Record Information
Version2.0
Creation Date2012-05-31 14:06:19 -0600
Update Date2015-10-15 16:13:34 -0600
Secondary Accession Numbers
  • ECMDB04142
Identification
Name:Pyrophosphate
Description:Pyrophosphates are the anions, the salts, and the esters of pyrophosphoric acid. The anion is abbreviated PPi and is formed by the hydrolysis of ATP into AMP in cells. This hydrolysis is called pyrophosphorolysis. The pyrophosphate anion has the structure P2O74-, and is an acid anhydride of phosphate. It is unstable in aqueous solution and rapidly hydrolyzes into inorganic phosphate
Structure
Thumb
Synonyms:
  • (4-)Diphosphate ion
  • (4-)Diphosphorate ion
  • (4-)Diphosphoric acid ion
  • (P2O74-)Diphosphate
  • (P2O74-)Diphosphoric acid
  • Diphosphate
  • Diphosphorate
  • Diphosphoric acid
  • PP
  • PPi
  • Pyrometaphosphate
  • Pyrometaphosphoric acid
  • Pyrophosphate
  • Pyrophosphate tetraanion
  • Pyrophosphate(4-) ion
  • Pyrophosphoric acid
  • Pyrophosphoric acid tetraanion
  • Pyrophosphoric acid(4-) ion
Chemical Formula:O7P2
Weight:Average: 173.9433
Monoisotopic: 173.911925378
InChI Key:XPPKVPWEQAFLFU-UHFFFAOYSA-J
InChI:InChI=1S/H4O7P2/c1-8(2,3)7-9(4,5)6/h(H2,1,2,3)(H2,4,5,6)/p-4
CAS number:14000-31-8
IUPAC Name:(phosphonatooxy)phosphonate
Traditional IUPAC Name:diphosphate
SMILES:[O-]P([O-])(=O)OP([O-])([O-])=O
Chemical Taxonomy
DescriptionThis compound belongs to the class of chemical entities known as non-metal pyrophosphates. These are inorganic non-metallic compounds containing a pyrophosphate as its largest oxoanion.
KingdomChemical entities
Super ClassInorganic compounds
ClassHomogeneous non-metal compounds
Sub ClassNon-metal oxoanionic compounds
Direct ParentNon-metal pyrophosphates
Alternative Parents
Substituents
  • Non-metal pyrophosphate
  • Inorganic oxide
Molecular FrameworkNot Available
External Descriptors
Physical Properties
State:Solid
Charge:-3
Melting point:61 °C
Experimental Properties:
PropertyValueSource
Predicted Properties
PropertyValueSource
logP-1.4ChemAxon
pKa (Strongest Acidic)1.7ChemAxon
Physiological Charge-3ChemAxon
Hydrogen Acceptor Count6ChemAxon
Hydrogen Donor Count0ChemAxon
Polar Surface Area135.61 Å2ChemAxon
Rotatable Bond Count2ChemAxon
Refractivity21.04 m3·mol-1ChemAxon
Polarizability9.03 Å3ChemAxon
Number of Rings0ChemAxon
Bioavailability1ChemAxon
Rule of FiveYesChemAxon
Ghose FilterYesChemAxon
Veber's RuleYesChemAxon
MDDR-like RuleYesChemAxon
Biological Properties
Cellular Locations:Cytoplasm
Reactions:
Dihydroneopterin triphosphate + Water > Dihydroneopterin monophosphate + Hydrogen ion + Pyrophosphate
Guanosine triphosphate + Water > Guanosine monophosphate + Hydrogen ion + Pyrophosphate
dGTP + Water > 2'-Deoxyguanosine 5'-monophosphate + Hydrogen ion + Pyrophosphate
Guanine + Phosphoribosyl pyrophosphate > Guanosine monophosphate + Pyrophosphate
Hypoxanthine + Phosphoribosyl pyrophosphate <> Inosinic acid + Pyrophosphate
Guanosine triphosphate + Water <> Cyclic pyranopterin monophosphate + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Dodecanoate (N-C12:0) + Hydrogen ion > Adenosine monophosphate + Lauroyl-CoA + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Palmitic acid > Adenosine monophosphate + Hydrogen ion + Palmityl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Octadecanoate (N-C18:0) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + Stearoyl-CoA
Adenosine triphosphate + Coenzyme A + Hydrogen ion + tetradecanoate (n-C14:0) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + Tetradecanoyl-CoA
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Tetradecenoate (N-C14:1) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + (2E)-Tetradecenoyl-CoA
Adenosine triphosphate + L-Phenylalanine + tRNA(Phe) + tRNA(Phe) <> Adenosine monophosphate + L-Phenylalanyl-tRNA(Phe) + Pyrophosphate + L-Phenylalanyl-tRNA(Phe)
Cytidine triphosphate + Water > Cytidine monophosphate + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Decanoate (N-C10:0) + Hydrogen ion > Adenosine monophosphate + Decanoyl-CoA (N-C10:0CoA) + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Caprylic acid > Adenosine monophosphate + Hydrogen ion + Octanoyl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Hexadecenoate (n-C16:1) > Adenosine monophosphate + Hydrogen ion + (2E)-Hexadecenoyl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Hexanoate (N-C6:0) > Adenosine monophosphate + Hydrogen ion + Hexanoyl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Octadecenoate (N-C18:1) > Adenosine monophosphate + Hydrogen ion + Octadecenoyl-CoA (N-C18:1CoA) + Pyrophosphate
Thymidine 5'-triphosphate + Glucose 1-phosphate + Hydrogen ion <> dTDP-D-Glucose + Pyrophosphate
Water + Triphosphate > Hydrogen ion + Phosphate + Pyrophosphate
Adenosine triphosphate + Dehydroglycine + 1-Deoxy-D-xylulose 5-phosphate + Hydrogen ion + IscS with bound sulfur + NADPH > 4-Methyl-5-(2-phosphoethyl)-thiazole + Adenosine monophosphate + Carbon dioxide +2 Water + IscS sulfur acceptor protein + NADP + Pyrophosphate
Water + Pyrophosphate > Hydrogen ion +2 Phosphate
Adenosine triphosphate + Guanosine triphosphate + Water + Sulfate > Adenosine phosphosulfate + Guanosine diphosphate + Phosphate + Pyrophosphate
dATP + Water > Deoxyadenosine monophosphate + Hydrogen ion + Pyrophosphate
dCTP + Water > dCMP + Hydrogen ion + Pyrophosphate
Thymidine 5'-triphosphate + Water > 5-Thymidylic acid + Hydrogen ion + Pyrophosphate
acyl carrier protein + Adenosine triphosphate + Palmitic acid > Adenosine monophosphate + Palmitoyl-ACP (n-C16:0ACP) + Pyrophosphate
acyl carrier protein + Adenosine triphosphate + Caprylic acid > Adenosine monophosphate + Octanoyl-ACP (n-C8:0ACP) + Pyrophosphate
acyl carrier protein + Adenosine triphosphate + Decanoate (N-C10:0) > Adenosine monophosphate + Decanoyl-ACP (n-C10:0ACP) + Pyrophosphate
acyl carrier protein + Adenosine triphosphate + Dodecanoate (N-C12:0) > Adenosine monophosphate + Dodecanoyl-ACP (n-C12:0ACP) + Pyrophosphate
acyl carrier protein + Adenosine triphosphate + Hexadecenoate (n-C16:1) > Adenosine monophosphate + cis-hexadec-9-enoyl-[acyl-carrier protein] (n-C16:1) + Pyrophosphate
acyl carrier protein + Adenosine triphosphate + Octadecanoate (N-C18:0) > Adenosine monophosphate + Octadecanoyl-ACP (n-C18:0ACP) + Pyrophosphate
acyl carrier protein + Adenosine triphosphate + Octadecenoate (N-C18:1) > Adenosine monophosphate + cis-octadec-11-enoyl-[acyl-carrier protein] (n-C18:1) + Pyrophosphate
acyl carrier protein + Adenosine triphosphate + tetradecanoate (n-C14:0) > Adenosine monophosphate + Myristoyl-ACP (n-C14:0ACP) + Pyrophosphate
acyl carrier protein + Adenosine triphosphate + Tetradecenoate (N-C14:1) > Adenosine monophosphate + Pyrophosphate + cis-tetradec-7-enoyl-[acyl-carrier protein] (n-C14:1)
Adenosine triphosphate + Glycine + tRNA(Gly) + tRNA(Gly) <> Adenosine monophosphate + Glycyl-tRNA(Gly) + Pyrophosphate + Glycyl-tRNA(Gly)
Deoxyuridine triphosphate + Water <> dUMP + Hydrogen ion + Pyrophosphate
bis-molybdenum cofactor + Guanosine triphosphate + Hydrogen ion > bis-molybdopterin mono-guanine dinucleotide + Pyrophosphate
Guanosine triphosphate + Hydrogen ion + Molybdopterin > Molybdopterin guanine dinucleotide + Pyrophosphate
bis-molybdopterin mono-guanine dinucleotide + Guanosine triphosphate + Hydrogen ion > Bis-molybdopterin guanine dinucleotide + Pyrophosphate
tungsten bispterin cofactor + Guanosine triphosphate + Hydrogen ion > tungsten bispterin cofactor mono-guanine dinucleotide + Pyrophosphate
tungsten bispterin cofactor mono-guanine dinucleotide + Guanosine triphosphate + Hydrogen ion > tungsten bispterin cofactor guanine dinucleotide + Pyrophosphate
Adenosine triphosphate + L-Lysine + tRNA(Lys) > Adenosine monophosphate + L-Lysine-tRNA (Lys) + Pyrophosphate
Adenosine triphosphate + Hydrogen ion + Nicotinamide ribotide + NMN <> NAD + Pyrophosphate
Adenosine triphosphate + Hydrogen ion + Molybdopterin <> Adenylated molybdopterin + Pyrophosphate
Adenosine triphosphate + Flavin Mononucleotide + Hydrogen ion > FAD + Pyrophosphate
Adenosine triphosphate + L-Isoleucine + tRNA(Ile) + tRNA(Ile) <> Adenosine monophosphate + L-Isoleucyl-tRNA(Ile) + Pyrophosphate + L-Isoleucyl-tRNA(Ile)
2 Hydrogen ion + Phosphoribosyl pyrophosphate + Quinolinic acid <> Carbon dioxide + Nicotinamide ribotide + Pyrophosphate
beta-Alanine + Adenosine triphosphate + (R)-Pantoate <> Adenosine monophosphate + Hydrogen ion + Pantothenic acid + Pyrophosphate
Farnesyl pyrophosphate + 8 Isopentenyl pyrophosphate >8 Pyrophosphate + Undecaprenyl diphosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-didodecanoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-dihexadec-9-enoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-dihexadecanoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-dioctadec-11-enoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-Dioctadecanoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-ditetradec-7-enoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-ditetradecanoylglycerol + Pyrophosphate
Adenosine triphosphate + L-Proline + tRNA(Pro) + tRNA(Pro) <> Adenosine monophosphate + Pyrophosphate + L-Prolyl-tRNA(Pro) + L-Prolyl-tRNA(Pro)
Phosphoribosyl pyrophosphate + Xanthine <> Pyrophosphate + Xanthylic acid
Dimethylallylpyrophosphate + Isopentenyl pyrophosphate > Geranyl-PP + Pyrophosphate
Geranyl-PP + Isopentenyl pyrophosphate + Geranyl diphosphate <> Farnesyl pyrophosphate + Pyrophosphate
Farnesyl pyrophosphate + Water + Heme > Heme O + Pyrophosphate
Adenine + Phosphoribosyl pyrophosphate <> Adenosine monophosphate + Pyrophosphate
Adenosine triphosphate + L-Cysteine + tRNA(Cys) + tRNA(Cys) <> Adenosine monophosphate + L-Cysteinyl-tRNA(Cys) + Pyrophosphate + L-Cysteinyl-tRNA(Cys)
Adenosine triphosphate + Hydrogen ion + L-Serine <> Pyrophosphate + L-Seryl-AMP
2-Pyrocatechuic acid + Adenosine triphosphate + Hydrogen ion > (2,3-Dihydroxybenzoyl)adenylic acid + Pyrophosphate
Adenosine triphosphate + Hydrogen ion + Nicotinamide ribotide <> Nicotinic acid adenine dinucleotide + Pyrophosphate
Adenosine triphosphate + L-Leucine + tRNA(Leu) > Adenosine monophosphate + L-Leucyl-tRNA(Leu) + Pyrophosphate
L-Aspartic acid + Adenosine triphosphate + L-Glutamine + Water > Adenosine monophosphate + L-Asparagine + L-Glutamate + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + L-Glutamine + tRNA(Gln) > Adenosine monophosphate + L-Glutaminyl-tRNA(Gln) + Pyrophosphate
Adenosine triphosphate + Hydrogen ion + MoaD Protein with carboxylate > MoaD Protein with bound AMP + Pyrophosphate
Adenosine triphosphate + L-Serine + tRNA(SeCys) > Adenosine monophosphate + Pyrophosphate
Adenosine triphosphate + L-Serine + tRNA(Ser) + tRNA(Ser) <> Adenosine monophosphate + Pyrophosphate + L-Seryl-tRNA(Ser) + L-Seryl-tRNA(Ser)
Cytidine triphosphate + 3-Deoxy-D-manno-octulosonate <> CMP-3-Deoxy-D-manno-octulosonate + Pyrophosphate
L-Asparagine + Adenosine triphosphate + tRNA(Asn) + tRNA(Asn) <> Adenosine monophosphate + L-Asparaginyl-tRNA(Asn) + Pyrophosphate + L-Asparaginyl-tRNA(Asn)
Adenosine triphosphate + Water + Nicotinic acid + Phosphoribosyl pyrophosphate > ADP + Nicotinamide ribotide + Phosphate + Pyrophosphate
Glucose 1-phosphate + Hydrogen ion + Uridine triphosphate <> Pyrophosphate + UDP-Glucose
2-Aminobenzoic acid + Phosphoribosyl pyrophosphate > Pyrophosphate + N-(5-Phospho-D-ribosyl)anthranilate
Guanosine triphosphate + 3 Water <> 2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Formic acid +2 Hydrogen ion + Pyrophosphate + 2,5-diamino-6-hydroxy-4-(5-phospho-D-ribosylamino)pyrimidine
Adenosine triphosphate + Coenzyme A + Benzeneacetic acid <> Adenosine monophosphate + Phenylacetyl-CoA + Pyrophosphate
Adenosine triphosphate + tRNA(Tyr) + L-Tyrosine + tRNA(Tyr) <> Adenosine monophosphate + Pyrophosphate + L-Tyrosyl-tRNA(Tyr) + L-Tyrosyl-tRNA(Tyr)
Adenosine triphosphate + L-Threonine + tRNA(Thr) + tRNA(Thr) <> Adenosine monophosphate + Pyrophosphate + L-Threonyl-tRNA(Thr) + L-Threonyl-tRNA(Thr)
Adenosine triphosphate + Nicotinic acid adenine dinucleotide + Ammonium > Adenosine monophosphate + Hydrogen ion + NAD + Pyrophosphate
L-Aspartic acid + Adenosine triphosphate + tRNA(Asp) + tRNA(Asp) <> Adenosine monophosphate + L-Aspartyl-tRNA(Asp) + Pyrophosphate + L-Aspartyl-tRNA(Asp)
L-Arginine + Adenosine triphosphate + tRNA(Arg) + tRNA(Arg) <> Adenosine monophosphate + L-Arginyl-tRNA(Arg) + Pyrophosphate + L-Arginyl-tRNA(Arg)
Adenosyl cobinamide phosphate + Guanosine triphosphate + Hydrogen ion > Adenosylcobinamide-GDP + Pyrophosphate
Adenosine triphosphate + Phosphoribosyl pyrophosphate <> Pyrophosphate + Phosphoribosyl-ATP
Water + Phosphoribosyl-ATP <> Hydrogen ion + Pyrophosphate + Phosphoribosyl-AMP
Adenosine triphosphate + L-Methionine + tRNA(Met) > Adenosine monophosphate + L-Methionyl-tRNA (Met) + Pyrophosphate
Adenosine triphosphate + Coenzyme A + 2-Succinylbenzoate <> Adenosine monophosphate + Pyrophosphate + 2-Succinylbenzoyl-CoA
L-Glutamine + Water + Phosphoribosyl pyrophosphate <> L-Glutamate + Pyrophosphate + 5-Phosphoribosylamine
Adenosine triphosphate + L-Glutamate + tRNA (Glu) > Adenosine monophosphate + L-Glutamyl-tRNA(Glu) + Pyrophosphate
Phosphoribosyl pyrophosphate + Uracil <> Pyrophosphate + Uridine 5'-monophosphate
Adenosine triphosphate + Phosphate <> ADP + Pyrophosphate
Adenosine triphosphate + Pyrophosphate <> ADP + Triphosphate
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid > Adenosine monophosphate + L-Glutamate + Guanosine monophosphate +2 Hydrogen ion + Pyrophosphate
Adenosine triphosphate + L-Histidine + tRNA(His) + tRNA(His) <> Adenosine monophosphate + L-Histidyl-tRNA(His) + Pyrophosphate + L-Histidyl-tRNA(His)
L-Alanine + Adenosine triphosphate + tRNA(Ala) > L-Alanyl-tRNA(Ala) + Adenosine monophosphate + Pyrophosphate
2-C-Methyl-D-erythritol-4-phosphate + Cytidine triphosphate + Hydrogen ion <> 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Pyrophosphate
Water + Uridine triphosphate > Hydrogen ion + Pyrophosphate + Uridine 5'-monophosphate
Adenosine triphosphate + Water <> Adenosine monophosphate + Hydrogen ion + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C12:0) + Adenosine triphosphate + Dodecanoate (N-C12:0) > Adenosine monophosphate + PE(14:0/14:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:0) + Adenosine triphosphate + tetradecanoate (n-C14:0) > Adenosine monophosphate + PE(14:0/14:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:1) + Adenosine triphosphate + Tetradecenoate (N-C14:1) > Adenosine monophosphate + PE(14:0/14:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:0) + Adenosine triphosphate + Palmitic acid > Adenosine monophosphate + PE(14:0/14:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:1) + Adenosine triphosphate + Hexadecenoate (n-C16:1) > Adenosine monophosphate + PE(14:0/14:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:0) + Adenosine triphosphate + Octadecanoate (N-C18:0) > Adenosine monophosphate + PE(14:0/14:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:1) + Adenosine triphosphate + Octadecenoate (N-C18:1) > Adenosine monophosphate + PE(14:0/14:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoglycerol (n-C12:0) + Adenosine triphosphate + Dodecanoate (N-C12:0) > Adenosine monophosphate + PG(12:0/12:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoglycerol (N-C14:0) + Adenosine triphosphate + tetradecanoate (n-C14:0) > Adenosine monophosphate + PG(14:0/14:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoglycerol (N-C14:1) + Adenosine triphosphate + Tetradecenoate (N-C14:1) > Adenosine monophosphate + PG(14:1(7Z)/14:1(7Z)) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoglycerol (N-C16:0) + Adenosine triphosphate + Palmitic acid > Adenosine monophosphate + PG(16:0/16:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoglycerol (N-C16:1) + Adenosine triphosphate + Hexadecenoate (n-C16:1) > Adenosine monophosphate + PG(16:1(9Z)/16:1(9Z)) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoglycerol (N-C18:0) + Adenosine triphosphate + Octadecanoate (N-C18:0) > Adenosine monophosphate + PG(18:0/18:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoglycerol (N-C18:1) + Adenosine triphosphate + Octadecenoate (N-C18:1) > Adenosine monophosphate + PG(18:1(11Z)/18:1(11Z)) + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + Molybdopterin > Molybdopterin cytosine dinucleotide + Pyrophosphate
Adenosine triphosphate + Water + L-Methionine <> S-Adenosylmethionine + Phosphate + Pyrophosphate
Water + Inosine triphosphate > Hydrogen ion + Inosinic acid + Pyrophosphate
Water + Xanthosine 5-triphosphate > Hydrogen ion + Pyrophosphate + Xanthylic acid
2'-Deoxyinosine triphosphate + Water > DIMP + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + D-Glycero-D-manno-heptose 1-phosphate + Hydrogen ion > ADP-D-Glycero-D-manno-heptose + Pyrophosphate
L-Aspartic acid + Adenosine triphosphate + Citrulline <> Adenosine monophosphate + Argininosuccinic acid + Hydrogen ion + Pyrophosphate
p-Aminobenzoic acid + 6-Hydroxymethyl-dihydropterin pyrophosphate > 7,8-Dihydropteroic acid + Pyrophosphate
Farnesyl pyrophosphate + 5 Isopentenyl pyrophosphate <> Octaprenyl diphosphate +5 Pyrophosphate
Adenosine triphosphate + tRNA(Trp) + L-Tryptophan + tRNA(Trp) <> Adenosine monophosphate + Pyrophosphate + L-Tryptophanyl-tRNA(Trp)
Adenosine triphosphate + Glucose 1-phosphate + Hydrogen ion <> ADP-Glucose + Pyrophosphate
Adenosine triphosphate + Hydrogen ion + Pantetheine 4'-phosphate <> Dephospho-CoA + Pyrophosphate
D-4'-Phosphopantothenate + Cytidine triphosphate + L-Cysteine > 4-Phosphopantothenoylcysteine + Cytidine monophosphate + Hydrogen ion + Pyrophosphate
Orotidylic acid + Pyrophosphate <> Orotic acid + Phosphoribosyl pyrophosphate
Water + Guanosine 3',5'-bis(diphosphate) <> Guanosine diphosphate + Pyrophosphate
Guanosine 3'-diphosphate 5'-triphosphate + Water > Guanosine triphosphate + Pyrophosphate
N-Acetyl-glucosamine 1-phosphate + Hydrogen ion + Uridine triphosphate > Pyrophosphate + Uridine diphosphate-N-acetylglucosamine
L-Aspartic acid + Adenosine triphosphate + Ammonium > Adenosine monophosphate + L-Asparagine + Hydrogen ion + Pyrophosphate
Adenosine triphosphate <> Cyclic AMP + Pyrophosphate
1,4-Dihydroxy-2-naphthoic acid + Hydrogen ion + Octaprenyl diphosphate > 2-Demethylmenaquinol 8 + Carbon dioxide + Pyrophosphate
2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate + 4-Methyl-5-(2-phosphoethyl)-thiazole + Hydrogen ion <> Pyrophosphate + Thiamine monophosphate
4-Hydroxybenzoic acid + Octaprenyl diphosphate > 3-Octaprenyl-4-hydroxybenzoate + Pyrophosphate
Acetic acid + Adenosine triphosphate + Coenzyme A <> Acetyl-CoA + Adenosine monophosphate + Pyrophosphate
2 Adenosine triphosphate + Hydrogen ion > Diadenosine tetraphosphate + Pyrophosphate
Adenosine triphosphate + tRNA(Val) + L-Valine + tRNA(Val) <> Adenosine monophosphate + Pyrophosphate + L-Valyl-tRNA(Val) + L-Valyl-tRNA(Val)
Adenosine triphosphate + Lipoic acid > Lipoyl-AMP + Pyrophosphate
Adenosine triphosphate + Hydrogen ion + Caprylic acid > Adenosine monophosphate + octanoate (protein bound) + Pyrophosphate
Adenosine triphosphate + Water <> Adenosine monophosphate + Pyrophosphate
Adenosine triphosphate <> Cyclic AMP + Pyrophosphate
Adenosine triphosphate + Nicotinamide ribotide <> Pyrophosphate + NAD
Adenosine triphosphate + Flavin Mononucleotide <> Pyrophosphate + FAD
Phosphate + Pyrophosphate + S-Adenosylmethionine <> Adenosine triphosphate + L-Methionine + Water
Adenosine triphosphate + Nicotinic acid adenine dinucleotide + Ammonia <> Adenosine monophosphate + Pyrophosphate + NAD
Adenosine monophosphate + Pyrophosphate <> Adenine + Phosphoribosyl pyrophosphate
Adenosine triphosphate + Acetic acid + Coenzyme A <> Adenosine monophosphate + Pyrophosphate + Acetyl-CoA
Uridine triphosphate + Glucose 1-phosphate <> Pyrophosphate + UDP-Glucose
Adenosine triphosphate + Acetic acid <> Pyrophosphate + Acetyl adenylate
Guanosine 3',5'-bis(diphosphate) + Water <> Guanosine diphosphate + Pyrophosphate
dATP + DNA <> Pyrophosphate + DNA
dGTP + DNA <> Pyrophosphate + DNA
dCTP + DNA <> Pyrophosphate + DNA
Thymidine 5'-triphosphate + DNA <> Pyrophosphate + DNA
Uridine triphosphate + Glucosamine-1P <> Pyrophosphate + Uridine diphosphate-N-acetylglucosamine
Guanosine triphosphate + 3 Water <> Formic acid + 2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Pyrophosphate
Guanosine triphosphate + Water <> Guanosine monophosphate + Pyrophosphate
Guanosine triphosphate <> Cyclic GMP + Pyrophosphate
Adenosine triphosphate + RNA + RNA <> Pyrophosphate + RNA
Guanosine triphosphate + RNA <> Pyrophosphate + RNA
Cytidine triphosphate + RNA <> Pyrophosphate + RNA
Uridine triphosphate + RNA <> Pyrophosphate + RNA
Adenosine triphosphate + L-Aspartic acid + Ammonia <> Adenosine monophosphate + Pyrophosphate + L-Asparagine
Cytidine triphosphate + Water <> Cytidine monophosphate + Pyrophosphate
Adenosine triphosphate + Sulfate <> Pyrophosphate + Adenosine phosphosulfate
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water <> Adenosine monophosphate + Pyrophosphate + L-Asparagine + L-Glutamate
Uridine triphosphate + Water <> Uridine 5'-monophosphate + Pyrophosphate
Inosine triphosphate + Water <> Inosinic acid + Pyrophosphate
Guanosine triphosphate + D-Mannose 1-phosphate <> Pyrophosphate + Guanosine diphosphate mannose
Adenosine triphosphate + Glucose 1-phosphate <> Pyrophosphate + ADP-Glucose
Uridine 5'-monophosphate + Pyrophosphate <> Uracil + Phosphoribosyl pyrophosphate
Phosphoribosyl-ATP + Pyrophosphate <> Adenosine triphosphate + Phosphoribosyl pyrophosphate
5-Phosphoribosylamine + Pyrophosphate + L-Glutamate <> L-Glutamine + Phosphoribosyl pyrophosphate + Water
N-(5-Phospho-D-ribosyl)anthranilate + Pyrophosphate <> 2-Aminobenzoic acid + Phosphoribosyl pyrophosphate
Adenosine triphosphate + Biotin <> Pyrophosphate + Biotinyl-5'-AMP
Dimethylallylpyrophosphate + tRNA <> Pyrophosphate + tRNA containing 6-isopentenyladenosine
Inosinic acid + Pyrophosphate <> Hypoxanthine + Phosphoribosyl pyrophosphate
Guanosine monophosphate + Pyrophosphate <> Guanine + Phosphoribosyl pyrophosphate
Adenosine triphosphate + Xanthylic acid + Ammonia <> Adenosine monophosphate + Pyrophosphate + Guanosine monophosphate
Adenosine triphosphate + Xanthylic acid + L-Glutamine + Water <> Adenosine monophosphate + Pyrophosphate + Guanosine monophosphate + L-Glutamate
Adenosine triphosphate + Palmitic acid + Coenzyme A <> Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
Adenosine triphosphate + Propionic acid <> Pyrophosphate + Propinol adenylate
Adenosine triphosphate + Long-chain fatty acid + Acyl-carrier protein <> Adenosine monophosphate + Pyrophosphate + Acyl-[acyl-carrier protein]
Dimethylallylpyrophosphate + Isopentenyl pyrophosphate <> Pyrophosphate + Geranyl-PP
Nicotinamide ribotide + Pyrophosphate + Adenosine triphosphate + Water <> Nicotinic acid + Phosphoribosyl pyrophosphate + ADP + Phosphate
Cytidine triphosphate + PA(16:0/16:0) <> Pyrophosphate + CDP-diacylglycerol
dGTP + Water <> 2'-Deoxyguanosine 5'-monophosphate + Pyrophosphate
Orotidylic acid + Pyrophosphate <> Orotic acid + Phosphoribosyl pyrophosphate
Adenosine triphosphate + Citrulline + L-Aspartic acid <> Adenosine monophosphate + Pyrophosphate + Argininosuccinic acid
Geranyl-PP + Isopentenyl pyrophosphate <> Pyrophosphate + Farnesyl pyrophosphate
Deoxyuridine triphosphate + Water <> dUMP + Pyrophosphate
Xanthylic acid + Pyrophosphate <> Xanthine + Phosphoribosyl pyrophosphate
Thymidine 5'-triphosphate + Glucose 1-phosphate <> Pyrophosphate + dTDP-D-Glucose
Adenosine triphosphate + (R)-Pantoate + beta-Alanine <> Adenosine monophosphate + Pyrophosphate + Pantothenic acid
Adenosine triphosphate + Benzeneacetic acid + Coenzyme A <> Adenosine monophosphate + Pyrophosphate + Phenylacetyl-CoA
Xanthosine 5-triphosphate + Water <> Xanthylic acid + Pyrophosphate
Adenosine triphosphate + L-Tyrosine + tRNA(Tyr) <> Adenosine monophosphate + Pyrophosphate + L-Tyrosyl-tRNA(Tyr)
Adenosine triphosphate + Nicotinamide ribotide <> Pyrophosphate + Nicotinic acid adenine dinucleotide
Adenosine triphosphate + Pantetheine 4'-phosphate <> Pyrophosphate + Dephospho-CoA
Adenosine triphosphate + L-Alanine + tRNA(Ala) + tRNA(Ala) <> Adenosine monophosphate + Pyrophosphate + L-Alanyl-tRNA + L-Alanyl-tRNA
2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + p-Aminobenzoic acid + (2-amino-4-hydroxy-7,8-dihydropteridin-6-yl)methyl diphosphate <> Pyrophosphate + 7,8-Dihydropteroic acid
2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate + 4-Methyl-5-(2-phosphoethyl)-thiazole <> Pyrophosphate + Thiamine monophosphate
Nicotinamide ribotide + Pyrophosphate + Carbon dioxide <> Quinolinic acid + Phosphoribosyl pyrophosphate
Cytidine triphosphate + 3-Deoxy-D-manno-octulosonate <> Pyrophosphate + CMP-3-Deoxy-D-manno-octulosonate
2'-Deoxyinosine triphosphate + Water <> DIMP + Pyrophosphate
Adenosine triphosphate + L-Arginine + tRNA(Arg) <> Adenosine monophosphate + Pyrophosphate + L-Arginyl-tRNA(Arg)
Adenosine triphosphate + L-Asparagine + tRNA(Asn) <> Adenosine monophosphate + Pyrophosphate + L-Asparaginyl-tRNA(Asn)
Adenosine triphosphate + L-Cysteine + tRNA(Cys) <> Adenosine monophosphate + Pyrophosphate + L-Cysteinyl-tRNA(Cys)
Adenosine triphosphate + L-Glutamine + tRNA(Gln) + tRNA(Gln) <> Adenosine monophosphate + Pyrophosphate + Glutaminyl-tRNA + Glutaminyl-tRNA
