-1,2-dihexadec-9-enoylglycerol + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/16:0)
CDP-1,2-dihexadecanoylglycerol + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/16:0)
CDP-1,2-dioctadec-11-enoylglycerol + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/16:0)
CDP-1,2-Dioctadecanoylglycerol + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/16:0)
CDP-1,2-ditetradec-7-enoylglycerol + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/16:0)
CDP-1,2-ditetradecanoylglycerol + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/16:0)
Hydrogen ion + Prephenate > Carbon dioxide + Water + Phenylpyruvic acid
Adenosine triphosphate + NAD <> ADP + Hydrogen ion + NADP
Adenosine triphosphate + L-Cysteine + L-Glutamate <> ADP + gamma-Glutamylcysteine + Hydrogen ion + Phosphate
NAD + Sorbitol-6-phosphate <> Fructose 6-phosphate + Hydrogen ion + NADH
2-C-Methyl-D-erythritol-4-phosphate + Cytidine triphosphate + Hydrogen ion <> 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Pyrophosphate
Adenosine phosphosulfate + Adenosine triphosphate <> ADP + Hydrogen ion + Phosphoadenosine phosphosulfate
Dihydroneopterin triphosphate + Water > Acetaldehyde + 6-Carboxy-5,6,7,8-tetrahydropterin + Hydrogen ion + Triphosphate
Adenosine triphosphate + L-Glutamine + Water + Uridine triphosphate > ADP + Cytidine triphosphate + L-Glutamate +2 Hydrogen ion + Phosphate
Water + Uridine triphosphate > Hydrogen ion + Pyrophosphate + Uridine 5'-monophosphate
Adenosine triphosphate + Water <> Adenosine monophosphate + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Guanosine triphosphate <> Adenosine monophosphate + Guanosine 3'-diphosphate 5'-triphosphate + Hydrogen ion
3 Hydrogen ion + 2 NADPH + 7-Cyano-7-carbaguanine >2 NADP + Queuine
Hydrogen ion + Lactaldehyde + NADH <> (S)-Propane-1,2-diol + NAD
Adenosine triphosphate + L-Fuculose <> ADP + L-Fuculose 1-phosphate + Hydrogen ion
3-Sulfinoalanine + 2 Hydrogen ion > L-Alanine + Sulfur dioxide
Acetyl-CoA + L-Glutamate <> N-Acetyl-L-alanine + Coenzyme A + Hydrogen ion + N-Acetylglutamic acid
Diaminopimelic acid + Hydrogen ion > Carbon dioxide + L-Lysine
Cytidine triphosphate + Hydrogen ion + Molybdopterin > Molybdopterin cytosine dinucleotide + Pyrophosphate
Guanine + Hydrogen ion + Water > Ammonium + Xanthine
N5-Formyl-H4F + Hydrogen ion > Water + 5,10-Methenyltetrahydrofolate
3-Phosphoglycerate + NAD > Phosphohydroxypyruvic acid + Hydrogen ion + NADH
Hydrogen ion + (S)-Methylmalonyl-CoA <> Carbon dioxide + Propionyl-CoA
L-Arginine + Hydrogen ion <> Agmatine + Carbon dioxide
Adenosine triphosphate + gamma-Glutamylcysteine + Glycine <> ADP + Glutathione + Hydrogen ion + Phosphate
Water + Inosine triphosphate > Hydrogen ion + Inosinic acid + Pyrophosphate
Water + Xanthosine 5-triphosphate > Hydrogen ion + Pyrophosphate + Xanthylic acid
2'-Deoxyinosine triphosphate + Water > DIMP + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Glutathione + Spermidine <> ADP + Glutathionylspermidine + Hydrogen ion + Phosphate
2-Demethylmenaquinone 8 + Hydrogen ion + NADPH > 2-Demethylmenaquinol 8 + NADP
Hydrogen ion + NADPH + Ubiquinone-8 > NADP + Ubiquinol-8
Hydrogen ion + Menaquinone 8 + NADPH > Menaquinol 8 + NADP
Menaquinol 8 + 2 Oxygen >2 Hydrogen ion + Menaquinone 8 +2 Superoxide anion
2 Oxygen + Ubiquinol-8 >2 Hydrogen ion +2 Superoxide anion + Ubiquinone-8
D-Ribulose 5-phosphate <> 3,4-Dihydroxy-2-butanone-4-P + Formic acid + Hydrogen ion
Adenosine triphosphate + D-Glycero-D-manno-heptose 1-phosphate + Hydrogen ion > ADP-D-Glycero-D-manno-heptose + Pyrophosphate
Adenosine triphosphate + D-Glycero-D-manno-heptose 7-phosphate > ADP + D-Glycero-D-manno-heptose 1,7-bisphosphate + Hydrogen ion
Glycerol 3-phosphate + Hexadecanoyl-phosphate (n-C16:0) > 1-hexadecanoyl-sn-glycerol 3-phosphate + Hydrogen ion + Phosphate
Glycerol 3-phosphate + Hexadecanoyl-phosphate (n-C16:1) > 1-Hexadec-9-enoyl-sn-glycerol 3-phosphate + Hydrogen ion + Phosphate
Glycerol 3-phosphate + Octadecanoyl-phosphate (n-C18:0) > 1-Octadecanoyl-sn-glycerol 3-phosphate + Hydrogen ion + Phosphate
Glycerol 3-phosphate + Octadecanoyl-phosphate (n-C18:1) > 1-Octadec-11-enoyl-sn-glycerol 3-phosphate + Hydrogen ion + Phosphate
Glycerol 3-phosphate + Tetradecanoyl-phosphate (n-C14:0) > 1-Tetradecanoyl-sn-glycerol 3-phosphate + Hydrogen ion + Phosphate
Glycerol 3-phosphate + Tetradecanoyl-phosphate (n-C14:1) > 1-Tetradec-7-enoyl-sn-glycerol 3-phosphate + Hydrogen ion + Phosphate
Dodecanoly-phosphate (n-C12:0) + Glycerol 3-phosphate > 1-Dodecanoyl-sn-glycerol 3-phosphate + Hydrogen ion + Phosphate
Adenosine triphosphate + Glyceric acid > 2-Phospho-D-glyceric acid + ADP + Hydrogen ion
L-Aspartic acid + Adenosine triphosphate + Citrulline <> Adenosine monophosphate + Argininosuccinic acid + Hydrogen ion + Pyrophosphate
N-Acetylmannosamine + Adenosine triphosphate > N-Acetyl-D-mannosamine 6-phosphate + ADP + Hydrogen ion
L-Malic acid + NAD <> Hydrogen ion + NADH + Oxalacetic acid
N10-Formyl-THF + L-Methionyl-tRNA (Met) > N-Formylmethionyl-tRNA + Hydrogen ion + Tetrahydrofolic acid
Iron + Sirohydrochlorin >3 Hydrogen ion + Siroheme
Precorrin 2 + NAD > Hydrogen ion + NADH + Sirohydrochlorin
Adenosine triphosphate + Fructoselysine > ADP + Fructoselysine-6-phosphate + Hydrogen ion
Adenosine triphosphate + Water + Iron > ADP + Iron + Hydrogen ion + Phosphate
Hydrogen cyanide + Thiosulfate > Hydrogen ion + Sulfite + Thiocyanate
ADP-Glucose > ADP + Glycogen + Hydrogen ion
Adenosine triphosphate + Glucose 1-phosphate + Hydrogen ion <> ADP-Glucose + Pyrophosphate
L-Aspartate-semialdehyde + NADP + Phosphate <> L-Aspartyl-4-phosphate + Hydrogen ion + NADPH
Glycerophosphocholine + Water > Choline + Glycerol 3-phosphate + Hydrogen ion
Glycerylphosphorylethanolamine + Water > Ethanolamine + Glycerol 3-phosphate + Hydrogen ion
Glycerophosphoglycerol + Water > Glycerol + Glycerol 3-phosphate + Hydrogen ion
Glycerophosphoserine + Water > Glycerol 3-phosphate + Hydrogen ion + L-Serine
Sn-Glycero-3-phospho-1-inositol + Water > Glycerol 3-phosphate + Hydrogen ion + Inositol
Adenosine triphosphate + Water + Zinc > ADP + Hydrogen ion + Phosphate + Zinc
Adenosine triphosphate + Water + Mercury > ADP + Hydrogen ion + Phosphate + Mercury
Adenosine triphosphate + Water + Nickel > ADP + Hydrogen ion + Phosphate + Nickel
Adenosine triphosphate + Cobalt + Water > ADP + Hydrogen ion + Phosphate + Cobalt
Adenosine triphosphate + Copper + Water > ADP + Hydrogen ion + Phosphate + Copper
Adenosine triphosphate + Cadmium + Water > ADP + Hydrogen ion + Phosphate + Cadmium
Glutathione disulfide + Hydrogen ion + NADPH <>2 Glutathione + NADP
Arsenite + Adenosine triphosphate + Water > ADP + Hydrogen ion + Phosphate + Arsenite
2-Keto-3-deoxy-D-gluconic acid + Adenosine triphosphate <> 2-Keto-3-deoxy-6-phosphogluconic acid + ADP + Hydrogen ion
D-Biotin D-sulfoxide + Hydrogen ion + NADH > Biotin + Water + NAD
D-Biotin D-sulfoxide + Hydrogen ion + NADPH > Biotin + Water + NADP
2 -Dehydro-L-gulonate + Hydrogen ion + NADH > Gluconic acid + NAD
2 -Dehydro-L-gulonate + Hydrogen ion + NADH > D-Galactonate + NAD
2 -Dehydro-L-gulonate + Hydrogen ion + NADPH > Gluconic acid + NADP
2 -Dehydro-L-gulonate + Hydrogen ion + NADPH > D-Galactonate + NADP
2,5-Diketo-D-gluconate + Hydrogen ion + NADH > 5-Keto-D-gluconate + NAD
2,5-Diketo-D-gluconate + Hydrogen ion + NADPH > 5-Keto-D-gluconate + NADP
Adenosine triphosphate + 1-Deoxy-D-xylulose > ADP + 1-Deoxy-D-xylulose 5-phosphate + Hydrogen ion
2,3-Diketo-L-gulonate + Hydrogen ion + NADH > 3-Dehydro-L-gulonate + NAD
3-Dehydro-L-gulonate + Adenosine triphosphate > 3-Dehydro-L-gulonate 6-phosphate + ADP + Hydrogen ion
Water + NADP + Propanal >2 Hydrogen ion + NADPH + Propionic acid
Acetaldehyde + Water + NADP > Acetic acid +2 Hydrogen ion + NADPH
Phosphoroselenoic acid > Hydrogen ion + Phosphate + L-Selenocysteinyl-tRNA(Sec)
Sorbitol-6-phosphate + NAD <> Fructose 6-phosphate + Hydrogen ion + NADH
Glycerol 3-phosphate + NADP <> Dihydroxyacetone phosphate + Hydrogen ion + NADPH
NAD + L-Threonine <> L-2-Amino-3-oxobutanoic acid + Hydrogen ion + NADH
ADP-L-Glycero-D-manno-heptose + heptosyl-kdo2-lipidA > ADP + Hydrogen ion + heptosyl-heptosyl-kdo2-lipidA
ADP-L-Glycero-D-manno-heptose + KDO2-Lipid A > ADP + Hydrogen ion + heptosyl-kdo2-lipidA
core oligosaccharide lipid A + (enterobacterial common antigen)x4 undecaprenyl-diphosphate > (enterobacterial common antigen)x4 core oligosaccharide lipid A + Hydrogen ion + Undecaprenyl diphosphate
core oligosaccharide lipid A + (O16 antigen)x4 undecaprenyl diphosphate > Hydrogen ion + (O16 antigen)x4 core oligosaccharide lipid A + Undecaprenyl diphosphate
ADP-L-Glycero-D-manno-heptose + glucosyl-glucosyl-galactosyl-glucosyl-inner core oligosaccharide lipid A > ADP + core oligosaccharide lipid A + Hydrogen ion
CMP-3-Deoxy-D-manno-octulosonate + Phospho-heptosyl-phospho-heptosyl-heptosyl-kdo2-lipidA > Cytidine monophosphate + Hydrogen ion + Kdo-phospho-heptosyl-phospho-heptosyl-heptosyl-kdo2-lipidA
Adenosine triphosphate + Heptosyl-phospho-heptosyl-heptosyl-kdo2-lipidA > ADP + Hydrogen ion + Phospho-heptosyl-phospho-heptosyl-heptosyl-kdo2-lipidA
glucosyl-galactosyl-glucosyl-inner core oligosaccharide lipid A + UDP-Glucose > glucosyl-glucosyl-galactosyl-glucosyl-inner core oligosaccharide lipid A + Hydrogen ion + Uridine 5'-diphosphate
galactosyl-glucosyl-inner core oligosaccharide lipid A + UDP-Glucose > glucosyl-galactosyl-glucosyl-inner core oligosaccharide lipid A + Hydrogen ion + Uridine 5'-diphosphate
glucosyl-inner core oligosaccharide lipid A + UDP-Glucose > galactosyl-glucosyl-inner core oligosaccharide lipid A + Hydrogen ion + Uridine 5'-diphosphate
Deoxythymidine diphosphate-L-rhamnose + Kdo-phospho-heptosyl-phospho-heptosyl-heptosyl-kdo2-lipidA > dTDP + Hydrogen ion + inner core oligosaccharide lipid A (E coli)
Adenosine triphosphate + heptosyl-heptosyl-kdo2-lipidA > ADP + Hydrogen ion + Phospho-heptosyl-heptosyl-kdo2-lipidA
inner core oligosaccharide lipid A (E coli) + UDP-Glucose > glucosyl-inner core oligosaccharide lipid A + Hydrogen ion + Uridine 5'-diphosphate
ADP-L-Glycero-D-manno-heptose + Phospho-heptosyl-heptosyl-kdo2-lipidA > ADP + Hydrogen ion + Heptosyl-phospho-heptosyl-heptosyl-kdo2-lipidA
CMP-3-Deoxy-D-manno-octulosonate + 2,3,2'3'-Tetrakis(beta-hydroxymyristoyl)-D-glucosaminyl-1,6-beta-D-glucosamine 1,4'-bisphosphate > Cytidine monophosphate + Hydrogen ion + KDO-lipid IV(A)
CMP-3-Deoxy-D-manno-octulosonate + KDO-lipid IV(A) > Cytidine monophosphate + Hydrogen ion + KDO(2)-lipid IV(A)
Adenosine triphosphate + Hydrogen ion + Pantetheine 4'-phosphate <> Dephospho-CoA + Pyrophosphate
D-4'-Phosphopantothenate + Cytidine triphosphate + L-Cysteine > 4-Phosphopantothenoylcysteine + Cytidine monophosphate + Hydrogen ion + Pyrophosphate
4-Phosphopantothenoylcysteine + Hydrogen ion <> Carbon dioxide + Pantetheine 4'-phosphate + pantotheine 4'-phosphate
Adenine + Hydrogen ion + Water > Hypoxanthine + Ammonium
2-Dehydro-3-deoxy-D-galactonate + Adenosine triphosphate <> 2-Dehydro-3-deoxy-D-galactonate-6-phosphate + ADP + Hydrogen ion
Acetyl-CoA + N-Acetyl-glucosamine 1-phosphate > N-Acetyl-glucosamine 1-phosphate + Coenzyme A + Hydrogen ion
N-Acetyl-glucosamine 1-phosphate + Hydrogen ion + Uridine triphosphate > Pyrophosphate + Uridine diphosphate-N-acetylglucosamine
L-Aspartic acid + Adenosine triphosphate + Ammonium > Adenosine monophosphate + L-Asparagine + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Ribose <> ADP + Hydrogen ion + D-Ribose-5-phosphate
2-Aceto-2-hydroxy-butyrate + Hydrogen ion + NADPH <> (R) 2,3-Dihydroxy-3-methylvalerate + NADP
(R)-2,3-Dihydroxy-isovalerate + NADP <> (S)-2-Acetolactate + Hydrogen ion + NADPH
Guanosine 3'-diphosphate 5'-triphosphate + Water <> Hydrogen ion + Phosphate + Guanosine 3',5'-bis(diphosphate)
Water + 2 NAD + UDP-N-Acetyl-D-mannosamine <>3 Hydrogen ion +2 NADH + UDP-N-Acetyl-D-mannosaminouronate
Acetyl-CoA + dTDP-D-Fucosamine > Coenzyme A + dTDP-4-Acetamido-4,6-dideoxy-D-galactose + Hydrogen ion
UDP-N-Acetyl-D-mannosaminouronate + Undecaprenyl-N-acetyl-alpha-D-glucosaminyl-pyrophosphate > Hydrogen ion + Uridine 5'-diphosphate + Undecaprenyl-diphospho-N-acetylglucosamine-N-acetylmannosaminuronate
Water + PA(16:0/16:0) > 1-Dodecanoyl-sn-glycerol 3-phosphate + Dodecanoate (N-C12:0) + Hydrogen ion
Water + PA(16:0/16:0) > 1-Hexadec-9-enoyl-sn-glycerol 3-phosphate + Hydrogen ion + Hexadecenoate (n-C16:1)
Water + PA(16:0/16:0) > 1-hexadecanoyl-sn-glycerol 3-phosphate + Hydrogen ion + Palmitic acid
Water + PA(16:0/16:0) > 1-Octadec-11-enoyl-sn-glycerol 3-phosphate + Hydrogen ion + Octadecenoate (N-C18:1)
Water + PA(16:0/16:0) > 1-Octadecanoyl-sn-glycerol 3-phosphate + Hydrogen ion + Octadecanoate (N-C18:0)
Water + PA(16:0/16:0) > 1-Tetradec-7-enoyl-sn-glycerol 3-phosphate + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + PA(16:0/16:0) > 1-Tetradecanoyl-sn-glycerol 3-phosphate + Hydrogen ion + tetradecanoate (n-C14:0)
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C12:0) + Dodecanoate (N-C12:0) + Hydrogen ion
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:0) + Hydrogen ion + tetradecanoate (n-C14:0)
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:1) + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:0) + Hydrogen ion + Palmitic acid
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:1) + Hydrogen ion + Hexadecenoate (n-C16:1)
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:0) + Hydrogen ion + Octadecanoate (N-C18:0)
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:1) + Hydrogen ion + Octadecenoate (N-C18:1)
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C12:0) + Dodecanoate (N-C12:0) + Hydrogen ion
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:0) + Hydrogen ion + tetradecanoate (n-C14:0)
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:1) + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:0) + Hydrogen ion + Palmitic acid
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:1) + Hydrogen ion + Hexadecenoate (n-C16:1)
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:0) + Hydrogen ion + Octadecanoate (N-C18:0)
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:1) + Hydrogen ion + Octadecenoate (N-C18:1)
Water + PG(16:0/16:0) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C16:0) + Hydrogen ion + Palmitic acid
Water + PG(16:0/16:0) > 2-Acyl-sn-glycero-3-phosphoglycerol (N-C16:0) + Hydrogen ion + Palmitic acid
Water + PG(16:1(9Z)/16:1(9Z)) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C16:1) + Hydrogen ion + Hexadecenoate (n-C16:1)
Water + PG(16:1(9Z)/16:1(9Z)) > 2-Acyl-sn-glycero-3-phosphoglycerol (N-C16:1) + Hydrogen ion + Hexadecenoate (n-C16:1)
Water + PG(18:1(11Z)/18:1(11Z)) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C18:1) + Hydrogen ion + Octadecenoate (N-C18:1)
Water + PG(18:1(11Z)/18:1(11Z)) > 2-Acyl-sn-glycero-3-phosphoglycerol (N-C18:1) + Hydrogen ion + Octadecenoate (N-C18:1)
Water + PG(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C14:0) + Hydrogen ion + tetradecanoate (n-C14:0)
Water + PG(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoglycerol (N-C14:0) + Hydrogen ion + tetradecanoate (n-C14:0)
Water + PG(12:0/12:0) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C12:0) + Dodecanoate (N-C12:0) + Hydrogen ion
Water + PG(12:0/12:0) > 2-Acyl-sn-glycero-3-phosphoglycerol (n-C12:0) + Dodecanoate (N-C12:0) + Hydrogen ion
Water + PG(14:1(7Z)/14:1(7Z)) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C14:1) + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + PG(14:1(7Z)/14:1(7Z)) > 2-Acyl-sn-glycero-3-phosphoglycerol (N-C14:1) + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + PG(18:0/18:0) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C18:0) + Hydrogen ion + Octadecanoate (N-C18:0)
Water + PG(18:0/18:0) > 2-Acyl-sn-glycero-3-phosphoglycerol (N-C18:0) + Hydrogen ion + Octadecanoate (N-C18:0)
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C12:0) + Water > Dodecanoate (N-C12:0) + Glycerylphosphorylethanolamine + Hydrogen ion
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:0) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + tetradecanoate (n-C14:0)
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:1) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Tetradecenoate (N-C14:1)
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:0) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Palmitic acid
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:1) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Hexadecenoate (n-C16:1)
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:0) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Octadecanoate (N-C18:0)
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:1) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Octadecenoate (N-C18:1)
2-Acyl-sn-glycero-3-phosphoglycerol (n-C12:0) + Water > Dodecanoate (N-C12:0) + Glycerophosphoglycerol + Hydrogen ion
2-Acyl-sn-glycero-3-phosphoglycerol (N-C14:0) + Water > Glycerophosphoglycerol + Hydrogen ion + tetradecanoate (n-C14:0)
2-Acyl-sn-glycero-3-phosphoglycerol (N-C14:1) + Water > Glycerophosphoglycerol + Hydrogen ion + Tetradecenoate (N-C14:1)
2-Acyl-sn-glycero-3-phosphoglycerol (N-C16:0) + Water > Glycerophosphoglycerol + Hydrogen ion + Palmitic acid
2-Acyl-sn-glycero-3-phosphoglycerol (N-C16:1) + Water > Glycerophosphoglycerol + Hydrogen ion + Hexadecenoate (n-C16:1)
2-Acyl-sn-glycero-3-phosphoglycerol (N-C18:0) + Water > Glycerophosphoglycerol + Hydrogen ion + Octadecanoate (N-C18:0)
2-Acyl-sn-glycero-3-phosphoglycerol (N-C18:1) + Water > Glycerophosphoglycerol + Hydrogen ion + Octadecenoate (N-C18:1)
2-dodecanoyl-sn-glycerol 3-phosphate + Water > Dodecanoate (N-C12:0) + Glycerol 3-phosphate +2 Hydrogen ion
2-hexadec-9-enoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate +2 Hydrogen ion + Hexadecenoate (n-C16:1)
2-hexadecanoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate +2 Hydrogen ion + Palmitic acid
2-octadec-11-enoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate +2 Hydrogen ion + Octadecenoate (N-C18:1)
2-octadecanoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate +2 Hydrogen ion + Octadecanoate (N-C18:0)
2-tetradec-7-enoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate +2 Hydrogen ion + Tetradecenoate (N-C14:1)
2-tetradecanoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate +2 Hydrogen ion + tetradecanoate (n-C14:0)
2-Demethylmenaquinol 8 + S-Adenosylmethionine > S-Adenosylhomocysteine + Hydrogen ion + Menaquinol 8
2-Octaprenyl-6-methoxy-1,4-benzoquinol + S-Adenosylmethionine > 2-Octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol + S-Adenosylhomocysteine + Hydrogen ion
FADH2 + 2 Fe3+ > FAD +2 Iron +2 Hydrogen ion
FAD + Hydrogen ion + NADH > FADH2 + NAD
Hydrogen ion + NADH + Riboflavin > NAD + Reduced riboflavin
Hydrogen ion + NADH + Succinic acid semialdehyde <> gamma-Hydroxybutyrate + NAD
Adenosine triphosphate + L-Rhamnulose <> ADP + Hydrogen ion + L-Rhamnulose 1-phosphate
Adenosine triphosphate + D-Sedoheptulose 7-phosphate > ADP + Hydrogen ion + Sedoheptulose 1,7-bisphosphate
Adenosine triphosphate + D-Tagatose 6-phosphate > ADP + Hydrogen ion + D-Tagatose 1,6-bisphosphate
CDP-1,2-didodecanoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
CDP-1,2-dihexadec-9-enoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
CDP-1,2-dihexadecanoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
CDP-1,2-dioctadec-11-enoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
CDP-1,2-Dioctadecanoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
CDP-1,2-ditetradec-7-enoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
CDP-1,2-ditetradecanoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
Adenosine triphosphate + Glycerol <> ADP + Glycerol 3-phosphate + Hydrogen ion
1,4-Dihydroxy-2-naphthoic acid + Hydrogen ion + Octaprenyl diphosphate > 2-Demethylmenaquinol 8 + Carbon dioxide + Pyrophosphate
L-Cysteine + O-Succinyl-L-homoserine <> L-Cystathionine + Hydrogen ion + Succinic acid
2 Hydrogen ion + 5,10-Methylene-THF + NADH > 5-Methyltetrahydrofolic acid + NAD
Acetol + Hydrogen ion + NADH > (R)-Propane-1,2-diol + NAD
Glycerol + NAD <> Dihydroxyacetone + Hydrogen ion + NADH
Aminoacetone + Hydrogen ion + NADH <> 1-Amino-2-propanol + NAD
Hydrogen ion + Pyruvaldehyde + NADH > D-Lactaldehyde + NAD
Carbon dioxide + Water + Phosphoenolpyruvic acid <> Hydrogen ion + Oxalacetic acid + Phosphate + Hydrogen carbonate
N-Acetyl-L-glutamate 5-semialdehyde + NADP + Phosphate <> N-Acetyl-L-glutamyl 5-phosphate + Hydrogen ion + NADPH
Hydrogen ion + NADPH + UDP-N-Acetyl-3-(1-carboxyvinyl)-D-glucosamine <> NADP + UDP-N-Acetylmuraminate
Adenosine triphosphate + Pantothenic acid <> D-4'-Phosphopantothenate + ADP + Hydrogen ion
S-Adenosylmethionine + NADPH + L-Tyrosine > p-Cresol + 5'-Deoxyadenosine + Dehydroglycine + Hydrogen ion + L-Methionine + NADP
2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate + 4-Methyl-5-(2-phosphoethyl)-thiazole + Hydrogen ion <> Pyrophosphate + Thiamine monophosphate
5-Aminoimidazole ribonucleotide + Water + NAD > 4-Amino-2-methyl-5-phosphomethylpyrimidine +2 Formic acid +3 Hydrogen ion + NADH
4 Hydrogen ion + Uroporphyrinogen III <>4 Carbon dioxide + Coproporphyrin III
Adenosine triphosphate + Glycine + 5-Phosphoribosylamine <> ADP + Glycineamideribotide + Hydrogen ion + Phosphate
1,2-Diacyl-sn-glycerol (didodecanoyl, n-C12:0) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
1,2-Diacyl-sn-glycerol (dihexadec-9-enoyl, n-C16:1) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
1,2-Diacyl-sn-glycerol (dihexadecanoyl, n-C16:0) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
1,2-Diacyl-sn-glycerol (dioctadec-11-enoyl, n-C18:1) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
1,2-Diacyl-sn-glycerol (dioctadecanoyl, n-C18:0) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
1,2-Diacyl-sn-glycerol (ditetradec-7-enoyl, n-C14:1) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
1,2-Diacyl-sn-glycerol (ditetradecanoyl, n-C14:0) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
D-Allose + Adenosine triphosphate > ADP + D-Allose 6-phosphate + Hydrogen ion
L-Arginine + Hydrogen ion > Agmatine + Carbon dioxide
2 Adenosine triphosphate + Hydrogen ion > Diadenosine tetraphosphate + Pyrophosphate
Hydrogen ion + PS(16:0/16:0) <> Carbon dioxide + PE(14:0/14:0)
Hydrogen ion + PS(16:0/16:0) > Carbon dioxide + PE(14:0/14:0)
Hydrogen ion + PS(16:0/16:0) > Carbon dioxide + PE(14:0/14:0)
Hydrogen ion + PS(16:0/16:0) > Carbon dioxide + PE(14:0/14:0)
Hydrogen ion + PS(16:0/16:0) > Carbon dioxide + PE(14:0/14:0)
Hydrogen ion + PS(16:0/16:0) > Carbon dioxide + PE(14:0/14:0)
Hydrogen ion + PS(16:0/16:0) > Carbon dioxide + PE(14:0/14:0)
Cytidine triphosphate + Water > CDP + Hydrogen ion + Phosphate
Guanosine triphosphate + Water > Guanosine diphosphate + Hydrogen ion + Phosphate
L-Aspartic acid + Guanosine triphosphate + Inosinic acid <> Adenylsuccinic acid + Guanosine diphosphate +2 Hydrogen ion + Phosphate
L-Ascorbate 6-phosphate + Water > 3-Dehydro-L-gulonate 6-phosphate + Hydrogen ion
Adenosine 2',3'-cyclic phosphate + Water > 3'-AMP + Hydrogen ion
Guanosine 2',3'-cyclic phosphate + Water > Guanosine 3'-phosphate + Hydrogen ion
2',3'-Cyclic UMP + Water > 3'-UMP + Hydrogen ion
2',3'-Cyclic CMP + Water > 3'-CMP + Hydrogen ion
L-Alanine-D-glutamate-meso-2,6-diaminoheptanedioate-D-alanine + Adenosine triphosphate + UDP-N-Acetylmuraminate > ADP + Hydrogen ion + Phosphate + UDP-N-acetylmuramoyl-L-alanyl-D-gamma-glutamyl-meso-2,6-diaminopimelate-D-alanine
L-alanine-D-glutamate-meso-2,6-diaminoheptanedioate + Adenosine triphosphate + UDP-N-Acetylmuraminate > ADP + Hydrogen ion + Phosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate
Adenosine triphosphate + Water + Magnesium > ADP + Hydrogen ion + Magnesium + Phosphate
5-Keto-D-gluconate + Hydrogen ion + NADPH <> Gluconic acid + NADP
5-Keto-D-gluconate + Hydrogen ion + NADH <> D-Galactonate + NAD
5-Keto-D-gluconate + Hydrogen ion + NADPH > D-Galactonate + NADP
D-Mannonate + NAD <> D-Fructuronate + Hydrogen ion + NADH
D-Galactonate + NAD > Hydrogen ion + NADH + 5-Keto-D-gluconate
FADH2 + 2 Ferroxamine > FAD +2 Iron +2 ferroxamine minus Fe(3) +2 Hydrogen ion
2 Ferroxamine + FMNH >2 Iron +2 ferroxamine minus Fe(3) + Flavin Mononucleotide +2 Hydrogen ion
2 Ferroxamine + Reduced riboflavin >2 Iron +2 ferroxamine minus Fe(3) +2 Hydrogen ion + Riboflavin
Adenosine triphosphate + Hydrogen ion + Caprylic acid > Adenosine monophosphate + octanoate (protein bound) + Pyrophosphate
Water + Xanthosine 5-triphosphate > Hydrogen ion + Phosphate + XDP
2'-Deoxyinosine triphosphate + Water > DIDP + Hydrogen ion + Phosphate
dTDP-4-Acetamido-4,6-dideoxy-D-galactose + Undecaprenyl-diphospho-N-acetylglucosamine-N-acetylmannosaminuronate > dTDP + Hydrogen ion + Undecaprenyl-diphospho N-acetylglucosamine-N-acetylmannosaminuronate-N-acetamido-4,6-dideoxy-D-galactose
Adenosine triphosphate + Hydrogen ion + Water > Inosine triphosphate + Ammonium
Guanosine triphosphate + Hydrogen ion + Water > Ammonium + Xanthosine 5-triphosphate
L-Glutamic-gamma-semialdehyde > L-D-1-Pyrroline-5-carboxylic acid + Hydrogen ion + Water
dATP + Hydrogen ion + Water > 2'-Deoxyinosine triphosphate + Ammonium
Carbamic acid + 2 Hydrogen ion > Carbon dioxide + Ammonium
L-2-Amino-3-oxobutanoic acid + Hydrogen ion > Aminoacetone + Carbon dioxide
2-Isopropyl-3-oxosuccinate + Hydrogen ion > Ketoleucine + Carbon dioxide
2 [4Fe-4S] iron-sulfur cluster + 2 Hydrogen ion + Hydrogen peroxide >2 [3Fe-4S] damaged iron-sulfur cluster +2 Fe3+ +2 Water
2 [4Fe-4S] iron-sulfur cluster + 2 Hydrogen ion + 2 Nitric oxide >2 [3Fe-4S] damaged iron-sulfur cluster +2 Fe3+ + Water + Nitrous oxide
Oxygen + 4 Fe2+ + 4 Hydrogen ion + 4 Fe2+ <>4 Fe3+ +2 Water
2 L-Glutamate + NAD <> L-Glutamine + alpha-Ketoglutarate + NADH + Hydrogen ion
2 Glutathione + NAD <> Glutathione disulfide + NADH + Hydrogen ion
NAD + 2 Cob(II)alamin + 2 Water + Hydrogen ion <> NADH +2 Aquacobalamin
2 L-Glutamate + NADP <> L-Glutamine + alpha-Ketoglutarate + NADPH + Hydrogen ion
2 Glutathione + NADP <> Glutathione disulfide + NADPH + Hydrogen ion
S-Adenosylmethionine + Hydrogen ion <> S-Adenosylmethioninamine + Carbon dioxide
L-Lactic acid + 2 Ferricytochrome c + Ferricytochrome c <> Pyruvic acid +2 Ferrocytochrome c +2 Hydrogen ion + Ferrocytochrome c
Pyruvaldehyde + NAD + Water <> Pyruvic acid + NADH + Hydrogen ion
L-Malic acid + NAD <> Pyruvic acid + Carbon dioxide + NADH + Hydrogen ion
(R)-Malate + NAD <> Pyruvic acid + Carbon dioxide + NADH + Hydrogen ion
L-Malic acid + NADP <> Pyruvic acid + Carbon dioxide + NADPH + Hydrogen ion
Acetaldehyde + Coenzyme A + NAD <> Acetyl-CoA + NADH + Hydrogen ion
L-Glutamate + NAD + Water <> alpha-Ketoglutarate + Ammonia + NADH + Hydrogen ion
L-Glutamic-gamma-semialdehyde + NAD + Water <> L-Glutamate + NADH + Hydrogen ion
L-Glutamate + NADP + Water <> alpha-Ketoglutarate + Ammonia + NADPH + Hydrogen ion
Isocitric acid + NADP <> alpha-Ketoglutarate + Carbon dioxide + NADPH + Hydrogen ion
UDP-Glucose + Water + 2 NAD <> Uridine diphosphate glucuronic acid +2 NADH +2 Hydrogen ion
Protoporphyrin IX + Fe2+ <> Heme +2 Hydrogen ion + Fe2+
L-Malic acid + NAD <> Oxalacetic acid + NADH + Hydrogen ion
Glycolic acid + NADP <> Glyoxylic acid + NADPH + Hydrogen ion
Formic acid + NAD <> Hydrogen ion + Carbon dioxide + NADH
Primary alcohol + NAD <> Aldehyde + NADH + Hydrogen ion
D-Lactic acid + NAD <> Pyruvic acid + NADH + Hydrogen ion
L-D-1-Pyrroline-5-carboxylic acid + NAD + 2 Water <> L-Glutamate + NADH + Hydrogen ion
L-D-1-Pyrroline-5-carboxylic acid + NADP + 2 Water <> L-Glutamate + NADPH + Hydrogen ion
Succinic acid semialdehyde + NAD + Water <> Succinic acid + NADH + Hydrogen ion
Succinic acid semialdehyde + NADP + Water <> Succinic acid + NADPH + Hydrogen ion
Ethanol + NAD <> Acetaldehyde + NADH + Hydrogen ion
Ammonium hydroxide + 3 NAD + Water + Ammonia <> Nitrite +3 NADH +3 Hydrogen ion
Ammonium hydroxide + 3 NADP + Water <> Nitrite +3 NADPH +3 Hydrogen ion
Glycerol 3-phosphate + NAD <> Dihydroxyacetone phosphate + NADH + Hydrogen ion
Glycerol 3-phosphate + NADP <> Dihydroxyacetone phosphate + NADPH + Hydrogen ion
Hydrogen sulfide + 3 NADP + 3 Water <> Sulfite +3 NADPH +3 Hydrogen ion
Tetrahydrofolic acid + NAD <> Dihydrofolic acid + NADH + Hydrogen ion
Tetrahydrofolic acid + 2 NAD <> Folic acid +2 NADH +2 Hydrogen ion
Tetrahydrofolic acid + NADP <> Dihydrofolic acid + NADPH + Hydrogen ion
Tetrahydrofolic acid + 2 NADP <> Folic acid +2 NADPH +2 Hydrogen ion
2-Ketobutyric acid + Carbon dioxide + NADH + Hydrogen ion <> D-Erythro-3-Methylmalate + NAD
Glycerol + NAD <> Dihydroxyacetone + NADH + Hydrogen ion
D-Glyceraldehyde 3-phosphate + Phosphate + NAD <> Glyceric acid 1,3-biphosphate + NADH + Hydrogen ion
Dethiobiotin + Sulfur donor + 2 S-Adenosylmethionine + 2 e- + 2 Hydrogen ion <> Biotin +2 L-Methionine +2 5'-Deoxyadenosine
2 Ferricytochrome c + Nitrite + Water <> Nitrate +2 Ferrocytochrome c +2 Hydrogen ion
Inosinic acid + NAD + Water <> Xanthylic acid + NADH + Hydrogen ion
Inosinic acid + Ammonia + NADP <> Guanosine monophosphate + NADPH + Hydrogen ion
L-Histidinal + Water + NAD <> L-Histidine + NADH + Hydrogen ion
Butanal + Coenzyme A + NAD <> Butanoyl-CoA + NADH + Hydrogen ion
2 Reduced ferredoxin + Acetyl-CoA + Carbon dioxide + 2 Hydrogen ion + Oxidized ferredoxin <>2 Oxidized ferredoxin + Pyruvic acid + Coenzyme A + Reduced ferredoxin
Glycine + Tetrahydrofolic acid + NAD <> 5,10-Methylene-THF + Ammonia + Carbon dioxide + NADH + Hydrogen ion
5-Methyltetrahydrofolic acid + NADP <> 5,10-Methylene-THF + NADPH + Hydrogen ion
L-Proline + NAD <> L-D-1-Pyrroline-5-carboxylic acid + NADH + Hydrogen ion
L-Proline + NADP <> L-D-1-Pyrroline-5-carboxylic acid + NADPH + Hydrogen ion
Glycolaldehyde + NAD + Water <> Glycolic acid + NADH + Hydrogen ion
Glyceric acid + NAD <> Hydroxypyruvic acid + NADH + Hydrogen ion
Glyceric acid + NADP <> Hydroxypyruvic acid + NADPH + Hydrogen ion
Lactaldehyde + NAD + Water <> L-Lactic acid + NADH + Hydrogen ion
L-Threonine + NAD <> L-2-Amino-3-oxobutanoic acid + NADH + Hydrogen ion
(2S,3S)-2,3-Dihydro-2,3-dihydroxybenzoate + NAD <> 2-Pyrocatechuic acid + NADH + Hydrogen ion
3-Phospho-D-glycerate + NAD <> Phosphohydroxypyruvic acid + NADH + Hydrogen ion
6-Phosphogluconic acid + NADP <> D-Ribulose 5-phosphate + Carbon dioxide + NADPH + Hydrogen ion
2-Keto-3-deoxy-D-gluconic acid + NAD <> (4S)-4,6-Dihydroxy-2,5-dioxohexanoate + NADH + Hydrogen ion
5,10-Methenyltetrahydrofolate + Water <> N10-Formyl-THF + Hydrogen ion
Dihydrolipoamide + NAD <> Lipoamide + NADH + Hydrogen ion
Prephenate + NAD <> 4-Hydroxyphenylpyruvic acid + Carbon dioxide + NADH + Hydrogen ion
Gluconic acid + NADP <> 2-Keto-D-gluconic acid + NADPH + Hydrogen ion + 2-Dehydro-D-gluconate
Glyceric acid + NAD <> Tartronate semialdehyde + NADH + Hydrogen ion
Glyceric acid + NADP <> Tartronate semialdehyde + NADPH + Hydrogen ion
Hypoxanthine + NAD + Water <> Xanthine + NADH + Hydrogen ion
L-Homoserine + NAD <> L-Aspartate-semialdehyde + NADH + Hydrogen ion
L-Homoserine + NADP <> L-Aspartate-semialdehyde + NADPH + Hydrogen ion
Ethylene glycol + NAD <> Glycolaldehyde + NADH + Hydrogen ion
D-Erythrose 4-phosphate + NAD + Water <> 4-Phospho-D-erythronate + NADH + Hydrogen ion
Quinate + NAD <> 3-Dehydroquinate + NADH + Hydrogen ion
Isocitric acid + NADP <> Oxalosuccinic acid + NADPH + Hydrogen ion
Oxoadipic acid + Coenzyme A + NAD <> Glutaryl-CoA + Carbon dioxide + NADH + Hydrogen ion
(S)-3-Hydroxybutanoyl-CoA + NAD <> Acetoacetyl-CoA + NADH + Hydrogen ion
(S)-3-Hydroxybutanoyl-CoA + NADP + 3-Hydroxybutyryl-CoA <> Acetoacetyl-CoA + NADPH + Hydrogen ion
2 Reduced rubredoxin + NAD <>2 Oxidized rubredoxin + NADH + Hydrogen ion
Thioredoxin + NADP + Thioredoxin <> Thioredoxin disulfide + NADPH + Hydrogen ion + Thioredoxin disulfide
Xanthine + NAD + Water <> Uric acid + NADH + Hydrogen ion
Retinol + NAD <> Retinal + NADH + Hydrogen ion
Dihydrofolic acid + NAD <> Folic acid + NADH + Hydrogen ion
Dihydrofolic acid + NADP <> Folic acid + NADPH + Hydrogen ion
Propylene glycol + NAD <> Lactaldehyde + NADH + Hydrogen ion
L-Aspartate-semialdehyde + Phosphate + NADP <> L-Aspartyl-4-phosphate + NADPH + Hydrogen ion
Nicotinate D-ribonucleoside + Phosphate <> Nicotinic acid + alpha-D-Ribose 1-phosphate + Hydrogen ion
Shikimic acid + NADP <> 3-Dehydro-shikimate + NADPH + Hydrogen ion
D-Mannonate + NAD <> D-Fructuronate + NADH + Hydrogen ion
(R)-Pantoate + NADP <> 2-Dehydropantoate + NADPH + Hydrogen ion
D-Lactaldehyde + NAD <> Pyruvaldehyde + NADH + Hydrogen ion
Phenylacetaldehyde + NAD + Water <> Benzeneacetic acid + NADH + Hydrogen ion
Meso-Tartaric acid + NAD <> 2-Hydroxy-3-oxosuccinate + NADH + Hydrogen ion
4-Aminobutyraldehyde + NAD + Water <> gamma-Aminobutyric acid + NADH + Hydrogen ion
D-Altronate + NAD <> 5-Keto-D-gluconate + NADH + Hydrogen ion
Betaine aldehyde + NAD + Water <> Betaine + NADH +2 Hydrogen ion
Betaine aldehyde + NADP + Water <> Betaine + NADPH +2 Hydrogen ion
3-Dehydro-L-gulonate + NAD <> 2,3-Diketo-L-gulonate + NADH + Hydrogen ion
3-Dehydro-L-gulonate + NADP <> 2,3-Diketo-L-gulonate + NADPH + Hydrogen ion
2 3-Hydroxyanthranilic acid + 4 Oxygen <> Cinnavalininate +2 Superoxide anion +2 Hydrogen peroxide +2 Hydrogen ion
Sorbitol-6-phosphate + NAD <> beta-D-Fructose 6-phosphate + NADH + Hydrogen ion
beta-D-Glucose 6-phosphate + NADP <> 6-Phosphonoglucono-D-lactone + NADPH + Hydrogen ion
Deoxythymidine diphosphate-L-rhamnose + NADP <> dTDP-4-Dehydro-6-deoxy-L-mannose + NADPH + Hydrogen ion
Siroheme + 2 Hydrogen ion <> Fe2+ + Sirohydrochlorin
(S)-Ureidoglycolic acid + NAD <> Oxalureate + NADH + Hydrogen ion
(S)-Ureidoglycolic acid + NADP <> Oxalureate + NADPH + Hydrogen ion
L-Histidinol + NAD <> L-Histidinal + NADH + Hydrogen ion
2-Acetolactate + NADPH + Hydrogen ion <> 2,3-Dihydroxyisovaleric acid + NADP
UDP-N-Acetylmuraminate + NAD <> UDP-N-Acetyl-3-(1-carboxyvinyl)-D-glucosamine + NADH + Hydrogen ion
UDP-N-Acetylmuraminate + NADP <> UDP-N-Acetyl-3-(1-carboxyvinyl)-D-glucosamine + NADPH + Hydrogen ion
Hydroxyproline + NAD <> Pyrroline hydroxycarboxylic acid + NADH + Hydrogen ion
Hydroxyproline + NADP <> Pyrroline hydroxycarboxylic acid + NADPH + Hydrogen ion
L-Glutamic-gamma-semialdehyde + Phosphate + NADP <> L-Glutamyl 5-phosphate + NADPH + Hydrogen ion + L-Glutamic acid 5-phosphate
UDP-N-Acetyl-D-mannosamine + 2 NAD + Water <> UDP-N-Acetyl-D-mannosaminouronate +2 NADH +2 Hydrogen ion
N-Acetyl-L-glutamate 5-semialdehyde + Phosphate + NADP <> N-Acetyl-L-glutamyl 5-phosphate + NADPH + Hydrogen ion
5-Amino-6-(5'-phosphoribitylamino)uracil + NADP <> 5-Amino-6-(5'-phosphoribosylamino)uracil + NADPH + Hydrogen ion
Cyanate + Hydrogen ion + Hydrogen carbonate <> Carbon dioxide + Carbamic acid
Hydrogen selenide + 3 NADP + 3 Water <> Selenite +3 NADPH +5 Hydrogen ion