Adenosine triphosphate + Glycine + tRNA(Gly) <> Adenosine monophosphate + Pyrophosphate + Glycyl-tRNA(Gly)
Adenosine triphosphate + L-Histidine + tRNA(His) <> Adenosine monophosphate + Pyrophosphate + L-Histidyl-tRNA(His)
Adenosine triphosphate + L-Isoleucine + tRNA(Ile) <> Adenosine monophosphate + Pyrophosphate + L-Isoleucyl-tRNA(Ile)
Adenosine triphosphate + L-Leucine + tRNA(Leu) + tRNA(Leu) <> Adenosine monophosphate + Pyrophosphate + L-Leucyl-tRNA + L-Leucyl-tRNA
Adenosine triphosphate + L-Lysine + tRNA(Lys) + tRNA(Lys) <> Adenosine monophosphate + Pyrophosphate + L-Lysyl-tRNA + L-Lysyl-tRNA
Adenosine triphosphate + L-Methionine + tRNA(Met) + tRNA(Met) <> Adenosine monophosphate + Pyrophosphate + L-Methionyl-tRNA + L-Methionyl-tRNA
Adenosine triphosphate + L-Phenylalanine + tRNA(Phe) <> Adenosine monophosphate + Pyrophosphate + L-Phenylalanyl-tRNA(Phe)
Adenosine triphosphate + L-Proline + tRNA(Pro) <> Adenosine monophosphate + Pyrophosphate + L-Prolyl-tRNA(Pro)
Adenosine triphosphate + L-Serine + tRNA(Ser) <> Adenosine monophosphate + Pyrophosphate + L-Seryl-tRNA(Ser)
Adenosine triphosphate + L-Threonine + tRNA(Thr) <> Adenosine monophosphate + Pyrophosphate + L-Threonyl-tRNA(Thr)
Adenosine triphosphate + L-Tryptophan + tRNA(Trp) <> Adenosine monophosphate + Pyrophosphate + L-Tryptophanyl-tRNA(Trp)
Adenosine triphosphate + L-Valine + tRNA(Val) <> Adenosine monophosphate + Pyrophosphate + L-Valyl-tRNA(Val)
Adenosine triphosphate + 2-Succinylbenzoate + Coenzyme A <> Adenosine monophosphate + Pyrophosphate + 2-Succinylbenzoyl-CoA
Phosphoribosyl-ATP + Water <> Phosphoribosyl-AMP + Pyrophosphate
Adenosine triphosphate + D-4'-Phosphopantothenate + L-Cysteine <> Adenosine monophosphate + Pyrophosphate + 4-Phosphopantothenoylcysteine
Cytidine triphosphate + D-4'-Phosphopantothenate + L-Cysteine <> Cytidine monophosphate + Pyrophosphate + 4-Phosphopantothenoylcysteine
AICAR + Pyrophosphate <> 5-Amino-4-imidazolecarboxyamide + Phosphoribosyl pyrophosphate
Adenosine triphosphate + Selenomethionine + Water <> Phosphate + Pyrophosphate + Se-Adenosylselenomethionine
Adenosine triphosphate + Selenomethionine + tRNA(Met) <> Adenosine monophosphate + Pyrophosphate + Selenomethionyl-tRNA(Met)
Adenosine triphosphate + Selenate <> Pyrophosphate + Adenylylselenate
all-trans-Polyprenyl diphosphate + 4-Hydroxybenzoic acid + Geranyl-PP <> 4-Hydroxy-3-polyprenylbenzoate + Pyrophosphate + 4-Hydroxy-3-polyprenylbenzoate
Adenosyl cobinamide phosphate + Guanosine triphosphate <> Adenosylcobinamide-GDP + Pyrophosphate
tRNA(Asp) + L-Aspartic acid + Adenosine triphosphate <> L-Aspartyl-tRNA(Asp) + Pyrophosphate + Adenosine monophosphate
tRNA(Glu) + L-Glutamate + Adenosine triphosphate + tRNA(Glu) <> L-Glutamyl-tRNA(Glu) + Pyrophosphate + Adenosine monophosphate + L-Glutamyl-tRNA(Glu)
Octaprenyl diphosphate + 4-Hydroxybenzoic acid <> 3-Octaprenyl-4-hydroxybenzoate + Pyrophosphate
1,4-Dihydroxy-2-naphthoic acid + Octaprenyl diphosphate <> 2-Demethylmenaquinone 8 + Pyrophosphate + Carbon dioxide
2-C-Methyl-D-erythritol-4-phosphate + Cytidine triphosphate <> 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Pyrophosphate
Adenosine triphosphate + D-Glycero-D-manno-heptose 1-phosphate <> Pyrophosphate + ADP-D-Glycero-D-manno-heptose
Farnesyl pyrophosphate + 8 Isopentenyl pyrophosphate <> di-trans,poly-cis-Undecaprenyl diphosphate +8 Pyrophosphate + Undecaprenyl diphosphate
1,4-Dihydroxy-2-naphthoic acid + Phytyl diphosphate <> 2-Phytyl-1,4-naphthoquinone + Carbon dioxide + Pyrophosphate
Heme + Water + Farnesyl pyrophosphate <> Heme O + Pyrophosphate
C15810 + Adenosine triphosphate <> C15813 + Pyrophosphate
Adenosine triphosphate + Lipoic acid <> Pyrophosphate + Lipoyl-AMP
2 Guanosine triphosphate <> 3',5'-Cyclic diGMP +2 Pyrophosphate + Cyclic di-3',5'-guanylate
Adenosine triphosphate + L-Serine + tRNA(Sec) <> Adenosine monophosphate + Pyrophosphate + L-Seryl-tRNA(Sec)
6-Mercaptopurine + Phosphoribosyl pyrophosphate <> 6-Thioinosine-5'-monophosphate + Pyrophosphate
6-Methylmercaptopurine + Phosphoribosyl pyrophosphate <> 6-Methylthiopurine 5'-monophosphate ribonucleotide + Pyrophosphate
6-Thioxanthine 5'-monophosphate + Adenosine triphosphate + L-Glutamine + Water <> 6-Thioguanosine monophosphate + Adenosine monophosphate + Pyrophosphate + L-Glutamate
Thioguanine + Phosphoribosyl pyrophosphate <> 6-Thioguanosine monophosphate + Pyrophosphate
Farnesyl pyrophosphate + 5 Isopentenyl pyrophosphate <> Octaprenyl diphosphate +5 Pyrophosphate
tRNA precursor + 2 Cytidine triphosphate + Adenosine triphosphate <> tRNA with a 3' CCA end +3 Pyrophosphate
tRNA precursor + Cytidine triphosphate <> tRNA with a 3' cytidine + Pyrophosphate
tRNA with a 3' cytidine + Cytidine triphosphate <> tRNA with a 3' CC end + Pyrophosphate
tRNA with a 3' CC end + Adenosine triphosphate <> tRNA with a 3' CCA end + Pyrophosphate
Guanosine triphosphate + Water <> Cyclic pyranopterin monophosphate + Pyrophosphate
[tRNA(Ile2)]-cytidine34 + L-Lysine + Adenosine triphosphate <> [tRNA(Ile2)]-lysidine34 + Adenosine monophosphate + Pyrophosphate + Water
Adenosine triphosphate + Molybdopterin <> Pyrophosphate + Adenylated molybdopterin
Adenosine triphosphate + L-Serine <> Pyrophosphate + L-Seryl-AMP
a tRNA uridine<sup>34</sup> + a [TusE sulfur carrier protein]-<i>S</i>-sulfanylcysteine + Adenosine triphosphate > a tRNA 2-thiouridine<sup>34</sup> + a [TusE sulfur carrier protein]-L-cysteine + Adenosine monophosphate + Pyrophosphate
&alpha;-D-ribose-1-methylphosphonate-5-triphosphate + Water > Hydrogen ion + &alpha;-D-ribose-1-methylphosphonate-5-phosphate + Pyrophosphate
Hydrogen ion + Nicotinamide ribotide + Adenosine triphosphate <> NAD + Pyrophosphate
Hydrogen ion + D-Mannose 1-phosphate + Guanosine triphosphate > Guanosine diphosphate mannose + Pyrophosphate
Hydrogen ion + 2-C-Methyl-D-erythritol-4-phosphate + Cytidine triphosphate > 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Pyrophosphate
a nucleoside triphosphate + Water > a nucleoside monophosphate + Pyrophosphate + Hydrogen ion
all-<i>trans</i>-octaprenyl diphosphate + 4-Hydroxybenzoic acid > Pyrophosphate + 3-Octaprenyl-4-hydroxybenzoate
Coenzyme A + Acetic acid + Adenosine triphosphate > Acetyl-CoA + Pyrophosphate + Adenosine monophosphate
a 2,3,4-saturated fatty acid + Coenzyme A + Adenosine triphosphate > a 2,3,4-saturated fatty acyl CoA + Pyrophosphate + Adenosine monophosphate
Pyrophosphate + Adenosine monophosphate < Phosphoribosyl pyrophosphate + Adenine
Adenosine triphosphate > Cyclic AMP + Pyrophosphate
L-Aspartic acid + Citrulline + Adenosine triphosphate > Hydrogen ion + L-arginino-succinate + Pyrophosphate + Adenosine monophosphate
Ammonia + L-Aspartic acid + Adenosine triphosphate > L-Asparagine + Pyrophosphate + Adenosine monophosphate
L-Glutamine + L-Aspartic acid + Adenosine triphosphate + Water > Hydrogen ion + L-Glutamate + L-Asparagine + Pyrophosphate + Adenosine monophosphate
Phosphoribosyl-ATP + Pyrophosphate <> Adenosine triphosphate + Phosphoribosyl pyrophosphate
Cytidine triphosphate + PA(16:0/16:0) + Hydrogen ion > Pyrophosphate + a CDP-diacylglycerol
Hydrogen ion + Adenosyl cobinamide phosphate + Guanosine triphosphate > Adenosylcobinamide-GDP + Pyrophosphate
3-Deoxy-D-manno-octulosonate + Cytidine triphosphate > CMP-3-Deoxy-D-manno-octulosonate + Pyrophosphate
dCTP + Water > Hydrogen ion + dCMP + Pyrophosphate
Hydrogen ion + Adenosine triphosphate + 2-Pyrocatechuic acid > Pyrophosphate + (2,3-Dihydroxybenzoyl)adenylic acid
all-<i>trans</i>-octaprenyl diphosphate + 1,4-Dihydroxy-2-naphthoic acid + Hydrogen ion > 2-Demethylmenaquinol 8 + Pyrophosphate + Carbon dioxide
Hydrogen ion + Glucose 1-phosphate + Thymidine 5'-triphosphate <> dTDP-D-Glucose + Pyrophosphate
Deoxyuridine triphosphate + Water > Hydrogen ion + dUMP + Pyrophosphate
Adenosine triphosphate + L-Serine + 2-Pyrocatechuic acid > Hydrogen ion + Pyrophosphate + Adenosine monophosphate + Enterochelin
Flavin Mononucleotide + Adenosine triphosphate + Hydrogen ion > FAD + Pyrophosphate
Geranyl-PP + Isopentenyl pyrophosphate > Farnesyl pyrophosphate + Pyrophosphate
Hydrogen ion + Glucose 1-phosphate + Adenosine triphosphate > ADP-Glucose + Pyrophosphate
Hydrogen ion + Glucose 1-phosphate + Uridine triphosphate > UDP-Glucose + Pyrophosphate
Water + L-Glutamine + Xanthylic acid + Adenosine triphosphate > Hydrogen ion + L-Glutamate + Guanosine monophosphate + Pyrophosphate + Adenosine monophosphate
Adenosine triphosphate + Xanthylic acid + Ammonia > Hydrogen ion + Adenosine monophosphate + Pyrophosphate + Guanosine monophosphate
Dimethylallylpyrophosphate + Isopentenyl pyrophosphate > Geranyl-PP + Pyrophosphate
Water + Guanosine triphosphate > Hydrogen ion + Pyrophosphate + 2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Formic acid
Guanosine monophosphate + Pyrophosphate <> Guanine + Phosphoribosyl pyrophosphate
Guanosine triphosphate <> Cyclic GMP + Pyrophosphate
Dihydroneopterin triphosphate + Water > Hydrogen ion + Dihydroneopterin monophosphate + Pyrophosphate
p-Aminobenzoic acid + 6-Hydroxymethyl-dihydropterin pyrophosphate > 7,8-Dihydropteroic acid + Pyrophosphate
Heme + Farnesyl pyrophosphate + Water <> Heme O + Pyrophosphate
Phosphoribosyl-ATP + Water > Hydrogen ion + Phosphoribosyl-AMP + Pyrophosphate
Pyrophosphate + Inosinic acid < Phosphoribosyl pyrophosphate + Hypoxanthine
Water + Pyrophosphate > Hydrogen ion + Phosphate
Coenzyme A + Carnitine + Adenosine triphosphate > L-Carnitinyl-CoA + Adenosine monophosphate + Pyrophosphate
Adenosine triphosphate + Nicotinic acid adenine dinucleotide + L-Glutamine + Water > Hydrogen ion + Adenosine monophosphate + Pyrophosphate + NAD + L-Glutamate
Adenosine triphosphate + Nicotinic acid adenine dinucleotide + Ammonia > Adenosine monophosphate + Pyrophosphate + NAD
Hydrogen ion + <i>N</i>-acetyl-&alpha;-D-glucosamine 1-phosphate + Uridine triphosphate > Uridine diphosphate-N-acetylglucosamine + Pyrophosphate
Hydrogen ion + Adenosine triphosphate + Nicotinamide ribotide > Pyrophosphate + Nicotinic acid adenine dinucleotide
Nicotinamide ribotide + Pyrophosphate < Hydrogen ion + Nicotinic acid + Phosphoribosyl pyrophosphate
Adenosine triphosphate + 2-Succinylbenzoate + Coenzyme A > Adenosine monophosphate + Pyrophosphate + 2-Succinylbenzoyl-CoA
Orotidylic acid + Pyrophosphate <> Phosphoribosyl pyrophosphate + Orotic acid
D-4'-Phosphopantothenate + L-Cysteine + Cytidine triphosphate > Hydrogen ion + Pyrophosphate + Cytidine monophosphate + 4-Phosphopantothenoylcysteine
Hydrogen ion + Pantetheine 4'-phosphate + Adenosine triphosphate <> Dephospho-CoA + Pyrophosphate
beta-Alanine + (R)-Pantoate + Adenosine triphosphate > Hydrogen ion + Pantothenic acid + Pyrophosphate + Adenosine monophosphate
Coenzyme A + phenylacetate + Adenosine triphosphate > Phenylacetyl-CoA + Pyrophosphate + Adenosine monophosphate
Guanosine 3',5'-bis(diphosphate) + Water > Hydrogen ion + Pyrophosphate + Guanosine diphosphate
Coenzyme A + Propionic acid + Adenosine triphosphate > Propionyl-CoA + Pyrophosphate + Adenosine monophosphate
5-Phosphoribosylamine + Pyrophosphate + L-Glutamate < Phosphoribosyl pyrophosphate + L-Glutamine + Water
N-(5-Phospho-D-ribosyl)anthranilate + Pyrophosphate < 2-Aminobenzoic acid + Phosphoribosyl pyrophosphate
Nicotinamide ribotide + Pyrophosphate + Carbon dioxide < Phosphoribosyl pyrophosphate + Quinolinic acid + Hydrogen ion
8-oxo-dGTP + Water > Hydrogen ion + 8-oxo-dGMP + Pyrophosphate
2-[(2<i>R</i>,5<i>Z</i>)-(2-carboxy-4-methylthiazol-5(2<i>H</i>)-ylidene]ethyl phosphate + 2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate + Hydrogen ion > Thiamine monophosphate + Carbon dioxide + Pyrophosphate
Guanosine triphosphate > Cyclic pyranopterin monophosphate + Pyrophosphate
Hydrogen ion + Molybdopterin + Adenosine triphosphate > Adenylated molybdopterin + Pyrophosphate
Hydrogen ion + Lipoic acid + Adenosine triphosphate > Lipoyl-AMP + Pyrophosphate
Farnesyl pyrophosphate + Isopentenyl pyrophosphate > all-<i>trans</i>-octaprenyl diphosphate + Pyrophosphate
Farnesyl pyrophosphate + Isopentenyl pyrophosphate > Undecaprenyl diphosphate + Pyrophosphate
2'-Deoxyinosine triphosphate + Water > Hydrogen ion + DIMP + Pyrophosphate
Xanthosine 5-triphosphate + Water > Hydrogen ion + Xanthylic acid + Pyrophosphate
Hydrogen ion + molybdenum cofactor + Guanosine triphosphate <> Molybdopterin guanine dinucleotide + Pyrophosphate
Cytidine triphosphate + Water > Hydrogen ion + Cytidine monophosphate + Pyrophosphate
dATP + Water > Hydrogen ion + Deoxyadenosine monophosphate + Pyrophosphate
dGTP + Water > Hydrogen ion + 2'-Deoxyguanosine 5'-monophosphate + Pyrophosphate
Hydrogen ion + D-<i>glycero</i>-&beta;-D-<i>manno</i>-heptose 1-phosphate + Adenosine triphosphate > ADP-D-Glycero-D-manno-heptose + Pyrophosphate
Thymidine 5'-triphosphate + Water > Hydrogen ion + 5-Thymidylic acid + Pyrophosphate
Hydrogen ion + Adenosine triphosphate + Adenosine triphosphate Diadenosine tetraphosphate + Pyrophosphate
Hydrogen ion + Adenosine triphosphate + ADP > Diadenosine triphosphate + Pyrophosphate
Guanosine triphosphate > cyclic di-3',5'-guanylate + Pyrophosphate
Cytidine triphosphate + a 2,3,4-saturated L-phosphatidate + Hydrogen ion > Pyrophosphate + a CDP-2,3,4-saturated-diacylglycerol
Hydrogen ion + molybdenum cofactor + Cytidine triphosphate > Molybdopterin cytosine dinucleotide + Pyrophosphate
Inosine triphosphate + Water > Hydrogen ion + Inosinic acid + Pyrophosphate
Guanosine 3'-diphosphate 5'-triphosphate + Water > Hydrogen ion + Guanosine triphosphate + Pyrophosphate
2-Hydroxydeoxyadenosine 5'-triphosphate + Water > 2-hydroxydeoxyadenosine 5'-monophosphate + Pyrophosphate
Adenosine triphosphate + L-Methionine + Water > Phosphate + Pyrophosphate + S-Adenosylmethionine
Hydrogen ion + Sulfate + Adenosine triphosphate > Adenosine phosphosulfate + Pyrophosphate
Hydrogen ion + 4-Methyl-5-(2-phosphoethyl)-thiazole + 2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate > Thiamine monophosphate + Pyrophosphate
Pyrophosphate + Uridine 5'-monophosphate < Phosphoribosyl pyrophosphate + Uracil
Xanthylic acid + Pyrophosphate < Xanthine + Phosphoribosyl pyrophosphate
Adenosine triphosphate + an acid + [acyl-carrier-protein] > Adenosine monophosphate + Pyrophosphate + acyl-[acyl-carrier-protein]
Adenosine triphosphate + Acetic acid + CoA > Adenosine monophosphate + Pyrophosphate + Acetyl-CoA
2 Guanosine triphosphate >2 Pyrophosphate + Cyclic di-3',5'-guanylate
Adenosine monophosphate + Pyrophosphate > Adenine + Phosphoribosyl pyrophosphate
Adenosine triphosphate + L-Aspartic acid + Ammonia > Adenosine monophosphate + Pyrophosphate + L-Asparagine
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water > Adenosine monophosphate + Pyrophosphate + L-Asparagine + L-Glutamate
Adenosine triphosphate + Citrulline + L-Aspartic acid > Adenosine monophosphate + Pyrophosphate + 2-(N(omega)-L-arginino)succinate
Adenosine triphosphate + Biotin + apo-[acetyl-CoA:carbon-dioxide ligase (ADP-forming)] > Adenosine monophosphate + Pyrophosphate + [acetyl-CoA:carbon-dioxide ligase (ADP-forming)]
A tRNA precursor + 2 Cytidine triphosphate + Adenosine triphosphate > a tRNA with a 3' CCA end +3 Pyrophosphate
Cytidine triphosphate + phosphatidate > Pyrophosphate + CDP-diacylglycerol
Adenosine triphosphate + Acetic acid + [citrate (pro-3S)-lyase](thiol form) > Adenosine monophosphate + Pyrophosphate + [citrate (pro-3S)-lyase](acetyl form)
2'-(5-Triphosphoribosyl)-3'-dephospho-CoA + citrate lyase apo-[acyl-carrier-protein] > citrate lyase holo-[acyl-carrier-protein] + Pyrophosphate
Cytidine triphosphate + (R)-4'-phosphopantothenate + L-Cysteine > Cytidine monophosphate + Pyrophosphate + 4-Phosphopantothenoylcysteine
Adenosine triphosphate + pantotheine 4'-phosphate > Pyrophosphate + 3'-dephospho-CoA
Guanosine triphosphate + adenosylcobinamide phosphate > Pyrophosphate + Adenosylcobinamide-GDP
Adenosine triphosphate > Cyclic AMP + Pyrophosphate
Adenosine triphosphate + Sulfate > Pyrophosphate + Adenosine phosphosulfate
Adenosine triphosphate + Sulfate > Pyrophosphate + Adenosine phosphosulfate
2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine diphosphate + p-Aminobenzoic acid > Pyrophosphate + 7,8-Dihydropteroic acid
2 Guanosine triphosphate >2 Pyrophosphate + Cyclic di-3',5'-guanylate
Deoxynucleoside triphosphate + DNA(n) > Pyrophosphate + DNA(n+1)
Deoxynucleoside triphosphate + DNA(n) > Pyrophosphate + DNA(n+1)
Deoxynucleoside triphosphate + DNA(n) > Pyrophosphate + DNA(n+1)
Deoxynucleoside triphosphate + DNA(n) > Pyrophosphate + DNA(n+1)
Deoxynucleoside triphosphate + DNA(n) > Pyrophosphate + DNA(n+1)
Deoxynucleoside triphosphate + DNA(n) > Pyrophosphate + DNA(n+1)
Deoxynucleoside triphosphate + DNA(n) > Pyrophosphate + DNA(n+1)
Deoxyuridine triphosphate + Water > dUMP + Pyrophosphate
Adenosine triphosphate + 2-Pyrocatechuic acid > Pyrophosphate + (2,3-Dihydroxybenzoyl)adenylic acid
Adenosine triphosphate + L-Serine > Pyrophosphate + L-Seryl-AMP
Adenosine triphosphate + a short-chain carboxylic acid + CoA > Adenosine monophosphate + Pyrophosphate + an acyl-CoA
Adenosine triphosphate + [protein] > Pyrophosphate + [protein]-AMP
Uridine triphosphate + Alpha-D-glucose 1-phosphate > Pyrophosphate + UDP-Glucose
Uridine triphosphate + Alpha-D-glucose 1-phosphate > Pyrophosphate + UDP-Glucose
Adenosine triphosphate + Alpha-D-glucose 1-phosphate > Pyrophosphate + ADP-Glucose
Uridine triphosphate + N-acetyl-alpha-D-glucosamine 1-phosphate > Pyrophosphate + Uridine diphosphate-N-acetylglucosamine
Uridine triphosphate + [protein-PII] > Pyrophosphate + uridylyl-[protein-PII]
Adenosine triphosphate + [L-glutamate:ammonia ligase (ADP-forming)] > Pyrophosphate + adenylyl-[L-glutamate:ammonia ligase (ADP-forming)]
Adenosine triphosphate + Xanthylic acid + L-Glutamine + Water > Adenosine monophosphate + Pyrophosphate + Guanosine monophosphate + L-Glutamate
Phosphoribosyl-ATP + Pyrophosphate > Adenosine triphosphate + Phosphoribosyl pyrophosphate
Phosphoribosyl-ATP + Water > 1-(5-phosphoribosyl)-AMP + Pyrophosphate
Adenosine triphosphate + D-glycero-beta-D-manno-heptose 1-phosphate > Pyrophosphate + ADP-D-glycero-beta-D-manno-heptose
Deoxynucleoside triphosphate + DNA(n) > Pyrophosphate + DNA(n+1)
Deoxynucleoside triphosphate + DNA(n) > Pyrophosphate + DNA(n+1)
Deoxynucleoside triphosphate + DNA(n) > Pyrophosphate + DNA(n+1)
Deoxynucleoside triphosphate + DNA(n) > Pyrophosphate + DNA(n+1)
Deoxynucleoside triphosphate + DNA(n) > Pyrophosphate + DNA(n+1)
Inosinic acid + Pyrophosphate > Hypoxanthine + Phosphoribosyl pyrophosphate
Pyrophosphate + Water >2 Inorganic phosphate
Geranyl-PP + Isopentenyl pyrophosphate > Pyrophosphate + Farnesyl pyrophosphate
Farnesyl pyrophosphate + 5 Isopentenyl pyrophosphate >5 Pyrophosphate + Octaprenyl diphosphate
Cytidine triphosphate + 2-C-methyl-D-erythritol 4-phosphate > Pyrophosphate + 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol
Cytidine triphosphate + 3-Deoxy-D-manno-octulosonate > Pyrophosphate + CMP-3-Deoxy-D-manno-octulosonate
Adenosine triphosphate + a long-chain fatty acid + CoA > Adenosine monophosphate + Pyrophosphate + an acyl-CoA
Adenosine triphosphate + lipoate > Pyrophosphate + Lipoyl-AMP
Guanosine triphosphate + Alpha-D-mannose 1-phosphate > Pyrophosphate + Guanosine diphosphate mannose
Adenosine triphosphate + Water > Adenosine monophosphate + Pyrophosphate
An all-trans-polyprenyl diphosphate + 1,4-Dihydroxy-2-naphthoic acid > a demethylmenaquinol + Pyrophosphate + Carbon dioxide
Adenosine triphosphate + 2-Succinylbenzoate + CoA > Adenosine monophosphate + Pyrophosphate + 2-Succinylbenzoyl-CoA
Adenosine triphosphate + L-Methionine + Water > Inorganic phosphate + Pyrophosphate + S-adenosyl-L-methionine
Dimethylallylpyrophosphate + tRNA > Pyrophosphate + tRNA containing 6-dimethylallyladenosine
Guanosine triphosphate + Molybdopterin > Pyrophosphate + Guanylyl molybdenum cofactor
Cytidine triphosphate + Molybdopterin > Pyrophosphate + Cytidylyl molybdenum cofactor
Adenosine triphosphate + [molybdopterin-synthase sulfur-carrier protein]-Gly-Gly > Pyrophosphate + [molybdopterin-synthase sulfur-carrier protein]-Gly-Gly-AMP
Adenosine triphosphate + molybdopterin forma > Pyrophosphate + Adenylyl-molybdopterin
8-oxo-dGTP + Water > 8-oxo-dGMP + Pyrophosphate
Nicotinamide ribotide + Pyrophosphate + Carbon dioxide > Quinolinic acid + Phosphoribosyl pyrophosphate
Adenosine triphosphate + Nicotinamide ribotide > Pyrophosphate + Nicotinic acid adenine dinucleotide
Adenosine triphosphate + Nicotinic acid adenine dinucleotide + Ammonia > Adenosine monophosphate + Pyrophosphate + NAD
Adenosine triphosphate + NMN > Pyrophosphate + NAD
Cytidine triphosphate + Water > Cytidine monophosphate + Pyrophosphate
Nucleoside triphosphate + Water > nucleoside monophosphate + Pyrophosphate
Adenosine triphosphate + Benzeneacetic acid + CoA > Adenosine monophosphate + Pyrophosphate + Phenylacetyl-CoA
Adenosine triphosphate + (R)-Pantoate + beta-Alanine > Adenosine monophosphate + Pyrophosphate + (R)-pantothenate
Adenosine triphosphate + RNA(n) > Pyrophosphate + RNA(n+1)
Nicotinamide ribotide + Pyrophosphate > Nicotinic acid + Phosphoribosyl pyrophosphate
Adenosine triphosphate + Propionic acid + CoA > Adenosine monophosphate + Pyrophosphate + Propionyl-CoA
[Pyruvate, water dikinase] phosphate + Inorganic phosphate > [pyruvate, water dikinase] + Pyrophosphate
5-Phosphoribosylamine + Pyrophosphate + L-Glutamate > L-Glutamine + Phosphoribosyl pyrophosphate + Water
Formic acid + Adenosine triphosphate + 5'-Phospho-ribosylglycinamide > 5'-Phosphoribosyl-N-formylglycineamide + ADP + Pyrophosphate
Orotidylic acid + Pyrophosphate > Orotic acid + Phosphoribosyl pyrophosphate
A nucleoside triphosphate + Water > a nucleotide + Pyrophosphate
Guanosine triphosphate + 3 Water > Formic acid + 2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Pyrophosphate
Adenosine triphosphate + Flavin Mononucleotide > Pyrophosphate + FAD
Thymidine 5'-triphosphate + Alpha-D-glucose 1-phosphate > Pyrophosphate + dTDP-glucose
Thymidine 5'-triphosphate + Alpha-D-glucose 1-phosphate > Pyrophosphate + dTDP-glucose
Nucleoside triphosphate + RNA(n) > Pyrophosphate + RNA(n+1)
Nucleoside triphosphate + RNA(n) > Pyrophosphate + RNA(n+1)
Nucleoside triphosphate + RNA(n) > Pyrophosphate + RNA(n+1)
Nucleoside triphosphate + RNA(n) > Pyrophosphate + RNA(n+1)
Adenosine triphosphate + RNA 3'-terminal-phosphate > Adenosine monophosphate + Pyrophosphate + RNA terminal-2',3'-cyclic-phosphate
Guanosine 3',5'-bis(diphosphate) + Water > Guanosine diphosphate + Pyrophosphate
Adenosine triphosphate + L-Alanine + tRNA(Ala) > Adenosine monophosphate + Pyrophosphate + L-alanyl-tRNA(Ala)
Adenosine triphosphate + L-Cysteine + tRNA(Cys) > Adenosine monophosphate + Pyrophosphate + L-cysteinyl-tRNA(Cys)
Adenosine triphosphate + L-Aspartic acid + tRNA(Asp) > Adenosine monophosphate + Pyrophosphate + L-aspartyl-tRNA(Asp)
Adenosine triphosphate + L-Glutamate + tRNA(Glu) > Adenosine monophosphate + Pyrophosphate + L-glutamyl-tRNA(Glu)
Adenosine triphosphate + L-Phenylalanine + tRNA(Phe) > Adenosine monophosphate + Pyrophosphate + L-phenylalanyl-tRNA(Phe)
Adenosine triphosphate + L-Phenylalanine + tRNA(Phe) > Adenosine monophosphate + Pyrophosphate + L-phenylalanyl-tRNA(Phe)
Adenosine triphosphate + Glycine + tRNA(Gly) > Adenosine monophosphate + Pyrophosphate + glycyl-tRNA(Gly)
Adenosine triphosphate + Glycine + tRNA(Gly) > Adenosine monophosphate + Pyrophosphate + glycyl-tRNA(Gly)
Adenosine triphosphate + L-Histidine + tRNA(His) > Adenosine monophosphate + Pyrophosphate + L-histidyl-tRNA(His)
Adenosine triphosphate + L-Isoleucine + tRNA(Ile) > Adenosine monophosphate + Pyrophosphate + L-isoleucyl-tRNA(Ile)
Adenosine triphosphate + L-Lysine + tRNA(Lys) > Adenosine monophosphate + Pyrophosphate + L-lysyl-tRNA(Lys)
Adenosine triphosphate + L-Lysine + tRNA(Lys) > Adenosine monophosphate + Pyrophosphate + L-lysyl-tRNA(Lys)
Adenosine triphosphate + L-Leucine + tRNA(Leu) > Adenosine monophosphate + Pyrophosphate + L-leucyl-tRNA(Leu)
Adenosine triphosphate + L-Methionine + tRNA(Met) > Adenosine monophosphate + Pyrophosphate + L-methionyl-tRNA(Met)
Adenosine triphosphate + L-Asparagine + tRNA(Asn) > Adenosine monophosphate + Pyrophosphate + L-asparaginyl-tRNA(Asn)
Adenosine triphosphate + L-Proline + tRNA(Pro) > Adenosine monophosphate + Pyrophosphate + L-prolyl-tRNA(Pro)
Adenosine triphosphate + L-Glutamine + tRNA(Gln) > Adenosine monophosphate + Pyrophosphate + L-glutaminyl-tRNA(Gln)
Adenosine triphosphate + L-Arginine + tRNA(Arg) > Adenosine monophosphate + Pyrophosphate + L-arginyl-tRNA(Arg)
Adenosine triphosphate + L-Serine + tRNA(Ser) > Adenosine monophosphate + Pyrophosphate + L-seryl-tRNA(Ser)
Adenosine triphosphate + L-Serine + tRNA(Sec) > Adenosine monophosphate + Pyrophosphate + L-seryl-tRNA(Sec)
Adenosine triphosphate + L-Threonine + tRNA(Thr) > Adenosine monophosphate + Pyrophosphate + L-threonyl-tRNA(Thr)
Adenosine triphosphate + L-Valine + tRNA(Val) > Adenosine monophosphate + Pyrophosphate + L-valyl-tRNA(Val)
Adenosine triphosphate + L-Tryptophan + tRNA(Trp) > Adenosine monophosphate + Pyrophosphate + L-tryptophyl-tRNA(Trp)
Adenosine triphosphate + L-Tyrosine + tRNA(Tyr) > Adenosine monophosphate + Pyrophosphate + L-tyrosyl-tRNA(Tyr)
2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate + 4-Methyl-5-(2-phosphoethyl)-thiazole > Pyrophosphate + Thiamine monophosphate