Dihydrolipoylprotein + NAD <> Lipoylprotein + NADH + Hydrogen ion
Precorrin 2 + NAD <> Sirohydrochlorin + NADH + Hydrogen ion
N-Methylputrescine + Oxygen + Hydrogen ion <> 1-Methylpyrrolinium + Hydrogen peroxide + Ammonia
L-Glutamyl-tRNA(Glu) + NADPH + Hydrogen ion + tRNA(Glu) <> (S)-4-Amino-5-oxopentanoate + tRNA(Glu) + NADP + L-Glutamyl-tRNA(Glu)
Nicotinamide ribotide + Dimethylbenzimidazole <> Nicotinic acid + N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole + Hydrogen ion
Tetrahydrodipicolinate + NAD <> 2,3-Dihydrodipicolinic acid + NADH + Hydrogen ion
Tetrahydrodipicolinate + NADP <> 2,3-Dihydrodipicolinic acid + NADPH + Hydrogen ion
2-Methyl-3-hydroxybutyryl-CoA + NAD <> 2-Methylacetoacetyl-CoA + NADH + Hydrogen ion
4-Phospho-D-erythronate + NAD <> 2-Oxo-3-hydroxy-4-phosphobutanoic acid + NADH + Hydrogen ion
3-Isopropylmalate + NAD <> 2-Isopropyl-3-oxosuccinate + NADH + Hydrogen ion
Butyryl-[acp] + NAD <> But-2-enoyl-[acyl-carrier protein] + NADH + Hydrogen ion
(R)-2,3-Dihydroxy-isovalerate + NADP <> 3-Hydroxy-3-methyl-2-oxobutanoic acid + NADPH + Hydrogen ion
Pyrroline hydroxycarboxylic acid + NAD + 2 Water <> L-erythro-4-Hydroxyglutamate + NADH + Hydrogen ion
Pyrroline hydroxycarboxylic acid + NADP + 2 Water <> L-erythro-4-Hydroxyglutamate + NADPH + Hydrogen ion
(3R)-3-Hydroxybutanoyl-[acyl-carrier protein] + NADP <> Acetoacetyl-[acp] + NADPH + Hydrogen ion
(3R)-3-Hydroxyoctanoyl-[acyl-carrier protein] + NADP <> 3-Oxooctanoyl-[acp] + NADPH + Hydrogen ion
(3R)-3-Hydroxypalmitoyl-[acyl-carrier protein] + NADP <> 3-Oxohexadecanoyl-[acp] + NADPH + Hydrogen ion
(3R)-3-Hydroxytetradecanoyl-[acyl-carrier protein] + NADP <> 3-Oxotetradecanoyl-[acp] + NADPH + Hydrogen ion
Dodecanoyl-[acyl-carrier protein] + NAD <> trans-Dodec-2-enoyl-[acp] + NADH + Hydrogen ion
(S)-3-Hydroxyhexadecanoyl-CoA + NAD <> 3-Oxohexadecanoyl-CoA + NADH + Hydrogen ion
(S)-3-Hydroxydodecanoyl-CoA + NAD <> 3-Oxododecanoyl-CoA + NADH + Hydrogen ion
(S)-Hydroxyoctanoyl-CoA + NAD <> 3-Oxooctanoyl-CoA + NADH + Hydrogen ion
(S)-Hydroxyhexanoyl-CoA + NAD <> 3-Oxohexanoyl-CoA + NADH + Hydrogen ion
O-Acetylserine + Thiosulfate + Thioredoxin + Hydrogen ion <> L-Cysteine + Sulfite + Thioredoxin disulfide + Acetic acid
3,4-Dihydroxyphenylglycol + NAD <> 3,4-Dihydroxymandelaldehyde + NADH + Hydrogen ion
(R)-3-Hydroxyhexanoyl-[acp] + NADP <> 3-Oxohexanoyl-[acp] + NADPH + Hydrogen ion
Hexanoyl-[acp] + NAD <> trans-Hex-2-enoyl-[acp] + NADH + Hydrogen ion
Octanoyl-[acp] + NAD <> trans-Oct-2-enoyl-[acp] + NADH + Hydrogen ion
Decanoyl-[acp] + NAD <> trans-Dec-2-enoyl-[acp] + NADH + Hydrogen ion
(R)-3-Hydroxydodecanoyl-[acp] + NADP <> 3-Oxododecanoyl-[acp] + NADPH + Hydrogen ion
Tetradecanoyl-[acp] + NAD <> trans-Tetradec-2-enoyl-[acp] + NADH + Hydrogen ion
Hexadecanoyl-[acp] + NAD <> trans-Hexadec-2-enoyl-[acp] + NADH + Hydrogen ion
2-Octaprenylphenol + Oxygen + NADPH + Hydrogen ion <> 2-Octaprenyl-6-hydroxyphenol + NADP + Water
N2-Succinyl-L-glutamic acid 5-semialdehyde + NAD + Water <> N-Succinyl-L-glutamate + NADH + Hydrogen ion
L-erythro-4-Hydroxyglutamate + NADH + Hydrogen ion <> L-4-Hydroxyglutamate semialdehyde + NAD + Water
(S)-3-Hydroxyisobutyrate + NAD <> (S)-Methylmalonic acid semialdehyde + NADH + Hydrogen ion
(R) 2,3-Dihydroxy-3-methylvalerate + NADP <> (R)-3-Hydroxy-3-methyl-2-oxopentanoate + NADPH + Hydrogen ion
trans-3-Chloro-2-propene-1-ol + NAD <> trans-3-Chloroallyl aldehyde + NADH + Hydrogen ion
cis-3-Chloro-2-propene-1-ol + NAD <> cis-3-Chloroallyl aldehyde + NADH + Hydrogen ion
4-Chlorobiphenyl + Oxygen + NADH + Hydrogen ion <> cis-2,3-Dihydro-2,3-dihydroxy-4'-chlorobiphenyl + NAD
4-Chlorobiphenyl + Oxygen + NADPH + Hydrogen ion <> cis-2,3-Dihydro-2,3-dihydroxy-4'-chlorobiphenyl + NADP
Biphenyl + Oxygen + NADH + Hydrogen ion <> cis-2,3-Dihydro-2,3-dihydroxybiphenyl + NAD
Biphenyl + Oxygen + NADPH + Hydrogen ion <> cis-2,3-Dihydro-2,3-dihydroxybiphenyl + NADP
4-Nitrocatechol + Oxygen + 3 Hydrogen ion <> Benzene-1,2,4-triol + Nitrite + Water
4-Sulfolactone + Water <> HSO3- + 2-Maleylacetate + Hydrogen ion
Ethylbenzene + Oxygen + NADH + Hydrogen ion <> cis-1,2-Dihydro-3-ethylcatechol + NAD
Galactitol 1-phosphate + NAD <> D-Tagatose 6-phosphate + NADH + Hydrogen ion
3-Hydroxybutanoyl-CoA + NADP <> Acetoacetyl-CoA + NADPH + Hydrogen ion
Sorbitol-6-phosphate + NAD <> beta-D-Fructose 6-phosphate + NADH + Hydrogen ion
O-Phospho-4-hydroxy-L-threonine + NAD <> 2-Amino-3-oxo-4-phosphonooxybutyrate + NADH + Hydrogen ion
L-Idonate + NADP <> 5-Dehydro-D-gluconate + NADPH + Hydrogen ion
2-C-Methyl-D-erythritol-4-phosphate + NADP <> 1-Deoxy-D-xylulose 5-phosphate + NADPH + Hydrogen ion
GDP-L-Fucose + NADP <> GDP-4-Dehydro-6-deoxy-D-mannose + NADPH + Hydrogen ion
FMNH + NAD <> Flavin Mononucleotide + NADH + Hydrogen ion
FMNH + NADP <> Flavin Mononucleotide + NADPH + Hydrogen ion
Ammonia + 2 Water + 6 Ferricytochrome c + Ferricytochrome c <> Nitrite +6 Ferrocytochrome c +6 Hydrogen ion + Ferrocytochrome c
1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADPH + Hydrogen ion <> Isopentenyl pyrophosphate + NADP + Water
2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinone + Oxygen + NADPH + Hydrogen ion <> 2-octaprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinone + NADP + Water
Tartaric acid + NAD <> 2-Hydroxy-3-oxosuccinate + NADH + Hydrogen ion
alpha-Pinene + Oxygen + 2 Hydrogen ion + 2 e- <> Pinocarveol + Water
Hydrocinnamic acid + Oxygen + NADH + Hydrogen ion <> cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD
trans-Cinnamic acid + Oxygen + NADH + Hydrogen ion <> cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD
cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD <> 3-(2,3-Dihydroxyphenyl)propionic acid + NADH + Hydrogen ion
cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD <> Trans-2,3-Dihydroxycinnamate + NADH + Hydrogen ion
3-(3-Hydroxyphenyl)propanoic acid + Oxygen + NADH + Hydrogen ion <> 3-(2,3-Dihydroxyphenyl)propionic acid + Water + NAD
3-Hydroxycinnamic acid + Oxygen + NADH + Hydrogen ion <> Trans-2,3-Dihydroxycinnamate + Water + NAD
Quinate + NADP <> 3-Dehydroquinate + NADPH + Hydrogen ion
Shikimic acid + NAD <> 3-Dehydro-shikimate + NADH + Hydrogen ion
Bisphenol A + NADH + Hydrogen ion + Oxygen <> 1,2-Bis(4-hydroxyphenyl)-2-propanol + NAD + Water
2,2-Bis(4-hydroxyphenyl)-1-propanol + NADH + Hydrogen ion + Oxygen <> 2,3-Bis(4-hydroxyphenyl)-1,2-propanediol + NAD + Water
1-Hydroxymethylnaphthalene + NAD <> 1-Naphthaldehyde + NADH + Hydrogen ion
(2-Naphthyl)methanol + NAD <> 2-Naphthaldehyde + NADH + Hydrogen ion
(3S)-3-Hydroxyadipyl-CoA + NAD <> 3-Oxoadipyl-CoA + NADH + Hydrogen ion
S-(Hydroxymethyl)glutathione + NAD <> S-Formylglutathione + NADH + Hydrogen ion
Chloral hydrate + NADH + Hydrogen ion <> Trichloroethanol + NAD + Water
1,2-Dibromoethane + Glutathione + Hydrogen ion <> Glutathione episulfonium ion +2 Hydrobromic acid
3-Dehydro-L-gulonate 6-phosphate + Hydrogen ion <> L-Xylulose 5-phosphate + Carbon dioxide
5-Methyltetrahydrofolic acid + NAD <> 5,10-Methylene-THF + NADH + Hydrogen ion
Dimethylallylpyrophosphate + NADP + Water <> 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADPH + Hydrogen ion
gamma-Glutamyl-gamma-butyraldehyde + NAD + Water <> 4-(Glutamylamino) butanoate + NADH + Hydrogen ion
gamma-Glutamyl-gamma-butyraldehyde + NADP + Water <> 4-(Glutamylamino) butanoate + NADPH + Hydrogen ion
Enzyme N6-(dihydrolipoyl)lysine + NAD <> Enzyme N6-(lipoyl)lysine + NADH + Hydrogen ion
Uridine diphosphate glucuronic acid + NAD <> UDP-4-Keto-pyranose + Carbon dioxide + NADH + Hydrogen ion
Anthracene + Oxygen + 2 Hydrogen ion + 2 e- <> Anthracene-9,10-dihydrodiol
3-Oxooctadecanoyl-CoA + NADPH + Hydrogen ion <> 3-Hydroxyoctadecanoyl-CoA + NADP
3-Oxostearoyl-[acp] + NADPH + Hydrogen ion <> 3-Hydroxyoctadecanoyl-[acp] + NADP
(2E)-Octadecenoyl-[acp] + NADH + Hydrogen ion <> Octadecanoyl-[acyl-carrier protein] + NAD
Trinitrotoluene + 2 NADPH + 2 Hydrogen ion <> 4-Hydroxylamino-2,6-dinitrotoluene +2 NADP + Water
Trinitrotoluene + 2 NADH + 2 Hydrogen ion <> 4-Hydroxylamino-2,6-dinitrotoluene +2 NAD + Water
Trinitrotoluene + 2 NADH + 2 Hydrogen ion <> 2-Hydroxylamino-4,6-dinitrotoluene +2 NAD + Water
3-Hydroxy-5-methylhex-4-enoyl-CoA + NAD <> 5-Methyl-3-oxo-4-hexenoyl-CoA + NADH + Hydrogen ion
Isopentenyl pyrophosphate + NAD + Water <> 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH + Hydrogen ion
Dimethylallylpyrophosphate + NAD + Water <> 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH + Hydrogen ion
6-Thioinosine-5'-monophosphate + NAD + Water <> 6-Thioxanthine 5'-monophosphate + NADH + Hydrogen ion
Aldophosphamide + NADH + Hydrogen ion <> Alcophosphamide + NAD
2-Phenyl-1,3-propanediol monocarbamate + NAD <> 3-Carbamoyl-2-phenylpropionaldehyde + NADH + Hydrogen ion
4-Hydroxy-5-phenyltetrahydro-1,3-oxazin-2-one + NAD <> 5-Phenyl-1,3-oxazinane-2,4-dione + NADH + Hydrogen ion
2-Polyprenyl-3-methyl-6-methoxy-1,4-benzoquinone + Oxygen + NADPH + Hydrogen ion <> 2-Polyprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinone + NADP + Water
3-Hydroxypropanoate + NADP <> Malonic semialdehyde + NADPH + Hydrogen ion
2 NADPH + 2 Hydrogen ion + Methylselenic acid <>2 NADP +2 Water + Methaneselenol
3-Oxo-5,6-dehydrosuberyl-CoA semialdehyde + NADP + Water <> 3-Oxo-5,6-dehydrosuberyl-CoA + NADPH + Hydrogen ion
Phenylacetyl-CoA + Oxygen + NADPH + Hydrogen ion <> 2-(1,2-Epoxy-1,2-dihydrophenyl)acetyl-CoA + Water + NADP + 2-(1,2-Epoxy-1,2-dihydrophenyl)acetyl-CoA
2-Octaprenylphenol + Oxygen + NADPH + Hydrogen ion > 2-Octaprenyl-6-hydroxyphenol + Water + NADP
Adenosine triphosphate + an aliphatic sulfonate + Water > an aliphatic sulfonate + ADP + Phosphate + Hydrogen ion
D-Ribulose + Adenosine triphosphate > Hydrogen ion + D-Ribulose-1-phosphate + ADP
4,6-Dideoxy-4-oxo-dTDP-D-glucose + NADH + Hydrogen ion <> Deoxythymidine diphosphate-L-rhamnose + NAD
(2,3-Dihydroxybenzoyl)adenylic acid + L-Seryl-AMP <> Hydrogen ion + Enterochelin + Adenosine monophosphate
Hydrogen ion + Formic acid > Carbon dioxide + Hydrogen (gas)
NAD + Glycine + Tetrahydrofolic acid > Hydrogen ion + 5,10-Methylene-THF + Ammonia + Carbon dioxide + NADH
NAD + Ethylene glycol <> Hydrogen ion + Glycolaldehyde + NADH
Hydrogen ion + L-Glutamate + Adenosine triphosphate + NADPH > ADP + L-Glutamic-gamma-semialdehyde + NADP + Phosphate
4-(2-aminophenyl)-2,4-dioxobutanoate > kynurenate + Water + Hydrogen ion
an oxidized electron acceptor + Ascorbic acid + Hydrogen ion > a reduced electron acceptor + monodehydroascorbate
Guanosine triphosphate + hydroxyl radical > Hydrogen ion + 8-oxo-GTP
dGTP + hydroxyl radical > Hydrogen ion + 8-oxo-dGTP
2-Oxo-4-methylthiobutanoic acid + hydroxyl radical > Hydrogen ion + ethylene + methanethiol + Carbon dioxide
Hydrogen ion + Hydrogen peroxide + Iron > hydroxyl radical + OH<SUP>-</SUP> + Fe<SUP>3+</SUP>
dehydroascorbate (bicyclic form) > 2,3-Diketo-L-gulonate + Hydrogen ion
dehydroascorbate (bicyclic form) + Hydrogen peroxide > L-threonate + Oxalic acid + Hydrogen ion
Selenite + Glutathione + Hydrogen ion > Selenodiglutathione + Glutathione disulfide + Water
dehydroascorbate (bicyclic form) > cyclic-2,3-<i>O</i>-oxalyl-L-threonate + Hydrogen ion
2-carboxy-L-xylonolactone + Water > 2-carboxy-L-<i>threo</i>-pentonate + Hydrogen ion
monodehydroascorbate + Hydrogen ion > Ascorbic acid + L-dehydro-ascorbate
a 2(R)-hydroperoxy fatty acid + Hydrogen ion > a fatty aldehyde + Carbon dioxide + Water
(<i>S</i>)-2-acetolactate + an oxidized electron acceptor + Hydrogen ion > diacetyl + Carbon dioxide + a reduced electron acceptor
5,10-Methenyltetrahydrofolate + Water Hydrogen ion + N5-Formyl-H4F
Hydrogen ion + 2-Isopropyl-3-oxosuccinate > Ketoleucine + Carbon dioxide
Hydrogen ion + coumarinate > coumarin + Water
Hydrogen ion + Sulfite <> bisulfite
2-Amino-3-oxo-4-phosphonooxybutyrate + Hydrogen ion > 1-Amino-propan-2-one-3-phosphate + Carbon dioxide
Propylene glycol + NAD <> acetol + NADH + Hydrogen ion
S-Adenosylmethionine + a [protein]-L-glutamine > Hydrogen ion + S-Adenosylhomocysteine + a [protein]-N<sup>5</sup>-methyl-L-glutamine
Ribose-1-phosphate + Adenosine triphosphate > Hydrogen ion + Ribose 1,5-bisphosphate + ADP
Enterochelin + Water > Hydrogen ion + 2,3-Dihydroxybenzoylserine
Hydrogen ion + Pyruvic acid + Acetaldehyde > acetoin + Carbon dioxide
Glutathione + Adenosine triphosphate + Water > Glutathione + ADP + Phosphate + Hydrogen ion
2-Pyrocatechuic acid + Oxygen > Hydrogen ion + 2-Carboxymuconate
Hydrogen ion > Hydrogen (gas)
menadiol + Oxygen > Hydrogen ion + menadione + Superoxide anion
Thiamine pyrophosphate + Water > Hydrogen ion + Thiamine monophosphate + Phosphate
2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate + Water > Hydrogen ion + 4-Amino-2-methyl-5-phosphomethylpyrimidine + Phosphate
a 1,2-diacyl-<i>sn</i>-glycerol 3-diphosphate + Water PA(16:0/16:0) + Phosphate + Hydrogen ion
&alpha;-Kdo-(2->4)-&alpha;-Kdo-(2->6)-lipid IV<SUB>A</SUB> + ADP-L-Glycero-D-manno-heptose Hydrogen ion + heptosyl-Kdo<sub>2</sub>-lipid IV<sub>A</sub> + ADP
3,4-dihydroxyphenylacetyl-CoA + Water 3,4-Dihydroxybenzeneacetic acid + Coenzyme A + Hydrogen ion
Guanosine diphosphate mannose + Water > Hydrogen ion + Guanosine monophosphate + D-Mannose 1-phosphate
Cadaverine + S-Adenosylmethioninamine > Hydrogen ion + Aminopropylcadaverine + 5'-Methylthioadenosine
Ammonia + Hydrogen ion <> Ammonium
OH<SUP>-</SUP> + Hydrogen ion <> Water
Carbamic acid + Hydrogen ion > Ammonia + Carbon dioxide
an L-1-phosphatidyl-glycerol + Adenosine triphosphate > an L-1-phosphatidylglycerol-phosphate + ADP + Hydrogen ion
L-Galactonate + NAD > Hydrogen ion + D-tagaturonate + NADH
Hydrogen ion + Lipid A-core + Undecaprenyl diphosphate lipid A-core 1-diphosphate + Di-trans,poly-cis-undecaprenyl phosphate
poly-&beta;-1,6-N-acetyl-D-glucosamine + Water Hydrogen ion + partially N-deacetylated poly-&beta;-1,6-N-acetyl-D-glucosamine + Acetic acid
4,5-Dihydroxy-2,3-pentanedione + Adenosine triphosphate > Hydrogen ion + P-DPD + ADP
Hydrogen ion + Heme Protoporphyrin IX + Iron
Dihydromonapterin-triphosphate + Water > Hydrogen ion + 7,8-Dihydroneopterin + Phosphate
3-ureidoacrylate + Water > Hydrogen ion + Carbamic acid + 3-Aminoacrylate
Peroxyaminoacrylate + a reduced electron acceptor > 3-Aminoacrylate + Water + Hydrogen ion + an oxidized electron acceptor
D-Sedoheptulose 7-phosphate + Adenosine triphosphate > Hydrogen ion + Sedoheptulose 1,7-bisphosphate + ADP
bromoacetate + Glutathione Hydrogen ion + glutathione-S-acetate + Br<SUP>-</SUP>
curcumin + NADPH + Hydrogen ion > dihydrocurcumin + NADP
dihydrocurcumin + NADPH + Hydrogen ion > tetrahydrocurcumin + NADP
&alpha;-D-ribose-1,2-cyclic-phosphate-5-phosphate + Water > Hydrogen ion + Ribose 1,5-bisphosphate
D-Galactose + NAD 3-keto-&beta;-D-galactose + NADH + Hydrogen ion
&alpha;-D-ribose-1-methylphosphonate-5-triphosphate + Water > Hydrogen ion + &alpha;-D-ribose-1-methylphosphonate-5-phosphate + Pyrophosphate
Hydrogen ion + &alpha;-D-ribose-1-methylphosphonate-5-phosphate + S-Adenosylmethionine > &alpha;-D-ribose-1,2-cyclic-phosphate-5-phosphate + methane + 5'-Deoxyadenosine + L-Methionine
Hydrogen ion + 3-Mercaptopyruvic acid > Pyruvic acid + Hydrogen sulfide
3-Dehydro-L-gulonate + Adenosine triphosphate > Hydrogen ion + 3-Dehydro-L-gulonate 6-phosphate + ADP
Fructoselysine + Adenosine triphosphate > Hydrogen ion + Fructoselysine-6-phosphate + ADP
L-Glutamic-gamma-semialdehyde <> Hydrogen ion + Water + L-D-1-Pyrroline-5-carboxylic acid
Hydrogen ion + L-2-Amino-3-oxobutanoic acid > Aminoacetone + Carbon dioxide
&beta;-D-galactofuranose + Adenosine triphosphate + Water > &beta;-D-galactofuranose + ADP + Phosphate + Hydrogen ion
S-Adenosylmethionine + Uroporphyrinogen III <> S-Adenosylhomocysteine + precorrin-1 + Hydrogen ion
Adenosine triphosphate + Water + Phosphate ADP + Phosphate + Hydrogen ion
a lipopolysaccharide + Water + Adenosine triphosphate > a lipopolysaccharide + Phosphate + ADP + Hydrogen ion
Hydrogen ion + Water + Adenosine triphosphate <> Hydrogen ion + Phosphate + ADP
Hydrogen ion + Water + Adenosine triphosphate <> Hydrogen ion + Phosphate + ADP
NADP + NADH + Hydrogen ion > NADPH + NAD + Hydrogen ion
NADP + NADH + Hydrogen ion > NADPH + NAD + Hydrogen ion
NADP + Gluconic acid <> Hydrogen ion + 2-Dehydro-D-gluconate + NADPH
O-Phospho-4-hydroxy-L-threonine + NAD > Hydrogen ion + NADH + 2-Amino-3-oxo-4-phosphonooxybutyrate
NAD(P)<sup>+</sup> + L-Idonate <> NAD(P)H + 5-Keto-D-gluconate + Hydrogen ion
GDP-L-Fucose + NADP < Hydrogen ion + NADPH + GDP-4-Dehydro-6-deoxy-D-mannose
Hydrogen ion + NADPH + 2,5-Diketo-D-gluconate <> 2-Dehydro-D-gluconate + NADP
3-(2,3-Dihydroxyphenyl)propionic acid + Oxygen > Hydrogen ion + 2-Hydroxy-6-ketononadienedicarboxylate
an aldehyde + Water + an oxidized electron acceptor a carboxylate + a reduced electron acceptor + Hydrogen ion
5-Methyltetrahydrofolic acid + NAD <> 5,10-Methylene-THF + Hydrogen ion + NADH
NAD(P)<sup>+</sup> + Tetrahydropteridine <> NAD(P)H + 6,7-Dihydropteridine + Hydrogen ion
Adenosine triphosphate + Fructose 1-phosphate > Hydrogen ion + ADP + Fructose 1,6-bisphosphate
(R)-Pantoate + NADP < Hydrogen ion + 2-Dehydropantoate + NADPH
alpha-Ketoisovaleric acid + Acetyl-CoA + Water > Hydrogen ion + 3-Carboxy-3-hydroxy-isocaproate + Coenzyme A
Oxalacetic acid + Water + Propionyl-CoA <> Hydrogen ion + Methylcitric acid + Coenzyme A
2-Octaprenyl-6-methoxyphenol + Oxygen + NADPH + Hydrogen ion > 2-Octaprenyl-6-methoxy-1,4-benzoquinol + Water + NADP
2-Octaprenyl-6-hydroxyphenol + S-Adenosylmethionine > Hydrogen ion + 2-Octaprenyl-6-methoxyphenol + S-Adenosylhomocysteine
2-Octaprenyl-6-methoxy-1,4-benzoquinol + S-Adenosylmethionine > Hydrogen ion + 2-Octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol + S-Adenosylhomocysteine
S-Adenosylmethionine + a [protein]-L-&beta;-isoaspartate > S-Adenosylhomocysteine + a protein L-&beta;-isoaspartate &alpha;-methyl ester + Hydrogen ion
a phospholipid olefinic fatty acid + S-Adenosylmethionine > a phospholipid cyclopropane fatty acid + S-Adenosylhomocysteine + Hydrogen ion
Glucosamine-1P + Acetyl-CoA > Hydrogen ion + <i>N</i>-acetyl-&alpha;-D-glucosamine 1-phosphate + Coenzyme A
Hydrogen ion + Isochorismate + Oxoglutaric acid > 2-Succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate + Carbon dioxide
4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Adenosine triphosphate > Hydrogen ion + 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + ADP
Adenosine triphosphate + a [protein]-L-tyrosine > ADP + a protein-L-tyrosine phosphate + Hydrogen ion
Adenosine triphosphate + a [protein]-L-tyrosine a protein-L-tyrosine phosphate + ADP + Hydrogen ion
Hydrogen ion + Nicotinamide ribotide + Adenosine triphosphate <> NAD + Pyrophosphate
Hydrogen ion + D-Mannose 1-phosphate + Guanosine triphosphate > Guanosine diphosphate mannose + Pyrophosphate
Hydrogen ion + 2-C-Methyl-D-erythritol-4-phosphate + Cytidine triphosphate > 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Pyrophosphate
Hydrogen ion + Dephospho-CoA + Adenosine triphosphate > 2'-(5-Triphosphoribosyl)-3'-dephospho-CoA + Adenine
<i>S</i>-sulfanyl-[acceptor] + Dethiobiotin + S-Adenosylmethionine > an unsulfurated sulfur acceptor + Biotin + 5'-Deoxyadenosine + L-Methionine + Hydrogen ion
3-Isopropylmalate + NAD <> 2-Isopropyl-3-oxosuccinate + NADH + Hydrogen ion
Hydrogen ion + 3-Octaprenyl-4-hydroxybenzoate > 2-Octaprenylphenol + Carbon dioxide
Water + formyl-L-methionyl peptide > Hydrogen ion + methionyl peptide + Formic acid
a nucleoside triphosphate + Water > a nucleoside monophosphate + Pyrophosphate + Hydrogen ion
Water + Diadenosine tetraphosphate > Hydrogen ion + ADP
Guanosine triphosphate + Water > Hydrogen ion + Guanosine diphosphate + Phosphate
NAD + gamma-Hydroxybutyrate <> Hydrogen ion + NADH + Succinic acid semialdehyde
2,3-diaminopropanoate + Water > Hydrogen ion + Ammonia + Pyruvic acid
L-Serine > Hydrogen ion + Pyruvic acid + Ammonia
Fructose 6-phosphate + Adenosine triphosphate > Hydrogen ion + ADP + Fructose 1,6-bisphosphate
6-Phosphonoglucono-D-lactone + Water > Hydrogen ion + 6-Phosphogluconic acid
NAD + cholate Hydrogen ion + NADH + 3-alpha,12-alpha-dihydroxy-7-oxo-5-beta-cholanate
Hydrogen ion + L-Alanine + pimeloyl-CoA > Carbon dioxide + Coenzyme A + 8-Amino-7-oxononanoate
Adenosine triphosphate + Ferric enterobactin + Water > ADP + Phosphate + Ferric enterobactin + Hydrogen ion
Adenosine triphosphate + L-Glutamine + Water > ADP + Phosphate + L-Glutamine + Hydrogen ion
Adenosine triphosphate + L-Glutamate + Water > ADP + Phosphate + L-Glutamate + Hydrogen ion
Adenosine triphosphate + L-Histidine + Water > ADP + Phosphate + L-Histidine + Hydrogen ion
Adenosine triphosphate + L-Isoleucine + Water > ADP + Phosphate + L-Isoleucine + Hydrogen ion
Adenosine triphosphate + D-Maltose + Water > ADP + Phosphate + D-Maltose + Hydrogen ion
Adenosine triphosphate + D-Galactose + Water > ADP + Phosphate + D-Galactose + Hydrogen ion
Adenosine triphosphate + Molybdate + Water > ADP + Phosphate + Molybdate + Hydrogen ion
Water + L-Arabinose + Adenosine triphosphate > L-Arabinose + Phosphate + ADP + Hydrogen ion
Ni<SUP>2+</SUP> + Adenosine triphosphate + Water > Ni<SUP>2+</SUP> + ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + Water + an alkylphosphonate > ADP + Phosphate + an alkylphosphonate + Hydrogen ion
Adenosine triphosphate + Spermidine + Water > ADP + Phosphate + Spermidine + Hydrogen ion
Adenosine triphosphate + Putrescine + Water > ADP + Phosphate + Putrescine + Hydrogen ion
Adenosine triphosphate + L-Proline + Water > ADP + Phosphate + L-Proline + Hydrogen ion
Adenosine triphosphate + Phosphate + Water > ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + beta-D-Ribopyranose + Water > ADP + Phosphate + beta-D-Ribopyranose + Hydrogen ion
L-Lysine + Adenosine triphosphate + Water > L-Lysine + ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + Thiamine + Water > ADP + Phosphate + Thiamine + Hydrogen ion
Adenosine triphosphate + D-Xylose + Water > ADP + Phosphate + D-Xylose + Hydrogen ion
Adenosine triphosphate + Glycerol 3-phosphate + Water > ADP + Phosphate + Glycerol 3-phosphate + Hydrogen ion
Adenosine triphosphate + L-Leucine + Water > ADP + Phosphate + L-Leucine + Hydrogen ion
Adenosine triphosphate + L-Valine + Water > ADP + Phosphate + L-Valine + Hydrogen ion
Adenosine triphosphate + Ornithine + Water > ADP + Phosphate + Ornithine + Hydrogen ion
Adenosine triphosphate + L-Arginine + Water > ADP + Phosphate + L-Arginine + Hydrogen ion
D-Allose + Adenosine triphosphate + Water > D-Allose + ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + Cob(I)alamin + Water > ADP + Phosphate + Cob(I)alamin + Hydrogen ion
Zinc + Water + Adenosine triphosphate > Zinc + ADP + Phosphate + Hydrogen ion
Taurine + Adenosine triphosphate + Water > Taurine + ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + Thiosulfate + Water > ADP + Phosphate + Thiosulfate + Hydrogen ion
Sulfate + Water + Adenosine triphosphate > Sulfate + Phosphate + ADP + Hydrogen ion
Adenosine triphosphate + a dipeptide + Water > ADP + Phosphate + a dipeptide + Hydrogen ion
Adenosine triphosphate + Fe(III)dicitrate + Water > ADP + Phosphate + Fe(III)dicitrate + Hydrogen ion
NAD + Coenzyme A + Acetaldehyde <> Hydrogen ion + NADH + Acetyl-CoA
Acetoacetic acid + Hydrogen ion acetone + Carbon dioxide
acetoin + NADP diacetyl + NADPH + Hydrogen ion
(R)-2,3-Dihydroxy-isovalerate + NADP <> (<i>S</i>)-2-acetolactate + NADPH + Hydrogen ion
Hydrogen ion + Pyruvic acid <> (<i>S</i>)-2-acetolactate + Carbon dioxide
(R) 2,3-Dihydroxy-3-methylvalerate + NADP <> Hydrogen ion + 2-Aceto-2-hydroxy-butyrate + NADPH
Hydrogen ion + Pyruvic acid + 2-Ketobutyric acid > 2-Aceto-2-hydroxy-butyrate + Carbon dioxide
Adenosine triphosphate + Acetyl-CoA + Hydrogen carbonate > Hydrogen ion + Malonyl-CoA + Phosphate + ADP
Water + an acetic ester > an alcohol + Acetic acid + Hydrogen ion
O-Acetylserine + Hydrogen sulfide <> Hydrogen ion + L-Cysteine + Acetic acid
an acyl-CoA + Water > Coenzyme A + a carboxylate + Hydrogen ion
Water + an acyl phosphate > Phosphate + a carboxylate + Hydrogen ion
4-Amino-4-deoxychorismate <> Hydrogen ion + p-Aminobenzoic acid + Pyruvic acid
Water + Adenosine triphosphate > Hydrogen ion + Phosphate + ADP
L-Aspartic acid + Inosinic acid + Guanosine triphosphate > Hydrogen ion + adenylo-succinate + Phosphate + Guanosine diphosphate
Adenosine phosphosulfate + Adenosine triphosphate > Hydrogen ion + Phosphoadenosine phosphosulfate + ADP
2-Demethylmenaquinol 8 + S-Adenosylmethionine > Menaquinol 8 + Hydrogen ion + S-Adenosylhomocysteine
Adenosine triphosphate + Phosphoribosylformylglycineamidine > Hydrogen ion + ADP + Phosphate + 5-Aminoimidazole ribonucleotide
Glycine + Acetyl-CoA <> Hydrogen ion + L-2-Amino-3-oxobutanoic acid + Coenzyme A
3-chloro-D-alanine + thioglycolate <> Hydrogen ion + S-Carboxymethyl-D-cysteine + Chloride
a primary alcohol + NAD <> an aldehyde + NADH + Hydrogen ion
Ethanol + NAD <> Acetaldehyde + NADH + Hydrogen ion
NADP + an alcohol an aldehyde + NADPH + Hydrogen ion
an aldehyde + Water + NADP a carboxylate + NADPH + Hydrogen ion
Hydrogen ion + Allantoic acid + Water > <i>S</i>-ureidoglycine + Ammonia + Carbon dioxide
<i>S</i>-allantoin + Water > Hydrogen ion + Allantoic acid
D-Allose + Adenosine triphosphate > Hydrogen ion + D-Allose 6-phosphate + ADP
NAD + D-Altronate <> Hydrogen ion + NADH + D-tagaturonate
Aminoacetone + Water + Oxygen > Hydrogen ion + Pyruvaldehyde + Ammonia + Hydrogen peroxide
an aliphatic amine + Water + Oxygen > an aldehyde + Ammonia + Hydrogen peroxide + Hydrogen ion
Water + Oxygen + Phenylethylamine > Hydrogen ion + Hydrogen peroxide + Ammonia + Phenylacetaldehyde
4-Aminobutyraldehyde + NAD + Water > gamma-Aminobutyric acid + NADH + Hydrogen ion
1-Amino-2-propanol + NAD < Hydrogen ion + Aminoacetone + NADH
Chorismate + L-Glutamine > Hydrogen ion + 2-Aminobenzoic acid + Pyruvic acid + L-Glutamate
Hydrogen ion + L-Arginine > Carbon dioxide + Agmatine
L-Arginine + Succinyl-CoA > Hydrogen ion + N2-Succinyl-L-arginine + Coenzyme A
L-Aspartic acid + Citrulline + Adenosine triphosphate > Hydrogen ion + L-arginino-succinate + Pyrophosphate + Adenosine monophosphate
L-Glutamine + L-Aspartic acid + Adenosine triphosphate + Water > Hydrogen ion + L-Glutamate + L-Asparagine + Pyrophosphate + Adenosine monophosphate
L-Asparagine + Water > Hydrogen ion + L-Aspartic acid + Ammonia
L-Aspartic acid <> Hydrogen ion + Fumaric acid + Ammonia
NADP + Phosphate + L-Aspartate-semialdehyde <> Hydrogen ion + NADPH + L-Aspartyl-4-phosphate
L-Aspartic acid + Carbamoylphosphate > Hydrogen ion + Ureidosuccinic acid + Phosphate
Hydrogen ion + L-Aspartic acid > beta-Alanine + Carbon dioxide
Betaine aldehyde + NAD + Water > Hydrogen ion + Betaine + NADH
Ammonia + Carbon dioxide + Adenosine triphosphate < Hydrogen ion + Carbamoylphosphate + ADP
a carboxylic ester + Water > an alcohol + a carboxylate + Hydrogen ion
Adenosine triphosphate + L-Glutamine + Hydrogen carbonate + Water > Hydrogen ion + Carbamoylphosphate + L-Glutamate + Phosphate + ADP
a CDP-diacylglycerol + Water <> PA(16:0/16:0) + Cytidine monophosphate + Hydrogen ion
Cytidine triphosphate + PA(16:0/16:0) + Hydrogen ion > Pyrophosphate + a CDP-diacylglycerol
Oxalacetic acid + Acetyl-CoA + Water <> Hydrogen ion + Citric acid + Coenzyme A
Adenosylcobinamide-GDP + N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole > adenosylcobalamin 5'-phosphate + Guanosine monophosphate + Hydrogen ion
Adenosylcobinamide-GDP + N1-(alpha-D-ribosyl)-5,6-dimethyl-benzimidazole Hydrogen ion + Adenosylcobalamin + Guanosine monophosphate
Adenosyl cobinamide + Adenosine triphosphate > Hydrogen ion + Adenosyl cobinamide phosphate + ADP
Hydrogen ion + Adenosyl cobinamide phosphate + Guanosine triphosphate > Adenosylcobinamide-GDP + Pyrophosphate
Adenosine triphosphate + Uridine triphosphate + L-Glutamine + Water > Hydrogen ion + ADP + Phosphate + Cytidine triphosphate + L-Glutamate
a nucleoside 2',3'-cyclic phosphate + Water > a nucleoside 3'-phosphate + Hydrogen ion
L-Cystathionine + Water > Hydrogen ion + Pyruvic acid + Ammonia + L-Homocysteine
Cytidine + Guanosine triphosphate > Hydrogen ion + Cytidine monophosphate + Guanosine diphosphate
D-Alanine + Adenosine triphosphate > Hydrogen ion + D-Alanyl-D-alanine + Phosphate + ADP
dCTP + Water > Hydrogen ion + dCMP + Pyrophosphate
D-Cysteine + Water <> Pyruvic acid + Hydrogen sulfide + Ammonia + Hydrogen ion
2-Dehydro-3-deoxy-D-galactonate + Adenosine triphosphate > Hydrogen ion + 2-Dehydro-3-deoxy-D-galactonate-6-phosphate + ADP
(<i>R</i>)-pantolactone + NADP <> 2-Dehydropantoyl lactone + NADPH + Hydrogen ion
2-Keto-3-deoxy-D-gluconic acid + Adenosine triphosphate > Hydrogen ion + 2-Keto-3-deoxy-6-phosphogluconic acid + ADP
Dephospho-CoA + Adenosine triphosphate > Hydrogen ion + Coenzyme A + ADP
Carbon dioxide + 7,8-Diaminononanoate + Adenosine triphosphate > Hydrogen ion + Dethiobiotin + Phosphate + ADP
Water + dGTP > Hydrogen ion + Triphosphate + Deoxyguanosine
Hydrogen ion + Adenosine triphosphate + 2-Pyrocatechuic acid > Pyrophosphate + (2,3-Dihydroxybenzoyl)adenylic acid
NAD + (2S,3S)-2,3-Dihydro-2,3-dihydroxybenzoate > Hydrogen ion + NADH + 2-Pyrocatechuic acid
2-octaprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinone + S-Adenosylmethionine > Hydrogen ion + Ubiquinol-8 + S-Adenosylhomocysteine
Adenosine triphosphate + a 1,2-diacylglycerol <> Hydrogen ion + PA(16:0/16:0) + ADP
an aliphatic &alpha;,&omega;-diamine + Acetyl-CoA <> an aliphatic <i>N</i>-acetyl-diamine + Coenzyme A + Hydrogen ion
Hydrogen ion + <i>meso</i>-diaminopimelate > L-Lysine + Carbon dioxide
(2E)-Decenoyl-CoA + NADP <> Hydrogen ion + trans-Delta2, cis-delta4-decadienoyl-CoA + NADPH
Pyruvic acid + L-Aspartate-semialdehyde <> Hydrogen ion + Water + 2,3-Dihydrodipicolinic acid
NADP + Tetrahydrofolic acid < Hydrogen ion + NADPH + Dihydrofolic acid
L-Glutamate + 7,8-Dihydropteroic acid + Adenosine triphosphate > Hydrogen ion + Dihydrofolic acid + Phosphate + ADP
4,5-Dihydroorotic acid + Water <> Hydrogen ion + Ureidosuccinic acid
NAD(P)<sup>+</sup> + Tetrahydrodipicolinate < NAD(P)H + 2,3-Dihydrodipicolinic acid + Hydrogen ion
NAD + Dihydrouracil <> Hydrogen ion + NADH + Uracil
Precorrin 2 + NAD <> Hydrogen ion + Sirohydrochlorin + NADH
D-Ribulose 5-phosphate > Hydrogen ion + 3,4-Dihydroxy-2-butanone-4-P + Formic acid
NAD + D-Lactic acid < Hydrogen ion + NADH + Pyruvic acid
Nicotinamide ribotide + Dimethylbenzimidazole > Hydrogen ion + Nicotinic acid + N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole
all-<i>trans</i>-octaprenyl diphosphate + 1,4-Dihydroxy-2-naphthoic acid + Hydrogen ion > 2-Demethylmenaquinol 8 + Pyrophosphate + Carbon dioxide
D-Serine > Hydrogen ion + Pyruvic acid + Ammonia
NADP + Deoxythymidine diphosphate-L-rhamnose <> Hydrogen ion + NADPH + dTDP-4-dehydro-6-deoxy-&beta;-L-mannose
Hydrogen ion + Glucose 1-phosphate + Thymidine 5'-triphosphate <> dTDP-D-Glucose + Pyrophosphate
Deoxyuridine + Adenosine triphosphate > Hydrogen ion + dUMP + ADP
Deoxyuridine triphosphate + Water > Hydrogen ion + dUMP + Pyrophosphate
2-C-Methyl-D-erythritol-4-phosphate + NADP <> Hydrogen ion + 1-Deoxy-D-xylulose 5-phosphate + NADPH
Pyruvic acid + D-Glyceraldehyde 3-phosphate + Hydrogen ion > Carbon dioxide + 1-Deoxy-D-xylulose 5-phosphate
Adenosine triphosphate + L-Serine + 2-Pyrocatechuic acid > Hydrogen ion + Pyrophosphate + Adenosine monophosphate + Enterochelin
D-Erythrose 4-phosphate + Water + NAD > 4-Phospho-D-erythronate + NADH + Hydrogen ion
4-Phospho-D-erythronate + NAD > Hydrogen ion + 2-Oxo-3-hydroxy-4-phosphobutanoic acid + NADH
Ethanolamine > Hydrogen ion + Acetaldehyde + Ammonia
Flavin Mononucleotide + Adenosine triphosphate + Hydrogen ion > FAD + Pyrophosphate
Adenosine triphosphate + 5'-Phosphoribosyl-N-formylglycineamide + L-Glutamine + Water > Hydrogen ion + ADP + Phosphate + Phosphoribosylformylglycineamidine + L-Glutamate
NAD(P)<sup>+</sup> + FMNH <> NAD(P)H + Flavin Mononucleotide + Hydrogen ion
Formic acid + Hydrogen ion + a menaquinone > Hydrogen ion + Carbon dioxide + a menaquinol
Formic acid + Hydrogen ion + a menaquinone > Hydrogen ion + Carbon dioxide + a menaquinol
Water + N10-Formyl-THF > Hydrogen ion + Tetrahydrofolic acid + Formic acid
D-Fructose + Adenosine triphosphate > Hydrogen ion + Fructose 6-phosphate + ADP
Undecaprenyl phosphate + dTDP-4-Acetamido-4,6-dideoxy-D-galactose > Hydrogen ion + undecaprenyl N-acetyl-glucosaminyl-N-acetyl-mannosaminuronate-4-acetamido-4,6-dideoxy-D-galactose pyrophosphate + dTDP
L-Fuculose + Adenosine triphosphate > Hydrogen ion + L-Fuculose 1-phosphate + ADP
Galactitol 1-phosphate + NAD <> Hydrogen ion + D-Tagatose 6-phosphate + NADH
D-Galactose + Adenosine triphosphate > Hydrogen ion + Galactose 1-phosphate + ADP
D-Glyceraldehyde 3-phosphate + Phosphate + NAD <> Hydrogen ion + Glyceric acid 1,3-biphosphate + NADH
N10-Formyl-THF + Glycineamideribotide <> Hydrogen ion + Tetrahydrofolic acid + 5'-Phosphoribosyl-N-formylglycineamide
Glycineamideribotide + Formic acid + Adenosine triphosphate > Hydrogen ion + Phosphate + 5'-Phosphoribosyl-N-formylglycineamide + ADP
GDP-&alpha;-D-glucose + Water > Hydrogen ion + b-D-Glucose + Guanosine diphosphate
Guanosine diphosphate mannose + Water > D-Mannose + Hydrogen ion + Guanosine diphosphate
Adenosine triphosphate + Glyceric acid > Hydrogen ion + 2-Phospho-D-glyceric acid + ADP
Glucose 6-phosphate + NADP <> 6-Phosphonoglucono-D-lactone + NADPH + Hydrogen ion
Hydrogen ion + Glucose 1-phosphate + Adenosine triphosphate > ADP-Glucose + Pyrophosphate
Hydrogen ion + Glucose 1-phosphate + Uridine triphosphate > UDP-Glucose + Pyrophosphate
b-D-Glucose + Adenosine triphosphate > Hydrogen ion + Glucose 6-phosphate + ADP
NAD(P)<sup>+</sup> + Gluconic acid <> NAD(P)H + 5-Keto-D-gluconate + Hydrogen ion
Adenosine triphosphate + Gluconic acid > Hydrogen ion + ADP + 6-Phosphogluconic acid
Gluconolactone + Water > Hydrogen ion + Gluconic acid
Glucosamine 6-phosphate + Water <> Hydrogen ion + Fructose 6-phosphate + Ammonia
L-Glutamate + NADP < Hydrogen ion + L-Glutamine + Oxoglutaric acid + NADPH
Phosphoribulosylformimino-AICAR-P + L-Glutamine > Hydrogen ion + L-Glutamate + D-Erythro-imidazole-glycerol-phosphate + AICAR
L-Glutamine + Water > Hydrogen ion + L-Glutamate + Ammonia
Glutathione + NADP < Glutathione disulfide + NADPH + Hydrogen ion
Glycine + gamma-Glutamylcysteine + Adenosine triphosphate > Hydrogen ion + Glutathione + Phosphate + ADP
L-Cysteine + L-Glutamate + Adenosine triphosphate > Hydrogen ion + gamma-Glutamylcysteine + Phosphate + ADP
Hydrogen ion + L-Glutamate > Carbon dioxide + gamma-Aminobutyric acid
L-Glutamate + Water + NADP <> Hydrogen ion + Oxoglutaric acid + Ammonia + NADPH
L-Glutamic-gamma-semialdehyde + Phosphate + NADP < L-Glutamic acid 5-phosphate + NADPH + Hydrogen ion
Glyceric acid + Adenosine triphosphate > Hydrogen ion + 3-Phosphoglycerate + ADP
NAD(P)<sup>+</sup> + Glycerol 3-phosphate < NAD(P)H + Dihydroxyacetone phosphate + Hydrogen ion
Glycerol + NAD <> Dihydroxyacetone + NADH + Hydrogen ion
Glycerol + Adenosine triphosphate > Hydrogen ion + Glycerol 3-phosphate + ADP
Water + NAD + Glycolaldehyde > Hydrogen ion + NADH + Glycolic acid
a glycerophosphodiester + Water > an alcohol + Glycerol 3-phosphate + Hydrogen ion
Hydrogen ion + Glyoxylic acid > Carbon dioxide + Tartronate semialdehyde
S-Lactoylglutathione + Water > Hydrogen ion + Glutathione + D-Lactic acid
D-Lactic acid + Hydrogen ion < Pyruvaldehyde + Water
Glycolic acid + NADP < Hydrogen ion + NADPH + Glyoxylic acid
Adenosine triphosphate + 5-Phosphoribosylamine + Glycine <> Hydrogen ion + ADP + Phosphate + Glycineamideribotide
Ammonia + Inosinic acid + NADP < Hydrogen ion + Guanosine monophosphate + NADPH
Water + L-Glutamine + Xanthylic acid + Adenosine triphosphate > Hydrogen ion + L-Glutamate + Guanosine monophosphate + Pyrophosphate + Adenosine monophosphate
Adenosine triphosphate + Xanthylic acid + Ammonia > Hydrogen ion + Adenosine monophosphate + Pyrophosphate + Guanosine monophosphate
Spermidine + Glutathione + Adenosine triphosphate > Hydrogen ion + Glutathionylspermidine + ADP + Phosphate
1-chloro-2,4-dinitrobenzene + Glutathione <> Hydrogen ion + 2,4-dinitrophenyl-S-glutathione + Chloride
Guanosine triphosphate + Water > Hydrogen ion + Formic acid + Dihydroneopterin triphosphate
Water + Guanosine triphosphate > Hydrogen ion + Pyrophosphate + 2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Formic acid
Guanosine diphosphate + Water > Hydrogen ion + Guanosine monophosphate + Phosphate
Guanosine + Adenosine triphosphate > Hydrogen ion + Guanosine monophosphate + ADP
Dihydroneopterin triphosphate + Water > Hydrogen ion + Dihydroneopterin monophosphate + Pyrophosphate
6-Hydroxymethyl dihydropterin + Adenosine triphosphate > Hydrogen ion + 6-Hydroxymethyl-dihydropterin pyrophosphate + Adenosine monophosphate
Hydrocinnamic acid + NADH + Oxygen + Hydrogen ion > cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD
histidinal + NAD + Water > Hydrogen ion + L-Histidine + NADH
L-Histidinol + NAD > Hydrogen ion + histidinal + NADH
Phosphoribosyl-ATP + Water > Hydrogen ion + Phosphoribosyl-AMP + Pyrophosphate
L-Homocysteine + S-Adenosylmethionine Hydrogen ion + L-Methionine + S-Adenosylhomocysteine
NAD(P)<sup>+</sup> + L-Homoserine < NAD(P)H + L-Aspartate-semialdehyde + Hydrogen ion
L-Homoserine + Adenosine triphosphate > Hydrogen ion + O-Phosphohomoserine + ADP
Propionyl-CoA + Water + Glyoxylic acid <> 2-hydroxyglutarate + Hydrogen ion + Coenzyme A
Hydrogen ion + 1-(2-Carboxyphenylamino)-1'-deoxy-D-ribulose 5'-phosphate > Indoleglycerol phosphate + Carbon dioxide + Water
Water + NAD + Inosinic acid > Hydrogen ion + NADH + Xanthylic acid
Water + Pyrophosphate > Hydrogen ion + Phosphate
Inosine + Adenosine triphosphate > Hydrogen ion + Inosinic acid + ADP
Isopentenyl pyrophosphate + NAD(P)<sup>+</sup> + Water < 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NAD(P)H + Hydrogen ion
CMP-3-Deoxy-D-manno-octulosonate + lipid IV<sub>A</sub> <> Hydrogen ion + KDO-lipid IV(A) + Cytidine monophosphate
KDO-lipid IV(A) + CMP-3-Deoxy-D-manno-octulosonate <> Hydrogen ion + &alpha;-Kdo-(2->4)-&alpha;-Kdo-(2->6)-lipid IV<SUB>A</SUB> + Cytidine monophosphate
NAD + 2-Deoxygluconate <> Hydrogen ion + NADH + 3-Dehydro-2-deoxy-D-gluconate
Oxygen + L-Aspartic acid > Hydrogen ion + Hydrogen peroxide + Iminoaspartic acid
Water + NAD + Lactaldehyde > Hydrogen ion + NADH + L-Lactic acid
Hydrogen ion + NADH + Lactaldehyde <> NAD + Propylene glycol
L-Cysteine + Water > Pyruvic acid + Ammonia + Hydrogen sulfide + Hydrogen ion
2,3-Bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl 1-phosphate + UDP-2,3-Bis(3-hydroxytetradecanoyl)glucosamine > Hydrogen ion + 2,3,2',3'-Tetrakis(3-hydroxytetradecanoyl)-D-glucosaminyl-1,6-beta-D-glucosamine 1-phosphate + Uridine 5'-diphosphate
Water + UDP-2,3-Bis(3-hydroxytetradecanoyl)glucosamine > Hydrogen ion + 2,3-Bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl 1-phosphate + Uridine 5'-monophosphate
5-amino-6-(D-ribitylamino)uracil + 3,4-Dihydroxy-2-butanone-4-P > Hydrogen ion + 6,7-Dimethyl-8-(1-D-ribityl)lumazine + Phosphate + Water
Hydrogen ion + L-Lysine > Carbon dioxide + Cadaverine
2-Acylglycerophosphocholine + Water a carboxylate + Glycerophosphocholine + Hydrogen ion
L-xylulose + Adenosine triphosphate > Hydrogen ion + L-Xylulose 5-phosphate + ADP
L-Malic acid + NAD <> Hydrogen ion + Oxalacetic acid + NADH
Acetyl-CoA + Water + Glyoxylic acid > Hydrogen ion + L-Malic acid + Coenzyme A
D-Mannose + Adenosine triphosphate > Hydrogen ion + Mannose 6-phosphate + ADP
NAD + D-Mannonate <> D-Fructuronate + Hydrogen ion + NADH
Sorbitol-6-phosphate + NAD <> Hydrogen ion + Fructose 6-phosphate + NADH
Hydrogen cyanide + 3-Mercaptopyruvic acid Hydrogen ion + Pyruvic acid + Thiocyanate
Hydrogen ion + 2-Ketobutyric acid + Succinic acid + Ammonia O-Succinyl-L-homoserine + Water
Water + 5,10-Methenyltetrahydrofolate <> Hydrogen ion + N10-Formyl-THF
2-Hydroxy-6-ketononadienedicarboxylate + Water > 2-Hydroxy-2,4-pentadienoate + Succinic acid + Hydrogen ion
Hydrogen ion + 3-(3-Hydroxyphenyl)propionate + NADH + Oxygen > Water + 3-(2,3-Dihydroxyphenyl)propionic acid + NAD
S-methyl-L-methionine + L-Homocysteine Hydrogen ion + L-Methionine
N-Acetyl-D-glucosamine + Adenosine triphosphate > Hydrogen ion + N-Acetyl-D-Glucosamine 6-Phosphate + ADP
N-Acetyl-L-glutamate 5-semialdehyde + NADP + Phosphate <> Hydrogen ion + N-Acetyl-L-glutamyl 5-phosphate + NADPH
L-Glutamate + Acetyl-CoA <> Hydrogen ion + <i>N</i>-acetyl-L-glutamate + Coenzyme A
N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimelyl-D-alanyl-D-alanine-diphosphoundecaprenol + Uridine diphosphate-N-acetylglucosamine <> Hydrogen ion + N-Acetylmuramoyl-L-alanyl-D-glutamyl-L-lysyl-D-alanyl-D-alanine-diphosphoundecaprenyl-N-acetylglucosamine + Uridine 5'-diphosphate
NAD + Adenosine triphosphate > Hydrogen ion + NADP + ADP
Adenosine triphosphate + Nicotinic acid adenine dinucleotide + L-Glutamine + Water > Hydrogen ion + Adenosine monophosphate + Pyrophosphate + NAD + L-Glutamate
Hydrogen ion + a ubiquinone + NADH <> a ubiquinol + NAD
menadione + NADH + Hydrogen ion menadiol + NAD
Water + NAD <> Hydrogen ion + Adenosine diphosphate ribose + Niacinamide
Reduced riboflavin + NADP < Hydrogen ion + Riboflavin + NADPH
Water + NAD > Hydrogen ion + Nicotinamide ribotide + Adenosine monophosphate
Hydrogen ion + <i>N</i>-acetyl-&alpha;-D-glucosamine 1-phosphate + Uridine triphosphate > Uridine diphosphate-N-acetylglucosamine + Pyrophosphate
N-Acetylmannosamine + Adenosine triphosphate > Hydrogen ion + N-Acetyl-D-mannosamine 6-phosphate + ADP
Hydrogen ion + 2-Succinylbenzoyl-CoA > 1,4-Dihydroxy-2-naphthoyl-CoA + Water
Hydrogen ion + Adenosine triphosphate + Nicotinamide ribotide > Pyrophosphate + Nicotinic acid adenine dinucleotide
Niacinamide + Water > Hydrogen ion + Nicotinic acid + Ammonia
Nicotinamide ribotide + Pyrophosphate < Hydrogen ion + Nicotinic acid + Phosphoribosyl pyrophosphate
Nitrous oxide + Water + Cytochromes-C-Oxidized Nitric oxide + Hydrogen ion + Cytochromes-C-Reduced
Nicotinamide ribotide + Water > Hydrogen ion + Nicotinamide ribotide + Ammonia
Water + Nicotinamide ribotide <> Hydrogen ion + D-Ribose-5-phosphate + Niacinamide
NAD(P)H + Hydrogen ion + a quinone a quinol + NAD(P)<sup>+</sup>
a nucleoside diphosphate + Water > a nucleoside monophosphate + Phosphate + Hydrogen ion
L-Cysteine + O-Succinyl-L-homoserine > Hydrogen ion + Succinic acid + L-Cystathionine
NAD + a (3<i>S</i>)-3-hydroxyacyl-CoA > NADH + a 3-oxoacyl-CoA + Hydrogen ion
Water + Porphobilinogen <> Hydrogen ion + Ammonia + Hydroxymethylbilane
Adenosine triphosphate + 4-Amino-5-hydroxymethyl-2-methylpyrimidine <> Hydrogen ion + ADP + 4-Amino-2-methyl-5-phosphomethylpyrimidine
Ornithine + Carbamoylphosphate <> Hydrogen ion + Citrulline + Phosphate
Hydrogen ion + Ornithine > Carbon dioxide + Putrescine
Hydrogen ion + Orotidylic acid > Carbon dioxide + Uridine 5'-monophosphate
Hydrogen ion + Oxalacetic acid > Pyruvic acid + Carbon dioxide
Hydrogen ion + Oxalyl-CoA Carbon dioxide + Formyl-CoA
Hydrogen ion + 4-Phosphopantothenoylcysteine > Pantetheine 4'-phosphate + Carbon dioxide
D-4'-Phosphopantothenate + L-Cysteine + Cytidine triphosphate > Hydrogen ion + Pyrophosphate + Cytidine monophosphate + 4-Phosphopantothenoylcysteine
Hydrogen ion + Pantetheine 4'-phosphate + Adenosine triphosphate <> Dephospho-CoA + Pyrophosphate
beta-Alanine + (R)-Pantoate + Adenosine triphosphate > Hydrogen ion + Pantothenic acid + Pyrophosphate + Adenosine monophosphate
Pantothenic acid + Adenosine triphosphate > Hydrogen ion + D-4'-Phosphopantothenate + ADP
1-Amino-propan-2-one-3-phosphate + 1-Deoxy-D-xylulose 5-phosphate > Hydrogen ion + Pyridoxine 5'-phosphate + Phosphate + Water
Pyruvic acid + Adenosine triphosphate <> Hydrogen ion + ADP + Phosphoenolpyruvic acid
Water + Pyruvic acid + Adenosine triphosphate > Hydrogen ion + Phosphate + Phosphoenolpyruvic acid + Adenosine monophosphate
3-Phosphoglycerate + NAD <> Hydrogen ion + Phosphohydroxypyruvic acid + NADH
Water + NAD + Phenylacetaldehyde <> Hydrogen ion + NADH + phenylacetate
cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD > Hydrogen ion + 3-(2,3-Dihydroxyphenyl)propionic acid + NADH
a CDP-diacylglycerol + Glycerol 3-phosphate <> Cytidine monophosphate + an L-1-phosphatidylglycerol-phosphate + Hydrogen ion
an L-1-phosphatidylserine + Hydrogen ion > PE(14:0/14:0) + Carbon dioxide
a CDP-diacylglycerol + L-Serine <> Cytidine monophosphate + an L-1-phosphatidylserine + Hydrogen ion
Oxygen + Water + Pyridoxamine 5'-phosphate > Hydrogen ion + Hydrogen peroxide + Ammonia + Pyridoxal 5'-phosphate
Adenosine triphosphate + Pyridoxine > Hydrogen ion + ADP + Pyridoxine 5'-phosphate
5-Aminolevulinic acid <> Hydrogen ion + Water + Porphobilinogen
Guanosine 3',5'-bis(diphosphate) + Water > Hydrogen ion + Pyrophosphate + Guanosine diphosphate
Water + Guanosine 3'-diphosphate 5'-triphosphate > Hydrogen ion + Phosphate + Guanosine 3',5'-bis(diphosphate)
Hydrogen ion + Prephenate > Phenylpyruvic acid + Water + Carbon dioxide
Adenosine triphosphate + Hydrogen carbonate + Propionyl-CoA > Hydrogen ion + ADP + Phosphate + (S)-Methylmalonyl-CoA
Iron + Protoporphyrin IX > Heme + Hydrogen ion
Adenosine triphosphate + D-Ribose-5-phosphate <> Hydrogen ion + Phosphoribosyl pyrophosphate + Adenosine monophosphate
Pseudouridine + Adenosine triphosphate > Hydrogen ion + Pseudouridine 5'-phosphate + ADP
Adenosine triphosphate + Pyridoxamine <> Hydrogen ion + ADP + Pyridoxamine 5'-phosphate
+ Water Hydrogen ion + Pyrazinic acid + Ammonia
Adenosine triphosphate + Pyridoxal > Hydrogen ion + ADP + Pyridoxal 5'-phosphate
5-Aminoimidazole ribonucleotide + S-Adenosylmethionine 4-Amino-2-methyl-5-phosphomethylpyrimidine + 5'-Deoxyadenosine + L-Methionine + Formic acid + carbon monoxide + Hydrogen ion
L-D-1-Pyrroline-5-carboxylic acid + NAD + Water > Hydrogen ion + L-Glutamate + NADH
NAD(P)<sup>+</sup> + L-Proline < NAD(P)H + L-D-1-Pyrroline-5-carboxylic acid + Hydrogen ion
Hydrogen ion + Pyruvic acid + Lipoamide S-Acetyldihydrolipoamide + Carbon dioxide
Nicotinamide ribotide + Pyrophosphate + Carbon dioxide < Phosphoribosyl pyrophosphate + Quinolinic acid + Hydrogen ion
NAD(P)<sup>+</sup> + (S)-Ureidoglycolic acid > NAD(P)H + Oxalureate + Hydrogen ion
NADH + Copper Hydrogen ion + NAD + Cu<SUP>+</SUP>
an alcohol + Water + NAD < an organic hydroperoxide + NADH + Hydrogen ion
Cyanate + Hydrogen carbonate + Hydrogen ion > Carbamic acid + Carbon dioxide
NAD(P)H + Nitric oxide + Oxygen > NAD(P)<sup>+</sup> + Nitrate + Hydrogen ion
L-Rhamnulose + Adenosine triphosphate > Hydrogen ion + L-Rhamnulose 1-phosphate + ADP
Hydrogen ion + 6,7-Dimethyl-8-(1-D-ribityl)lumazine > 5-amino-6-(D-ribitylamino)uracil + Riboflavin
Riboflavin + Adenosine triphosphate > Hydrogen ion + Flavin Mononucleotide + ADP
5-Amino-6-(5'-phosphoribitylamino)uracil + NADP < 5-Amino-6-(5'-phosphoribosylamino)uracil + NADPH + Hydrogen ion
D-ribose + Adenosine triphosphate > Hydrogen ion + D-Ribose-5-phosphate + ADP
Nicotinamide riboside + Adenosine triphosphate > Hydrogen ion + Nicotinamide ribotide + ADP
3-Hydroxycinnamic acid + Oxygen + NADH + Hydrogen ion > Trans-2,3-Dihydroxycinnamate + Water + NAD
Adenosine triphosphate + Water > Hydrogen ion + ADP + Phosphate
L-Tyrosine + S-Adenosylmethionine + a reduced electron acceptor > Dehydroglycine + p-Cresol + 5'-Deoxyadenosine + L-Methionine + an oxidized electron acceptor + Hydrogen ion
8-oxo-dGTP + Water > Hydrogen ion + 8-oxo-dGMP + Pyrophosphate
L-Alanine + Hydrogen ion + Pimeloyl-ACPs > 8-Amino-7-oxononanoate + Carbon dioxide + ACP
2-Hydroxy-6-ketononatrienedioate + Water > 2-Hydroxy-2,4-pentadienoate + Fumaric acid + Hydrogen ion
cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD > Trans-2,3-Dihydroxycinnamate + NADH + Hydrogen ion
trans-Cinnamic acid + NADH + Oxygen + Hydrogen ion > cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD
Trans-2,3-Dihydroxycinnamate + Oxygen > 2-Hydroxy-6-ketononatrienedioate + Hydrogen ion
2,5-Diketo-D-gluconate + NAD(P)H + Hydrogen ion > 2-keto-L-gulonate + NAD(P)<sup>+</sup>
2-keto-L-gulonate + NAD(P)H + Hydrogen ion > L-Idonate + NAD(P)<sup>+</sup>
Uridine 5'-diphosphate + Water > Phosphate + Uridine 5'-monophosphate + Hydrogen ion
CDP + Water > Phosphate + Cytidine monophosphate + Hydrogen ion
a methylated nucleobase within DNA + Oxygen + Oxoglutaric acid Hydrogen ion + a nucleobase within DNA + Carbon dioxide + Formaldehyde + Succinic acid
Ascorbic acid + Hydrogen peroxide + Hydrogen ion > Ascorbic acid + L-dehydro-ascorbate + Water
FMNH + NADP < Flavin Mononucleotide + NADPH + Hydrogen ion
Reduced riboflavin + NAD(P)<sup>+</sup> Riboflavin + NAD(P)H + Hydrogen ion
Hydrogen ion + Pyruvic acid + Thiamine pyrophosphate > 2-(a-Hydroxyethyl)thiamine diphosphate + Carbon dioxide
L-Cysteine + a sulfur acceptor + Hydrogen ion L-Alanine + <i>S</i>-sulfanyl-[acceptor]
2-[(2<i>R</i>,5<i>Z</i>)-(2-carboxy-4-methylthiazol-5(2<i>H</i>)-ylidene]ethyl phosphate + 2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate + Hydrogen ion > Thiamine monophosphate + Carbon dioxide + Pyrophosphate
Thymine + Oxygen + FMNH > (<i>Z</i>)-2-methylureidoacrylate peracid + Flavin Mononucleotide + Hydrogen ion
(<i>Z</i>)-2-methylureidoacrylate peracid + Water > (<i>Z</i>)-2-methyl-peroxyaminoacrylate + Carbamic acid + Hydrogen ion
(<i>S</i>)-NADPHX + ADP NADPH + Adenosine monophosphate + Phosphate + Hydrogen ion
Adenosine triphosphate + Hydrogen carbonate + Ammonia > ADP + Phosphate + Carbamoylphosphate + Hydrogen ion
Isethionic acid + FMNH + Oxygen > Glycolaldehyde + Sulfite + Water + Flavin Mononucleotide + Hydrogen ion
NAD(P)<sup>+</sup> + S-(Hydroxymethyl)glutathione <> NAD(P)H + S-Formylglutathione + Hydrogen ion
Hydrogen ion + Tetrahydrodipicolinate + Water > L-&alpha;-amino-&epsilon;-keto-pimelate
Hypoxanthine + NAD + Water > Xanthine + NADH + Hydrogen ion
NAD(P)<sup>+</sup> + Quinate NAD(P)H + 3-Dehydroquinate + Hydrogen ion
NAD(P)<sup>+</sup> + Shikimic acid < NAD(P)H + 3-Dehydro-shikimate + Hydrogen ion
L-Proline + an oxidized electron acceptor > L-D-1-Pyrroline-5-carboxylic acid + a reduced electron acceptor + Hydrogen ion
Hydrogen ion + Molybdopterin + Adenosine triphosphate > Adenylated molybdopterin + Pyrophosphate
Lactaldehyde + NADP < Pyruvaldehyde + NADPH + Hydrogen ion
a quaternary amine + Water + Adenosine triphosphate > a quaternary amine + Phosphate + ADP + Hydrogen ion
Oxalosuccinic acid + Hydrogen ion > Oxoglutaric acid + Carbon dioxide
2-hydroxyglutarate + NAD <> Hydrogen ion + Oxoglutaric acid + NADH
Hydrogen ion + Lipoic acid + Adenosine triphosphate > Lipoyl-AMP + Pyrophosphate
3-Hydroxypropanoate + NADP < Malonic semialdehyde + NADPH + Hydrogen ion
1,4-Dihydroxy-2-naphthoyl-CoA + Water > Hydrogen ion + 1,4-Dihydroxy-2-naphthoic acid + Coenzyme A
L-Aspartic acid + Fumaric acid > Hydrogen ion + Iminoaspartic acid + Succinic acid
Isocitric acid + NADP > Oxalosuccinic acid + NADPH + Hydrogen ion
Adenosine triphosphate + Water > Hydrogen ion + ADP + Phosphate
Glutathione + Adenosine triphosphate + Water > Glutathione + ADP + Phosphate + Hydrogen ion
Adenosine diphosphate ribose + Water > Hydrogen ion + Adenosine monophosphate + D-Ribose-5-phosphate
Coproporphyrinogen III + Oxygen + Hydrogen ion > Protoporphyrinogen IX + Carbon dioxide + Water
Iron + Hydrogen ion + Oxygen > Fe<SUP>3+</SUP> + Water
2'-Deoxyinosine triphosphate + Water > Hydrogen ion + DIMP + Pyrophosphate
Xanthosine 5-triphosphate + Water > Hydrogen ion + Xanthylic acid + Pyrophosphate
Uridine 5''-diphospho-{beta}-4-deoxy-4-amino-L-arabinose + N10-Formyl-THF > Hydrogen ion + Uridine 5''-diphospho-{beta}-4-deoxy-4-formamido-L-arabinose + Tetrahydrofolic acid
Hydrogen ion + Ethyl-2-methylacetoacetate + NADPH <> Ethyl-(2R)-methyl-(3S)-hydroxybutanoate + NADP
Phenylacetyl-CoA + Oxygen + NADPH + Hydrogen ion > 2-(1,2-epoxy-1,2-dihydrophenyl)acetyl-CoA + NADP + Water
3-Hydroxyadipyl-CoA + NAD <> Hydrogen ion + 3-Oxoadipyl-CoA + NADH
L-Serine + NADP 2-Aminomalonate semialdehyde + NADPH + Hydrogen ion
UDP-N-Acetylmuraminate + L-Ala-D-Glu-meso-A2pm + Adenosine triphosphate > Hydrogen ion + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate + ADP + Phosphate
Hydrogen ion + molybdenum cofactor + Guanosine triphosphate <> Molybdopterin guanine dinucleotide + Pyrophosphate
NADPH + Hydrogen ion + an electron-transfer-related quinone > NADP + an electron-transfer-related quinol
3-Sulfinoalanine + Water Hydrogen ion + L-Alanine + Sulfite
an alkanesulfonate + Oxygen + FMNH > an aldehyde + Sulfite + Water + Flavin Mononucleotide + Hydrogen ion
Cu<SUP>+</SUP> + Hydrogen ion + Oxygen > Copper + Water
Taurine + Oxoglutaric acid + Oxygen > Hydrogen ion + Aminoacetaldehyde + Sulfite + Succinic acid + Carbon dioxide
L-Cysteine + Adenosine triphosphate + Water > L-Cysteine + ADP + Phosphate + Hydrogen ion
Glyceric acid + NADP <> Hydrogen ion + Hydroxypyruvic acid + NADPH
Hydrogen ion + R-Methylmalonyl-CoA > Propionyl-CoA + Carbon dioxide
Formic acid + an oxidized electron acceptor + Hydrogen ion > Carbon dioxide + a reduced electron acceptor
a menaquinol + Nitrate + Hydrogen ion > a menaquinone + Nitrite + Water + Hydrogen ion
a menaquinol + Nitrate + Hydrogen ion > a menaquinone + Nitrite + Water + Hydrogen ion
Adenosine triphosphate + 1-Deoxy-D-xylulose > Hydrogen ion + 1-Deoxy-D-xylulose 5-phosphate + ADP
Cytidine triphosphate + Water > Hydrogen ion + Cytidine monophosphate + Pyrophosphate
dATP + Water > Hydrogen ion + Deoxyadenosine monophosphate + Pyrophosphate
dGTP + Water > Hydrogen ion + 2'-Deoxyguanosine 5'-monophosphate + Pyrophosphate
Putrescine + L-Glutamate + Adenosine triphosphate > Hydrogen ion + gamma-Glutamyl-L-putrescine + ADP + Phosphate
NAD(P)<sup>+</sup> + gamma-Glutamyl-gamma-butyraldehyde + Water > 4-(Glutamylamino) butanoate + NAD(P)H + Hydrogen ion
Acetaldehyde + NADP + Water > Acetic acid + NADPH + Hydrogen ion
preQ<sub>1</sub> + NADP < 7-Cyano-7-carbaguanine + NADPH + Hydrogen ion
cyclic di-3',5'-guanylate + Water > Hydrogen ion + Linear dimeric GMP
Hydrogen ion + Pyruvaldehyde + NADPH > acetol + NADP
D-Glycero-D-manno-heptose 7-phosphate + Adenosine triphosphate > Hydrogen ion + D-Glycero-D-manno-heptose 1,7-bisphosphate + ADP
Hydrogen ion + D-<i>glycero</i>-&beta;-D-<i>manno</i>-heptose 1-phosphate + Adenosine triphosphate > ADP-D-Glycero-D-manno-heptose + Pyrophosphate
NADH + Water > Hydrogen ion + NMNH + Adenosine monophosphate
Water + Adenosine triphosphate + L-Methionine > Phosphate + ADP + L-Methionine + Hydrogen ion
1,6-Anhydro-N-acetylmuramate + Adenosine triphosphate + Water > Hydrogen ion + N-Acetylmuramic acid 6-phosphate + ADP
Cyclic AMP + Water > Hydrogen ion + Adenosine monophosphate
Heptosyl-KDO2-lipid A + ADP-L-Glycero-D-manno-heptose > Hydrogen ion + Heptosyl2-KDO2-lipid A + ADP
N-6-isopentyl adenosine-37 tRNA + S-Adenosylmethionine + <i>S</i>-sulfanyl-[acceptor] 2-methylthio-N-6-isopentyl adenosine-37 tRNA + S-Adenosylhomocysteine + L-Methionine + 5'-Deoxyadenosine + an unsulfurated sulfur acceptor + Hydrogen ion
Inosine triphosphate + Water > Hydrogen ion + IDP + Phosphate
Xanthosine 5-triphosphate + Water > Hydrogen ion + XDP + Phosphate
Hydrogen ion + <i>N</i>-ethylmaleimide N-Ethylsuccinimide
Thymidine 5'-triphosphate + Water > Hydrogen ion + 5-Thymidylic acid + Pyrophosphate
L-Ribulose + Adenosine triphosphate > Hydrogen ion + L-Ribulose 5-phosphate + ADP
Hydrogen ion + KDO2-Lipid A + ADP-L-Glycero-D-manno-heptose > Heptosyl-KDO2-lipid A + ADP
UDP-Glucose + Heptosyl2-KDO2-lipid A > Hydrogen ion + Glucosyl-heptosyl2-KDO2-lipid A + Uridine 5'-diphosphate
Glucosyl-heptosyl2-KDO2-lipid A + Adenosine triphosphate > Hydrogen ion + Glucosyl-heptosyl2-KDO2-lipid A-phosphate + ADP
Glucosyl-heptosyl2-KDO2-lipid A-phosphate + ADP-L-Glycero-D-manno-heptose > Hydrogen ion + Glucosyl-heptosyl3-KDO2-lipid A-phosphate + ADP
Glucosyl-heptosyl3-KDO2-lipid A-phosphate + Adenosine triphosphate > Hydrogen ion + Glucosyl-heptosyl3-KDO2-lipid A-bisphosphate + ADP
Glucosyl-heptosyl3-KDO2-lipid A-bisphosphate + Uridine diphosphategalactose > Hydrogen ion + Galactosyl-glucosyl-heptosyl3-KDO2-lipid A-bisphosphate + Uridine 5'-diphosphate
UDP-Glucose + Galactosyl-glucosyl-heptosyl3-KDO2-lipid A-bisphosphate > Hydrogen ion + Galactosyl-glucosyl2-heptosyl3-KDO2-lipid A-bisphosphate + Uridine 5'-diphosphate
UDP-Glucose + Galactosyl-glucosyl2-heptosyl3-KDO2-lipid A-bisphosphate > Hydrogen ion + Galactosyl-glucosyl3-heptosyl3-KDO2-lipid A-bisphosphate + Uridine 5'-diphosphate
Galactosyl-glucosyl3-heptosyl3-KDO2-lipid A-bisphosphate + ADP-L-Glycero-D-manno-heptose > Hydrogen ion + Lipid A-core + ADP
Hydrogen ion + 4-nitrobenzaldehyde + NADPH 4-nitrobenzyl alcohol + NADP
an aminated amine donor + 2-Ketobutyric acid + Hydrogen ion 2-aminobutyrate + a deaminated amine donor
Zinc + Water + Adenosine triphosphate > Zinc + ADP + Phosphate + Hydrogen ion
Hydrogen ion + Adenosine triphosphate + Adenosine triphosphate Diadenosine tetraphosphate + Pyrophosphate
Hydrogen ion + Adenosine triphosphate + ADP > Diadenosine triphosphate + Pyrophosphate
octyl alpha-D-glucopyranoside + UDP-D-Galacto-1,4-furanose Hydrogen ion + octyl beta-1,6-D-galactofuranosyl-alpha-D-glucopyranoside + Uridine 5'-diphosphate
Hydrogen ion + Pyruvaldehyde + NADH acetol + NAD
Hydrogen carbonate + Hydrogen ion <> Carbon dioxide + Water
a menaquinone + Hydrogen ion + Hydrogen (gas) > a menaquinol + Hydrogen ion
a menaquinone + Hydrogen ion + Hydrogen (gas) > a menaquinol + Hydrogen ion
a menaquinol + Hydrogen ion + Trimethylamine N-Oxide > a menaquinone + Water + Trimethylamine
Oxygen + Hydrogen ion + a ubiquinol > a ubiquinone + Water + Hydrogen ion
Oxygen + Hydrogen ion + a ubiquinol > a ubiquinone + Water + Hydrogen ion
Oxygen + Hydrogen ion + a ubiquinol > a ubiquinone + Water + Hydrogen ion
Oxygen + Hydrogen ion + a ubiquinol > a ubiquinone + Water + Hydrogen ion
Pyruvic acid + Hydrogen ion > L-Lactic acid
Glyceric acid + NAD <> Hydrogen ion + Tartronate semialdehyde + NADH
Hydrogen ion + Thiamine pyrophosphate + ADP <> adenosine thiamine triphosphate + Phosphate
Ubiquinone-8 + Hydrogen ion > Ubiquinol-8
Hydrogen ion + a ubiquinone + NADH > a ubiquinol + NAD
Hydrogen ion + methyl red + NADH 2-Aminobenzoic acid + N,N'-dimethyl-p-phenylenediamine + NAD
methyl-1,4-benzoquinone + NADPH + Hydrogen ion methyl-1,4-benzoquinol + NADP
NADH + Hydrogen ion + a menaquinone > a menaquinol + NAD
3,5-Tetradecadienoyl-CoA + Water > Hydrogen ion + 3,5-tetradecadienoate + Coenzyme A
N-Acetylmuramoyl-L-alanyl-D-glutamyl-L-lysyl-D-alanyl-D-alanine-diphosphoundecaprenyl-N-acetylglucosamine > Hydrogen ion + a peptidoglycan dimer (<I>meso</I>-diaminopimelate containing) + Undecaprenyl diphosphate
Glycerol 3-phosphate + NADP < Hydrogen ion + L-Glyceraldehyde 3-phosphate + NADPH
3-hydroxypropionaldehyde + NAD + Water > Hydrogen ion + 3-Hydroxypropanoate + NADH
Guanosine triphosphate + Water > Hydrogen ion + Guanosine diphosphate + Phosphate
Dihydroneopterin triphosphate + Water > Hydrogen ion + 6-Carboxy-5,6,7,8-tetrahydropterin + Triphosphate + Acetaldehyde
Cytidine triphosphate + a 2,3,4-saturated L-phosphatidate + Hydrogen ion > Pyrophosphate + a CDP-2,3,4-saturated-diacylglycerol
Hydrogen ion + molybdenum cofactor + Cytidine triphosphate > Molybdopterin cytosine dinucleotide + Pyrophosphate
<i>S</i>-sulfanyl-[acceptor] + Hydrogen cyanide an unsulfurated sulfur acceptor + Thiocyanate + Hydrogen ion
Tetrahydromonapterin + NADP < Hydrogen ion + 7,8-Dihydroneopterin + NADPH
Nitrate + Hydrogen ion > Nitrite + Water
Gluconolactone + Hydrogen ion <> b-D-Glucose
Acetic acid + Carbon dioxide + Hydrogen ion <> Pyruvic acid + Water
NAD(P)H + Nitrite + Hydrogen ion > NAD(P)<sup>+</sup> + Ammonium + Water
Inosine triphosphate + Water > Hydrogen ion + Inosinic acid + Pyrophosphate
Guanosine 3'-diphosphate 5'-triphosphate + Water > Hydrogen ion + Guanosine triphosphate + Pyrophosphate
Uracil + Oxygen + FMNH > Hydrogen ion + Ureidoacrylate peracid + Flavin Mononucleotide
Ureidoacrylate peracid + Water > Hydrogen ion + Carbamic acid + Peroxyaminoacrylate
3-hydroxypropionaldehyde + NADPH + Hydrogen ion 1,3-propanediol + NADP
2-Oxepin-2(3H)-ylideneacetyl-CoA + NADP + Water > 3-Oxo-5,6-dehydrosuberyl-CoA + NADPH + Hydrogen ion
Iron + a siderophore + NADP < an Fe(III)-siderophore + NADPH + Hydrogen ion
4-Hydroxy-L-threonine + Adenosine triphosphate > Hydrogen ion + O-Phospho-4-hydroxy-L-threonine + ADP
Dihydrothymine + NAD <> Thymine + NADH + Hydrogen ion
6-Carboxy-5,6,7,8-tetrahydropterin + S-Adenosylmethionine + Hydrogen ion > 7-carboxy-7-deazaguanine + 5'-Deoxyadenosine + L-Methionine + Ammonia
PE(14:0/14:0) + Water a fatty acid + a 2-lyso-phosphatidyl-ethanolamine + Hydrogen ion
(<i>S</i>)-NADHX + ADP > Hydrogen ion + NADH + Adenosine monophosphate + Phosphate
a guanine<sup>1516</sup> in 16S rRNA + S-Adenosylmethionine > an <i>N</i><sup>2</sup>-methylguanine<sup>1516</sup> in 16S rRNA + S-Adenosylhomocysteine + Hydrogen ion
Iron + (2,3-dihydroxybenzoylserine)<sub>3</sub> + NADP < ferric 2,3-dihydroxybenzoylserine + NADPH + Hydrogen ion
PE(14:0/14:0) + Water > a 1-lyso-2-acyl-<i>sn</i>-glycero-3-phosphoethanolamine + a fatty acid + Hydrogen ion
Butanesulfonate + Oxygen + FMNH > Butanal + Sulfite + Water + Flavin Mononucleotide + Hydrogen ion
3-Dehydro-L-gulonate + NAD < Hydrogen ion + 2,3-Diketo-L-gulonate + NADH
Hydrogen ion + 3-Dehydro-L-gulonate 6-phosphate > L-Xylulose 5-phosphate + Carbon dioxide
5-Aminoimidazole ribonucleotide + Adenosine triphosphate + Hydrogen carbonate > Hydrogen ion + N5-Carboxyaminoimidazole ribonucleotide + ADP + Phosphate
1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + Water + Oxidized-ferredoxins < 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate + Hydrogen ion + Reduced-ferredoxins
NAD(P)<sup>+</sup> + Dimethylallylpyrophosphate + Water < NAD(P)H + Hydrogen ion + 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate
Xanthine + NAD + Water > Uric acid + NADH + Hydrogen ion
N1-Methyladenine + Oxygen + Oxoglutaric acid > Hydrogen ion + Adenine + Carbon dioxide + Formaldehyde + Succinic acid
N3-Methylcytosine + Oxygen + Oxoglutaric acid > Hydrogen ion + Cytosine + Carbon dioxide + Formaldehyde + Succinic acid
3-oxo-5,6-dehydrosuberyl-CoA semialdehyde + NADP + Water > 3-Oxo-5,6-dehydrosuberyl-CoA + NADPH + Hydrogen ion
S-Formylglutathione + Water > Hydrogen ion + Formic acid + Glutathione
Adenosine triphosphate + 5-Amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylate + L-Aspartic acid > Hydrogen ion + ADP + Phosphate + SAICAR
Hydrogen ion + S-Adenosylmethionine > Carbon dioxide + S-Adenosylmethioninamine
a reduced electron acceptor + Selenocysteine <> L-Alanine + Selenium + an oxidized electron acceptor + Hydrogen ion
NADP + Shikimic acid < Hydrogen ion + NADPH + 3-Dehydro-shikimate
Shikimic acid + Adenosine triphosphate > Hydrogen ion + Shikimate 3-phosphate + ADP
Sirohydrochlorin + Iron <> Hydrogen ion + Siroheme
Sorbitol-6-phosphate + NAD <> Hydrogen ion + Fructose 6-phosphate + NADH
Acetyl-CoA + Spermidine <> N1-Acetylspermidine + Hydrogen ion + Coenzyme A
Putrescine + S-Adenosylmethioninamine > Hydrogen ion + Spermidine + 5'-Methylthioadenosine
N2-Succinyl-L-glutamic acid 5-semialdehyde + NAD + Water > N<SUP>2</SUP>-succinylglutamate + NADH + Hydrogen ion
Water + NAD + Succinic acid semialdehyde > Hydrogen ion + NADH + Succinic acid
Succinic acid semialdehyde + NADP + Water > Succinic acid + NADPH + Hydrogen ion
Hydrogen ion + Sulfate + Adenosine triphosphate > Adenosine phosphosulfate + Pyrophosphate
Water + NADP + Hydrogen sulfide < Hydrogen ion + NADPH + Sulfite
Hydrogen ion + Superoxide anion > Hydrogen peroxide + Oxygen
D-Tagatose 6-phosphate + Adenosine triphosphate > Hydrogen ion + D-Tagatose 1,6-bisphosphate + ADP
dTDP-D-Fucosamine + Acetyl-CoA > Hydrogen ion + dTDP-4-Acetamido-4,6-dideoxy-D-galactose + Coenzyme A
2,3,2',3'-Tetrakis(3-hydroxytetradecanoyl)-D-glucosaminyl-1,6-beta-D-glucosamine 1-phosphate + Adenosine triphosphate <> Hydrogen ion + lipid IV<sub>A</sub> + ADP
Hydrogen ion + 4-Methyl-5-(2-phosphoethyl)-thiazole + 2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate > Thiamine monophosphate + Pyrophosphate
Adenosine triphosphate + 5-(2-Hydroxyethyl)-4-methylthiazole > Hydrogen ion + ADP + 4-Methyl-5-(2-phosphoethyl)-thiazole
Thiamine + Adenosine triphosphate > Hydrogen ion + Thiamine monophosphate + ADP
a 2,3,4-saturated fatty acyl CoA + Water a 2,3,4-saturated fatty acid + Coenzyme A + Hydrogen ion
Hydrogen cyanide + Thiosulfate > Hydrogen ion + Thiocyanate + Sulfite
L-Threonine > Hydrogen ion + 2-Ketobutyric acid + Ammonia
L-Threonine + NAD > Hydrogen ion + L-2-Amino-3-oxobutanoic acid + NADH
Thymidine + Adenosine triphosphate > Hydrogen ion + 5-Thymidylic acid + ADP
Trimethylamine N-Oxide + NADH + Hydrogen ion > Trimethylamine + NAD + Water
Potassium + Water + Adenosine triphosphate > Potassium + Phosphate + ADP + Hydrogen ion
Magnesium + Water + Adenosine triphosphate > Magnesium + Phosphate + ADP + Hydrogen ion
Adenosine triphosphate + Arsenate + Water > ADP + Arsenate + Phosphate + Hydrogen ion
Heme + Adenosine triphosphate + Water > Phosphate + ADP + Heme + Hydrogen ion
Water + Adenosine triphosphate + D-Methionine > Phosphate + ADP + D-Methionine + Hydrogen ion
Cu<SUP>+</SUP> + Water + Adenosine triphosphate > Cu<SUP>+</SUP> + Phosphate + ADP + Hydrogen ion
Adenosine triphosphate + Water + N-Acetyl-D-glucosamine > N-Acetyl-D-glucosamine + ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + L-Aspartic acid + Water > L-Aspartic acid + ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + L-Ala-D-Glu-meso-A2pm + Water > L-Ala-D-Glu-meso-A2pm + ADP + Phosphate + Hydrogen ion
(2R,4S)-2-Methyl-2,3,3,4-tetrahydroxytetrahydrofuran + Adenosine triphosphate + Water > (2R,4S)-2-Methyl-2,3,3,4-tetrahydroxytetrahydrofuran + ADP + Phosphate + Hydrogen ion
Glycerol 2-phosphate + Water + Adenosine triphosphate > Glycerol 2-phosphate + ADP + Hydrogen ion + Phosphate
selenate + Water + Adenosine triphosphate > selenate + ADP + Phosphate + Hydrogen ion
Selenite + Water + Adenosine triphosphate > Selenite + ADP + Phosphate + Hydrogen ion
&alpha;-D-galactofuranose + Adenosine triphosphate + Water > &alpha;-D-galactofuranose + Phosphate + ADP + Hydrogen ion
Maltotriose + Adenosine triphosphate + Water > ADP + Phosphate + Maltotriose + Hydrogen ion
Maltotetraose + Adenosine triphosphate + Water > ADP + Maltotetraose + Phosphate + Hydrogen ion
a 2,3,4-saturated fatty acyl CoA + NADP > a <i>trans</i>-2-enoyl-CoA + NADPH + Hydrogen ion
UDP-Glucose + &alpha;-D-glucose 6-phosphate > Hydrogen ion + Uridine 5'-diphosphate + Trehalose 6-phosphate
L-Tryptophan + Water <> Hydrogen ion + Indole + Pyruvic acid + Ammonia
NAD(P)<sup>+</sup> + Glyceric acid < NAD(P)H + Tartronate semialdehyde + Hydrogen ion
L-Alanine + UDP-N-Acetylmuraminate + Adenosine triphosphate <> Hydrogen ion + UDP-N-Acetylmuramoyl-L-alanine + Phosphate + ADP
D-Glutamic acid + UDP-N-Acetylmuramoyl-L-alanine + Adenosine triphosphate > Hydrogen ion + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamate + Phosphate + ADP
D-Alanyl-D-alanine + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate + Adenosine triphosphate > Hydrogen ion + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-6-carboxy-L-lysyl-D-alanyl-D-alanine + Phosphate + ADP
<i>meso</i>-diaminopimelate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamate + Adenosine triphosphate > Hydrogen ion + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate + Phosphate + ADP
Undecaprenyl-N-acetyl-alpha-D-glucosaminyl-pyrophosphate + UDP-N-Acetyl-D-mannosaminouronate <> Hydrogen ion + Undecaprenyl phosphate + Uridine 5'-diphosphate
UDP-N-Acetyl-D-mannosamine + NAD + Water <> UDP-N-Acetyl-D-mannosaminouronate + NADH + Hydrogen ion
NADP + UDP-N-Acetylmuraminate < Hydrogen ion + NADPH + UDP-N-Acetyl-3-(1-carboxyvinyl)-D-glucosamine
a UDP-sugar + Water > Uridine 5'-monophosphate + an &alpha;-D-aldose-1-phosphate + Hydrogen ion
UDP-Glucose + Water + NAD > Hydrogen ion + NADH + Uridine diphosphate glucuronic acid
Undecaprenyl diphosphate + Water > Hydrogen ion + Di-trans,poly-cis-undecaprenyl phosphate + Phosphate
Uridine + Guanosine triphosphate > Hydrogen ion + Uridine 5'-monophosphate + Guanosine diphosphate
Hydrogen ion + Uroporphyrinogen III > Carbon dioxide + Coproporphyrinogen III
<i>S</i>-ureidoglycine + Water > Hydrogen ion + Ammonia + (S)-Ureidoglycolic acid
D-Xylulose + Adenosine triphosphate > Hydrogen ion + Xylulose 5-phosphate + ADP
Hydrogen ion + 2,5-Diketo-D-gluconate + NADPH <> 5-Keto-D-gluconate + NADP
Hydrogen ion + 2-Dehydro-D-gluconate + NADPH <> L-Idonate + NADP
4 Iron + 4 Hydrogen ion + Oxygen >4 Fe3+ +2 Water
Cyanate + Carbonic acid + 2 Hydrogen ion > Ammonia +2 Carbon dioxide
Siroheme + 2 Hydrogen ion > Sirohydrochlorin + Iron
2 Iron + Hydrogen peroxide + 2 Hydrogen ion >2 Fe3+ +2 Water
2 reduced ferredoxin + NADP + Hydrogen ion >2 oxidized ferredoxin + NADPH
4 Iron + 4 Hydrogen ion + Oxygen >4 Fe3+ +2 Water
Coproporphyrinogen III + Oxygen + 2 Hydrogen ion > Protoporphyrinogen IX +2 Carbon dioxide +2 Water
Heme + 2 Hydrogen ion > Protoporphyrin IX + Iron
L-Lactic acid + 2 Ferricytochrome c > Pyruvic acid +2 Ferrocytochrome c +2 Hydrogen ion
Ammonia + 2 Water + 6 Ferricytochrome c > Nitrite +6 Ferrocytochrome c +7 Hydrogen ion
2 superoxide + 2 Hydrogen ion > Oxygen + Hydrogen peroxide
2 superoxide + 2 Hydrogen ion > Oxygen + Hydrogen peroxide
2 superoxide + 2 Hydrogen ion > Oxygen + Hydrogen peroxide
L-Tyrosine + S-adenosyl-L-methionine + reduced acceptor > 2-iminoacetate + p-Cresol + 5'-Deoxyadenosine + L-Methionine + acceptor +2 Hydrogen ion