Adenosine triphosphate + [ThiS] > Pyrophosphate + adenylyl-[ThiS]
(tRNA(Ile2))-cytidine(34) + L-Lysine + Adenosine triphosphate > (tRNA(Ile2))-lysidine(34) + Adenosine monophosphate + Pyrophosphate + Water
N-(5-Phospho-D-ribosyl)anthranilate + Pyrophosphate > 2-Aminobenzoic acid + Phosphoribosyl pyrophosphate
Farnesyl pyrophosphate + 8 Isopentenyl pyrophosphate >8 Pyrophosphate + di-trans,octa-cis-undecaprenyl diphosphate
Uridine 5'-monophosphate + Pyrophosphate > Uracil + Phosphoribosyl pyrophosphate
Xanthylic acid + Pyrophosphate > Phosphoribosyl pyrophosphate + Xanthine
2 Guanosine triphosphate >2 Pyrophosphate + Cyclic di-3',5'-guanylate
2 Guanosine triphosphate >2 Pyrophosphate + Cyclic di-3',5'-guanylate
2 Guanosine triphosphate >2 Pyrophosphate + Cyclic di-3',5'-guanylate
2 Guanosine triphosphate >2 Pyrophosphate + Cyclic di-3',5'-guanylate
2 Guanosine triphosphate >2 Pyrophosphate + Cyclic di-3',5'-guanylate
2 Guanosine triphosphate >2 Pyrophosphate + Cyclic di-3',5'-guanylate
2 Guanosine triphosphate >2 Pyrophosphate + Cyclic di-3',5'-guanylate
2 Guanosine triphosphate >2 Pyrophosphate + Cyclic di-3',5'-guanylate
Nucleoside triphosphate + RNA <> Pyrophosphate
Deoxynucleoside triphosphate + DNA <> Pyrophosphate
8-oxo-dGTP + Water <> 8-oxo-dGMP + Pyrophosphate
Adenosine triphosphate + 2-Pyrocatechuic acid <> Pyrophosphate + (2,3-Dihydroxybenzoyl)adenylic acid
Cytidine triphosphate + Water + dCTP <> Cytidine monophosphate + Pyrophosphate + dCMP
Xanthosine 5-triphosphate + Water + 2'-Deoxyinosine triphosphate <> Xanthylic acid + Pyrophosphate + DIMP
tRNA precursor + 2 Cytidine triphosphate + Adenosine triphosphate + tRNA with a 3' cytidine + tRNA with a 3' CC end <> tRNA with a 3' CCA end +3 Pyrophosphate
Adenosine triphosphate + Biotin + Apo-[acetyl-CoA:carbon-dioxide ligase (ADP-forming)] <> Adenosine monophosphate + Pyrophosphate + [Acetyl-CoA:carbon-dioxide ligase (ADP-forming)]
Uridine triphosphate + [Protein-PII] <> Pyrophosphate + Uridylyl-[protein-PII]
2'-(5-Triphosphoribosyl)-3'-dephospho-CoA <> Pyrophosphate
Adenosine triphosphate + Acetic acid + Citrate (pro-3S)-lyase (thiol form) <> Adenosine monophosphate + Pyrophosphate + Citrate (pro-3S)-lyase (acetyl form)
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water + Ammonia <> Adenosine monophosphate + Pyrophosphate + L-Asparagine + L-Glutamate
Adenosine triphosphate + Long-chain fatty acid + Coenzyme A <> Adenosine monophosphate + Pyrophosphate + Acyl-CoA
Adenosine triphosphate + Xanthylic acid + L-Glutamine + Water + Ammonia <> Adenosine monophosphate + Pyrophosphate + Guanosine monophosphate + L-Glutamate
Adenosine triphosphate <> Pyrophosphate
Triphosphate + Water <> Pyrophosphate + Phosphate
L-Threonine + Adenosine triphosphate + Hydrogen carbonate <> L-Threonylcarbamoyladenylate + Pyrophosphate + Water
Adenosine triphosphate + RNA 3'-terminal-phosphate <> Adenosine monophosphate + Pyrophosphate + RNA terminal-2',3'-cyclic-phosphate
Adenosine triphosphate + RNA <> Adenosine monophosphate + Pyrophosphate
Geranyl-PP + 1,4-Dihydroxy-2-naphthoic acid <> Demethylmenaquinol + Pyrophosphate + Carbon dioxide
alpha-D-Ribose 1-methylphosphonate 5-triphosphate + Water <> alpha-D-Ribose 1-methylphosphonate 5-phosphate + Pyrophosphate
Pyrophosphate + Water <> Phosphate
Adenosine triphosphate + lipoate + Lipoyl-AMP + Apoprotein <> Pyrophosphate + Protein N6-(lipoyl)lysine + Adenosine monophosphate
Adenosine triphosphate + Propionic acid + Coenzyme A <> Adenosine monophosphate + Pyrophosphate + Propionyl-CoA
4-amino-2-methyl-5-diphosphomethylpyrimidine + 2-((2R,5Z)-2-Carboxy-4-methylthiazol-5(2H)-ylidene)ethyl phosphate + 2 Hydrogen ion + 2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate > Thiamine monophosphate + Carbon dioxide + diphosphate + Thiamine monophosphate + Pyrophosphate
Biotin + Adenosine triphosphate > diphosphate + Biotinyl-5'-AMP + Pyrophosphate
DG(18:1(9Z)/19:0cycw8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(9Z)/19:0cycw8c) + Pyrophosphate + Pyrophosphate
2 DG(15:0cyclo/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(15:0cyclo/16:0) + Pyrophosphate + Pyrophosphate
2 DG(15:0cyclo/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(18:1(9Z)/18:1(9Z)) + Pyrophosphate + Pyrophosphate
DG(16:1(9Z)/19:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:1(9Z)/19:0) + Pyrophosphate + Pyrophosphate
Bis-molybdopterin guanine dinucleotide + Guanosine triphosphate + Hydrogen ion + Molybdopterin guanine dinucleotide > Guanylyl molybdenum cofactor + Pyrophosphate
L-Carnitine + Coenzyme A + Adenosine triphosphate > D-Carnitinyl-CoA + Adenosine monophosphate + Pyrophosphate
2,3-Dihydroxybenzoic acid + Adenosine triphosphate + Hydrogen ion > (2,3-Dihydroxybenzoyl)adenylic acid + Pyrophosphate
N-Acetyl-glucosamine 1-phosphate + Uridine triphosphate + Hydrogen ion > Uridine diphosphate-N-acetylglucosamine + Pyrophosphate
D-glycero-beta-D-manno-heptose 1-phosphate + Adenosine triphosphate + Hydrogen ion > ADP-D-Glycero-D-manno-heptose + Pyrophosphate
α-D-glucose 1-phosphate + Thymidine 5'-triphosphate + Hydrogen ion > dTDP-D-Glucose + Pyrophosphate
molybdenum cofactor + Cytidine triphosphate + Hydrogen ion > Molybdopterin cytosine dinucleotide + Pyrophosphate
Xanthine + Phosphoribosyl pyrophosphate > Xanthylic acid + Pyrophosphate
More...

SMPDB Pathways:
1,6-anhydro-<i>N</i>-acetylmuramic acid recyclingPW002064 Pw002064Pw002064 greyscalePw002064 simple
ADP-L-glycero-Beta-D-manno-heptose biosynthesisPW002095 Pw002095Pw002095 greyscalePw002095 simple
Amino sugar and nucleotide sugar metabolism IPW000886 Pw000886Pw000886 greyscalePw000886 simple
Amino sugar and nucleotide sugar metabolism IIPW000887 Pw000887Pw000887 greyscalePw000887 simple
Amino sugar and nucleotide sugar metabolism IIIPW000895 Pw000895Pw000895 greyscalePw000895 simple
Asparagine biosynthesisPW000813 Pw000813Pw000813 greyscalePw000813 simple
Aspartate metabolismPW000787 Pw000787Pw000787 greyscalePw000787 simple
Biosynthesis of siderophore group nonribosomal peptidesPW000760 Pw000760Pw000760 greyscalePw000760 simple
Biotin metabolismPW000762 Pw000762Pw000762 greyscalePw000762 simple
Enterobactin BiosynthesisPW002048 Pw002048Pw002048 greyscalePw002048 simple
Fatty acid biosynthesisPW000900 Pw000900Pw000900 greyscalePw000900 simple
Fatty acid metabolismPW000796 Pw000796Pw000796 greyscalePw000796 simple
Flavin biosynthesisPW001971 Pw001971Pw001971 greyscalePw001971 simple
Folate biosynthesisPW000908 Pw000908Pw000908 greyscalePw000908 simple
GTP degradationPW001888 Pw001888Pw001888 greyscalePw001888 simple
Galactose metabolismPW000821 Pw000821Pw000821 greyscalePw000821 simple
L-carnitine degradation IPW002037 Pw002037Pw002037 greyscalePw002037 simple
Lipoic acid metabolismPW000770 Pw000770Pw000770 greyscalePw000770 simple
Lipopolysaccharide biosynthesisPW000831 Pw000831Pw000831 greyscalePw000831 simple
Mannose MetabolismPW000822 Pw000822Pw000822 greyscalePw000822 simple
Menaquinol biosythesisPW001897 Pw001897Pw001897 greyscalePw001897 simple
NAD biosynthesisPW000829 Pw000829Pw000829 greyscalePw000829 simple
NAD salvagePW000830 Pw000830Pw000830 greyscalePw000830 simple
Nitrogen metabolismPW000755 Pw000755Pw000755 greyscalePw000755 simple
O-antigen building blocks biosynthesisPW002089 Pw002089Pw002089 greyscalePw002089 simple
Oxidative phosphorylationPW000919 Pw000919Pw000919 greyscalePw000919 simple
Pantothenate and CoA biosynthesisPW000828 Pw000828Pw000828 greyscalePw000828 simple
Phenylalanine metabolismPW000921 Pw000921Pw000921 greyscalePw000921 simple
Porphyrin metabolismPW000936 Pw000936Pw000936 greyscalePw000936 simple
Propanoate metabolismPW000940 Pw000940Pw000940 greyscalePw000940 simple
Pyrimidine metabolismPW000942 Pw000942Pw000942 greyscalePw000942 simple
Quorum SensingPW000836 Pw000836Pw000836 greyscalePw000836 simple
S-adenosyl-L-methionine biosynthesisPW000837 Pw000837Pw000837 greyscalePw000837 simple
Secondary Metabolites: Histidine biosynthesisPW000984 Pw000984Pw000984 greyscalePw000984 simple
Secondary Metabolites: Ubiquinol biosynthesisPW000981 Pw000981Pw000981 greyscalePw000981 simple
Secondary Metabolites: enterobacterial common antigen biosynthesisPW000959 Pw000959Pw000959 greyscalePw000959 simple
Secondary metabolites: Trehalose Biosynthesis and MetabolismPW000968 Pw000968Pw000968 greyscalePw000968 simple
Secondary metabolites: isoprenoid biosynthesis (nonmevalonate pathway)PW000975 Pw000975Pw000975 greyscalePw000975 simple
Secondary metabolites: methylerythritol phosphate and polyisoprenoid biosynthesisPW000958 Pw000958Pw000958 greyscalePw000958 simple
Starch and sucrose metabolismPW000941 Pw000941Pw000941 greyscalePw000941 simple
Sulfur metabolismPW000922 Pw000922Pw000922 greyscalePw000922 simple
Tryptophan metabolismPW000815 Pw000815Pw000815 greyscalePw000815 simple
Vitamin B1/ThiaminePW000892 Pw000892Pw000892 greyscalePw000892 simple
adenosylcobalamin salvage from cobinamidePW001884 Pw001884Pw001884 greyscalePw001884 simple
arginine metabolismPW000790 Pw000790Pw000790 greyscalePw000790 simple
beta-Alanine metabolismPW000896 Pw000896Pw000896 greyscalePw000896 simple
colanic acid building blocks biosynthesisPW000951 Pw000951Pw000951 greyscalePw000951 simple
cysteine biosynthesisPW000800 Pw000800Pw000800 greyscalePw000800 simple
fatty acid oxidationPW000758 Pw000758Pw000758 greyscalePw000758 simple
galactose degradation/Leloir PathwayPW000884 Pw000884Pw000884 greyscalePw000884 simple
guanylyl molybdenum cofactor biosynthesisPW002032 Pw002032Pw002032 greyscalePw002032 simple
histidine biosynthesisPW000810 Pw000810Pw000810 greyscalePw000810 simple
lipopolysaccharide biosynthesis IIPW001905 Pw001905Pw001905 greyscalePw001905 simple
peptidoglycan biosynthesis IPW000906 Pw000906Pw000906 greyscalePw000906 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/15:0cyclo/18:1(9Z))PW001064 Pw001064Pw001064 greyscalePw001064 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/15:0cyclo/19:0cycv8c)PW001065 Pw001065Pw001065 greyscalePw001065 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/18:1(9Z)/15:0cyclo)PW001082 Pw001082Pw001082 greyscalePw001082 simple
phospholipid biosynthesis (CDP-DG(16:0/15:0))PW001745 Pw001745Pw001745 greyscalePw001745 simple
phospholipid biosynthesis (CDP-DG(16:1(9Z)/15:0))PW001757 Pw001757Pw001757 greyscalePw001757 simple
phospholipid biosynthesis (CDP-DG(18:0/10:0))PW001761 Pw001761Pw001761 greyscalePw001761 simple
phospholipid biosynthesis (CDP-DG(18:0/12:0))PW001762 Pw001762Pw001762 greyscalePw001762 simple
phospholipid biosynthesis (CDP-DG(18:0/15:0)PW001766 Pw001766Pw001766 greyscalePw001766 simple
phospholipid biosynthesis (CDP-DG(18:0/19:1(9Z)))PW001776 Pw001776Pw001776 greyscalePw001776 simple
phospholipid biosynthesis (CDP-DG(18:1(9Z)/15:0))PW001782 Pw001782Pw001782 greyscalePw001782 simple
phospholipid biosynthesis (CDP-DG(18:1(9Z)/19:1(9Z)))PW001785 Pw001785Pw001785 greyscalePw001785 simple
phospholipid biosynthesis (CDP-DG(19:1(9Z)/14:0))PW001788 Pw001788Pw001788 greyscalePw001788 simple
phospholipid biosynthesis (CDP-DG(19:1(9Z)/16:0))PW001790 Pw001790Pw001790 greyscalePw001790 simple
phospholipid biosynthesis (CDP-DG(19:1(9Z)/18:0))PW001791 Pw001791Pw001791 greyscalePw001791 simple
phospholipid biosynthesis (CDP-DG(19:1(9Z)/19:1(9Z)))PW001792 Pw001792Pw001792 greyscalePw001792 simple
phospholipid biosynthesis (CL(10:0(3-OH)/10:0/10:0(3-OH)/10:0))PW001899 Pw001899Pw001899 greyscalePw001899 simple
phospholipid biosynthesis (CL(10:0(3-OH)/12:0(3-OH)/10:0(3-OH)/12:0(3-OH)))PW001900 Pw001900Pw001900 greyscalePw001900 simple
phospholipid biosynthesis (CL(10:0(3-OH)/12:0/10:0(3-OH)/12:0))PW001901 Pw001901Pw001901 greyscalePw001901 simple
phospholipid biosynthesis (CL(10:0(3-OH)/15:0cyclo/10:0(3-OH)/15:0cyclo))PW001902 Pw001902Pw001902 greyscalePw001902 simple
phospholipid biosynthesis (CL(10:0(3-OH)/16:0/10:0(3-OH)/16:0))PW001904 Pw001904Pw001904 greyscalePw001904 simple
phospholipid biosynthesis (CL(10:0(3-OH)/16:1(9Z)/10:0(3-OH)/16:1(9Z)))PW001903 Pw001903Pw001903 greyscalePw001903 simple
phospholipid biosynthesis (CL(10:0(3-OH)/17:0cycw7c/10:0(3-OH)/17:0cycw7c))PW001906 Pw001906Pw001906 greyscalePw001906 simple
phospholipid biosynthesis (CL(10:0(3-OH)/17:0cycw7c/14:0/14:0))PW001907 Pw001907Pw001907 greyscalePw001907 simple
phospholipid biosynthesis (CL(10:0(3-OH)/19:0cycv8c/10:0(3-OH)/19:0cycv8c))PW001908 Pw001908Pw001908 greyscalePw001908 simple
phospholipid biosynthesis (CL(10:0(3-OH)/19:iso/10:0(3-OH)/19:iso))PW001909 Pw001909Pw001909 greyscalePw001909 simple
phospholipid biosynthesis (CL(10:0/10:0(3-OH)/10:0/10:0(3-OH)))PW001910 Pw001910Pw001910 greyscalePw001910 simple
phospholipid biosynthesis (CL(10:0/12:0(3-OH)/10:0/12:0(3-OH)))PW001911 Pw001911Pw001911 greyscalePw001911 simple
phospholipid biosynthesis (CL(10:0/17:0cycw7c/14:0/14:0))PW001912 Pw001912Pw001912 greyscalePw001912 simple
phospholipid biosynthesis (CL(12:0(3-OH)/10:0(3-OH)/12:0(3-OH)/10:0(3-OH)))PW001913 Pw001913Pw001913 greyscalePw001913 simple
phospholipid biosynthesis (CL(12:0(3-OH)/10:0/12:0(3-OH)/10:0))PW001914 Pw001914Pw001914 greyscalePw001914 simple
phospholipid biosynthesis (CL(12:0(3-OH)/12:0(3-OH)/12:0/12:0))PW001915 Pw001915Pw001915 greyscalePw001915 simple
phospholipid biosynthesis (CL(12:0(3-OH)/12:0/12:0/12:0))PW001917 Pw001917Pw001917 greyscalePw001917 simple
phospholipid biosynthesis (CL(12:0(3-OH)/14:0(3-OH)/12:0(3-OH)/14:0(3-OH)))PW001918 Pw001918Pw001918 greyscalePw001918 simple
phospholipid biosynthesis (CL(12:0(3-OH)/14:0/12:0(3-OH)/14:0))PW001919 Pw001919Pw001919 greyscalePw001919 simple
phospholipid biosynthesis (CL(12:0(3-OH)/15:0/12:0(3-OH)/15:0))PW001920 Pw001920Pw001920 greyscalePw001920 simple
phospholipid biosynthesis (CL(12:0(3-OH)/15:0cyclo/12:0(3-OH)/15:0cyclo))PW001921 Pw001921Pw001921 greyscalePw001921 simple
phospholipid biosynthesis (CL(12:0(3-OH)/17:0cycw7c/12:0(3-OH)/17:0cycw7c))PW001922 Pw001922Pw001922 greyscalePw001922 simple
phospholipid biosynthesis (CL(12:0(3-OH)/17:0cycw7c/12:0/12:0))PW001923 Pw001923Pw001923 greyscalePw001923 simple
phospholipid biosynthesis (CL(12:0(3-OH)/18:1(9Z)/12:0(3-OH)/18:1(9Z)))PW001924 Pw001924Pw001924 greyscalePw001924 simple
phospholipid biosynthesis (CL(12:0(3-OH)/19:0cycv8c/12:0(3-OH)/19:0cycv8c))PW001925 Pw001925Pw001925 greyscalePw001925 simple
phospholipid biosynthesis (CL(12:0(3-OH)/19:iso/12:0(3-OH)/19:iso))PW001926 Pw001926Pw001926 greyscalePw001926 simple
phospholipid biosynthesis (CL(12:0/10:0(3-OH)/12:0/10:0(3-OH)))PW001928 Pw001928Pw001928 greyscalePw001928 simple
phospholipid biosynthesis (CL(12:0/12:0(3-OH)/12:0/12:0))PW001929 Pw001929Pw001929 greyscalePw001929 simple
phospholipid biosynthesis (CL(12:0/12:0/12:0/12:0))PW001930 Pw001930Pw001930 greyscalePw001930 simple
phospholipid biosynthesis (CL(12:0/14:0(3-OH)/12:0/14:0(3-OH)))PW001931 Pw001931Pw001931 greyscalePw001931 simple
phospholipid biosynthesis (CL(12:0/17:0cycw7c/12:0/12:0))PW001932 Pw001932Pw001932 greyscalePw001932 simple
phospholipid biosynthesis (CL(12:0/19:iso/12:0/19:iso))PW001933 Pw001933Pw001933 greyscalePw001933 simple
phospholipid biosynthesis (CL(14:0(3-OH)/12:0(3-OH)/14:0(3-OH)/12:0(3-OH)))PW001934 Pw001934Pw001934 greyscalePw001934 simple
phospholipid biosynthesis (CL(14:0(3-OH)/12:0/14:0(3-OH)/12:0))PW001935 Pw001935Pw001935 greyscalePw001935 simple
phospholipid biosynthesis (CL(14:0(3-OH)/14:0(3-OH)/14:0/14:0))PW001936 Pw001936Pw001936 greyscalePw001936 simple
phospholipid biosynthesis (CL(14:0(3-OH)/14:0/14:0/14:0))PW001937 Pw001937Pw001937 greyscalePw001937 simple
phospholipid biosynthesis (CL(14:0(3-OH)/16:0/16:0/16:0))PW001938 Pw001938Pw001938 greyscalePw001938 simple
phospholipid biosynthesis (CL(14:0(3-OH)/16:1(9Z)/14:0(3-OH)/16:1(9Z)))PW001939 Pw001939Pw001939 greyscalePw001939 simple
phospholipid biosynthesis (CL(14:0(3-OH)/16:1(9Z)/14:0/14:0))PW001940 Pw001940Pw001940 greyscalePw001940 simple
phospholipid biosynthesis (CL(14:0(3-OH)/17:0cycw7c/14:0(3-OH)/17:0cycw7c))PW001941 Pw001941Pw001941 greyscalePw001941 simple
phospholipid biosynthesis (CL(14:0(3-OH)/17:0cycw7c/14:0/14:0))PW001942 Pw001942Pw001942 greyscalePw001942 simple
phospholipid biosynthesis (CL(14:0/12:0(3-OH)/14:0/12:0(3-OH)))PW001943 Pw001943Pw001943 greyscalePw001943 simple
phospholipid biosynthesis (CL(14:0/14:0(3-OH)/14:0/14:0))PW001944 Pw001944Pw001944 greyscalePw001944 simple
phospholipid biosynthesis (CL(14:0/15:0cyclo/17:0cycw7c/14:0)PW001030 Pw001030Pw001030 greyscalePw001030 simple
phospholipid biosynthesis (CL(15:0/10:0(3-OH)/15:0/10:0(3-OH)))PW001945 Pw001945Pw001945 greyscalePw001945 simple
phospholipid biosynthesis (CL(15:0/12:0(3-OH)/15:0/12:0(3-OH)))PW001946 Pw001946Pw001946 greyscalePw001946 simple
phospholipid biosynthesis (CL(15:0/14:0(3-OH)/14:0/14:0))PW001947 Pw001947Pw001947 greyscalePw001947 simple
phospholipid biosynthesis (CL(15:0cyclo/10:0(3-OH)/15:0cyclo/10:0(3-OH)))PW001948 Pw001948Pw001948 greyscalePw001948 simple
phospholipid biosynthesis (CL(15:0cyclo/15:0cyclo/18:1(9Z)/16:0))PW001713 Pw001713Pw001713 greyscalePw001713 simple
phospholipid biosynthesis (CL(15:0cyclo/15:0cyclo/19:0cycv8c/19:0cycv8c))PW001789 Pw001789Pw001789 greyscalePw001789 simple
phospholipid biosynthesis (CL(15:0cyclo/16:0/19:0cycv8c/15:0cyclo))PW001114 Pw001114Pw001114 greyscalePw001114 simple
phospholipid biosynthesis (CL(16:0/10:0(3-OH)/16:0/10:0(3-OH)))PW001949 Pw001949Pw001949 greyscalePw001949 simple
phospholipid biosynthesis (CL(16:0/12:0/12:0/12:0)) 2PW001952 Pw001952Pw001952 greyscalePw001952 simple
phospholipid biosynthesis (CL(16:0/14:0(3-OH)/16:0/14:0(3-OH)))PW001951 Pw001951Pw001951 greyscalePw001951 simple
phospholipid biosynthesis (CL(16:0/16:0/16:0/16:0))PW002010 Pw002010Pw002010 greyscalePw002010 simple
phospholipid biosynthesis (CL(16:1(9Z)/10:0/14:0/14:0))PW001954 Pw001954Pw001954 greyscalePw001954 simple
phospholipid biosynthesis (CL(16:1(9Z)/12:0/12:0/12:0))PW001955 Pw001955Pw001955 greyscalePw001955 simple
phospholipid biosynthesis (CL(16:1(9Z)/14:0(3-OH)/14:0/14:0))PW001957 Pw001957Pw001957 greyscalePw001957 simple
phospholipid biosynthesis (CL(16:1(9Z)/14:0(3-OH)/16:1(9Z)/14:0(3-OH)))PW001958 Pw001958Pw001958 greyscalePw001958 simple
phospholipid biosynthesis (CL(16:1(9Z)/17:0cycw7c/14:0/17:0cycw7c))PW001959 Pw001959Pw001959 greyscalePw001959 simple
phospholipid biosynthesis (CL(16:1(9Z)/18:1(9Z)/16:1(9Z)/14:0))PW001759 Pw001759Pw001759 greyscalePw001759 simple
phospholipid biosynthesis (CL(16:1(9Z)/19:0/14:0/14:0))PW001960 Pw001960Pw001960 greyscalePw001960 simple
phospholipid biosynthesis (CL(16:1(9Z)/19:0/16:0/16:0))PW001961 Pw001961Pw001961 greyscalePw001961 simple
phospholipid biosynthesis (CL(16:1(9Z)/19:0/16:1(9Z)/19:0))PW001962 Pw001962Pw001962 greyscalePw001962 simple
phospholipid biosynthesis (CL(17:0/16:1(9Z)/14:0/14:0))PW001963 Pw001963Pw001963 greyscalePw001963 simple
phospholipid biosynthesis (CL(17:0/16:1(9Z)/16:0/16:0))PW001964 Pw001964Pw001964 greyscalePw001964 simple
phospholipid biosynthesis (CL(17:0cycw7c/10:0(3-OH)/10:0/10:0))PW001965 Pw001965Pw001965 greyscalePw001965 simple
phospholipid biosynthesis (CL(17:0cycw7c/10:0(3-OH)/14:0/14:0))PW001966 Pw001966Pw001966 greyscalePw001966 simple
phospholipid biosynthesis (CL(17:0cycw7c/10:0(3-OH)/17:0cycw7c/10:0(3-OH)))PW001967 Pw001967Pw001967 greyscalePw001967 simple
phospholipid biosynthesis (CL(17:0cycw7c/10:0/14:0/14:0))PW001968 Pw001968Pw001968 greyscalePw001968 simple
phospholipid biosynthesis (CL(17:0cycw7c/12:0(3-OH)/12:0/12:0))PW001969 Pw001969Pw001969 greyscalePw001969 simple
phospholipid biosynthesis (CL(17:0cycw7c/12:0(3-OH)/17:0cycw7c/12:0(3-OH)))PW001970 Pw001970Pw001970 greyscalePw001970 simple
phospholipid biosynthesis (CL(17:0cycw7c/12:0/12:0/12:0))PW001972 Pw001972Pw001972 greyscalePw001972 simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/14:0/17:0cycw7c))PW001692 Pw001692Pw001692 greyscalePw001692 simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/16:1(9Z)/14:0))PW001694 Pw001694Pw001694 greyscalePw001694 simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/17:0cycw7c/14:0))PW001695 Pw001695Pw001695 greyscalePw001695 simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/17:0cycw7c/16:1(9Z)))PW001696 Pw001696Pw001696 greyscalePw001696 simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/17:0cycw7c/17:0cycw7c))PW001697 Pw001697Pw001697 greyscalePw001697 simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/17:0cycw7c/18:1(9Z)))PW001698 Pw001698Pw001698 greyscalePw001698 simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/17:0cycw7c/19:0cycv8c))PW001699 Pw001699Pw001699 greyscalePw001699 simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/18:1(9Z)/17:0cycw7c))PW001700 Pw001700Pw001700 greyscalePw001700 simple
phospholipid biosynthesis (CL(17:0cycw7c/16:1(9Z)/19:0cycv8c/17:0cycw7c))PW001701 Pw001701Pw001701 greyscalePw001701 simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/15:0cyclo))PW001702 Pw001702Pw001702 greyscalePw001702 simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/16:0))PW001703 Pw001703Pw001703 greyscalePw001703 simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/16:1(9Z)))PW001704 Pw001704Pw001704 greyscalePw001704 simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/17:0cycw7c))PW001705 Pw001705Pw001705 greyscalePw001705 simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/18:1(9Z)))PW001706 Pw001706Pw001706 greyscalePw001706 simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/14:0/19:0cycv8c))PW001707 Pw001707Pw001707 greyscalePw001707 simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/17:0cycw7c/14:0))PW001708 Pw001708Pw001708 greyscalePw001708 simple
phospholipid biosynthesis (CL(17:0cycw7c/17:0cycw7c/17:0cycw7c/17:0cycw7c))PW001709 Pw001709Pw001709 greyscalePw001709 simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/14:0/14:0))PW001710 Pw001710Pw001710 greyscalePw001710 simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/14:0/17:0cycw7c))PW001711 Pw001711Pw001711 greyscalePw001711 simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/14:0/18:1(9Z)))PW001712 Pw001712Pw001712 greyscalePw001712 simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/17:0cycw7c/14:0))PW001464 Pw001464Pw001464 greyscalePw001464 simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/17:0cycw7c/17:0cycw7c))PW001465 Pw001465Pw001465 greyscalePw001465 simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/17:0cycw7c/18:1(9Z)))PW001466 Pw001466Pw001466 greyscalePw001466 simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/17:0cycw7c/19:0cycv8c))PW001467 Pw001467Pw001467 greyscalePw001467 simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/18:1(9Z)/14:0))PW001473 Pw001473Pw001473 greyscalePw001473 simple
phospholipid biosynthesis (CL(17:0cycw7c/18:1(9Z)/19:0cycv8c/17:0cycw7c))PW001474 Pw001474Pw001474 greyscalePw001474 simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/14:0/14:0))PW001475 Pw001475Pw001475 greyscalePw001475 simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/14:0/17:0cycw7c))PW001476 Pw001476Pw001476 greyscalePw001476 simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/14:0/19:0cycv8c))PW001482 Pw001482Pw001482 greyscalePw001482 simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/17:0cycw7c/14:0))PW001483 Pw001483Pw001483 greyscalePw001483 simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/17:0cycw7c/19:0cycv8c))PW001484 Pw001484Pw001484 greyscalePw001484 simple
phospholipid biosynthesis (CL(17:0cycw7c/19:0cycv8c/19:0cycv8c/14:0))PW001485 Pw001485Pw001485 greyscalePw001485 simple
phospholipid biosynthesis (CL(17:0cycw7c/19:iso/17:0cycw7c/19:iso))PW001973 Pw001973Pw001973 greyscalePw001973 simple
phospholipid biosynthesis (CL(18:0/10:0/10:0/10:0))PW001974 Pw001974Pw001974 greyscalePw001974 simple
phospholipid biosynthesis (CL(18:0/12:0/12:0/12:0))PW001975 Pw001975Pw001975 greyscalePw001975 simple
phospholipid biosynthesis (CL(18:1(11Z)/10:0/10:0/10:0))PW001976 Pw001976Pw001976 greyscalePw001976 simple
phospholipid biosynthesis (CL(18:1(11Z)/12:0/12:0/12:0))PW001977 Pw001977Pw001977 greyscalePw001977 simple
phospholipid biosynthesis (CL(18:1(11Z)/17:0/14:0/14:0))PW001978 Pw001978Pw001978 greyscalePw001978 simple
phospholipid biosynthesis (CL(18:1(11Z)/19:0/14:0/14:0))PW001979 Pw001979Pw001979 greyscalePw001979 simple
phospholipid biosynthesis (CL(18:1(11Z)/19:0/18:1(11Z)/19:0))PW001980 Pw001980Pw001980 greyscalePw001980 simple
phospholipid biosynthesis (CL(18:1(11Z)/19:0/19:0/19:0))PW001981 Pw001981Pw001981 greyscalePw001981 simple
phospholipid biosynthesis (CL(18:1(9Z)/12:0(3-OH)/18:1(9Z)/12:0(3-OH)))PW001982 Pw001982Pw001982 greyscalePw001982 simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/14:0/14:0))PW001493 Pw001493Pw001493 greyscalePw001493 simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/14:0/17:0cycw7c))PW001492 Pw001492Pw001492 greyscalePw001492 simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/14:0/18:1(9Z)))PW001494 Pw001494Pw001494 greyscalePw001494 simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/14:0/19:0cycv8c))PW001495 Pw001495Pw001495 greyscalePw001495 simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/17:0cycw7c/14:0))PW001498 Pw001498Pw001498 greyscalePw001498 simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/17:0cycw7c/17:0cycw7c))PW001499 Pw001499Pw001499 greyscalePw001499 simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/18:1(9Z)/14:0))PW001500 Pw001500Pw001500 greyscalePw001500 simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/19:0cycv8c/14:0))PW001502 Pw001502Pw001502 greyscalePw001502 simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/19:0cycv8c/19:0cycv8c) 2)PW001781 Pw001781Pw001781 greyscalePw001781 simple
phospholipid biosynthesis (CL(18:1(9Z)/14:0/19:0cycv8c/19:0cycv8c))PW001506 Pw001506Pw001506 greyscalePw001506 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/14:0/15:0cyclo) 5)PW001717 Pw001717Pw001717 greyscalePw001717 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/14:0/15:0cyclo))PW001507 Pw001507Pw001507 greyscalePw001507 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/14:0/18:1(9Z)))PW001514 Pw001514Pw001514 greyscalePw001514 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/15:0cyclo/14:0))PW001515 Pw001515Pw001515 greyscalePw001515 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/15:0cyclo/17:0cycw7c))PW001516 Pw001516Pw001516 greyscalePw001516 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/15:0cyclo/19:0cycv8c))PW001517 Pw001517Pw001517 greyscalePw001517 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/16:0/18:1(9Z)))PW001518 Pw001518Pw001518 greyscalePw001518 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/16:1(9Z)/18:1(9Z)))PW001519 Pw001519Pw001519 greyscalePw001519 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/17:0cycw7c/15:0cyclo))PW001527 Pw001527Pw001527 greyscalePw001527 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/17:0cycw7c/17:0cycw7c))PW001528 Pw001528Pw001528 greyscalePw001528 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/17:0cycw7c/18:1(9Z)))PW001529 Pw001529Pw001529 greyscalePw001529 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/14:0))PW001530 Pw001530Pw001530 greyscalePw001530 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/15:0cyclo))PW001531 Pw001531Pw001531 greyscalePw001531 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/16:0))PW001532 Pw001532Pw001532 greyscalePw001532 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/16:1(9Z)))PW001533 Pw001533Pw001533 greyscalePw001533 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/17:0cycw7c))PW001534 Pw001534Pw001534 greyscalePw001534 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/18:1(9Z)))PW001540 Pw001540Pw001540 greyscalePw001540 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/18:1(9Z)/19:0cycv8c))PW001541 Pw001541Pw001541 greyscalePw001541 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/19:0cycv8c/15:0cyclo))PW001577 Pw001577Pw001577 greyscalePw001577 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/19:0cycv8c/18:1(9Z)))PW001578 Pw001578Pw001578 greyscalePw001578 simple
phospholipid biosynthesis (CL(18:1(9Z)/15:0cyclo/19:0cycv8c/19:0cycv8c))PW001579 Pw001579Pw001579 greyscalePw001579 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/14:0/14:0))PW001580 Pw001580Pw001580 greyscalePw001580 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/14:0/16:0))PW001581 Pw001581Pw001581 greyscalePw001581 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/14:0/18:1(9Z)))PW001582 Pw001582Pw001582 greyscalePw001582 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/16:0/14:0))PW002011 Pw002011Pw002011 greyscalePw002011 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/16:0/17:0cycw7c))PW002012 Pw002012Pw002012 greyscalePw002012 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/16:0/19:0cycv8c) 2)PW001783 Pw001783Pw001783 greyscalePw001783 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/16:0/19:0cycv8c))PW001583 Pw001583Pw001583 greyscalePw001583 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/16:1(9Z)/18:1(9Z)))PW002013 Pw002013Pw002013 greyscalePw002013 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/17:0cycw7c/16:0))PW001584 Pw001584Pw001584 greyscalePw001584 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/17:0cycw7c/17:0cycw7c))PW001585 Pw001585Pw001585 greyscalePw001585 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/17:0cycw7c/18:1(9Z)))PW001586 Pw001586Pw001586 greyscalePw001586 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/14:0))PW001587 Pw001587Pw001587 greyscalePw001587 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/16:0))PW001588 Pw001588Pw001588 greyscalePw001588 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/16:1(9Z)))PW001594 Pw001594Pw001594 greyscalePw001594 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/17:0cycw7c))PW001595 Pw001595Pw001595 greyscalePw001595 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/18:1(9Z)))PW001596 Pw001596Pw001596 greyscalePw001596 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/18:1(9Z)/19:0cycv8c))PW001597 Pw001597Pw001597 greyscalePw001597 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/19:0cycv8c/16:0))PW001598 Pw001598Pw001598 greyscalePw001598 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/19:0cycv8c/18:1(9Z)))PW001599 Pw001599Pw001599 greyscalePw001599 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:0/19:0cycv8c/19:0cycv8c))PW001600 Pw001600Pw001600 greyscalePw001600 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/14:0/14:0))PW001601 Pw001601Pw001601 greyscalePw001601 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/14:0/16:1(9Z)))PW001607 Pw001607Pw001607 greyscalePw001607 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/14:0/18:1(9Z)))PW001608 Pw001608Pw001608 greyscalePw001608 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/16:1(9Z)/14:0))PW001609 Pw001609Pw001609 greyscalePw001609 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/16:1(9Z)/17:0cycw7c))PW001610 Pw001610Pw001610 greyscalePw001610 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/16:1(9Z)/19:0cycv8c))PW001612 Pw001612Pw001612 greyscalePw001612 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/17:0cycw7c/16:1(9Z)))PW001613 Pw001613Pw001613 greyscalePw001613 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/17:0cycw7c/17:0cycw7c))PW001618 Pw001618Pw001618 greyscalePw001618 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/17:0cycw7c/18:1(9Z)))PW001619 Pw001619Pw001619 greyscalePw001619 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/18:1(9Z)/14:0))PW001620 Pw001620Pw001620 greyscalePw001620 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/18:1(9Z)/16:1(9Z)))PW001621 Pw001621Pw001621 greyscalePw001621 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/18:1(9Z)/17:0cycw7c))PW002014 Pw002014Pw002014 greyscalePw002014 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/18:1(9Z)/18:1(9Z)))PW001622 Pw001622Pw001622 greyscalePw001622 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/18:1(9Z)/19:0cycv8c))PW001623 Pw001623Pw001623 greyscalePw001623 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/19:0cycv8c/16:1(9Z)))PW001629 Pw001629Pw001629 greyscalePw001629 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/19:0cycv8c/18:1(9Z)) 2)PW001784 Pw001784Pw001784 greyscalePw001784 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/19:0cycv8c/18:1(9Z)))PW001630 Pw001630Pw001630 greyscalePw001630 simple
phospholipid biosynthesis (CL(18:1(9Z)/16:1(9Z)/19:0cycv8c/19:0cycv8c))PW001632 Pw001632Pw001632 greyscalePw001632 simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/14:0/14:0))PW001633 Pw001633Pw001633 greyscalePw001633 simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/14:0/17:0cycw7c))PW001634 Pw001634Pw001634 greyscalePw001634 simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/14:0/18:1(9Z)))PW001635 Pw001635Pw001635 greyscalePw001635 simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/17:0cycw7c/14:0))PW001638 Pw001638Pw001638 greyscalePw001638 simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/17:0cycw7c/17:0cycw7c))PW001640 Pw001640Pw001640 greyscalePw001640 simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/17:0cycw7c/18:1(9Z)))PW001644 Pw001644Pw001644 greyscalePw001644 simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/17:0cycw7c/19:0cycv8c))PW001645 Pw001645Pw001645 greyscalePw001645 simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/18:1(9Z)/14:0))PW001646 Pw001646Pw001646 greyscalePw001646 simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/18:1(9Z)/17:0cycw7c))PW001647 Pw001647Pw001647 greyscalePw001647 simple
phospholipid biosynthesis (CL(18:1(9Z)/17:0cycw7c/19:0cycv8c/17:0cycw7c))PW001648 Pw001648Pw001648 greyscalePw001648 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/14:0))PW001649 Pw001649Pw001649 greyscalePw001649 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/15:0cyclo))PW001664 Pw001664Pw001664 greyscalePw001664 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/16:0))PW001665 Pw001665Pw001665 greyscalePw001665 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/16:1(9Z)))PW001666 Pw001666Pw001666 greyscalePw001666 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/17:0cycw7c))PW001667 Pw001667Pw001667 greyscalePw001667 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/18:1(9Z)))PW001668 Pw001668Pw001668 greyscalePw001668 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/14:0/19:0cycv8c))PW001669 Pw001669Pw001669 greyscalePw001669 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/14:0))PW001670 Pw001670Pw001670 greyscalePw001670 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/15:0cyclo))PW001671 Pw001671Pw001671 greyscalePw001671 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/16:0))PW001672 Pw001672Pw001672 greyscalePw001672 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/16:1(9Z)))PW001673 Pw001673Pw001673 greyscalePw001673 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/17:0cycw7c))PW001679 Pw001679Pw001679 greyscalePw001679 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/18:1(9Z)))PW001680 Pw001680Pw001680 greyscalePw001680 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/17:0cycw7c/19:0cycv8c))PW001685 Pw001685Pw001685 greyscalePw001685 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/18:1(9Z)/14:0))PW001686 Pw001686Pw001686 greyscalePw001686 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/18:1(9Z)/17:0cycw7c))PW001687 Pw001687Pw001687 greyscalePw001687 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/18:1(9Z)/19:0cycv8c))PW001026 Pw001026Pw001026 greyscalePw001026 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/18:1(9Z)/19:0cycv8c)) 1440195714PW001034 Pw001034Pw001034 greyscalePw001034 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/18:1(9Z)/19:0cycv8c)) 2PW001186 Pw001186Pw001186 greyscalePw001186 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/14:0))PW001688 Pw001688Pw001688 greyscalePw001688 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/15:0cyclo))PW001185 Pw001185Pw001185 greyscalePw001185 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/16:0))PW001194 Pw001194Pw001194 greyscalePw001194 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/16:0)) 1442332377PW001956 Pw001956Pw001956 greyscalePw001956 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/16:1(9Z))PW001212 Pw001212Pw001212 greyscalePw001212 simple
phospholipid biosynthesis (CL(18:1(9Z)/18:1(9Z)/19:0cycv8c/17:0cycw7c))PW001210 Pw001210Pw001210 greyscalePw001210 simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/14:0/14:0))PW001211 Pw001211Pw001211 greyscalePw001211 simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/14:0/18:1(9Z)))PW001233 Pw001233Pw001233 greyscalePw001233 simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/14:0/19:0cycv8c))PW001234 Pw001234Pw001234 greyscalePw001234 simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/17:0cycw7c/17:0cycw7c))PW001240 Pw001240Pw001240 greyscalePw001240 simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/17:0cycw7c/18:1(9Z)))PW001241 Pw001241Pw001241 greyscalePw001241 simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/18:1(9Z)/14:0))PW001244 Pw001244Pw001244 greyscalePw001244 simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/18:1(9Z)/17:0cycw7c))PW001248 Pw001248Pw001248 greyscalePw001248 simple
phospholipid biosynthesis (CL(18:1(9Z)/19:0cycv8c/19:0cycv8c/14:0))PW001249 Pw001249Pw001249 greyscalePw001249 simple
phospholipid biosynthesis (CL(18:1/18:1/18:1/18:1))PW001027 Pw001027Pw001027 greyscalePw001027 simple
phospholipid biosynthesis (CL(19:0/16:1(9Z)/14:0/14:0))PW001983 Pw001983Pw001983 greyscalePw001983 simple
phospholipid biosynthesis (CL(19:0/16:1(9Z)/16:0/16:0))PW001984 Pw001984Pw001984 greyscalePw001984 simple
phospholipid biosynthesis (CL(19:0/16:1(9Z)/19:0/16:1(9Z)))PW001985 Pw001985Pw001985 greyscalePw001985 simple
phospholipid biosynthesis (CL(19:0/18:1(11Z)/14:0/14:0))PW001986 Pw001986Pw001986 greyscalePw001986 simple
phospholipid biosynthesis (CL(19:0/18:1(11Z)/19:0/18:1(11Z)))PW001987 Pw001987Pw001987 greyscalePw001987 simple
phospholipid biosynthesis (CL(19:0/18:1(11Z)/19:0/19:0))PW001988 Pw001988Pw001988 greyscalePw001988 simple
phospholipid biosynthesis (CL(19:0cycv8c/10:0(3-OH)/10:0/10:0))PW001989 Pw001989Pw001989 greyscalePw001989 simple
phospholipid biosynthesis (CL(19:0cycv8c/10:0(3-OH)/19:0cycv8c/10:0(3-OH)))PW001991 Pw001991Pw001991 greyscalePw001991 simple
phospholipid biosynthesis (CL(19:0cycv8c/12:0(3-OH)/12:0/12:0))PW001992 Pw001992Pw001992 greyscalePw001992 simple
phospholipid biosynthesis (CL(19:0cycv8c/12:0(3-OH)/19:0cycv8c/12:0(3-OH)))PW001993 Pw001993Pw001993 greyscalePw001993 simple
phospholipid biosynthesis (CL(19:0cycv8c/14:0/14:0/17:0cycw7c))PW001251 Pw001251Pw001251 greyscalePw001251 simple
phospholipid biosynthesis (CL(19:0cycv8c/14:0/14:0/19:0cycv8c))PW001253 Pw001253Pw001253 greyscalePw001253 simple
phospholipid biosynthesis (CL(19:0cycv8c/14:0/17:0cycw7c/14:0))PW001262 Pw001262Pw001262 greyscalePw001262 simple
phospholipid biosynthesis (CL(19:0cycv8c/14:0/17:0cycw7c/17:0cycw7c))PW001263 Pw001263Pw001263 greyscalePw001263 simple
phospholipid biosynthesis (CL(19:0cycv8c/14:0/19:0cycv8c/14:0))PW001275 Pw001275Pw001275 greyscalePw001275 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/14:0/15:0cyclo))PW001276 Pw001276Pw001276 greyscalePw001276 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/14:0/19:0cycv8c))PW001291 Pw001291Pw001291 greyscalePw001291 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/15:0cyclo/14:0))PW001292 Pw001292Pw001292 greyscalePw001292 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/15:0cyclo/17:0cycw7c))PW001298 Pw001298Pw001298 greyscalePw001298 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/16:0/19:0cycv8c))PW001299 Pw001299Pw001299 greyscalePw001299 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/16:1(9Z)/19:0cycv8c))PW001300 Pw001300Pw001300 greyscalePw001300 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/17:0cycw7c/15:0cyclo))PW001301 Pw001301Pw001301 greyscalePw001301 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/17:0cycw7c/17:0cycw7c))PW001302 Pw001302Pw001302 greyscalePw001302 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/18:1(9Z)/19:0cycv8c))PW001304 Pw001304Pw001304 greyscalePw001304 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/14:0))PW001309 Pw001309Pw001309 greyscalePw001309 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/15:0cyclo))PW001310 Pw001310Pw001310 greyscalePw001310 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/16:0))PW001316 Pw001316Pw001316 greyscalePw001316 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/16:1(9Z)))PW001317 Pw001317Pw001317 greyscalePw001317 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/18:1(9Z)))PW001318 Pw001318Pw001318 greyscalePw001318 simple
phospholipid biosynthesis (CL(19:0cycv8c/15:0cyclo/19:0cycv8c/19:0cycv8c))PW001319 Pw001319Pw001319 greyscalePw001319 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/14:0/14:0))PW001320 Pw001320Pw001320 greyscalePw001320 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/14:0/16:0))PW001321 Pw001321Pw001321 greyscalePw001321 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/14:0/19:0cycv8c))PW001322 Pw001322Pw001322 greyscalePw001322 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/16:0/14:0))PW001323 Pw001323Pw001323 greyscalePw001323 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/16:0/17:0cycw7c))PW001324 Pw001324Pw001324 greyscalePw001324 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/16:1(9Z)/19:0cycv8c))PW001326 Pw001326Pw001326 greyscalePw001326 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/17:0cycw7c/16:0))PW001331 Pw001331Pw001331 greyscalePw001331 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/17:0cycw7c/17:0cycw7c))PW001332 Pw001332Pw001332 greyscalePw001332 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/17:0cycw7c/19:0cycv8c))PW001333 Pw001333Pw001333 greyscalePw001333 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/18:1(9Z)/19:0cycv8c))PW001334 Pw001334Pw001334 greyscalePw001334 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/19:0cycv8c/14:0))PW001340 Pw001340Pw001340 greyscalePw001340 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/19:0cycv8c/16:1(9Z)))PW001341 Pw001341Pw001341 greyscalePw001341 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/19:0cycv8c/17:0cycw7c))PW001372 Pw001372Pw001372 greyscalePw001372 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:0/19:0cycv8c/18:1(9Z)))PW001373 Pw001373Pw001373 greyscalePw001373 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/14:0/14:0))PW001374 Pw001374Pw001374 greyscalePw001374 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/14:0/16:1(9Z)))PW001375 Pw001375Pw001375 greyscalePw001375 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/14:0/19:0cycv8c))PW001376 Pw001376Pw001376 greyscalePw001376 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/16:1(9Z)/14:0))PW001377 Pw001377Pw001377 greyscalePw001377 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/16:1(9Z)/17:0cycw7c))PW001383 Pw001383Pw001383 greyscalePw001383 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/17:0cycw7c/16:1(9Z)))PW001384 Pw001384Pw001384 greyscalePw001384 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/17:0cycw7c/17:0cycw7c))PW001385 Pw001385Pw001385 greyscalePw001385 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/17:0cycw7c/19:0cycv8c))PW001386 Pw001386Pw001386 greyscalePw001386 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/18:1(9Z)/19:0cycv8c))PW001387 Pw001387Pw001387 greyscalePw001387 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/19:0cycv8c/14:0))PW001388 Pw001388Pw001388 greyscalePw001388 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/19:0cycv8c/16:1(9Z)))PW001394 Pw001394Pw001394 greyscalePw001394 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/19:0cycv8c/17:0cycw7c))PW001395 Pw001395Pw001395 greyscalePw001395 simple
phospholipid biosynthesis (CL(19:0cycv8c/16:1(9Z)/19:0cycv8c/18:1(9Z)))PW001396 Pw001396Pw001396 greyscalePw001396 simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/14:0/14:0))PW001397 Pw001397Pw001397 greyscalePw001397 simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/14:0/17:0cycw7c))PW001403 Pw001403Pw001403 greyscalePw001403 simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/14:0/19:0cycv8c))PW001404 Pw001404Pw001404 greyscalePw001404 simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/17:0cycw7c/14:0))PW001405 Pw001405Pw001405 greyscalePw001405 simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/17:0cycw7c/19:0cycv8c))PW001406 Pw001406Pw001406 greyscalePw001406 simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/19:0cycv8c/14:0))PW001407 Pw001407Pw001407 greyscalePw001407 simple
phospholipid biosynthesis (CL(19:0cycv8c/17:0cycw7c/19:0cycv8c/17:0cycw7c))PW001408 Pw001408Pw001408 greyscalePw001408 simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/14:0/14:0))PW001414 Pw001414Pw001414 greyscalePw001414 simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/14:0/18:1(9Z)))PW001415 Pw001415Pw001415 greyscalePw001415 simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/14:0/19:0cycv8c))PW001420 Pw001420Pw001420 greyscalePw001420 simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/17:0cycw7c/17:0cycw7c))PW001422 Pw001422Pw001422 greyscalePw001422 simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/17:0cycw7c/18:1(9Z)))PW001423 Pw001423Pw001423 greyscalePw001423 simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/18:1(9Z)/14:0))PW001424 Pw001424Pw001424 greyscalePw001424 simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/18:1(9Z)/17:0cycw7c))PW001426 Pw001426Pw001426 greyscalePw001426 simple
phospholipid biosynthesis (CL(19:0cycv8c/18:1(9Z)/19:0cycv8c/14:0))PW001428 Pw001428Pw001428 greyscalePw001428 simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/14:0))PW001432 Pw001432Pw001432 greyscalePw001432 simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/15:0cyclo))PW001433 Pw001433Pw001433 greyscalePw001433 simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/16:0))PW001434 Pw001434Pw001434 greyscalePw001434 simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/16:1(9Z)))PW001435 Pw001435Pw001435 greyscalePw001435 simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/17:0cycw7c))PW001436 Pw001436Pw001436 greyscalePw001436 simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/18:1(9Z)))PW001438 Pw001438Pw001438 greyscalePw001438 simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/14:0/19:0cycv8c))PW001443 Pw001443Pw001443 greyscalePw001443 simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/17:0cycw7c/14:0))PW001444 Pw001444Pw001444 greyscalePw001444 simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/17:0cycw7c/16:0))PW001445 Pw001445Pw001445 greyscalePw001445 simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/17:0cycw7c/16:1(9Z)))PW001446 Pw001446Pw001446 greyscalePw001446 simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/17:0cycw7c/17:0cycw7c))PW001447 Pw001447Pw001447 greyscalePw001447 simple
phospholipid biosynthesis (CL(19:0cycv8c/19:0cycv8c/19:0cycv8c/14:0))PW001448 Pw001448Pw001448 greyscalePw001448 simple
phospholipid biosynthesis (CL(19:0cycw8c/10:0/10:0/10:0))PW001994 Pw001994Pw001994 greyscalePw001994 simple
phospholipid biosynthesis (CL(19:1(9Z)/16:1(9Z)/19:1(9Z)/16:1(9Z)))PW001995 Pw001995Pw001995 greyscalePw001995 simple
phospholipid biosynthesis (CL(19:iso/10:0(3-OH)/10:0/10:0))PW001996 Pw001996Pw001996 greyscalePw001996 simple
phospholipid biosynthesis (CL(19:iso/10:0(3-OH)/19:iso/10:0(3-OH)))PW001997 Pw001997Pw001997 greyscalePw001997 simple
phospholipid biosynthesis (CL(19:iso/10:0/19:iso/10:0))PW001998 Pw001998Pw001998 greyscalePw001998 simple
phospholipid biosynthesis (CL(19:iso/12:0(3-OH)/12:0/12:0))PW001999 Pw001999Pw001999 greyscalePw001999 simple
phospholipid biosynthesis (CL(19:iso/12:0(3-OH)/19:iso/12:0(3-OH)))PW002000 Pw002000Pw002000 greyscalePw002000 simple
phospholipid biosynthesis (CL(19:iso/12:0/19:iso/12:0))PW002001 Pw002001Pw002001 greyscalePw002001 simple
phospholipid biosynthesis (CL(19:iso/14:0(3-OH)/14:0/14:0))PW002002 Pw002002Pw002002 greyscalePw002002 simple
phospholipid biosynthesis (CL(19:iso/14:0(3-OH)/19:iso/14:0(3-OH)))PW002004 Pw002004Pw002004 greyscalePw002004 simple
phospholipid biosynthesis (CL(19:iso/14:0/14:0/14:0))PW002005 Pw002005Pw002005 greyscalePw002005 simple
phospholipid biosynthesis (CL(19:iso/14:0/19:iso/14:0))PW002006 Pw002006Pw002006 greyscalePw002006 simple
phospholipid biosynthesis (CL(19:iso/17:0cycw7c/19:0/19:0))PW002007 Pw002007Pw002007 greyscalePw002007 simple
phospholipid biosynthesis (CL(19:iso/19:0cycv8c/19:0/19:0))PW002008 Pw002008Pw002008 greyscalePw002008 simple
phospholipid biosynthesis (CL(19:iso/19:iso/19:iso/19:iso))PW002009 Pw002009Pw002009 greyscalePw002009 simple
phospholipid biosynthesis (PE(16:0/10:0(3-OH)))PW001741 Pw001741Pw001741 greyscalePw001741 simple
phospholipid biosynthesis (PE(16:0/12:0(3-OH)))PW001744 Pw001744Pw001744 greyscalePw001744 simple
phospholipid biosynthesis (PE(16:0/18:0))PW001748 Pw001748Pw001748 greyscalePw001748 simple
phospholipid biosynthesis (PE(16:0/19:iso))PW001751 Pw001751Pw001751 greyscalePw001751 simple
phospholipid biosynthesis (PE(16:1(9Z)/10:0(3-OH)))PW001753 Pw001753Pw001753 greyscalePw001753 simple
phospholipid biosynthesis (PE(16:1(9Z)/12:0(3-OH)))PW001755 Pw001755Pw001755 greyscalePw001755 simple
phospholipid biosynthesis (PE(16:1(9Z)/18:0))PW001758 Pw001758Pw001758 greyscalePw001758 simple
phospholipid biosynthesis (PE(16:1(9Z)/19:iso))PW001760 Pw001760Pw001760 greyscalePw001760 simple
phospholipid biosynthesis (PE(18:0/14:0))PW001765 Pw001765Pw001765 greyscalePw001765 simple
phospholipid biosynthesis (PE(18:0/16:0))PW001767 Pw001767Pw001767 greyscalePw001767 simple
phospholipid biosynthesis (PE(18:0/16:1(9Z)))PW001770 Pw001770Pw001770 greyscalePw001770 simple
phospholipid biosynthesis (PE(18:0/18:0))PW001772 Pw001772Pw001772 greyscalePw001772 simple
phospholipid biosynthesis (PE(18:0/18:1(9Z)))PW001774 Pw001774Pw001774 greyscalePw001774 simple
phospholipid biosynthesis (PE(18:1(9Z)/10:0(3-OH)))PW001779 Pw001779Pw001779 greyscalePw001779 simple
phospholipid biosynthesis (PE(18:1(9Z)/12:0(3-OH)))PW001780 Pw001780Pw001780 greyscalePw001780 simple
phospholipid biosynthesis (PE(19:iso/10:0))PW001786 Pw001786Pw001786 greyscalePw001786 simple
phospholipid biosynthesis (PE(19:iso/12:0))PW001787 Pw001787Pw001787 greyscalePw001787 simple
phospholipid biosynthesis CDP-DG(10:0/10:0) IPW001743 Pw001743Pw001743 greyscalePw001743 simple
phospholipid biosynthesis CDP-DG(10:0/10:0) IIPW001815 Pw001815Pw001815 greyscalePw001815 simple