Trimethylamine + 2 (ferricytochrome c)-subunit + Water > Trimethylamine N-Oxide +2 (ferrocytochrome c)-subunit +2 Hydrogen ion
Trimethylamine + 2 (ferricytochrome c)-subunit + Water > Trimethylamine N-Oxide +2 (ferrocytochrome c)-subunit +2 Hydrogen ion
Quercetin + Oxygen > 2-(3,4-dihydroxybenzoyloxy)-4,6-dihydroxybenzoate + CO + Hydrogen ion
2 Iron + 2 an apo-siderophore + NADP + Hydrogen ion >2 an Fe(III)-siderophore + NADPH
2 Hydrogen ion + 2 superoxide <> Oxygen + Hydrogen peroxide
Succinic acid semialdehyde + NAD + NADP + Water <> Succinic acid + NADH + NADPH +2 Hydrogen ion
Glyceric acid + NAD + NADP <> Tartronate semialdehyde + NADH + NADPH + Hydrogen ion
Protein dithiol + NAD + NADP <> Protein disulfide + NADH + NADPH + Hydrogen ion
Isopentenyl pyrophosphate + NAD + NADP + Water + Dimethylallylpyrophosphate <> 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH + NADPH + Hydrogen ion
Tetrahydrodipicolinate + NAD + NADP + Water <> (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate + NADH + NADPH + Hydrogen ion
Protein N6-(dihydrolipoyl)lysine + NAD <> Protein N6-(lipoyl)lysine + NADH + Hydrogen ion
NADP <> 2,5-Diketo-D-gluconate + NADPH + Hydrogen ion
Cyanate + Hydrogen carbonate + 2 Hydrogen ion + Carbamic acid <> Ammonia +2 Carbon dioxide
3-(3-Hydroxyphenyl)propanoic acid + NADH + Hydrogen ion + Oxygen + 3-Hydroxycinnamic acid <> 3-(2,3-Dihydroxyphenyl)propionic acid + Water + NAD + Trans-2,3-Dihydroxycinnamate
NADH + Hydrogen ion + Acceptor <> NAD + Reduced acceptor
L-Allothreonine + NADP + L-2-Amino-3-oxobutanoic acid <> Aminoacetone + Carbon dioxide + NADPH + Hydrogen ion
Quinate + NAD + NADP + Shikimic acid <> 3-Dehydroquinate + NADH + NADPH + Hydrogen ion + 3-Dehydro-shikimate
Tartaric acid + NAD <> 2-Hydroxy-3-oxosuccinate + NADH + Hydrogen ion
L-Histidinol + 2 NAD + Water <> L-Histidine +2 NADH +3 Hydrogen ion
Dihydrouracil + NAD + Dihydrothymine <> Uracil + NADH + Hydrogen ion + Thymine
NADH + Hydrogen ion + Oxygen + Hydrocinnamic acid <> cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD + Trans-2,3-Dihydroxycinnamate
cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD + cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol <> 3-(2,3-Dihydroxyphenyl)propionic acid + NADH + Hydrogen ion + Trans-2,3-Dihydroxycinnamate
NAD + Hydrogen ion <> NADH
Nitric oxide + 2 Oxygen + NADH + NADPH <>2 Nitrate + NAD + NADP + Hydrogen ion
Sorbitol 6-phosphate + NAD <> Fructose 6-phosphate + NADH + Hydrogen ion
7-Aminomethyl-7-carbaguanine + NADP <> 7-Cyano-7-carbaguanine + NADPH +2 Hydrogen ion
trans-2,3-Dehydroacyl-CoA + NADP <> trans,trans-2,3,4,5-Tetradehydroacyl-CoA + NADPH + Hydrogen ion
2 L-Glutamate + NADP + Ammonia + Water <> L-Glutamine + alpha-Ketoglutarate + NADPH + Hydrogen ion
3-Dehydro-L-gulonate + NAD + NADP <> 2,3-Diketo-L-gulonate + NADH + NADPH + Hydrogen ion
Mannitol 1-phosphate + NAD <> Fructose 6-phosphate + NADH + Hydrogen ion
(R)-2,3-Dihydroxy-isovalerate + NADP <> (S)-2-Acetolactate + NADPH + Hydrogen ion
5-Methyltetrahydrofolic acid + NAD + NADP <> 5,10-Methylene-THF + NADH + NADPH + Hydrogen ion
NAD + 2-Amino-3-oxo-4-phosphonooxybutyrate + O-Phospho-4-hydroxy-L-threonine <> 3-Amino-2-oxopropyl phosphate + Carbon dioxide + NADH + Hydrogen ion
3-Isopropylmalate + NAD + 2-Isopropyl-3-oxosuccinate <> Ketoleucine + Carbon dioxide + NADH + Hydrogen ion
S-(Hydroxymethyl)glutathione + NAD + NADP <> S-Formylglutathione + NADH + NADPH + Hydrogen ion
L-Proline + NAD + NADP <> (S)-1-pyrroline-5-carboxylate + NADH + NADPH + Hydrogen ion
Tetrahydropteridine + NAD + NADP <> 6,7-Dihydropteridine + NADH + NADPH + Hydrogen ion
NADH + NADPH + Hydrogen ion + Quinone <> NAD + NADP + Hydroquinone
Acyl-[acyl-carrier protein] + NAD <> trans-2,3-Dehydroacyl-[acyl-carrier protein] + NADH + Hydrogen ion
Primary alcohol + NAD + Secondary alcohol <> Aldehyde + NADH + Hydrogen ion + Ketone
L-Gulonate + NAD <> D-Fructuronate + NADH + Hydrogen ion
Cholic acid + NAD <> NADH + Hydrogen ion
Glucose 6-phosphate + NADP <> 6-Phosphonoglucono-D-lactone + NADPH + Hydrogen ion
NAD + Galactitol 1-phosphate <> L-Tagatose-6-phosphate + NADH + Hydrogen ion
(3S)-3-Hydroxyacyl-CoA + NAD <> 3-Oxoacyl-CoA + NADH + Hydrogen ion
(R)-Propane-1,2-diol + (S)-Propane-1,2-diol + NAD <> D-Lactaldehyde + (S)-Lactaldehyde + NADH + Hydrogen ion
2-Deoxygluconate + NAD <> 3-Dehydro-2-deoxy-D-gluconate + NADH + Hydrogen ion
3-Phospho-D-glycerate + NAD + D-2-Hydroxyglutaric acid <> Phosphohydroxypyruvic acid + NADH + Hydrogen ion + alpha-Ketoglutarate
NADP + Hydrogen ion <> NADPH
Glycerol 3-phosphate + NAD + NADP <> Dihydroxyacetone phosphate + NADH + NADPH + Hydrogen ion
4-Hydroxybutanoic acid + NAD <> Succinic acid semialdehyde + NADH + Hydrogen ion
Reduced ferredoxin + NADP + Hydrogen ion <> Oxidized ferredoxin + NADPH
L-Tyrosine + S-Adenosylmethionine + NADPH <> 2-iminoacetate + p-Cresol + 5'-Deoxyadenosine + L-Methionine + NADP + Hydrogen ion
NADPH + Hydrogen ion + 2 Quinone <> NADP +2 Semiquinone
Gluconic acid + NAD + NADP <> 5-Keto-D-gluconate + NADH + NADPH + Hydrogen ion
L-Idonate + NAD + NADP <> 5-Keto-D-gluconate + NADH + NADPH + Hydrogen ion
Alcohol + NADP <> Aldehyde + NADPH + Hydrogen ion
Propionyl-CoA + NADP <> Acrylyl-CoA + NADPH + Hydrogen ion
Isocitric acid + NADP + Oxalosuccinic acid <> alpha-Ketoglutarate + Carbon dioxide + NADPH + Hydrogen ion
Ammonia + NAD + 3 NADP + 2 Water <> Nitrite + NADH +3 NADPH +5 Hydrogen ion
(3R)-3-Hydroxyacyl-[acyl-carrier protein] + NADP <> 3-Oxoacyl-[acyl-carrier protein] + NADPH + Hydrogen ion
2-Dehydro-D-gluconate + NADP <> 2,5-Diketo-D-gluconate + NADPH + Hydrogen ion
(S)-Ureidoglycolic acid + NAD + NADP <> Oxalureate + NADH + NADPH + Hydrogen ion
O-Phospho-4-hydroxy-L-threonine + NAD > NADH + Hydrogen ion + 2-Amino-3-oxo-4-phosphonooxybutyrate
1-Deoxy-D-xylulose 5-phosphate + 2-Amino-3-phosphonopropionic acid + 1-Deoxy-D-xylulose 5-phosphate + 2-Amino-3-phosphonopropionic acid > Pyridoxine 5'-phosphate + Phosphate + Hydrogen ion +2 Water
D-Glyceraldehyde 3-phosphate + Pyruvic acid + Hydrogen ion + D-Glyceraldehyde 3-phosphate > 1-Deoxy-D-xylulose 5-phosphate + Carbon dioxide + 1-Deoxy-D-xylulose 5-phosphate
D-Glyceraldehyde 3-phosphate + Hydrogen ion + D-Glyceraldehyde 3-phosphate > Carbon dioxide + 1-Deoxy-D-xylulose 5-phosphate + 1-Deoxy-D-xylulose 5-phosphate
Pyridoxine + Adenosine triphosphate > Pyridoxine 5'-phosphate + Adenosine diphosphate + Hydrogen ion + ADP
4-amino-2-methyl-5-diphosphomethylpyrimidine + 2-((2R,5Z)-2-Carboxy-4-methylthiazol-5(2H)-ylidene)ethyl phosphate + 2 Hydrogen ion + 2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate > Thiamine monophosphate + Carbon dioxide + diphosphate + Thiamine monophosphate + Pyrophosphate
beta-D-Glucose 6-phosphate + NADP > 6-Phosphonoglucono-D-lactone + NADPH + Hydrogen ion + NADPH
6-Phosphonoglucono-D-lactone + Water > 6-Phosphogluconic acid + Hydrogen ion
Selenate + 2 Hydrogen ion + 2 Electron > Selenite + Water
Nitrite + 3 NADH + 5 Hydrogen ion + Nitrite Ammonia +2 Water +3 NAD
Nitrite + 6 ferrocytochrome c + 7 Hydrogen ion + Nitrite + 6 Ferrocytochrome c <> Ammonia +6 ferricytochrome c +2 Water +6 Ferricytochrome c
Hydrogen carbonate + Cyanate + Hydrogen ion + Cyanate > Carbamic acid
L-Glutamic acid + Adenosine triphosphate + Ammonium + L-Glutamate > L-Glutamine + Hydrogen ion + Adenosine diphosphate + Phosphate + ADP
Hydrogen ion + NADPH + Ammonia + NADPH <> Water + NADP + L-Glutamic acid + L-Glutamate
Oxoglutaric acid + NADPH + Ammonium + Hydrogen ion + NADPH > L-Glutamic acid + Water + NADP + L-Glutamate
2 L-Glutamic acid + NADP + 2 L-Glutamate > L-Glutamine + NADPH + Hydrogen ion + Oxoglutaric acid + NADPH
L-Glutamine + Oxoglutaric acid + NADPH + Hydrogen ion + NADPH >2 L-Glutamic acid + NADP +2 L-Glutamate
(3S)-3-hydroxyacyl-CoA + NAD > NADH + Hydrogen ion + a 3-oxoacyl-CoA 
3-Hydroxybutyryl-CoA + NAD + 3-Hydroxybutyryl-CoA > NADH + Hydrogen ion + Acetoacetyl-CoA + Acetoacetyl-CoA
(S)-Hydroxydecanoyl-CoA + NAD > NADH + Hydrogen ion + 3-Oxodecanoyl-CoA
(S)-Hydroxyhexanoyl-CoA + NAD > NADH + Hydrogen ion + 3-Oxohexanoyl-CoA
(S)-3-Hydroxydodecanoyl-CoA + NAD > NADH + Hydrogen ion + 3-Oxododecanoyl-CoA
(S)-3-Hydroxytetradecanoyl-CoA + NAD > NADH + Hydrogen ion + 3-Oxotetradecanoyl-CoA
(S)-Hydroxyoctanoyl-CoA + NAD + (S)-Hydroxyoctanoyl-CoA NADH + Hydrogen ion + 3-Oxooctanoyl-CoA
(S)-3-Hydroxyhexadecanoyl-CoA + NAD > NADH + Hydrogen ion + 3-Oxohexadecanoyl-CoA
(S)-3-Hydroxyoctadecanoyl-CoA + NAD > NADH + Hydrogen ion + 3-Oxooctadecanoyl-CoA + 3-Oxooctadecanoyl-CoA
2,3-dihydroxy-2,3-dihydrobenzoate + NAD > 2,3-Dihydroxybenzoic acid + NADH + Hydrogen ion
2,3-dihydroxy-2,3-dihydrobenzoate + NAD > 2-Pyrocatechuic acid + NADH + Hydrogen ion
a malonyl-[acp] + a malonyl-[acp] methyl ester + Hydrogen ion > Carbon dioxide + a holo-[acyl-carrier protein] + 3-Ketoglutaryl-[acp] methyl ester
3-Ketoglutaryl-[acp] methyl ester + NADPH + Hydrogen ion + NADPH > NADP + a 3R-hydroxyglutaryl-[acp] methyl ester
3-Ketopimeloyl-[acp] methyl ester + NADPH + Hydrogen ion + NADPH > NADP + 3-Hydroxypimeloyl-[acp] methyl ester
3-oxo-cis-Δ5-dodecenoyl-[acp]  + Hydrogen ion + NADPH + NADPH > 3R-hydroxy cis Δ9-hexadecenoyl-[acp] + NADP
a 3-oxo-cis-Δ7-tetradecenoyl-[acp]  + Hydrogen ion + NADPH + NADPH > a 3R-hydroxy cis Δ7-tetradecenoyl-[acp] + NADP
3-oxo-cis-Δ9-hexadecenoyl-[acp]  + Hydrogen ion + NADPH + NADPH > NADP + 3R-hydroxy cis Δ9-hexadecenoyl-[acp]
3-oxo-cis-vaccenoyl-[acp]  + Hydrogen ion + NADPH + NADPH > NADP + (R)-3-hydroxy-cis-vaccenoyl-[acp]
3-oxoacyl-[acp]  + Hydrogen ion + NADPH + NADPH > NADP + (3R)-3-hydroxyacyl-[acyl-carrier protein]
acetoacetyl-[acp] + Hydrogen ion + NADPH + NADPH > NADP + (R)-3-hydroxybutanoyl-[acp]
3-oxo-hexanoyl-[acp]  + Hydrogen ion + NADPH + NADPH > (R)-3-hydroxyhexanoyl-[acp] + NADP
3-oxo-octanoyl-[acp]  + Hydrogen ion + NADPH + NADPH > NADP + (R)-3-hydroxyoctanoyl-[acp]
3-oxo-decanoyl-[acp]  + Hydrogen ion + NADPH + NADPH > NADP + an (R)-3-hydroxydecanoyl-[acp] 
3-oxo-dodecanoyl-[acp]  + Hydrogen ion + NADPH + NADPH > NADP + (R)-3-hydroxydodecanoyl-[acp]
3-oxo-myristoyl-[acp]  + Hydrogen ion + NADPH + NADPH > NADP + (3R)-3-hydroxymyristoyl-[acp]
3-oxo-palmitoyl-[acp]  + Hydrogen ion + NADPH + NADPH > NADP + (R)-3-hydroxypalmitoyl-[acp]
3-oxo-cis-Δ5-dodecenoyl-[acp]  + Hydrogen ion + NADPH + NADPH > NADP + a (3R)-hydroxy cis Δ5-dodecenoyl-[acp]
Glutaryl-[acp] methyl ester + NADP < NADPH + Hydrogen ion + Enoylglutaryl-[acp] methyl ester + NADPH
NADPH + Hydrogen ion + an enoylpimeloyl-[acp] methyl ester + NADPH > NADP + a pimeloyl-[acp] methyl ester
trans-2-enoyl-[acyl-carrier protein] + Hydrogen ion + NADPH + NADPH > NADP + 2,3,4-saturated fatty acyl-[acp]
(S)-3-Hydroxyhexadecanoyl-CoA + NAD <> 3-Oxohexadecanoyl-CoA + NADH + Hydrogen ion
(S)-3-Hydroxytetradecanoyl-CoA + NAD <> 3-Oxotetradecanoyl-CoA + NADH + Hydrogen ion
(S)-3-Hydroxydodecanoyl-CoA + NAD <> 3-Oxododecanoyl-CoA + NADH + Hydrogen ion
(S)-Hydroxydecanoyl-CoA + NAD <> 3-Oxodecanoyl-CoA + Hydrogen ion + NADH
(S)-Hydroxyoctanoyl-CoA + NAD + (S)-Hydroxyoctanoyl-CoA <> 3-Oxooctanoyl-CoA + Hydrogen ion + NADH
(S)-Hydroxyhexanoyl-CoA + NAD <> 3-Oxohexanoyl-CoA + NADH + Hydrogen ion
3-Hydroxybutyryl-CoA + NAD + 3-Hydroxybutyryl-CoA <> Acetoacetyl-CoA + NADH + Hydrogen ion + Acetoacetyl-CoA
NAD + 3-Hydroxy-5-methylhex-4-enoyl-CoA > NADH + Hydrogen ion + 5-Methyl-3-oxo-4-hexenoyl-CoA
(3S)-3-Hydroxyadipyl-CoA + NAD > 3-Oxoadipyl-CoA + NADH + Hydrogen ion
Dethiobiotin + 2 S-adenosyl-L-methionine + 2 Hydrogen ion + a sulfurated [sulfur carrier] > Biotin +2 L-Methionine +2 5'-Deoxyadenosine
Octanoyl-[acyl-carrier protein] + a [lipoyl-carrier protein]-L-lysine > Hydrogen ion + a holo-[acyl-carrier protein] + Protein N6-(octanoyl)lysine
(R)-lipoic acid + Adenosine triphosphate + Hydrogen ion + Lipoic acid > Pyrophosphate + Lipoyl-AMP + Lipoyl-AMP
Lipoyl-AMP + a [lipoyl-carrier protein]-L-lysine + Lipoyl-AMP > Adenosine monophosphate + Hydrogen ion + Protein N6-(lipoyl)lysine
Caprylic acid + Adenosine triphosphate + a [lipoyl-carrier protein]-L-lysine > Hydrogen ion + Pyrophosphate + Adenosine monophosphate + Protein N6-(octanoyl)lysine
L-Aspartyl-4-phosphate + NADPH + Hydrogen ion + NADPH > Phosphate + NADP + L-Aspartate-semialdehyde
L-Aspartyl-4-phosphate + NADPH + Hydrogen ion + NADPH > Phosphate + NADP + L-Aspartate-semialdehyde
L-Aspartate-semialdehyde + Pyruvic acid > Hydrogen ion + Water + (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate
(2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + Hydrogen ion + NADPH + (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate + NADPH > Water + NADP + (S)-2,3,4,5-tetrahydrodipicolinate
Meso-2,6-Diaminoheptanedioate + Hydrogen ion > L-Lysine + Carbon dioxide + L-Lysine
L-Lysine + Hydrogen ion + L-Lysine > Cadaverine + Carbon dioxide
L-Lysine + Hydrogen ion + L-Lysine > Cadaverine + Carbon dioxide
Dihydrofolic acid + NADP + Dihydrofolic acid > Folic acid + NADPH + Hydrogen ion + NADPH
Dihydrofolic acid + NADPH + Hydrogen ion + Dihydrofolic acid + NADPH > Tetrahydrofolic acid + NADP + Tetrahydrofolic acid
7,8-dihydrofolate monoglutamate + Hydrogen ion + NADPH + Dihydrofolic acid + NADPH > NADP + Tetrahydrofolic acid + Tetrahydrofolic acid
Folic acid + 2 NADPH + 2 Hydrogen ion + 2 NADPH > Tetrahydrofolic acid +2 NADP + Tetrahydrofolic acid
5,10-Methylene-THF + NADPH + Hydrogen ion + 5,10-Methylene-THF + NADPH > 5-Methyltetrahydrofolic acid + NADP + 5-Methyltetrahydrofolic acid
N1-(5-phospho-β-D-ribosyl)glycinamide + Adenosine triphosphate + Formic acid > 5'-Phosphoribosyl-N-formylglycinamide + Adenosine diphosphate + Phosphate + Hydrogen ion + 5'-Phosphoribosyl-N-formylglycineamide + ADP
10-Formyltetrahydrofolate + Hydrogen ion <> 5,10-Methenyltetrahydrofolic acid + Water
L-Glutamic acid + Hydrogen ion + L-Glutamate > Carbon dioxide + 4-(Glutamylamino) butanoate
Taurine + Oxoglutaric acid + Oxygen > Sulfite + Succinic acid + Carbon dioxide + Hydrogen ion + Aminoacetaldehyde + Sulfite
Isocitric acid + NAD + Isocitric acid > Oxoglutaric acid + Carbon dioxide + NADH + Hydrogen ion
Oxoglutaric acid + NAD + Coenzyme A > Succinyl-CoA + NADH + Hydrogen ion + Carbon dioxide + Succinyl-CoA
L-Malic acid + NAD + L-Malic acid <> Oxalacetic acid + NADH + Hydrogen ion
Oxalacetic acid + Water + Acetyl-CoA > Citric acid + Coenzyme A + Hydrogen ion
L-Malic acid + NAD + L-Malic acid > Oxalacetic acid + NADH + Hydrogen ion
Fructose 6-phosphate + Adenosine triphosphate + Fructose 6-phosphate > Fructose 1,6-bisphosphate + Adenosine diphosphate + Hydrogen ion + Fructose 1,6-bisphosphate + ADP
D-Glyceraldehyde 3-phosphate + NAD + Phosphate + D-Glyceraldehyde 3-phosphate > Glyceric acid 1,3-biphosphate + NADH + Hydrogen ion + Glyceric acid 1,3-biphosphate
Glyceric acid 1,3-biphosphate + NADH + Hydrogen ion + Glyceric acid 1,3-biphosphate > NAD + Phosphate + D-Glyceraldehyde 3-phosphate + D-Glyceraldehyde 3-phosphate
Phosphoenolpyruvic acid + Adenosine monophosphate + Phosphate + 2 Hydrogen ion > Adenosine triphosphate + Water + Pyruvic acid
Water + Adenosine triphosphate + Pyruvic acid > Adenosine monophosphate + Phosphate +2 Hydrogen ion + Phosphoenolpyruvic acid
Phosphoenolpyruvic acid + Adenosine diphosphate + Hydrogen ion + ADP > Adenosine triphosphate + Pyruvic acid
L-Aspartic acid + Oxygen + L-Aspartic acid > Hydrogen peroxide + Hydrogen ion + Iminoaspartic acid
Inosinic acid + L-Aspartic acid + Guanosine triphosphate + L-Aspartic acid > Guanosine diphosphate + Phosphate +2 Hydrogen ion + N(6)-(1,2-dicarboxyethyl)AMP + Adenylsuccinic acid
L-Glutamic acid + Acetyl-CoA + L-Glutamate > Coenzyme A + Hydrogen ion + N-Acetylglutamic acid + N-Acetylglutamic acid
N-Acetyl-L-glutamyl 5-phosphate + NADPH + Hydrogen ion + NADPH > N-acetyl-L-glutamate + Phosphate + NADP
Ornithine + Carbamoylphosphate + Ornithine > Phosphate + Hydrogen ion + Citrulline
Hydrogen carbonate + Water + L-Glutamine + 2 Adenosine triphosphate >2 Adenosine diphosphate + Phosphate + L-Glutamic acid +2 Hydrogen ion + Carbamoylphosphate +2 ADP + L-Glutamate
L-Arginine + Succinyl-CoA + Succinyl-CoA > Coenzyme A + Hydrogen ion + N2-succinyl-L-arginine + N2-succinyl-L-arginine
N2-succinyl-L-arginine + 2 Water + 2 Hydrogen ion + N2-succinyl-L-arginine > Carbon dioxide +2 Ammonium + N2-Succinyl-L-ornithine
N2-Succinyl-L-glutamic acid 5-semialdehyde + Water + NAD >2 Hydrogen ion + NADH + N2-succinylglutamate + N2-succinylglutamate
L-Arginine + Hydrogen ion + Carbon dioxide > Agmatine
Putrescine + Adenosine triphosphate + L-Glutamic acid + L-Glutamate > Phosphate + Adenosine diphosphate + Hydrogen ion + gamma-Glutamyl-L-putrescine + ADP
4-(γ-glutamylamino)butanal + Water + NADP > 4-(Glutamylamino) butanoate +2 Hydrogen ion + NADPH + NADPH
4-Aminobutyraldehyde + Water + NAD > Hydrogen ion + NADH + gamma-Aminobutyric acid
Succinic acid semialdehyde + Water + NADP > NADPH +2 Hydrogen ion + Succinic acid + NADPH
Succinic acid semialdehyde + NAD + Water >2 Hydrogen ion + NADH + Succinic acid
Ornithine + Hydrogen ion + Ornithine > Putrescine + Carbon dioxide
3-Dehydro-L-gulonate + Adenosine triphosphate > 3-keto-L-gulonate 6-phosphate + Adenosine diphosphate + Hydrogen ion + 3-Keto-L-gulonate 6-phosphate + ADP
2,3-Diketo-L-gulonate + NADH + Hydrogen ion + 2,3-Diketo-L-gulonate > 3-Dehydro-L-gulonate + NAD
3-keto-L-gulonate 6-phosphate + Hydrogen ion + 3-Keto-L-gulonate 6-phosphate > Xylulose 5-phosphate + Carbon dioxide + Xylulose 5-phosphate
2,3-Diketo-L-gulonate + Hydrogen ion + 2,3-Diketo-L-gulonate > Carbon dioxide + Xylulose 5-phosphate + Xylulose 5-phosphate
3-keto-L-gulonate 6-phosphate + Hydrogen ion + 3-Keto-L-gulonate 6-phosphate > L-xylulose -5-phosphate + Carbon dioxide + L-Xylulose 5-phosphate
3-keto-L-gulonate 6-phosphate + Hydrogen ion + 3-Keto-L-gulonate 6-phosphate > Carbon dioxide + Xylulose 5-phosphate + Xylulose 5-phosphate
3-keto-L-gulonate 6-phosphate + Hydrogen ion + 3-Keto-L-gulonate 6-phosphate > Carbon dioxide + L-xylulose -5-phosphate + L-Xylulose 5-phosphate
3-keto-L-gulonate 6-phosphate + Hydrogen ion + 3-Keto-L-gulonate 6-phosphate > L-xylulose -5-phosphate + Carbon dioxide + L-Xylulose 5-phosphate
L-Glutamic acid 5-phosphate + Hydrogen ion + NADPH + NADPH > L-Glutamic-gamma-semialdehyde + NADP + Phosphate
1-Pyrroline-5-carboxylic acid + Hydrogen ion + NADPH + L-D-1-Pyrroline-5-carboxylic acid + NADPH > NADP + L-Proline + L-Proline
L-Proline + Ubiquinone-1 + L-Proline > Hydrogen ion + Ubiquinol-1 + 1-Pyrroline-5-carboxylic acid + L-D-1-Pyrroline-5-carboxylic acid
L-Glutamic-gamma-semialdehyde + NAD + Water >2 Hydrogen ion + NADH + L-Glutamic acid + L-Glutamate
Tartronate semialdehyde + Hydrogen ion + NADPH + NADPH > NADP + Glyceric acid
Glyceric acid + Adenosine triphosphate > Hydrogen ion + Adenosine diphosphate + 2-Phosphoglyceric acid + ADP + 2-Phosphoglyceric acid
Glyceric acid + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + 3-Phosphoglyceric acid + ADP + 3-Phosphoglycerate
cis-Δ3-decenoyl-ACP + Hydrogen ion + a malonyl-[acp] > Carbon dioxide + a holo-[acyl-carrier protein] + 3-oxo-cis-Δ5-dodecenoyl-[acp] 
cis-Δ5-dodecenoyl-[acp]  + Hydrogen ion + a malonyl-[acp] > a 3-oxo-cis-Δ7-tetradecenoyl-[acp]  + a holo-[acyl-carrier protein] + Carbon dioxide
trans-Δ3-cis-Δ7-tetradecenoyl-[acp] + Hydrogen ion + NADH > NAD + cis-Δ7-tetradecenoyl-[acp] 
cis-Δ7-tetradecenoyl-[acp]  + Hydrogen ion + a malonyl-[acp] > Carbon dioxide + a holo-[acyl-carrier protein] + 3-oxo-cis-Δ9-hexadecenoyl-[acp] 
2,3,4-saturated fatty acyl-[acp] + a malonyl-[acp] + Hydrogen ion > Carbon dioxide + a holo-[acyl-carrier protein] + 3-oxoacyl-[acp] 
butyryl-[acp] + Hydrogen ion + a malonyl-[acp] > a holo-[acyl-carrier protein] + Carbon dioxide + 3-oxo-hexanoyl-[acp] 
hexanoyl-[acyl-carrier-protein] + Hydrogen ion + a malonyl-[acp] > a holo-[acyl-carrier protein] + Carbon dioxide + 3-oxo-octanoyl-[acp] 
Octanoyl-[acyl-carrier protein] + Hydrogen ion + a malonyl-[acp] > a holo-[acyl-carrier protein] + 3-oxo-decanoyl-[acp]  + Carbon dioxide
dodecanoyl-[acp]  + Hydrogen ion + a malonyl-[acp] > a holo-[acyl-carrier protein] + Carbon dioxide + 3-oxo-myristoyl-[acp] 
trans tetradec-2-enoyl-[acp] + Hydrogen ion + NADH > NAD + myristoyl-[acp]
myristoyl-[acp] + Hydrogen ion + a malonyl-[acp] > a holo-[acyl-carrier protein] + Carbon dioxide + 3-oxo-palmitoyl-[acp] 
a malonyl-[acp] + Hydrogen ion > Carbon dioxide + an acetyl-[acp]
a malonyl-[acp] + Hydrogen ion + an acetyl-[acp] > Carbon dioxide + a holo-[acyl-carrier protein] + acetoacetyl-[acp]
trans-Δ3-cis-Δ5-dodecenoyl-[acp] + Hydrogen ion + NADH > cis-Δ5-dodecenoyl-[acp]  + NAD
trans-Δ3-cis-Δ7-tetradecenoyl-[acp] + Hydrogen ion + NADH > NAD + cis-Δ7-tetradecenoyl-[acp] 
trans-Δ3-cis-Δ9-hexadecenoyl-[acp] + Hydrogen ion + NADH > NAD + a palmitoleoyl-[acp] 
cis-vaccen-2-enoyl-[acp] + Hydrogen ion + NADH > NAD + a cis-vaccenoyl-[acp]
trans-2-enoyl-[acyl-carrier protein] + Hydrogen ion + NADH > NAD + 2,3,4-saturated fatty acyl-[acp]
crotonyl-[acp] + Hydrogen ion + NADH > NAD + butyryl-[acp]
trans hex-2-enoyl-[acp] + Hydrogen ion + NADH > NAD + hexanoyl-[acyl-carrier-protein]
trans oct-2-enoyl-[acp] + Hydrogen ion + NADH > NAD + Octanoyl-[acyl-carrier protein]
a trans-Δ2-decenoyl-[acp]  + Hydrogen ion + NADH > NAD + decanoyl-[acp]
trans dodec-2-enoyl-[acp] + Hydrogen ion + NADH > NAD + dodecanoyl-[acp] 
trans tetradec-2-enoyl-[acp] + Hydrogen ion + NADH > NAD + myristoyl-[acp]
Hydrogen ion + NADH + trans hexadecenoyl-[acp] > NAD + palmitoyl-[acp]
Water + a palmitoleoyl-[acp]  > a holo-[acyl-carrier protein] + Hydrogen ion + Hexadecenoate (n-C16:1)
a cis-vaccenoyl-[acp] + Water > Hydrogen ion + a holo-[acyl-carrier protein] + Vaccenic acid
a palmitoleoyl-[acp]  + a malonyl-[acp] + Hydrogen ion > a holo-[acyl-carrier protein] + Carbon dioxide + 3-oxo-cis-vaccenoyl-[acp] 
Acetyl-CoA + Hydrogen carbonate + Adenosine triphosphate > Adenosine diphosphate + Phosphate + Hydrogen ion + Malonyl-CoA + ADP + Malonyl-CoA
a malonyl-[acp] + Hydrogen ion + Acetyl-CoA > Carbon dioxide + Coenzyme A + acetoacetyl-[acp]
L-Arginine + tRNA(Arg) + Adenosine triphosphate + Hydrogen ion > Pyrophosphate + Adenosine monophosphate + L-arginyl-tRNA(Arg)
L-Cysteine + tRNA(Cys) + Adenosine triphosphate + Hydrogen ion > Pyrophosphate + Adenosine monophosphate + L-cysteinyl-tRNA(Cys)
L-Glutamic acid + Adenosine triphosphate + Hydrogen ion + tRNA(Glu) + L-Glutamate > Pyrophosphate + Adenosine monophosphate + L-glutamyl-tRNA(Glu)
8 L-Glutamic acid + 8 Hydrogen ion + 8 Adenosine triphosphate + 8 tRNA(Glu) + 8 L-Glutamate >8 Adenosine monophosphate +8 Pyrophosphate +8 L-glutamyl-tRNA(Glu)
L-Alanine + Adenosine triphosphate + Hydrogen ion + tRNA(Ala) + L-Alanine > Pyrophosphate + Adenosine monophosphate + L-alanyl-tRNA(Ala)
Glycine + Adenosine triphosphate + Hydrogen ion + tRNA(gly) > Adenosine monophosphate + Pyrophosphate + Glycyl-tRNA(Gly)
L-Threonine + Adenosine triphosphate + Hydrogen ion + tRNA(Thr) + L-Threonine > Pyrophosphate + Adenosine monophosphate + L-Threonyl-tRNA(Thr)
L-Serine + Adenosine triphosphate + Hydrogen ion + tRNA(Ser) + L-Serine > Adenosine monophosphate + Pyrophosphate + L-Seryl-tRNA(Ser)
L-Leucine + Adenosine triphosphate + Hydrogen ion + tRNA(Leu) > Adenosine monophosphate + Pyrophosphate + L-Leucyl-tRNA(Leu)
L-Valine + Adenosine triphosphate + Hydrogen ion + tRNA(Val) + L-Valine > Adenosine monophosphate + Pyrophosphate + L-Valyl-tRNA(Val)
L-Isoleucine + Adenosine triphosphate + Hydrogen ion + tRNA(Ile) + L-Isoleucine > L-Isoleucyl-tRNA(Ile) + Adenosine monophosphate + Pyrophosphate
L-Glutamine + Adenosine triphosphate + Hydrogen ion + tRNA(Gln) > Adenosine diphosphate + Pyrophosphate + L-Glutaminyl-tRNA(Gln) + ADP
L-Aspartic acid + Adenosine triphosphate + Hydrogen ion + tRNA(Asp) + L-Aspartic acid > Pyrophosphate + Adenosine monophosphate + L-aspartyl-tRNA(Asp)
L-Tyrosine + Adenosine triphosphate + Hydrogen ion + tRNA(Tyr) + L-Tyrosine > Adenosine monophosphate + Pyrophosphate + L-tyrosyl-tRNA(Tyr)
L-Tryptophan + Adenosine triphosphate + Hydrogen ion + tRNA(Trp) > Adenosine monophosphate + Pyrophosphate + L-tryptophyl-tRNA(Trp)
L-Phenylalanine + Adenosine triphosphate + Hydrogen ion + tRNA(Phe) + L-Phenylalanine > Adenosine monophosphate + Pyrophosphate + L-phenylalanyl-tRNA(Phe)
L-Asparagine + Adenosine triphosphate + Hydrogen ion + tRNA(Asn) + L-Asparagine > Pyrophosphate + Adenosine monophosphate + L-asparaginyl-tRNA(Asn)
L-Histidine + Adenosine triphosphate + Hydrogen ion + tRNA(His) + L-Histidine > Adenosine monophosphate + Pyrophosphate + L-histidyl-tRNA(His)
L-Lysine + Adenosine triphosphate + Hydrogen ion + tRNA(Lys) + L-Lysine > Adenosine monophosphate + Pyrophosphate + L-Lysyl-tRNA
L-Methionine + Adenosine triphosphate + Hydrogen ion + tRNA(Met) > Adenosine monophosphate + Pyrophosphate + L-methionyl-tRNA(Met)
L-Proline + Adenosine triphosphate + Hydrogen ion + tRNA(Pro) + L-Proline > Adenosine monophosphate + Pyrophosphate + L-prolyl-tRNA(Pro)
3-Phosphoglyceric acid + NAD + 3-Phosphoglycerate > NADH + Hydrogen ion + Phosphohydroxypyruvic acid
O-Acetylserine > Hydrogen ion + Acetic acid + L-Cysteine
O-Acetylserine + Hydrogen sulfide > Hydrogen ion + Acetic acid + L-Cysteine
Hydrogen sulfide + O-Acetylserine <> L-Cysteine + Acetic acid + Hydrogen ion
L-Cysteine > Hydrogen ion + Hydrogen sulfide + 2-Aminoacrylic acid
3 NADPH + 5 Hydrogen ion + Sulfite + 3 NADPH + Sulfite > Hydrogen sulfide +3 Water +3 NADP
Sulfite + 3 NADPH + 5 Hydrogen ion + Sulfite + 3 NADPH >3 Water + NADP + Hydrogen sulfide
Phosphoadenosine phosphosulfate + reduced thioredoxin > Sulfite +2 Hydrogen ion + Adenosine 3',5'-diphosphate +2 oxidized thioredoxin + Sulfite + Adenosine 3',5'-diphosphate
Phosphoadenosine phosphosulfate + reduced thioredoxin > Sulfite + oxidized thioredoxin + Hydrogen ion + Adenosine 3',5'-diphosphate + Sulfite + Adenosine 3',5'-diphosphate
Adenosine phosphosulfate + Adenosine triphosphate > Phosphoadenosine phosphosulfate + Adenosine diphosphate + Hydrogen ion + ADP
Adenosine triphosphate + Hydrogen ion + Sulfate + Sulfate > Adenosine phosphosulfate + Pyrophosphate
Prephenate + Hydrogen ion > Carbon dioxide + Water + Phenylpyruvic acid
3-Phosphoglyceric acid + NAD + 3-Phosphoglycerate > NADH + Hydrogen ion + Phosphohydroxypyruvic acid
Phosphoribosyl pyrophosphate + Hydrogen ion > Pyrophosphate + Phosphoribosyl-ATP + Phosphoribosyl-ATP
Phosphoribosyl-ATP + Water + Phosphoribosyl-ATP > Hydrogen ion + Pyrophosphate + Phosphoribosyl-AMP
Phosphoribulosylformimino-AICAR-P + L-Glutamine > L-Glutamic acid + Hydrogen ion + 5-Amino-4-imidazolecarboxyamide + D-Erythro-imidazole-glycerol-phosphate + L-Glutamate
L-Histidinol + NAD > NADH + Hydrogen ion + Histidinal
Water + NAD + Histidinal >2 Hydrogen ion + NADH + L-Histidine + L-Histidine
3-Methyl-2-oxovaleric acid + Water + Acetyl-CoA + 3-Methyl-2-oxovaleric acid > Coenzyme A + Hydrogen ion + 2-Isopropylmalic acid
3-Isopropylmalate + NAD > NADH + Hydrogen ion + 2-Isopropyl-3-oxosuccinate
2 Pyruvic acid + Hydrogen ion > Carbon dioxide + (S)-2-Acetolactate
2 Pyruvic acid + Hydrogen ion > Carbon dioxide + (S)-2-Acetolactate
(R)-2,3-Dihydroxy-isovalerate + Hydrogen ion + NADPH + NADPH > NADP + (R) 2,3-Dihydroxy-3-methylvalerate
2-Aceto-2-hydroxy-butyrate + NADPH + Hydrogen ion + NADPH > NADP + (R) 2,3-Dihydroxy-3-methylvalerate
2-dehydropantoate + NADPH + Hydrogen ion + 2-Dehydropantoate + NADPH > NADP + (R)-pantoate + (R)-Pantoate
(S)-2-Acetolactate + Hydrogen ion + NADPH + NADPH > NADP + (R)-2,3-Dihydroxy-isovalerate
L-Aspartic acid + Water + Adenosine triphosphate + L-Glutamine + L-Aspartic acid > L-Asparagine + Hydrogen ion + Adenosine monophosphate + L-Glutamic acid + Pyrophosphate + L-Asparagine + L-Glutamate
L-Aspartic acid + Adenosine triphosphate + Ammonium + L-Aspartic acid > L-Asparagine + Adenosine monophosphate + Pyrophosphate + Hydrogen ion + L-Asparagine
O-Succinyl-L-homoserine + L-Cysteine > Succinic acid + Hydrogen ion + L-Cystathionine
L-Cystathionine > Hydrogen ion + Homocysteine + 2-aminoprop-2-enoate + Homocysteine
Chorismate + L-Glutamine > L-Glutamic acid + Pyruvic acid + Hydrogen ion + 2-Aminobenzoic acid + L-Glutamate
1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate + Hydrogen ion + 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate > Water + Carbon dioxide
1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate + Hydrogen ion + 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate > Water + Carbon dioxide + (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate + (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate
L-Tryptophan > Hydrogen ion + Indole + 2-Aminoacrylic acid
3-dehydroshikimate + Hydrogen ion + NADPH + 3-Dehydro-shikimate + NADPH > NADP + Shikimic acid
3-dehydroshikimate + NADPH + Hydrogen ion + 3-Dehydro-shikimate + NADPH > NADP + Shikimic acid
Shikimic acid + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + shikimate 3-phosphate + ADP + Shikimate 3-phosphate
L-Aspartate-semialdehyde + Hydrogen ion + NADPH + NADPH > NADP + L-Homoserine + L-Homoserine
L-Homoserine + Adenosine triphosphate + L-Homoserine > Adenosine diphosphate + Hydrogen ion + O-Phosphohomoserine + ADP
L-Threonine + L-Threonine > Hydrogen ion + Water + (2Z)-2-aminobut-2-enoate
2-Ketobutyric acid + Hydrogen ion + Pyruvic acid > Carbon dioxide + 2-Aceto-2-hydroxy-butyrate
2-dehydro-3-deoxy-D-galactonate + Adenosine triphosphate + 2-Dehydro-3-deoxy-D-galactonate > Adenosine diphosphate + Hydrogen ion + 2-dehydro-3-deoxy-D-galactonate 6-phosphate + ADP + 2-Dehydro-3-deoxy-D-galactonate 6-phosphate
Galactose 1-phosphate + NAD + Galactose 1-phosphate > NADH + Hydrogen ion + D-tagatofuranose 6-phosphate
D-tagatofuranose 6-phosphate + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + D-tagatofuranose 1,6-bisphosphate + ADP
Glucose 1-phosphate + Uridine triphosphate + Hydrogen ion + Uridine triphosphate > Pyrophosphate + UDP-Glucose
β-D-glucose 1-phosphate + Uridine triphosphate + Hydrogen ion + Uridine triphosphate > UDP-Glucose + Pyrophosphate
Alpha-D-glucose 1-phosphate + Uridine triphosphate + Hydrogen ion + Uridine triphosphate > Pyrophosphate + UDP-Glucose
Alpha-D-Galactose + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + Galactose 1-phosphate + ADP + Galactose 1-phosphate
D-Mannose 1-phosphate + Guanosine triphosphate + Hydrogen ion > Pyrophosphate + Guanosine diphosphate mannose
α-D-mannose 1-phosphate + Guanosine triphosphate + Hydrogen ion > Guanosine diphosphate mannose + Pyrophosphate
GDP-4-Dehydro-6-deoxy-D-mannose + NADPH + Hydrogen ion + NADPH > GDP-L-Fucose + NADP
GDP-4-dehydro-6-deoxy-α-D-mannose + NADPH + Hydrogen ion + NADPH > NADP + GDP-β-L-fucose
D-allopyranose + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + aldehydo-D-allose 6-phosphate + ADP + aldehydo-D-allose 6-phosphate
L-rhamnulofuranose + Adenosine triphosphate + L-rhamnulofuranose > Adenosine diphosphate + Hydrogen ion + L-rhamnulose 1-phosphate + ADP + L-Rhamnulose 1-phosphate
Adenosine triphosphate + keto-L-rhamnulose > L-fuculose 1-phosphate + Adenosine diphosphate + Hydrogen ion + L-Fuculose 1-phosphate + ADP
D-Ribulose + Adenosine triphosphate + D-Ribulose > Adenosine diphosphate + Hydrogen ion + D-Ribulose-1-phosphate + ADP
NAD + Water + (S)-lactaldehyde + Lactaldehyde > NADH +2 Hydrogen ion + L-Lactic acid + L-Lactic acid
(S)-lactaldehyde + NADH + Hydrogen ion + Lactaldehyde > NAD + Propylene glycol
Glyoxylic acid + Water + Acetyl-CoA > Coenzyme A + Hydrogen ion + L-Malic acid + L-Malic acid
2 Glyoxylic acid + Hydrogen ion > Carbon dioxide + Tartronate semialdehyde
Tartronate semialdehyde + NADH + Hydrogen ion > NAD + Glyceric acid
Allantoin + Water > Allantoic acid + Hydrogen ion
Allantoic acid + Water + 2 Hydrogen ion > Carbon dioxide + Ammonium + S-ureidoglycine
L-Aspartic acid + Hydrogen ion + L-Aspartic acid Carbon dioxide + beta-Alanine
L-Aspartic acid + Hydrogen ion + L-Aspartic acid > Carbon dioxide + beta-Alanine
beta-Alanine + Adenosine triphosphate + (R)-pantoate + (R)-Pantoate > Adenosine monophosphate + Pyrophosphate + Hydrogen ion + Pantothenic acid + Pantothenic acid
beta-Alanine + Adenosine triphosphate > Adenosine monophosphate + Pyrophosphate + Hydrogen ion
Pantothenic acid + Adenosine triphosphate + Pantothenic acid > Adenosine diphosphate + Hydrogen ion + D-4'-Phosphopantothenate + ADP + D-4'-Phosphopantothenate
D-4'-Phosphopantothenate + Cytidine triphosphate + L-Cysteine + D-4'-Phosphopantothenate > Cytidine monophosphate + Pyrophosphate + Hydrogen ion + 4-Phosphopantothenoylcysteine + Cytidine monophosphate
4-Phosphopantothenoylcysteine + Hydrogen ion > Carbon dioxide + 4'-phosphopantetheine + 4'-phosphopantetheine
4'-phosphopantetheine + Adenosine triphosphate + Hydrogen ion + 4'-phosphopantetheine > Pyrophosphate + Dephospho-CoA
Dephospho-CoA + Adenosine triphosphate > Hydrogen ion + Adenosine diphosphate + Coenzyme A + ADP
Quinolinic acid + Hydrogen ion + Phosphoribosyl pyrophosphate > Carbon dioxide + Pyrophosphate + nicotinate beta-D-ribonucleotide + Nicotinamide ribotide
nicotinate beta-D-ribonucleotide + Adenosine triphosphate + Hydrogen ion + Nicotinamide ribotide > Pyrophosphate + Nicotinic acid adenine dinucleotide
Nicotinic acid adenine dinucleotide + Water + L-Glutamine + Adenosine triphosphate > Hydrogen ion + Adenosine monophosphate + Pyrophosphate + L-Glutamic acid + NAD + L-Glutamate
Nicotinic acid adenine dinucleotide + Adenosine triphosphate + Ammonium > Hydrogen ion + Adenosine monophosphate + Pyrophosphate + NAD
nicotinate beta-D-ribonucleotide + Adenosine triphosphate + Hydrogen ion + Nicotinamide ribotide > Pyrophosphate + Nicotinic acid adenine dinucleotide
Nicotinamide riboside + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + beta-nicotinamide D-ribonucleotide + ADP + NMN
beta-nicotinamide D-ribonucleotide + Adenosine triphosphate + Hydrogen ion + NMN > Pyrophosphate + NAD
UDP-3-O-(3-Hydroxytetradecanoyl)-D-glucosamine + (3R)-3-hydroxymyristoyl-[acp] > Hydrogen ion + a holo-[acyl-carrier protein] + UDP-2-N,3-O-bis[(3R)-3-hydroxytetradecanoyl]-α-D-glucosamine
UDP-2-N,3-O-bis[(3R)-3-hydroxytetradecanoyl]-α-D-glucosamine + Water > Uridine 5'-monophosphate + Hydrogen ion + 2,3-bis[(3R)-3-hydroxymyristoyl]-α-D-glucosaminyl 1-phosphate
2,3-bis[(3R)-3-hydroxymyristoyl]-α-D-glucosaminyl 1-phosphate + UDP-2-N,3-O-bis[(3R)-3-hydroxytetradecanoyl]-α-D-glucosamine > Uridine 5'-diphosphate + Hydrogen ion + (2-N,3-O-bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl)-(1->6)-(2-N,3-O-bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl phosphate)
(2-N,3-O-bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl)-(1->6)-(2-N,3-O-bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl phosphate) + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + (2-N,3-O-bis(3-Hydroxytetradecanoyl)-4-O-phosphono-beta-D-glucosaminyl)-(1->6)-(2-N,3-O-bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl phosphate) + ADP
CMP-3-Deoxy-D-manno-octulosonate + (2-N,3-O-bis(3-Hydroxytetradecanoyl)-4-O-phosphono-beta-D-glucosaminyl)-(1->6)-(2-N,3-O-bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl phosphate) > Cytidine monophosphate + Hydrogen ion + alpha-Kdo-(2→6)-lipid IVA + Cytidine monophosphate
alpha-Kdo-(2→6)-lipid IVA + CMP-3-Deoxy-D-manno-octulosonate > Cytidine monophosphate + Hydrogen ion + a-Kdo-(2->4)-a-Kdo-(2->6)-lipid IVA + Cytidine monophosphate + a-Kdo-(2->4)-a-Kdo-(2->6)-lipid IVA
(KDO)2-lipid A + ADP-L-glycero-beta-D-manno-heptose > Hydrogen ion + Adenosine diphosphate + heptosyl-Kdo2-lipid A + ADP + Heptosyl-KDO2-lipid A
heptosyl-Kdo2-lipid A + ADP-L-glycero-beta-D-manno-heptose + Heptosyl-KDO2-lipid A > Adenosine diphosphate + Hydrogen ion + (heptosyl)2-Kdo2-lipid A + ADP
(heptosyl)2-Kdo2-lipid A + UDP-Glucose > Uridine 5'-diphosphate + Hydrogen ion + glucosyl-(heptosyl)2-Kdo2-lipid A
glucosyl-(heptosyl)2-Kdo2-lipid A + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + glucosyl-(heptosyl)2-Kdo2-lipid A-phosphate + ADP
glucosyl-(heptosyl)2-Kdo2-lipid A-phosphate + ADP-L-glycero-beta-D-manno-heptose > Adenosine diphosphate + Hydrogen ion + glucosyl-(heptosyl)3-Kdo2-lipid A-phosphate + ADP
glucosyl-(heptosyl)3-Kdo2-lipid A-phosphate + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + glucosyl-(heptosyl)3-Kdo2-lipid A-bisphosphate + ADP
glucosyl-(heptosyl)3-Kdo2-lipid A-bisphosphate + UDP-α-D-galactose > galactosyl-glucosyl-(heptosyl)3-Kdo2-lipid A-bisphosphate + Uridine 5'-diphosphate + Hydrogen ion
galactosyl-glucosyl-(heptosyl)3-Kdo2-lipid A-bisphosphate + UDP-Glucose > Uridine 5'-diphosphate + Hydrogen ion + galactosyl-(glucosyl)2-(heptosyl)3-Kdo2-lipid A-bisphosphate
galactosyl-(glucosyl)2-(heptosyl)3-Kdo2-lipid A-bisphosphate + UDP-Glucose > Uridine 5'-diphosphate + Hydrogen ion + galactosyl-(glucosyl)3-(heptosyl)3-Kdo2-lipid A-bisphosphate
galactosyl-(glucosyl)3-(heptosyl)3-Kdo2-lipid A-bisphosphate + ADP-L-glycero-beta-D-manno-heptose > Hydrogen ion + Adenosine diphosphate + Lipid A-core + ADP
L-Glutamic acid + Adenosine triphosphate + L-Cysteine + L-Glutamate > Adenosine diphosphate + Phosphate + Hydrogen ion + gamma-Glutamylcysteine + ADP
gamma-Glutamylcysteine + Glycine + Adenosine triphosphate > Hydrogen ion + Phosphate + Adenosine diphosphate + Glutathione + ADP
Oxidized glutathione + Hydrogen ion + NADPH + Glutathione disulfide + NADPH > NADP +2 Glutathione
D-Fructuronate + NADH + Hydrogen ion > NAD + D-altronate
D-tagaturonate + NADH + Hydrogen ion + D-Tagaturonate > NAD + D-altronate + D-altronate
2-Dehydro-3-deoxy-D-galactonate + Adenosine triphosphate + 2-Keto-3-deoxy-D-gluconic acid > Hydrogen ion + 2-Keto-3-deoxy-6-phosphogluconic acid + Adenosine diphosphate + ADP
(2R,4S)-2-methyl-2,3,3,4-tetrahydroxytetrahydrofuran + Adenosine triphosphate + (2R,4S)-2-Methyl-2,3,3,4-tetrahydroxytetrahydrofuran > Adenosine diphosphate + Hydrogen ion + (4S)-4-hydroxy-2,3-pentanedione 5-phosphate + ADP + (4S)-4-hydroxy-2,3-pentanedione 5-phosphate
Dihydroxyacetone phosphate + Hydrogen ion + NADPH + NADPH > NADP + Glycerol 3-phosphate
Cytidine triphosphate + Hydrogen ion + PA(18:0/18:0) > Pyrophosphate + CDP-1,2-Dioctadecanoylglycerol
DG(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:1(11Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) + Pyrophosphate + CDP-DG(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z))
DG(19:1(9Z)/18:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate > Pyrophosphate + CDP-DG(19:1(9Z)/18:1(9Z))
DG(18:1(9Z)/18:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate + DG(18:1(9Z)/18:1(9Z)/0:0) > Pyrophosphate + CDP-DG(18:1(9Z)/18:0) + CDP-DG(18:1(9Z)/18:0)
DG(16:0/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:0/10:0) + Pyrophosphate
DG(10:0/10:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(10:0/10:0) + Pyrophosphate
DG(16:0/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:0/12:0) + Pyrophosphate
DG(16:0/15:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(16:0/15:0/0:0) > CDP-DG(16:0/15:0) + Pyrophosphate
Hydrogen ion + Cytidine triphosphate + CDP-DG(10:0/12:0) > Pyrophosphate + DG(10:0/12:0/0:0)
1-hexadecanoyl-2-octadecanoyl-sn-glycerol + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:0/18:0) + Pyrophosphate + CDP-DG(16:0/18:0)
DG(10:0/12:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(10:0/12:0) + Pyrophosphate
DG(10:0/14:0/0:0) + Hydrogen ion + Cytidine triphosphate CDP-DG(10:0/14:0) + Pyrophosphate
DG(10:0/15:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(10:0/15:0) + Pyrophosphate
DG(10:0/16:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(10:0/16:0) + Pyrophosphate
DG(16:0/19:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:0/19:1(9Z)) + Pyrophosphate
DG(16:1(9Z)/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:1(9Z)/10:0) + Pyrophosphate
DG(10:0/16:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(10:0/16:1(9Z)) + Pyrophosphate
DG(16:1(9Z)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:1(9Z)/12:0) + Pyrophosphate
DG(10:0/18:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(10:0/18:0) + Pyrophosphate
DG(16:1(9Z)/15:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(16:1(9Z)/15:0/0:0) > CDP-DG(16:1(9Z)/15:0) + Pyrophosphate
DG(16:1(9Z)/18:0/0:0) + Hydrogen ion + Cytidine triphosphate + DG(16:1(9Z)/18:0/0:0) > CDP-DG(16:1(9Z)/18:0) + Pyrophosphate
DG(16:1(9Z)/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion + DG(16:1(9Z)/18:1(9Z)/0:0) > CDP-DG(16:1(9Z)/18:1(9Z)) + Pyrophosphate
DG(16:1(9Z)/19:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:1(9Z)/19:1(9Z)) + Pyrophosphate
DG(18:0/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:0/10:0) + Pyrophosphate
DG(10:0/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(10:0/18:1(9Z)) + Pyrophosphate
DG(18:0/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:0/12:0) + Pyrophosphate
DG(18:0/14:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:0/14:0/0:0) > CDP-DG(18:0/14:0) + Pyrophosphate
DG(10:0/19:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(10:0/19:1(9Z)) + Pyrophosphate
DG(18:0/15:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:0/15:0/0:0) > CDP-DG(18:0/15:0) + Pyrophosphate
DG(12:0/10:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(12:0/10:0) + Pyrophosphate
DG(18:0/16:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:0/16:0/0:0) > CDP-DG(18:0/16:0) + Pyrophosphate + CDP-DG(18:0/16:0)
DG(12:0/14:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0/14:0) + Pyrophosphate
DG(12:0/15:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(12:0/15:0) + Pyrophosphate
DG(18:0/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:0/16:1(9Z)/0:0) > CDP-DG(18:0/16:1(9Z)) + Pyrophosphate
1,2-Diacyl-sn-glycerol (dioctadecanoyl, n-C18:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:0/18:0) + Pyrophosphate + CDP-DG(18:0/18:0)
DG(12:0/16:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(12:0/16:0) + Pyrophosphate
DG(12:0/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0/16:1(9Z)) + Pyrophosphate
DG(18:0/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:0/18:1(9Z)/0:0) > CDP-DG(18:0/18:1(9Z)) + Pyrophosphate + CDP-DG(18:0/18:1(9Z))
DG(12:0/18:0/0:0) + Cytidine triphosphate + Hydrogen ion CDP-DG(12:0/18:0) + Pyrophosphate
DG(18:0/19:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:0/19:1(9Z)) + Pyrophosphate
DG(18:1(9Z)/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(9Z)/10:0) + Pyrophosphate
DG(18:1(9Z)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(9Z)/12:0) + Pyrophosphate
DG(18:1(9Z)/14:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:1(9Z)/14:0/0:0) > CDP-DG(18:1(9Z)/14:0) + Pyrophosphate
DG(12:0/18:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(12:0/18:1(9Z)) + Pyrophosphate
DG(18:1(9Z)/15:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:1(9Z)/15:0/0:0) > CDP-DG(18:1(9Z)/15:0) + Pyrophosphate
DG(18:1(9Z)/16:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:1(9Z)/16:0/0:0) > CDP-DG(18:1(9Z)/16:0) + Pyrophosphate + CDP-DG(18:1(9Z)/16:0)
DG(18:1(9Z)/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:1(9Z)/16:1(9Z)/0:0) > CDP-DG(18:1(9Z)/16:1(9Z)) + Pyrophosphate
DG(18:1(9Z)/19:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(9Z)/19:1(9Z)) + Pyrophosphate
DG(19:1(9Z)/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/10:0) + Pyrophosphate
DG(19:1(9Z)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/12:0) + Pyrophosphate
DG(19:1(9Z)/14:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/14:0) + Pyrophosphate
DG(19:1(9Z)/15:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/15:0) + Pyrophosphate
DG(19:1(9Z)/16:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/16:0) + Pyrophosphate
DG(19:1(9Z)/18:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/18:0) + Pyrophosphate
DG(12:0/19:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0/19:1(9Z)) + Pyrophosphate
DG(19:1(9Z)/19:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/19:1(9Z)) + Pyrophosphate
DG(14:0/10:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(14:0/10:0) + Pyrophosphate
DG(14:0/12:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(14:0/12:0) + Pyrophosphate
DG(14:0/15:0/0:0) + Hydrogen ion + Cytidine triphosphate + DG(14:0/15:0/0:0) > CDP-DG(14:0/15:0) + Pyrophosphate
Hydrogen ion + Cytidine triphosphate + DG(14:0/18:0/0:0) + DG(14:0/18:0/0:0) > CDP-DG(14:0/18:0) + Pyrophosphate
DG(14:0/18:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate + DG(14:0/18:1(9Z)/0:0) > CDP-DG(14:0/18:1(9Z)) + Pyrophosphate
DG(14:0/19:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(14:0/19:1(9Z)) + Pyrophosphate
DG(15:0/10:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(15:0/10:0) + Pyrophosphate
DG(15:0/12:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(15:0/12:0) + Pyrophosphate
DG(15:0/14:0/0:0) + Hydrogen ion + Cytidine triphosphate + DG(15:0/14:0/0:0) > CDP-DG(15:0/14:0) + Pyrophosphate
DG(15:0/15:0/0:0) + Hydrogen ion + Cytidine triphosphate + DG(15:0/15:0/0:0) > CDP-DG(15:0/15:0) + Pyrophosphate
DG(15:0/16:0/0:0) + Hydrogen ion + Cytidine triphosphate + DG(15:0/16:0/0:0) > CDP-DG(15:0/16:0) + Pyrophosphate
DG(15:0/16:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate + DG(15:0/16:1(9Z)/0:0) > CDP-DG(15:0/16:1(9Z)) + Pyrophosphate
DG(15:0/18:0/0:0) + Hydrogen ion + Cytidine triphosphate + DG(15:0/18:0/0:0) > CDP-DG(15:0/18:0) + Pyrophosphate
DG(15:0/18:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate + DG(15:0/18:1(9Z)/0:0) > Pyrophosphate + CDP-DG(15:0/18:1(9Z))
DG(15:0/19:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(15:0/19:1(9Z)) + Pyrophosphate
DG(17:0cycw7c/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/17:0cycw7c) + Pyrophosphate
2 DG(18:1(9Z)/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(18:1(9Z)/19:0cycv8c) + Carbon dioxide
2 DG(19:0cycv8c/15:0cyclo/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0cycv8c/15:0cyclo) + Pyrophosphate
DG(19:0cycv8c/14:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:0cycv8c/14:0) + Pyrophosphate
DG(19:0cycv8c/16:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:0cycv8c/16:0) + Pyrophosphate
DG(14:0/16:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(14:0/16:0/0:0) > CDP-DG(14:0/16:0) + Pyrophosphate
2 DG(19:0cycv8c/16:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0cycv8c/16:0) + Pyrophosphate
DG(17:0cycw7c/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/19:0cycv8c) + Pyrophosphate
DG(19:0cycv8c/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:0cycv8c/16:1(9Z)) + Pyrophosphate
2 DG(19:0cycv8c/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0cycv8c/16:1(9Z)) + Pyrophosphate
DG(17:0cycw7c/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/16:1(9Z)) + Pyrophosphate
DG(19:0cycv8c/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:0cycv8c/17:0cycw7c) + Pyrophosphate
2 DG(14:0/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(14:0/17:0cycw7c) + Pyrophosphate
2 DG(19:0cycv8c/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0cycv8c/18:1(9Z)) + Pyrophosphate
DG(19:0cycv8c/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:0cycv8c/19:0cycv8c) + Pyrophosphate
2 DG(14:0/16:0/0:0) + Cytidine triphosphate + Hydrogen ion + 2 DG(14:0/16:0/0:0) >2 CDP-DG(14:0/16:0) + Pyrophosphate
2 DG(19:0cycv8c/14:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0cycv8c/14:0) + Pyrophosphate
CDP-DG(16:0/14:0) + L-Serine + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/14:0) + Cytidine monophosphate
CDP-DG(16:0/16:0) + L-Serine + CDP-DG(16:0/16:0) + L-Serine > Hydrogen ion + Cytidine monophosphate + PS(16:0/16:0) + Cytidine monophosphate
L-Serine + CDP-DG(16:0/16:1(9Z)) + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/16:1(9Z)) + Cytidine monophosphate
CDP-DG(16:0/18:1(11Z)) + L-Serine + L-Serine > Hydrogen ion + Cytidine monophosphate + PS(16:0/18:1(11Z)) + Cytidine monophosphate
CDP-DG(16:1(9Z)/14:0) + L-Serine + L-Serine > Hydrogen ion + Cytidine monophosphate + PS(16:1(9Z)/14:0) + Cytidine monophosphate
L-Serine + CDP-DG(16:1(9Z)/16:0) + L-Serine > Hydrogen ion + Cytidine monophosphate + PS(16:1(9Z)/16:0) + Cytidine monophosphate
Hydrogen ion + PS(17:0/19:0) > Carbon dioxide + PE(17:0/19:0)
CDP-DG(18:1(11Z)/16:0) + L-Serine + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(18:1(11Z)/16:0) + Cytidine monophosphate
CDP-DG(18:1(11Z)/18:1(11Z)) + L-Serine + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(18:1(11Z)/18:1(11Z)) + Cytidine monophosphate
Hydrogen ion + PS(19:0/17:0) > Carbon dioxide + PE(19:0/17:0)
L-Serine + CDP-1,2-Dioctadecanoylglycerol + L-Serine > Hydrogen ion + Cytidine monophosphate + PS(18:0/18:0) + Cytidine monophosphate
L-Serine + CDP-DG(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) + L-Serine + CDP-DG(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) > Hydrogen ion + Cytidine monophosphate + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:2(9Z,12Z)) + Cytidine monophosphate
L-Serine + CDP-DG(19:1(9Z)/18:1(9Z)) + L-Serine > Hydrogen ion + Cytidine monophosphate + PS(19:iso/18:1(9Z)) + Cytidine monophosphate
CDP-DG(18:1(9Z)/18:0) + L-Serine + CDP-DG(18:1(9Z)/18:0) + L-Serine > Hydrogen ion + Cytidine monophosphate + PS(18:1(9Z)/18:0) + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + L-Serine + L-Serine > PS(16:0/18:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + L-Serine + L-Serine > PS(17:0/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + L-Serine + L-Serine > PS(17:0/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + L-Serine + L-Serine > PS(19:0/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + L-Serine + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(19:0/17:0) + Cytidine monophosphate
CDP-DG(16:0/10:0) + L-Serine + L-Serine > PS(16:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:0/12:0) + L-Serine + L-Serine > PS(16:0/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:0/18:0) + L-Serine + CDP-DG(16:0/18:0) + L-Serine > PS(16:0/18:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:1(9Z)/10:0) + L-Serine + L-Serine > PS(16:1(9Z)/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:1(9Z)/12:0) + L-Serine + L-Serine > PS(16:1(9Z)/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:1(9Z)/18:0) + L-Serine + L-Serine > PS(16:1(9Z)/18:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:1(9Z)/18:1(9Z)) + L-Serine + L-Serine > PS(16:1(9Z)/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:0/14:0) + L-Serine + L-Serine > PS(18:0/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:0/16:0) + L-Serine + CDP-DG(18:0/16:0) + L-Serine > PS(18:0/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:0/16:1(9Z)) + L-Serine + L-Serine > PS(18:0/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:0/18:0) + L-Serine + CDP-DG(18:0/18:0) + L-Serine > PS(18:0/18:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:0/18:1(9Z)) + L-Serine + CDP-DG(18:0/18:1(9Z)) + L-Serine > PS(18:0/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:1(9Z)/10:0) + L-Serine + L-Serine > PS(18:1(9Z)/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:1(9Z)/14:0) + L-Serine + L-Serine > PS(18:1(9Z)/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:1(9Z)/16:0) + L-Serine + CDP-DG(18:1(9Z)/16:0) + L-Serine > PS(18:1(9Z)/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:1(9Z)/16:1(9Z)) + L-Serine + L-Serine > PS(18:1(9Z)/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:1(9Z)/19:1(9Z)) + L-Serine + L-Serine > PS(16:1(9Z)/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/10:0) + L-Serine + L-Serine > PS(19:iso/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:0/19:1(9Z)) + L-Serine + L-Serine > PS(16:0/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/15:0) + L-Serine + L-Serine > PS(19:iso/15:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:1(9Z)/12:0) + L-Serine + L-Serine > PS(18:1(9Z)/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/12:0) + L-Serine + L-Serine > PS(19:iso/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/10:0) + L-Serine + L-Serine > PS(10:0(3-OH)/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/10:0) + L-Serine + L-Serine > PS(10:0(3-OH)/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/10:0) + L-Serine + L-Serine > PS(10:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/12:0) + L-Serine + L-Serine > PS(10:0(3-OH)/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/12:0) + L-Serine + L-Serine > PS(10:0(3-OH)/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/12:0) + L-Serine + L-Serine > PS(10:0/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/14:0) + L-Serine + L-Serine > PS(10:0(3-OH)/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/14:0) + L-Serine + L-Serine > PS(10:0(3-OH)/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/14:0) + L-Serine + L-Serine > PS(10:0/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/15:0) + L-Serine + L-Serine > PS(10:0(3-OH)/15:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/15:0) + L-Serine + L-Serine > PS(10:0(3-OH)/15:0cyclo) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/16:0) + L-Serine + L-Serine > PS(10:0(3-OH)/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/16:1(9Z)) + L-Serine + L-Serine > PS(10:0(3-OH)/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/18:0) + L-Serine + L-Serine > PS(10:0(3-OH)/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/18:1(9Z)) + L-Serine + L-Serine > PS(10:0(3-OH)/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/19:1(9Z)) + L-Serine + L-Serine > PS(10:0(3-OH)/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/19:1(9Z)) + L-Serine + L-Serine > PS(10:0(3-OH)/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/19:1(9Z)) + L-Serine + L-Serine > PS(10:0/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/10:0) + L-Serine + L-Serine > PS(12:0(3-OH)/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/10:0) + L-Serine + L-Serine > PS(12:0(3-OH)/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/14:0) + L-Serine + L-Serine > PS(12:0(3-OH)/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/14:0) + L-Serine + L-Serine > PS(12:0(3-OH)/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/15:0) + L-Serine + L-Serine > PS(12:0(3-OH)/15:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/14:0) + L-Serine + L-Serine > PS(12:0/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/15:0) + L-Serine + L-Serine > PS(12:0(3-OH)/15:0cyclo) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/16:0) + L-Serine + L-Serine > PS(12:0(3-OH)/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/16:1(9Z)) + L-Serine + L-Serine > PS(12:0(3-OH)/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/18:0) + L-Serine + L-Serine > PS(12:0(3-OH)/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/18:1(9Z)) + L-Serine + L-Serine > PS(12:0(3-OH)/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/19:1(9Z)) + L-Serine + L-Serine > PS(12:0(3-OH)/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/10:0) + L-Serine + L-Serine > PS(12:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/19:1(9Z)) + L-Serine + L-Serine > PS(12:0(3-OH)/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/19:1(9Z)) + L-Serine + L-Serine > PS(12:0/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/10:0) + L-Serine + L-Serine > PS(14:0(3-OH)/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/10:0) + L-Serine + L-Serine > PS(14:0(3-OH)/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/10:0) + L-Serine + L-Serine > PS(14:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/12:0) + L-Serine + L-Serine > PS(14:0(3-OH)/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/12:0) + L-Serine + L-Serine > PS(14:0(3-OH)/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/12:0) + L-Serine + L-Serine > PS(14:0/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/15:0) + L-Serine + L-Serine > PS(14:0(3-OH)/15:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/15:0) + L-Serine + L-Serine > PS(14:0(3-OH)/15:0cyclo) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/19:1(9Z)) + L-Serine + L-Serine > PS(14:0(3-OH)/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/19:1(9Z)) + L-Serine + L-Serine > PS(14:0(3-OH)/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(15:0/10:0) + L-Serine + L-Serine > PS(15:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(15:0/10:0) + L-Serine + L-Serine > PS(15:0cyclo/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(15:0/12:0) + L-Serine + L-Serine > PS(15:0/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(15:0/12:0) + L-Serine + L-Serine > PS(15:0cyclo/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:0/12:0) + L-Serine + L-Serine > PS(16:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(17:0cycw7c/17:0cycw7c) + L-Serine + L-Serine > PS(17:0cycw7c/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/18:1(9Z)) + L-Serine + L-Serine > PS(14:0/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:0cycv8c/14:0) + L-Serine + L-Serine > PS(19:0cycv8c/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:0cycv8c/16:0) + L-Serine + L-Serine > PS(19:0cycv8c/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/16:0) + L-Serine + L-Serine > PS(14:0/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(17:0cycw7c/19:0cycv8c) + L-Serine + L-Serine > PS(17:0cycw7c/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:0cycv8c/16:1(9Z)) + L-Serine + L-Serine > PS(19:0cycv8c/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(17:0cycw7c/16:1(9Z)) + L-Serine + L-Serine > PS(17:0cycw7c/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:0cycv8c/17:0cycw7c) + L-Serine + L-Serine > PS(19:0cycv8c/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:0cycv8c/19:0cycv8c) + L-Serine + L-Serine > PS(19:0cycv8c/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(17:0cycw7c/18:1(9Z)) + L-Serine + L-Serine > PS(17:0cycw7c/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
an L-1-phosphatidylserine + Hydrogen ion > Carbon dioxide + an L-1-phosphatidylethanolamine
PS(14:0/14:0) + Hydrogen ion > PE(14:0/14:0) + Carbon dioxide
PS(14:0/16:0) + Hydrogen ion > Carbon dioxide + PE(14:0/16:0)
PS(14:0/16:1(9Z)) + Hydrogen ion > Carbon dioxide + PE(14:0/16:1(9Z))
PS(14:0/17:0) + Hydrogen ion > Carbon dioxide + PE(14:0/17:0)
PS(14:0/18:1(11Z)) + Hydrogen ion > Carbon dioxide + PE(14:0/18:1(11Z))
PS(14:0/19:0) + Hydrogen ion > Carbon dioxide + PE(14:0/19:0)
PS(16:0/14:0) + Hydrogen ion > PE(16:0/14:0) + Carbon dioxide
PS(16:0/16:0) + Hydrogen ion > PE(16:0/16:0) + Carbon dioxide
PS(16:0/16:1(9Z)) + Hydrogen ion > Carbon dioxide + PE(16:0/16:1(9Z))
PS(16:0/17:0) + Hydrogen ion > Carbon dioxide + PE(16:0/17:0)
PS(16:0/18:1(11Z)) + Hydrogen ion > Carbon dioxide + PE(16:0/18:1(11Z))
PS(16:0/19:0) + Hydrogen ion > Carbon dioxide + PE(16:0/19:0)
PS(16:1(9Z)/14:0) + Hydrogen ion > Carbon dioxide + PE(16:1(9Z)/14:0)
PS(16:1(9Z)/16:0) + Hydrogen ion > Carbon dioxide + PE(16:1(9Z)/16:0)
PS(16:1(9Z)/16:1(9Z)) + Hydrogen ion > PE(16:1(9Z)/16:1(9Z)) + Carbon dioxide
PS(16:1(9Z)/18:1(11Z)) + Hydrogen ion > PE(16:1(9Z)/18:1(11Z)) + Carbon dioxide
PS(17:0/14:0) + Hydrogen ion > PE(17:0/14:0) + Carbon dioxide
PS(17:0/16:0) + Hydrogen ion > PE(17:0/16:0) + Carbon dioxide
PS(17:0/17:0) + Hydrogen ion > Carbon dioxide + PE(17:0/17:0)
PS(18:1(11Z)/14:0) + Hydrogen ion > Carbon dioxide + PE(18:1(11Z)/14:0)
PS(18:1(11Z)/16:0) + Hydrogen ion > PE(18:1(11Z)/16:0) + Carbon dioxide
PS(18:1(11Z)/16:1(9Z)) + Hydrogen ion > Carbon dioxide + PE(18:1(11Z)/16:1(9Z))
Hydrogen ion + PS(18:1(11Z)/18:1(11Z)) > Carbon dioxide + PE(18:1(11Z)/18:1(11Z))
Hydrogen ion + PS(19:0/14:0) > Carbon dioxide + PE(19:0/14:0)
Hydrogen ion + PS(19:0/16:0) > Carbon dioxide + PE(19:0/16:0)
Hydrogen ion + PS(19:0/19:0) > Carbon dioxide + PE(19:0/19:0)
Hydrogen ion + PS(18:0/18:0) > PE(18:0/18:0) + Carbon dioxide
PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:2(9Z,12Z)) + Hydrogen ion > Carbon dioxide + PE(22:5(7Z,10Z,13Z,16Z,19Z)/18:2(9Z,12Z))
PS(19:iso/18:1(9Z)) + Hydrogen ion > PE(18:1(9Z)/18:0) + Carbon dioxide
PS(18:1(9Z)/18:0) + Hydrogen ion > Carbon dioxide + PE(18:1(11Z)/17:0)
PS(14:0/18:0) + Hydrogen ion > Carbon dioxide + PE(14:0/17:0cycw7c)
PS(15:0/19:iso) + Hydrogen ion > PE(15:0/17:0cycw7c) + Coenzyme A
PS(14:0/17:0) + Hydrogen ion > PE(14:0/16:0) + Carbon dioxide
PS(14:0/17:0) + Hydrogen ion > PE(14:0/16:1(9Z)) + Carbon dioxide
PS(14:0/19:0) + Hydrogen ion > PE(14:0/18:1(9Z)) + Carbon dioxide
PS(16:0/19:iso) + Hydrogen ion > PE(16:0/19:0cycw8c) + Carbon dioxide
PS(14:0/18:1(9Z)) + Hydrogen ion > PE(14:0/18:1(9Z)) + Carbon dioxide
Hydrogen ion + PS(16:1(9Z)/16:1(9Z)) > PE(16:1(9Z)/16:1(9Z)) + Carbon dioxide
PS(16:1(9Z)/18:1(9Z)) + Hydrogen ion > PE(16:1(9Z)/18:1(9Z)) + Carbon dioxide
PS(16:1(9Z)/19:iso) + Hydrogen ion > PE(16:1(9Z)/19:iso) + Carbon dioxide
PS(16:1(9Z)/19:iso) + Hydrogen ion > PE(16:1(9Z)/19:iso) + Carbon dioxide
PS(17:0/18:1(11Z)) + Hydrogen ion > PE(17:0/18:1(11Z)) + Carbon dioxide
PS(18:1(9Z)/18:1(9Z)) + Hydrogen ion > PE(18:1(9Z)/18:1(9Z)) + Carbon dioxide
PS(18:1(9Z)/19:iso) + Hydrogen ion > PE(18:1(9Z)/19:iso) + Carbon dioxide
PS(17:0cycw7c/19:iso) + Hydrogen ion > PE(17:0cycw7c/19:iso) + Carbon dioxide
Hydrogen ion + PS(19:0cycv8c/19:iso) > Carbon dioxide + PE(19:0cycv8c/19:iso)
PS(15:0cyclo/19:iso) + Hydrogen ion > PE(15:0cyclo/19:iso) + Carbon dioxide
PS(15:0cyclo/14:0(3-OH)) + Hydrogen ion > PE(15:0cyclo/14:0(3-OH)) + Carbon dioxide
PS(14:0/17:0) + Hydrogen ion > PE(14:0/17:0cycw7c) + Carbon dioxide
PS(17:0/17:0) + Hydrogen ion > PE(17:0cycw7c/17:0cycw7c) + Carbon dioxide
Hydrogen ion + PS(18:1(9Z)/16:0) > Carbon dioxide + PE(18:1(9Z)/15:0)
Hydrogen ion + PS(19:iso/15:0cyclo) > PE(19:iso/15:0cyclo) + Carbon dioxide
PS(16:0/16:0) + Hydrogen ion > PE(16:0/15:0) + Carbon dioxide
PS(16:0/14:1(9Z)) + Hydrogen ion > PE(15:0/15:0) + Carbon dioxide
PS(17:0/16:0) + Hydrogen ion > PE(15:0/17:0cycw7c) + Carbon dioxide
PS(15:0/19:iso) + Hydrogen ion > PE(15:0/19:iso) + Carbon dioxide
PS(15:0/19:iso) + Hydrogen ion > PE(15:0/18:1(9Z)) + Carbon dioxide
PS(16:0/16:0) + Hydrogen ion > PE(15:0/16:0) + Carbon dioxide
PS(16:0/16:1(9Z)) + Hydrogen ion > PE(15:0/16:1(9Z)) + Carbon dioxide
PS(14:0/16:0) + Hydrogen ion > PE(15:0/14:0) + Carbon dioxide
PS(19:iso/15:0) + Hydrogen ion > PE(19:iso/15:0) + Carbon dioxide
PS(18:0/14:0) + Hydrogen ion > PE(18:0/16:0) + Carbon dioxide
PS(16:0/18:0) + Hydrogen ion > PE(16:0/18:0) + Carbon dioxide
PS(16:0/18:0) + Hydrogen ion > PE(14:0/20:0) + Carbon dioxide
PS(16:0/18:1(9Z)) + Hydrogen ion > PE(16:0/18:1(9Z)) + Carbon dioxide
PS(17:0/14:0) + Hydrogen ion > PE(17:0/14:0) + Carbon dioxide
PS(17:0/16:0) + Hydrogen ion > PE(17:0/16:0) + Carbon dioxide
PS(14:0/19:iso) + Hydrogen ion > PE(14:0/19:iso) + Carbon dioxide
PS(16:0/17:0) + Hydrogen ion > PE(15:0/17:0cycw7c) + Carbon dioxide
PS(19:0/16:0) + Hydrogen ion > PE(19:0/16:0) + Carbon dioxide
PS(16:1(9Z)/17:0) + Hydrogen ion > PE(16:1(9Z)/17:0) + Carbon dioxide
PS(18:0/18:0) + Hydrogen ion > PE(18:0/17:0cycw7c) + Carbon dioxide
PS(19:0/17:0) + Hydrogen ion > PE(19:0/17:0) + Carbon dioxide
PS(18:0/20:0) + Hydrogen ion > PE(19:iso/19:0cycv8c) + Carbon dioxide
PS(14:0/14:1(9Z)) + Hydrogen ion > PE(14:0/15:0) + Carbon dioxide
PS(16:0/10:0(3-OH)) + Hydrogen ion > PE(16:0/10:0(3-OH)) + Carbon dioxide
PS(16:0/12:0(3-OH)) + Hydrogen ion > PE(16:0/12:0(3-OH)) + Carbon dioxide
PS(16:1(9Z)/10:0(3-OH)) + Hydrogen ion > PE(16:1(9Z)/10:0(3-OH)) + Carbon dioxide
PS(16:1(9Z)/12:0(3-OH)) + Hydrogen ion > PE(16:1(9Z)/12:0(3-OH)) + Carbon dioxide
PS(16:1(9Z)/18:0) + Hydrogen ion > PE(16:1(9Z)/18:0) + Carbon dioxide
PS(16:1(9Z)/18:1(9Z)) + Hydrogen ion > PE(16:1(9Z)/18:1(9Z)) + Carbon dioxide
PS(18:0/14:0) + Hydrogen ion > PE(18:0/14:0) + Carbon dioxide
PS(18:0/16:0) + Hydrogen ion > PE(18:0/16:0) + Carbon dioxide
PS(18:0/16:1(9Z)) + Hydrogen ion > PE(18:0/16:1(9Z)) + Carbon dioxide
PS(18:0/18:1(9Z)) + Hydrogen ion > PE(18:0/18:1(9Z)) + Carbon dioxide
PS(18:1(9Z)/10:0(3-OH)) + Hydrogen ion > PE(18:1(9Z)/10:0(3-OH)) + Carbon dioxide
PS(18:1(9Z)/14:0) + Hydrogen ion > PE(18:1(9Z)/14:0) + Carbon dioxide
PS(18:1(9Z)/16:0) + Hydrogen ion > PE(18:1(9Z)/16:0) + Carbon dioxide
PS(18:1(9Z)/16:1(9Z)) + Hydrogen ion > PE(18:1(9Z)/16:1(9Z)) + Carbon dioxide
PS(19:iso/10:0) + Hydrogen ion > PE(19:iso/10:0) + Carbon dioxide
PS(16:0/19:iso) + Hydrogen ion > PE(16:0/19:iso) + Carbon dioxide
PS(18:1(9Z)/12:0(3-OH)) + Hydrogen ion > PE(18:1(9Z)/12:0(3-OH)) + Carbon dioxide
PS(19:iso/12:0) + Hydrogen ion > PE(19:iso/12:0) + Carbon dioxide
PS(10:0(3-OH)/10:0(3-OH)) + Hydrogen ion > PE(10:0(3-OH)/10:0(3-OH)) + Carbon dioxide
PS(10:0(3-OH)/10:0) + Hydrogen ion > PE(10:0(3-OH)/10:0) + Carbon dioxide
PS(10:0(3-OH)/10:0) + Hydrogen ion > Carbon dioxide + PE(10:0/10:0)
PS(10:0/10:0(3-OH)) + Hydrogen ion > PE(10:0/10:0(3-OH)) + Carbon dioxide
PS(10:0(3-OH)/12:0(3-OH)) + Hydrogen ion > PE(10:0(3-OH)/12:0(3-OH)) + Carbon dioxide
PS(10:0(3-OH)/12:0) + Hydrogen ion > PE(10:0(3-OH)/12:0) + Carbon dioxide
PS(10:0(3-OH)/12:0) + Hydrogen ion > PE(10:0/12:0) + Carbon dioxide
PS(10:0/12:0(3-OH)) + Hydrogen ion > PE(10:0/12:0(3-OH)) + Carbon dioxide
PS(10:0(3-OH)/14:0(3-OH)) + Hydrogen ion > PE(10:0(3-OH)/14:0(3-OH)) + Carbon dioxide
PS(10:0(3-OH)/14:0) + Hydrogen ion > PE(10:0(3-OH)/14:0) + Carbon dioxide
PS(10:0(3-OH)/14:0) + Hydrogen ion > PE(10:0/14:0) + Carbon dioxide
PS(10:0/14:0(3-OH)) + Hydrogen ion > PE(10:0/14:0(3-OH)) + Carbon dioxide
PS(10:0(3-OH)/15:0) + Hydrogen ion > PE(10:0(3-OH)/15:0) + Carbon dioxide
PS(10:0(3-OH)/15:0cyclo) + Hydrogen ion > PE(10:0(3-OH)/15:0cyclo) + Carbon dioxide
PS(10:0(3-OH)/15:0cyclo) + Hydrogen ion > PE(10:0/15:0) + Carbon dioxide
PS(10:0(3-OH)/16:0) + Hydrogen ion > PE(10:0(3-OH)/16:0) + Carbon dioxide
PS(10:0(3-OH)/16:0) + Hydrogen ion > PE(10:0/16:0) + Carbon dioxide
PS(10:0(3-OH)/16:1(9Z)) + Hydrogen ion > PE(10:0(3-OH)/16:1(9Z)) + Carbon dioxide
PS(10:0(3-OH)/16:1(9Z)) + Hydrogen ion > PE(10:0/16:1(9Z)) + Carbon dioxide
PS(10:0(3-OH)/16:1(9Z)) + Hydrogen ion > PE(10:0/18:0) + Carbon dioxide
PS(10:0(3-OH)/18:1(9Z)) + Hydrogen ion > PE(10:0/18:0) + Carbon dioxide
PS(10:0(3-OH)/18:1(9Z)) + Hydrogen ion > PE(10:0(3-OH)/18:1(9Z)) + Carbon dioxide
PS(10:0(3-OH)/19:0cycv8c) + Hydrogen ion > PE(10:0(3-OH)/19:0cycv8c) + Carbon dioxide
PS(19:iso/17:0cycw7c) + Hydrogen ion > PE(19:0cycw8c/17:0cycw7c) + Carbon dioxide
PS(10:0(3-OH)/19:0cycv8c) + Hydrogen ion > PE(10:0/19:0cycw8c) + Carbon dioxide
PS(10:0(3-OH)/19:0cycv8c) + Hydrogen ion > PE(10:0/19:1(12Z)) + Carbon dioxide
PS(19:0cycv8c/14:0(3-OH)) + Hydrogen ion > PE(19:0cycv8c/14:0(3-OH)) + Carbon dioxide
PS(10:0(3-OH)/19:iso) + Hydrogen ion > PE(10:0(3-OH)/19:iso) + Carbon dioxide
PS(10:0/19:iso) + Hydrogen ion > PE(10:0/19:iso) + Carbon dioxide
PS(10:0(3-OH)/18:1(9Z)) + Hydrogen ion > PE(10:0/18:1(11Z)) + Carbon dioxide
PS(12:0(3-OH)/10:0(3-OH)) + Hydrogen ion > PE(12:0(3-OH)/10:0(3-OH)) + Carbon dioxide
PS(12:0(3-OH)/10:0(3-OH)) + Hydrogen ion > PE(12:0/10:0) + Carbon dioxide
PS(12:0(3-OH)/10:0) + Hydrogen ion > PE(12:0(3-OH)/10:0) + Carbon dioxide
PS(12:0(3-OH)/14:0(3-OH)) + Hydrogen ion > PE(12:0(3-OH)/14:0(3-OH)) + Carbon dioxide
PS(12:0(3-OH)/14:0) + Hydrogen ion > PE(12:0(3-OH)/14:0) + Carbon dioxide
PS(12:0(3-OH)/14:0) + Hydrogen ion > PE(12:0/14:0) + Carbon dioxide
PS(12:0(3-OH)/15:0) + Hydrogen ion > PE(12:0(3-OH)/15:0) + Carbon dioxide
PS(12:0(3-OH)/15:0) + Hydrogen ion > PE(12:0/15:0) + Carbon dioxide
PS(12:0/14:0(3-OH)) + Hydrogen ion > PE(12:0/14:0(3-OH)) + Carbon dioxide
PS(12:0(3-OH)/15:0cyclo) + Hydrogen ion > PE(12:0(3-OH)/15:0cyclo) + Carbon dioxide
PS(12:0(3-OH)/16:0) + Hydrogen ion > PE(12:0(3-OH)/16:0) + Carbon dioxide
PS(12:0(3-OH)/16:0) + Hydrogen ion > PE(12:0/16:0) + Carbon dioxide
PS(12:0(3-OH)/16:1(9Z)) + Hydrogen ion > PE(12:0(3-OH)/16:1(9Z)) + Carbon dioxide
PS(12:0(3-OH)/16:1(9Z)) + Hydrogen ion > PE(12:0/16:1(9Z)) + Carbon dioxide
PS(12:0(3-OH)/18:1(9Z)) + Hydrogen ion > PE(12:0/18:0) + Carbon dioxide
PS(12:0(3-OH)/18:1(9Z)) + Hydrogen ion > PE(12:0(3-OH)/18:1(9Z)) + Carbon dioxide
PS(12:0(3-OH)/18:1(9Z)) + Hydrogen ion > PE(12:0/18:1(11Z)) + Carbon dioxide
PS(14:0(3-OH)/19:0cycv8c) + Hydrogen ion > PE(14:0(3-OH)/19:0cycv8c) + Carbon dioxide
PS(12:0(3-OH)/19:0cycv8c) + Hydrogen ion > PE(12:0(3-OH)/19:0cycv8c) + Carbon dioxide
PS(12:0/10:0(3-OH)) + Hydrogen ion > PE(12:0/10:0(3-OH)) + Carbon dioxide
PS(12:0(3-OH)/19:iso) + Hydrogen ion > PE(12:0(3-OH)/19:iso) + Carbon dioxide
PS(12:0/19:iso) + Hydrogen ion > PE(12:0/19:iso) + Carbon dioxide
PS(17:0cycw7c/14:0(3-OH)) + Hydrogen ion > PE(17:0cycw7c/14:0(3-OH)) + Carbon dioxide
PS(12:0(3-OH)/19:0cycv8c) + Hydrogen ion > PE(12:0/19:0cycw8c) + Carbon dioxide
PS(12:0/19:iso) + Hydrogen ion > PE(12:0/19:1(12Z)) + Carbon dioxide
PS(14:0(3-OH)/10:0(3-OH)) + Hydrogen ion > PE(14:0(3-OH)/10:0(3-OH)) + Carbon dioxide
PS(14:0(3-OH)/10:0) + Hydrogen ion > PE(14:0(3-OH)/10:0) + Carbon dioxide
PS(14:0/10:0(3-OH)) + Hydrogen ion > PE(14:0/10:0(3-OH)) + Carbon dioxide
PS(14:0(3-OH)/10:0) + Hydrogen ion > PE(14:0/10:0) + Carbon dioxide
PS(14:0(3-OH)/12:0(3-OH)) + Hydrogen ion > PE(14:0(3-OH)/12:0(3-OH)) + Carbon dioxide
PS(14:0(3-OH)/12:0) + Hydrogen ion > PE(14:0(3-OH)/12:0) + Carbon dioxide
PS(14:0/12:0(3-OH)) + Hydrogen ion > PE(14:0/12:0(3-OH)) + Carbon dioxide
PS(14:0(3-OH)/12:0) + Hydrogen ion > PE(14:0/12:0) + Carbon dioxide
PS(14:0(3-OH)/15:0) + Hydrogen ion > PE(14:0(3-OH)/15:0) + Carbon dioxide
PS(14:0(3-OH)/17:0cycw7c) + Hydrogen ion > PE(14:0/17:0cycw7c) + Carbon dioxide
PS(14:0(3-OH)/15:0cyclo) + Hydrogen ion > PE(14:0(3-OH)/15:0cyclo) + Carbon dioxide
PS(14:0(3-OH)/19:iso) + Hydrogen ion > PE(14:0(3-OH)/19:iso) + Carbon dioxide
PS(15:0/10:0(3-OH)) + Hydrogen ion > PE(15:0/10:0(3-OH)) + Carbon dioxide
PS(15:0cyclo/10:0(3-OH)) + Hydrogen ion > PE(15:0cyclo/10:0(3-OH)) + Carbon dioxide
PS(15:0/10:0(3-OH)) + Hydrogen ion > PE(15:0/10:0) + Carbon dioxide