phospholipid biosynthesis CDP-DG(10:0/10:0) IIIPW001816 Pw001816Pw001816 greyscalePw001816 simple
phospholipid biosynthesis CDP-DG(10:0/10:0) IVPW001817 Pw001817Pw001817 greyscalePw001817 simple
phospholipid biosynthesis CDP-DG(10:0/12:0)PW001746 Pw001746Pw001746 greyscalePw001746 simple
phospholipid biosynthesis CDP-DG(10:0/12:0) IIPW001818 Pw001818Pw001818 greyscalePw001818 simple
phospholipid biosynthesis CDP-DG(10:0/12:0) IIIPW001819 Pw001819Pw001819 greyscalePw001819 simple
phospholipid biosynthesis CDP-DG(10:0/12:0) IVPW001820 Pw001820Pw001820 greyscalePw001820 simple
phospholipid biosynthesis CDP-DG(10:0/14:0)PW001747 Pw001747Pw001747 greyscalePw001747 simple
phospholipid biosynthesis CDP-DG(10:0/14:0) IIPW001821 Pw001821Pw001821 greyscalePw001821 simple
phospholipid biosynthesis CDP-DG(10:0/14:0) IIIPW001822 Pw001822Pw001822 greyscalePw001822 simple
phospholipid biosynthesis CDP-DG(10:0/14:0) IVPW001823 Pw001823Pw001823 greyscalePw001823 simple
phospholipid biosynthesis CDP-DG(10:0/15:0)PW001749 Pw001749Pw001749 greyscalePw001749 simple
phospholipid biosynthesis CDP-DG(10:0/15:0) IIPW001826 Pw001826Pw001826 greyscalePw001826 simple
phospholipid biosynthesis CDP-DG(10:0/15:0) IIIPW001825 Pw001825Pw001825 greyscalePw001825 simple
phospholipid biosynthesis CDP-DG(10:0/16:0)PW001750 Pw001750Pw001750 greyscalePw001750 simple
phospholipid biosynthesis CDP-DG(10:0/16:0) IIPW001827 Pw001827Pw001827 greyscalePw001827 simple
phospholipid biosynthesis CDP-DG(10:0/16:1(9Z))PW001752 Pw001752Pw001752 greyscalePw001752 simple
phospholipid biosynthesis CDP-DG(10:0/16:1(9Z)) IIPW001828 Pw001828Pw001828 greyscalePw001828 simple
phospholipid biosynthesis CDP-DG(10:0/18:0)PW001754 Pw001754Pw001754 greyscalePw001754 simple
phospholipid biosynthesis CDP-DG(10:0/18:0) IIIPW001833 Pw001833Pw001833 greyscalePw001833 simple
phospholipid biosynthesis CDP-DG(10:0/18:1(9Z))PW001756 Pw001756Pw001756 greyscalePw001756 simple
phospholipid biosynthesis CDP-DG(10:0/19:1(9Z))PW001763 Pw001763Pw001763 greyscalePw001763 simple
phospholipid biosynthesis CDP-DG(10:0/19:1(9Z)) IIPW001829 Pw001829Pw001829 greyscalePw001829 simple
phospholipid biosynthesis CDP-DG(10:0/19:1(9Z)) IIIPW001830 Pw001830Pw001830 greyscalePw001830 simple
phospholipid biosynthesis CDP-DG(10:0/19:1(9Z)) IVPW001831 Pw001831Pw001831 greyscalePw001831 simple
phospholipid biosynthesis CDP-DG(10:0/19:1(9Z)) VPW001832 Pw001832Pw001832 greyscalePw001832 simple
phospholipid biosynthesis CDP-DG(12:0/10:0)PW001764 Pw001764Pw001764 greyscalePw001764 simple
phospholipid biosynthesis CDP-DG(12:0/10:0) IIPW001834 Pw001834Pw001834 greyscalePw001834 simple
phospholipid biosynthesis CDP-DG(12:0/10:0) IIIPW001835 Pw001835Pw001835 greyscalePw001835 simple
phospholipid biosynthesis CDP-DG(12:0/10:0) IVPW001844 Pw001844Pw001844 greyscalePw001844 simple
phospholipid biosynthesis CDP-DG(12:0/14:0)PW001768 Pw001768Pw001768 greyscalePw001768 simple
phospholipid biosynthesis CDP-DG(12:0/14:0) IIPW001836 Pw001836Pw001836 greyscalePw001836 simple
phospholipid biosynthesis CDP-DG(12:0/14:0) IIIPW001837 Pw001837Pw001837 greyscalePw001837 simple
phospholipid biosynthesis CDP-DG(12:0/14:0) IVPW001840 Pw001840Pw001840 greyscalePw001840 simple
phospholipid biosynthesis CDP-DG(12:0/15:0)PW001769 Pw001769Pw001769 greyscalePw001769 simple
phospholipid biosynthesis CDP-DG(12:0/15:0) IIPW001838 Pw001838Pw001838 greyscalePw001838 simple
phospholipid biosynthesis CDP-DG(12:0/15:0) IIIPW001839 Pw001839Pw001839 greyscalePw001839 simple
phospholipid biosynthesis CDP-DG(12:0/16:0)PW001771 Pw001771Pw001771 greyscalePw001771 simple
phospholipid biosynthesis CDP-DG(12:0/16:0) IIPW001841 Pw001841Pw001841 greyscalePw001841 simple
phospholipid biosynthesis CDP-DG(12:0/16:1(9Z))PW001773 Pw001773Pw001773 greyscalePw001773 simple
phospholipid biosynthesis CDP-DG(12:0/16:1(9Z)) IIPW001842 Pw001842Pw001842 greyscalePw001842 simple
phospholipid biosynthesis CDP-DG(12:0/18:0)PW001775 Pw001775Pw001775 greyscalePw001775 simple
phospholipid biosynthesis CDP-DG(12:0/18:1(9Z))PW001777 Pw001777Pw001777 greyscalePw001777 simple
phospholipid biosynthesis CDP-DG(12:0/18:1(9Z)) IIPW001843 Pw001843Pw001843 greyscalePw001843 simple
phospholipid biosynthesis CDP-DG(12:0/19:1(9Z))PW001778 Pw001778Pw001778 greyscalePw001778 simple
phospholipid biosynthesis CDP-DG(12:0/19:1(9Z)) IIPW001848 Pw001848Pw001848 greyscalePw001848 simple
phospholipid biosynthesis CDP-DG(12:0/19:1(9Z)) IIIPW001847 Pw001847Pw001847 greyscalePw001847 simple
phospholipid biosynthesis CDP-DG(12:0/19:1(9Z)) IVPW001846 Pw001846Pw001846 greyscalePw001846 simple
phospholipid biosynthesis CDP-DG(12:0/19:1(9Z)) VPW001845 Pw001845Pw001845 greyscalePw001845 simple
phospholipid biosynthesis CDP-DG(14:0/10:0)PW001793 Pw001793Pw001793 greyscalePw001793 simple
phospholipid biosynthesis CDP-DG(14:0/10:0) IIPW001852 Pw001852Pw001852 greyscalePw001852 simple
phospholipid biosynthesis CDP-DG(14:0/10:0) IIIPW001851 Pw001851Pw001851 greyscalePw001851 simple
phospholipid biosynthesis CDP-DG(14:0/10:0) IVPW001850 Pw001850Pw001850 greyscalePw001850 simple
phospholipid biosynthesis CDP-DG(14:0/12:0)PW001794 Pw001794Pw001794 greyscalePw001794 simple
phospholipid biosynthesis CDP-DG(14:0/12:0) IIPW001855 Pw001855Pw001855 greyscalePw001855 simple
phospholipid biosynthesis CDP-DG(14:0/12:0) IIIPW001854 Pw001854Pw001854 greyscalePw001854 simple
phospholipid biosynthesis CDP-DG(14:0/12:0) IVPW001853 Pw001853Pw001853 greyscalePw001853 simple
phospholipid biosynthesis CDP-DG(14:0/15:0)PW001795 Pw001795Pw001795 greyscalePw001795 simple
phospholipid biosynthesis CDP-DG(14:0/15:0) IIPW001857 Pw001857Pw001857 greyscalePw001857 simple
phospholipid biosynthesis CDP-DG(14:0/18:0)PW001802 Pw001802Pw001802 greyscalePw001802 simple
phospholipid biosynthesis CDP-DG(14:0/18:1(9Z))PW001803 Pw001803Pw001803 greyscalePw001803 simple
phospholipid biosynthesis CDP-DG(14:0/19:1(9Z))PW001804 Pw001804Pw001804 greyscalePw001804 simple
phospholipid biosynthesis CDP-DG(14:0/19:1(9Z)) IIPW001858 Pw001858Pw001858 greyscalePw001858 simple
phospholipid biosynthesis CDP-DG(15:0/10:0)PW001805 Pw001805Pw001805 greyscalePw001805 simple
phospholipid biosynthesis CDP-DG(15:0/10:0) IIPW001859 Pw001859Pw001859 greyscalePw001859 simple
phospholipid biosynthesis CDP-DG(15:0/12:0)PW001806 Pw001806Pw001806 greyscalePw001806 simple
phospholipid biosynthesis CDP-DG(15:0/12:0) IIPW001861 Pw001861Pw001861 greyscalePw001861 simple
phospholipid biosynthesis CDP-DG(15:0/12:0) IIIPW001862 Pw001862Pw001862 greyscalePw001862 simple
phospholipid biosynthesis CDP-DG(15:0/14:0)PW001807 Pw001807Pw001807 greyscalePw001807 simple
phospholipid biosynthesis CDP-DG(15:0/15:0)PW001808 Pw001808Pw001808 greyscalePw001808 simple
phospholipid biosynthesis CDP-DG(15:0/16:0)PW001809 Pw001809Pw001809 greyscalePw001809 simple
phospholipid biosynthesis CDP-DG(15:0/16:1(9Z))PW001810 Pw001810Pw001810 greyscalePw001810 simple
phospholipid biosynthesis CDP-DG(15:0/18:0)PW001811 Pw001811Pw001811 greyscalePw001811 simple
phospholipid biosynthesis CDP-DG(15:0/18:1(9Z))PW001812 Pw001812Pw001812 greyscalePw001812 simple
phospholipid biosynthesis CDP-DG(15:0/19:1(9Z))PW001813 Pw001813Pw001813 greyscalePw001813 simple
phospholipid biosynthesis CDP-DG(16:0/10:0)PW001814 Pw001814Pw001814 greyscalePw001814 simple
phospholipid biosynthesis CL(14:0/15:0cyclo/14:0/17:0cycw7c)PW001029 Pw001029Pw001029 greyscalePw001029 simple
phospholipid biosynthesis CL(14:0/16:0/14:0/14:0)PW001031 Pw001031Pw001031 greyscalePw001031 simple
phospholipid biosynthesis CL(14:0/16:0/14:0/16:0)PW001032 Pw001032Pw001032 greyscalePw001032 simple
phospholipid biosynthesis CL(14:0/16:0/14:0/16:1(9Z))PW001871 Pw001871Pw001871 greyscalePw001871 simple
phospholipid biosynthesis CL(14:0/16:0/14:0/18:1(9Z))PW001033 Pw001033Pw001033 greyscalePw001033 simple
phospholipid biosynthesis CL(14:0/16:0/14:0/19:0cycv8c)PW001035 Pw001035Pw001035 greyscalePw001035 simple
phospholipid biosynthesis CL(14:0/16:0/16:1(9Z)/14:0)PW001036 Pw001036Pw001036 greyscalePw001036 simple
phospholipid biosynthesis CL(14:0/16:0/18:1(9Z)/14:0)PW001037 Pw001037Pw001037 greyscalePw001037 simple
phospholipid biosynthesis CL(14:0/16:0/19:0cycv8c/14:0)PW001038 Pw001038Pw001038 greyscalePw001038 simple
phospholipid biosynthesis CL(14:0/16:1(9Z)/14:0/16:1(9Z))PW001039 Pw001039Pw001039 greyscalePw001039 simple
phospholipid biosynthesis CL(14:0/16:1(9Z)/14:0/18:1(9Z))PW001040 Pw001040Pw001040 greyscalePw001040 simple
phospholipid biosynthesis CL(14:0/16:1(9Z)/14:0/19:0cycv8c)PW001041 Pw001041Pw001041 greyscalePw001041 simple
phospholipid biosynthesis CL(14:0/16:1(9Z)/18:1(9Z)/14:0)PW001042 Pw001042Pw001042 greyscalePw001042 simple
phospholipid biosynthesis CL(14:0/16:1(9Z)/19:0cycv8c/14:0)PW001043 Pw001043Pw001043 greyscalePw001043 simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/14:0/14:0)PW001044 Pw001044Pw001044 greyscalePw001044 simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/14:0/17:0cycw7c)PW001045 Pw001045Pw001045 greyscalePw001045 simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/14:0/18:1(9Z))PW001046 Pw001046Pw001046 greyscalePw001046 simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/14:0/19:0cycv8c)PW001047 Pw001047Pw001047 greyscalePw001047 simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/17:0cycw7c/14:0)PW001048 Pw001048Pw001048 greyscalePw001048 simple
phospholipid biosynthesis CL(14:0/18:1(9Z)/19:0cycv8c/14:0)PW001049 Pw001049Pw001049 greyscalePw001049 simple
phospholipid biosynthesis CL(14:0/19:0cycv8c/14:0/17:0cycw7c)PW001050 Pw001050Pw001050 greyscalePw001050 simple
phospholipid biosynthesis CL(14:0/19:0cycv8c/14:0/19:0cycv8c)PW001051 Pw001051Pw001051 greyscalePw001051 simple
phospholipid biosynthesis CL(14:0/19:0cycv8c/17:0cycw7c/14:0)PW001052 Pw001052Pw001052 greyscalePw001052 simple
phospholipid biosynthesis CL(15:0cyclo/14:0/14:0/17:0cycw7c)PW001053 Pw001053Pw001053 greyscalePw001053 simple
phospholipid biosynthesis CL(15:0cyclo/14:0/16:1(9Z)/16:1(9Z))PW001054 Pw001054Pw001054 greyscalePw001054 simple
phospholipid biosynthesis CL(15:0cyclo/14:0/17:0cycw7c/14:0)PW001055 Pw001055Pw001055 greyscalePw001055 simple
phospholipid biosynthesis CL(15:0cyclo/14:0/17:0cycw7c/17:0cycw7c)PW001056 Pw001056Pw001056 greyscalePw001056 simple
phospholipid biosynthesis CL(15:0cyclo/14:0/18:1(9Z)/18:1(9Z))PW001057 Pw001057Pw001057 greyscalePw001057 simple
phospholipid biosynthesis CL(15:0cyclo/14:0/19:0cycv8c/19:0cycv8c)PW001058 Pw001058Pw001058 greyscalePw001058 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/14:0/16:0)PW001059 Pw001059Pw001059 greyscalePw001059 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/14:0/16:1(9Z))PW001060 Pw001060Pw001060 greyscalePw001060 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/14:0/18:1(9Z))PW001061 Pw001061Pw001061 greyscalePw001061 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/14:0/19:0cycv8c)PW001062 Pw001062Pw001062 greyscalePw001062 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:0/14:0)PW001066 Pw001066Pw001066 greyscalePw001066 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:0/16:1(9Z))PW001063 Pw001063Pw001063 greyscalePw001063 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:0/17:0cycw7c)PW001067 Pw001067Pw001067 greyscalePw001067 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:0/18:1(9Z))PW001069 Pw001069Pw001069 greyscalePw001069 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:0/19:0cycv8c)PW001070 Pw001070Pw001070 greyscalePw001070 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:1(9Z)/14:0)PW001071 Pw001071Pw001071 greyscalePw001071 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:1(9Z)/16:0)PW001072 Pw001072Pw001072 greyscalePw001072 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:1(9Z)/16:1(9Z))PW001068 Pw001068Pw001068 greyscalePw001068 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:1(9Z)/17:0cycw7c)PW001073 Pw001073Pw001073 greyscalePw001073 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:1(9Z)/18:1(9Z))PW001074 Pw001074Pw001074 greyscalePw001074 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/16:1(9Z)/19:0cycv8c)PW001075 Pw001075Pw001075 greyscalePw001075 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/17:0cycw7c/16:0)PW001076 Pw001076Pw001076 greyscalePw001076 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/17:0cycw7c/16:1(9Z))PW001077 Pw001077Pw001077 greyscalePw001077 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/17:0cycw7c/17:0cycw7c)PW001078 Pw001078Pw001078 greyscalePw001078 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/17:0cycw7c/18:1(9Z))PW001079 Pw001079Pw001079 greyscalePw001079 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/17:0cycw7c/19:0cycv8c)PW001080 Pw001080Pw001080 greyscalePw001080 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/18:1(9Z)/14:0)PW001081 Pw001081Pw001081 greyscalePw001081 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/18:1(9Z)/16:1(9Z))PW001083 Pw001083Pw001083 greyscalePw001083 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/18:1(9Z)/17:0cycw7c)PW001084 Pw001084Pw001084 greyscalePw001084 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/18:1(9Z)/18:1(9Z))PW001085 Pw001085Pw001085 greyscalePw001085 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/18:1(9Z)/19:0cycv8c)PW001086 Pw001086Pw001086 greyscalePw001086 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/14:0)PW001087 Pw001087Pw001087 greyscalePw001087 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/15:0cyclo)PW001088 Pw001088Pw001088 greyscalePw001088 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/16:0)PW001089 Pw001089Pw001089 greyscalePw001089 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/16:1(9Z))PW001090 Pw001090Pw001090 greyscalePw001090 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/17:0cycw7c)PW001091 Pw001091Pw001091 greyscalePw001091 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/18:1(9Z))PW001092 Pw001092Pw001092 greyscalePw001092 simple
phospholipid biosynthesis CL(15:0cyclo/15:0cyclo/19:0cycv8c/19:0cycv8c)PW001093 Pw001093Pw001093 greyscalePw001093 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/14:0/15:0cyclo)PW001094 Pw001094Pw001094 greyscalePw001094 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/15:0cyclo/14:0)PW001095 Pw001095Pw001095 greyscalePw001095 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/15:0cyclo/16:1(9Z))PW001096 Pw001096Pw001096 greyscalePw001096 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/15:0cyclo/17:0cycw7c)PW001097 Pw001097Pw001097 greyscalePw001097 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/15:0cyclo/18:1(9Z))PW001098 Pw001098Pw001098 greyscalePw001098 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/15:0cyclo/19:0cycv8c)PW001099 Pw001099Pw001099 greyscalePw001099 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:0/16:0)PW001100 Pw001100Pw001100 greyscalePw001100 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:0/16:1(9Z))PW001102 Pw001102Pw001102 greyscalePw001102 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:0/17:0cycw7c)PW001103 Pw001103Pw001103 greyscalePw001103 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:0/18:1(9Z))PW001104 Pw001104Pw001104 greyscalePw001104 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:0/19:0cycv8c)PW001105 Pw001105Pw001105 greyscalePw001105 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:1(9Z)/15:0cyclo)PW001107 Pw001107Pw001107 greyscalePw001107 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:1(9Z)/16:0)PW001106 Pw001106Pw001106 greyscalePw001106 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/16:1(9Z)/16:1(9Z))PW001108 Pw001108Pw001108 greyscalePw001108 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/17:0cycw7c/15:0cyclo)PW001101 Pw001101Pw001101 greyscalePw001101 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/17:0cycw7c/16:0)PW001109 Pw001109Pw001109 greyscalePw001109 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/17:0cycw7c/17:0cycw7c)PW001110 Pw001110Pw001110 greyscalePw001110 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/18:1(9Z)/15:0cyclo)PW001111 Pw001111Pw001111 greyscalePw001111 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/18:1(9Z)/16:0)PW001112 Pw001112Pw001112 greyscalePw001112 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/18:1(9Z)/18:1(9Z))PW001113 Pw001113Pw001113 greyscalePw001113 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/19:0cycv8c/16:0)PW001115 Pw001115Pw001115 greyscalePw001115 simple
phospholipid biosynthesis CL(15:0cyclo/16:0/19:0cycv8c/19:0cycv8c)PW001116 Pw001116Pw001116 greyscalePw001116 simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/14:0/15:0cyclo)PW001117 Pw001117Pw001117 greyscalePw001117 simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/14:0/16:1(9Z))PW001118 Pw001118Pw001118 greyscalePw001118 simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/15:0cyclo/14:0)PW001119 Pw001119Pw001119 greyscalePw001119 simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/15:0cyclo/16:1(9Z))PW001120 Pw001120Pw001120 greyscalePw001120 simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/15:0cyclo/17:0cycw7c)PW001121 Pw001121Pw001121 greyscalePw001121 simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/15:0cyclo/18:1(9Z))PW001122 Pw001122Pw001122 greyscalePw001122 simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/15:0cyclo/19:0cycv8c)PW001123 Pw001123Pw001123 greyscalePw001123 simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:0/16:0)PW001124 Pw001124Pw001124 greyscalePw001124 simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:0/16:1(9Z))PW001125 Pw001125Pw001125 greyscalePw001125 simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:1(9Z)/14:0)PW001126 Pw001126Pw001126 greyscalePw001126 simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:1(9Z)/15:0cyclo)PW001127 Pw001127Pw001127 greyscalePw001127 simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:1(9Z)/16:0)PW001128 Pw001128Pw001128 greyscalePw001128 simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:1(9Z)/16:1(9Z))PW001129 Pw001129Pw001129 greyscalePw001129 simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:1(9Z)/17:0cycw7c)PW001130 Pw001130Pw001130 greyscalePw001130 simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:1(9Z)/18:1(9Z))PW001131 Pw001131Pw001131 greyscalePw001131 simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/16:1(9Z)/19:0cycv8c)PW001132 Pw001132Pw001132 greyscalePw001132 simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/17:0cycw7c/15:0cyclo)PW001133 Pw001133Pw001133 greyscalePw001133 simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/17:0cycw7c/16:1(9Z))PW001134 Pw001134Pw001134 greyscalePw001134 simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/17:0cycw7c/17:0cycw7c)PW001135 Pw001135Pw001135 greyscalePw001135 simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/18:1(9Z)/15:0cyclo)PW001136 Pw001136Pw001136 greyscalePw001136 simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/18:1(9Z)/16:1(9Z))PW001137 Pw001137Pw001137 greyscalePw001137 simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/18:1(9Z)/18:1(9Z))PW001138 Pw001138Pw001138 greyscalePw001138 simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/19:0cycv8c/15:0cyclo)PW001139 Pw001139Pw001139 greyscalePw001139 simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/19:0cycv8c/16:1(9Z))PW001140 Pw001140Pw001140 greyscalePw001140 simple
phospholipid biosynthesis CL(15:0cyclo/16:1(9Z)/19:0cycv8c/19:0cycv8c)PW001141 Pw001141Pw001141 greyscalePw001141 simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/14:0/14:0)PW001142 Pw001142Pw001142 greyscalePw001142 simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/14:0/17:0cycw7c)PW001143 Pw001143Pw001143 greyscalePw001143 simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/15:0cyclo/17:0cycw7c)PW001144 Pw001144Pw001144 greyscalePw001144 simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/16:0/16:0)PW001145 Pw001145Pw001145 greyscalePw001145 simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/16:0/17:0cycw7c)PW001146 Pw001146Pw001146 greyscalePw001146 simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/16:1(9Z)/16:1(9Z))PW001147 Pw001147Pw001147 greyscalePw001147 simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/16:1(9Z)/17:0cycw7c)PW001148 Pw001148Pw001148 greyscalePw001148 simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/17:0cycw7c)/16:0)PW001151 Pw001151Pw001151 greyscalePw001151 simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/17:0cycw7c/14:0)PW001149 Pw001149Pw001149 greyscalePw001149 simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/17:0cycw7c/15:0cyclo)PW001150 Pw001150Pw001150 greyscalePw001150 simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/17:0cycw7c/16:1(9Z))PW001152 Pw001152Pw001152 greyscalePw001152 simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/17:0cycw7c/17:0cycw7c)PW001153 Pw001153Pw001153 greyscalePw001153 simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/17:0cycw7c/18:1(9Z))PW001154 Pw001154Pw001154 greyscalePw001154 simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/17:0cycw7c/19:0cycv8c)PW001155 Pw001155Pw001155 greyscalePw001155 simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/18:1(9Z)/17:0cycw7c)PW001156 Pw001156Pw001156 greyscalePw001156 simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/18:1(9Z)/18:1(9Z))PW001157 Pw001157Pw001157 greyscalePw001157 simple
phospholipid biosynthesis CL(15:0cyclo/17:0cycw7c/19:0cycv8c/17:0cycw7c)PW001158 Pw001158Pw001158 greyscalePw001158 simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/14:0/15:0cyclo)PW001159 Pw001159Pw001159 greyscalePw001159 simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/14:0/18:1(9Z))PW001160 Pw001160Pw001160 greyscalePw001160 simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/15:0cyclo/14:0)PW001161 Pw001161Pw001161 greyscalePw001161 simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/15:0cyclo/17:0cycw7c)PW001162 Pw001162Pw001162 greyscalePw001162 simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/15:0cyclo/18:1(9Z))PW001163 Pw001163Pw001163 greyscalePw001163 simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/15:0cyclo/19:0cycv8c)PW001164 Pw001164Pw001164 greyscalePw001164 simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/16:0/16:0)PW001165 Pw001165Pw001165 greyscalePw001165 simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/16:0/18:1(9Z))PW001166 Pw001166Pw001166 greyscalePw001166 simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/16:1(9Z)/16:1(9Z))PW001167 Pw001167Pw001167 greyscalePw001167 simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/16:1(9Z)/18:1(9Z))PW001168 Pw001168Pw001168 greyscalePw001168 simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/17:0cycw7c/15:0cyclo)PW001169 Pw001169Pw001169 greyscalePw001169 simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/17:0cycw7c/17:0cycw7c)PW001170 Pw001170Pw001170 greyscalePw001170 simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/17:0cycw7c/18:1(9Z))PW001171 Pw001171Pw001171 greyscalePw001171 simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/18:1(9Z)/14:0)PW001172 Pw001172Pw001172 greyscalePw001172 simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/18:1(9Z)/15:0cyclo)PW001173 Pw001173Pw001173 greyscalePw001173 simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/18:1(9Z)/16:0)PW001174 Pw001174Pw001174 greyscalePw001174 simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/18:1(9Z)/16:1(9Z))PW001175 Pw001175Pw001175 greyscalePw001175 simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/18:1(9Z)/17:0cycw7c)PW001176 Pw001176Pw001176 greyscalePw001176 simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/18:1(9Z)/18:1(9Z))PW001177 Pw001177Pw001177 greyscalePw001177 simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/18:1(9Z)/19:0cycv8c)PW001178 Pw001178Pw001178 greyscalePw001178 simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/19:0cycv8c/15:0cyclo)PW001179 Pw001179Pw001179 greyscalePw001179 simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/19:0cycv8c/18:1(9Z))PW001180 Pw001180Pw001180 greyscalePw001180 simple
phospholipid biosynthesis CL(15:0cyclo/18:1(9Z)/19:0cycv8c/19:0cycv8c)PW001181 Pw001181Pw001181 greyscalePw001181 simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/14:0/15:0cyclo)PW001182 Pw001182Pw001182 greyscalePw001182 simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/14:0/19:0cycv8c)PW001183 Pw001183Pw001183 greyscalePw001183 simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/15:0cyclo/14:0)PW001184 Pw001184Pw001184 greyscalePw001184 simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/15:0cyclo/17:0cycw7c)PW001187 Pw001187Pw001187 greyscalePw001187 simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/15:0cyclo/19:0cycv8c)PW001188 Pw001188Pw001188 greyscalePw001188 simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/16:0/16:0)PW001189 Pw001189Pw001189 greyscalePw001189 simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/16:0/19:0cycv8c)PW001190 Pw001190Pw001190 greyscalePw001190 simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/16:1(9Z)/16:1(9Z))PW001191 Pw001191Pw001191 greyscalePw001191 simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/16:1(9Z)/19:0cycv8c)PW001192 Pw001192Pw001192 greyscalePw001192 simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/17:0cycw7c/15:0cyclo)PW001193 Pw001193Pw001193 greyscalePw001193 simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/17:0cycw7c/17:0cycw7c)PW001195 Pw001195Pw001195 greyscalePw001195 simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/18:1(9Z)/18:1(9Z))PW001196 Pw001196Pw001196 greyscalePw001196 simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/18:1(9Z)/19:0cycv8c)PW001197 Pw001197Pw001197 greyscalePw001197 simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/19:0cycv8c/14:0)PW001198 Pw001198Pw001198 greyscalePw001198 simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/19:0cycv8c/15:0cyclo)PW001199 Pw001199Pw001199 greyscalePw001199 simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/19:0cycv8c/16:0)PW001200 Pw001200Pw001200 greyscalePw001200 simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/19:0cycv8c/16:1(9Z))PW001201 Pw001201Pw001201 greyscalePw001201 simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/19:0cycv8c/18:1(9Z))PW001202 Pw001202Pw001202 greyscalePw001202 simple