PS(15:0/12:0(3-OH)) + Hydrogen ion > PE(15:0/12:0(3-OH)) + Carbon dioxide
PS(15:0cyclo/12:0(3-OH)) + Hydrogen ion > PE(15:0cyclo/12:0(3-OH)) + Carbon dioxide
PS(15:0/12:0(3-OH)) + Hydrogen ion > PE(15:0/12:0) + Carbon dioxide
PS(16:0/10:0(3-OH)) + Hydrogen ion > PE(16:0/10:0) + Carbon dioxide
PS(19:iso/16:0) + Hydrogen ion > PE(19:iso/16:0) + Carbon dioxide
PS(19:iso/16:1(9Z)) + Hydrogen ion > PE(19:iso/16:1(9Z)) + Carbon dioxide
PS(16:1(9Z)/14:0) + Hydrogen ion > PE(16:1(9Z)/14:0) + Carbon dioxide
PS(19:iso/18:1(9Z)) + Hydrogen ion > PE(19:iso/18:1(9Z)) + Carbon dioxide
PS(17:0cycw7c/17:0cycw7c) + Hydrogen ion > PE(17:0cycw7c/17:0cycw7c) + Carbon dioxide
PS(19:0cycv8c/14:0) + Hydrogen ion > PE(19:0cycv8c/14:0) + Carbon dioxide
PS(19:0cycv8c/16:0) + Hydrogen ion > PE(19:0cycv8c/16:0) + Carbon dioxide
PS(17:0cycw7c/19:0cycv8c) + Hydrogen ion > PE(17:0cycw7c/19:0cycv8c) + Carbon dioxide
PS(19:0cycv8c/16:1(9Z)) + Hydrogen ion > PE(19:0cycv8c/16:1(9Z)) + Carbon dioxide
PS(17:0cycw7c/16:1(9Z)) + Hydrogen ion > PE(17:0cycw7c/16:1(9Z)) + Carbon dioxide
PS(19:0cycv8c/17:0cycw7c) + Hydrogen ion > PE(19:0cycv8c/17:0cycw7c) + Carbon dioxide
PS(19:0cycv8c/19:0cycv8c) + Hydrogen ion > PE(19:0cycv8c/19:0cycv8c) + Carbon dioxide
PS(17:0cycw7c/18:1(9Z)) + Hydrogen ion > PE(17:0cycw7c/18:1(9Z)) + Carbon dioxide
CDP-DG(16:0/16:0) + Glycerol 3-phosphate + CDP-DG(16:0/16:0) > Cytidine monophosphate + Hydrogen ion + PGP(16:0/16:0) + Cytidine monophosphate
Glycerol 3-phosphate + CDP-DG(16:0/16:1(9Z)) > Hydrogen ion + PGP(16:0/16:1(9Z)) + Cytidine monophosphate + Cytidine monophosphate
CDP-DG(16:0/18:1(11Z)) + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(16:0/18:1(11Z)) + Cytidine monophosphate
CDP-DG(16:1(9Z)/16:0) + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(16:1(9Z)/16:0) + Cytidine monophosphate
CDP-DG(18:1(11Z)/16:0) + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(18:1(11Z)/16:0) + Cytidine monophosphate
CDP-DG(18:1(11Z)/18:1(11Z)) + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(18:1(11Z)/18:1(11Z)) + Cytidine monophosphate
Glycerol 3-phosphate + CDP-1,2-Dioctadecanoylglycerol > Hydrogen ion + Cytidine monophosphate + PGP(18:0/18:0) + Cytidine monophosphate
CDP-DG(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) + Glycerol 3-phosphate + CDP-DG(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) > PGP(18:2(9Z,12Z)/18:2(9Z,12Z)) + Hydrogen ion + Cytidine monophosphate + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + Glycerol 3-phosphate > Hydrogen ion + Cytidine monophosphate + PGP(18:1(9Z)/18:1(9Z)) + Cytidine monophosphate
CDP-DG(18:1(9Z)/18:0) + Glycerol 3-phosphate + CDP-DG(18:1(9Z)/18:0) > Hydrogen ion + Cytidine monophosphate + PGP(18:1(9Z)/18:1(9Z)) + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + Glycerol 3-phosphate > PGP(16:0/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + L-Serine + L-Serine > PS(18:0/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + Glycerol 3-phosphate > PGP(16:0/18:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + Glycerol 3-phosphate > PGP(14:0/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(18:1(9Z)/19:0cycv8c) + Glycerol 3-phosphate >2 PGP(18:1(9Z)/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0cycv8c/15:0cyclo) + Glycerol 3-phosphate >2 PGP(19:0cycv8c/15:0cyclo) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0cycv8c/16:0) + Glycerol 3-phosphate >2 PGP(19:0cycv8c/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0cycv8c/16:1(9Z)) + Glycerol 3-phosphate >2 PGP(19:0cycv8c/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(14:0/17:0cycw7c) + Glycerol 3-phosphate >2 PGP(14:0/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0cycv8c/18:1(9Z)) + Glycerol 3-phosphate >2 PGP(19:0cycv8c/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(14:0/16:0) + Glycerol 3-phosphate >2 PGP(14:0/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0cycv8c/14:0) + Glycerol 3-phosphate >2 PGP(19:0cycv8c/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
PS(19:iso/19:iso) + Hydrogen ion > PE(19:iso/19:iso) + Carbon dioxide
Beta-D-Glucose + Adenosine triphosphate + b-D-Glucose > Hydrogen ion + Adenosine diphosphate + beta-D-Glucose 6-phosphate + ADP
D-Glucose + Adenosine triphosphate > Hydrogen ion + Adenosine diphosphate + beta-D-Glucose 6-phosphate + ADP
β-D-fructofuranose + Adenosine triphosphate + D-Fructose > Adenosine diphosphate + Hydrogen ion + D-tagatofuranose 6-phosphate + ADP
D-Fructose + Adenosine triphosphate + D-Fructose > D-tagatofuranose 6-phosphate + Adenosine diphosphate + Hydrogen ion + ADP
N-Acetyl-D-glucosamine + Adenosine triphosphate + N-Acetylglucosamine > N-Acetyl-D-Glucosamine 6-Phosphate + Adenosine diphosphate + Hydrogen ion + N-Acetyl-D-Glucosamine 6-Phosphate + ADP
Glucosamine-1P + Acetyl-CoA + Glucosamine-1P > N-Acetyl-glucosamine 1-phosphate + Coenzyme A + Hydrogen ion + N-Acetyl-glucosamine 1-phosphate
N-Acetyl-glucosamine 1-phosphate + Uridine triphosphate + Hydrogen ion + N-Acetyl-glucosamine 1-phosphate + Uridine triphosphate > Uridine diphosphate-N-acetylglucosamine + Pyrophosphate
UDP-N-acetyl-D-mannosamine + 2 NAD + Water + UDP-N-Acetyl-D-mannosamine > UDP-N-acetyl-α-D-mannosaminuronate +2 NADH +3 Hydrogen ion
UDP-N-acetyl-α-D-glucosamine-enolpyruvate + NADPH + Hydrogen ion + NADPH > NADP + UDP-N-acetyl-α-D-muramate
D-Erythrose 4-phosphate + NAD + Water > NADH + Hydrogen ion + 4-Phospho-D-erythronate
4-Phospho-D-erythronate + NAD > NADH + Hydrogen ion + 2-Oxo-3-hydroxy-4-phosphobutanoic acid
Alpha-D-glucose 1-phosphate + Adenosine triphosphate + Hydrogen ion > ADP-Glucose + Pyrophosphate
UDP-Glucose + 2 NAD + Water > UDP-Glucuronic acid +2 NADH +3 Hydrogen ion
Uridine 5''-diphospho-{beta}-4-deoxy-4-amino-L-arabinose + an N10-formyl-tetrahydrofolate + N10-Formyl-THF > UDP-4-Deoxy-4-formamido-beta-L-arabinose + Hydrogen ion + a tetrahydrofolate + Tetrahydrofolic acid
a malonyl-[acp] + Hydrogen ion + Acetyl-CoA > Carbon dioxide + Coenzyme A + acetoacetyl-[acp]
6 Adenosine triphosphate + 3 L-Serine + 3 2,3-Dihydroxybenzoic acid + 3 L-Serine >6 Adenosine monophosphate + enterobactin +6 Pyrophosphate +3 Hydrogen ion
Guanosine triphosphate + Water > Formic acid + Hydrogen ion + 7,8-dihydroneopterin 3'-triphosphate
7,8-dihydroneopterin 3'-triphosphate + Water > Pyrophosphate + Hydrogen ion + Dihydroneopterin monophosphate
6-Hydroxymethyl dihydropterin + Adenosine triphosphate > Adenosine monophosphate + Hydrogen ion + 6-Hydroxymethyl-dihydropterin pyrophosphate
4-amino-4-deoxychorismate + 4-Amino-4-deoxychorismate > Pyruvic acid + Hydrogen ion + p-Aminobenzoic acid
7,8-Dihydropteroic acid + Adenosine triphosphate + L-Glutamic acid + L-Glutamate > Adenosine diphosphate + Phosphate + Hydrogen ion + 7,8-dihydrofolate monoglutamate + ADP + Dihydrofolic acid
D-Ribose-5-phosphate + Adenosine triphosphate > Hydrogen ion + Adenosine monophosphate + Phosphoribosyl pyrophosphate
5-Phosphoribosylamine + Glycine + Adenosine triphosphate + 5-Phosphoribosylamine > N1-(5-phospho-β-D-ribosyl)glycinamide + Phosphate + Adenosine diphosphate + Hydrogen ion + ADP
5'-Phosphoribosyl-N-formylglycinamide + Water + L-Glutamine + Adenosine triphosphate + 5'-Phosphoribosyl-N-formylglycineamide > 2-(Formamido)-N1-(5-phospho-D-ribosyl)acetamidine + L-Glutamic acid + Phosphate + Adenosine diphosphate + Hydrogen ion + L-Glutamate + ADP
2-(Formamido)-N1-(5-phospho-D-ribosyl)acetamidine + Adenosine triphosphate > 5-Aminoimidazole ribonucleotide + Phosphate + Adenosine diphosphate + Hydrogen ion + ADP
5-Aminoimidazole ribonucleotide + Hydrogen carbonate + Adenosine triphosphate > N5-Carboxyaminoimidazole ribonucleotide + Adenosine diphosphate + Phosphate +2 Hydrogen ion + N5-Carboxyaminoimidazole ribonucleotide + ADP
5-Amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylate + L-Aspartic acid + Adenosine triphosphate + L-Aspartic acid > SAICAR + Phosphate + Adenosine diphosphate + Hydrogen ion + SAICAR + ADP
Inosinic acid + NAD + Water > NADH + Hydrogen ion + Xanthylic acid
Xanthylic acid + Adenosine triphosphate + L-Glutamine + Water > Adenosine monophosphate + Pyrophosphate + L-Glutamic acid +2 Hydrogen ion + Guanosine monophosphate + L-Glutamate
Adenosine diphosphate + Phosphate + 4 Hydrogen ion + ADP <> Water +3 Hydrogen ion + Adenosine triphosphate
Adenosine diphosphate + Phosphate + 4 Hydrogen ion + ADP <> Water +3 Hydrogen ion + Adenosine triphosphate
β-D-fructofuranose 1-phosphate + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + Fructose 1,6-bisphosphate + ADP + Fructose 1,6-bisphosphate
a glycerophosphodiester + Water > Hydrogen ion + Alcohol + Glycerol 3-phosphate
sn-glycero-3-phosphocholine + Water > Hydrogen ion + Benzyl alcohol + Glycerol 3-phosphate
sn-glycero-3-phosphoethanolamine + Water > Benzyl alcohol + Hydrogen ion + Glycerol 3-phosphate
Glycerophosphoglycerol + Water > Benzyl alcohol + Hydrogen ion + Glycerol 3-phosphate
glycerophosphoserine + Water > Hydrogen ion + Benzyl alcohol + Glycerol 3-phosphate
Glycerol + Adenosine triphosphate > Hydrogen ion + Adenosine diphosphate + Glycerol 3-phosphate + ADP
UDP-N-acetyl-α-D-muramate + L-Alanine + Adenosine triphosphate + L-Alanine > Adenosine diphosphate + Phosphate + Hydrogen ion + UDP-N-Acetylmuramoyl-L-alanine + ADP
UDP-N-acetylmuramoyl-L-alanyl-D-glutamate + Meso-2,6-Diaminoheptanedioate + Adenosine triphosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamate > Adenosine diphosphate + Phosphate + Hydrogen ion + UDP-N-Acetylmuramoyl-L-alanyl-D-gamma-glutamyl-meso-2,6-diaminopimelate + ADP
UDP-N-Acetylmuramoyl-L-alanyl-D-gamma-glutamyl-meso-2,6-diaminopimelate + D-Alanyl-D-alanine + Adenosine triphosphate > Adenosine diphosphate + Phosphate + Hydrogen ion + UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine + ADP
Undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine + Uridine diphosphate-N-acetylglucosamine + Undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine > Uridine 5'-diphosphate + Hydrogen ion + lipid II(A) + Uridine 5'-diphosphate
2 lipid II(A) > Undecaprenyl diphosphate + Hydrogen ion + a peptidoglycan dimer (meso-diaminopimelate containing)
alkylsulfonate + FMNH2 + Oxygen > Betaine aldehyde + Sulfite + Flavin Mononucleotide + Water +2 Hydrogen ion + Sulfite
Butanesulfonate + Oxygen + FMNH2 > Hydrogen ion + Water + Sulfite + Flavin Mononucleotide + Betaine aldehyde + Sulfite
Oxygen + FMNH2 + 3-(N-morpholino)propanesulfonate > Sulfite + Water + Hydrogen ion + Flavin Mononucleotide + Betaine aldehyde + Sulfite
ethanesulfonate + Oxygen + FMNH2 > Hydrogen ion + Water + Flavin Mononucleotide + Sulfite + Betaine aldehyde + Sulfite
isethionate + Oxygen + FMNH2 > Betaine aldehyde + Flavin Mononucleotide + Hydrogen ion + Water + Sulfite + Sulfite
Oxygen + methanesulfonate + FMNH2 + Methanesulfonate > Hydrogen ion + Water + Flavin Mononucleotide + Sulfite + Betaine aldehyde + Sulfite
Cyanide + Thiosulfate + Cyanide + Thiosulfate > Thiocyanate + Sulfite + Hydrogen ion + Thiocyanate + Sulfite
8 5-Aminolevulinic acid >4 Hydrogen ion +8 Water +4 Porphobilinogen
Uroporphyrinogen III + 4 Hydrogen ion >4 Carbon dioxide + Coproporphyrinogen III
Uroporphyrinogen I + 4 Hydrogen ion >4 Carbon dioxide + Coproporphyrinogen I
Coproporphyrinogen III + 2 Hydrogen ion + Oxygen >2 Water +2 Carbon dioxide + Protoporphyrinogen IX
Protoporphyrin IX + Iron >2 Hydrogen ion + ferroheme b
Uroporphyrinogen III + S-adenosyl-L-methionine > Hydrogen ion + S-Adenosylhomocysteine + Precorrin-1
Precorrin-2 + NAD > NADH + Hydrogen ion + Sirohydrochlorin
Sirohydrochlorin + Iron >2 Hydrogen ion + Siroheme
Propionyl-CoA + Water + Oxalacetic acid + Propionyl-CoA > Coenzyme A + Hydrogen ion + 2-Methylcitric acid + Methylcitric acid
Methylmalonyl-CoA + Hydrogen ion > Carbon dioxide + Propionyl-CoA + Propionyl-CoA
UDP-Glucose + Alpha-D-glucose 6-phosphate > Uridine 5'-diphosphate + Trehalose 6-phosphate + Hydrogen ion + Uridine 5'-diphosphate
Carbamoylphosphate + L-Aspartic acid + L-Aspartic acid > Phosphate + Hydrogen ion + N-carbamoyl-L-aspartate
N-carbamoyl-L-aspartate + Hydrogen ion > Water + 4,5-Dihydroorotic acid + 4,5-Dihydroorotic acid
Orotidylic acid + Hydrogen ion > Carbon dioxide + Uridine 5'-monophosphate
Uridine triphosphate + L-Glutamine + Water + Adenosine triphosphate + Uridine triphosphate > Adenosine diphosphate + Hydrogen ion + Phosphate + L-Glutamic acid + Cytidine triphosphate + ADP + L-Glutamate
Deoxyuridine triphosphate + Water > Phosphate + Hydrogen ion + dUMP
dCTP + Water + Hydrogen ion > Ammonium + Deoxyuridine triphosphate
L-Serine + L-Serine > Water + Hydrogen ion + 2-Aminoacrylic acid
L-Serine + L-Serine > Water + Hydrogen ion + 2-Aminoacrylic acid
NADPH + Hydrogen ion + 1-Deoxy-D-xylulose 5-phosphate + NADPH + 1-Deoxy-D-xylulose 5-phosphate > NADP + 2-C-methyl-D-erythritol 4-phosphate
2-C-methyl-D-erythritol 4-phosphate + Cytidine triphosphate + Hydrogen ion > Pyrophosphate + 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol
D-Ribulose 5-phosphate > 1-Deoxy-L-glycero-tetrulose 4-phosphate + Formic acid + Hydrogen ion
4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Adenosine triphosphate + 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol > Adenosine diphosphate + Hydrogen ion + 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + ADP + 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol
2-C-Methyl-D-erythritol-2,4-cyclodiphosphate + a reduced flavodoxin > Water + Hydrogen ion + an oxidized flavodoxin + 1-Hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate
1-Hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate + Hydrogen ion + NADPH + NADPH > Water + NADPH + Isopentenyl pyrophosphate + Isopentenyl pyrophosphate
1-Hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate + Hydrogen ion + NADPH + NADPH > NADP + Water + Dimethylallylpyrophosphate + Dimethylallylpyrophosphate
N-acetyl-α-D-glucosaminyl-diphospho-ditrans,octacis-undecaprenol + UDP-ManNAcA > Uridine 5'-diphosphate + Hydrogen ion + Undecaprenyl N-acetyl-glucosaminyl-N-acetyl-mannosaminuronate pyrophosphate + Uridine 5'-diphosphate + Undecaprenyl-diphospho-N-acetylglucosamine-N-acetylmannosaminuronate
Undecaprenyl N-acetyl-glucosaminyl-N-acetyl-mannosaminuronate pyrophosphate + TDP-Fuc4NAc + Undecaprenyl-diphospho-N-acetylglucosamine-N-acetylmannosaminuronate > Hydrogen ion + dTDP + Undecaprenyl N-acetyl-glucosaminyl-N-acetyl-mannosaminuronate-4-acetamido-4,6-dideoxy-D-galactose pyrophosphate + Undecaprenyl-diphospho N-acetylglucosamine-N-acetylmannosaminuronate-N-acetamido-4,6-dideoxy-D-galactose
Acetyl-CoA + dTDP-thomosamine > TDP-Fuc4NAc + Coenzyme A + Hydrogen ion
Thymidine 5'-triphosphate + Hydrogen ion + Glucose 1-phosphate > Pyrophosphate + dTDP-D-Glucose
Glucose 1-phosphate + Thymidine 5'-triphosphate + Hydrogen ion > Pyrophosphate + dTDP-D-Glucose
D-Glyceraldehyde 3-phosphate + Hydrogen ion + D-Glyceraldehyde 3-phosphate > Carbon dioxide + 1-Deoxy-D-xylulose 5-phosphate + 1-Deoxy-D-xylulose 5-phosphate
3-Octaprenyl-4-hydroxybenzoate + Hydrogen ion > Carbon dioxide + 2-Octaprenylphenol
2-Octaprenylphenol + Hydrogen ion + NADPH + Oxygen + NADPH > NADP + Water + 2-Octaprenyl-6-hydroxyphenol + 2-Octaprenyl-6-hydroxyphenol
2-Octaprenyl-6-hydroxyphenol + S-adenosyl-L-methionine + 2-Octaprenyl-6-hydroxyphenol > Hydrogen ion + S-Adenosylhomocysteine + 2-methoxy-6-(all-trans-octaprenyl)phenol
3-demethylubiquinol-8 + S-adenosyl-L-methionine > Hydrogen ion + S-Adenosylhomocysteine + Ubiquinol 8 + Ubiquinol-8
Hydrogen ion + NADPH + Oxygen + 2-methoxy-6-(all-trans-octaprenyl)phenol + NADPH > Water + NADP + 2-Octaprenyl-6-methoxy-1,4-benzoquinol
2-Octaprenyl-6-methoxy-1,4-benzoquinol + S-adenosyl-L-methionine > S-Adenosylhomocysteine + Hydrogen ion + 6-Methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol
2-Demethylmenaquinol 8 + S-adenosyl-L-methionine > Hydrogen ion + S-Adenosylhomocysteine + Menaquinol 8
3-(3-Hydroxyphenyl)propanoic acid + NADH + Hydrogen ion + Oxygen > 3-(2,3-Dihydroxyphenyl)propionic acid + NAD + Water
3-Hydroxycinnamic acid + Hydrogen ion + NADH + Oxygen > NAD + Water + 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid + 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid
trans-Octadec-2-enoyl-CoA + Water + Trans-Octadec-2-enoyl-CoA > Coenzyme A + Hydrogen ion + Elaidic acid
Cytosine + Hydrogen ion + Water > Ammonium + Uracil
a [protein]-(L-serine/L-threonine) + Adenosine triphosphate > a [protein]-(L-serine/L-threonine) phosphate + Adenosine diphosphate + Hydrogen ion + ADP
Adenosyl cobinamide + Adenosine triphosphate + Adenosyl cobinamide > Adenosine diphosphate + Hydrogen ion + adenosylcobinamide phosphate + ADP
adenosylcobinamide phosphate + Guanosine triphosphate + Hydrogen ion > Pyrophosphate + Adenosylcobinamide-GDP + Adenosylcobinamide-GDP
Dimethylbenzimidazole + nicotinate beta-D-ribonucleotide + Nicotinamide ribotide > Hydrogen ion + Nicotinic acid + N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole
N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole + Adenosylcobinamide-GDP + Adenosylcobinamide-GDP > Hydrogen ion + GMP + Adenosylcobalamin 5'-phosphate
Fructose 6-phosphate + NADH + Hydrogen ion + Fructose 6-phosphate <> NAD + Mannitol 1-phosphate
Acetyl-CoA + L-Glutamic acid + L-Glutamate <> N-Acetyl-L-alanine + Coenzyme A + Hydrogen ion + N-Acetylglutamic acid + N-Acetyl-L-alanine + N-Acetylglutamic acid
Pseudouridine + Adenosine triphosphate + Pseudouridine > Pseudouridine 5'-phosphate + Adenosine diphosphate + Hydrogen ion + ADP
Cyclic pyranopterin monophosphate + Water + thiocarboxylated small subunit of molybdopterin synthase >4 Hydrogen ion +2 thiocarboxylated small subunit of molybdopterin synthase + Molybdopterin + Molybdopterin
Molybdopterin + Adenosine triphosphate + Hydrogen ion + Molybdopterin > Pyrophosphate + Adenylyl-molybdopterin + Adenylyl-molybdopterin
trans-Cinnamic acid + Hydrogen ion + Oxygen + NADH > cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD
NAD + cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol > NADH + Hydrogen ion + 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid + 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid
2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid + Oxygen + 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid > Hydrogen ion + 2-Hydroxy-6-ketononatrienedioate
2-Hydroxy-6-ketononatrienedioate + Water > Hydrogen ion + Fumaric acid + 2-Hydroxy-2,4-pentadienoate + 2-Hydroxy-2,4-pentadienoate
Acetaldehyde + Coenzyme A + NAD > Hydrogen ion + NADH + Acetyl-CoA
S-adenosyl-L-methionine + Hydrogen ion > Carbon dioxide + S-Adenosylmethioninamine
Putrescine + S-Adenosylmethioninamine > Spermidine + Hydrogen ion + 5'-S-methyl-5'-thioadenosine
L-Threonine + NAD + L-Threonine > Hydrogen ion + NADH + L-2-Amino-3-oxobutanoic acid
L-Tyrosine + NADPH + S-adenosyl-L-methionine + L-Tyrosine + NADPH > Hydrogen ion + NADP + L-Methionine + 5'-Deoxyadenosine + p-Cresol + 2-iminoacetate
7,8-dihydroneopterin 3'-triphosphate + Water > Acetaldehyde + Triphosphate +2 Hydrogen ion + 6-Carboxy-5,6,7,8-tetrahydropterin + Triphosphate
7-Deaza-7-carboxyguanine + Adenosine triphosphate + Ammonium > Water + Phosphate + Adenosine diphosphate + Hydrogen ion + 7-Cyano-7-carbaguanine + ADP
7-Cyano-7-carbaguanine + 3 Hydrogen ion + 2 NADPH + 2 NADPH >2 NADP + 7-Aminomethyl-7-carbaguanine
7-Cyano-7-carbaguanine + 3 Hydrogen ion + 2 NADPH + 2 NADPH > Queuine +2 NADP + Queuine
7-aminomethyl-7-deazaguanosine34 in tRNA + S-adenosyl-L-methionine > Hydrogen ion + L-Methionine + Adenine + epoxyqueuosine
Spermidine + Acetyl-CoA > N8-Acetylspermidine + Coenzyme A + Hydrogen ion
Curcumin + Hydrogen ion + NADPH + curcumin + NADPH > NADP + Dihydrocurcumin + Dihydrocurcumin
Dihydrocurcumin + Hydrogen ion + NADPH + Dihydrocurcumin + NADPH > Tetrahydrocurcumin + NADP
isochorismate + Oxoglutaric acid + Hydrogen ion + Isochorismate > Carbon dioxide + 2-Succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate
2-Succinylbenzoyl-CoA + Hydrogen ion > Water + 1,4-dihydroxy-2-naphthoyl-CoA + 1,4-Dihydroxy-2-naphthoyl-CoA
1,4-dihydroxy-2-naphthoyl-CoA + Water + 1,4-Dihydroxy-2-naphthoyl-CoA > Coenzyme A + Hydrogen ion + 1,4-dihydroxy-2-naphthoate
1,4-dihydroxy-2-naphthoate + Hydrogen ion + Farnesylfarnesylgeranyl-PP + 1,4-Dihydroxy-2-naphthoyl-CoA > Carbon dioxide + Pyrophosphate + 2-Demethylmenaquinol 8
Octaprenyl diphosphate + 1,4-dihydroxy-2-naphthoate + Hydrogen ion + Octaprenyl diphosphate + 1,4-Dihydroxy-2-naphthoyl-CoA > Carbon dioxide + Pyrophosphate + 2-Demethylmenaquinol 8
L-Arginine + Adenosine triphosphate + Water > L-Arginine + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
L-Glutamic acid + Adenosine triphosphate + Water + L-Glutamate > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Glutamic acid + ADP
L-Leucine + Adenosine triphosphate + Water > L-Leucine + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
L-Valine + Adenosine triphosphate + Water + L-Valine > L-Valine + Adenosine diphosphate + Pyrophosphate + Hydrogen ion + ADP
L-Isoleucine + Adenosine triphosphate + Water + L-Isoleucine > L-Isoleucine + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
L-Glutamine + Adenosine triphosphate + Water > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Glutamine + ADP
L-Aspartic acid + Adenosine triphosphate + Water + L-Aspartic acid > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Aspartic acid + ADP
L-Histidine + Adenosine triphosphate + Water + L-Histidine > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Histidine + ADP
L-Lysine + Adenosine triphosphate + Water + L-Lysine > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Lysine + ADP
L-Methionine + Adenosine triphosphate + Water > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Methionine + ADP
L-Proline + Adenosine triphosphate + Water + L-Proline > L-Proline + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
D-allopyranose + Adenosine triphosphate + Water > D-allopyranose + Adenosine diphosphate + Hydrogen ion + Phosphate + ADP
Lipid A-core + Adenosine triphosphate + Water > Adenosine diphosphate + Phosphate + Hydrogen ion + Lipid A-core + ADP
(2R,4S)-2-methyl-2,3,3,4-tetrahydroxytetrahydrofuran + Phosphoribosyl-ATP + Water + (2R,4S)-2-Methyl-2,3,3,4-tetrahydroxytetrahydrofuran + Phosphoribosyl-ATP > (2R,4S)-2-methyl-2,3,3,4-tetrahydroxytetrahydrofuran + Adenosine diphosphate + Hydrogen ion + Pyrophosphate + ADP
L-Methionine + Adenosine triphosphate + Water > Adenosine diphosphate + Pyrophosphate + Hydrogen ion + L-Methionine + ADP
Ferric enterobactin + Adenosine triphosphate + Water Ferric enterobactin + Adenosine diphosphate + Hydrogen ion + ADP
2 Ubiquinol-1 + Oxygen + 4 Hydrogen ion >2 Ubiquinone-1 +2 Water +4 Hydrogen ion
2 Ubiquinol-1 + Oxygen + 4 Hydrogen ion >2 Ubiquinone-1 +2 Water +4 Hydrogen ion
Oxygen + 2 Ubiquinol-1 + 4 Hydrogen ion >2 Water +4 Hydrogen ion +2 Ubiquinone-1
Oxygen + 2 Ubiquinol-1 + 4 Hydrogen ion >2 Water +4 Hydrogen ion +2 Ubiquinone-1
Oxygen + 8 Hydrogen ion + 2 Ubiquinol-1 >2 Water +8 Hydrogen ion +2 Ubiquinone-1
Oxygen + 8 Hydrogen ion + 2 Ubiquinol-1 >2 Water +8 Hydrogen ion +2 Ubiquinone-1
NADH + 5 Hydrogen ion + Ubiquinone-1 > Hydrogen ion + NAD + Ubiquinol-1
NADH + 5 Hydrogen ion + Ubiquinone-1 > Hydrogen ion + NAD + Ubiquinol-1
Adenosine triphosphate + Water + Sulfate + Sulfate > Adenosine diphosphate + Phosphate + Hydrogen ion + Sulfate + ADP
Alkyl Sulfate + Adenosine triphosphate + Water > Adenosine diphosphate + Phosphate + Hydrogen ion + Alkyl Sulfate + ADP
Adenosine triphosphate + Water + Butanesulfonate > Adenosine diphosphate + Phosphate + Hydrogen ion + Butanesulfonate + ADP
Adenosine triphosphate + Water + 3-(N-morpholino)propanesulfonate > Phosphate + Hydrogen ion + Adenosine diphosphate + 3-(N-morpholino)propanesulfonate + ADP
Adenosine triphosphate + Water + ethanesulfonate > Hydrogen ion + Phosphate + Adenosine diphosphate + ethanesulfonate + ADP
Adenosine triphosphate + Water + isethionate > Adenosine diphosphate + Hydrogen ion + Phosphate + isethionate + ADP
Adenosine triphosphate + Water + methanesulfonate + Methanesulfonate > Adenosine diphosphate + Phosphate + Hydrogen ion + methanesulfonate + ADP
Maltotetraose + Adenosine triphosphate + Water > Maltotetraose + Phosphate + Hydrogen ion + Adenosine diphosphate + ADP
Maltotriose + Adenosine triphosphate + Water > Adenosine diphosphate + Phosphate + Hydrogen ion + Maltotriose + ADP
D-Maltose + Adenosine triphosphate + Water > D-Maltose + Phosphate + Hydrogen ion + Adenosine diphosphate + ADP
Adenosine triphosphate + Water + DL-O-Phosphoserine > Hydrogen ion + Phosphate + Adenosine diphosphate + DL-O-Phosphoserine + ADP
Taurine + Adenosine triphosphate + Water > Taurine + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
Cysteine-S-sulfate + Adenosine triphosphate + Water > Cysteine-S-sulfate + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
Homocarnosine + Adenosine triphosphate + Water + Homocarnosine > Homocarnosine + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
Cobinamide + Adenosine triphosphate + Water + Cobinamide > Adenosine diphosphate + Phosphate + Hydrogen ion + Cobinamide + ADP
Cyanocobalamin + Adenosine triphosphate + Water + Cyanocobalamin > Adenosine diphosphate + Phosphate + Hydrogen ion + Cyanocobalamin + ADP
NADH + 4 Hydrogen ion + 2 Hydrogen ion + menaquinone-8 NAD + Hydrogen ion + Menaquinol 8 + Electron +4 Hydrogen ion
NADH + 4 Hydrogen ion + 2 Hydrogen ion + menaquinone-8 NAD + Hydrogen ion + Menaquinol 8 + Electron +4 Hydrogen ion
NADH + 4 Hydrogen ion + 2 Hydrogen ion + menaquinone-8 NAD + Hydrogen ion + Menaquinol 8 + Electron +4 Hydrogen ion
NADH + 4 Hydrogen ion + 2 Hydrogen ion + menaquinone-8 NAD + Hydrogen ion + Menaquinol 8 + Electron +4 Hydrogen ion
Trimethylamine N-Oxide + 3 Hydrogen ion + Menaquinol 8 + 2 Electron > Trimethylamine + Water +2 Hydrogen ion + menaquinone-8
Trimethylamine N-Oxide + 3 Hydrogen ion + Menaquinol 8 + 2 Electron > Trimethylamine + Water +2 Hydrogen ion + menaquinone-8
Hydrogen ion + Electron + 2 Hydrogen ion + menaquinone-8 > Menaquinol 8 + Hydrogen ion
Hydrogen ion + Electron + 2 Hydrogen ion + menaquinone-8 > Menaquinol 8 + Hydrogen ion
Hydrogen ion + Electron + 2 Hydrogen ion + menaquinone-8 > Menaquinol 8 + Hydrogen ion
Formic acid + menaquinone-8 + Electron + Hydrogen ion > Carbon dioxide + Hydrogen ion + Menaquinol 8
Formic acid + menaquinone-8 + Electron + Hydrogen ion > Carbon dioxide + Hydrogen ion + Menaquinol 8
Menaquinol 8 + Dimethyl sulfoxide + 2 Hydrogen ion + 2 Electron > menaquinone-8 + Dimethyl sulfide + Water +2 Hydrogen ion
Menaquinol 8 + Dimethyl sulfoxide + 2 Hydrogen ion + 2 Electron > menaquinone-8 + Dimethyl sulfide + Water +2 Hydrogen ion
1-(2-Carboxyphenylamino)-1'-deoxyribulose-5'-phosphate + Hydrogen ion > Carbon dioxide + Water + (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate + (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate
DG(17:0cycw7c/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/18:1(9Z)) + Pyrophosphate
2 DG(10:0/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion 2 CDP-DG(10:0(3-OH)/10:0) + Pyrophosphate
2 DG(10:0(3-OH)/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/12:0(3-OH)) + Pyrophosphate
2 DG(10:0(3-OH)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/12:0) + Pyrophosphate
2 DG(10:0(3-OH)/15:0cyclo/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/15:0cyclo) + Pyrophosphate
2 DG(10:0(3-OH)/16:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/16:0) + Pyrophosphate
2 DG(10:0(3-OH)/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/16:1(9Z)) + Pyrophosphate
2 DG(10:0(3-OH)/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/17:0cycw7c) + Pyrophosphate
1,2-Diacyl-sn-glycerol (ditetradecanoyl, n-C14:0) + Cytidine triphosphate + Hydrogen ion > CDP-1,2-ditetradecanoylglycerol + Pyrophosphate
2 DG(10:0(3-OH)/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/19:0cycv8c) + Pyrophosphate
2 DG(10:0(3-OH)/19:iso/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(10:0(3-OH)/19:iso) + Pyrophosphate
2 DG(10:0/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0/10:0(3-OH)) + Pyrophosphate
2 DG(10:0/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0/12:0(3-OH)) + Pyrophosphate
DG(10:0/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(10:0/17:0cycw7c) + Pyrophosphate
2 1,2-Diacyl-sn-glycerol (ditetradecanoyl, n-C14:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-1,2-ditetradecanoylglycerol + Pyrophosphate
2 DG(12:0(3-OH)/10:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/10:0(3-OH)) + Pyrophosphate
2 DG(12:0(3-OH)/10:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/10:0) + Pyrophosphate
DG(12:0(3-OH)/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0(3-OH)/12:0(3-OH)) + Pyrophosphate
2 DG(12:0/12:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-1,2-didodecanoylglycerol + Pyrophosphate
DG(12:0(3-OH)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0(3-OH)/12:0) + Pyrophosphate
2 DG(12:0(3-OH)/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/14:0(3-OH)) + Pyrophosphate
2 DG(12:0(3-OH)/14:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/14:0) + Pyrophosphate
2 DG(12:0(3-OH)/15:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/15:0) + Pyrophosphate
2 DG(12:0(3-OH)/15:0cyclo/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/15:0cyclo) + Pyrophosphate
2 DG(12:0(3-OH)/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/17:0cycw7c) + Pyrophosphate
DG(12:0(3-OH)/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0(3-OH)/17:0cycw7c) + Pyrophosphate
2 DG(12:0(3-OH)/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/18:1(9Z)) + Pyrophosphate
2 DG(12:0(3-OH)/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/19:0cycv8c) + Pyrophosphate
2 DG(12:0(3-OH)/19:iso/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/19:iso) + Pyrophosphate
2 DG(12:0/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0/10:0(3-OH)) + Pyrophosphate
DG(12:0/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0/12:0(3-OH)) + Pyrophosphate
2 DG(12:0/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0/14:0(3-OH)) + Pyrophosphate
DG(12:0/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0/17:0cycw7c) + Pyrophosphate
2 DG(12:0/19:iso/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0/19:iso) + Pyrophosphate
2 DG(14:0(3-OH)/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(14:0(3-OH)/12:0(3-OH)) + Pyrophosphate
2 DG(14:0(3-OH)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(14:0(3-OH)/12:0) + Pyrophosphate
DG(14:0(3-OH)/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(14:0(3-OH)/14:0(3-OH)) + Pyrophosphate
DG(14:0(3-OH)/14:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(14:0(3-OH)/14:0) + Pyrophosphate
DG(14:0(3-OH)/16:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(14:0(3-OH)/16:0) + Pyrophosphate
2 DG(14:0(3-OH)/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(14:0(3-OH)/16:1(9Z)) + Pyrophosphate
2 DG(14:0(3-OH)/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(14:0(3-OH)/17:0cycw7c) + Pyrophosphate
2 DG(14:0/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(14:0/12:0(3-OH)) + Pyrophosphate
DG(14:0/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(14:0/14:0(3-OH)) + Pyrophosphate
2 DG(15:0/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(15:0/10:0(3-OH)) + Pyrophosphate
2 DG(15:0/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(15:0/12:0(3-OH)) + Pyrophosphate
DG(15:0/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion > Pyrophosphate + CDP-DG(15:0/14:0(3-OH))
2 DG(15:0cyclo/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(15:0cyclo/10:0(3-OH)) + Pyrophosphate
2 DG(16:0/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(16:0/10:0(3-OH)) + Pyrophosphate
2 DG(16:0/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(16:0/14:0(3-OH)) + Pyrophosphate
2 DG(16:1(9Z)/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(16:1(9Z)/14:0(3-OH)) + Pyrophosphate
2 DG(16:1(9Z)/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(16:1(9Z)/17:0cycw7c) + Pyrophosphate
DG(16:1(9Z)/0:0/19:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:1(9Z)/19:0) + Pyrophosphate
DG(17:0/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0/16:1(9Z)) + Pyrophosphate
2 DG(17:0cycw7c/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(17:0cycw7c/10:0(3-OH)) + Pyrophosphate
DG(17:0cycw7c/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/10:0) + Pyrophosphate
2 DG(17:0cycw7c/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(17:0cycw7c/12:0(3-OH)) + Pyrophosphate
CDP-1,2-ditetradecanoylglycerol + L-Serine + L-Serine > PS(14:0/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/17:0cycw7c) + L-Serine + L-Serine > PS(10:0/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0(3-OH)/12:0(3-OH)) + L-Serine + L-Serine > PS(12:0(3-OH)/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0(3-OH)/12:0) + L-Serine + L-Serine > PS(12:0(3-OH)/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0(3-OH)/17:0cycw7c) + L-Serine + L-Serine > PS(12:0(3-OH)/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/12:0(3-OH)) + L-Serine + L-Serine > PS(12:0/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/17:0cycw7c) + L-Serine + L-Serine > PS(12:0/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0(3-OH)/14:0(3-OH)) + L-Serine + L-Serine > PS(14:0(3-OH)/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0(3-OH)/14:0) + L-Serine + L-Serine > PS(14:0(3-OH)/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0(3-OH)/16:0) + L-Serine + L-Serine > PS(14:0(3-OH)/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0(3-OH)/16:1(9Z)) + L-Serine + L-Serine > PS(14:0(3-OH)/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/14:0(3-OH)) + L-Serine + L-Serine > PS(14:0/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(15:0/14:0(3-OH)) + L-Serine + L-Serine > PS(15:0/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:0/12:0) + L-Serine + L-Serine > PS(16:0/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:1(9Z)/14:0(3-OH)) + L-Serine + L-Serine > PS(16:1(9Z)/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:1(9Z)/19:0) + L-Serine + L-Serine > PS(16:1(9Z)/19:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(17:0/16:1(9Z)) + L-Serine + L-Serine > PS(17:0/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(17:0cycw7c/10:0(3-OH)) + L-Serine + L-Serine > PS(17:0cycw7c/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
PS(10:0/17:0cycw7c) + Hydrogen ion > PE(10:0/17:0cycw7c) + Carbon dioxide
PS(12:0(3-OH)/12:0(3-OH)) + Hydrogen ion > PE(12:0(3-OH)/12:0(3-OH)) + Carbon dioxide
PS(12:0(3-OH)/12:0) + Hydrogen ion > PE(12:0(3-OH)/12:0) + Carbon dioxide
PS(12:0(3-OH)/17:0cycw7c) + Hydrogen ion > PE(12:0(3-OH)/17:0cycw7c) + Carbon dioxide
PS(12:0/12:0(3-OH)) + Hydrogen ion > PE(12:0/12:0(3-OH)) + Carbon dioxide
PS(12:0/17:0cycw7c) + Hydrogen ion > PE(12:0/17:0cycw7c) + Carbon dioxide
PS(14:0(3-OH)/14:0(3-OH)) + Hydrogen ion > PE(14:0(3-OH)/14:0(3-OH)) + Carbon dioxide
PS(14:0(3-OH)/14:0) + Hydrogen ion > PE(14:0(3-OH)/14:0) + Carbon dioxide
PS(14:0(3-OH)/16:0) + Hydrogen ion PE(14:0(3-OH)/16:0) + Carbon dioxide
PS(14:0(3-OH)/16:1(9Z)) + Hydrogen ion > PE(14:0(3-OH)/16:1(9Z)) + Carbon dioxide
PS(14:0/14:0(3-OH)) + Hydrogen ion > PE(14:0/14:0(3-OH)) + Carbon dioxide
PS(15:0/14:0(3-OH)) + Hydrogen ion > PE(15:0/14:0(3-OH)) + Carbon dioxide
PS(16:0/12:0) + Hydrogen ion > PE(16:0/12:0) + Carbon dioxide
PS(16:1(9Z)/10:0) + Hydrogen ion > PE(16:1(9Z)/10:0) + Carbon dioxide
PS(16:1(9Z)/12:0) + Hydrogen ion > PE(16:1(9Z)/12:0) + Carbon dioxide
PS(16:1(9Z)/14:0(3-OH)) + Hydrogen ion > PE(16:1(9Z)/14:0(3-OH)) + Carbon dioxide
PS(14:0/17:0cycw7c) + Hydrogen ion PE(14:0(3-OH)/17:0cycw7c) + Carbon dioxide
PS(16:1(9Z)/19:0) + Hydrogen ion > PE(16:1(9Z)/19:0) + Carbon dioxide
PS(17:0/16:1(9Z)) + Hydrogen ion > PE(17:0/16:1(9Z)) + Carbon dioxide
PS(17:0cycw7c/10:0(3-OH)) + Hydrogen ion > PE(17:0cycw7c/10:0(3-OH)) + Carbon dioxide
PS(12:0/12:0) + Hydrogen ion > PE(12:0/12:0) + Carbon dioxide
2 CDP-DG(18:1(9Z)/19:0cycv8c) + Glycerol 3-phosphate >2 PGP(18:1(9Z)/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/10:0) + Glycerol 3-phosphate >2 PGP(10:0(3-OH)/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(10:0(3-OH)/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/12:0) + Glycerol 3-phosphate >2 PGP(10:0(3-OH)/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/15:0cyclo) + Glycerol 3-phosphate >2 PGP(10:0(3-OH)/15:0cyclo) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/16:0) + Glycerol 3-phosphate >2 PGP(10:0(3-OH)/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/16:1(9Z)) + Glycerol 3-phosphate > PGP(10:0(3-OH)/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/17:0cycw7c) + Glycerol 3-phosphate >2 PGP(10:0(3-OH)/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/19:0cycv8c) + Glycerol 3-phosphate >2 PGP(10:0(3-OH)/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/19:iso) + Glycerol 3-phosphate >2 PGP(10:0(3-OH)/19:iso) + Cytidine triphosphate + Hydrogen ion
2 CDP-DG(10:0/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(10:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(10:0/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-1,2-ditetradecanoylglycerol + Glycerol 3-phosphate >2 PGP(14:0/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/10:0) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-1,2-didodecanoylglycerol + Glycerol 3-phosphate >2 PGP(12:0/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/14:0(3-OH)) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/14:0) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/15:0) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/15:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/15:0cyclo) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/15:0cyclo) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/17:0cycw7c) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/18:1(9Z)) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/19:0cycv8c) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/19:iso) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(12:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0/14:0(3-OH)) + Glycerol 3-phosphate >2 PGP(12:0/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0/19:iso) + Glycerol 3-phosphate >2 PGP(12:0/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(14:0(3-OH)/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(14:0(3-OH)/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(14:0(3-OH)/12:0) + Glycerol 3-phosphate >2 PGP(14:0(3-OH)/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(14:0(3-OH)/16:1(9Z)) + Glycerol 3-phosphate >2 PGP(14:0(3-OH)/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(14:0(3-OH)/17:0cycw7c) + Glycerol 3-phosphate >2 PGP(14:0(3-OH)/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(14:0/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(14:0/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(15:0/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(15:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(15:0/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(15:0/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(15:0cyclo/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(15:0cyclo/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(16:0/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(16:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(16:0/14:0(3-OH)) + Glycerol 3-phosphate >2 PGP(16:0/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(16:1(9Z)/14:0(3-OH)) + Glycerol 3-phosphate >2 PGP(16:1(9Z)/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(16:1(9Z)/17:0cycw7c) + Glycerol 3-phosphate >2 PGP(16:1(9Z)/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(17:0cycw7c/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(17:0cycw7c/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(17:0cycw7c/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(17:0cycw7c/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
Guanosine triphosphate + 3 Water > Formic acid + Pyrophosphate +2 Hydrogen ion + 2,5-Diamino-6-(5'-phosphoribosylamino)-4-pyrimidineone
1-Amino-2-propanol + NAD + 4,5-Dihydro-4-hydroxy-5-S-glutathionyl-benzo[a]pyrene < NADH + Hydrogen ion + Aminoacetone
Ferric enterobactin + 3 Water >3 2,3-Dihydroxybenzoylserine + Fe3+ +3 Hydrogen ion
DG(17:0cycw7c/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/12:0) + Pyrophosphate
2 DG(17:0cycw7c/19:iso/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(17:0cycw7c/19:iso) + Pyrophosphate
DG(18:1(11Z)/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(11Z)/10:0) + Pyrophosphate
DG(18:1(11Z)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(11Z)/12:0) + Pyrophosphate
DG(18:1(11Z)/17:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(11Z)/17:0) + Pyrophosphate
2 DG(18:1(11Z)/19:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(18:1(11Z)/19:0) + Pyrophosphate
2 CDP-DG(18:1(11Z)/19:0) + Cytidine triphosphate + Hydrogen ion >2 PGP(18:1(11Z)/19:0) + Pyrophosphate
2 DG(18:1(9Z)/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(18:1(9Z)/12:0(3-OH)) + Pyrophosphate
2 DG(19:0/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0/16:1(9Z)) + Pyrophosphate
2 DG(19:0/18:1(11Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0/18:1(11Z)) + Pyrophosphate
2 DG(19:0cycv8c/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0cycv8c/10:0(3-OH)) + Pyrophosphate
2 DG(19:0cycv8c/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0cycv8c/12:0(3-OH)) + Pyrophosphate
DG(19:0cycw8c/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:0cycw8c/10:0) + Pyrophosphate
2 DG(19:1(9Z)/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:1(9Z)/16:1(9Z)) + Pyrophosphate
2 DG(19:iso/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/10:0(3-OH)) + Pyrophosphate
2 DG(19:iso/10:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/10:0) + Pyrophosphate
2 DG(19:iso/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/12:0(3-OH)) + Pyrophosphate
2 DG(19:iso/12:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/12:0) + Pyrophosphate
2 DG(19:iso/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/14:0(3-OH)) + Pyrophosphate
2 DG(19:iso/14:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/14:0) + Pyrophosphate
2 DG(19:iso/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/17:0cycw7c) + Pyrophosphate
2 DG(19:iso/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/19:0cycv8c) + Pyrophosphate
2 DG(19:iso/19:iso/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/19:iso) + Pyrophosphate
CDP-DG(17:0cycw7c/12:0) + L-Serine + L-Serine > PS(17:0cycw7c/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:1(11Z)/10:0) + L-Serine + L-Serine > PS(18:1(11Z)/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:1(11Z)/12:0) + L-Serine + L-Serine > PS(18:1(11Z)/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:1(11Z)/17:0) + L-Serine + L-Serine > PS(18:1(11Z)/17:0) + Cytidine triphosphate + Hydrogen ion
CDP-DG(18:1(11Z)/19:0) + L-Serine + L-Serine > PS(18:1(11Z)/19:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:0cycw8c/10:0) + L-Serine + L-Serine > PS(19:0cycw8c/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
PS(17:0cycw7c/12:0) + Hydrogen ion > PE(17:0cycw7c/12:0) + Carbon dioxide
PS(18:0/10:0) + Hydrogen ion > PE(18:0/10:0) + Carbon dioxide
PS(18:0/12:0) + Hydrogen ion > PE(18:0/12:0) + Carbon dioxide
PS(18:1(11Z)/10:0) + Hydrogen ion > PE(18:1(11Z)/10:0) + Carbon dioxide
PS(18:1(11Z)/12:0) + Hydrogen ion > PE(18:1(11Z)/12:0) + Carbon dioxide
PS(18:1(11Z)/17:0) + Hydrogen ion > PE(18:1(11Z)/17:0) + Carbon dioxide
PS(18:1(11Z)/19:0) + Hydrogen ion > PE(18:1(11Z)/19:0) + Carbon dioxide
PS(19:0cycw8c/10:0) + Hydrogen ion > PE(19:0cycw8c/10:0) + Carbon dioxide
PS(19:0/19:0) + Hydrogen ion > PE(19:0/19:0) + Carbon dioxide
2 CDP-DG(17:0cycw7c/19:iso) + Glycerol 3-phosphate >2 PGP(17:0cycw7c/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(18:1(9Z)/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(18:1(9Z)/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0/16:1(9Z)) + Glycerol 3-phosphate >2 PGP(19:0/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0/18:1(11Z)) + Glycerol 3-phosphate >2 PGP(19:0/18:1(11Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0cycv8c/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(19:0cycv8c/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0cycv8c/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(19:0cycv8c/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:1(9Z)/16:1(9Z)) + Glycerol 3-phosphate >2 PGP(19:1(9Z)/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:iso/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(19:iso/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:iso/10:0) + Glycerol 3-phosphate >2 PGP(19:iso/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:iso/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(19:iso/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:iso/12:0) + Glycerol 3-phosphate >2 PGP(19:iso/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:iso/14:0(3-OH)) + Glycerol 3-phosphate >2 PGP(19:iso/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:iso/14:0) + Glycerol 3-phosphate >2 PGP(19:iso/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:iso/17:0cycw7c) + Glycerol 3-phosphate >2 PGP(19:iso/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:iso/19:0cycv8c) + Glycerol 3-phosphate >2 PGP(19:iso/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:iso/19:iso) + Glycerol 3-phosphate >2 PGP(19:iso/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
Guanosine triphosphate + Water > 2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Hydrogen ion + Formic acid + Pyrophosphate
2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Water + Hydrogen ion > 5-Amino-6-(5'-phosphoribosylamino)uracil + Ammonium
2,5-Diamino-6-(5'-phosphoribosylamino)-4-pyrimidineone + Water + Hydrogen ion > Ammonium + 5-Amino-6-(5'-phosphoribosylamino)uracil
5-Amino-6-(5'-phosphoribosylamino)uracil + Hydrogen ion + NADPH + NADPH > NADP + 5-Amino-6-(5'-phosphoribitylamino)uracil + 5-Amino-6-(5'-phosphoribitylamino)uracil
5-Amino-6-ribitylamino uracil + 1-Deoxy-L-glycero-tetrulose 4-phosphate > Water + Phosphate + Hydrogen ion + 6,7-Dimethyl-8-(1-D-ribityl)lumazine + 6,7-Dimethyl-8-(1-D-ribityl)lumazine
D-Ribulose 5-phosphate > Formic acid + Hydrogen ion + 1-Deoxy-L-glycero-tetrulose 4-phosphate
6,7-Dimethyl-8-(1-D-ribityl)lumazine + Hydrogen ion + 6,7-Dimethyl-8-(1-D-ribityl)lumazine > Riboflavin + 5-Amino-6-ribitylamino uracil + Riboflavin
Riboflavin + Adenosine triphosphate + Riboflavin > Adenosine diphosphate + Hydrogen ion + Flavin Mononucleotide + ADP
Flavin Mononucleotide + Hydrogen ion + Adenosine triphosphate > Pyrophosphate + FAD
2,5-Diketo-D-gluconate + NADPH + Hydrogen ion + NADPH > NADP + 5-Keto-D-gluconate + 5-Keto-D-gluconate
2-Keto-L-gluconate + Hydrogen ion + NADPH + 2-Dehydro-D-gluconate + NADPH > NADP + L-Idonate
2,5-Diketo-D-gluconate + Hydrogen ion + NADPH + NADPH > NADP + 2-Keto-L-gluconate + 2-Dehydro-D-gluconate
L-Idonate + NADP > Hydrogen ion + NADPH + 5-Keto-D-gluconate + NADPH + 5-Keto-D-gluconate
2-Keto-L-gluconate + NADPH + Hydrogen ion + 2-Dehydro-D-gluconate + NADPH > Gluconic acid + NADP
2 DG(16:0/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(16:0/17:0cycw7c) + Pyrophosphate
DG(18:1(9Z)/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(9Z)/17:0cycw7c) + Pyrophosphate
DG(14:0/15:0cyclo/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(14:0/15:0cyclo) + Pyrophosphate
DG(14:0/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion + DG(14:0/16:1(9Z)/0:0) > CDP-DG(14:0/16:1(9Z)) + Pyrophosphate
DG(14:0/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(14:0/19:0cycv8c) + Pyrophosphate
DG(14:0/19:0cycw8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(14:0/19:0cycw8c) + Pyrophosphate
DG(15:0cyclo/14:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(15:0cyclo/14:0) + Pyrophosphate
DG(15:0cyclo/15:0cyclo/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(15:0cyclo/15:0cyclo) + Pyrophosphate
2 DG(15:0cyclo/16:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(15:0cyclo/16:0) + Pyrophosphate
DG(15:0cyclo/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(15:0cyclo/17:0cycw7c) + Pyrophosphate
DG(15:0cyclo/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(15:0cyclo/19:0cycv8c) + Pyrophosphate
2 DG(16:0/14:0/0:0) + Cytidine triphosphate + Hydrogen ion + 2 DG(16:0/14:0/0:0) >2 CDP-DG(16:0/14:0) + Pyrophosphate
DG(16:0/15:0cyclo/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:0/15:0cyclo) + Pyrophosphate
2 DG(16:0/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion + 2 DG(16:0/16:1(9Z)/0:0) >2 CDP-DG(16:0/16:1(9Z)) + Pyrophosphate
2 DG(16:0/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion + 2 DG(16:0/18:1(9Z)/0:0) >2 CDP-DG(16:0/18:1(9Z)) + Pyrophosphate +2 CDP-DG(16:0/18:1(9Z))
DG(16:0/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:0/19:0cycv8c) + Pyrophosphate
DG(16:0/19:0cycw8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:0/19:0cycw8c) + Pyrophosphate
2 DG(16:1(9Z)/14:0/0:0) + Cytidine triphosphate + Hydrogen ion + 2 DG(16:1(9Z)/14:0/0:0) >2 CDP-DG(16:1(9Z)/14:0) + Pyrophosphate
2 DG(16:1(9Z)/16:0/0:0) + Cytidine triphosphate + Hydrogen ion + 2 DG(16:1(9Z)/16:0/0:0) >2 CDP-DG(16:1(9Z)/16:0) + Pyrophosphate
2 1,2-Diacyl-sn-glycerol (dihexadec-9-enoyl, n-C16:1) + Cytidine triphosphate + Hydrogen ion >2 CDP-1,2-dihexadec-9-enoylglycerol + Pyrophosphate
DG(16:1(9Z)/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:1(9Z)/19:0cycv8c) + Pyrophosphate
DG(16:1(9Z)/19:0cycw8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:1(9Z)/19:0cycw8c) + Pyrophosphate
DG(17:0cycw7c/14:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/14:0) + Pyrophosphate
DG(17:0cycw7c/15:0cyclo/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/15:0cyclo) + Pyrophosphate
DG(17:0cycw7c/16:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/16:0) + Pyrophosphate
DG(18:1(11Z)/0:0/18:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(11Z)/18:0) + Pyrophosphate
DG(18:1(11Z)/0:0/18:1(9Z)) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(11Z)/18:1(9Z)) + Pyrophosphate
DG(18:1(9Z)/15:0cyclo/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(9Z)/15:0cyclo) + Pyrophosphate
PS(18:1(9Z)/17:0cycw7c) + Hydrogen ion > PE(18:1(9Z)/17:0cycw7c) + Carbon dioxide
2 CDP-DG(16:0/16:0) + Glycerol 3-phosphate + 2 CDP-DG(16:0/16:0) >2 PGP(16:0/16:0) + Cytidine monophosphate + Hydrogen ion
2 CDP-DG(18:1(9Z)/18:1(9Z)) + Glycerol 3-phosphate >2 PGP(18:1(9Z)/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion
5-Keto-D-gluconate + Hydrogen ion + NADPH + 5-Keto-D-gluconate + NADPH > NADP + Gluconic acid
Gluconic acid + Adenosine triphosphate > ADP + Hydrogen ion + gluconate 6-phosphate
DG(18:1(9Z)/19:0cycw8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(9Z)/19:0cycw8c) + Pyrophosphate + Pyrophosphate
2 DG(15:0cyclo/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(15:0cyclo/16:0) + Pyrophosphate + Pyrophosphate
2 DG(15:0cyclo/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(18:1(9Z)/18:1(9Z)) + Pyrophosphate + Pyrophosphate
DG(16:1(9Z)/19:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:1(9Z)/19:0) + Pyrophosphate + Pyrophosphate
PS(17:0cycw7c/14:0) + Hydrogen ion > PE(17:0cycw7c/14:0) + Carbon dioxide
PS(16:0/17:0cycw7c) + Hydrogen ion > PE(15:0/17:0cycw7c) + Carbon dioxide
PS(16:0/18:1(11Z)) + Hydrogen ion > PE(16:0/18:1(11Z)) + Carbon dioxide
PS(16:0/19:0cycw8c) + Hydrogen ion > PE(16:0/19:0cycw8c) + Carbon dioxide
PS(19:iso/19:0cycv8c) + Hydrogen ion > PE(19:iso/19:0cycv8c) + Carbon dioxide
PS(19:iso/17:0cycw7c) + Hydrogen ion > PE(19:iso/17:0cycw7c) + Carbon dioxide
PS(10:0(3-OH)/17:0cycw7c) + Hydrogen ion > PE(10:0(3-OH)/17:0cycw7c) + Carbon dioxide
PS(14:0(3-OH)/18:1(9Z)) + Hydrogen ion > PE(14:0(3-OH)/18:1(9Z)) + Carbon dioxide
PS(18:1(9Z)/14:0(3-OH)) + Hydrogen ion > PE(18:1(9Z)/14:0(3-OH)) + Carbon dioxide
PS(14:0/15:0cyclo) + Hydrogen ion > PE(14:0/15:0cyclo) + Carbon dioxide
PS(15:0cyclo/14:0) + Hydrogen ion > PE(15:0cyclo/14:0) + Carbon dioxide
PS(14:0/19:0cycv8c) + Hydrogen ion > PE(14:0/19:0cycv8c) + Carbon dioxide
PS(14:0/19:0cycw8c) + Hydrogen ion > PE(14:0/19:0cycw8c) + Carbon dioxide
PS(15:0cyclo/15:0cyclo) + Hydrogen ion > PE(15:0cyclo/15:0cyclo) + Carbon dioxide
PS(15:0cyclo/16:0) + Hydrogen ion > PE(15:0cyclo/16:0) + Carbon dioxide
PS(15:0cyclo/17:0cycw7c) + Hydrogen ion > PE(15:0cyclo/17:0cycw7c) + Carbon dioxide
PS(17:0cycw7c/15:0cyclo) + Hydrogen ion > PE(17:0cycw7c/15:0cyclo) + Carbon dioxide
PS(15:0cyclo/19:0cycv8c) + Hydrogen ion > PE(15:0cyclo/19:0cycv8c) + Carbon dioxide
PS(19:0cycv8c/15:0cyclo) + Hydrogen ion > PE(19:0cycv8c/15:0cyclo) + Carbon dioxide
PS(16:0/14:0(3-OH)) + Hydrogen ion > PE(16:0/14:0(3-OH)) + Carbon dioxide
PS(16:0/19:0) + Hydrogen ion > PE(16:0/19:0) + Carbon dioxide
PS(16:0/19:0cycv8c) + Hydrogen ion > PE(16:0/19:0cycv8c) + Carbon dioxide
PS(16:1(9Z)/17:0cycw7c) + Hydrogen ion > PE(16:1(9Z)/17:0cycw7c) + Carbon dioxide
PS(16:1(9Z)/18:1(11Z)) + Hydrogen ion > PE(16:1(9Z)/18:1(11Z)) + Carbon dioxide
PS(18:1(11Z)/16:1(9Z)) + Hydrogen ion > PE(18:1(11Z)/16:1(9Z)) + Carbon dioxide
PS(16:1(9Z)/19:0cycv8c) + Hydrogen ion > PE(16:1(9Z)/19:0cycv8c) + Carbon dioxide
PS(16:1(9Z)/19:0cycw8c) + Hydrogen ion > PE(16:1(9Z)/19:0cycw8c) + Carbon dioxide
PS(17:0cycw7c/12:0(3-OH)) + Hydrogen ion > PE(17:0cycw7c/12:0(3-OH)) + Carbon dioxide
PS(17:0cycw7c/16:0) + Hydrogen ion > PE(17:0cycw7c/16:0) + Carbon dioxide
PS(18:1(11Z)/16:0) + Hydrogen ion > PE(18:1(11Z)/16:0) + Carbon dioxide
PS(18:1(11Z)/18:1(11Z)) + Hydrogen ion > PE(18:1(11Z)/18:1(11Z)) + Carbon dioxide
PS(18:1(9Z)/15:0cyclo) + Hydrogen ion > PE(18:1(9Z)/15:0cyclo) + Carbon dioxide
PS(18:1(9Z)/19:0cycv8c) + Hydrogen ion > PE(18:1(9Z)/19:0cycv8c) + Carbon dioxide
PS(18:1(9Z)/19:0cycw8c) + Hydrogen ion > PE(18:1(9Z)/19:0cycw8c) + Carbon dioxide
PS(19:0cycv8c/18:1(9Z)) + Hydrogen ion > PE(19:0cycv8c/18:1(9Z)) + Carbon dioxide
PS(19:0/14:0) + Hydrogen ion > PE(19:0/14:0) + Carbon dioxide
PS(19:0/16:1(9Z)) + Hydrogen ion > PE(19:0/16:1(9Z)) + Carbon dioxide
PS(19:0/18:1(11Z)) + Hydrogen ion > PE(19:0/18:1(11Z)) + Carbon dioxide
PS(19:0cycv8c/10:0(3-OH)) + Hydrogen ion > PE(19:0cycv8c/10:0(3-OH)) + Carbon dioxide
PS(19:0cycv8c/12:0(3-OH)) + Hydrogen ion > PE(19:0cycv8c/12:0(3-OH)) + Carbon dioxide
PS(19:iso/10:0(3-OH)) + Hydrogen ion > PE(19:iso/10:0(3-OH)) + Carbon dioxide
PS(19:iso/12:0(3-OH)) + Hydrogen ion > PE(19:iso/12:0(3-OH)) + Carbon dioxide
PS(19:iso/14:0(3-OH)) + Hydrogen ion > PE(19:iso/14:0(3-OH)) + Carbon dioxide
PS(19:iso/14:0) + Hydrogen ion > PE(19:iso/14:0) + Carbon dioxide
Homocysteine + S-Methylmethionine <>2 L-Methionine + Hydrogen ion
Sorbitol-6-phosphate + NAD <> Fructose 6-phosphate + NADH + Hydrogen ion
Quinate + NADP <> 3-Dehydroquinate + NADPH + Hydrogen ion
2 DG(18:1(11Z)/0:0/18:1(9Z)) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(18:1(11Z)/18:1(9Z)) + Pyrophosphate
2 DG(18:1(9Z)/0:0/18:1(11Z)) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(18:1(9Z)/18:1(11Z)) + Pyrophosphate
2 CDP-DG(18:1(11Z)/18:1(11Z)) + Glycerol 3-phosphate >2 PGP(18:1(11Z)/18:1(11Z)) + Cytidine monophosphate + Hydrogen ion
2 CDP-DG(18:1(11Z)/18:1(9Z)) + Glycerol 3-phosphate >2 PGP(18:1(11Z)/18:1(11Z)) + Cytidine monophosphate + Hydrogen ion
2 CDP-DG(18:1(9Z)/18:1(11Z)) + Glycerol 3-phosphate >2 PGP(18:1(11Z)/18:1(11Z)) + Cytidine monophosphate + Hydrogen ion
Precorrin 2 + NAD <> Sirohydrochlorin + NADH +2 Hydrogen ion
Trimethylamine N-Oxide + NADH + 2 Hydrogen ion > Trimethylamine + NAD + Water
3-(2,3-Dihydroxyphenyl)propionic acid + Oxygen > (2E,4Z)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate + Hydrogen ion
(2E,4Z)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate + Water > (2Z)-2-hydroxypenta-2,4-dienoate + Succinic acid + Hydrogen ion
2-Aminomalonate semialdehyde + NADPH + Hydrogen ion <> NADP + L-Serine
2-Pyrocatechuic acid + Oxygen > Hydrogen ion + 2-Carboxymuconate
Hydrogen (gas) + 2 Hydrogen ion + 2-Demethylmenaquinone 8 >
2-Deoxygluconate + NAD > 3-Dehydro-2-deoxy-D-gluconate + NADH + Hydrogen ion
Tartaric acid + NAD <> NADH + Hydrogen ion + 2-Hydroxy-3-oxosuccinate
Uracil + FMNH2 + Oxygen > Ureidoacrylate peracid + Flavin Mononucleotide + Hydrogen ion + Peroxyaminoacrylate
Ureidoacrylate peracid + Water > Peroxyaminoacrylate + Carbamic acid + Hydrogen ion + 3-Aminoacrylate
2-Aminoacrylic acid + Water + Hydrogen ion > Malonic semialdehyde + Ammonium
Malonic semialdehyde + NADPH + Hydrogen ion > 3-Hydroxypropanoate + NADP
Xanthosine 5-triphosphate + Water > XDP + Phosphate + Hydrogen ion
trans-Delta2, cis-delta4-decadienoyl-CoA + NADPH + Hydrogen ion > (2E)-Decenoyl-CoA + NADP
Riboflavin + NADPH + 2 Hydrogen ion > Riboflavin reduced + NADP
Adenosine triphosphate + Water > ADP + Phosphate + Hydrogen ion
(2-Naphthyl)methanol + NAD > 2-Naphthaldehyde + Hydrogen ion + NADH
3-Oxo-5,6-dehydrosuberyl-CoA semialdehyde + Water + NADP > Hydrogen ion + NADPH + 3-Oxo-5,6-dehydrosuberyl-CoA
2',3'-Cyclic UMP + Water > Hydrogen ion + 3'-UMP
Cytidine + Hydrogen ion + Water > Uridine + Ammonium
3,5-Tetradecadienoyl-CoA + Water > Hydrogen ion + Coenzyme A + 3,5-tetradecadienoate
Hydrogen ion + NADH + Oxygen + 3-(3-Hydroxyphenyl)propanoic acid > 3-(2,3-Dihydroxyphenyl)propionic acid + Water + NAD
Phenylacetaldehyde + NAD + Water > NADH + Hydrogen ion + Benzeneacetic acid
Phenylacetyl-CoA + Hydrogen ion + NADPH + Oxygen > Water + NADP + 2-(1,2-Epoxy-1,2-dihydrophenyl)acetyl-CoA
3-Hydroxyadipyl-CoA + NAD > NADH + Hydrogen ion + 3-Oxoadipyl-CoA
10-formyl-tetrahydrofolate mono-L-glutamate + N1-(5-phospho-β-D-ribosyl)glycinamide > Hydrogen ion + tetrahydropteroyl mono-L-glutamate + 5'-Phosphoribosyl-N-formylglycineamide
5-Aminoimidazole ribonucleotide + S-adenosyl-L-methionine >3 Hydrogen ion + CO + Formic acid + L-Methionine + 5'-Deoxyadenosine + 4-amino-2-methyl-5-phosphomethylpyrimidine
2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate + 2-((2R,5Z)-2-Carboxy-4-methylthiazol-5(2H)-ylidene)ethyl phosphate + Hydrogen ion > Carbon dioxide + Pyrophosphate + Thiamine monophosphate
3-Aminopropylphosphonate + Adenosine triphosphate + Water > ADP + Phosphate + Hydrogen ion
Bis-molybdopterin guanine dinucleotide + Guanosine triphosphate + Hydrogen ion + Molybdopterin guanine dinucleotide > Guanylyl molybdenum cofactor + Pyrophosphate
2,3-dihydroxy-2,3-dihydrobenzoate + NAD > 2,3-Dihydroxybenzoic acid + NADH + Hydrogen ion
2,3-Dihydroxybenzoic acid + Adenosine triphosphate + Hydrogen ion > (2,3-Dihydroxybenzoyl)adenylic acid + Pyrophosphate
(2,3-Dihydroxybenzoyl)adenylic acid + a holo-[EntB isochorismatase/aryl-carrier protein] > a 2,3-dihydroxybenzoyl-[EntB isochorismatase/aryl-carrier protein] + Adenosine monophosphate + Hydrogen ion
a 2,3-dihydroxybenzoyl-[EntB isochorismatase/aryl-carrier protein] + a seryl-[EntF peptidyl-carrier protein] > a holo-[EntB isochorismatase/aryl-carrier protein] + a DHB-seryl-[EntF peptidyl-carrier protein] + Hydrogen ion
1-[(5-Amino-5-carboxypentyl)amino]-1-deoxyfructose + Adenosine triphosphate > Fructoselysine-6-phosphate + ADP + Hydrogen ion
2 Superoxide anion + 2 Hydrogen ion > Hydrogen peroxide + Oxygen
Putrescine + L-Glutamate + Adenosine triphosphate > gamma-Glutamyl-L-putrescine + ADP + Hydrogen ion + Phosphate
Pyruvaldehyde + NADPH + Hydrogen ion <> Hydroxyacetone + NADP
NAD + Adenosine triphosphate > NADP + ADP + Hydrogen ion
oxidized thioredoxin + NADPH + Hydrogen ion > reduced thioredoxin + NADP
a [pyruvate dehydrogenase E2 protein] N6-dihydrolipoyl-L-lysine + NAD > a [pyruvate dehydrogenase E2 protein] N6-lipoyl-L-lysine + NADH + Hydrogen ion
Pyruvaldehyde + Water > D-Lactic acid + Hydrogen ion
Adenosine triphosphate + Water > ADP + Phosphate + Hydrogen ion
L-Cysteine + Adenosine triphosphate + Water > ADP + Phosphate + Hydrogen ion
Fumaric acid + 2 Hydrogen ion + "a menaquinol" > Succinic acid + "a menaquinone"
Hydrogen ion + NADH + NADP > NADPH + NAD
Adenosine triphosphate + Biotin + Biotin-Carboxyl Carrying Protein > Hydrogen ion + Adenosine monophosphate + Pyrophosphate + Biotinylated [BCCP monomer]
L-Lysine + Hydrogen ion > Cadaverine + Carbon dioxide
gamma-Glutamyl-L-putrescine + Oxygen + Hydrogen ion > gamma-Glutamyl-gamma-butyraldehyde + Hydrogen peroxide + Ammonium
gamma-Glutamyl-gamma-butyraldehyde + NADP + Water > gamma-glutamyl-gamma-aminobutyrate + NADPH +2 Hydrogen ion
Succinic acid semialdehyde + NAD + Water > Succinic acid + NADH +2 Hydrogen ion
a biotinylated [BCCP dimer] + Adenosine triphosphate + Hydrogen carbonate > carboxylated-biotinylated [BCCP dimer] + Hydrogen ion + ADP + Phosphate
D-Ribulose + Adenosine triphosphate > D-Ribulose-1-phosphate + Adenosine monophosphate + Hydrogen ion
Glycolaldehyde + NAD + Water > Glycolic acid + NADH +2 Hydrogen ion
N-Acetyl-glucosamine 1-phosphate + Uridine triphosphate + Hydrogen ion > Uridine diphosphate-N-acetylglucosamine + Pyrophosphate
D-Erythrose 4-phosphate + NAD + Water > 4-Phospho-D-erythronate + NADH +2 Hydrogen ion
Dihydromethysticin + NADPH + Hydrogen ion > Tetrahydromonapterin + NADP
5-Aminoimidazole ribonucleotide + Hydrogen carbonate + Adenosine triphosphate > 5-Phosphoribosyl-5-carboxyaminoimidazole + ADP + Phosphate + Hydrogen ion
UDP-N-acetyl-α-D-muramate + Adenosine triphosphate + L-Alanine > UDP-N-Acetylmuramyl-L-Ala + ADP + Phosphate + Hydrogen ion
UDP-N-Acetylmuramoyl-L-alanyl-D-gamma-glutamyl-meso-2,6-diaminopimelate + D-Alanyl-D-alanine + Adenosine triphosphate > N-Acetylmuramoyl-L-alanyl-D-glutamyl-L-lysyl-D-alanyl-D-alanine-diphosphoundecaprenyl-N-acetylglucosamine + ADP + Phosphate + Hydrogen ion
N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimelyl-D-alanyl-D-alanine-diphosphoundecaprenol + Uridine diphosphate-N-acetylglucosamine > Undecaprenyl-diphospho-N-acetylmuramoyl-(N-acetylglucosamine)-L-alanyl-D-glutaminyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine + Uridine 5'-diphosphate + Hydrogen ion
2 Undecaprenyl-diphospho-N-acetylmuramoyl-(N-acetylglucosamine)-L-alanyl-D-glutaminyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine > a peptidoglycan dimer (meso-diaminopimelate containing) + Undecaprenyl diphosphate + Hydrogen ion
Hydrogen cyanide + Thiosulfate > Thiocyanate + Sulfite +2 Hydrogen ion
R-Methylmalonyl-CoA + Hydrogen ion > Propionyl-CoA + Carbon dioxide
Undecaprenyl-N-acetyl-alpha-D-glucosaminyl-pyrophosphate + UDP-ManNAcA > Uridine 5'-diphosphate + Undecaprenyl-diphospho-N-acetylglucosamine-N-acetylmannosaminuronate + Hydrogen ion
Undecaprenyl-diphospho-N-acetylglucosamine-N-acetylmannosaminuronate + dTDP-4-Acetamido-4,6-dideoxy-D-galactose > Undecaprenyl-diphospho N-acetylglucosamine-N-acetylmannosaminuronate-N-acetamido-4,6-dideoxy-D-galactose + dTDP + Hydrogen ion
Acetyl-CoA + dTDP-D-Fucosamine > Coenzyme A + Hydrogen ion + dTDP-4-Acetamido-4,6-dideoxy-D-galactose
Glucose 1-phosphate + Thymidine 5'-triphosphate + Hydrogen ion > Pyrophosphate + TDP-Glucose
D-Glyceraldehyde 3-phosphate + Pyruvic acid + Hydrogen ion > 1-Deoxy-D-xylulose 5-phosphate + Carbon dioxide
2-octaprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinone + S-adenosyl-L-methionine > S-Adenosylhomocysteine + Ubiquinol-8 + Hydrogen ion
2-Octaprenyl-6-methoxy-1,4-benzoquinol + S-adenosyl-L-methionine > 2-Octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol + S-Adenosylhomocysteine + Hydrogen ion
trans-Cinnamic acid + Hydrogen ion + Oxygen + NADH > Cis-3-(3-carboxyethyl)-3,5-cyclohexadiene-1,2-diol + NAD
Cis-3-(3-carboxyethyl)-3,5-cyclohexadiene-1,2-diol + NAD > 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid + NADH + Hydrogen ion
S-adenosyl-L-methionine + Hydrogen ion > Decarboxy-SAM + Carbon dioxide
Cadaverine + Decarboxy-SAM > Aminopropylcadaverine + 5'-Methylthioadenosine + Hydrogen ion
Decarboxy-SAM + Putrescine > 5'-Methylthioadenosine + Spermidine + Hydrogen ion
L-Tyrosine + S-adenosyl-L-methionine + NADPH > Dehydroglycine + 4-Methylcatechol + 5'-Deoxyadenosine + L-Methionine + NADP + Hydrogen ion
anhydro-n-acetylmuramic acid + Adenosine triphosphate + Water > N-Acetylmuramate 6-phosphate + ADP + Hydrogen ion
Hydroxyacetone + NADH + Hydrogen ion <> Propylene glycol + NAD
Pyruvaldehyde + NADPH + Hydrogen ion > Lactaldehyde + NADP
Deoxycytidine + Water + Hydrogen ion > Ammonium + Deoxyuridine
N-Acetylmannosamine + Adenosine triphosphate > ADP + Hydrogen ion + N-Acetyl-D-mannosamine 6-phosphate
Adenylyl-molybdopterin + Hydrogen ion + Molybdate > Adenosine monophosphate + Water + molybdenum cofactor
(S)-Ureidoglycolic acid + NAD > Hydrogen ion + NADH + Oxalureate
Carbamoylphosphate + ADP + 2 Hydrogen ion > Ammonium + Adenosine triphosphate + Carbon dioxide
molybdenum cofactor + Cytidine triphosphate + Hydrogen ion > Pyrophosphate + Cytidylyl molybdenum cofactor
Alpha-D-glucose 1-phosphate + Thymidine 5'-triphosphate + Hydrogen ion > Pyrophosphate + dTDP-D-Glucose
dTDP-4-dehydro-beta-L-rhamnose + NADPH + Hydrogen ion > NADP + Deoxythymidine diphosphate-L-rhamnose
L-Galactonate + NAD > NADH + Hydrogen ion + D-Tagaturonate
Deoxyuridine + Adenosine triphosphate > ADP + Hydrogen ion + dUMP
Thymidine + Adenosine triphosphate > ADP + Hydrogen ion + 5-Thymidylic acid
alpha-D-Ribose 1-methylphosphonate 5-triphosphate + Water > Hydrogen ion + Pyrophosphate + alpha-D-Ribose 1-methylphosphonate 5-phosphate
alpha-D-Ribose 1,2-cyclic phosphate 5-phosphate + Water > Hydrogen ion + Ribose 1,5-bisphosphate
a biotinylated [BCCP dimer] + Hydrogen ion + Phosphate + ADP + Malonyl-CoA < Water + Acetyl-CoA + Adenosine triphosphate + carboxylated-biotinylated [BCCP dimer]
Adenosine + Water + Hydrogen ion > Ammonium + Inosine
Deoxyinosine + Ammonium < Water + Hydrogen ion + Deoxyadenosine
Inosine + Adenosine triphosphate > ADP + Hydrogen ion + Inosinic acid
Guanosine + Adenosine triphosphate > ADP + Hydrogen ion + Guanosine monophosphate
Dephospho-CoA + Adenosine triphosphate + Hydrogen ion > Adenine + 2'-(5-Triphosphoribosyl)-3'-dephospho-CoA
2'-(5-Triphosphoribosyl)-3'-dephospho-CoA + [an apo citrate-lyase acyl-carrier protein] > Pyrophosphate + Hydrogen ion + [a holo citrate lyase acyl-carrier protein]
Pyruvic acid + a [pyruvate dehydrogenase E2 protein] N6-lipoyl-L-lysine + Hydrogen ion > a [pyruvate dehydrogenase E2 protein] N6-S-acetyldihydrolipoyl-L-lysine + Carbon dioxide
Zinc + Adenosine triphosphate + Water > ADP + Phosphate + Hydrogen ion
Thiosulfate + Adenosine triphosphate + Water > ADP + Phosphate + Hydrogen ion
"a menaquinone" + 4 Hydrogen ion + NADH > "a menaquinol" + NAD
a [2-oxoglutarate dehydrogenase E2 protein] N6-dihydrolipoyl-L-lysine + NAD > a [2-oxoglutarate dehydrogenase E2 protein] N6-lipoyl-L-lysine + NADH + Hydrogen ion
D-Lactic acid + 2 Hydrogen ion + an ubiquinol  > Pyruvic acid + ubiquinone
D-Glycero-D-manno-heptose 7-phosphate + Adenosine triphosphate > D-Glycero-D-manno-heptose 1,7-bisphosphate + ADP + Hydrogen ion
D-glycero-beta-D-manno-heptose 1-phosphate + Adenosine triphosphate + Hydrogen ion > ADP-D-Glycero-D-manno-heptose + Pyrophosphate
Ribose + Adenosine triphosphate > D-Ribose-5-phosphate + ADP + Hydrogen ion
L-Ribulose + Adenosine triphosphate > L-ribulose 5-phosphate + ADP + Hydrogen ion
L-Threo-2-pentulose + Adenosine triphosphate > Xylulose 5-phosphate + ADP + Hydrogen ion
a [2-oxoglutarate dehydrogenase E2 protein] N6-lipoyl-L-lysine + Oxoglutaric acid + Hydrogen ion > a [2-oxoglutarate dehydrogenase E2 protein] N6-S-succinyldihydrolipoyl-L-lysine + Carbon dioxide
a [phospholipid] olefinic fatty acid + S-adenosyl-L-methionine > a [phospholipid] cyclopropane fatty acid + S-Adenosylhomocysteine + Hydrogen ion
beta-D-Ribopyranose + Adenosine triphosphate + Water > ADP + Phosphate + Hydrogen ion
Carbon dioxide + Water > Hydrogen ion + Hydrogen carbonate
Hydrogen carbonate + Cyanate + Hydrogen ion > Carbon dioxide + Carbamic acid
an acetyl-[acp] + a [lipoyl-carrier protein]-L-lysine > a [lipoyl-carrier protein] N6-octanoyl-L-lysine + Hydrogen ion + a holo-[acyl-carrier protein]
D-Sedoheptulose 7-phosphate + Adenosine triphosphate > Sedoheptulose 1,7-bisphosphate + ADP + Hydrogen ion
L-Threo-2-pentulose + Adenosine triphosphate > L-Xylulose 5-phosphate + ADP + Hydrogen ion
Glyceric acid + Adenosine triphosphate > 2-Phospho-D-glyceric acid + ADP + Hydrogen ion
L-Cysteine > Hydrogen sulfide + Hydrogen ion + 2-aminoprop-2-enoate
Ethylene glycol + NAD <> Glycolaldehyde + NADH + Hydrogen ion
Beta-D-Glucopyranuronic acid + Adenosine triphosphate > Glucose 6-phosphate + ADP + Hydrogen ion
Oxygen + 4 Hydrogen ion + Electron >2 Water
UDP-Glucose + Mannose 6-phosphate > alpha,alpha-Trehalose 6-phosphate + Uridine 5'-diphosphate + Hydrogen ion
α-D-glucose 1-phosphate + Thymidine 5'-triphosphate + Hydrogen ion > dTDP-D-Glucose + Pyrophosphate
molybdenum cofactor + Cytidine triphosphate + Hydrogen ion > Molybdopterin cytosine dinucleotide + Pyrophosphate
dTDP-4-dehydro-beta-L-rhamnose + NADPH + Hydrogen ion > dTDP-6-deoxy-L-mannose + NADP
dTDP-4-dehydro-beta-L-rhamnose + NADH + Hydrogen ion > NADP + TDP-Rhamnose
2 Pyruvic acid + 2 Water > Carbon dioxide + Acetic acid + Hydrogen ion + Electron
Hypoxanthine + Water + NAD > Hydrogen ion + NADH + Xanthine
Xanthine + Water + NAD > NADH + Hydrogen ion + Uric acid
D-Serine > Water + Hydrogen ion + 2-Aminoacrylic acid
S-Lactoylglutathione + Water > Glutathione + Hydrogen ion + L-Lactic acid
4 Hydrogen ion + NADH + "a menaquinone" > NAD + "a menaquinol"
Nitrate + 2 Hydrogen ion + "a menaquinol" > Nitrite + Water + "a menaquinone"
More...