phospholipid biosynthesis CL(15:0cyclo/19:0cycv8c/19:0cycv8c/19:0cycv8c)PW001203 Pw001203Pw001203 greyscalePw001203 simple
phospholipid biosynthesis CL(16:0/14:0/14:0/14:0)PW001204 Pw001204Pw001204 greyscalePw001204 simple
phospholipid biosynthesis CL(16:0/14:0/14:0/16:0)PW001205 Pw001205Pw001205 greyscalePw001205 simple
phospholipid biosynthesis CL(16:0/14:0/14:0/16:1(9Z))PW001206 Pw001206Pw001206 greyscalePw001206 simple
phospholipid biosynthesis CL(16:0/14:0/14:0/18:1(9Z))PW001207 Pw001207Pw001207 greyscalePw001207 simple
phospholipid biosynthesis CL(16:0/14:0/14:0/19:0cycv8c)PW001208 Pw001208Pw001208 greyscalePw001208 simple
phospholipid biosynthesis CL(16:0/14:0/16:0/14:0)PW001209 Pw001209Pw001209 greyscalePw001209 simple
phospholipid biosynthesis CL(16:0/14:0/16:1(9Z)/14:0)PW001213 Pw001213Pw001213 greyscalePw001213 simple
phospholipid biosynthesis CL(16:0/14:0/16:1(9Z)/16:1(9Z))PW001214 Pw001214Pw001214 greyscalePw001214 simple
phospholipid biosynthesis CL(16:0/14:0/17:0cycw7c/17:0cycw7c)PW001215 Pw001215Pw001215 greyscalePw001215 simple
phospholipid biosynthesis CL(16:0/14:0/18:1(9Z)/14:0)PW001216 Pw001216Pw001216 greyscalePw001216 simple
phospholipid biosynthesis CL(16:0/14:0/18:1(9Z)/18:1(9Z))PW001217 Pw001217Pw001217 greyscalePw001217 simple
phospholipid biosynthesis CL(16:0/14:0/19:0cycv8c/14:0)PW001218 Pw001218Pw001218 greyscalePw001218 simple
phospholipid biosynthesis CL(16:0/14:0/19:0cycv8c/19:0cycv8c)PW001219 Pw001219Pw001219 greyscalePw001219 simple
phospholipid biosynthesis CL(16:0/15:0cyclo/14:0/15:0cyclo)PW001220 Pw001220Pw001220 greyscalePw001220 simple
phospholipid biosynthesis CL(16:0/15:0cyclo/15:0cyclo/14:0)PW001221 Pw001221Pw001221 greyscalePw001221 simple
phospholipid biosynthesis CL(16:0/15:0cyclo/15:0cyclo/16:1(9Z))PW001222 Pw001222Pw001222 greyscalePw001222 simple
phospholipid biosynthesis CL(16:0/15:0cyclo/15:0cyclo/17:0cycw7c)PW001223 Pw001223Pw001223 greyscalePw001223 simple
phospholipid biosynthesis CL(16:0/15:0cyclo/15:0cyclo/18:1(9Z))PW001224 Pw001224Pw001224 greyscalePw001224 simple
phospholipid biosynthesis CL(16:0/15:0cyclo/15:0cyclo/19:0cycv8c)PW001225 Pw001225Pw001225 greyscalePw001225 simple
phospholipid biosynthesis CL(16:0/15:0cyclo/16:0/16:0)PW001226 Pw001226Pw001226 greyscalePw001226 simple
phospholipid biosynthesis CL(16:0/15:0cyclo/16:0/16:1(9Z))PW001227 Pw001227Pw001227 greyscalePw001227 simple
phospholipid biosynthesis CL(16:0/15:0cyclo/16:0/17:0cycw7c)PW001228 Pw001228Pw001228 greyscalePw001228 simple
phospholipid biosynthesis CL(16:0/15:0cyclo/16:0/18:1(9Z))PW001229 Pw001229Pw001229 greyscalePw001229 simple
phospholipid biosynthesis CL(16:0/15:0cyclo/16:0/19:0cycv8c)PW001230 Pw001230Pw001230 greyscalePw001230 simple
phospholipid biosynthesis CL(16:0/15:0cyclo/16:1(9Z)/15:0cyclo)PW001231 Pw001231Pw001231 greyscalePw001231 simple
phospholipid biosynthesis CL(16:0/15:0cyclo/16:1(9Z)/16:0)PW001232 Pw001232Pw001232 greyscalePw001232 simple
phospholipid biosynthesis CL(16:0/15:0cyclo/16:1(9Z)/16:1(9Z))PW001235 Pw001235Pw001235 greyscalePw001235 simple
phospholipid biosynthesis CL(16:0/15:0cyclo/17:0cycw7c/15:0cyclo)PW001236 Pw001236Pw001236 greyscalePw001236 simple
phospholipid biosynthesis CL(16:0/15:0cyclo/17:0cycw7c/16:0)PW001237 Pw001237Pw001237 greyscalePw001237 simple
phospholipid biosynthesis CL(16:0/15:0cyclo/17:0cycw7c/17:0cycw7c)PW001238 Pw001238Pw001238 greyscalePw001238 simple
phospholipid biosynthesis CL(16:0/15:0cyclo/18:1(9Z)/15:0cyclo)PW001239 Pw001239Pw001239 greyscalePw001239 simple
phospholipid biosynthesis CL(16:0/15:0cyclo/18:1(9Z)/16:0)PW001242 Pw001242Pw001242 greyscalePw001242 simple
phospholipid biosynthesis CL(16:0/15:0cyclo/18:1(9Z)/18:1(9Z))PW001243 Pw001243Pw001243 greyscalePw001243 simple
phospholipid biosynthesis CL(16:0/15:0cyclo/19:0cycv8c/15:0cyclo)PW001245 Pw001245Pw001245 greyscalePw001245 simple
phospholipid biosynthesis CL(16:0/15:0cyclo/19:0cycv8c/16:0)PW001246 Pw001246Pw001246 greyscalePw001246 simple
phospholipid biosynthesis CL(16:0/15:0cyclo/19:0cycv8c/19:0cycv8c)PW001247 Pw001247Pw001247 greyscalePw001247 simple
phospholipid biosynthesis CL(16:0/16:0/14:0/14:0)PW001250 Pw001250Pw001250 greyscalePw001250 simple
phospholipid biosynthesis CL(16:0/16:0/14:0/16:1(9Z))PW001252 Pw001252Pw001252 greyscalePw001252 simple
phospholipid biosynthesis CL(16:0/16:0/14:0/17:0cycw7c)PW001254 Pw001254Pw001254 greyscalePw001254 simple
phospholipid biosynthesis CL(16:0/16:0/14:0/18:1(9Z))PW001255 Pw001255Pw001255 greyscalePw001255 simple
phospholipid biosynthesis CL(16:0/16:0/14:0/19:0cycv8c)PW001256 Pw001256Pw001256 greyscalePw001256 simple
phospholipid biosynthesis CL(16:0/16:0/16:0/17:0cycw7c)PW001257 Pw001257Pw001257 greyscalePw001257 simple
phospholipid biosynthesis CL(16:0/16:0/16:0/18:1(9Z))PW001258 Pw001258Pw001258 greyscalePw001258 simple
phospholipid biosynthesis CL(16:0/16:0/16:0/19:0cycv8c)PW001259 Pw001259Pw001259 greyscalePw001259 simple
phospholipid biosynthesis CL(16:0/16:0/16:1(9Z)/14:0)PW001260 Pw001260Pw001260 greyscalePw001260 simple
phospholipid biosynthesis CL(16:0/16:0/16:1(9Z)/15:0cyclo)PW001261 Pw001261Pw001261 greyscalePw001261 simple
phospholipid biosynthesis CL(16:0/16:0/16:1(9Z)/16:0)PW001264 Pw001264Pw001264 greyscalePw001264 simple
phospholipid biosynthesis CL(16:0/16:0/16:1(9Z)/16:1(9Z))PW001265 Pw001265Pw001265 greyscalePw001265 simple
phospholipid biosynthesis CL(16:0/16:0/16:1(9Z)/17:0cycw7c)PW001267 Pw001267Pw001267 greyscalePw001267 simple
phospholipid biosynthesis CL(16:0/16:0/16:1(9Z)/18:1(9Z))PW001268 Pw001268Pw001268 greyscalePw001268 simple
phospholipid biosynthesis CL(16:0/16:0/16:1(9Z)/19:0cycv8c)PW001269 Pw001269Pw001269 greyscalePw001269 simple
phospholipid biosynthesis CL(16:0/16:0/17:0cycw7c/14:0)PW001270 Pw001270Pw001270 greyscalePw001270 simple
phospholipid biosynthesis CL(16:0/16:0/17:0cycw7c/15:0cyclo)PW001271 Pw001271Pw001271 greyscalePw001271 simple
phospholipid biosynthesis CL(16:0/16:0/17:0cycw7c/16:0)PW001272 Pw001272Pw001272 greyscalePw001272 simple
phospholipid biosynthesis CL(16:0/16:0/17:0cycw7c/16:1(9Z))PW001273 Pw001273Pw001273 greyscalePw001273 simple
phospholipid biosynthesis CL(16:0/16:0/17:0cycw7c/17:0cycw7c)PW001274 Pw001274Pw001274 greyscalePw001274 simple
phospholipid biosynthesis CL(16:0/16:0/17:0cycw7c/18:1(9Z))PW001277 Pw001277Pw001277 greyscalePw001277 simple
phospholipid biosynthesis CL(16:0/16:0/17:0cycw7c/19:0cycv8c)PW001278 Pw001278Pw001278 greyscalePw001278 simple
phospholipid biosynthesis CL(16:0/16:0/18:1(9Z)/14:0)PW001266 Pw001266Pw001266 greyscalePw001266 simple
phospholipid biosynthesis CL(16:0/16:0/18:1(9Z)/15:0cyclo)PW001279 Pw001279Pw001279 greyscalePw001279 simple
phospholipid biosynthesis CL(16:0/16:0/18:1(9Z)/16:0)PW001280 Pw001280Pw001280 greyscalePw001280 simple
phospholipid biosynthesis CL(16:0/16:0/18:1(9Z)/16:1(9Z))PW001281 Pw001281Pw001281 greyscalePw001281 simple
phospholipid biosynthesis CL(16:0/16:0/18:1(9Z)/17:0cycw7c)PW001282 Pw001282Pw001282 greyscalePw001282 simple
phospholipid biosynthesis CL(16:0/16:0/18:1(9Z)/18:1(9Z))PW001283 Pw001283Pw001283 greyscalePw001283 simple
phospholipid biosynthesis CL(16:0/16:0/18:1(9Z)/19:0cycv8c)PW001284 Pw001284Pw001284 greyscalePw001284 simple
phospholipid biosynthesis CL(16:0/16:0/19:0cycv8c/14:0)PW001285 Pw001285Pw001285 greyscalePw001285 simple
phospholipid biosynthesis CL(16:0/16:0/19:0cycv8c/15:0cyclo)PW001286 Pw001286Pw001286 greyscalePw001286 simple
phospholipid biosynthesis CL(16:0/16:0/19:0cycv8c/16:0)PW001287 Pw001287Pw001287 greyscalePw001287 simple
phospholipid biosynthesis CL(16:0/16:0/19:0cycv8c/16:1(9Z))PW001288 Pw001288Pw001288 greyscalePw001288 simple
phospholipid biosynthesis CL(16:0/16:0/19:0cycv8c/17:0cycw7c)PW001289 Pw001289Pw001289 greyscalePw001289 simple
phospholipid biosynthesis CL(16:0/16:0/19:0cycv8c/18:1(9Z))PW001290 Pw001290Pw001290 greyscalePw001290 simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/14:0/14:0)PW001293 Pw001293Pw001293 greyscalePw001293 simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/14:0/16:0)PW001294 Pw001294Pw001294 greyscalePw001294 simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/14:0/16:1(9Z))PW001295 Pw001295Pw001295 greyscalePw001295 simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:0/14:0)PW001296 Pw001296Pw001296 greyscalePw001296 simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:0/16:1(9Z))PW001297 Pw001297Pw001297 greyscalePw001297 simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:0/17:0cycw7c)PW001303 Pw001303Pw001303 greyscalePw001303 simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:0/18:1(9Z))PW001305 Pw001305Pw001305 greyscalePw001305 simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:0/19:0cycv8c)PW001306 Pw001306Pw001306 greyscalePw001306 simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:1(9Z)/14:0)PW001307 Pw001307Pw001307 greyscalePw001307 simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:1(9Z)/16:0)PW001308 Pw001308Pw001308 greyscalePw001308 simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:1(9Z)/16:1(9Z))PW001311 Pw001311Pw001311 greyscalePw001311 simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:1(9Z)/17:0cycw7c)PW001312 Pw001312Pw001312 greyscalePw001312 simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/16:1(9Z)/18:1(9Z))PW001313 Pw001313Pw001313 greyscalePw001313 simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/17:0cycw7c/16:0)PW001315 Pw001315Pw001315 greyscalePw001315 simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/17:0cycw7c/16:1(9Z))PW001325 Pw001325Pw001325 greyscalePw001325 simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/17:0cycw7c/17:0cycw7c)PW001327 Pw001327Pw001327 greyscalePw001327 simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/18:1(9Z)/16:0)PW001328 Pw001328Pw001328 greyscalePw001328 simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/18:1(9Z)/16:1(9Z))PW001329 Pw001329Pw001329 greyscalePw001329 simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/18:1(9Z)/18:1(9Z))PW001330 Pw001330Pw001330 greyscalePw001330 simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/19:0cycv8c/16:0)PW001335 Pw001335Pw001335 greyscalePw001335 simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/19:0cycv8c/16:1(9Z))PW001336 Pw001336Pw001336 greyscalePw001336 simple
phospholipid biosynthesis CL(16:0/16:1(9Z)/19:0cycv8c/19:0cycv8c)PW001337 Pw001337Pw001337 greyscalePw001337 simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/14:0/16:0)PW001338 Pw001338Pw001338 greyscalePw001338 simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/14:0/17:0cycw7c)PW001339 Pw001339Pw001339 greyscalePw001339 simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/16:0/14:0)PW001342 Pw001342Pw001342 greyscalePw001342 simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/16:0/17:0cycw7c)PW001343 Pw001343Pw001343 greyscalePw001343 simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/16:1(9Z)/16:1(9Z))PW001344 Pw001344Pw001344 greyscalePw001344 simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/16:1(9Z)/17:0cycw7c)PW001345 Pw001345Pw001345 greyscalePw001345 simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/17:0cycw7c/14:0)PW001346 Pw001346Pw001346 greyscalePw001346 simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/17:0cycw7c/16:1(9Z))PW001347 Pw001347Pw001347 greyscalePw001347 simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/17:0cycw7c/17:0cycw7c)PW001351 Pw001351Pw001351 greyscalePw001351 simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/17:0cycw7c/18:1(9Z))PW001348 Pw001348Pw001348 greyscalePw001348 simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/17:0cycw7c/19:0cycv8c)PW001349 Pw001349Pw001349 greyscalePw001349 simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/18:1(9Z)/17:0cycw7c)PW001350 Pw001350Pw001350 greyscalePw001350 simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/18:1(9Z)/18:1(9Z))PW001352 Pw001352Pw001352 greyscalePw001352 simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/19:0cycv8c/17:0cycw7c)PW001353 Pw001353Pw001353 greyscalePw001353 simple
phospholipid biosynthesis CL(16:0/17:0cycw7c/19:0cycv8c/19:0cycv8c)PW001354 Pw001354Pw001354 greyscalePw001354 simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/14:0/14:0)PW001355 Pw001355Pw001355 greyscalePw001355 simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/14:0/16:0)PW001356 Pw001356Pw001356 greyscalePw001356 simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/14:0/18:1(9Z))PW001357 Pw001357Pw001357 greyscalePw001357 simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/16:0/14:0)PW001358 Pw001358Pw001358 greyscalePw001358 simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/16:0/17:0cycw7c)PW001359 Pw001359Pw001359 greyscalePw001359 simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/16:0/18:1(9Z))PW001360 Pw001360Pw001360 greyscalePw001360 simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/16:0/19:0cycv8c)PW001361 Pw001361Pw001361 greyscalePw001361 simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/16:1(9Z)/16:1(9Z))PW001362 Pw001362Pw001362 greyscalePw001362 simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/16:1(9Z)/18:1(9Z))PW001363 Pw001363Pw001363 greyscalePw001363 simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/17:0cycw7c/16:0)PW001364 Pw001364Pw001364 greyscalePw001364 simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/17:0cycw7c/17:0cycw7c)PW001365 Pw001365Pw001365 greyscalePw001365 simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/17:0cycw7c/18:1(9Z))PW001366 Pw001366Pw001366 greyscalePw001366 simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/18:1(9Z)/14:0)PW001367 Pw001367Pw001367 greyscalePw001367 simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/18:1(9Z)/16:0)PW001368 Pw001368Pw001368 greyscalePw001368 simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/18:1(9Z)/16:1(9Z))PW001369 Pw001369Pw001369 greyscalePw001369 simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/18:1(9Z)/17:0cycw7c)PW001370 Pw001370Pw001370 greyscalePw001370 simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/18:1(9Z)/18:1(9Z))PW001371 Pw001371Pw001371 greyscalePw001371 simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/18:1(9Z)/19:0cycv8c)PW001378 Pw001378Pw001378 greyscalePw001378 simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/19:0cycv8c/16:0)PW001379 Pw001379Pw001379 greyscalePw001379 simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/19:0cycv8c/18:1(9Z))PW001380 Pw001380Pw001380 greyscalePw001380 simple
phospholipid biosynthesis CL(16:0/18:1(9Z)/19:0cycv8c/19:0cycv8c)PW001381 Pw001381Pw001381 greyscalePw001381 simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/14:0/14:0)PW001382 Pw001382Pw001382 greyscalePw001382 simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/14:0/16:0)PW001389 Pw001389Pw001389 greyscalePw001389 simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/14:0/19:0cycv8c)PW001390 Pw001390Pw001390 greyscalePw001390 simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/16:0/14:0)PW001391 Pw001391Pw001391 greyscalePw001391 simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/16:0/17:0cycw7c)PW001392 Pw001392Pw001392 greyscalePw001392 simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/16:1(9Z)/16:1(9Z))PW001393 Pw001393Pw001393 greyscalePw001393 simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/16:1(9Z)/19:0cycv8c)PW001398 Pw001398Pw001398 greyscalePw001398 simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/17:0cycw7c/16:0)PW001399 Pw001399Pw001399 greyscalePw001399 simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/17:0cycw7c/17:0cycw7c)PW001400 Pw001400Pw001400 greyscalePw001400 simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/17:0cycw7c/19:0cycv8c)PW001401 Pw001401Pw001401 greyscalePw001401 simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/18:1(9Z)/18:1(9Z))PW001402 Pw001402Pw001402 greyscalePw001402 simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/18:1(9Z)/19:0cycv8c)PW001409 Pw001409Pw001409 greyscalePw001409 simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/19:0cycv8c/14:0)PW001410 Pw001410Pw001410 greyscalePw001410 simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/19:0cycv8c/16:1(9Z))PW001411 Pw001411Pw001411 greyscalePw001411 simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/19:0cycv8c/17:0cycw7c)PW001412 Pw001412Pw001412 greyscalePw001412 simple
phospholipid biosynthesis CL(16:0/19:0cycv8c/19:0cycv8c/18:1(9Z))PW001413 Pw001413Pw001413 greyscalePw001413 simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/14:0/16:1(9Z))PW001416 Pw001416Pw001416 greyscalePw001416 simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/14:0/18:1(9Z))PW001417 Pw001417Pw001417 greyscalePw001417 simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/14:0/19:0cycv8c)PW001418 Pw001418Pw001418 greyscalePw001418 simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/16:1(9Z)/14:0)PW001419 Pw001419Pw001419 greyscalePw001419 simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/17:0cycw7c/17:0cycw7c)PW001421 Pw001421Pw001421 greyscalePw001421 simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/18:1(9Z)/14:0)PW001425 Pw001425Pw001425 greyscalePw001425 simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/18:1(9Z)/18:1(9Z))PW001427 Pw001427Pw001427 greyscalePw001427 simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/19:0cycv8c/14:0)PW001429 Pw001429Pw001429 greyscalePw001429 simple
phospholipid biosynthesis CL(16:1(9Z)/14:0/19:0cycv8c/19:0cycv8c)PW001430 Pw001430Pw001430 greyscalePw001430 simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/14:0/15:0cyclo)PW001431 Pw001431Pw001431 greyscalePw001431 simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/14:0/16:1(9Z))PW001437 Pw001437Pw001437 greyscalePw001437 simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/15:0cyclo/14:0) )PW001724 Pw001724Pw001724 greyscalePw001724 simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/15:0cyclo/17:0cycw7c)PW001440 Pw001440Pw001440 greyscalePw001440 simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/15:0cyclo/18:1(9Z))PW001441 Pw001441Pw001441 greyscalePw001441 simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/15:0cyclo/19:0cycv8c)PW001442 Pw001442Pw001442 greyscalePw001442 simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/16:0/16:1(9Z))PW001449 Pw001449Pw001449 greyscalePw001449 simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/16:1(9Z)/14:0)PW001450 Pw001450Pw001450 greyscalePw001450 simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/16:1(9Z)/15:0cyclo)PW001451 Pw001451Pw001451 greyscalePw001451 simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/16:1(9Z)/16:0)PW001452 Pw001452Pw001452 greyscalePw001452 simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/16:1(9Z)/16:1(9Z))PW001453 Pw001453Pw001453 greyscalePw001453 simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/16:1(9Z)/18:1(9Z))PW001455 Pw001455Pw001455 greyscalePw001455 simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/16:1(9Z)/19:0cycv8c)PW001456 Pw001456Pw001456 greyscalePw001456 simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/17:0cycw7c/15:0cyclo)PW001457 Pw001457Pw001457 greyscalePw001457 simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/17:0cycw7c/16:1(9Z))PW001458 Pw001458Pw001458 greyscalePw001458 simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/17:0cycw7c/17:0cycw7c)PW001459 Pw001459Pw001459 greyscalePw001459 simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/18:1(9Z)/15:0cyclo)PW001460 Pw001460Pw001460 greyscalePw001460 simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/18:1(9Z)/16:1(9Z))PW001461 Pw001461Pw001461 greyscalePw001461 simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/18:1(9Z)/18:1(9Z))PW001462 Pw001462Pw001462 greyscalePw001462 simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/19:0cycv8c/15:0cyclo)PW001463 Pw001463Pw001463 greyscalePw001463 simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/19:0cycv8c/16:1(9Z))PW001468 Pw001468Pw001468 greyscalePw001468 simple
phospholipid biosynthesis CL(16:1(9Z)/15:0cyclo/19:0cycv8c/19:0cycv8c)PW001469 Pw001469Pw001469 greyscalePw001469 simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/14:0/14:0)PW001470 Pw001470Pw001470 greyscalePw001470 simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/14:0/16:0)PW001471 Pw001471Pw001471 greyscalePw001471 simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/14:0/16:1(9Z))PW001472 Pw001472Pw001472 greyscalePw001472 simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:0/14:0)PW001477 Pw001477Pw001477 greyscalePw001477 simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:0/17:0cycw7c)PW001478 Pw001478Pw001478 greyscalePw001478 simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:0/18:1(9Z))PW001479 Pw001479Pw001479 greyscalePw001479 simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:0/19:0cycv8c)PW001480 Pw001480Pw001480 greyscalePw001480 simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:1(9Z)/14:0)PW001481 Pw001481Pw001481 greyscalePw001481 simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:1(9Z)/16:0)PW001486 Pw001486Pw001486 greyscalePw001486 simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:1(9Z)/16:1(9Z))PW001487 Pw001487Pw001487 greyscalePw001487 simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:1(9Z)/17:0cycw7c)PW001488 Pw001488Pw001488 greyscalePw001488 simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:1(9Z)/18:1(9Z))PW001489 Pw001489Pw001489 greyscalePw001489 simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/16:1(9Z)/19:0cycv8c)PW001490 Pw001490Pw001490 greyscalePw001490 simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/17:0cycw7c/16:0)PW001491 Pw001491Pw001491 greyscalePw001491 simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/17:0cycw7c/16:1(9Z))PW001496 Pw001496Pw001496 greyscalePw001496 simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/17:0cycw7c/17:0cycw7c)PW001497 Pw001497Pw001497 greyscalePw001497 simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/18:1(9Z)/16:0)PW001501 Pw001501Pw001501 greyscalePw001501 simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/18:1(9Z)/16:1(9Z))PW001503 Pw001503Pw001503 greyscalePw001503 simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/18:1(9Z)/18:1(9Z))PW001504 Pw001504Pw001504 greyscalePw001504 simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/19:0cycv8c/16:0)PW001505 Pw001505Pw001505 greyscalePw001505 simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/19:0cycv8c/16:1(9Z))PW001508 Pw001508Pw001508 greyscalePw001508 simple