SMPDB Pathways:
1,6-anhydro-<i>N</i>-acetylmuramic acid recyclingPW002064 ThumbThumb?image type=greyscaleThumb?image type=simple
2,3-dihydroxybenzoate biosynthesisPW000751 ThumbThumb?image type=greyscaleThumb?image type=simple
2-O-alpha-mannosyl-D-glycerate degradationPW002096 ThumbThumb?image type=greyscaleThumb?image type=simple
2-Oxopent-4-enoate metabolismPW001890 ThumbThumb?image type=greyscaleThumb?image type=simple
2-Oxopent-4-enoate metabolism 2PW002035 ThumbThumb?image type=greyscaleThumb?image type=simple
2-oxoglutarate decarboxylation to succinyl-CoAPW002108 ThumbThumb?image type=greyscaleThumb?image type=simple
4-aminobutanoate degradation IPW002068 ThumbThumb?image type=greyscaleThumb?image type=simple
ADP-L-glycero-Beta-D-manno-heptose biosynthesisPW002095 ThumbThumb?image type=greyscaleThumb?image type=simple
Amino sugar and nucleotide sugar metabolism IPW000886 ThumbThumb?image type=greyscaleThumb?image type=simple
Amino sugar and nucleotide sugar metabolism IIPW000887 ThumbThumb?image type=greyscaleThumb?image type=simple
Amino sugar and nucleotide sugar metabolism IIIPW000895 ThumbThumb?image type=greyscaleThumb?image type=simple
Ascorbate metabolismPW000793 ThumbThumb?image type=greyscaleThumb?image type=simple
Asparagine biosynthesisPW000813 ThumbThumb?image type=greyscaleThumb?image type=simple
Biosynthesis of siderophore group nonribosomal peptidesPW000760 ThumbThumb?image type=greyscaleThumb?image type=simple
Biotin metabolismPW000762 ThumbThumb?image type=greyscaleThumb?image type=simple
Chorismate biosynthesisPW000816 ThumbThumb?image type=greyscaleThumb?image type=simple
Citrate lyase activationPW002075 ThumbThumb?image type=greyscaleThumb?image type=simple
Collection of Reactions without pathwaysPW001891 ThumbThumb?image type=greyscaleThumb?image type=simple
Conversion of Succinate to PropanoatePW002058 ThumbThumb?image type=greyscaleThumb?image type=simple
Cyclopropane Fatty Acid (CFA) BiosynthesisPW002109 ThumbThumb?image type=greyscaleThumb?image type=simple
D-Glutamine and D-glutamate metabolismPW000769 ThumbThumb?image type=greyscaleThumb?image type=simple
D-allulose degradationPW000825 ThumbThumb?image type=greyscaleThumb?image type=simple
D-arabinose degradation IPW002038 ThumbThumb?image type=greyscaleThumb?image type=simple
D-serine degradationPW002101 ThumbThumb?image type=greyscaleThumb?image type=simple
D-sorbitol degradation IIPW002022 ThumbThumb?image type=greyscaleThumb?image type=simple
Enterobactin BiosynthesisPW002048 ThumbThumb?image type=greyscaleThumb?image type=simple
Ethylene Glycol DegradationPW002093 ThumbThumb?image type=greyscaleThumb?image type=simple
Fatty acid biosynthesisPW000900 ThumbThumb?image type=greyscaleThumb?image type=simple
Fatty acid metabolismPW000796 ThumbThumb?image type=greyscaleThumb?image type=simple
Flavin biosynthesisPW001971 ThumbThumb?image type=greyscaleThumb?image type=simple
Folate biosynthesisPW000908 ThumbThumb?image type=greyscaleThumb?image type=simple
Fructoselysine and Psicoselysine DegradationPW002049 ThumbThumb?image type=greyscaleThumb?image type=simple
GLYCINE BIOSYNTHESISPW000808 ThumbThumb?image type=greyscaleThumb?image type=simple
GTP degradationPW001888 ThumbThumb?image type=greyscaleThumb?image type=simple
Galactitol and galactonate degradationPW000820 ThumbThumb?image type=greyscaleThumb?image type=simple
Galactose metabolismPW000821 ThumbThumb?image type=greyscaleThumb?image type=simple
Gluconeogenesis from L-malic acidPW000819 ThumbThumb?image type=greyscaleThumb?image type=simple
Glutathione metabolismPW000833 ThumbThumb?image type=greyscaleThumb?image type=simple
Hydrogen Sulfide Biosynthesis IPW002066 ThumbThumb?image type=greyscaleThumb?image type=simple
L-arabinose Degradation IPW002103 ThumbThumb?image type=greyscaleThumb?image type=simple
L-cysteine degradationPW002110 ThumbThumb?image type=greyscaleThumb?image type=simple
L-glutamate metabolismPW000789 ThumbThumb?image type=greyscaleThumb?image type=simple
L-glutamate metabolism IIPW001886 ThumbThumb?image type=greyscaleThumb?image type=simple
L-lactaldehyde degradation (aerobic)PW002073 ThumbThumb?image type=greyscaleThumb?image type=simple
L-lyxose DegradationPW002100 ThumbThumb?image type=greyscaleThumb?image type=simple
L-threonine degradation to methylglyoxalPW002106 ThumbThumb?image type=greyscaleThumb?image type=simple
Leucine BiosynthesisPW000811 ThumbThumb?image type=greyscaleThumb?image type=simple
Lipoate Biosynthesis and Incorporation IPW002107 ThumbThumb?image type=greyscaleThumb?image type=simple
Lipoic acid metabolismPW000770 ThumbThumb?image type=greyscaleThumb?image type=simple
Lipopolysaccharide biosynthesisPW000831 ThumbThumb?image type=greyscaleThumb?image type=simple
Lysine Degradation IPW000772 ThumbThumb?image type=greyscaleThumb?image type=simple
Lysine biosynthesisPW000771 ThumbThumb?image type=greyscaleThumb?image type=simple
Mannose MetabolismPW000822 ThumbThumb?image type=greyscaleThumb?image type=simple
Menaquinol biosythesisPW001897 ThumbThumb?image type=greyscaleThumb?image type=simple
N-acetylneuraminate and N-acetylmannosamine and N-acetylglucosamine degradationPW002030 ThumbThumb?image type=greyscaleThumb?image type=simple
N-oxide electron transferPW001889 ThumbThumb?image type=greyscaleThumb?image type=simple
NAD biosynthesisPW000829 ThumbThumb?image type=greyscaleThumb?image type=simple
NAD phosphorylation and dephosphorylationPW002081 ThumbThumb?image type=greyscaleThumb?image type=simple
NAD salvagePW000830 ThumbThumb?image type=greyscaleThumb?image type=simple
Nitrogen metabolismPW000755 ThumbThumb?image type=greyscaleThumb?image type=simple
O-antigen building blocks biosynthesisPW002089 ThumbThumb?image type=greyscaleThumb?image type=simple
Oleic acid OxidationPW002025 ThumbThumb?image type=greyscaleThumb?image type=simple
One Carbon Pool by Folate IPW001735 ThumbThumb?image type=greyscaleThumb?image type=simple
One carbon pool by folatePW000773 ThumbThumb?image type=greyscaleThumb?image type=simple
Oxidative phosphorylationPW000919 ThumbThumb?image type=greyscaleThumb?image type=simple
PRPP BiosynthesisPW000909 ThumbThumb?image type=greyscaleThumb?image type=simple
Pantothenate and CoA biosynthesisPW000828 ThumbThumb?image type=greyscaleThumb?image type=simple
Pentose PhosphatePW000893 ThumbThumb?image type=greyscaleThumb?image type=simple
Phenylalanine metabolismPW000921 ThumbThumb?image type=greyscaleThumb?image type=simple
Phenylethylamine metabolismPW002027 ThumbThumb?image type=greyscaleThumb?image type=simple
Porphyrin metabolismPW000936 ThumbThumb?image type=greyscaleThumb?image type=simple
Propanoate metabolismPW000940 ThumbThumb?image type=greyscaleThumb?image type=simple
Purine degradationPW001887 ThumbThumb?image type=greyscaleThumb?image type=simple
Putrescine Degradation IIPW002054 ThumbThumb?image type=greyscaleThumb?image type=simple
Pyrimidine metabolismPW000942 ThumbThumb?image type=greyscaleThumb?image type=simple
Pyrimidine ribonucleosides degradtionPW002024 ThumbThumb?image type=greyscaleThumb?image type=simple
Quorum SensingPW000836 ThumbThumb?image type=greyscaleThumb?image type=simple
Ribose DegradationPW002102 ThumbThumb?image type=greyscaleThumb?image type=simple
S-adenosyl-L-methionine biosynthesisPW000837 ThumbThumb?image type=greyscaleThumb?image type=simple
S-adenosyl-L-methionine cyclePW002080 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolite: Leucine biosynthesisPW000980 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolites: Glyoxylate cyclePW000967 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolites: Histidine biosynthesisPW000984 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolites: Shikimate PathwayPW000985 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolites: Ubiquinol biosynthesisPW000981 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolites: Ubiquinol biosynthesis 2PW002036 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolites: Valine and I-leucine biosynthesis from pyruvatePW000978 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolites: cysteine biosynthesis from serinePW000977 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolites: enterobacterial common antigen biosynthesisPW000959 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolites: enterobacterial common antigen biosynthesis 2PW002045 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolites: enterobacterial common antigen biosynthesis 3PW002046 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary Metabolites: threonine biosynthesis from aspartatePW000976 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary metabolites: Trehalose Biosynthesis and MetabolismPW000968 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary metabolites: isoprenoid biosynthesis (nonmevalonate pathway)PW000975 ThumbThumb?image type=greyscaleThumb?image type=simple
Secondary metabolites: methylerythritol phosphate and polyisoprenoid biosynthesisPW000958 ThumbThumb?image type=greyscaleThumb?image type=simple
Sedoheptulose Bisphosphate BypassPW002098 ThumbThumb?image type=greyscaleThumb?image type=simple
Selenium metabolismPW001894 ThumbThumb?image type=greyscaleThumb?image type=simple
Spermidine Biosynthesis IPW002040 ThumbThumb?image type=greyscaleThumb?image type=simple
Spermidine biosynthesis and metabolismPW002085 ThumbThumb?image type=greyscaleThumb?image type=simple
Starch and sucrose metabolismPW000941 ThumbThumb?image type=greyscaleThumb?image type=simple
Sulfur metabolismPW000922 ThumbThumb?image type=greyscaleThumb?image type=simple
Superoxide Radicals DegradationPW002053 ThumbThumb?image type=greyscaleThumb?image type=simple
TCA cyclePW000779 ThumbThumb?image type=greyscaleThumb?image type=simple
TCA cycle (ubiquinol-0)PW002023 ThumbThumb?image type=greyscaleThumb?image type=simple
TCA cycle (ubiquinol-10)PW001010 ThumbThumb?image type=greyscaleThumb?image type=simple
TCA cycle (ubiquinol-2)PW001002 ThumbThumb?image type=greyscaleThumb?image type=simple
TCA cycle (ubiquinol-3)PW001003 ThumbThumb?image type=greyscaleThumb?image type=simple
TCA cycle (ubiquinol-4)PW001004 ThumbThumb?image type=greyscaleThumb?image type=simple
TCA cycle (ubiquinol-5)PW001005 ThumbThumb?image type=greyscaleThumb?image type=simple
TCA cycle (ubiquinol-6)PW001006 ThumbThumb?image type=greyscaleThumb?image type=simple
TCA cycle (ubiquinol-7)PW001007 ThumbThumb?image type=greyscaleThumb?image type=simple
TCA cycle (ubiquinol-8)PW001008 ThumbThumb?image type=greyscaleThumb?image type=simple
TCA cycle (ubiquinol-9)PW001009 ThumbThumb?image type=greyscaleThumb?image type=simple
Taurine MetabolismPW000774 ThumbThumb?image type=greyscaleThumb?image type=simple
Taurine Metabolism IPW001028 ThumbThumb?image type=greyscaleThumb?image type=simple
Tetrahydromonapterin BiosynthesisPW002043 ThumbThumb?image type=greyscaleThumb?image type=simple
Thiamin diphosphate biosynthesisPW002028 ThumbThumb?image type=greyscaleThumb?image type=simple
Thiazole Biosynthesis IPW002041 ThumbThumb?image type=greyscaleThumb?image type=simple
Thiosulfate Disproportionation IIIPW002060 ThumbThumb?image type=greyscaleThumb?image type=simple
Trehalose Degradation I (low osmolarity)PW002097 ThumbThumb?image type=greyscaleThumb?image type=simple
Tryptophan metabolismPW000815 ThumbThumb?image type=greyscaleThumb?image type=simple
Uracil degradation IIIPW002026 ThumbThumb?image type=greyscaleThumb?image type=simple
Valine BiosynthesisPW000812 ThumbThumb?image type=greyscaleThumb?image type=simple
Vitamin B1/ThiaminePW000892 ThumbThumb?image type=greyscaleThumb?image type=simple
Vitamin B6 1430936196PW000891 ThumbThumb?image type=greyscaleThumb?image type=simple
Xylose Degradation IPW002105 ThumbThumb?image type=greyscaleThumb?image type=simple
adenine and adenosine salvage IPW002069 ThumbThumb?image type=greyscaleThumb?image type=simple
adenine and adenosine salvage IIPW002071 ThumbThumb?image type=greyscaleThumb?image type=simple
adenine and adenosine salvage IIIPW002072 ThumbThumb?image type=greyscaleThumb?image type=simple
adenosine nucleotides degradationPW002091 ThumbThumb?image type=greyscaleThumb?image type=simple
adenosylcobalamin salvage from cobinamidePW001884 ThumbThumb?image type=greyscaleThumb?image type=simple
allantoin degradation (anaerobic)PW002050 ThumbThumb?image type=greyscaleThumb?image type=simple
aminopropylcadaverine biosynthesisPW002039 ThumbThumb?image type=greyscaleThumb?image type=simple
arginine metabolismPW000790 ThumbThumb?image type=greyscaleThumb?image type=simple
beta-Alanine metabolismPW000896 ThumbThumb?image type=greyscaleThumb?image type=simple
biotin-carboxyl carrier protein assemblyPW002067 ThumbThumb?image type=greyscaleThumb?image type=simple
colanic acid building blocks biosynthesisPW000951 ThumbThumb?image type=greyscaleThumb?image type=simple
curcumin degradationPW001896 ThumbThumb?image type=greyscaleThumb?image type=simple
cyanate degradationPW002099 ThumbThumb?image type=greyscaleThumb?image type=simple
cysteine biosynthesisPW000800 ThumbThumb?image type=greyscaleThumb?image type=simple
dimethyl sulfoxide electron transferPW001892 ThumbThumb?image type=greyscaleThumb?image type=simple
fatty acid elongation -- saturatedPW000798 ThumbThumb?image type=greyscaleThumb?image type=simple
fatty acid oxidationPW000758 ThumbThumb?image type=greyscaleThumb?image type=simple
fatty acid oxidation (Butanoate)PW001017 ThumbThumb?image type=greyscaleThumb?image type=simple
fatty acid oxidation (Decanoate)PW001018 ThumbThumb?image type=greyscaleThumb?image type=simple
fatty acid oxidation (hexanoate)PW001019 ThumbThumb?image type=greyscaleThumb?image type=simple
fatty acid oxidation (laurate)PW001020 ThumbThumb?image type=greyscaleThumb?image type=simple
fatty acid oxidation (myristate)PW001021 ThumbThumb?image type=greyscaleThumb?image type=simple
fatty acid oxidation (octanoate)PW001022 ThumbThumb?image type=greyscaleThumb?image type=simple
fatty acid oxidation (palmitate)PW001023 ThumbThumb?image type=greyscaleThumb?image type=simple
fatty acid oxidation (steareate)PW001024 ThumbThumb?image type=greyscaleThumb?image type=simple
fructose metabolismPW000913 ThumbThumb?image type=greyscaleThumb?image type=simple
fucose and rhamnose degradationPW000826 ThumbThumb?image type=greyscaleThumb?image type=simple
galactose degradation/Leloir PathwayPW000884 ThumbThumb?image type=greyscaleThumb?image type=simple
glutathione metabolism IIPW001927 ThumbThumb?image type=greyscaleThumb?image type=simple
glutathione metabolism IIIPW002018 ThumbThumb?image type=greyscaleThumb?image type=simple
glycerol metabolismPW000914 ThumbThumb?image type=greyscaleThumb?image type=simple
glycerol metabolism IIPW000915 ThumbThumb?image type=greyscaleThumb?image type=simple
glycerol metabolism III (sn-glycero-3-phosphoethanolamine)PW000916 ThumbThumb?image type=greyscaleThumb?image type=simple
glycerol metabolism IV (glycerophosphoglycerol)PW000917 ThumbThumb?image type=greyscaleThumb?image type=simple
glycerol metabolism V (glycerophosphoserine)PW000918 ThumbThumb?image type=greyscaleThumb?image type=simple
glycolate and glyoxylate degradationPW000827 ThumbThumb?image type=greyscaleThumb?image type=simple
glycolate and glyoxylate degradation IIPW002021 ThumbThumb?image type=greyscaleThumb?image type=simple
glycolysis and pyruvate dehydrogenasePW000785 ThumbThumb?image type=greyscaleThumb?image type=simple
guanine and guanosine salvagePW002074 ThumbThumb?image type=greyscaleThumb?image type=simple
guanylyl molybdenum cofactor biosynthesisPW002032 ThumbThumb?image type=greyscaleThumb?image type=simple
hexuronide and hexuronate degradationPW000834 ThumbThumb?image type=greyscaleThumb?image type=simple
histidine biosynthesisPW000810 ThumbThumb?image type=greyscaleThumb?image type=simple
inner membrane transportPW000786 ThumbThumb?image type=greyscaleThumb?image type=simple
isoleucine biosynthesisPW000818 ThumbThumb?image type=greyscaleThumb?image type=simple
ketogluconate metabolismPW002003 ThumbThumb?image type=greyscaleThumb?image type=simple
lipopolysaccharide biosynthesis IIPW001905 ThumbThumb?image type=greyscaleThumb?image type=simple
lipopolysaccharide biosynthesis IIIPW002059 ThumbThumb?image type=greyscaleThumb?image type=simple
methionine biosynthesisPW000814 ThumbThumb?image type=greyscaleThumb?image type=simple
methylglyoxal degradation IIPW002084 ThumbThumb?image type=greyscaleThumb?image type=simple
methylglyoxal degradation IIIPW002079 ThumbThumb?image type=greyscaleThumb?image type=simple
methylglyoxal degradation IVPW002078 ThumbThumb?image type=greyscaleThumb?image type=simple
methylphosphonate degradation IPW002065 ThumbThumb?image type=greyscaleThumb?image type=simple
nitrate reduction VIIIPW002092 ThumbThumb?image type=greyscaleThumb?image type=simple
ornithine metabolismPW000791 ThumbThumb?image type=greyscaleThumb?image type=simple
palmitate biosynthesisPW000797 ThumbThumb?image type=greyscaleThumb?image type=simple
palmitate biosynthesis 2PW002044 ThumbThumb?image type=greyscaleThumb?image type=simple
peptidoglycan biosynthesis IPW000906 ThumbThumb?image type=greyscaleThumb?image type=simple
peptidoglycan biosynthesis I 2PW002062 ThumbThumb?image type=greyscaleThumb?image type=simple
phenylalanine biosynthesisPW000807 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/15:0cyclo/18:1(9Z))PW001064 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/15:0cyclo/19:0cycv8c)PW001065 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/18:1(9Z)/15:0cyclo)PW001082 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CDP-DG(16:0/15:0))PW001745 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CDP-DG(16:1(9Z)/15:0))PW001757 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CDP-DG(18:0/10:0))PW001761 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CDP-DG(18:0/12:0))PW001762 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CDP-DG(18:0/15:0)PW001766 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CDP-DG(18:0/19:1(9Z)))PW001776 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CDP-DG(18:1(9Z)/15:0))PW001782 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CDP-DG(18:1(9Z)/19:1(9Z)))PW001785 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CDP-DG(19:1(9Z)/14:0))PW001788 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CDP-DG(19:1(9Z)/16:0))PW001790 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CDP-DG(19:1(9Z)/18:0))PW001791 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CDP-DG(19:1(9Z)/19:1(9Z)))PW001792 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/10:0/10:0(3-OH)/10:0))PW001899 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/12:0(3-OH)/10:0(3-OH)/12:0(3-OH)))PW001900 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/12:0/10:0(3-OH)/12:0))PW001901 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/15:0cyclo/10:0(3-OH)/15:0cyclo))PW001902 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/16:0/10:0(3-OH)/16:0))PW001904 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/16:1(9Z)/10:0(3-OH)/16:1(9Z)))PW001903 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/17:0cycw7c/10:0(3-OH)/17:0cycw7c))PW001906 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/17:0cycw7c/14:0/14:0))PW001907 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/19:0cycv8c/10:0(3-OH)/19:0cycv8c))PW001908 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0(3-OH)/19:iso/10:0(3-OH)/19:iso))PW001909 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0/10:0(3-OH)/10:0/10:0(3-OH)))PW001910 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0/12:0(3-OH)/10:0/12:0(3-OH)))PW001911 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(10:0/17:0cycw7c/14:0/14:0))PW001912 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/10:0(3-OH)/12:0(3-OH)/10:0(3-OH)))PW001913 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/10:0/12:0(3-OH)/10:0))PW001914 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/12:0(3-OH)/12:0/12:0))PW001915 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/12:0/12:0/12:0))PW001917 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/14:0(3-OH)/12:0(3-OH)/14:0(3-OH)))PW001918 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/14:0/12:0(3-OH)/14:0))PW001919 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/15:0/12:0(3-OH)/15:0))PW001920 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/15:0cyclo/12:0(3-OH)/15:0cyclo))PW001921 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/17:0cycw7c/12:0(3-OH)/17:0cycw7c))PW001922 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/17:0cycw7c/12:0/12:0))PW001923 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/18:1(9Z)/12:0(3-OH)/18:1(9Z)))PW001924 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/19:0cycv8c/12:0(3-OH)/19:0cycv8c))PW001925 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0(3-OH)/19:iso/12:0(3-OH)/19:iso))PW001926 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0/10:0(3-OH)/12:0/10:0(3-OH)))PW001928 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0/12:0(3-OH)/12:0/12:0))PW001929 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0/12:0/12:0/12:0))PW001930 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0/14:0(3-OH)/12:0/14:0(3-OH)))PW001931 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0/17:0cycw7c/12:0/12:0))PW001932 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(12:0/19:iso/12:0/19:iso))PW001933 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0(3-OH)/12:0(3-OH)/14:0(3-OH)/12:0(3-OH)))PW001934 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0(3-OH)/12:0/14:0(3-OH)/12:0))PW001935 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0(3-OH)/14:0(3-OH)/14:0/14:0))PW001936 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0(3-OH)/14:0/14:0/14:0))PW001937 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0(3-OH)/16:0/16:0/16:0))PW001938 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0(3-OH)/16:1(9Z)/14:0(3-OH)/16:1(9Z)))PW001939 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0(3-OH)/16:1(9Z)/14:0/14:0))PW001940 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0(3-OH)/17:0cycw7c/14:0(3-OH)/17:0cycw7c))PW001941 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0(3-OH)/17:0cycw7c/14:0/14:0))PW001942 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0/12:0(3-OH)/14:0/12:0(3-OH)))PW001943 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0/14:0(3-OH)/14:0/14:0))PW001944 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(14:0/15:0cyclo/17:0cycw7c/14:0)PW001030 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(15:0/10:0(3-OH)/15:0/10:0(3-OH)))PW001945 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(15:0/12:0(3-OH)/15:0/12:0(3-OH)))PW001946 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(15:0/14:0(3-OH)/14:0/14:0))PW001947 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(15:0cyclo/10:0(3-OH)/15:0cyclo/10:0(3-OH)))PW001948 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(15:0cyclo/15:0cyclo/15:0cyclo/15:0cyclo))PW002015 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(15:0cyclo/15:0cyclo/18:1(9Z)/16:0))PW001713 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(15:0cyclo/15:0cyclo/18:1(9Z)/16:0)) 1442599180PW002016 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(15:0cyclo/15:0cyclo/19:0cycv8c/19:0cycv8c))PW001789 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(15:0cyclo/16:0/19:0cycv8c/15:0cyclo))PW001114 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:0/10:0(3-OH)/16:0/10:0(3-OH)))PW001949 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:0/12:0/12:0/12:0)) 2PW001952 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:0/14:0(3-OH)/16:0/14:0(3-OH)))PW001951 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:0/16:0/16:0/16:0))PW002010 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/10:0/14:0/14:0))PW001954 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/12:0/12:0/12:0))PW001955 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/14:0(3-OH)/14:0/14:0))PW001957 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/14:0(3-OH)/16:1(9Z)/14:0(3-OH)))PW001958 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/17:0cycw7c/14:0/17:0cycw7c))PW001959 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/18:1(9Z)/16:1(9Z)/14:0))PW001759 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/19:0/14:0/14:0))PW001960 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/19:0/16:0/16:0))PW001961 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/19:0/16:1(9Z)/19:0))PW001962 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(16:1(9Z)/19:0cycv8c/16:1(9Z)/19:0cycv8c))PW002017 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0/16:1(9Z)/14:0/14:0))PW001963 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0/16:1(9Z)/16:0/16:0))PW001964 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/10:0(3-OH)/10:0/10:0))PW001965 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/10:0(3-OH)/14:0/14:0))PW001966 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/10:0(3-OH)/17:0cycw7c/10:0(3-OH)))PW001967 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/10:0/14:0/14:0))PW001968 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/12:0(3-OH)/12:0/12:0))PW001969 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/12:0(3-OH)/17:0cycw7c/12:0(3-OH)))PW001970 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/12:0/12:0/12:0))PW001972 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/14:0/17:0cycw7c))PW001692 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/16:1(9Z)/14:0))PW001694 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/17:0cycw7c/14:0))PW001695 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/17:0cycw7c/16:1(9Z)))PW001696 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/17:0cycw7c/17:0cycw7c))PW001697 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/17:0cycw7c/18:1(9Z)))PW001698 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/17:0cycw7c/19:0cycv8c))PW001699 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/18:1(9Z)/17:0cycw7c))PW001700 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/19:0cycv8c/17:0cycw7c))PW001701 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/15:0cyclo))PW001702 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/16:0))PW001703 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/16:1(9Z)))PW001704 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/17:0cycw7c))PW001705 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/18:1(9Z)))PW001706 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/19:0cycv8c))PW001707 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/17:0cycw7c/14:0))PW001708 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/17:0cycw7c/17:0cycw7c))PW001709 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/14:0/14:0))PW001710 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/14:0/17:0cycw7c))PW001711 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/14:0/18:1(9Z)))PW001712 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/17:0cycw7c/14:0))PW001464 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/17:0cycw7c/17:0cycw7c))PW001465 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/17:0cycw7c/18:1(9Z)))PW001466 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/17:0cycw7c/19:0cycv8c))PW001467 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/18:1(9Z)/14:0))PW001473 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/19:0cycv8c/17:0cycw7c))PW001474 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/14:0/14:0))PW001475 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/14:0/17:0cycw7c))PW001476 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/14:0/19:0cycv8c))PW001482 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/17:0cycw7c/14:0))PW001483 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/17:0cycw7c/19:0cycv8c))PW001484 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/19:0cycv8c/14:0))PW001485 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(17:0cycw7c/19:iso/17:0cycw7c/19:iso))PW001973 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:0/10:0/10:0/10:0))PW001974 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:0/12:0/12:0/12:0))PW001975 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(11Z)/10:0/10:0/10:0))PW001976 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(11Z)/12:0/12:0/12:0))PW001977 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(11Z)/17:0/14:0/14:0))PW001978 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(11Z)/19:0/14:0/14:0))PW001979 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(11Z)/19:0/18:1(11Z)/19:0))PW001980 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(11Z)/19:0/19:0/19:0))PW001981 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/12:0(3-OH)/18:1(9Z)/12:0(3-OH)))PW001982 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/14:0/14:0))PW001493 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/14:0/17:0cycw7c))PW001492 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/14:0/18:1(9Z)))PW001494 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/14:0/19:0cycv8c))PW001495 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/17:0cycw7c/14:0))PW001498 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/17:0cycw7c/17:0cycw7c))PW001499 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/18:1(9Z)/14:0))PW001500 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/19:0cycv8c/14:0))PW001502 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/19:0cycv8c/19:0cycv8c) 2)PW001781 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/19:0cycv8c/19:0cycv8c))PW001506 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/14:0/15:0cyclo) 5)PW001717 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/14:0/15:0cyclo))PW001507 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/14:0/18:1(9Z)))PW001514 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/15:0cyclo/14:0))PW001515 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/15:0cyclo/17:0cycw7c))PW001516 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/15:0cyclo/19:0cycv8c))PW001517 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/16:0/18:1(9Z)))PW001518 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/16:1(9Z)/18:1(9Z)))PW001519 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/17:0cycw7c/15:0cyclo))PW001527 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/17:0cycw7c/17:0cycw7c))PW001528 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/17:0cycw7c/18:1(9Z)))PW001529 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/14:0))PW001530 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/15:0cyclo))PW001531 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/16:0))PW001532 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/16:1(9Z)))PW001533 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/17:0cycw7c))PW001534 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/18:1(9Z)))PW001540 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/19:0cycv8c))PW001541 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/19:0cycv8c/15:0cyclo))PW001577 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/19:0cycv8c/18:1(9Z)))PW001578 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/19:0cycv8c/19:0cycv8c))PW001579 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/14:0/14:0))PW001580 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/14:0/16:0))PW001581 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/14:0/18:1(9Z)))PW001582 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/16:0/14:0))PW002011 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/16:0/17:0cycw7c))PW002012 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/16:0/19:0cycv8c) 2)PW001783 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/16:0/19:0cycv8c))PW001583 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/16:1(9Z)/18:1(9Z)))PW002013 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/17:0cycw7c/16:0))PW001584 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/17:0cycw7c/17:0cycw7c))PW001585 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/17:0cycw7c/18:1(9Z)))PW001586 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/14:0))PW001587 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/16:0))PW001588 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/16:1(9Z)))PW001594 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/17:0cycw7c))PW001595 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/18:1(9Z)))PW001596 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/19:0cycv8c))PW001597 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/19:0cycv8c/16:0))PW001598 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/19:0cycv8c/18:1(9Z)))PW001599 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/19:0cycv8c/19:0cycv8c))PW001600 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/14:0/14:0))PW001601 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/14:0/16:1(9Z)))PW001607 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/14:0/18:1(9Z)))PW001608 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/16:1(9Z)/14:0))PW001609 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/16:1(9Z)/17:0cycw7c))PW001610 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/16:1(9Z)/19:0cycv8c))PW001612 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/17:0cycw7c/16:1(9Z)))PW001613 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/17:0cycw7c/17:0cycw7c))PW001618 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/17:0cycw7c/18:1(9Z)))PW001619 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/18:1(9Z)/14:0))PW001620 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/18:1(9Z)/16:1(9Z)))PW001621 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/18:1(9Z)/17:0cycw7c))PW002014 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/18:1(9Z)/18:1(9Z)))PW001622 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/18:1(9Z)/19:0cycv8c))PW001623 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/19:0cycv8c/16:1(9Z)))PW001629 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/19:0cycv8c/18:1(9Z)) 2)PW001784 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/19:0cycv8c/18:1(9Z)))PW001630 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/19:0cycv8c/19:0cycv8c))PW001632 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/14:0/14:0))PW001633 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/14:0/17:0cycw7c))PW001634 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/14:0/18:1(9Z)))PW001635 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/17:0cycw7c/14:0))PW001638 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/17:0cycw7c/17:0cycw7c))PW001640 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/17:0cycw7c/18:1(9Z)))PW001644 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/17:0cycw7c/19:0cycv8c))PW001645 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/18:1(9Z)/14:0))PW001646 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/18:1(9Z)/17:0cycw7c))PW001647 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/19:0cycv8c/17:0cycw7c))PW001648 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/14:0))PW001649 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/15:0cyclo))PW001664 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/16:0))PW001665 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/16:1(9Z)))PW001666 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/17:0cycw7c))PW001667 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/18:1(9Z)))PW001668 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/19:0cycv8c))PW001669 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/14:0))PW001670 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/15:0cyclo))PW001671 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/16:0))PW001672 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/16:1(9Z)))PW001673 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/17:0cycw7c))PW001679 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/18:1(9Z)))PW001680 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/19:0cycv8c))PW001685 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/18:1(9Z)/14:0))PW001686 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/18:1(9Z)/17:0cycw7c))PW001687 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/18:1(9Z)/19:0cycv8c))PW001026 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/18:1(9Z)/19:0cycv8c)) 1440195714PW001034 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/18:1(9Z)/19:0cycv8c)) 2PW001186 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/14:0))PW001688 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/15:0cyclo))PW001185 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/16:0))PW001194 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/16:0)) 1442332377PW001956 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/16:1(9Z))PW001212 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/17:0cycw7c))PW001210 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/14:0/14:0))PW001211 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/14:0/18:1(9Z)))PW001233 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/14:0/19:0cycv8c))PW001234 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/17:0cycw7c/17:0cycw7c))PW001240 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/17:0cycw7c/18:1(9Z)))PW001241 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/18:1(9Z)/14:0))PW001244 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/18:1(9Z)/17:0cycw7c))PW001248 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/19:0cycv8c/14:0))PW001249 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(18:1/18:1/18:1/18:1))PW001027 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0/16:1(9Z)/14:0/14:0))PW001983 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0/16:1(9Z)/16:0/16:0))PW001984 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0/16:1(9Z)/19:0/16:1(9Z)))PW001985 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0/18:1(11Z)/14:0/14:0))PW001986 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0/18:1(11Z)/19:0/18:1(11Z)))PW001987 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0/18:1(11Z)/19:0/19:0))PW001988 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/10:0(3-OH)/10:0/10:0))PW001989 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/10:0(3-OH)/19:0cycv8c/10:0(3-OH)))PW001991 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/12:0(3-OH)/12:0/12:0))PW001992 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/12:0(3-OH)/19:0cycv8c/12:0(3-OH)))PW001993 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/14:0/14:0/17:0cycw7c))PW001251 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/14:0/14:0/19:0cycv8c))PW001253 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/14:0/17:0cycw7c/14:0))PW001262 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/14:0/17:0cycw7c/17:0cycw7c))PW001263 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/14:0/19:0cycv8c/14:0))PW001275 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/14:0/15:0cyclo))PW001276 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/14:0/19:0cycv8c))PW001291 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/15:0cyclo/14:0))PW001292 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/15:0cyclo/17:0cycw7c))PW001298 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/16:0/19:0cycv8c))PW001299 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/16:1(9Z)/19:0cycv8c))PW001300 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/17:0cycw7c/15:0cyclo))PW001301 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/17:0cycw7c/17:0cycw7c))PW001302 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/18:1(9Z)/19:0cycv8c))PW001304 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/14:0))PW001309 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/15:0cyclo))PW001310 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/16:0))PW001316 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/16:1(9Z)))PW001317 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/18:1(9Z)))PW001318 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/19:0cycv8c))PW001319 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/14:0/14:0))PW001320 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/14:0/16:0))PW001321 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/14:0/19:0cycv8c))PW001322 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/16:0/14:0))PW001323 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/16:0/17:0cycw7c))PW001324 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/16:1(9Z)/19:0cycv8c))PW001326 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/17:0cycw7c/16:0))PW001331 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/17:0cycw7c/17:0cycw7c))PW001332 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/17:0cycw7c/19:0cycv8c))PW001333 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/18:1(9Z)/19:0cycv8c))PW001334 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/19:0cycv8c/14:0))PW001340 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/19:0cycv8c/16:1(9Z)))PW001341 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/19:0cycv8c/17:0cycw7c))PW001372 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/19:0cycv8c/18:1(9Z)))PW001373 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/14:0/14:0))PW001374 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/14:0/16:1(9Z)))PW001375 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/14:0/19:0cycv8c))PW001376 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/16:1(9Z)/14:0))PW001377 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/16:1(9Z)/17:0cycw7c))PW001383 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/17:0cycw7c/16:1(9Z)))PW001384 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/17:0cycw7c/17:0cycw7c))PW001385 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/17:0cycw7c/19:0cycv8c))PW001386 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/18:1(9Z)/19:0cycv8c))PW001387 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/19:0cycv8c/14:0))PW001388 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/19:0cycv8c/16:1(9Z)))PW001394 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/19:0cycv8c/17:0cycw7c))PW001395 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/19:0cycv8c/18:1(9Z)))PW001396 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/14:0/14:0))PW001397 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/14:0/17:0cycw7c))PW001403 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/14:0/19:0cycv8c))PW001404 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/17:0cycw7c/14:0))PW001405 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/17:0cycw7c/19:0cycv8c))PW001406 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/19:0cycv8c/14:0))PW001407 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/19:0cycv8c/17:0cycw7c))PW001408 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/14:0/14:0))PW001414 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/14:0/18:1(9Z)))PW001415 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/14:0/19:0cycv8c))PW001420 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/17:0cycw7c/17:0cycw7c))PW001422 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/17:0cycw7c/18:1(9Z)))PW001423 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/18:1(9Z)/14:0))PW001424 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/18:1(9Z)/17:0cycw7c))PW001426 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/19:0cycv8c/14:0))PW001428 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/14:0))PW001432 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/15:0cyclo))PW001433 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/16:0))PW001434 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/16:1(9Z)))PW001435 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/17:0cycw7c))PW001436 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/18:1(9Z)))PW001438 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/19:0cycv8c))PW001443 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/17:0cycw7c/14:0))PW001444 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/17:0cycw7c/16:0))PW001445 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/17:0cycw7c/16:1(9Z)))PW001446 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/17:0cycw7c/17:0cycw7c))PW001447 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/19:0cycv8c/14:0))PW001448 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:0cycw8c/10:0/10:0/10:0))PW001994 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:1(9Z)/16:1(9Z)/19:1(9Z)/16:1(9Z)))PW001995 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/10:0(3-OH)/10:0/10:0))PW001996 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/10:0(3-OH)/19:iso/10:0(3-OH)))PW001997 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/10:0/19:iso/10:0))PW001998 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/12:0(3-OH)/12:0/12:0))PW001999 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/12:0(3-OH)/19:iso/12:0(3-OH)))PW002000 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/12:0/19:iso/12:0))PW002001 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/14:0(3-OH)/14:0/14:0))PW002002 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/14:0(3-OH)/19:iso/14:0(3-OH)))PW002004 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/14:0/14:0/14:0))PW002005 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/14:0/19:iso/14:0))PW002006 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/17:0cycw7c/19:0/19:0))PW002007 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/19:0cycv8c/19:0/19:0))PW002008 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (CL(19:iso/19:iso/19:iso/19:iso))PW002009 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(16:0/10:0(3-OH)))PW001741 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(16:0/12:0(3-OH)))PW001744 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(16:0/18:0))PW001748 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(16:0/19:iso))PW001751 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(16:1(9Z)/10:0(3-OH)))PW001753 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(16:1(9Z)/12:0(3-OH)))PW001755 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(16:1(9Z)/18:0))PW001758 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(16:1(9Z)/19:iso))PW001760 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(18:0/14:0))PW001765 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(18:0/16:0))PW001767 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(18:0/16:1(9Z)))PW001770 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(18:0/18:0))PW001772 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(18:0/18:1(9Z)))PW001774 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(18:1(9Z)/10:0(3-OH)))PW001779 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(18:1(9Z)/12:0(3-OH)))PW001780 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(19:iso/10:0))PW001786 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis (PE(19:iso/12:0))PW001787 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/10:0) IPW001743 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/10:0) IIPW001815 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/10:0) IIIPW001816 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/10:0) IVPW001817 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/12:0)PW001746 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/12:0) IIPW001818 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/12:0) IIIPW001819 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/12:0) IVPW001820 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/14:0)PW001747 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/14:0) IIPW001821 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/14:0) IIIPW001822 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/14:0) IVPW001823 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/15:0)PW001749 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/15:0) IIPW001826 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/15:0) IIIPW001825 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/16:0)PW001750 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/16:0) IIPW001827 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/16:1(9Z))PW001752 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/16:1(9Z)) IIPW001828 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/18:0)PW001754 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/18:0) IIIPW001833 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/18:1(9Z))PW001756 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/19:1(9Z))PW001763 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/19:1(9Z)) IIPW001829 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/19:1(9Z)) IIIPW001830 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/19:1(9Z)) IVPW001831 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(10:0/19:1(9Z)) VPW001832 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/10:0)PW001764 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/10:0) IIPW001834 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/10:0) IIIPW001835 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/10:0) IVPW001844 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/14:0)PW001768 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/14:0) IIPW001836 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/14:0) IIIPW001837 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/14:0) IVPW001840 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/15:0)PW001769 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/15:0) IIPW001838 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/15:0) IIIPW001839 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/16:0)PW001771 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/16:0) IIPW001841 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/16:1(9Z))PW001773 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/16:1(9Z)) IIPW001842 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/18:0)PW001775 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/18:1(9Z))PW001777 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/18:1(9Z)) IIPW001843 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/19:1(9Z))PW001778 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/19:1(9Z)) IIPW001848 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/19:1(9Z)) IIIPW001847 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/19:1(9Z)) IVPW001846 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(12:0/19:1(9Z)) VPW001845 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/10:0)PW001793 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/10:0) IIPW001852 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/10:0) IIIPW001851 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/10:0) IVPW001850 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/12:0)PW001794 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/12:0) IIPW001855 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/12:0) IIIPW001854 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/12:0) IVPW001853 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/15:0)PW001795 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/15:0) IIPW001857 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/18:0)PW001802 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/18:1(9Z))PW001803 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/19:1(9Z))PW001804 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(14:0/19:1(9Z)) IIPW001858 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(15:0/10:0)PW001805 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(15:0/10:0) IIPW001859 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(15:0/12:0)PW001806 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(15:0/12:0) IIPW001861 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(15:0/12:0) IIIPW001862 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(15:0/14:0)PW001807 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(15:0/15:0)PW001808 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(15:0/16:0)PW001809 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(15:0/16:1(9Z))PW001810 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(15:0/18:0)PW001811 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(15:0/18:1(9Z))PW001812 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(15:0/19:1(9Z))PW001813 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CDP-DG(16:0/10:0)PW001814 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/15:0cyclo/14:0/17:0cycw7c)PW001029 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:0/14:0/14:0)PW001031 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:0/14:0/16:0)PW001032 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:0/14:0/16:1(9Z))PW001871 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:0/14:0/18:1(9Z))PW001033 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:0/14:0/19:0cycv8c)PW001035 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:0/16:1(9Z)/14:0)PW001036 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:0/18:1(9Z)/14:0)PW001037 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:0/19:0cycv8c/14:0)PW001038 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:1(9Z)/14:0/16:1(9Z))PW001039 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:1(9Z)/14:0/18:1(9Z))PW001040 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:1(9Z)/14:0/19:0cycv8c)PW001041 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:1(9Z)/18:1(9Z)/14:0)PW001042 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/16:1(9Z)/19:0cycv8c/14:0)PW001043 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/14:0/14:0)PW001044 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/14:0/17:0cycw7c)PW001045 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/14:0/18:1(9Z))PW001046 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/14:0/19:0cycv8c)PW001047 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/17:0cycw7c/14:0)PW001048 ThumbThumb?image type=greyscaleThumb?image type=simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/19:0cycv8c/14:0)PW001049 Thumb