phospholipid biosynthesis CL(16:1(9Z)/16:0/19:0cycv8c/19:0cycv8c)PW001509 Pw001509Pw001509 greyscalePw001509 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/14:0/14:0)PW001510 Pw001510Pw001510 greyscalePw001510 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/14:0/15:0cyclo)PW001511 Pw001511Pw001511 greyscalePw001511 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/14:0/16:0)PW001512 Pw001512Pw001512 greyscalePw001512 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/14:0/16:1(9Z))PW001513 Pw001513Pw001513 greyscalePw001513 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/14:0/17:0cycw7c)PW001520 Pw001520Pw001520 greyscalePw001520 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/14:0/18:1(9Z))PW001521 Pw001521Pw001521 greyscalePw001521 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/14:0/19:0cycv8c)PW001522 Pw001522Pw001522 greyscalePw001522 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/16:1(9Z)/14:0)PW001523 Pw001523Pw001523 greyscalePw001523 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/16:1(9Z)/17:0cycw7c)PW001524 Pw001524Pw001524 greyscalePw001524 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/16:1(9Z)/18:1(9Z))PW001525 Pw001525Pw001525 greyscalePw001525 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/16:1(9Z)/19:0cycv8c)PW001526 Pw001526Pw001526 greyscalePw001526 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/17:0cycw7c/14:0)PW001535 Pw001535Pw001535 greyscalePw001535 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/17:0cycw7c/15:0cyclo)PW001536 Pw001536Pw001536 greyscalePw001536 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/17:0cycw7c/16:0)PW001537 Pw001537Pw001537 greyscalePw001537 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/17:0cycw7c/16:1(9Z))PW001538 Pw001538Pw001538 greyscalePw001538 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/17:0cycw7c/17:0cycw7c)PW001539 Pw001539Pw001539 greyscalePw001539 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/17:0cycw7c/18:1(9Z))PW001542 Pw001542Pw001542 greyscalePw001542 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/17:0cycw7c/19:0cycv8c)PW001543 Pw001543Pw001543 greyscalePw001543 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/18:1(9Z)/14:0)PW001544 Pw001544Pw001544 greyscalePw001544 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/18:1(9Z)/15:0cyclo)PW001545 Pw001545Pw001545 greyscalePw001545 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/18:1(9Z)/16:0)PW001546 Pw001546Pw001546 greyscalePw001546 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/18:1(9Z)/16:1(9Z))PW001547 Pw001547Pw001547 greyscalePw001547 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/18:1(9Z)/17:0cycw7c)PW001548 Pw001548Pw001548 greyscalePw001548 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/18:1(9Z)/18:1(9Z))PW001549 Pw001549Pw001549 greyscalePw001549 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/18:1(9Z)/19:0cycv8c)PW001550 Pw001550Pw001550 greyscalePw001550 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/19:0cycv8c/14:0)PW001551 Pw001551Pw001551 greyscalePw001551 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/19:0cycv8c/15:0cyclo)PW001552 Pw001552Pw001552 greyscalePw001552 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/19:0cycv8c/16:0)PW001553 Pw001553Pw001553 greyscalePw001553 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/19:0cycv8c/16:1(9Z))PW001554 Pw001554Pw001554 greyscalePw001554 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/19:0cycv8c/17:0cycw7c)PW001555 Pw001555Pw001555 greyscalePw001555 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/19:0cycv8c/18:1(9Z))PW001556 Pw001556Pw001556 greyscalePw001556 simple
phospholipid biosynthesis CL(16:1(9Z)/16:1(9Z)/19:0cycv8c/19:0cycv8c)PW001557 Pw001557Pw001557 greyscalePw001557 simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/14:0/16:1(9Z))PW001558 Pw001558Pw001558 greyscalePw001558 simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/14:0/17:0cycw7c)PW001559 Pw001559Pw001559 greyscalePw001559 simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/16:1(9Z)/14:0)PW001560 Pw001560Pw001560 greyscalePw001560 simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/16:1(9Z)/17:0cycw7c)PW001561 Pw001561Pw001561 greyscalePw001561 simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/17:0cycw7c/14:0)PW001562 Pw001562Pw001562 greyscalePw001562 simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/17:0cycw7c/16:1(9Z))PW001563 Pw001563Pw001563 greyscalePw001563 simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/17:0cycw7c/17:0cycw7c)PW001564 Pw001564Pw001564 greyscalePw001564 simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/17:0cycw7c/18:1(9Z))PW001565 Pw001565Pw001565 greyscalePw001565 simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/17:0cycw7c/19:0cycv8c)PW001566 Pw001566Pw001566 greyscalePw001566 simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/18:1(9Z)/17:0cycw7c)PW001567 Pw001567Pw001567 greyscalePw001567 simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/18:1(9Z)/18:1(9Z))PW001568 Pw001568Pw001568 greyscalePw001568 simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/19:0cycv8c/17:0cycw7c)PW001569 Pw001569Pw001569 greyscalePw001569 simple
phospholipid biosynthesis CL(16:1(9Z)/17:0cycw7c/19:0cycv8c/19:0cycv8c)PW001570 Pw001570Pw001570 greyscalePw001570 simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/14:0/14:0)PW001571 Pw001571Pw001571 greyscalePw001571 simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/14:0/16:1(9Z))PW001572 Pw001572Pw001572 greyscalePw001572 simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/14:0/18:1(9Z))PW001573 Pw001573Pw001573 greyscalePw001573 simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/16:1(9Z)/14:0)PW001574 Pw001574Pw001574 greyscalePw001574 simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/16:1(9Z)/17:0cycw7c)PW001575 Pw001575Pw001575 greyscalePw001575 simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/16:1(9Z)/18:1(9Z))PW001576 Pw001576Pw001576 greyscalePw001576 simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/16:1(9Z)/19:0cycv8c)PW001589 Pw001589Pw001589 greyscalePw001589 simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/17:0cycw7c/16:1(9Z))PW001590 Pw001590Pw001590 greyscalePw001590 simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/17:0cycw7c/17:0cycw7c)PW001591 Pw001591Pw001591 greyscalePw001591 simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/17:0cycw7c/18:1(9Z))PW001592 Pw001592Pw001592 greyscalePw001592 simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/18:1(9Z)/14:0)PW001593 Pw001593Pw001593 greyscalePw001593 simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/18:1(9Z)/16:1(9Z))PW001602 Pw001602Pw001602 greyscalePw001602 simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/18:1(9Z)/17:0cycw7c)PW001603 Pw001603Pw001603 greyscalePw001603 simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/18:1(9Z)/18:1(9Z))PW001604 Pw001604Pw001604 greyscalePw001604 simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/18:1(9Z)/19:0cycv8c)PW001605 Pw001605Pw001605 greyscalePw001605 simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/19:0cycv8c/16:1(9Z))PW001606 Pw001606Pw001606 greyscalePw001606 simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/19:0cycv8c/18:1(9Z))PW001611 Pw001611Pw001611 greyscalePw001611 simple
phospholipid biosynthesis CL(16:1(9Z)/18:1(9Z)/19:0cycv8c/19:0cycv8c)PW001614 Pw001614Pw001614 greyscalePw001614 simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/14:0/14:0)PW001615 Pw001615Pw001615 greyscalePw001615 simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/14:0/16:1(9Z))PW001616 Pw001616Pw001616 greyscalePw001616 simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/14:0/19:0cycv8c)PW001617 Pw001617Pw001617 greyscalePw001617 simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/16:1(9Z)/14:0)PW001624 Pw001624Pw001624 greyscalePw001624 simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/16:1(9Z)/17:0cycw7c)PW001625 Pw001625Pw001625 greyscalePw001625 simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/16:1(9Z)/19:0cycv8c)PW001626 Pw001626Pw001626 greyscalePw001626 simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/17:0cycw7c/16:1(9Z))PW001627 Pw001627Pw001627 greyscalePw001627 simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/17:0cycw7c/17:0cycw7c)PW001628 Pw001628Pw001628 greyscalePw001628 simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/17:0cycw7c/19:0cycv8c)PW001631 Pw001631Pw001631 greyscalePw001631 simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/18:1(9Z)/18:1(9Z))PW001636 Pw001636Pw001636 greyscalePw001636 simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/18:1(9Z)/19:0cycv8c)PW001637 Pw001637Pw001637 greyscalePw001637 simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/19:0cycv8c/14:0)PW001639 Pw001639Pw001639 greyscalePw001639 simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/19:0cycv8c/16:1(9Z))PW001641 Pw001641Pw001641 greyscalePw001641 simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/19:0cycv8c/17:0cycw7c)PW001642 Pw001642Pw001642 greyscalePw001642 simple
phospholipid biosynthesis CL(16:1(9Z)/19:0cycv8c/19:0cycv8c/18:1(9Z))PW001643 Pw001643Pw001643 greyscalePw001643 simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/14:0/14:0)PW001650 Pw001650Pw001650 greyscalePw001650 simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/14:0/17:0cycw7c)PW001651 Pw001651Pw001651 greyscalePw001651 simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/16:0/17:0cycw7c)PW001652 Pw001652Pw001652 greyscalePw001652 simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/16:1(9Z)/17:0cycw7c)PW001653 Pw001653Pw001653 greyscalePw001653 simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/17:0cycw7c/14:0)PW001654 Pw001654Pw001654 greyscalePw001654 simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/17:0cycw7c/15:0cyclo)PW001655 Pw001655Pw001655 greyscalePw001655 simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/17:0cycw7c/16:0)PW001656 Pw001656Pw001656 greyscalePw001656 simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/17:0cycw7c/16:1(9Z))PW001657 Pw001657Pw001657 greyscalePw001657 simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/17:0cycw7c/17:0cycw7c)PW001658 Pw001658Pw001658 greyscalePw001658 simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/17:0cycw7c/18:1(9Z))PW001659 Pw001659Pw001659 greyscalePw001659 simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/17:0cycw7c/19:0cycv8c)PW001660 Pw001660Pw001660 greyscalePw001660 simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/18:1(9Z)/17:0cycw7c)PW001661 Pw001661Pw001661 greyscalePw001661 simple
phospholipid biosynthesis CL(17:0cycw7c/15:0cyclo/19:0cycv8c/17:0cycw7c)PW001662 Pw001662Pw001662 greyscalePw001662 simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/14:0/16:0)PW001663 Pw001663Pw001663 greyscalePw001663 simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/14:0/17:0cycw7c)PW001674 Pw001674Pw001674 greyscalePw001674 simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/16:0/14:0)PW001675 Pw001675Pw001675 greyscalePw001675 simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/16:0/17:0cycw7c)PW001676 Pw001676Pw001676 greyscalePw001676 simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/16:1(9Z)/17:0cycw7c)PW001677 Pw001677Pw001677 greyscalePw001677 simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/17:0cycw7c/14:0)PW001678 Pw001678Pw001678 greyscalePw001678 simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/17:0cycw7c/16:0)PW001681 Pw001681Pw001681 greyscalePw001681 simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/17:0cycw7c/16:1(9Z))PW001682 Pw001682Pw001682 greyscalePw001682 simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/17:0cycw7c/17:0cycw7c)PW001683 Pw001683Pw001683 greyscalePw001683 simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/17:0cycw7c/18:1(9Z))PW001684 Pw001684Pw001684 greyscalePw001684 simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/17:0cycw7c/19:0cycv8c)PW001689 Pw001689Pw001689 greyscalePw001689 simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/18:1(9Z)/17:0cycw7c)PW001690 Pw001690Pw001690 greyscalePw001690 simple
phospholipid biosynthesis CL(17:0cycw7c/16:0/19:0cycv8c/17:0cycw7c)PW001691 Pw001691Pw001691 greyscalePw001691 simple
phospholipid biosynthesis CL(17:0cycw7c/16:1(9Z)/14:0/16:1(9Z))PW001693 Pw001693Pw001693 greyscalePw001693 simple
phospholipid biosynthesis I (18:0, 18:0)PW001001 Pw001001Pw001001 greyscalePw001001 simple
phospholipid biosynthesis I (CL(18:2(9Z,12Z)/18:2(9Z,12Z)/18:2(9Z,12Z)/18:2(9Z,12Z)) )PW001025 Pw001025Pw001025 greyscalePw001025 simple
phospholipid biosynthesisCL(16:0/16:1(9Z)/16:1(9Z)/19:0cycv8c)PW001314 Pw001314Pw001314 greyscalePw001314 simple
phospholipid biosynthesisCL(16:1(9Z)/15:0cyclo/16:1(9Z)/17:0cycw7c)PW001454 Pw001454Pw001454 greyscalePw001454 simple
purine nucleotides de novo biosynthesisPW000910 Pw000910Pw000910 greyscalePw000910 simple
purine nucleotides de novo biosynthesis 1435709748PW000960 Pw000960Pw000960 greyscalePw000960 simple
purine ribonucleosides degradationPW002076 Pw002076Pw002076 greyscalePw002076 simple
sulfur metabolism (butanesulfonate)PW000923 Pw000923Pw000923 greyscalePw000923 simple
sulfur metabolism (ethanesulfonate)PW000925 Pw000925Pw000925 greyscalePw000925 simple
sulfur metabolism (isethionate)PW000926 Pw000926Pw000926 greyscalePw000926 simple
sulfur metabolism (methanesulfonate)PW000927 Pw000927Pw000927 greyscalePw000927 simple
sulfur metabolism (propanesulfonate)PW000924 Pw000924Pw000924 greyscalePw000924 simple
tRNA Charging 2PW000803 Pw000803Pw000803 greyscalePw000803 simple
tRNA chargingPW000799 Pw000799Pw000799 greyscalePw000799 simple
tryptophan metabolism IIPW001916 Pw001916Pw001916 greyscalePw001916 simple
KEGG Pathways:
EcoCyc Pathways:
Concentrations
ConcentrationStrainMediaGrowth StatusGrowth SystemTemperatureDetails
500± 0 uMK12MOPS-buffered minimal mediaMid-Log PhaseShake flask37 oCPMID: 6291941
Find out more about how we convert literature concentrations.
Spectra
Spectra:
Spectrum TypeDescriptionSplash Key
GC-MSGC-MS Spectrum - GC-MS (4 TMS)splash10-0udi-0320900000-0abbcb28a43d7e24fe81View in MoNA
GC-MSGC-MS Spectrum - GC-MSsplash10-0udi-0320900000-0abbcb28a43d7e24fe81View in MoNA
LC-MS/MSLC-MS/MS Spectrum - Quattro_QQQ 10V, Positive (Annotated)splash10-004j-5900000000-6633d5123eb37c266247View in MoNA
LC-MS/MSLC-MS/MS Spectrum - Quattro_QQQ 25V, Positive (Annotated)splash10-0002-9000000000-1274b83242b279e9dac7View in MoNA
LC-MS/MSLC-MS/MS Spectrum - Quattro_QQQ 40V, Positive (Annotated)splash10-001i-9000000000-69bc4c795fec87fef4b8View in MoNA
References
References:
  • Kanehisa, M., Goto, S., Sato, Y., Furumichi, M., Tanabe, M. (2012). "KEGG for integration and interpretation of large-scale molecular data sets." Nucleic Acids Res 40:D109-D114. Pubmed: 22080510
  • Keseler, I. M., Collado-Vides, J., Santos-Zavaleta, A., Peralta-Gil, M., Gama-Castro, S., Muniz-Rascado, L., Bonavides-Martinez, C., Paley, S., Krummenacker, M., Altman, T., Kaipa, P., Spaulding, A., Pacheco, J., Latendresse, M., Fulcher, C., Sarker, M., Shearer, A. G., Mackie, A., Paulsen, I., Gunsalus, R. P., Karp, P. D. (2011). "EcoCyc: a comprehensive database of Escherichia coli biology." Nucleic Acids Res 39:D583-D590. Pubmed: 21097882
  • Kukko, E., Heinonen, J. (1982). "The intracellular concentration of pyrophosphate in the batch culture of Escherichia coli." Eur J Biochem 127:347-349. Pubmed: 6291941
  • van der Werf, M. J., Overkamp, K. M., Muilwijk, B., Coulier, L., Hankemeier, T. (2007). "Microbial metabolomics: toward a platform with full metabolome coverage." Anal Biochem 370:17-25. Pubmed: 17765195
  • Winder, C. L., Dunn, W. B., Schuler, S., Broadhurst, D., Jarvis, R., Stephens, G. M., Goodacre, R. (2008). "Global metabolic profiling of Escherichia coli cultures: an evaluation of methods for quenching and extraction of intracellular metabolites." Anal Chem 80:2939-2948. Pubmed: 18331064
Synthesis Reference:Dittmer, Donald C.; Silverstein, V. Opshelor. Production of pyrophosphate from S-n-butyl phosphorothioate. Journal of Organic Chemistry (1961), 26 4706-7.
Material Safety Data Sheet (MSDS)Download (PDF)
External Links:
ResourceLink
CHEBI ID29888
HMDB IDHMDB00250
Pubchem Compound ID1023
Kegg IDC00013
ChemSpider ID559142
WikipediaPyrophosphate
BioCyc IDPPI
EcoCyc IDPPI
Ligand ExpoPPV

Enzymes

General function:
Involved in nucleic acid binding
Specific function:
In addition to polymerase activity, this DNA polymerase exhibits 3' to 5' and 5' to 3' exonuclease activity. It is able to utilize nicked circular duplex DNA as a template and can unwind the parental DNA strand from its template
Gene Name:
polA
Uniprot ID:
P00582
Molecular weight:
103117
Reactions
Deoxynucleoside triphosphate + DNA(n) = diphosphate + DNA(n+1).
General function:
Involved in anthranilate phosphoribosyltransferase activity
Specific function:
Chorismate + L-glutamine = anthranilate + pyruvate + L-glutamate
Gene Name:
trpD
Uniprot ID:
P00904
Molecular weight:
56869
Reactions
Chorismate + L-glutamine = anthranilate + pyruvate + L-glutamate.
N-(5-phospho-D-ribosyl)-anthranilate + diphosphate = anthranilate + 5-phospho-alpha-D-ribose 1-diphosphate.
General function:
Involved in adenylate cyclase activity
Specific function:
ATP = 3',5'-cyclic AMP + diphosphate
Gene Name:
cyaA
Uniprot ID:
P00936
Molecular weight:
97585
Reactions
ATP = 3',5'-cyclic AMP + diphosphate.
General function:
Involved in nucleotide binding
Specific function:
ATP + L-tryptophan + tRNA(Trp) = AMP + diphosphate + L-tryptophyl-tRNA(Trp)
Gene Name:
trpS
Uniprot ID:
P00954
Molecular weight:
37438
Reactions
ATP + L-tryptophan + tRNA(Trp) = AMP + diphosphate + L-tryptophyl-tRNA(Trp).
General function:
Involved in nucleotide binding
Specific function:
Catalyzes the attachment of isoleucine to tRNA(Ile). As IleRS can inadvertently accommodate and process structurally similar amino acids such as valine, to avoid such errors it has two additional distinct tRNA(Ile)-dependent editing activities. One activity is designated as 'pretransfer' editing and involves the hydrolysis of activated Val-AMP. The other activity is designated 'posttransfer' editing and involves deacylation of mischarged Val-tRNA(Ile)
Gene Name:
ileS
Uniprot ID:
P00956
Molecular weight:
104296
Reactions
ATP + L-isoleucine + tRNA(Ile) = AMP + diphosphate + L-isoleucyl-tRNA(Ile).
General function:
Involved in nucleotide binding
Specific function:
Edits incorrectly charged Ser-tRNA(Ala) and Gly- tRNA(Ala) but not incorrectly charged Ser-tRNA(Thr)
Gene Name:
alaS
Uniprot ID:
P00957
Molecular weight:
96032
Reactions
ATP + L-alanine + tRNA(Ala) = AMP + diphosphate + L-alanyl-tRNA(Ala).
General function:
Involved in nucleotide binding
Specific function:
Is required not only for elongation of protein synthesis but also for the initiation of all mRNA translation through initiator tRNA(fMet) aminoacylation
Gene Name:
metG
Uniprot ID:
P00959
Molecular weight:
76254
Reactions
ATP + L-methionine + tRNA(Met) = AMP + diphosphate + L-methionyl-tRNA(Met).
General function:
Involved in nucleotide binding
Specific function:
ATP + glycine + tRNA(Gly) = AMP + diphosphate + glycyl-tRNA(Gly)
Gene Name:
glyQ
Uniprot ID:
P00960
Molecular weight:
34774
Reactions
ATP + glycine + tRNA(Gly) = AMP + diphosphate + glycyl-tRNA(Gly).
General function:
Involved in arginine-tRNA ligase activity
Specific function:
ATP + glycine + tRNA(Gly) = AMP + diphosphate + glycyl-tRNA(Gly)
Gene Name:
glyS
Uniprot ID:
P00961
Molecular weight:
76812
Reactions
ATP + glycine + tRNA(Gly) = AMP + diphosphate + glycyl-tRNA(Gly).
General function:
Involved in nucleotide binding
Specific function:
ATP + L-glutamine + tRNA(Gln) = AMP + diphosphate + L-glutaminyl-tRNA(Gln)
Gene Name:
glnS
Uniprot ID:
P00962
Molecular weight:
63477
Reactions
ATP + L-glutamine + tRNA(Gln) = AMP + diphosphate + L-glutaminyl-tRNA(Gln).
General function:
Involved in nucleotide binding
Specific function:
ATP + L-aspartate + NH(3) = AMP + diphosphate + L-asparagine
Gene Name:
asnA
Uniprot ID:
P00963
Molecular weight:
36650
Reactions
ATP + L-aspartate + NH(3) = AMP + diphosphate + L-asparagine.
General function:
Involved in DNA binding
Specific function:
DNA polymerase III is a complex, multichain enzyme responsible for most of the replicative synthesis in bacteria. The epsilon subunit contain the editing function and is a proofreading 3'-5' exonuclease
Gene Name:
dnaQ
Uniprot ID:
P03007
Molecular weight:
27099
Reactions
Deoxynucleoside triphosphate + DNA(n) = diphosphate + DNA(n+1).
General function:
Involved in GMP synthase (glutamine-hydrolyzing) activity
Specific function:
Catalyzes the synthesis of GMP from XMP
Gene Name:
guaA
Uniprot ID:
P04079
Molecular weight:
58679
Reactions
ATP + xanthosine 5'-phosphate + L-glutamine + H(2)O = AMP + diphosphate + GMP + L-glutamate.
General function:
Involved in nucleotide binding
Specific function:
Catalyzes the attachment of glutamate to tRNA(Glu) in a two-step reaction:glutamate is first activated by ATP to form Glu-AMP and then transferred to the acceptor end of tRNA(Glu)
Gene Name:
gltX
Uniprot ID:
P04805
Molecular weight:
53815
Reactions
ATP + L-glutamate + tRNA(Glu) = AMP + diphosphate + L-glutamyl-tRNA(Glu).
General function:
Involved in lipopolysaccharide biosynthetic process
Specific function:
Activates KDO (a required 8-carbon sugar) for incorporation into bacterial lipopolysaccharide in Gram-negative bacteria
Gene Name:
kdsB
Uniprot ID:
P04951
Molecular weight:
27614
Reactions
CTP + 3-deoxy-D-manno-octulosonate = diphosphate + CMP-3-deoxy-D-manno-octulosonate.
General function:
Involved in biotin-[acetyl-CoA-carboxylase] ligase activity
Specific function:
BirA acts both as a biotin-operon repressor and as the enzyme that synthesizes the corepressor, acetyl-CoA:carbon-dioxide ligase. This protein also activates biotin to form biotinyl-5'- adenylate and transfers the biotin moiety to biotin-accepting proteins
Gene Name:
birA
Uniprot ID:
P06709
Molecular weight:
35312
Reactions
ATP + biotin + apo-[acetyl-CoA:carbon-dioxide ligase (ADP-forming)] = AMP + diphosphate + [acetyl-CoA:carbon-dioxide ligase (ADP-forming)].
General function:
Involved in nucleotide binding
Specific function:
The gamma chain seems to interact with the delta subunit to transfer the beta subunit on the DNA
Gene Name:
dnaX
Uniprot ID:
P06710
Molecular weight:
71137
Reactions
Deoxynucleoside triphosphate + DNA(n) = diphosphate + DNA(n+1).
General function:
Involved in RNA binding
Specific function:
Catalyzes the addition and repair of the essential 3'- terminal CCA sequence in tRNAs without using a nucleic acid template. Adds these three nucleotides in the order of C, C, and A to the tRNA nucleotide-73, using CTP and ATP as substrates and producing inorganic pyrophosphate. Also shows highest phosphatase activity in the presence of Ni(2+) and hydrolyzes pyrophosphate, canonical 5'-nucleoside tri- and diphosphates, NADP, and 2'-AMP with the production of Pi. Displays a metal-independent phosphodiesterase activity toward 2',3'-cAMP, 2',3'-cGMP, and 2',3'-cCMP. Without metal or in the presence of Mg(2+), this protein hydrolyzes 2',3'-cyclic substrates with the formation of 2'-nucleotides, whereas in the presence of Ni(2+), it also produces some 3'-nucleotides. These phosphohydrolase activities are probably involved in the repair of the tRNA 3'-CCA terminus degraded by intracellular RNases
Gene Name:
cca
Uniprot ID:
P06961
Molecular weight:
46467
Reactions
A tRNA precursor + 2 CTP + ATP = a tRNA with a 3' CCA end + 3 diphosphate.
General function:
Involved in hydrolase activity
Specific function:
This enzyme is involved in nucleotide metabolism:it produces dUMP, the immediate precursor of thymidine nucleotides and it decreases the intracellular concentration of dUTP so that uracil cannot be incorporated into DNA
Gene Name:
dut
Uniprot ID:
P06968
Molecular weight:
16155
Reactions
dUTP + H(2)O = dUMP + diphosphate.
General function:
Involved in phosphoribosyl-AMP cyclohydrolase activity
Specific function:
1-(5-phosphoribosyl)-ATP + H(2)O = 1-(5- phosphoribosyl)-AMP + diphosphate
Gene Name:
hisI
Uniprot ID:
P06989
Molecular weight:
22756
Reactions
1-(5-phosphoribosyl)-ATP + H(2)O = 1-(5-phosphoribosyl)-AMP + diphosphate.
1-(5-phosphoribosyl)-AMP + H(2)O = 1-(5-phosphoribosyl)-5-((5-phosphoribosylamino)methylideneamino)imidazole-4-carboxamide.
General function:
Involved in nucleotide binding
Specific function:
Catalyzes the attachment of valine to tRNA(Val). As ValRS can inadvertently accommodate and process structurally similar amino acids such as threonine, to avoid such errors, it has a "posttransfer" editing activity that hydrolyzes mischarged Thr-tRNA(Val) in a tRNA-dependent manner
Gene Name:
valS
Uniprot ID:
P07118
Molecular weight:
108192
Reactions
ATP + L-valine + tRNA(Val) = AMP + diphosphate + L-valyl-tRNA(Val).
General function:
Involved in RNA binding
Specific function:
ATP + L-phenylalanine + tRNA(Phe) = AMP + diphosphate + L-phenylalanyl-tRNA(Phe)
Gene Name:
pheT
Uniprot ID:
P07395
Molecular weight:
87377
Reactions
ATP + L-phenylalanine + tRNA(Phe) = AMP + diphosphate + L-phenylalanyl-tRNA(Phe).
General function:
Involved in nucleotide binding
Specific function:
ATP + L-leucine + tRNA(Leu) = AMP + diphosphate + L-leucyl-tRNA(Leu)
Gene Name:
leuS
Uniprot ID:
P07813
Molecular weight:
97233
Reactions
ATP + L-leucine + tRNA(Leu) = AMP + diphosphate + L-leucyl-tRNA(Leu).
General function:
Involved in nucleotide binding
Specific function:
ATP + L-phenylalanine + tRNA(Phe) = AMP + diphosphate + L-phenylalanyl-tRNA(Phe)
Gene Name:
pheS
Uniprot ID:
P08312
Molecular weight:
36832
Reactions
ATP + L-phenylalanine + tRNA(Phe) = AMP + diphosphate + L-phenylalanyl-tRNA(Phe).
General function:
Involved in metabolic process
Specific function:
Catalyzes the removal of elemental sulfur and selenium atoms from cysteine and selenocysteine to produce alanine. Functions as a sulfur delivery protein for NAD, biotin and Fe-S cluster synthesis. Transfers sulfur on 'Cys-456' of thiI in a transpersulfidation reaction. Transfers sulfur on 'Cys-19' of tusA in a transpersulfidation reaction. Functions also as a selenium delivery protein in the pathway for the biosynthesis of selenophosphate
Gene Name:
iscS
Uniprot ID:
P0A6B7
Molecular weight:
45089
Reactions
L-cysteine + acceptor = L-alanine + S-sulfanyl-acceptor.
General function:
Involved in argininosuccinate synthase activity
Specific function:
ATP + L-citrulline + L-aspartate = AMP + diphosphate + N(omega)-(L-arginino)succinate
Gene Name:
argG
Uniprot ID:
P0A6E4
Molecular weight:
49898
Reactions
ATP + L-citrulline + L-aspartate = AMP + diphosphate + N(omega)-(L-arginino)succinate.
General function:
Involved in catalytic activity
Specific function:
Reversibly transfers an adenylyl group from ATP to 4'- phosphopantetheine, yielding dephospho-CoA (dPCoA) and pyrophosphate
Gene Name:
coaD
Uniprot ID:
P0A6I6
Molecular weight:
17837
Reactions
ATP + pantetheine 4'-phosphate = diphosphate + 3'-dephospho-CoA.
General function:
Involved in glycogen biosynthetic process
Specific function:
ATP + alpha-D-glucose 1-phosphate = diphosphate + ADP-glucose
Gene Name:
glgC
Uniprot ID:
P0A6V1
Molecular weight:
48697
Reactions
ATP + alpha-D-glucose 1-phosphate = diphosphate + ADP-glucose.
General function:
Involved in catalytic activity
Specific function:
Catalyzes the reversible adenylation of nicotinate mononucleotide (NaMN) to nicotinic acid adenine dinucleotide (NaAD)
Gene Name:
nadD
Uniprot ID:
P0A752
Molecular weight:
24528
Reactions
ATP + beta-nicotinate-D-ribonucleotide = diphosphate + deamido-NAD(+).
General function:
Involved in hydrolase activity
Specific function:
Master regulator of 5'-dependent mRNA decay. Accelerates the degradation of transcripts by removing pyrophosphate from the 5'-end of triphosphorylated RNA, leading to a more labile monophosphorylated state that can stimulate subsequent ribonuclease cleavage. Preferentially hydrolyzes diadenosine penta-phosphate with ATP as one of the reaction products. Also able to hydrolyze diadenosine hexa- and tetra-phosphate. Has no activity on diadenosine tri-phosphate, ADP-ribose, NADH and UDP- glucose. In the meningitis causing strain E.coli K1, has been shown to play a role in HBMEC (human brain microvascular endothelial cells) invasion in vitro
Gene Name:
rppH
Uniprot ID:
P0A776
Molecular weight:
20795
General function:
Involved in magnesium ion binding
Specific function:
Diphosphate + H(2)O = 2 phosphate
Gene Name:
ppa
Uniprot ID:
P0A7A9
Molecular weight:
19703
Reactions
Diphosphate + H(2)O = 2 phosphate.
General function:
Involved in catalytic activity
Specific function:
Catalyzes the reversible transfer of the terminal phosphate of ATP to form a long-chain polyphosphate (polyP). Can form linear polymers of orthophosphate with chain lengths up to 1000 or more. Can also act in the reverse direction to form ATP in the presence of excess ADP. Can also use GTP instead of ATP; but the efficiency of GTP is 5% that of ATP
Gene Name:
ppk
Uniprot ID:
P0A7B1
Molecular weight:
80431
Reactions
ATP + (phosphate)(n) = ADP + (phosphate)(n+1).
General function:
Involved in orotate phosphoribosyltransferase activity
Specific function:
Catalyzes the transfer of a ribosyl phosphate group from 5-phosphoribose 1-diphosphate to orotate, leading to the formation of orotidine monophosphate (OMP)
Gene Name:
pyrE
Uniprot ID:
P0A7E3
Molecular weight:
23567
Reactions
Orotidine 5'-phosphate + diphosphate = orotate + 5-phospho-alpha-D-ribose 1-diphosphate.
General function:
Involved in GTP cyclohydrolase II activity
Specific function:
Catalyzes the conversion of GTP to 2,5-diamino-6- ribosylamino-4(3H)-pyrimidinone 5'-phosphate (DARP), formate and pyrophosphate
Gene Name:
ribA
Uniprot ID:
P0A7I7
Molecular weight:
21836
Reactions
GTP + 3 H(2)O = formate + 2,5-diamino-6-hydroxy-4-(5-phospho-D-ribosylamino)pyrimidine + diphosphate.
General function:
Involved in DNA-directed RNA polymerase activity
Specific function:
DNA-dependent RNA polymerase catalyzes the transcription of DNA into RNA using the four ribonucleoside triphosphates as substrates. This subunit plays an important role in subunit assembly since its dimerization is the first step in the sequential assembly of subunits to form the holoenzyme
Gene Name:
rpoA
Uniprot ID:
P0A7Z4
Molecular weight:
36511
Reactions
Nucleoside triphosphate + RNA(n) = diphosphate + RNA(n+1).
General function:
Involved in DNA-directed RNA polymerase activity
Specific function:
Promotes RNA polymerase assembly. Latches the N- and C- terminal regions of the beta' subunit thereby facilitating its interaction with the beta and alpha subunits
Gene Name:
rpoZ
Uniprot ID:
P0A800
Molecular weight:
10237
Reactions
Nucleoside triphosphate + RNA(n) = diphosphate + RNA(n+1).
General function:
Involved in methionine adenosyltransferase activity
Specific function:
Catalyzes the formation of S-adenosylmethionine from methionine and ATP. The overall synthetic reaction is composed of two sequential steps, AdoMet formation and the subsequent tripolyphosphate hydrolysis which occurs prior to release of AdoMet from the enzyme. Is essential for growth
Gene Name:
metK
Uniprot ID:
P0A817
Molecular weight:
41951
Reactions
ATP + L-methionine + H(2)O = phosphate + diphosphate + S-adenosyl-L-methionine.
General function:
Involved in hydrolase activity
Specific function:
Nucleotidase with a broad substrate specificity as it can dephosphorylate various ribo- and deoxyribonucleoside 5'- monophosphates and ribonucleoside 3'-monophosphates with highest affinity to 3'-AMP. Also hydrolyzes polyphosphate (exopolyphosphatase activity) with the preference for short-chain- length substrates (P20-25). Might be involved in the regulation of dNTP and NTP pools, and in the turnover of 3'-mononucleotides produced by numerous intracellular RNases (T1, T2, and F) during the degradation of various RNAs. Also plays a significant physiological role in stress-response and is required for the survival of E.coli in stationary growth phase
Gene Name:
surE
Uniprot ID:
P0A840
Molecular weight:
26900
Reactions
A 5'-ribonucleotide + H(2)O = a ribonucleoside + phosphate.
A 3'-ribonucleotide + H(2)O = a ribonucleoside + phosphate.
(Polyphosphate)(n) + H(2)O = (polyphosphate)(n-1) + phosphate.
General function:
Involved in nucleoside metabolic process
Specific function:
Catalyzes the conversion of uracil and 5-phospho-alpha- D-ribose 1-diphosphate (PRPP) to UMP and diphosphate
Gene Name:
upp
Uniprot ID:
P0A8F0
Molecular weight:
22533
Reactions
UMP + diphosphate = uracil + 5-phospho-alpha-D-ribose 1-diphosphate.
General function:
Involved in nucleotide binding
Specific function:
Catalyzes the attachment of serine to tRNA(Ser). Is also able to aminoacylate tRNA(Sec) with serine, to form the misacylated tRNA L-seryl-tRNA(Sec), which will be further converted into selenocysteinyl-tRNA(Sec)
Gene Name:
serS
Uniprot ID:
P0A8L1
Molecular weight:
48414
Reactions
ATP + L-serine + tRNA(Ser) = AMP + diphosphate + L-seryl-tRNA(Ser).
ATP + L-serine + tRNA(Sec) = AMP + diphosphate + L-seryl-tRNA(Sec).
General function:
Involved in nucleotide binding
Specific function:
ATP + L-asparagine + tRNA(Asn) = AMP + diphosphate + L-asparaginyl-tRNA(Asn)
Gene Name:
asnS
Uniprot ID:
P0A8M0
Molecular weight:
52570
Reactions
ATP + L-asparagine + tRNA(Asn) = AMP + diphosphate + L-asparaginyl-tRNA(Asn).
General function:
Involved in nucleotide binding
Specific function:
ThrS is also a translational repressor protein, it controls the translation of its own gene by binding to its mRNA
Gene Name:
thrS
Uniprot ID:
P0A8M3
Molecular weight:
74014
Reactions
ATP + L-threonine + tRNA(Thr) = AMP + diphosphate + L-threonyl-tRNA(Thr).
General function:
Involved in nucleotide binding
Specific function:
ATP + L-lysine + tRNA(Lys) = AMP + diphosphate + L-lysyl-tRNA(Lys)
Gene Name:
lysS
Uniprot ID:
P0A8N3
Molecular weight:
57603
Reactions
ATP + L-lysine + tRNA(Lys) = AMP + diphosphate + L-lysyl-tRNA(Lys).
General function:
Involved in nucleotide binding
Specific function:
Also can synthesize a number of adenyl dinucleotides (in particular AppppA). These dinucleotides have been proposed to act as modulators of the heat-shock response and stress response
Gene Name:
lysU
Uniprot ID:
P0A8N5
Molecular weight:
57826
Reactions
ATP + L-lysine + tRNA(Lys) = AMP + diphosphate + L-lysyl-tRNA(Lys).
General function:
Involved in nucleotide binding
Specific function:
With YjeK might be involved in the post-translational modification of elongation factor P (EF-P)
Gene Name:
poxA
Uniprot ID:
P0A8N7
Molecular weight:
36976
General function:
Involved in DNA binding
Specific function:
DNA-dependent RNA polymerase catalyzes the transcription of DNA into RNA using the four ribonucleoside triphosphates as substrates
Gene Name:
rpoC
Uniprot ID:
P0A8T7
Molecular weight:
155159
Reactions
Nucleoside triphosphate + RNA(n) = diphosphate + RNA(n+1).
General function:
Involved in DNA binding
Specific function:
DNA-dependent RNA polymerase catalyzes the transcription of DNA into RNA using the four ribonucleoside triphosphates as substrates
Gene Name:
rpoB
Uniprot ID:
P0A8V2
Molecular weight:
150631
Reactions
Nucleoside triphosphate + RNA(n) = diphosphate + RNA(n+1).
General function:
Involved in DNA binding
Specific function:
DNA polymerase III is a complex, multichain enzyme responsible for most of the replicative synthesis in bacteria. This DNA polymerase also exhibits 3' to 5' exonuclease activity. The beta chain is required for initiation of replication once it is clamped onto DNA, it slides freely (bidirectional and ATP- independent) along duplex DNA
Gene Name:
dnaN
Uniprot ID:
P0A988
Molecular weight:
40586
Reactions
Deoxynucleoside triphosphate + DNA(n) = diphosphate + DNA(n+1).
General function:
Involved in hypoxanthine phosphoribosyltransferase activity
Specific function:
This enzyme acts exclusively on hypoxanthine; it does not act on guanine
Gene Name:
hpt
Uniprot ID:
P0A9M2
Molecular weight:
20115
Reactions
IMP + diphosphate = hypoxanthine + 5-phospho-alpha-D-ribose 1-diphosphate.
General function:
Involved in nucleoside metabolic process
Specific function:
Acts on guanine, xanthine and to a lesser extent hypoxanthine
Gene Name:
gpt
Uniprot ID:
P0A9M5
Molecular weight:
16971
Reactions
XMP + diphosphate = 5-phospho-alpha-D-ribose 1-diphosphate + xanthine.
General function:
Involved in enzyme regulator activity
Specific function:
UTP + alpha-D-glucose 1-phosphate = diphosphate + UDP-glucose
Gene Name:
galF
Uniprot ID:
P0AAB6
Molecular weight:
32829
Reactions
UTP + alpha-D-glucose 1-phosphate = diphosphate + UDP-glucose.
General function:
Involved in RNA binding
Specific function:
Polymerase that creates the 3' poly(A) tail found in some mRNA's. Seems to be involved in plasmid copy number control
Gene Name:
pcnB
Uniprot ID:
P0ABF1
Molecular weight:
53870
Reactions
ATP + RNA(n) = diphosphate + RNA(n+1).
General function:
Involved in transferase activity, transferring phosphorus-containing groups
Specific function:
CTP + phosphatidate = diphosphate + CDP- diacylglycerol
Gene Name:
cdsA
Uniprot ID:
P0ABG1
Molecular weight:
31453
Reactions
CTP + phosphatidate = diphosphate + CDP-diacylglycerol.
General function:
Involved in phosphopantothenate--cysteine ligase activity
Specific function:
Catalyzes two steps in the biosynthesis of coenzyme A. In the first step cysteine is conjugated to 4'-phosphopantothenate to form 4-phosphopantothenoylcysteine, in the latter compound is decarboxylated to form 4'-phosphopantotheine
Gene Name:
coaBC
Uniprot ID:
P0ABQ0
Molecular weight:
43438
Reactions
N-((R)-4'-phosphopantothenoyl)-L-cysteine = pantotheine 4'-phosphate + CO(2).
CTP + (R)-4'-phosphopantothenate + L-cysteine = CMP + diphosphate + N-((R)-4'-phosphopantothenoyl)-L-cysteine.
General function:
Involved in DNA binding
Specific function:
The exact function of the theta subunit is unknown
Gene Name:
holE
Uniprot ID:
P0ABS8
Molecular weight:
8846
Reactions
Deoxynucleoside triphosphate + DNA(n) = diphosphate + DNA(n+1).
General function:
Involved in dihydropteroate synthase activity
Specific function:
DHPS catalyzes the formation of the immediate precursor of folic acid. It is implicated in resistance to sulfonamide
Gene Name:
folP
Uniprot ID:
P0AC13
Molecular weight:
30615
Reactions
(2-amino-4-hydroxy-7,8-dihydropteridin-6-yl)methyl diphosphate + 4-aminobenzoate = diphosphate + dihydropteroate.
General function:
Involved in magnesium ion binding
Specific function:
Catalyzes the last two sequential reactions in the de novo biosynthetic pathway for UDP-GlcNAc. Responsible for the acetylation of Glc-N-1-P to give GlcNAc-1-P and for the uridyl transfer from UTP to GlcNAc-1-P which produces UDP-GlcNAc
Gene Name:
glmU
Uniprot ID:
P0ACC7
Molecular weight:
49190
Reactions
Acetyl-CoA + alpha-D-glucosamine 1-phosphate = CoA + N-acetyl-alpha-D-glucosamine 1-phosphate.
UTP + N-acetyl-alpha-D-glucosamine 1-phosphate = diphosphate + UDP-N-acetyl-D-glucosamine.
General function:
Involved in nucleotide binding
Specific function:
ATP-dependent phosphorylation of adenosylcobinamide and adds GMP to adenosylcobinamide phosphate
Gene Name:
cobU
Uniprot ID:
P0AE76
Molecular weight:
20164
Reactions
ATP or GTP + adenosylcobinamide = adenosylcobinamide phosphate + ADP or GDP.
GTP + adenosylcobinamide phosphate = diphosphate + adenosylcobinamide-GDP.
General function:
Involved in UTP:glucose-1-phosphate uridylyltransferase activity
Specific function:
May play a role in stationary phase survival
Gene Name:
galU
Uniprot ID:
P0AEP3
Molecular weight:
32942
Reactions
UTP + alpha-D-glucose 1-phosphate = diphosphate + UDP-glucose.
General function:
Involved in nucleoside-triphosphate diphosphatase activity
Specific function:
Specific function unknown
Gene Name:
mazG
Uniprot ID:
P0AEY3
Molecular weight:
30412
Reactions
ATP + H(2)O = AMP + diphosphate.
General function:
Involved in dATP pyrophosphohydrolase activity
Specific function:
Catalyzes the hydrolysis of dihydroneopterin triphosphate to dihydroneopterin monophosphate and pyrophosphate. Required for efficient folate biosynthesis. Can also hydrolyze nucleoside triphosphates with a preference for dATP
Gene Name:
nudB
Uniprot ID:
P0AFC0
Molecular weight:
17306
General function:
Involved in magnesium ion binding
Specific function:
Degradation of inorganic polyphosphates. Orthophosphate is released progressively from the ends of polyphosphate of circa 500 residues long, while chains of circa 15 residues compete poorly with polyphosphate as substrate
Gene Name:
ppx
Uniprot ID:
P0AFL6
Molecular weight:
58136
Reactions
(Polyphosphate)(n) + H(2)O = (polyphosphate)(n-1) + phosphate.
General function:
Involved in amidophosphoribosyltransferase activity
Specific function:
5-phospho-beta-D-ribosylamine + diphosphate + L-glutamate = L-glutamine + 5-phospho-alpha-D-ribose 1-diphosphate + H(2)O
Gene Name:
purF
Uniprot ID:
P0AG16
Molecular weight:
56488
Reactions
5-phospho-beta-D-ribosylamine + diphosphate + L-glutamate = L-glutamine + 5-phospho-alpha-D-ribose 1-diphosphate + H(2)O.
General function:
Involved in catalytic activity
Specific function:
In eubacteria ppGpp (guanosine 3'-diphosphate 5-' diphosphate) is a mediator of the stringent response that coordinates a variety of cellular activities in response to changes in nutritional abundance. This enzyme catalyzes both the synthesis and degradation of ppGpp. The second messengers ppGpp and c-di-GMP together control biofilm formation in response to translational stress; ppGpp represses biofilm formation while c- di-GMP induces it
Gene Name:
spoT
Uniprot ID:
P0AG24
Molecular weight:
79342
Reactions
ATP + GTP = AMP + guanosine 3'-diphosphate 5'-triphosphate.
Guanosine 3',5'-bis(diphosphate) + H(2)O = guanosine 5'-diphosphate + diphosphate.
General function:
Involved in FMN adenylyltransferase activity
Specific function:
ATP + riboflavin = ADP + FMN
Gene Name:
ribF
Uniprot ID:
P0AG40
Molecular weight:
34734
Reactions
ATP + riboflavin = ADP + FMN.
ATP + FMN = diphosphate + FAD.
General function:
Involved in nucleotide binding
Specific function:
Catalyzes the attachment of tyrosine to tRNA(Tyr) in a two-step reaction:tyrosine is first activated by ATP to form Tyr- AMP and then transferred to the acceptor end of tRNA(Tyr)
Gene Name:
tyrS
Uniprot ID:
P0AGJ9
Molecular weight:
47527
Reactions
ATP + L-tyrosine + tRNA(Tyr) = AMP + diphosphate + L-tyrosyl-tRNA(Tyr).
General function:
Involved in catalytic activity
Specific function:
Activates the carboxylate group of 2,3-dihydroxy- benzoate (2,3-DHB), via ATP-dependent PPi exchange reactions, to the acyladenylate. Then, catalyzes the acylation of holo-entB with 2,3-DHB adenylate, preparing that molecule for amide bond formation with L-serine
Gene Name:
entE
Uniprot ID:
P10378
Molecular weight:
59112
Reactions
ATP + 2,3-dihydroxybenzoate = diphosphate + (2,3-dihydroxybenzoyl)adenylate.
(2,3-dihydroxybenzoyl)adenylate + holo-entB = adenosine 5'-monophosphate + acyl-holo-entB.
General function:
Involved in 3'-5' exonuclease activity
Specific function:
DNA polymerase III is a complex, multichain enzyme responsible for most of the replicative synthesis in bacteria. This DNA polymerase also exhibits 3' to 5' exonuclease activity. The alpha chain is the DNA polymerase
Gene Name:
dnaE
Uniprot ID:
P10443
Molecular weight:
129903
Reactions
Deoxynucleoside triphosphate + DNA(n) = diphosphate + DNA(n+1).
General function:
Involved in ligase activity
Specific function:
Activates the carboxylate group of L-serine via ATP- dependent PPi exchange reactions to the aminoacyladenylate, preparing that molecule for the final stages of enterobactin synthesis. Holo-entF acts as the catalyst for the formation of the three amide and three ester bonds present in the cyclic (2,3- dihydroxybenzoyl)serine trimer enterobactin, using seryladenylate and acyl-holo-entB (acylated with 2,3-dihydroxybenzoate by entE)
Gene Name:
entF
Uniprot ID:
P11454
Molecular weight:
141990
Reactions
ATP + L-serine = diphosphate + L-serine-adenylate.
General function:
Involved in nucleotide binding
Specific function:
ATP + L-arginine + tRNA(Arg) = AMP + diphosphate + L-arginyl-tRNA(Arg)
Gene Name:
argS
Uniprot ID:
P11875
Molecular weight:
64682
Reactions
ATP + L-arginine + tRNA(Arg) = AMP + diphosphate + L-arginyl-tRNA(Arg).
General function:
Involved in ATP binding
Specific function:
Catalyzes the transfer of a dimethylallyl group onto the adenine at position 37 in tRNAs that read codons beginning with uridine, leading to the formation of N6-(dimethylallyl)adenosine (i(6)A)
Gene Name:
miaA
Uniprot ID:
P16384
Molecular weight:
35065
Reactions
Dimethylallyl diphosphate + tRNA = diphosphate + tRNA containing 6-dimethylallyladenosine.
General function:
Involved in nucleotide binding
Specific function:
Catalyzes the attachment of proline to tRNA(Pro) in a two-step reaction:proline is first activated by ATP to form Pro- AMP and then transferred to the acceptor end of tRNA(Pro). As ProRS can inadvertently accommodate and process non-cognate amino acids such as alanine and cysteine, to avoid such errors it has two additional distinct editing activities against alanine. One activity is designated as 'pretransfer' editing and involves the tRNA(Pro)-independent hydrolysis of activated Ala-AMP. The other activity is designated 'posttransfer' editing and involves deacylation of mischarged Ala-tRNA(Pro). Misacylated Cys-tRNA(Pro) is not edited by ProRS, but instead may be edited in trans by ybaK
Gene Name:
proS
Uniprot ID:
P16659
Molecular weight:
63692
Reactions
ATP + L-proline + tRNA(Pro) = AMP + diphosphate + L-prolyl-tRNA(Pro).
General function:
Involved in nicotinate phosphoribosyltransferase activity
Specific function:
Nicotinate D-ribonucleotide + diphosphate = nicotinate + 5-phospho-alpha-D-ribose 1-diphosphate
Gene Name:
pncB
Uniprot ID:
P18133
Molecular weight:
45897
Reactions
Beta-nicotinate D-ribonucleotide + diphosphate = nicotinate + 5-phospho-alpha-D-ribose 1-diphosphate.
General function:
Involved in NAD+ synthase (glutamine-hydrolyzing) activity
Specific function:
Catalyzes a key step in NAD biosynthesis, transforming deamido-NAD into NAD by a two-step reaction
Gene Name:
nadE
Uniprot ID:
P18843
Molecular weight:
30637
Reactions
ATP + deamido-NAD(+) + NH(3) = AMP + diphosphate + NAD(+).
General function:
Involved in catalytic activity
Specific function:
ATP + sulfate = diphosphate + adenylyl sulfate
Gene Name:
cysD
Uniprot ID:
P21156
Molecular weight:
35188
Reactions
ATP + sulfate = diphosphate + adenylyl sulfate.
General function:
Involved in nucleotide binding
Specific function:
Thought to be involved in DNA repair and/or mutagenesis
Gene Name:
polB
Uniprot ID:
P21189
Molecular weight:
90052
Reactions
Deoxynucleoside triphosphate + DNA(n) = diphosphate + DNA(n+1).
General function:
Involved in cysteine-tRNA ligase activity
Specific function:
ATP + L-cysteine + tRNA(Cys) = AMP + diphosphate + L-cysteinyl-tRNA(Cys)
Gene Name:
cysS
Uniprot ID:
P21888
Molecular weight:
52202
Reactions
ATP + L-cysteine + tRNA(Cys) = AMP + diphosphate + L-cysteinyl-tRNA(Cys).
General function:
Involved in nucleotide binding
Specific function:
ATP + L-aspartate + tRNA(Asp) = AMP + diphosphate + L-aspartyl-tRNA(Asp)
Gene Name:
aspS
Uniprot ID:
P21889
Molecular weight:
65913
Reactions
ATP + L-aspartate + tRNA(Asp) = AMP + diphosphate + L-aspartyl-tRNA(Asp).
General function:
Involved in asparagine synthase (glutamine-hydrolyzing) activity
Specific function:
ATP + L-aspartate + L-glutamine + H(2)O = AMP + diphosphate + L-asparagine + L-glutamate
Gene Name:
asnB
Uniprot ID:
P22106
Molecular weight:
62659
Reactions
ATP + L-aspartate + L-glutamine + H(2)O = AMP + diphosphate + L-asparagine + L-glutamate.
General function:
Involved in isoprenoid biosynthetic process
Specific function:
Geranyl diphosphate + isopentenyl diphosphate = diphosphate + trans,trans-farnesyl diphosphate
Gene Name:
ispA
Uniprot ID:
P22939
Molecular weight:
32159
Reactions
Geranyl diphosphate + isopentenyl diphosphate = diphosphate + (2E,6E)-farnesyl diphosphate.
General function:
Involved in GTPase activity
Specific function:
May be the GTPase, regulating ATP sulfurylase activity
Gene Name:
cysN
Uniprot ID:
P23845
Molecular weight:
52558
Reactions
ATP + sulfate = diphosphate + adenylyl sulfate.
General function:
Involved in nucleotidyltransferase activity
Specific function:
Involved in the biosynthesis of the capsular polysaccharide colanic acid
Gene Name:
manC
Uniprot ID:
P24174
Molecular weight:
53016
Reactions
GTP + alpha-D-mannose 1-phosphate = diphosphate + GDP-mannose.
General function:
Involved in sulfurtransferase activity
Specific function:
Catalyzes the 2-thiolation of uridine at the wobble position (U34) of tRNA(Lys), tRNA(Glu) and tRNA(Gln), leading to the formation of s(2)U34, the first step of tRNA-mnm(5)s(2)U34 synthesis. Sulfur is provided by iscS, via a sulfur-relay system. Binds ATP and its substrate tRNAs
Gene Name:
mnmA
Uniprot ID:
P25745
Molecular weight:
40959
General function:
Involved in amino acid binding
Specific function:
Modifies, by uridylylation or deuridylylation the PII (glnB) regulatory protein
Gene Name:
glnD
Uniprot ID:
P27249
Molecular weight:
102389
Reactions
UTP + [protein-PII] = diphosphate + uridylyl-[protein-PII].
General function:
Involved in negative regulation of transcription, DNA-dependent
Specific function:
NadR is bifunctional; it interacts with pnuC at low internal NAD levels, permitting transport of NMN intact into the cell. As NAD levels increase within the cell, the affinity of nadR for the operator regions of nadA, nadB, and pncB increases, repressing the transcription of these genes
Gene Name:
nadR
Uniprot ID:
P27278
Molecular weight:
47346
Reactions
ATP + nicotinamide ribonucleotide = diphosphate + NAD(+).
ATP + N-ribosylnicotinamide = ADP + nicotinamide ribonucleotide.
General function:
Involved in acetate-CoA ligase activity
Specific function:
Enables the cell to use acetate during aerobic growth to generate energy via the TCA cycle, and biosynthetic compounds via the glyoxylate shunt. Acetylates CheY, the response regulator involved in flagellar movement and chemotaxis
Gene Name:
acs
Uniprot ID:
P27550
Molecular weight:
72093
Reactions
ATP + acetate + CoA = AMP + diphosphate + acetyl-CoA.
General function:
Involved in DNA binding
Specific function:
DNA polymerase III is a complex, multichain enzyme responsible for most of the replicative synthesis in bacteria. This DNA polymerase also exhibits 3' to 5' exonuclease activity. The delta subunit seems to interact with the gamma subunit to transfer the beta subunit on the DNA
Gene Name:
holA
Uniprot ID:
P28630
Molecular weight:
38703
Reactions
Deoxynucleoside triphosphate + DNA(n) = diphosphate + DNA(n+1).
General function:
Involved in DNA binding
Specific function:
DNA polymerase III is a complex, multichain enzyme responsible for most of the replicative synthesis in bacteria. This DNA polymerase also exhibits 3' to 5' exonuclease activity
Gene Name:
holB
Uniprot ID:
P28631
Molecular weight:
36936
Reactions
Deoxynucleoside triphosphate + DNA(n) = diphosphate + DNA(n+1).
General function:
Involved in DNA-directed DNA polymerase activity
Specific function:
DNA polymerase III is a complex, multichain enzyme responsible for most of the replicative synthesis in bacteria. This DNA polymerase also exhibits 3' to 5' exonuclease activity. The exact function of the psi subunit is unknown
Gene Name:
holD
Uniprot ID:
P28632
Molecular weight:
15174
Reactions
Deoxynucleoside triphosphate + DNA(n) = diphosphate + DNA(n+1).
General function:
Involved in DNA binding
Specific function:
DNA polymerase III is a complex, multichain enzyme responsible for most of the replicative synthesis in bacteria. This DNA polymerase also exhibits 3' to 5' exonuclease activity
Gene Name:
holC
Uniprot ID:
P28905
Molecular weight:
16633
Reactions
Deoxynucleoside triphosphate + DNA(n) = diphosphate + DNA(n+1).
General function:
Involved in catalytic activity
Specific function:
Involved in the catabolism of quinolinic acid (QA)
Gene Name:
nadC
Uniprot ID:
P30011
Molecular weight:
32762
Reactions
Beta-nicotinate D-ribonucleotide + diphosphate + CO(2) = pyridine-2,3-dicarboxylate + 5-phospho-alpha-D-ribose 1-diphosphate.
General function:
Involved in catalytic activity
Specific function:
Condenses 4-methyl-5-(beta-hydroxyethyl)thiazole monophosphate (THZ-P) and 2-methyl-4-amino-5-hydroxymethyl pyrimidine pyrophosphate (HMP-PP) to form thiamine monophosphate (TMP)
Gene Name:
thiE
Uniprot ID:
P30137
Molecular weight:
23015
Reactions
2-methyl-4-amino-5-hydroxymethylpyrimidine diphosphate + 4-methyl-5-(2-phosphono-oxyethyl)thiazole = diphosphate + thiamine phosphate.
General function:
Involved in [glutamate-ammonia-ligase] adenylyltransferase activity
Specific function:
Adenylation and deadenylation of glutamate--ammonia ligase
Gene Name:
glnE
Uniprot ID:
P30870
Molecular weight:
108417
Reactions
ATP + [L-glutamate:ammonia ligase (ADP-forming)] = diphosphate + adenylyl-[L-glutamate:ammonia ligase (ADP-forming)].
General function:
Involved in transferase activity, transferring acyl groups
Specific funct